Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2023-52791 (GCVE-0-2023-52791)
Vulnerability from cvelistv5 – Published: 2024-05-21 15:31 – Updated: 2026-05-11 19:33| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
bae1d3a05a8b99bd748168bbf8155a1d047c562e , < 25eb381a736e7ae39a4245ef5c96484eb1073809
(git)
Affected: bae1d3a05a8b99bd748168bbf8155a1d047c562e , < 25284c46b657f48c0f3880a2e0706c70d81182c0 (git) Affected: bae1d3a05a8b99bd748168bbf8155a1d047c562e , < f6237afabc349c1c7909db00e15d2816519e0d2b (git) Affected: bae1d3a05a8b99bd748168bbf8155a1d047c562e , < 185f3617adc8fe45e40489b458f03911f0dec46c (git) Affected: bae1d3a05a8b99bd748168bbf8155a1d047c562e , < 8c3fa52a46ff4d208cefb1a462ec94e0043a91e1 (git) Affected: bae1d3a05a8b99bd748168bbf8155a1d047c562e , < 3473cf43b9068b9dfef2f545f833f33c6a544b91 (git) Affected: bae1d3a05a8b99bd748168bbf8155a1d047c562e , < aa49c90894d06e18a1ee7c095edbd2f37c232d02 (git) |
guessed | |
| Linux | Linux |
Affected:
5.2
Unaffected: 0 , < 5.2 (semver) Unaffected: 5.4.262 , ≤ 5.4.* (semver) Unaffected: 5.10.202 , ≤ 5.10.* (semver) Unaffected: 5.15.140 , ≤ 5.15.* (semver) Unaffected: 6.1.64 , ≤ 6.1.* (semver) Unaffected: 6.5.13 , ≤ 6.5.* (semver) Unaffected: 6.6.3 , ≤ 6.6.* (semver) Unaffected: 6.7 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-52791",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-17T17:36:52.732311Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-17T17:37:13.581Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
},
{
"providerMetadata": {
"dateUpdated": "2024-08-02T23:11:35.653Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/25eb381a736e7ae39a4245ef5c96484eb1073809"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/25284c46b657f48c0f3880a2e0706c70d81182c0"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/f6237afabc349c1c7909db00e15d2816519e0d2b"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/185f3617adc8fe45e40489b458f03911f0dec46c"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8c3fa52a46ff4d208cefb1a462ec94e0043a91e1"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3473cf43b9068b9dfef2f545f833f33c6a544b91"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/aa49c90894d06e18a1ee7c095edbd2f37c232d02"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/i2c/i2c-core.h"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "25eb381a736e7ae39a4245ef5c96484eb1073809",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "25284c46b657f48c0f3880a2e0706c70d81182c0",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "f6237afabc349c1c7909db00e15d2816519e0d2b",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "185f3617adc8fe45e40489b458f03911f0dec46c",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "8c3fa52a46ff4d208cefb1a462ec94e0043a91e1",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "3473cf43b9068b9dfef2f545f833f33c6a544b91",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "aa49c90894d06e18a1ee7c095edbd2f37c232d02",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/i2c/i2c-core.h"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.2"
},
{
"lessThan": "5.2",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.262",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.140",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.5.*",
"status": "unaffected",
"version": "6.5.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.7",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.262",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.202",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.140",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.64",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.5.13",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.3",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.7",
"versionStartIncluding": "5.2",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ni2c: core: Run atomic i2c xfer when !preemptible\n\nSince bae1d3a05a8b, i2c transfers are non-atomic if preemption is\ndisabled. However, non-atomic i2c transfers require preemption (e.g. in\nwait_for_completion() while waiting for the DMA).\n\npanic() calls preempt_disable_notrace() before calling\nemergency_restart(). Therefore, if an i2c device is used for the\nrestart, the xfer should be atomic. This avoids warnings like:\n\n[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0\n[ 12.676926] Voluntary context switch within RCU read-side critical section!\n...\n[ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114\n[ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70\n...\n[ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58\n[ 13.001050] machine_restart from panic+0x2a8/0x32c\n\nUse !preemptible() instead, which is basically the same check as\npre-v5.2."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T19:33:13.121Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/25eb381a736e7ae39a4245ef5c96484eb1073809"
},
{
"url": "https://git.kernel.org/stable/c/25284c46b657f48c0f3880a2e0706c70d81182c0"
},
{
"url": "https://git.kernel.org/stable/c/f6237afabc349c1c7909db00e15d2816519e0d2b"
},
{
"url": "https://git.kernel.org/stable/c/185f3617adc8fe45e40489b458f03911f0dec46c"
},
{
"url": "https://git.kernel.org/stable/c/8c3fa52a46ff4d208cefb1a462ec94e0043a91e1"
},
{
"url": "https://git.kernel.org/stable/c/3473cf43b9068b9dfef2f545f833f33c6a544b91"
},
{
"url": "https://git.kernel.org/stable/c/aa49c90894d06e18a1ee7c095edbd2f37c232d02"
}
],
"title": "i2c: core: Run atomic i2c xfer when !preemptible",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-52791",
"datePublished": "2024-05-21T15:31:06.997Z",
"dateReserved": "2024-05-21T15:19:24.241Z",
"dateUpdated": "2026-05-11T19:33:13.121Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2023-52791",
"date": "2026-09-22",
"epss": "0.0024",
"percentile": "0.15359"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/i2c/i2c-core.h"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "25eb381a736e7ae39a4245ef5c96484eb1073809",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "25284c46b657f48c0f3880a2e0706c70d81182c0",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "f6237afabc349c1c7909db00e15d2816519e0d2b",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "185f3617adc8fe45e40489b458f03911f0dec46c",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "8c3fa52a46ff4d208cefb1a462ec94e0043a91e1",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "3473cf43b9068b9dfef2f545f833f33c6a544b91",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "aa49c90894d06e18a1ee7c095edbd2f37c232d02",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/i2c/i2c-core.h"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.2"
},
{
"lessThan": "5.2",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.262",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.140",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.5.*",
"status": "unaffected",
"version": "6.5.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.7",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F349BD5C-EF29-421C-8EFB-D6FC454DFA91",
"versionEndExcluding": "5.4.262",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "39D508B4-58C7-40C2-BE05-44E41110EB98",
"versionEndExcluding": "5.10.202",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "15D6C23C-78A3-40D2-B76B-4F1D9C2D95C0",
"versionEndExcluding": "5.15.140",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "8D7C884A-CAA2-4EA2-9FEB-5CE776D7B05F",
"versionEndExcluding": "6.1.64",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "674C4F82-C336-4B49-BF64-1DE422E889C4",
"versionEndExcluding": "6.5.13",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B58252FA-A49C-411F-9B28-DC5FE44BC5A0",
"versionEndExcluding": "6.6.3",
"versionStartIncluding": "6.6",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ni2c: core: Run atomic i2c xfer when !preemptible\n\nSince bae1d3a05a8b, i2c transfers are non-atomic if preemption is\ndisabled. However, non-atomic i2c transfers require preemption (e.g. in\nwait_for_completion() while waiting for the DMA).\n\npanic() calls preempt_disable_notrace() before calling\nemergency_restart(). Therefore, if an i2c device is used for the\nrestart, the xfer should be atomic. This avoids warnings like:\n\n[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0\n[ 12.676926] Voluntary context switch within RCU read-side critical section!\n...\n[ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114\n[ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70\n...\n[ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58\n[ 13.001050] machine_restart from panic+0x2a8/0x32c\n\nUse !preemptible() instead, which is basically the same check as\npre-v5.2."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: i2c: core: ejecute atomic i2c xfer cuando !preemptible. Desde bae1d3a05a8b, las transferencias i2c no son at\u00f3micas si la preferencia est\u00e1 deshabilitada. Sin embargo, las transferencias i2c no at\u00f3micas requieren preferencia (por ejemplo, en wait_for_completion() mientras se espera el DMA). p\u00e1nico() llama a preempt_disable_notrace() antes de llamar a emergence_restart(). Por lo tanto, si se utiliza un dispositivo i2c para el reinicio, el xfer debe ser at\u00f3mico. Esto evita advertencias como: [12.667612] ADVERTENCIA: CPU: 1 PID: 1 en kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0 [12.676926] \u00a1Cambio de contexto voluntario dentro de la secci\u00f3n cr\u00edtica del lado de lectura de RCU! ... [12.742376] Schedule_timeout de wait_for_completion_timeout+0x90/0x114 [12.749179] wait_for_completion_timeout de tegra_i2c_wait_completion+0x40/0x70 ... [12.994527] atomic_notifier_call_chain de machine_restart+0x34/0x58 13.001050] machine_restart desde panic+0x2a8/0x32c Utilice !preemptible( ) en su lugar, que es b\u00e1sicamente la misma verificaci\u00f3n que la versi\u00f3n anterior a la v5.2."
}
],
"id": "CVE-2023-52791",
"lastModified": "2026-06-17T06:43:35.427",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-52791",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-17T17:36:52.732311Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-21T16:15:17.777",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/185f3617adc8fe45e40489b458f03911f0dec46c"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/25284c46b657f48c0f3880a2e0706c70d81182c0"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/25eb381a736e7ae39a4245ef5c96484eb1073809"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3473cf43b9068b9dfef2f545f833f33c6a544b91"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8c3fa52a46ff4d208cefb1a462ec94e0043a91e1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/aa49c90894d06e18a1ee7c095edbd2f37c232d02"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f6237afabc349c1c7909db00e15d2816519e0d2b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/185f3617adc8fe45e40489b458f03911f0dec46c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/25284c46b657f48c0f3880a2e0706c70d81182c0"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/25eb381a736e7ae39a4245ef5c96484eb1073809"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3473cf43b9068b9dfef2f545f833f33c6a544b91"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8c3fa52a46ff4d208cefb1a462ec94e0043a91e1"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/aa49c90894d06e18a1ee7c095edbd2f37c232d02"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f6237afabc349c1c7909db00e15d2816519e0d2b"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2026-06-28T07:47:41+00:00",
"cve": "CVE-2023-52791",
"id": "CVE-2023-52791",
"initial_release_date": "2023-01-01T00:00:00+00:00",
"product_status:fixed": "709",
"product_status:known_affected": "22",
"product_status:known_not_affected": "50",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: i2c: core: Run atomic i2c xfer when !preemptible",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2023/cve-2023-52791.json",
"version": "3"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T23:11:35.653Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/25eb381a736e7ae39a4245ef5c96484eb1073809"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/25284c46b657f48c0f3880a2e0706c70d81182c0"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/f6237afabc349c1c7909db00e15d2816519e0d2b"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/185f3617adc8fe45e40489b458f03911f0dec46c"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8c3fa52a46ff4d208cefb1a462ec94e0043a91e1"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3473cf43b9068b9dfef2f545f833f33c6a544b91"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/aa49c90894d06e18a1ee7c095edbd2f37c232d02"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2023-52791",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-17T17:36:52.732311Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-17T17:36:53.693Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/i2c/i2c-core.h"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "25eb381a736e7ae39a4245ef5c96484eb1073809",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "25284c46b657f48c0f3880a2e0706c70d81182c0",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "f6237afabc349c1c7909db00e15d2816519e0d2b",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "185f3617adc8fe45e40489b458f03911f0dec46c",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "8c3fa52a46ff4d208cefb1a462ec94e0043a91e1",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "3473cf43b9068b9dfef2f545f833f33c6a544b91",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "aa49c90894d06e18a1ee7c095edbd2f37c232d02",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/i2c/i2c-core.h"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.2"
},
{
"lessThan": "5.2",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.262",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.140",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.5.*",
"status": "unaffected",
"version": "6.5.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.7",
"versionType": "original_commit_for_fix"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ni2c: core: Run atomic i2c xfer when !preemptible\n\nSince bae1d3a05a8b, i2c transfers are non-atomic if preemption is\ndisabled. However, non-atomic i2c transfers require preemption (e.g. in\nwait_for_completion() while waiting for the DMA).\n\npanic() calls preempt_disable_notrace() before calling\nemergency_restart(). Therefore, if an i2c device is used for the\nrestart, the xfer should be atomic. This avoids warnings like:\n\n[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0\n[ 12.676926] Voluntary context switch within RCU read-side critical section!\n...\n[ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114\n[ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70\n...\n[ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58\n[ 13.001050] machine_restart from panic+0x2a8/0x32c\n\nUse !preemptible() instead, which is basically the same check as\npre-v5.2."
}
],
"providerMetadata": {
"dateUpdated": "2024-12-19T08:26:03.034Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/25eb381a736e7ae39a4245ef5c96484eb1073809"
},
{
"url": "https://git.kernel.org/stable/c/25284c46b657f48c0f3880a2e0706c70d81182c0"
},
{
"url": "https://git.kernel.org/stable/c/f6237afabc349c1c7909db00e15d2816519e0d2b"
},
{
"url": "https://git.kernel.org/stable/c/185f3617adc8fe45e40489b458f03911f0dec46c"
},
{
"url": "https://git.kernel.org/stable/c/8c3fa52a46ff4d208cefb1a462ec94e0043a91e1"
},
{
"url": "https://git.kernel.org/stable/c/3473cf43b9068b9dfef2f545f833f33c6a544b91"
},
{
"url": "https://git.kernel.org/stable/c/aa49c90894d06e18a1ee7c095edbd2f37c232d02"
}
],
"title": "i2c: core: Run atomic i2c xfer when !preemptible",
"x_generator": {
"engine": "bippy-5f407fcff5a0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-52791",
"datePublished": "2024-05-21T15:31:06.997Z",
"dateReserved": "2024-05-21T15:19:24.241Z",
"dateUpdated": "2024-12-19T08:26:03.034Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
}
}
CERTFR-2025-AVI-1057
Vulnerability from certfr_avis - Published: 2025-12-02 - Updated: 2025-12-02
De multiples vulnérabilités ont été découvertes dans les produits VMware. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 16.x antérieures à 16.11.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 14.x antérieures à 14.20.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 17.x antérieures à 17.7.0 | ||
| VMware | Tanzu Kubernetes Runtime | Tanzu Hub versions antérieures à 10.3.1 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 18.x antérieures à 18.1.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 15.x antérieures à 15.15.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 13.x antérieures à 13.23.0 |
| Title | Publication Time | Tags | ||||||
|---|---|---|---|---|---|---|---|---|
|
||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Tanzu pour Postgres versions 16.x ant\u00e9rieures \u00e0 16.11.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 14.x ant\u00e9rieures \u00e0 14.20.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 17.x ant\u00e9rieures \u00e0 17.7.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu Hub versions ant\u00e9rieures \u00e0 10.3.1",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 18.x ant\u00e9rieures \u00e0 18.1.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 15.x ant\u00e9rieures \u00e0 15.15.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 13.x ant\u00e9rieures \u00e0 13.23.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2019-12900",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-12900"
},
{
"name": "CVE-2019-25013",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-25013"
},
{
"name": "CVE-2020-28196",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-28196"
},
{
"name": "CVE-2020-10029",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10029"
},
{
"name": "CVE-2019-18276",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-18276"
},
{
"name": "CVE-2021-3421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3421"
},
{
"name": "CVE-2021-3326",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3326"
},
{
"name": "CVE-2020-27618",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-27618"
},
{
"name": "CVE-2021-20227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20227"
},
{
"name": "CVE-2021-36222",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36222"
},
{
"name": "CVE-2022-23960",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23960"
},
{
"name": "CVE-2022-37967",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37967"
},
{
"name": "CVE-2022-3629",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3629"
},
{
"name": "CVE-2022-3602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3602"
},
{
"name": "CVE-2022-37434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37434"
},
{
"name": "CVE-2022-2309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2309"
},
{
"name": "CVE-2022-43680",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43680"
},
{
"name": "CVE-2022-29824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29824"
},
{
"name": "CVE-2022-23308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23308"
},
{
"name": "CVE-2022-35737",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35737"
},
{
"name": "CVE-2022-40303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40303"
},
{
"name": "CVE-2022-40304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40304"
},
{
"name": "CVE-2022-42898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42898"
},
{
"name": "CVE-2022-3633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3633"
},
{
"name": "CVE-2022-3786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3786"
},
{
"name": "CVE-2022-32205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32205"
},
{
"name": "CVE-2022-32206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32206"
},
{
"name": "CVE-2018-25032",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-25032"
},
{
"name": "CVE-2022-3996",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3996"
},
{
"name": "CVE-2022-3903",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3903"
},
{
"name": "CVE-2022-22942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22942"
},
{
"name": "CVE-2022-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26878"
},
{
"name": "CVE-2021-20266",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20266"
},
{
"name": "CVE-2022-1292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1292"
},
{
"name": "CVE-2022-1974",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1974"
},
{
"name": "CVE-2021-3521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3521"
},
{
"name": "CVE-2022-27774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27774"
},
{
"name": "CVE-2022-27775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27775"
},
{
"name": "CVE-2022-22576",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22576"
},
{
"name": "CVE-2022-27776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27776"
},
{
"name": "CVE-2022-2068",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2068"
},
{
"name": "CVE-2022-2097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2097"
},
{
"name": "CVE-2022-20154",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20154"
},
{
"name": "CVE-2017-7500",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7500"
},
{
"name": "CVE-2021-33574",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33574"
},
{
"name": "CVE-2021-36690",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36690"
},
{
"name": "CVE-2021-37750",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37750"
},
{
"name": "CVE-2021-3999",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3999"
},
{
"name": "CVE-2022-23218",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23218"
},
{
"name": "CVE-2022-23219",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23219"
},
{
"name": "CVE-2022-27782",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27782"
},
{
"name": "CVE-2022-32208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32208"
},
{
"name": "CVE-2022-27781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27781"
},
{
"name": "CVE-2022-32207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32207"
},
{
"name": "CVE-2022-3358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3358"
},
{
"name": "CVE-2022-1271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1271"
},
{
"name": "CVE-2022-29458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29458"
},
{
"name": "CVE-2021-39537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39537"
},
{
"name": "CVE-2022-32221",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32221"
},
{
"name": "CVE-2022-42916",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42916"
},
{
"name": "CVE-2022-35252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35252"
},
{
"name": "CVE-2022-42915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-42915"
},
{
"name": "CVE-2022-43551",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43551"
},
{
"name": "CVE-2022-43552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43552"
},
{
"name": "CVE-2022-4304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4304"
},
{
"name": "CVE-2022-4203",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4203"
},
{
"name": "CVE-2023-0286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0286"
},
{
"name": "CVE-2023-0401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0401"
},
{
"name": "CVE-2023-0215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0215"
},
{
"name": "CVE-2023-0217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0217"
},
{
"name": "CVE-2023-0216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0216"
},
{
"name": "CVE-2022-4450",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4450"
},
{
"name": "CVE-2022-27672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27672"
},
{
"name": "CVE-2023-0045",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0045"
},
{
"name": "CVE-2023-23915",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23915"
},
{
"name": "CVE-2023-23914",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23914"
},
{
"name": "CVE-2023-23916",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23916"
},
{
"name": "CVE-2022-1304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1304"
},
{
"name": "CVE-2023-24329",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24329"
},
{
"name": "CVE-2023-1118",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1118"
},
{
"name": "CVE-2023-0464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0464"
},
{
"name": "CVE-2023-0466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0466"
},
{
"name": "CVE-2023-0465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0465"
},
{
"name": "CVE-2023-1838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1838"
},
{
"name": "CVE-2023-28410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28410"
},
{
"name": "CVE-2023-29469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29469"
},
{
"name": "CVE-2023-28484",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28484"
},
{
"name": "CVE-2023-2650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2650"
},
{
"name": "CVE-2023-27535",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27535"
},
{
"name": "CVE-2022-27779",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27779"
},
{
"name": "CVE-2023-27533",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27533"
},
{
"name": "CVE-2023-27538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27538"
},
{
"name": "CVE-2023-27534",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27534"
},
{
"name": "CVE-2023-27536",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27536"
},
{
"name": "CVE-2022-27780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27780"
},
{
"name": "CVE-2022-30115",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-30115"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2020-1752",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-1752"
},
{
"name": "CVE-2021-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35942"
},
{
"name": "CVE-2021-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38604"
},
{
"name": "CVE-2020-29562",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-29562"
},
{
"name": "CVE-2021-27645",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27645"
},
{
"name": "CVE-2022-3534",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3534"
},
{
"name": "CVE-2023-2156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2156"
},
{
"name": "CVE-2023-3006",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3006"
},
{
"name": "CVE-2023-1255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1255"
},
{
"name": "CVE-2023-28322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28322"
},
{
"name": "CVE-2022-46908",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-46908"
},
{
"name": "CVE-2021-31239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31239"
},
{
"name": "CVE-2023-28320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28320"
},
{
"name": "CVE-2023-28321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28321"
},
{
"name": "CVE-2023-2975",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2975"
},
{
"name": "CVE-2022-4899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4899"
},
{
"name": "CVE-2023-3446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3446"
},
{
"name": "CVE-2023-28319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28319"
},
{
"name": "CVE-2023-3817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3817"
},
{
"name": "CVE-2023-4387",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4387"
},
{
"name": "CVE-2023-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38546"
},
{
"name": "CVE-2023-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38545"
},
{
"name": "CVE-2023-5363",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5363"
},
{
"name": "CVE-2023-4807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4807"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2023-31085",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31085"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2023-40217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40217"
},
{
"name": "CVE-2020-22218",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-22218"
},
{
"name": "CVE-2023-2603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2603"
},
{
"name": "CVE-2023-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2602"
},
{
"name": "CVE-2023-4813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4813"
},
{
"name": "CVE-2022-0563",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0563"
},
{
"name": "CVE-2023-4039",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4039"
},
{
"name": "CVE-2023-5156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5156"
},
{
"name": "CVE-2023-29491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29491"
},
{
"name": "CVE-2023-39615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39615"
},
{
"name": "CVE-2021-37600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37600"
},
{
"name": "CVE-2021-33294",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33294"
},
{
"name": "CVE-2021-43618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43618"
},
{
"name": "CVE-2023-45322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45322"
},
{
"name": "CVE-2019-17498",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-17498"
},
{
"name": "CVE-2013-4235",
"url": "https://www.cve.org/CVERecord?id=CVE-2013-4235"
},
{
"name": "CVE-2023-29383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29383"
},
{
"name": "CVE-2023-48795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-48795"
},
{
"name": "CVE-2023-6237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6237"
},
{
"name": "CVE-2023-36054",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36054"
},
{
"name": "CVE-2023-7104",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7104"
},
{
"name": "CVE-2023-6129",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6129"
},
{
"name": "CVE-2023-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46218"
},
{
"name": "CVE-2024-0727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0727"
},
{
"name": "CVE-2023-52467",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52467"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2023-52445",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52445"
},
{
"name": "CVE-2024-26598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26598"
},
{
"name": "CVE-2023-52462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52462"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2023-52464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52464"
},
{
"name": "CVE-2023-52475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52475"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2024-26603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26603"
},
{
"name": "CVE-2023-52452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52452"
},
{
"name": "CVE-2023-52532",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52532"
},
{
"name": "CVE-2019-25162",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-25162"
},
{
"name": "CVE-2021-46904",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46904"
},
{
"name": "CVE-2024-24855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24855"
},
{
"name": "CVE-2023-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27043"
},
{
"name": "CVE-2023-36632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36632"
},
{
"name": "CVE-2024-28085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28085"
},
{
"name": "CVE-2024-2511",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2511"
},
{
"name": "CVE-2020-22916",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-22916"
},
{
"name": "CVE-2024-26631",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26631"
},
{
"name": "CVE-2017-7501",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7501"
},
{
"name": "CVE-2021-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35939"
},
{
"name": "CVE-2021-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35938"
},
{
"name": "CVE-2021-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35937"
},
{
"name": "CVE-2023-6597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6597"
},
{
"name": "CVE-2023-52426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52426"
},
{
"name": "CVE-2023-52501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52501"
},
{
"name": "CVE-2023-52519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52519"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-26670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26670"
},
{
"name": "CVE-2023-52477",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52477"
},
{
"name": "CVE-2023-52528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52528"
},
{
"name": "CVE-2023-52582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52582"
},
{
"name": "CVE-2021-47098",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47098"
},
{
"name": "CVE-2023-52513",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52513"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2021-47097",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47097"
},
{
"name": "CVE-2023-52520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52520"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2023-52523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52523"
},
{
"name": "CVE-2024-26803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26803"
},
{
"name": "CVE-2024-24858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24858"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26681"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2024-26621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26621"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2021-47020",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47020"
},
{
"name": "CVE-2021-47017",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47017"
},
{
"name": "CVE-2021-46984",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46984"
},
{
"name": "CVE-2021-47071",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47071"
},
{
"name": "CVE-2021-47202",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47202"
},
{
"name": "CVE-2024-26605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26605"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26987"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2023-52468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52468"
},
{
"name": "CVE-2023-52487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52487"
},
{
"name": "CVE-2024-26618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26618"
},
{
"name": "CVE-2023-52490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52490"
},
{
"name": "CVE-2023-52455",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52455"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26649"
},
{
"name": "CVE-2023-52473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52473"
},
{
"name": "CVE-2023-52465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52465"
},
{
"name": "CVE-2007-4559",
"url": "https://www.cve.org/CVERecord?id=CVE-2007-4559"
},
{
"name": "CVE-2023-52425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52425"
},
{
"name": "CVE-2024-4603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4603"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2021-47196",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47196"
},
{
"name": "CVE-2022-48702",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48702"
},
{
"name": "CVE-2022-48701",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48701"
},
{
"name": "CVE-2022-48694",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48694"
},
{
"name": "CVE-2022-48644",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48644"
},
{
"name": "CVE-2021-47217",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47217"
},
{
"name": "CVE-2022-48653",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48653"
},
{
"name": "CVE-2021-47214",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47214"
},
{
"name": "CVE-2022-48672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48672"
},
{
"name": "CVE-2022-48657",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48657"
},
{
"name": "CVE-2022-48652",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48652"
},
{
"name": "CVE-2022-48658",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48658"
},
{
"name": "CVE-2021-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47210"
},
{
"name": "CVE-2022-48662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48662"
},
{
"name": "CVE-2022-48639",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48639"
},
{
"name": "CVE-2023-52646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52646"
},
{
"name": "CVE-2022-48640",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48640"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2021-47215",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47215"
},
{
"name": "CVE-2021-47074",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47074"
},
{
"name": "CVE-2021-47041",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47041"
},
{
"name": "CVE-2024-27039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27039"
},
{
"name": "CVE-2022-48704",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48704"
},
{
"name": "CVE-2022-48675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48675"
},
{
"name": "CVE-2022-48690",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48690"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2022-48637",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48637"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2022-48660",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48660"
},
{
"name": "CVE-2024-4741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4741"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2023-52565",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52565"
},
{
"name": "CVE-2024-26892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26892"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2025-9232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9232"
},
{
"name": "CVE-2021-47227",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47227"
},
{
"name": "CVE-2021-47237",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47237"
},
{
"name": "CVE-2021-47239",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47239"
},
{
"name": "CVE-2021-47250",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47250"
},
{
"name": "CVE-2021-47261",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47261"
},
{
"name": "CVE-2021-47343",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47343"
},
{
"name": "CVE-2021-47360",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47360"
},
{
"name": "CVE-2021-47365",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47365"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2021-47398",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47398"
},
{
"name": "CVE-2021-47404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47404"
},
{
"name": "CVE-2021-47420",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47420"
},
{
"name": "CVE-2021-47422",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47422"
},
{
"name": "CVE-2021-47426",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47426"
},
{
"name": "CVE-2021-47428",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47428"
},
{
"name": "CVE-2021-47429",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47429"
},
{
"name": "CVE-2021-47430",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47430"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47444",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47444"
},
{
"name": "CVE-2021-47454",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47454"
},
{
"name": "CVE-2021-47457",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47457"
},
{
"name": "CVE-2021-47465",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47465"
},
{
"name": "CVE-2021-47481",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47481"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2021-47490",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47490"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2021-47499",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47499"
},
{
"name": "CVE-2021-47500",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47500"
},
{
"name": "CVE-2021-47505",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47505"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2021-47536",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47536"
},
{
"name": "CVE-2021-47537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47537"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47550"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2022-48689",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48689"
},
{
"name": "CVE-2022-48691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48691"
},
{
"name": "CVE-2022-48705",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48705"
},
{
"name": "CVE-2022-48709",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48709"
},
{
"name": "CVE-2022-48710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48710"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52702",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52702"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2023-52731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52731"
},
{
"name": "CVE-2023-52736",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52736"
},
{
"name": "CVE-2023-52739",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52739"
},
{
"name": "CVE-2023-52740",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52740"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52744",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52744"
},
{
"name": "CVE-2023-52747",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52747"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2024-5535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5535"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-35983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35983"
},
{
"name": "CVE-2024-2398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2398"
},
{
"name": "CVE-2024-0397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0397"
},
{
"name": "CVE-2024-4030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4030"
},
{
"name": "CVE-2024-4032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4032"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2023-52649",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52649"
},
{
"name": "CVE-2024-26953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26953"
},
{
"name": "CVE-2024-26975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26975"
},
{
"name": "CVE-2024-27026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27026"
},
{
"name": "CVE-2024-27079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27079"
},
{
"name": "CVE-2024-27390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27390"
},
{
"name": "CVE-2024-35787",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35787"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-3596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3596"
},
{
"name": "CVE-2023-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52560"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-0450",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0450"
},
{
"name": "CVE-2024-25062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25062"
},
{
"name": "CVE-2024-26458",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26458"
},
{
"name": "CVE-2024-26461",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26461"
},
{
"name": "CVE-2021-47539",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47539"
},
{
"name": "CVE-2021-47572",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47572"
},
{
"name": "CVE-2021-47576",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47576"
},
{
"name": "CVE-2021-47578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47578"
},
{
"name": "CVE-2021-47601",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47601"
},
{
"name": "CVE-2021-47607",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47607"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2021-47616",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47616"
},
{
"name": "CVE-2021-47617",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47617"
},
{
"name": "CVE-2021-47620",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47620"
},
{
"name": "CVE-2022-48712",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48712"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48714",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48714"
},
{
"name": "CVE-2022-48720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48720"
},
{
"name": "CVE-2022-48724",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48724"
},
{
"name": "CVE-2022-48725",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48725"
},
{
"name": "CVE-2022-48727",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48727"
},
{
"name": "CVE-2022-48728",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48728"
},
{
"name": "CVE-2022-48729",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48729"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48745",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48745"
},
{
"name": "CVE-2022-48746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48746"
},
{
"name": "CVE-2022-48752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48752"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2022-48763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48763"
},
{
"name": "CVE-2022-48767",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48767"
},
{
"name": "CVE-2022-48768",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48768"
},
{
"name": "CVE-2022-48769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48769"
},
{
"name": "CVE-2022-48770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48770"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2023-4641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4641"
},
{
"name": "CVE-2023-50495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50495"
},
{
"name": "CVE-2024-24859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24859"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-26818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26818"
},
{
"name": "CVE-2024-26831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26831"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35894"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35913"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35980"
},
{
"name": "CVE-2024-39298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39298"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40913"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-6923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6923"
},
{
"name": "CVE-2024-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3219"
},
{
"name": "CVE-2024-36028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36028"
},
{
"name": "CVE-2024-36884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36884"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36932"
},
{
"name": "CVE-2024-36956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36956"
},
{
"name": "CVE-2024-36961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36961"
},
{
"name": "CVE-2024-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38561"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-38606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38606"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-6197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6197"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2025-58056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58056"
},
{
"name": "CVE-2025-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58057"
},
{
"name": "CVE-2025-10966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10966"
},
{
"name": "CVE-2025-59425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59425"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-6232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6232"
},
{
"name": "CVE-2025-12817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12817"
},
{
"name": "CVE-2025-12818",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12818"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2019-14844",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14844"
},
{
"name": "CVE-2021-24031",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-24031"
},
{
"name": "CVE-2021-24032",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-24032"
},
{
"name": "CVE-2021-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44964"
},
{
"name": "CVE-2022-28805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28805"
},
{
"name": "CVE-2022-33099",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33099"
},
{
"name": "CVE-2025-0306",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0306"
},
{
"name": "CVE-2025-52099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52099"
},
{
"name": "CVE-2025-53643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53643"
},
{
"name": "CVE-2025-59375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59375"
},
{
"name": "CVE-2025-6141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6141"
},
{
"name": "CVE-2025-7709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7709"
},
{
"name": "CVE-2025-9714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9714"
},
{
"name": "CVE-2024-45491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45491"
},
{
"name": "CVE-2024-45492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45492"
},
{
"name": "CVE-2024-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38632"
},
{
"name": "CVE-2024-39491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39491"
},
{
"name": "CVE-2024-40922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40922"
},
{
"name": "CVE-2024-40930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40930"
},
{
"name": "CVE-2024-40964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40964"
},
{
"name": "CVE-2024-40992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40992"
},
{
"name": "CVE-2024-41003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41003"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-42085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42085"
},
{
"name": "CVE-2024-42109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42109"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2021-47517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47517"
},
{
"name": "CVE-2022-48865",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48865"
},
{
"name": "CVE-2022-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48875"
},
{
"name": "CVE-2022-48883",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48883"
},
{
"name": "CVE-2022-48886",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48886"
},
{
"name": "CVE-2022-48889",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48889"
},
{
"name": "CVE-2022-48890",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48890"
},
{
"name": "CVE-2022-48896",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48896"
},
{
"name": "CVE-2022-48899",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48899"
},
{
"name": "CVE-2022-48912",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48912"
},
{
"name": "CVE-2022-48913",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48913"
},
{
"name": "CVE-2022-48914",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48914"
},
{
"name": "CVE-2022-48915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48915"
},
{
"name": "CVE-2022-48921",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48921"
},
{
"name": "CVE-2022-48929",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48929"
},
{
"name": "CVE-2022-48931",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48931"
},
{
"name": "CVE-2022-48934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48934"
},
{
"name": "CVE-2022-48938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48938"
},
{
"name": "CVE-2022-48939",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48939"
},
{
"name": "CVE-2022-48942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48942"
},
{
"name": "CVE-2023-52859",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52859"
},
{
"name": "CVE-2023-52898",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52898"
},
{
"name": "CVE-2023-52901",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52901"
},
{
"name": "CVE-2023-52905",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52905"
},
{
"name": "CVE-2023-52906",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52906"
},
{
"name": "CVE-2023-52908",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52908"
},
{
"name": "CVE-2023-52909",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52909"
},
{
"name": "CVE-2023-52910",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52910"
},
{
"name": "CVE-2024-26637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26637"
},
{
"name": "CVE-2024-26682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26682"
},
{
"name": "CVE-2024-26683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26683"
},
{
"name": "CVE-2024-36970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36970"
},
{
"name": "CVE-2024-39486",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39486"
},
{
"name": "CVE-2024-41010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41010"
},
{
"name": "CVE-2024-41032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41032"
},
{
"name": "CVE-2024-41037",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41037"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-41045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41045"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-41084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41084"
},
{
"name": "CVE-2024-41094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41094"
},
{
"name": "CVE-2024-42107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42107"
},
{
"name": "CVE-2024-42125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42125"
},
{
"name": "CVE-2024-42132",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42132"
},
{
"name": "CVE-2024-42133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42133"
},
{
"name": "CVE-2024-42138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42138"
},
{
"name": "CVE-2024-42139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42139"
},
{
"name": "CVE-2024-42141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42141"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2024-42239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42239"
},
{
"name": "CVE-2024-42241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42241"
},
{
"name": "CVE-2024-42245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42245"
},
{
"name": "CVE-2024-42268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42268"
},
{
"name": "CVE-2024-42278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42278"
},
{
"name": "CVE-2024-42291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42291"
},
{
"name": "CVE-2024-42315",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42315"
},
{
"name": "CVE-2024-42316",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42316"
},
{
"name": "CVE-2024-43816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43816"
},
{
"name": "CVE-2024-43817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43817"
},
{
"name": "CVE-2024-43821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43821"
},
{
"name": "CVE-2024-43826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43826"
},
{
"name": "CVE-2024-43840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43840"
},
{
"name": "CVE-2024-43842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43842"
},
{
"name": "CVE-2024-43873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43873"
},
{
"name": "CVE-2024-43874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43874"
},
{
"name": "CVE-2024-7264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7264"
},
{
"name": "CVE-2024-41031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41031"
},
{
"name": "CVE-2024-42243",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42243"
},
{
"name": "CVE-2024-34459",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34459"
},
{
"name": "CVE-2024-8096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8096"
},
{
"name": "CVE-2024-44983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44983"
},
{
"name": "CVE-2024-44986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44986"
},
{
"name": "CVE-2024-45000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45000"
},
{
"name": "CVE-2024-45010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45010"
},
{
"name": "CVE-2024-45019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45019"
},
{
"name": "CVE-2024-45022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45022"
},
{
"name": "CVE-2024-45029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45029"
},
{
"name": "CVE-2024-46711",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46711"
},
{
"name": "CVE-2024-46784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46784"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2022-48944",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48944"
},
{
"name": "CVE-2024-42294",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42294"
},
{
"name": "CVE-2024-43870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43870"
},
{
"name": "CVE-2024-44967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44967"
},
{
"name": "CVE-2024-44984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44984"
},
{
"name": "CVE-2024-45001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45001"
},
{
"name": "CVE-2024-45005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45005"
},
{
"name": "CVE-2024-45012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45012"
},
{
"name": "CVE-2024-45013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45013"
},
{
"name": "CVE-2024-45017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45017"
},
{
"name": "CVE-2024-45020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45020"
},
{
"name": "CVE-2024-46672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46672"
},
{
"name": "CVE-2024-46692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46692"
},
{
"name": "CVE-2024-46706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46706"
},
{
"name": "CVE-2024-46709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46709"
},
{
"name": "CVE-2024-46710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46710"
},
{
"name": "CVE-2024-46767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46767"
},
{
"name": "CVE-2024-46786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46786"
},
{
"name": "CVE-2024-46797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46797"
},
{
"name": "CVE-2024-37370",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37370"
},
{
"name": "CVE-2024-37371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37371"
},
{
"name": "CVE-2024-9143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9143"
},
{
"name": "CVE-2024-41085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41085"
},
{
"name": "CVE-2024-26721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26721"
},
{
"name": "CVE-2024-42258",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42258"
},
{
"name": "CVE-2024-45490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45490"
},
{
"name": "CVE-2024-7592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7592"
},
{
"name": "CVE-2024-8088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8088"
},
{
"name": "CVE-2025-54121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-54121"
},
{
"name": "CVE-2012-2114",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-2114"
},
{
"name": "CVE-2021-46937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46937"
},
{
"name": "CVE-2021-46999",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46999"
},
{
"name": "CVE-2021-47033",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47033"
},
{
"name": "CVE-2021-47079",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47079"
},
{
"name": "CVE-2021-47092",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47092"
},
{
"name": "CVE-2021-47226",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47226"
},
{
"name": "CVE-2021-47251",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47251"
},
{
"name": "CVE-2021-47266",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47266"
},
{
"name": "CVE-2021-47318",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47318"
},
{
"name": "CVE-2021-47325",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47325"
},
{
"name": "CVE-2021-47346",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47346"
},
{
"name": "CVE-2021-47349",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47349"
},
{
"name": "CVE-2021-47519",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47519"
},
{
"name": "CVE-2021-47561",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47561"
},
{
"name": "CVE-2021-47613",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47613"
},
{
"name": "CVE-2022-1247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1247"
},
{
"name": "CVE-2022-20153",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20153"
},
{
"name": "CVE-2022-48641",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48641"
},
{
"name": "CVE-2022-48643",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48643"
},
{
"name": "CVE-2022-48707",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48707"
},
{
"name": "CVE-2022-48719",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48719"
},
{
"name": "CVE-2022-48781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48781"
},
{
"name": "CVE-2022-48819",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48819"
},
{
"name": "CVE-2022-48832",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48832"
},
{
"name": "CVE-2022-48848",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48848"
},
{
"name": "CVE-2022-48876",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48876"
},
{
"name": "CVE-2022-48963",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48963"
},
{
"name": "CVE-2022-48974",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48974"
},
{
"name": "CVE-2022-48976",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48976"
},
{
"name": "CVE-2022-48984",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48984"
},
{
"name": "CVE-2022-48986",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48986"
},
{
"name": "CVE-2022-49013",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49013"
},
{
"name": "CVE-2022-49018",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49018"
},
{
"name": "CVE-2022-49048",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49048"
},
{
"name": "CVE-2022-49049",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49049"
},
{
"name": "CVE-2022-49052",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49052"
},
{
"name": "CVE-2022-49072",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49072"
},
{
"name": "CVE-2022-49077",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49077"
},
{
"name": "CVE-2022-49094",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49094"
},
{
"name": "CVE-2022-49152",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49152"
},
{
"name": "CVE-2022-49198",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49198"
},
{
"name": "CVE-2022-49229",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49229"
},
{
"name": "CVE-2022-49231",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49231"
},
{
"name": "CVE-2022-49334",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49334"
},
{
"name": "CVE-2022-49340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49340"
},
{
"name": "CVE-2022-49374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49374"
},
{
"name": "CVE-2022-49401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49401"
},
{
"name": "CVE-2022-49403",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49403"
},
{
"name": "CVE-2022-49450",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49450"
},
{
"name": "CVE-2022-49554",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49554"
},
{
"name": "CVE-2022-49557",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49557"
},
{
"name": "CVE-2022-49567",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49567"
},
{
"name": "CVE-2022-49571",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49571"
},
{
"name": "CVE-2022-49572",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49572"
},
{
"name": "CVE-2022-49573",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49573"
},
{
"name": "CVE-2022-49574",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49574"
},
{
"name": "CVE-2022-49575",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49575"
},
{
"name": "CVE-2022-49577",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49577"
},
{
"name": "CVE-2022-49580",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49580"
},
{
"name": "CVE-2022-49585",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49585"
},
{
"name": "CVE-2022-49586",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49586"
},
{
"name": "CVE-2022-49587",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49587"
},
{
"name": "CVE-2022-49593",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49593"
},
{
"name": "CVE-2022-49594",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49594"
},
{
"name": "CVE-2022-49595",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49595"
},
{
"name": "CVE-2022-49596",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49596"
},
{
"name": "CVE-2022-49597",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49597"
},
{
"name": "CVE-2022-49598",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49598"
},
{
"name": "CVE-2022-49599",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49599"
},
{
"name": "CVE-2022-49600",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49600"
},
{
"name": "CVE-2022-49601",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49601"
},
{
"name": "CVE-2022-49602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49602"
},
{
"name": "CVE-2022-49604",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49604"
},
{
"name": "CVE-2022-49612",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49612"
},
{
"name": "CVE-2022-49629",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49629"
},
{
"name": "CVE-2022-49633",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49633"
},
{
"name": "CVE-2022-49637",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49637"
},
{
"name": "CVE-2022-49639",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49639"
},
{
"name": "CVE-2022-49659",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49659"
},
{
"name": "CVE-2022-49662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49662"
},
{
"name": "CVE-2022-49691",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49691"
},
{
"name": "CVE-2022-49744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49744"
},
{
"name": "CVE-2022-49747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49747"
},
{
"name": "CVE-2022-49752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49752"
},
{
"name": "CVE-2022-49754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49754"
},
{
"name": "CVE-2022-49760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49760"
},
{
"name": "CVE-2023-31082",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31082"
},
{
"name": "CVE-2023-52516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52516"
},
{
"name": "CVE-2023-52568",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52568"
},
{
"name": "CVE-2023-52570",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52570"
},
{
"name": "CVE-2023-52689",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52689"
},
{
"name": "CVE-2023-52704",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52704"
},
{
"name": "CVE-2023-52706",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52706"
},
{
"name": "CVE-2023-52828",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52828"
},
{
"name": "CVE-2023-52902",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52902"
},
{
"name": "CVE-2023-52932",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52932"
},
{
"name": "CVE-2023-52934",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52934"
},
{
"name": "CVE-2023-52940",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52940"
},
{
"name": "CVE-2023-52942",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52942"
},
{
"name": "CVE-2023-52977",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52977"
},
{
"name": "CVE-2023-52985",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52985"
},
{
"name": "CVE-2023-52987",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52987"
},
{
"name": "CVE-2023-52991",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52991"
},
{
"name": "CVE-2023-53004",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53004"
},
{
"name": "CVE-2023-53017",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53017"
},
{
"name": "CVE-2024-23196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23196"
},
{
"name": "CVE-2024-26678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26678"
},
{
"name": "CVE-2024-26725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26725"
},
{
"name": "CVE-2024-26746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26746"
},
{
"name": "CVE-2024-26918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26918"
},
{
"name": "CVE-2024-27023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27023"
},
{
"name": "CVE-2024-40907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40907"
},
{
"name": "CVE-2024-43896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43896"
},
{
"name": "CVE-2024-46748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46748"
},
{
"name": "CVE-2024-46862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46862"
},
{
"name": "CVE-2024-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53073"
},
{
"name": "CVE-2024-53225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53225"
},
{
"name": "CVE-2024-56668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56668"
},
{
"name": "CVE-2024-57852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57852"
},
{
"name": "CVE-2024-57914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57914"
},
{
"name": "CVE-2024-57985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57985"
},
{
"name": "CVE-2024-57989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57989"
},
{
"name": "CVE-2024-58064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58064"
},
{
"name": "CVE-2024-58075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58075"
},
{
"name": "CVE-2024-58084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58084"
},
{
"name": "CVE-2025-21709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21709"
},
{
"name": "CVE-2025-21807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21807"
},
{
"name": "CVE-2025-21817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21817"
},
{
"name": "CVE-2025-21827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21827"
},
{
"name": "CVE-2025-21851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21851"
},
{
"name": "CVE-2025-21874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21874"
},
{
"name": "CVE-2025-21907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21907"
},
{
"name": "CVE-2025-21921",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21921"
},
{
"name": "CVE-2025-24357",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24357"
},
{
"name": "CVE-2025-25183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25183"
},
{
"name": "CVE-2025-29770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29770"
},
{
"name": "CVE-2025-30165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30165"
},
{
"name": "CVE-2025-30202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30202"
},
{
"name": "CVE-2025-32381",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32381"
},
{
"name": "CVE-2025-32444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32444"
},
{
"name": "CVE-2025-46570",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46570"
},
{
"name": "CVE-2025-47277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47277"
},
{
"name": "CVE-2025-48887",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48887"
},
{
"name": "CVE-2025-48956",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48956"
},
{
"name": "CVE-2025-57809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-57809"
},
{
"name": "CVE-2025-62372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62372"
},
{
"name": "CVE-2025-62426",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62426"
},
{
"name": "CVE-2025-65106",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-65106"
},
{
"name": "CVE-2024-9681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9681"
},
{
"name": "CVE-2024-11168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11168"
},
{
"name": "CVE-2022-48879",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48879"
},
{
"name": "CVE-2022-48946",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48946"
},
{
"name": "CVE-2022-48951",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48951"
},
{
"name": "CVE-2022-48953",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48953"
},
{
"name": "CVE-2022-48969",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48969"
},
{
"name": "CVE-2022-48971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48971"
},
{
"name": "CVE-2022-48972",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48972"
},
{
"name": "CVE-2022-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48978"
},
{
"name": "CVE-2022-48981",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48981"
},
{
"name": "CVE-2022-48985",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48985"
},
{
"name": "CVE-2022-48987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48987"
},
{
"name": "CVE-2022-48988",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48988"
},
{
"name": "CVE-2022-48992",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48992"
},
{
"name": "CVE-2022-48994",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48994"
},
{
"name": "CVE-2022-48997",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48997"
},
{
"name": "CVE-2022-49005",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49005"
},
{
"name": "CVE-2022-49006",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49006"
},
{
"name": "CVE-2022-49011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49011"
},
{
"name": "CVE-2022-49012",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49012"
},
{
"name": "CVE-2022-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49014"
},
{
"name": "CVE-2022-49015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49015"
},
{
"name": "CVE-2022-49017",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49017"
},
{
"name": "CVE-2022-49021",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49021"
},
{
"name": "CVE-2022-49022",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49022"
},
{
"name": "CVE-2022-49024",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49024"
},
{
"name": "CVE-2022-49027",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49027"
},
{
"name": "CVE-2022-49028",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49028"
},
{
"name": "CVE-2022-49029",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49029"
},
{
"name": "CVE-2024-44932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44932"
},
{
"name": "CVE-2024-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44964"
},
{
"name": "CVE-2024-46766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46766"
},
{
"name": "CVE-2024-46825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46825"
},
{
"name": "CVE-2024-46864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46864"
},
{
"name": "CVE-2024-43869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43869"
},
{
"name": "CVE-2024-47672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47672"
},
{
"name": "CVE-2024-47675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47675"
},
{
"name": "CVE-2024-47682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47682"
},
{
"name": "CVE-2024-47687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47687"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47702"
},
{
"name": "CVE-2024-47715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47715"
},
{
"name": "CVE-2024-47719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47719"
},
{
"name": "CVE-2024-47727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47727"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-49862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49862"
},
{
"name": "CVE-2024-49864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49864"
},
{
"name": "CVE-2024-49866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49866"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2024-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49886"
},
{
"name": "CVE-2024-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49946"
},
{
"name": "CVE-2024-49953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49953"
},
{
"name": "CVE-2024-50000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50000"
},
{
"name": "CVE-2024-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50019"
},
{
"name": "CVE-2024-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50020"
},
{
"name": "CVE-2024-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50021"
},
{
"name": "CVE-2024-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50022"
},
{
"name": "CVE-2024-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50023"
},
{
"name": "CVE-2024-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50027"
},
{
"name": "CVE-2024-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50041"
},
{
"name": "CVE-2024-50042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50042"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2024-50064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50064"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-50075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50075"
},
{
"name": "CVE-2024-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50076"
},
{
"name": "CVE-2024-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50077"
},
{
"name": "CVE-2024-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50078"
},
{
"name": "CVE-2024-50081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50081"
},
{
"name": "CVE-2024-46824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46824"
},
{
"name": "CVE-2024-50126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50126"
},
{
"name": "CVE-2024-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50215"
},
{
"name": "CVE-2024-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50235"
},
{
"name": "CVE-2024-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50250"
},
{
"name": "CVE-2024-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50252"
},
{
"name": "CVE-2024-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50255"
},
{
"name": "CVE-2024-50259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50259"
},
{
"name": "CVE-2024-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50261"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2024-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53042"
},
{
"name": "CVE-2024-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53055"
},
{
"name": "CVE-2024-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53070"
},
{
"name": "CVE-2024-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53072"
},
{
"name": "CVE-2024-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53082"
},
{
"name": "CVE-2024-50226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50226"
},
{
"name": "CVE-2024-11053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11053"
},
{
"name": "CVE-2024-44994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44994"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2024-42317",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42317"
},
{
"name": "CVE-2024-43820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43820"
},
{
"name": "CVE-2024-43888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43888"
},
{
"name": "CVE-2024-43910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43910"
},
{
"name": "CVE-2024-44975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44975"
},
{
"name": "CVE-2024-44996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44996"
},
{
"name": "CVE-2024-45027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45027"
},
{
"name": "CVE-2024-46697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46697"
},
{
"name": "CVE-2024-46698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46698"
},
{
"name": "CVE-2024-46788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46788"
},
{
"name": "CVE-2024-46793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46793"
},
{
"name": "CVE-2024-46845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46845"
},
{
"name": "CVE-2024-47734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47734"
},
{
"name": "CVE-2024-49856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49856"
},
{
"name": "CVE-2024-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49977"
},
{
"name": "CVE-2024-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50093"
},
{
"name": "CVE-2024-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50186"
},
{
"name": "CVE-2024-50189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50189"
},
{
"name": "CVE-2022-48982",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48982"
},
{
"name": "CVE-2022-48983",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48983"
},
{
"name": "CVE-2022-48989",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48989"
},
{
"name": "CVE-2023-52778",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52778"
},
{
"name": "CVE-2024-49976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49976"
},
{
"name": "CVE-2024-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50101"
},
{
"name": "CVE-2024-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50102"
},
{
"name": "CVE-2024-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50121"
},
{
"name": "CVE-2024-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50124"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50128"
},
{
"name": "CVE-2024-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50136"
},
{
"name": "CVE-2024-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50139"
},
{
"name": "CVE-2024-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50141"
},
{
"name": "CVE-2024-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50145"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2024-50147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50147"
},
{
"name": "CVE-2024-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50153"
},
{
"name": "CVE-2024-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50155"
},
{
"name": "CVE-2024-50157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50157"
},
{
"name": "CVE-2024-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50158"
},
{
"name": "CVE-2024-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50160"
},
{
"name": "CVE-2024-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50169"
},
{
"name": "CVE-2024-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50172"
},
{
"name": "CVE-2024-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50182"
},
{
"name": "CVE-2024-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50200"
},
{
"name": "CVE-2024-50216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50216"
},
{
"name": "CVE-2024-50274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50274"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2024-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53045"
},
{
"name": "CVE-2024-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53048"
},
{
"name": "CVE-2024-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53074"
},
{
"name": "CVE-2024-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53085"
},
{
"name": "CVE-2024-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53110"
},
{
"name": "CVE-2024-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50162"
},
{
"name": "CVE-2024-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50163"
},
{
"name": "CVE-2024-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53097"
},
{
"name": "CVE-2024-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53113"
},
{
"name": "CVE-2024-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53120"
},
{
"name": "CVE-2024-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53123"
},
{
"name": "CVE-2024-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53136"
},
{
"name": "CVE-2024-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53064"
},
{
"name": "CVE-2024-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53105"
},
{
"name": "CVE-2024-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53117"
},
{
"name": "CVE-2024-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53118"
},
{
"name": "CVE-2024-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53134"
},
{
"name": "CVE-2024-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53151"
},
{
"name": "CVE-2024-53160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53160"
},
{
"name": "CVE-2024-53166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53166"
},
{
"name": "CVE-2024-53169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53169"
},
{
"name": "CVE-2024-53202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53202"
},
{
"name": "CVE-2024-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53206"
},
{
"name": "CVE-2024-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53207"
},
{
"name": "CVE-2024-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53208"
},
{
"name": "CVE-2024-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53213"
},
{
"name": "CVE-2024-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53215"
},
{
"name": "CVE-2024-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53222"
},
{
"name": "CVE-2024-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53229"
},
{
"name": "CVE-2024-56549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56549"
},
{
"name": "CVE-2024-56667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56667"
},
{
"name": "CVE-2024-56752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56752"
},
{
"name": "CVE-2024-48873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48873"
},
{
"name": "CVE-2024-49951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49951"
},
{
"name": "CVE-2024-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53091"
},
{
"name": "CVE-2024-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53170"
},
{
"name": "CVE-2024-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53175"
},
{
"name": "CVE-2024-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53185"
},
{
"name": "CVE-2024-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53230"
},
{
"name": "CVE-2024-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53231"
},
{
"name": "CVE-2024-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53232"
},
{
"name": "CVE-2024-53236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53236"
},
{
"name": "CVE-2024-55881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55881"
},
{
"name": "CVE-2024-56372",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56372"
},
{
"name": "CVE-2025-0938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0938"
},
{
"name": "CVE-2024-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53238"
},
{
"name": "CVE-2024-56617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56617"
},
{
"name": "CVE-2024-56625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56625"
},
{
"name": "CVE-2024-56632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56632"
},
{
"name": "CVE-2024-56654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56654"
},
{
"name": "CVE-2024-56663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56663"
},
{
"name": "CVE-2024-56675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56675"
},
{
"name": "CVE-2024-56708",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56708"
},
{
"name": "CVE-2024-56709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56709"
},
{
"name": "CVE-2024-56729",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56729"
},
{
"name": "CVE-2024-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56745"
},
{
"name": "CVE-2024-56760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56760"
},
{
"name": "CVE-2024-56765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56765"
},
{
"name": "CVE-2024-57793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57793"
},
{
"name": "CVE-2024-57804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57804"
},
{
"name": "CVE-2024-57932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57932"
},
{
"name": "CVE-2024-57933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57933"
},
{
"name": "CVE-2024-57936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57936"
},
{
"name": "CVE-2025-21645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21645"
},
{
"name": "CVE-2025-21649",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21649"
},
{
"name": "CVE-2025-0167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0167"
},
{
"name": "CVE-2025-0725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0725"
},
{
"name": "CVE-2024-46820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46820"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2024-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53047"
},
{
"name": "CVE-2024-56679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56679"
},
{
"name": "CVE-2024-56707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56707"
},
{
"name": "CVE-2024-56725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56725"
},
{
"name": "CVE-2024-56726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56726"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2024-57882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57882"
},
{
"name": "CVE-2024-57917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57917"
},
{
"name": "CVE-2025-21663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21663"
},
{
"name": "CVE-2025-21670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21670"
},
{
"name": "CVE-2024-50164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50164"
},
{
"name": "CVE-2025-21647",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21647"
},
{
"name": "CVE-2025-21668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21668"
},
{
"name": "CVE-2025-21671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21671"
},
{
"name": "CVE-2025-21681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21681"
},
{
"name": "CVE-2024-13176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13176"
},
{
"name": "CVE-2021-47222",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47222"
},
{
"name": "CVE-2021-47223",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47223"
},
{
"name": "CVE-2025-21673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21673"
},
{
"name": "CVE-2024-47700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47700"
},
{
"name": "CVE-2024-49880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49880"
},
{
"name": "CVE-2024-49885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49885"
},
{
"name": "CVE-2024-49999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49999"
},
{
"name": "CVE-2024-50029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50029"
},
{
"name": "CVE-2024-50107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50107"
},
{
"name": "CVE-2024-50109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50109"
},
{
"name": "CVE-2024-50114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50114"
},
{
"name": "CVE-2024-50120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50120"
},
{
"name": "CVE-2024-50152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50152"
},
{
"name": "CVE-2024-50165",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50165"
},
{
"name": "CVE-2024-50197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50197"
},
{
"name": "CVE-2024-50207",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50207"
},
{
"name": "CVE-2024-50223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50223"
},
{
"name": "CVE-2024-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50294"
},
{
"name": "CVE-2024-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50303"
},
{
"name": "CVE-2024-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53044"
},
{
"name": "CVE-2024-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53109"
},
{
"name": "CVE-2024-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53167"
},
{
"name": "CVE-2024-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53176"
},
{
"name": "CVE-2024-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53178"
},
{
"name": "CVE-2024-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53189"
},
{
"name": "CVE-2024-56535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56535"
},
{
"name": "CVE-2024-56545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56545"
},
{
"name": "CVE-2024-56696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56696"
},
{
"name": "CVE-2024-56702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56702"
},
{
"name": "CVE-2024-56742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56742"
},
{
"name": "CVE-2025-1795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1795"
},
{
"name": "CVE-2024-56783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56783"
},
{
"name": "CVE-2025-21694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21694"
},
{
"name": "CVE-2022-49080",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49080"
},
{
"name": "CVE-2022-49089",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49089"
},
{
"name": "CVE-2024-57994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57994"
},
{
"name": "CVE-2025-21705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21705"
},
{
"name": "CVE-2025-21716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21716"
},
{
"name": "CVE-2025-21724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21724"
},
{
"name": "CVE-2025-21725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21725"
},
{
"name": "CVE-2025-21790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21790"
},
{
"name": "CVE-2025-21795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21795"
},
{
"name": "CVE-2022-49043",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49043"
},
{
"name": "CVE-2024-45336",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45336"
},
{
"name": "CVE-2024-45341",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45341"
},
{
"name": "CVE-2025-22866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22866"
},
{
"name": "CVE-2021-47648",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47648"
},
{
"name": "CVE-2021-47649",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47649"
},
{
"name": "CVE-2021-47650",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47650"
},
{
"name": "CVE-2021-47659",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47659"
},
{
"name": "CVE-2022-49058",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49058"
},
{
"name": "CVE-2022-49061",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49061"
},
{
"name": "CVE-2022-49065",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49065"
},
{
"name": "CVE-2022-49066",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49066"
},
{
"name": "CVE-2022-49074",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49074"
},
{
"name": "CVE-2022-49086",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49086"
},
{
"name": "CVE-2022-49090",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49090"
},
{
"name": "CVE-2022-49092",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49092"
},
{
"name": "CVE-2022-49097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49097"
},
{
"name": "CVE-2022-49100",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49100"
},
{
"name": "CVE-2022-49103",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49103"
},
{
"name": "CVE-2022-49107",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49107"
},
{
"name": "CVE-2022-49118",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49118"
},
{
"name": "CVE-2022-49122",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49122"
},
{
"name": "CVE-2022-49130",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49130"
},
{
"name": "CVE-2022-49145",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49145"
},
{
"name": "CVE-2022-49147",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49147"
},
{
"name": "CVE-2022-49148",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49148"
},
{
"name": "CVE-2022-49153",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49153"
},
{
"name": "CVE-2022-49154",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49154"
},
{
"name": "CVE-2022-49155",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49155"
},
{
"name": "CVE-2022-49156",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49156"
},
{
"name": "CVE-2022-49159",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49159"
},
{
"name": "CVE-2022-49174",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49174"
},
{
"name": "CVE-2022-49175",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49175"
},
{
"name": "CVE-2022-49180",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49180"
},
{
"name": "CVE-2022-49187",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49187"
},
{
"name": "CVE-2022-49188",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49188"
},
{
"name": "CVE-2022-49206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49206"
},
{
"name": "CVE-2022-49208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49208"
},
{
"name": "CVE-2022-49216",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49216"
},
{
"name": "CVE-2022-49227",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49227"
},
{
"name": "CVE-2022-49257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49257"
},
{
"name": "CVE-2022-49259",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49259"
},
{
"name": "CVE-2022-49262",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49262"
},
{
"name": "CVE-2022-49263",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49263"
},
{
"name": "CVE-2022-49264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49264"
},
{
"name": "CVE-2022-49266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49266"
},
{
"name": "CVE-2022-49268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49268"
},
{
"name": "CVE-2022-49269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49269"
},
{
"name": "CVE-2022-49272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49272"
},
{
"name": "CVE-2022-49273",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49273"
},
{
"name": "CVE-2022-49279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49279"
},
{
"name": "CVE-2022-49286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49286"
},
{
"name": "CVE-2022-49290",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49290"
},
{
"name": "CVE-2022-49297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49297"
},
{
"name": "CVE-2022-49307",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49307"
},
{
"name": "CVE-2022-49308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49308"
},
{
"name": "CVE-2022-49321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49321"
},
{
"name": "CVE-2022-49322",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49322"
},
{
"name": "CVE-2022-49323",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49323"
},
{
"name": "CVE-2022-49339",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49339"
},
{
"name": "CVE-2022-49341",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49341"
},
{
"name": "CVE-2022-49343",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49343"
},
{
"name": "CVE-2022-49345",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49345"
},
{
"name": "CVE-2022-49350",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49350"
},
{
"name": "CVE-2022-49352",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49352"
},
{
"name": "CVE-2022-49356",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49356"
},
{
"name": "CVE-2022-49357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49357"
},
{
"name": "CVE-2022-49376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49376"
},
{
"name": "CVE-2022-49378",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49378"
},
{
"name": "CVE-2022-49379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49379"
},
{
"name": "CVE-2022-49384",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49384"
},
{
"name": "CVE-2022-49394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49394"
},
{
"name": "CVE-2022-49400",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49400"
},
{
"name": "CVE-2022-49402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49402"
},
{
"name": "CVE-2022-49404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49404"
},
{
"name": "CVE-2022-49407",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49407"
},
{
"name": "CVE-2022-49409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49409"
},
{
"name": "CVE-2022-49422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49422"
},
{
"name": "CVE-2022-49432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49432"
},
{
"name": "CVE-2022-49433",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49433"
},
{
"name": "CVE-2022-49434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49434"
},
{
"name": "CVE-2022-49441",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49441"
},
{
"name": "CVE-2022-49447",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49447"
},
{
"name": "CVE-2022-49455",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49455"
},
{
"name": "CVE-2022-49468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49468"
},
{
"name": "CVE-2022-49472",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49472"
},
{
"name": "CVE-2022-49475",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49475"
},
{
"name": "CVE-2022-49481",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49481"
},
{
"name": "CVE-2022-49486",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49486"
},
{
"name": "CVE-2022-49492",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49492"
},
{
"name": "CVE-2022-49498",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49498"
},
{
"name": "CVE-2022-49503",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49503"
},
{
"name": "CVE-2022-49508",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49508"
},
{
"name": "CVE-2022-49515",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49515"
},
{
"name": "CVE-2022-49519",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49519"
},
{
"name": "CVE-2022-49520",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49520"
},
{
"name": "CVE-2022-49521",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49521"
},
{
"name": "CVE-2022-49523",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49523"
},
{
"name": "CVE-2022-49526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49526"
},
{
"name": "CVE-2022-49532",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49532"
},
{
"name": "CVE-2022-49545",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49545"
},
{
"name": "CVE-2022-49559",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49559"
},
{
"name": "CVE-2022-49581",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49581"
},
{
"name": "CVE-2022-49583",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49583"
},
{
"name": "CVE-2022-49584",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49584"
},
{
"name": "CVE-2022-49592",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49592"
},
{
"name": "CVE-2022-49603",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49603"
},
{
"name": "CVE-2022-49605",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49605"
},
{
"name": "CVE-2022-49606",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49606"
},
{
"name": "CVE-2022-49607",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49607"
},
{
"name": "CVE-2022-49611",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49611"
},
{
"name": "CVE-2022-49613",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49613"
},
{
"name": "CVE-2022-49625",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49625"
},
{
"name": "CVE-2022-49627",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49627"
},
{
"name": "CVE-2022-49631",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49631"
},
{
"name": "CVE-2022-49634",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49634"
},
{
"name": "CVE-2022-49640",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49640"
},
{
"name": "CVE-2022-49641",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49641"
},
{
"name": "CVE-2022-49642",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49642"
},
{
"name": "CVE-2022-49643",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49643"
},
{
"name": "CVE-2022-49646",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49646"
},
{
"name": "CVE-2022-49648",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49648"
},
{
"name": "CVE-2022-49653",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49653"
},
{
"name": "CVE-2022-49656",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49656"
},
{
"name": "CVE-2022-49657",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49657"
},
{
"name": "CVE-2022-49663",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49663"
},
{
"name": "CVE-2022-49670",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49670"
},
{
"name": "CVE-2022-49671",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49671"
},
{
"name": "CVE-2022-49672",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49672"
},
{
"name": "CVE-2022-49673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49673"
},
{
"name": "CVE-2022-49674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49674"
},
{
"name": "CVE-2022-49675",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49675"
},
{
"name": "CVE-2022-49679",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49679"
},
{
"name": "CVE-2022-49688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49688"
},
{
"name": "CVE-2022-49699",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49699"
},
{
"name": "CVE-2022-49707",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49707"
},
{
"name": "CVE-2022-49708",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49708"
},
{
"name": "CVE-2022-49710",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49710"
},
{
"name": "CVE-2022-49716",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49716"
},
{
"name": "CVE-2022-49721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49721"
},
{
"name": "CVE-2022-49723",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49723"
},
{
"name": "CVE-2022-49726",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49726"
},
{
"name": "CVE-2022-49731",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49731"
},
{
"name": "CVE-2024-48876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48876"
},
{
"name": "CVE-2024-53681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53681"
},
{
"name": "CVE-2024-54460",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54460"
},
{
"name": "CVE-2024-55642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55642"
},
{
"name": "CVE-2024-56613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56613"
},
{
"name": "CVE-2024-56624",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56624"
},
{
"name": "CVE-2024-56638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56638"
},
{
"name": "CVE-2024-56653",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56653"
},
{
"name": "CVE-2024-56657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56657"
},
{
"name": "CVE-2024-56669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56669"
},
{
"name": "CVE-2024-56710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56710"
},
{
"name": "CVE-2024-56714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56714"
},
{
"name": "CVE-2024-56772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56772"
},
{
"name": "CVE-2024-56773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56773"
},
{
"name": "CVE-2024-57878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57878"
},
{
"name": "CVE-2024-57879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57879"
},
{
"name": "CVE-2024-57885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57885"
},
{
"name": "CVE-2025-21644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21644"
},
{
"name": "CVE-2025-21659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21659"
},
{
"name": "CVE-2024-56171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56171"
},
{
"name": "CVE-2025-27113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27113"
},
{
"name": "CVE-2024-57993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57993"
},
{
"name": "CVE-2024-58009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58009"
},
{
"name": "CVE-2024-58061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58061"
},
{
"name": "CVE-2024-58068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58068"
},
{
"name": "CVE-2024-58077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58077"
},
{
"name": "CVE-2025-21706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21706"
},
{
"name": "CVE-2025-21707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21707"
},
{
"name": "CVE-2025-21829",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21829"
},
{
"name": "CVE-2025-21830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21830"
},
{
"name": "CVE-2025-21832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21832"
},
{
"name": "CVE-2022-49057",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49057"
},
{
"name": "CVE-2022-49062",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49062"
},
{
"name": "CVE-2022-49064",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49064"
},
{
"name": "CVE-2022-49070",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49070"
},
{
"name": "CVE-2022-49139",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49139"
},
{
"name": "CVE-2022-49204",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49204"
},
{
"name": "CVE-2022-49205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49205"
},
{
"name": "CVE-2022-49207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49207"
},
{
"name": "CVE-2022-49209",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49209"
},
{
"name": "CVE-2022-49225",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49225"
},
{
"name": "CVE-2022-49228",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49228"
},
{
"name": "CVE-2022-49237",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49237"
},
{
"name": "CVE-2022-49330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49330"
},
{
"name": "CVE-2022-49353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49353"
},
{
"name": "CVE-2022-49406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49406"
},
{
"name": "CVE-2022-49436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49436"
},
{
"name": "CVE-2022-49446",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49446"
},
{
"name": "CVE-2022-49476",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49476"
},
{
"name": "CVE-2022-49511",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49511"
},
{
"name": "CVE-2022-49518",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49518"
},
{
"name": "CVE-2022-49538",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49538"
},
{
"name": "CVE-2022-49548",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49548"
},
{
"name": "CVE-2022-49552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49552"
},
{
"name": "CVE-2022-49560",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49560"
},
{
"name": "CVE-2022-49565",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49565"
},
{
"name": "CVE-2022-49624",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49624"
},
{
"name": "CVE-2022-49638",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49638"
},
{
"name": "CVE-2022-49655",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49655"
},
{
"name": "CVE-2022-49658",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49658"
},
{
"name": "CVE-2022-49697",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49697"
},
{
"name": "CVE-2022-49732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49732"
},
{
"name": "CVE-2022-49739",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49739"
},
{
"name": "CVE-2022-49746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49746"
},
{
"name": "CVE-2022-49759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49759"
},
{
"name": "CVE-2023-52933",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52933"
},
{
"name": "CVE-2023-52941",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52941"
},
{
"name": "CVE-2023-52976",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52976"
},
{
"name": "CVE-2023-52984",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52984"
},
{
"name": "CVE-2023-52992",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52992"
},
{
"name": "CVE-2023-52993",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52993"
},
{
"name": "CVE-2023-53006",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53006"
},
{
"name": "CVE-2023-53007",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53007"
},
{
"name": "CVE-2023-53015",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53015"
},
{
"name": "CVE-2023-53016",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53016"
},
{
"name": "CVE-2023-53019",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53019"
},
{
"name": "CVE-2023-53026",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53026"
},
{
"name": "CVE-2023-53029",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53029"
},
{
"name": "CVE-2023-53030",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53030"
},
{
"name": "CVE-2023-53033",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53033"
},
{
"name": "CVE-2024-46736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46736"
},
{
"name": "CVE-2024-46796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46796"
},
{
"name": "CVE-2024-57990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57990"
},
{
"name": "CVE-2024-57999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57999"
},
{
"name": "CVE-2024-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58057"
},
{
"name": "CVE-2024-58078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58078"
},
{
"name": "CVE-2024-58079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58079"
},
{
"name": "CVE-2025-21723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21723"
},
{
"name": "CVE-2025-21732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21732"
},
{
"name": "CVE-2025-21810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21810"
},
{
"name": "CVE-2025-21825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21825"
},
{
"name": "CVE-2025-21828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21828"
},
{
"name": "CVE-2025-21844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21844"
},
{
"name": "CVE-2025-21847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21847"
},
{
"name": "CVE-2025-21856",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21856"
},
{
"name": "CVE-2025-21857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21857"
},
{
"name": "CVE-2025-21864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21864"
},
{
"name": "CVE-2025-21869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21869"
},
{
"name": "CVE-2025-21870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21870"
},
{
"name": "CVE-2025-21876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21876"
},
{
"name": "CVE-2025-21883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21883"
},
{
"name": "CVE-2025-21886",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21886"
},
{
"name": "CVE-2025-21888",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21888"
},
{
"name": "CVE-2025-21890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21890"
},
{
"name": "CVE-2024-8176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8176"
},
{
"name": "CVE-2025-24928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24928"
},
{
"name": "CVE-2025-21913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21913"
},
{
"name": "CVE-2025-21916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21916"
},
{
"name": "CVE-2025-21918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21918"
},
{
"name": "CVE-2025-21924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21924"
},
{
"name": "CVE-2025-21936",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21936"
},
{
"name": "CVE-2025-21938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21938"
},
{
"name": "CVE-2025-21962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21962"
},
{
"name": "CVE-2025-21963",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21963"
},
{
"name": "CVE-2025-21964",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21964"
},
{
"name": "CVE-2025-21978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21978"
},
{
"name": "CVE-2025-21979",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21979"
},
{
"name": "CVE-2025-21986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21986"
},
{
"name": "CVE-2022-49220",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49220"
},
{
"name": "CVE-2022-49372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49372"
},
{
"name": "CVE-2022-49578",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49578"
},
{
"name": "CVE-2022-49589",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49589"
},
{
"name": "CVE-2022-49620",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49620"
},
{
"name": "CVE-2023-52997",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52997"
},
{
"name": "CVE-2023-53031",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53031"
},
{
"name": "CVE-2024-57952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57952"
},
{
"name": "CVE-2025-21691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21691"
},
{
"name": "CVE-2025-27516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27516"
},
{
"name": "CVE-2025-21953",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21953"
},
{
"name": "CVE-2025-4516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4516"
},
{
"name": "CVE-2024-9287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9287"
},
{
"name": "CVE-2025-32414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32414"
},
{
"name": "CVE-2025-32415",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32415"
},
{
"name": "CVE-2022-49171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49171"
},
{
"name": "CVE-2022-49197",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49197"
},
{
"name": "CVE-2022-49561",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49561"
},
{
"name": "CVE-2022-49590",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49590"
},
{
"name": "CVE-2023-52928",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52928"
},
{
"name": "CVE-2023-52937",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52937"
},
{
"name": "CVE-2023-52938",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52938"
},
{
"name": "CVE-2023-52981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52981"
},
{
"name": "CVE-2023-52982",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52982"
},
{
"name": "CVE-2023-52986",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52986"
},
{
"name": "CVE-2023-53009",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53009"
},
{
"name": "CVE-2023-53032",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53032"
},
{
"name": "CVE-2024-58070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58070"
},
{
"name": "CVE-2024-58088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58088"
},
{
"name": "CVE-2025-21808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21808"
},
{
"name": "CVE-2025-21836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21836"
},
{
"name": "CVE-2025-21854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21854"
},
{
"name": "CVE-2025-21884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21884"
},
{
"name": "CVE-2025-21889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21889"
},
{
"name": "CVE-2025-21895",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21895"
},
{
"name": "CVE-2025-21906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21906"
},
{
"name": "CVE-2025-21908",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21908"
},
{
"name": "CVE-2025-21930",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21930"
},
{
"name": "CVE-2025-21961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21961"
},
{
"name": "CVE-2025-21966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21966"
},
{
"name": "CVE-2025-4947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4947"
},
{
"name": "CVE-2025-5025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5025"
},
{
"name": "CVE-2024-56433",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56433"
},
{
"name": "CVE-2025-1390",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1390"
},
{
"name": "CVE-2025-29088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29088"
},
{
"name": "CVE-2025-32434",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32434"
},
{
"name": "CVE-2025-43859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-43859"
},
{
"name": "CVE-2024-58074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58074"
},
{
"name": "CVE-2025-21974",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21974"
},
{
"name": "CVE-2025-6021",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6021"
},
{
"name": "CVE-2022-49636",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49636"
},
{
"name": "CVE-2025-21939",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21939"
},
{
"name": "CVE-2024-47081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47081"
},
{
"name": "CVE-2025-3576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3576"
},
{
"name": "CVE-2024-57987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57987"
},
{
"name": "CVE-2024-57988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57988"
},
{
"name": "CVE-2024-57995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57995"
},
{
"name": "CVE-2024-58015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58015"
},
{
"name": "CVE-2024-58062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58062"
},
{
"name": "CVE-2025-21713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21713"
},
{
"name": "CVE-2025-21770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21770"
},
{
"name": "CVE-2025-21880",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21880"
},
{
"name": "CVE-2021-3995",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3995"
},
{
"name": "CVE-2021-3996",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3996"
},
{
"name": "CVE-2025-6069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6069"
},
{
"name": "CVE-2025-21809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21809"
},
{
"name": "CVE-2025-8194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8194"
},
{
"name": "CVE-2025-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50182"
},
{
"name": "CVE-2021-47316",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47316"
},
{
"name": "CVE-2021-32256",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-32256"
},
{
"name": "CVE-2024-25260",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25260"
},
{
"name": "CVE-2025-1371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1371"
},
{
"name": "CVE-2025-1376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1376"
},
{
"name": "CVE-2025-1377",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1377"
},
{
"name": "CVE-2025-49794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49794"
},
{
"name": "CVE-2025-49796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49796"
},
{
"name": "CVE-2024-54456",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54456"
},
{
"name": "CVE-2025-21783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21783"
},
{
"name": "CVE-2025-6965",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6965"
},
{
"name": "CVE-2025-55163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55163"
},
{
"name": "CVE-2024-26462",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26462"
},
{
"name": "CVE-2025-1352",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1352"
},
{
"name": "CVE-2025-1365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1365"
},
{
"name": "CVE-2025-1372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1372"
},
{
"name": "CVE-2025-27587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27587"
},
{
"name": "CVE-2025-49795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49795"
},
{
"name": "CVE-2025-6170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6170"
},
{
"name": "CVE-2025-8732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8732"
},
{
"name": "CVE-2025-9086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9086"
},
{
"name": "CVE-2025-41248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41248"
}
],
"initial_release_date": "2025-12-02T00:00:00",
"last_revision_date": "2025-12-02T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-1057",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-12-02T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits VMware. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits VMware",
"vendor_advisories": [
{
"published_at": "2025-12-01",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36560",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36560"
},
{
"published_at": "2025-12-01",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36564",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36564"
}
]
}
CERTFR-2026-AVI-1165
Vulnerability from certfr_avis - Published: 2026-09-11 - Updated: 2026-09-11
De multiples vulnérabilités ont été découvertes dans les produits IBM. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| IBM | Db2 | Db2 Common Container sans le correctif de sécurité 1159cn3 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 15.0.x antérieures à 15.0.1.14 | ||
| IBM | QRadar Hub | QRadar Hub versions antérieures à 3.9.1 | ||
| IBM | WebSphere Application Server | WebSphere Application Server Liberty versions antérieures à 26.0.0.10 (disponibilité prévue pour le quatrième trimestre 2026) | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 12.10 antérieures à InformixHQ 3.3.1 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 14.10.x antérieures à 14.10.xC14 | ||
| IBM | Db2 | Db2 versions V11.5.x sans le correctif de sécurité DT495924, DT474170, DT495462, DT470425 et DT501356 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Bridge versions antérieures à 1.1.5.2 | ||
| IBM | Db2 | Db2 Warehouse on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Sterling Partner Engagement Manager Standard Edition | Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Developer Extension versions 1.1.x antérieures à 1.1.2 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x antérieures à 6.3.0.3 | ||
| IBM | Db2 | Db2 on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Db2 | Db2 versions V12.1 sans le correctif de sécurité DT495924, DT495462 et DT474170 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Db2 Common Container sans le correctif de s\u00e9curit\u00e9 1159cn3",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 15.0.x ant\u00e9rieures \u00e0 15.0.1.14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Hub versions ant\u00e9rieures \u00e0 3.9.1",
"product": {
"name": "QRadar Hub",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "WebSphere Application Server Liberty versions ant\u00e9rieures \u00e0 26.0.0.10 (disponibilit\u00e9 pr\u00e9vue pour le quatri\u00e8me trimestre 2026)",
"product": {
"name": "WebSphere Application Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 12.10 ant\u00e9rieures \u00e0 InformixHQ 3.3.1",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 14.10.x ant\u00e9rieures \u00e0 14.10.xC14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V11.5.x sans le correctif de s\u00e9curit\u00e9 DT495924, DT474170, DT495462, DT470425 et DT501356",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Bridge versions ant\u00e9rieures \u00e0 1.1.5.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Warehouse on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Standard Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Developer Extension versions 1.1.x ant\u00e9rieures \u00e0 1.1.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x ant\u00e9rieures \u00e0 6.3.0.3",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V12.1 sans le correctif de s\u00e9curit\u00e9 DT495924, DT495462 et DT474170",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-75595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75595"
},
{
"name": "CVE-2026-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49978"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2023-52471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52471"
},
{
"name": "CVE-2026-5588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5588"
},
{
"name": "CVE-2021-33036",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33036"
},
{
"name": "CVE-2021-44906",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44906"
},
{
"name": "CVE-2026-54264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54264"
},
{
"name": "CVE-2024-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50142"
},
{
"name": "CVE-2026-59651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59651"
},
{
"name": "CVE-2026-45819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45819"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2026-50557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50557"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2026-59295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59295"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2023-43642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-43642"
},
{
"name": "CVE-2021-21409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21409"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2018-14042",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14042"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2025-2534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2534"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2026-41254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41254"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2026-16480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16480"
},
{
"name": "CVE-2018-1334",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1334"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2026-32990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-32990"
},
{
"name": "CVE-2024-26595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26595"
},
{
"name": "CVE-2026-50645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50645"
},
{
"name": "CVE-2026-22610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22610"
},
{
"name": "CVE-2024-42292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42292"
},
{
"name": "CVE-2026-42041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42041"
},
{
"name": "CVE-2014-125087",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-125087"
},
{
"name": "CVE-2026-14686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14686"
},
{
"name": "CVE-2026-68763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68763"
},
{
"name": "CVE-2023-1370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1370"
},
{
"name": "CVE-2026-45416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45416"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-33201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33201"
},
{
"name": "CVE-2026-10050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10050"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2024-42284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42284"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2026-53666",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53666"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2026-59648",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59648"
},
{
"name": "CVE-2026-69153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69153"
},
{
"name": "CVE-2026-3621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3621"
},
{
"name": "CVE-2026-43515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43515"
},
{
"name": "CVE-2026-42402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42402"
},
{
"name": "CVE-2021-47304",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47304"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2026-43868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43868"
},
{
"name": "CVE-2026-50560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50560"
},
{
"name": "CVE-2024-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26586"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2015-5237",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-5237"
},
{
"name": "CVE-2026-71290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71290"
},
{
"name": "CVE-2019-10099",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-10099"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2026-41716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41716"
},
{
"name": "CVE-2018-11760",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11760"
},
{
"name": "CVE-2026-15328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15328"
},
{
"name": "CVE-2026-59645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59645"
},
{
"name": "CVE-2022-45688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45688"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-23944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23944"
},
{
"name": "CVE-2022-33891",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33891"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2026-13006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13006"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2018-8024",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8024"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2024-49350",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49350"
},
{
"name": "CVE-2022-48619",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48619"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2025-66412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66412"
},
{
"name": "CVE-2025-36131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36131"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2026-54514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54514"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2018-14040",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14040"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2026-77414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77414"
},
{
"name": "CVE-2020-11988",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11988"
},
{
"name": "CVE-2021-46939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46939"
},
{
"name": "CVE-2025-56200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-56200"
},
{
"name": "CVE-2024-37071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37071"
},
{
"name": "CVE-2026-77413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77413"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2026-54399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54399"
},
{
"name": "CVE-2026-53668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53668"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2025-30065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30065"
},
{
"name": "CVE-2026-16243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16243"
},
{
"name": "CVE-2016-4055",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-4055"
},
{
"name": "CVE-2026-9171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9171"
},
{
"name": "CVE-2026-67214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67214"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2024-25638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25638"
},
{
"name": "CVE-2026-12185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12185"
},
{
"name": "CVE-2026-59921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59921"
},
{
"name": "CVE-2024-47118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47118"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2026-47010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47010"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2023-45288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45288"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2026-14685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14685"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-45178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45178"
},
{
"name": "CVE-2026-54171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54171"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2022-31160",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31160"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2020-10683",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10683"
},
{
"name": "CVE-2018-1273",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1273"
},
{
"name": "CVE-2026-41239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41239"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2026-33814",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33814"
},
{
"name": "CVE-2023-28746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28746"
},
{
"name": "CVE-2026-47891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47891"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2024-42114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42114"
},
{
"name": "CVE-2020-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26945"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2026-68569",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68569"
},
{
"name": "CVE-2026-59084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59084"
},
{
"name": "CVE-2026-65183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65183"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2026-14257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14257"
},
{
"name": "CVE-2026-41901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41901"
},
{
"name": "CVE-2026-73088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73088"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2024-23945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23945"
},
{
"name": "CVE-2021-41182",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41182"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2022-25647",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25647"
},
{
"name": "CVE-2026-9072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9072"
},
{
"name": "CVE-2022-26612",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26612"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2026-18097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18097"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2022-36364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36364"
},
{
"name": "CVE-2026-73089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73089"
},
{
"name": "CVE-2023-34610",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34610"
},
{
"name": "CVE-2026-47057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47057"
},
{
"name": "CVE-2024-47561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47561"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-31881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31881"
},
{
"name": "CVE-2019-11358",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-11358"
},
{
"name": "CVE-2026-69152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69152"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2026-68525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68525"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2026-59901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59901"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-35839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35839"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2026-14525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14525"
},
{
"name": "CVE-2026-67313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67313"
},
{
"name": "CVE-2020-13955",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-13955"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2026-8858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8858"
},
{
"name": "CVE-2026-42580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42580"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2026-41691",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41691"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2026-65637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65637"
},
{
"name": "CVE-2018-8009",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8009"
},
{
"name": "CVE-2026-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50163"
},
{
"name": "CVE-2026-67315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67315"
},
{
"name": "CVE-2026-54516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54516"
},
{
"name": "CVE-2026-55223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55223"
},
{
"name": "CVE-2025-7962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7962"
},
{
"name": "CVE-2026-18499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18499"
},
{
"name": "CVE-2019-20444",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20444"
},
{
"name": "CVE-2026-54515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54515"
},
{
"name": "CVE-2026-5516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5516"
},
{
"name": "CVE-2023-34462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34462"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2026-41721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41721"
},
{
"name": "CVE-2018-1313",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1313"
},
{
"name": "CVE-2026-16221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16221"
},
{
"name": "CVE-2023-34454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34454"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2022-46337",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-46337"
},
{
"name": "CVE-2026-6790",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6790"
},
{
"name": "CVE-2026-65911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65911"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2026-18401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18401"
},
{
"name": "CVE-2021-35516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35516"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26686"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2024-29857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29857"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-26645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26645"
},
{
"name": "CVE-2026-66143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66143"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2026-66144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66144"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2026-44494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44494"
},
{
"name": "CVE-2023-26049",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26049"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2026-42585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42585"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-45018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45018"
},
{
"name": "CVE-2026-12860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12860"
},
{
"name": "CVE-2026-10571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10571"
},
{
"name": "CVE-2024-34447",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34447"
},
{
"name": "CVE-2026-65901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65901"
},
{
"name": "CVE-2026-11541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11541"
},
{
"name": "CVE-2014-3578",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-3578"
},
{
"name": "CVE-2026-41635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41635"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2024-31880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31880"
},
{
"name": "CVE-2024-29025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29025"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2026-11546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11546"
},
{
"name": "CVE-2026-42036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42036"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2026-64607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64607"
},
{
"name": "CVE-2026-59652",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59652"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2023-34453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34453"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27043"
},
{
"name": "CVE-2024-41761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41761"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2026-65903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65903"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2026-65900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65900"
},
{
"name": "CVE-2026-66010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66010"
},
{
"name": "CVE-2026-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52746"
},
{
"name": "CVE-2024-28762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28762"
},
{
"name": "CVE-2023-3635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3635"
},
{
"name": "CVE-2026-43827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43827"
},
{
"name": "CVE-2026-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50184"
},
{
"name": "CVE-2026-47885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47885"
},
{
"name": "CVE-2026-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50169"
},
{
"name": "CVE-2021-47287",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47287"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2026-47065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47065"
},
{
"name": "CVE-2026-55831",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55831"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2023-5072",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5072"
},
{
"name": "CVE-2026-47841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47841"
},
{
"name": "CVE-2021-23337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23337"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2026-41707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41707"
},
{
"name": "CVE-2021-23369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23369"
},
{
"name": "CVE-2026-77415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77415"
},
{
"name": "CVE-2026-42403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42403"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2022-31777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31777"
},
{
"name": "CVE-2019-14893",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14893"
},
{
"name": "CVE-2026-10534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10534"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2026-59880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59880"
},
{
"name": "CVE-2026-65432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65432"
},
{
"name": "CVE-2026-59894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59894"
},
{
"name": "CVE-2019-0231",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0231"
},
{
"name": "CVE-2023-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50298"
},
{
"name": "CVE-2026-15057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15057"
},
{
"name": "CVE-2026-41607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41607"
},
{
"name": "CVE-2024-26308",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26308"
},
{
"name": "CVE-2025-1992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1992"
},
{
"name": "CVE-2026-44248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44248"
},
{
"name": "CVE-2018-20676",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20676"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-31141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31141"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2025-13755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13755"
},
{
"name": "CVE-2025-62718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62718"
},
{
"name": "CVE-2025-36136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36136"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2026-49458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49458"
},
{
"name": "CVE-2026-4800",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4800"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2026-42584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42584"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2026-4410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4410"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2026-44249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44249"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2026-41284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41284"
},
{
"name": "CVE-2025-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36008"
},
{
"name": "CVE-2026-59647",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59647"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2021-35517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35517"
},
{
"name": "CVE-2024-30172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30172"
},
{
"name": "CVE-2026-42577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42577"
},
{
"name": "CVE-2026-58059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58059"
},
{
"name": "CVE-2026-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48978"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2026-75596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75596"
},
{
"name": "CVE-2026-8484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8484"
},
{
"name": "CVE-2026-8763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8763"
},
{
"name": "CVE-2026-6051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6051"
},
{
"name": "CVE-2026-44598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44598"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2025-14917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14917"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2026-15325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15325"
},
{
"name": "CVE-2021-47073",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47073"
},
{
"name": "CVE-2026-69247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69247"
},
{
"name": "CVE-2026-49268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49268"
},
{
"name": "CVE-2024-36124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36124"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2026-33671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33671"
},
{
"name": "CVE-2026-14976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14976"
},
{
"name": "CVE-2026-5598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5598"
},
{
"name": "CVE-2025-68470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68470"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2026-65182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65182"
},
{
"name": "CVE-2018-11087",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11087"
},
{
"name": "CVE-2026-42033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42033"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2026-42035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42035"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2026-18446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18446"
},
{
"name": "CVE-2026-44495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44495"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2026-41695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41695"
},
{
"name": "CVE-2024-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23454"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2026-22740",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22740"
},
{
"name": "CVE-2026-47890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47890"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2022-3510",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3510"
},
{
"name": "CVE-2026-59903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59903"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2022-3509",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3509"
},
{
"name": "CVE-2026-14684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14684"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2026-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56746"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2021-37137",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37137"
},
{
"name": "CVE-2026-10842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10842"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2023-51074",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51074"
},
{
"name": "CVE-2024-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53122"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2026-9496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9496"
},
{
"name": "CVE-2026-34478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34478"
},
{
"name": "CVE-2026-42586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42586"
},
{
"name": "CVE-2026-35091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35091"
},
{
"name": "CVE-2024-57807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57807"
},
{
"name": "CVE-2025-30474",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30474"
},
{
"name": "CVE-2024-41008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41008"
},
{
"name": "CVE-2026-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40984"
},
{
"name": "CVE-2021-41973",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41973"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2024-8184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8184"
},
{
"name": "CVE-2026-54428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54428"
},
{
"name": "CVE-2026-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50162"
},
{
"name": "CVE-2026-42043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42043"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2025-11143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11143"
},
{
"name": "CVE-2026-15055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15055"
},
{
"name": "CVE-2026-8646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8646"
},
{
"name": "CVE-2026-45822",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45822"
},
{
"name": "CVE-2025-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36006"
},
{
"name": "CVE-2026-40477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40477"
},
{
"name": "CVE-2023-35701",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35701"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2026-47834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47834"
},
{
"name": "CVE-2026-34480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34480"
},
{
"name": "CVE-2026-14682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14682"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2018-20677",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20677"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2026-84305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-84305"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2026-73180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73180"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2026-59869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59869"
},
{
"name": "CVE-2026-47887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47887"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2025-36186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36186"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2026-62243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-62243"
},
{
"name": "CVE-2023-22946",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22946"
},
{
"name": "CVE-2026-65904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65904"
},
{
"name": "CVE-2026-58061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58061"
},
{
"name": "CVE-2025-12758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12758"
},
{
"name": "CVE-2026-40175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40175"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2026-69151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69151"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2026-27970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27970"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2026-9320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9320"
},
{
"name": "CVE-2026-49459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49459"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2021-36090",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36090"
},
{
"name": "CVE-2021-27568",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27568"
},
{
"name": "CVE-2026-6053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6053"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-23953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23953"
},
{
"name": "CVE-2026-54265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54265"
},
{
"name": "CVE-2025-68161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68161"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2021-38296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38296"
},
{
"name": "CVE-2025-21785",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21785"
},
{
"name": "CVE-2022-24823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24823"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-26649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26649"
},
{
"name": "CVE-2026-56624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56624"
},
{
"name": "CVE-2023-34455",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34455"
},
{
"name": "CVE-2021-41184",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41184"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-29131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29131"
},
{
"name": "CVE-2021-41183",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41183"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-29869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29869"
},
{
"name": "CVE-2026-41240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41240"
},
{
"name": "CVE-2026-67317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67317"
},
{
"name": "CVE-2026-40478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40478"
},
{
"name": "CVE-2026-22748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22748"
},
{
"name": "CVE-2025-33012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33012"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2026-34479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34479"
},
{
"name": "CVE-2024-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52804"
},
{
"name": "CVE-2026-43828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43828"
},
{
"name": "CVE-2026-42040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42040"
},
{
"name": "CVE-2023-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36478"
},
{
"name": "CVE-2021-37136",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37136"
},
{
"name": "CVE-2018-1330",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1330"
},
{
"name": "CVE-2026-47027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47027"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2026-47058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47058"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2026-16441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16441"
},
{
"name": "CVE-2024-6763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6763"
},
{
"name": "CVE-2026-6052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6052"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2026-14981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14981"
},
{
"name": "CVE-2026-58060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58060"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2021-21295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21295"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2026-42778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42778"
},
{
"name": "CVE-2026-14683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14683"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2026-14529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14529"
},
{
"name": "CVE-2019-0204",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0204"
},
{
"name": "CVE-2024-26851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26851"
},
{
"name": "CVE-2022-2047",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2047"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2018-11793",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11793"
},
{
"name": "CVE-2026-22741",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22741"
},
{
"name": "CVE-2023-39410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39410"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-25710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25710"
},
{
"name": "CVE-2026-12802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12802"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-7254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7254"
},
{
"name": "CVE-2024-46695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46695"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2020-9492",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9492"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2026-40181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40181"
},
{
"name": "CVE-2023-52700",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52700"
},
{
"name": "CVE-2025-14923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14923"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2026-10649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10649"
},
{
"name": "CVE-2026-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50020"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-29133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29133"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2026-54512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54512"
},
{
"name": "CVE-2026-58063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58063"
},
{
"name": "CVE-2026-57819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-57819"
},
{
"name": "CVE-2026-42578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42578"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2024-35910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35910"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2026-65899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65899"
},
{
"name": "CVE-2026-43514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43514"
},
{
"name": "CVE-2026-45773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45773"
},
{
"name": "CVE-2026-67319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67319"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2026-10532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10532"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2022-24785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24785"
},
{
"name": "CVE-2025-2518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2518"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46120"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-57979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57979"
},
{
"name": "CVE-2024-52046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52046"
},
{
"name": "CVE-2021-43797",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43797"
},
{
"name": "CVE-2026-70907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-70907"
},
{
"name": "CVE-2026-48589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48589"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2021-37404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37404"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2026-42404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42404"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2022-45787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45787"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2018-1199",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1199"
},
{
"name": "CVE-2024-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-14041"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2026-41586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41586"
},
{
"name": "CVE-2026-16192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16192"
},
{
"name": "CVE-2024-5569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5569"
},
{
"name": "CVE-2026-2950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2950"
},
{
"name": "CVE-2016-6811",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-6811"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2026-68945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68945"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2023-44981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44981"
},
{
"name": "CVE-2026-40895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40895"
},
{
"name": "CVE-2026-47063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47063"
},
{
"name": "CVE-2025-1493",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1493"
},
{
"name": "CVE-2026-12816",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12816"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2026-59083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59083"
},
{
"name": "CVE-2025-27553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27553"
},
{
"name": "CVE-2024-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47535"
},
{
"name": "CVE-2026-45772",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45772"
},
{
"name": "CVE-2023-52428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52428"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2026-41606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41606"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2026-59888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59888"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2026-10543",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10543"
},
{
"name": "CVE-2023-6040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6040"
},
{
"name": "CVE-2026-13149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13149"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2026-47021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47021"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-6485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6485"
},
{
"name": "CVE-2026-47842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47842"
},
{
"name": "CVE-2025-3050",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3050"
},
{
"name": "CVE-2023-40167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40167"
},
{
"name": "CVE-2018-1274",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1274"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2026-59898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59898"
},
{
"name": "CVE-2026-16440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16440"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2026-64958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64958"
},
{
"name": "CVE-2024-9823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9823"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2026-66422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66422"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2021-22569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22569"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-41762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41762"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2023-6378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6378"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2026-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41006"
},
{
"name": "CVE-2026-41711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41711"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2026-45205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45205"
},
{
"name": "CVE-2026-27830",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27830"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47018",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47018"
},
{
"name": "CVE-2026-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44487"
},
{
"name": "CVE-2026-13506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13506"
},
{
"name": "CVE-2024-26640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26640"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2026-2482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2482"
},
{
"name": "CVE-2026-11897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11897"
},
{
"name": "CVE-2026-35092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35092"
},
{
"name": "CVE-2026-42038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42038"
},
{
"name": "CVE-2026-49844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49844"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2021-46972",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46972"
},
{
"name": "CVE-2026-18096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18096"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2022-34169",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34169"
},
{
"name": "CVE-2026-2332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2332"
},
{
"name": "CVE-2026-1561",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1561"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2026-42039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42039"
},
{
"name": "CVE-2026-59879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59879"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2026-46968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46968"
},
{
"name": "CVE-2026-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40972"
},
{
"name": "CVE-2024-43892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43892"
},
{
"name": "CVE-2026-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50010"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2023-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36479"
},
{
"name": "CVE-2024-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50256"
},
{
"name": "CVE-2026-59296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59296"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2026-33672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33672"
},
{
"name": "CVE-2026-75838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75838"
},
{
"name": "CVE-2018-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14041"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2026-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40983"
},
{
"name": "CVE-2024-24549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24549"
},
{
"name": "CVE-2026-42581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42581"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2025-0915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0915"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-29267",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29267"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2026-42779",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42779"
},
{
"name": "CVE-2021-47097",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47097"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2026-43513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43513"
},
{
"name": "CVE-2023-28370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28370"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2026-54517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54517"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26843"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2026-25639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25639"
},
{
"name": "CVE-2026-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40973"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2020-11022",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11022"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2026-15064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15064"
},
{
"name": "CVE-2026-42044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42044"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2021-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31684"
},
{
"name": "CVE-2025-25193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25193"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2026-8620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8620"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2026-65905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65905"
},
{
"name": "CVE-2026-16439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16439"
},
{
"name": "CVE-2025-14915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14915"
},
{
"name": "CVE-2026-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56745"
},
{
"name": "CVE-2018-16487",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-16487"
},
{
"name": "CVE-2026-8633",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8633"
},
{
"name": "CVE-2022-31159",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31159"
},
{
"name": "CVE-2026-11714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11714"
},
{
"name": "CVE-2016-10735",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-10735"
},
{
"name": "CVE-2024-52903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52903"
},
{
"name": "CVE-2026-47838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47838"
},
{
"name": "CVE-2021-42550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42550"
},
{
"name": "CVE-2017-18214",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-18214"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2026-59642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59642"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2024-40679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40679"
},
{
"name": "CVE-2026-42034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42034"
},
{
"name": "CVE-2026-47884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47884"
},
{
"name": "CVE-2026-41417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41417"
},
{
"name": "CVE-2026-61308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-61308"
},
{
"name": "CVE-2025-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23215"
},
{
"name": "CVE-2026-48043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48043"
},
{
"name": "CVE-2026-9322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9322"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2026-87958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-87958"
},
{
"name": "CVE-2026-22745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22745"
},
{
"name": "CVE-2024-30171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30171"
},
{
"name": "CVE-2026-42587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42587"
},
{
"name": "CVE-2026-54513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54513"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2025-14914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14914"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2023-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52922"
},
{
"name": "CVE-2026-65927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65927"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2026-9563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9563"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2026-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54518"
},
{
"name": "CVE-2020-9480",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9480"
},
{
"name": "CVE-2024-36114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36114"
},
{
"name": "CVE-2026-47244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47244"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2026-13676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13676"
},
{
"name": "CVE-2024-26759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26759"
},
{
"name": "CVE-2026-54297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54297"
},
{
"name": "CVE-2026-53434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53434"
},
{
"name": "CVE-2011-4969",
"url": "https://www.cve.org/CVERecord?id=CVE-2011-4969"
},
{
"name": "CVE-2026-60589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60589"
},
{
"name": "CVE-2026-67312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67312"
},
{
"name": "CVE-2026-6938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6938"
},
{
"name": "CVE-2025-8916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8916"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2026-66142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66142"
},
{
"name": "CVE-2025-8885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8885"
},
{
"name": "CVE-2023-52464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52464"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2026-10051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10051"
},
{
"name": "CVE-2026-53669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53669"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2026-41409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41409"
},
{
"name": "CVE-2018-1259",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1259"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2026-6322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6322"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2026-8400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8400"
},
{
"name": "CVE-2026-45623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45623"
},
{
"name": "CVE-2026-14980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14980"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2023-24998",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24998"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2026-58062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58062"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2026-12143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12143"
},
{
"name": "CVE-2026-67318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67318"
},
{
"name": "CVE-2026-59893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59893"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2021-21290",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21290"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2023-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52560"
},
{
"name": "CVE-2026-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50151"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2026-44486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44486"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2026-42264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42264"
},
{
"name": "CVE-2026-12803",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12803"
},
{
"name": "CVE-2021-47069",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47069"
},
{
"name": "CVE-2026-8384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8384"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2023-2976",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2976"
},
{
"name": "CVE-2026-59650",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59650"
},
{
"name": "CVE-2025-1000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1000"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2026-44496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44496"
},
{
"name": "CVE-2018-8023",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8023"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2026-44492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44492"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2026-54225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54225"
},
{
"name": "CVE-2026-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-39865"
},
{
"name": "CVE-2026-41238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41238"
},
{
"name": "CVE-2026-47877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47877"
},
{
"name": "CVE-2023-52522",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52522"
},
{
"name": "CVE-2026-43512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43512"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2020-26555",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26555"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2021-22570",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22570"
},
{
"name": "CVE-2026-47883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47883"
},
{
"name": "CVE-2021-35515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35515"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2026-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41007"
},
{
"name": "CVE-2026-42037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42037"
},
{
"name": "CVE-2022-40898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40898"
},
{
"name": "CVE-2024-42265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42265"
},
{
"name": "CVE-2021-46984",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46984"
},
{
"name": "CVE-2026-55760",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55760"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-26048",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26048"
},
{
"name": "CVE-2026-42498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42498"
},
{
"name": "CVE-2026-42042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42042"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2026-9071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9071"
},
{
"name": "CVE-2017-7669",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7669"
},
{
"name": "CVE-2026-67213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67213"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2026-55833",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55833"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2024-45663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45663"
},
{
"name": "CVE-2026-13586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13586"
},
{
"name": "CVE-2025-33134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33134"
},
{
"name": "CVE-2021-47101",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47101"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2023-26112",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26112"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2026-9370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9370"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2023-52626",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52626"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2026-11806",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11806"
},
{
"name": "CVE-2023-52476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52476"
},
{
"name": "CVE-2024-42301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42301"
},
{
"name": "CVE-2026-12590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12590"
},
{
"name": "CVE-2026-34477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34477"
},
{
"name": "CVE-2026-65902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65902"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2026-56819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56819"
},
{
"name": "CVE-2026-54284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54284"
},
{
"name": "CVE-2026-6321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6321"
},
{
"name": "CVE-2022-3171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3171"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2026-44490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44490"
},
{
"name": "CVE-2016-7103",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-7103"
},
{
"name": "CVE-2015-9251",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-9251"
},
{
"name": "CVE-2026-59639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59639"
},
{
"name": "CVE-2026-86093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-86093"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2026-10852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10852"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2026-28338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28338"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2010-5312",
"url": "https://www.cve.org/CVERecord?id=CVE-2010-5312"
},
{
"name": "CVE-2026-68494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68494"
},
{
"name": "CVE-2024-26810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26810"
},
{
"name": "CVE-2023-52530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52530"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2012-6708",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-6708"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2020-7656",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-7656"
},
{
"name": "CVE-2018-8013",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8013"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2026-29063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-29063"
},
{
"name": "CVE-2026-60147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60147"
},
{
"name": "CVE-2026-47889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47889"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2019-16869",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-16869"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2026-15280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15280"
},
{
"name": "CVE-2026-67316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67316"
},
{
"name": "CVE-2025-14813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14813"
},
{
"name": "CVE-2022-41881",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41881"
},
{
"name": "CVE-2025-13465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13465"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2026-44488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44488"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2026-59899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59899"
},
{
"name": "CVE-2026-1718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1718"
},
{
"name": "CVE-2026-71491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71491"
},
{
"name": "CVE-2026-34481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34481"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2021-47257",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47257"
},
{
"name": "CVE-2026-38969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-38969"
},
{
"name": "CVE-2026-19880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-19880"
},
{
"name": "CVE-2024-46858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46858"
},
{
"name": "CVE-2026-47059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47059"
},
{
"name": "CVE-2022-25168",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25168"
},
{
"name": "CVE-2026-41293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41293"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2026-77310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77310"
},
{
"name": "CVE-2024-57699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57699"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2026-65898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65898"
},
{
"name": "CVE-2020-11023",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11023"
},
{
"name": "CVE-2023-5090",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5090"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2021-46909",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46909"
},
{
"name": "CVE-2019-8331",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-8331"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2018-1000632",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1000632"
},
{
"name": "CVE-2019-20445",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20445"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2026-59889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59889"
},
{
"name": "CVE-2025-36185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36185"
},
{
"name": "CVE-2025-11226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11226"
}
],
"initial_release_date": "2026-09-11T00:00:00",
"last_revision_date": "2026-09-11T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1165",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-11T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Injection de code indirecte \u00e0 distance (XSS)"
},
{
"description": "Injection de requ\u00eates ill\u00e9gitimes par rebond (CSRF)"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Falsification de requ\u00eates c\u00f4t\u00e9 serveur (SSRF)"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits IBM. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits IBM",
"vendor_advisories": [
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286777",
"url": "https://www.ibm.com/support/pages/node/7286777"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286776",
"url": "https://www.ibm.com/support/pages/node/7286776"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286990",
"url": "https://www.ibm.com/support/pages/node/7286990"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286976",
"url": "https://www.ibm.com/support/pages/node/7286976"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286993",
"url": "https://www.ibm.com/support/pages/node/7286993"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286782",
"url": "https://www.ibm.com/support/pages/node/7286782"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286515",
"url": "https://www.ibm.com/support/pages/node/7286515"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286646",
"url": "https://www.ibm.com/support/pages/node/7286646"
},
{
"published_at": "2026-09-11",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7287136",
"url": "https://www.ibm.com/support/pages/node/7287136"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286986",
"url": "https://www.ibm.com/support/pages/node/7286986"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286982",
"url": "https://www.ibm.com/support/pages/node/7286982"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286775",
"url": "https://www.ibm.com/support/pages/node/7286775"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286987",
"url": "https://www.ibm.com/support/pages/node/7286987"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286910",
"url": "https://www.ibm.com/support/pages/node/7286910"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286516",
"url": "https://www.ibm.com/support/pages/node/7286516"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286909",
"url": "https://www.ibm.com/support/pages/node/7286909"
}
]
}
FKIE_CVE-2023-52791
Vulnerability from fkie_nvd - Published: 2024-05-21 16:15 - Updated: 2026-06-17 06:43| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/i2c/i2c-core.h"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "25eb381a736e7ae39a4245ef5c96484eb1073809",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "25284c46b657f48c0f3880a2e0706c70d81182c0",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "f6237afabc349c1c7909db00e15d2816519e0d2b",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "185f3617adc8fe45e40489b458f03911f0dec46c",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "8c3fa52a46ff4d208cefb1a462ec94e0043a91e1",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "3473cf43b9068b9dfef2f545f833f33c6a544b91",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
},
{
"lessThan": "aa49c90894d06e18a1ee7c095edbd2f37c232d02",
"status": "affected",
"version": "bae1d3a05a8b99bd748168bbf8155a1d047c562e",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/i2c/i2c-core.h"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.2"
},
{
"lessThan": "5.2",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.262",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.202",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.140",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.5.*",
"status": "unaffected",
"version": "6.5.13",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.7",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F349BD5C-EF29-421C-8EFB-D6FC454DFA91",
"versionEndExcluding": "5.4.262",
"versionStartIncluding": "5.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "39D508B4-58C7-40C2-BE05-44E41110EB98",
"versionEndExcluding": "5.10.202",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "15D6C23C-78A3-40D2-B76B-4F1D9C2D95C0",
"versionEndExcluding": "5.15.140",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "8D7C884A-CAA2-4EA2-9FEB-5CE776D7B05F",
"versionEndExcluding": "6.1.64",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "674C4F82-C336-4B49-BF64-1DE422E889C4",
"versionEndExcluding": "6.5.13",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B58252FA-A49C-411F-9B28-DC5FE44BC5A0",
"versionEndExcluding": "6.6.3",
"versionStartIncluding": "6.6",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ni2c: core: Run atomic i2c xfer when !preemptible\n\nSince bae1d3a05a8b, i2c transfers are non-atomic if preemption is\ndisabled. However, non-atomic i2c transfers require preemption (e.g. in\nwait_for_completion() while waiting for the DMA).\n\npanic() calls preempt_disable_notrace() before calling\nemergency_restart(). Therefore, if an i2c device is used for the\nrestart, the xfer should be atomic. This avoids warnings like:\n\n[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0\n[ 12.676926] Voluntary context switch within RCU read-side critical section!\n...\n[ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114\n[ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70\n...\n[ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58\n[ 13.001050] machine_restart from panic+0x2a8/0x32c\n\nUse !preemptible() instead, which is basically the same check as\npre-v5.2."
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: i2c: core: ejecute atomic i2c xfer cuando !preemptible. Desde bae1d3a05a8b, las transferencias i2c no son at\u00f3micas si la preferencia est\u00e1 deshabilitada. Sin embargo, las transferencias i2c no at\u00f3micas requieren preferencia (por ejemplo, en wait_for_completion() mientras se espera el DMA). p\u00e1nico() llama a preempt_disable_notrace() antes de llamar a emergence_restart(). Por lo tanto, si se utiliza un dispositivo i2c para el reinicio, el xfer debe ser at\u00f3mico. Esto evita advertencias como: [12.667612] ADVERTENCIA: CPU: 1 PID: 1 en kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0 [12.676926] \u00a1Cambio de contexto voluntario dentro de la secci\u00f3n cr\u00edtica del lado de lectura de RCU! ... [12.742376] Schedule_timeout de wait_for_completion_timeout+0x90/0x114 [12.749179] wait_for_completion_timeout de tegra_i2c_wait_completion+0x40/0x70 ... [12.994527] atomic_notifier_call_chain de machine_restart+0x34/0x58 13.001050] machine_restart desde panic+0x2a8/0x32c Utilice !preemptible( ) en su lugar, que es b\u00e1sicamente la misma verificaci\u00f3n que la versi\u00f3n anterior a la v5.2."
}
],
"id": "CVE-2023-52791",
"lastModified": "2026-06-17T06:43:35.427",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-52791",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-17T17:36:52.732311Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-05-21T16:15:17.777",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/185f3617adc8fe45e40489b458f03911f0dec46c"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/25284c46b657f48c0f3880a2e0706c70d81182c0"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/25eb381a736e7ae39a4245ef5c96484eb1073809"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3473cf43b9068b9dfef2f545f833f33c6a544b91"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8c3fa52a46ff4d208cefb1a462ec94e0043a91e1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/aa49c90894d06e18a1ee7c095edbd2f37c232d02"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f6237afabc349c1c7909db00e15d2816519e0d2b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/185f3617adc8fe45e40489b458f03911f0dec46c"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/25284c46b657f48c0f3880a2e0706c70d81182c0"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/25eb381a736e7ae39a4245ef5c96484eb1073809"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3473cf43b9068b9dfef2f545f833f33c6a544b91"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8c3fa52a46ff4d208cefb1a462ec94e0043a91e1"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/aa49c90894d06e18a1ee7c095edbd2f37c232d02"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f6237afabc349c1c7909db00e15d2816519e0d2b"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-PCW4-494R-VQVF
Vulnerability from github – Published: 2024-05-21 18:31 – Updated: 2025-09-26 18:31In the Linux kernel, the following vulnerability has been resolved:
i2c: core: Run atomic i2c xfer when !preemptible
Since bae1d3a05a8b, i2c transfers are non-atomic if preemption is disabled. However, non-atomic i2c transfers require preemption (e.g. in wait_for_completion() while waiting for the DMA).
panic() calls preempt_disable_notrace() before calling emergency_restart(). Therefore, if an i2c device is used for the restart, the xfer should be atomic. This avoids warnings like:
[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0 [ 12.676926] Voluntary context switch within RCU read-side critical section! ... [ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114 [ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70 ... [ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58 [ 13.001050] machine_restart from panic+0x2a8/0x32c
Use !preemptible() instead, which is basically the same check as pre-v5.2.
{
"affected": [],
"aliases": [
"CVE-2023-52791"
],
"database_specific": {
"cwe_ids": [],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-05-21T16:15:17Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\ni2c: core: Run atomic i2c xfer when !preemptible\n\nSince bae1d3a05a8b, i2c transfers are non-atomic if preemption is\ndisabled. However, non-atomic i2c transfers require preemption (e.g. in\nwait_for_completion() while waiting for the DMA).\n\npanic() calls preempt_disable_notrace() before calling\nemergency_restart(). Therefore, if an i2c device is used for the\nrestart, the xfer should be atomic. This avoids warnings like:\n\n[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0\n[ 12.676926] Voluntary context switch within RCU read-side critical section!\n...\n[ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114\n[ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70\n...\n[ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58\n[ 13.001050] machine_restart from panic+0x2a8/0x32c\n\nUse !preemptible() instead, which is basically the same check as\npre-v5.2.",
"id": "GHSA-pcw4-494r-vqvf",
"modified": "2025-09-26T18:31:17Z",
"published": "2024-05-21T18:31:21Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52791"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/185f3617adc8fe45e40489b458f03911f0dec46c"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/25284c46b657f48c0f3880a2e0706c70d81182c0"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/25eb381a736e7ae39a4245ef5c96484eb1073809"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3473cf43b9068b9dfef2f545f833f33c6a544b91"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/8c3fa52a46ff4d208cefb1a462ec94e0043a91e1"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/aa49c90894d06e18a1ee7c095edbd2f37c232d02"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/f6237afabc349c1c7909db00e15d2816519e0d2b"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
ICSA-25-226-15
Vulnerability from csaf_cisa - Published: 2025-08-12 00:00 - Updated: 2026-02-25 07:00OESA-2024-1738 (CVE-2021-47366)
Vulnerability from osv_openeuler – Published: 2024-06-21 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
afs: Fix corruption in reads at fpos 2G-4G from an OpenAFS server
AFS-3 has two data fetch RPC variants, FS.FetchData and FS.FetchData64, and Linux's afs client switches between them when talking to a non-YFS server if the read size, the file position or the sum of the two have the upper 32 bits set of the 64-bit value.
This is a problem, however, since the file position and length fields of FS.FetchData are signed 32-bit values.
Fix this by capturing the capability bits obtained from the fileserver when it's sent an FS.GetCapabilities RPC, rather than just discarding them, and then picking out the VICED_CAPABILITY_64BITFILES flag. This can then be used to decide whether to use FS.FetchData or FS.FetchData64 - and also FS.StoreData or FS.StoreData64 - rather than using upper_32_bits() to switch on the parameter values.
This capabilities flag could also be used to limit the maximum size of the file, but all servers must be checked for that.
Note that the issue does not exist with FS.StoreData - that uses unsigned 32-bit values. It's also not a problem with Auristor servers as its YFS.FetchData64 op uses unsigned 64-bit values.
This can be tested by cloning a git repo through an OpenAFS client to an OpenAFS server and then doing "git status" on it from a Linux afs client1. Provided the clone has a pack file that's in the 2G-4G range, the git status will show errors like:
error: packfile .git/objects/pack/pack-5e813c51d12b6847bbc0fcd97c2bca66da50079c.pack does not match index
error: packfile .git/objects/pack/pack-5e813c51d12b6847bbc0fcd97c2bca66da50079c.pack does not match index
This can be observed in the server's FileLog with something like the following appearing:
Sun Aug 29 19:31:39 2021 SRXAFS_FetchData, Fid = 2303380852.491776.3263114, Host 192.168.11.201:7001, Id 1001 Sun Aug 29 19:31:39 2021 CheckRights: len=0, for host=192.168.11.201:7001 Sun Aug 29 19:31:39 2021 FetchData_RXStyle: Pos 18446744071815340032, Len 3154 Sun Aug 29 19:31:39 2021 FetchData_RXStyle: file size 2400758866 ... Sun Aug 29 19:31:40 2021 SRXAFS_FetchData returns 5
Note the file position of 18446744071815340032. This is the requested file position sign-extended.(CVE-2021-47366)
In the Linux kernel, the following vulnerability has been resolved:
net/smc: Fix possible access to freed memory in link clear
After modifying the QP to the Error state, all RX WR would be completed with WC in IB_WC_WR_FLUSH_ERR status. Current implementation does not wait for it is done, but destroy the QP and free the link group directly. So there is a risk that accessing the freed memory in tasklet context.
Here is a crash example:
BUG: unable to handle page fault for address: ffffffff8f220860 #PF: supervisor write access in kernel mode #PF: error_code(0x0002) - not-present page PGD f7300e067 P4D f7300e067 PUD f7300f063 PMD 8c4e45063 PTE 800ffff08c9df060 Oops: 0002 [#1] SMP PTI CPU: 1 PID: 0 Comm: swapper/1 Kdump: loaded Tainted: G S OE 5.10.0-0607+ #23 Hardware name: Inspur NF5280M4/YZMB-00689-101, BIOS 4.1.20 07/09/2018 RIP: 0010:native_queued_spin_lock_slowpath+0x176/0x1b0 Code: f3 90 48 8b 32 48 85 f6 74 f6 eb d5 c1 ee 12 83 e0 03 83 ee 01 48 c1 e0 05 48 63 f6 48 05 00 c8 02 00 48 03 04 f5 00 09 98 8e <48> 89 10 8b 42 08 85 c0 75 09 f3 90 8b 42 08 85 c0 74 f7 48 8b 32 RSP: 0018:ffffb3b6c001ebd8 EFLAGS: 00010086 RAX: ffffffff8f220860 RBX: 0000000000000246 RCX: 0000000000080000 RDX: ffff91db1f86c800 RSI: 000000000000173c RDI: ffff91db62bace00 RBP: ffff91db62bacc00 R08: 0000000000000000 R09: c00000010000028b R10: 0000000000055198 R11: ffffb3b6c001ea58 R12: ffff91db80e05010 R13: 000000000000000a R14: 0000000000000006 R15: 0000000000000040 FS: 0000000000000000(0000) GS:ffff91db1f840000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: ffffffff8f220860 CR3: 00000001f9580004 CR4: 00000000003706e0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <IRQ> _raw_spin_lock_irqsave+0x30/0x40 mlx5_ib_poll_cq+0x4c/0xc50 [mlx5_ib] smc_wr_rx_tasklet_fn+0x56/0xa0 [smc] tasklet_action_common.isra.21+0x66/0x100 __do_softirq+0xd5/0x29c asm_call_irq_on_stack+0x12/0x20 </IRQ> do_softirq_own_stack+0x37/0x40 irq_exit_rcu+0x9d/0xa0 sysvec_call_function_single+0x34/0x80 asm_sysvec_call_function_single+0x12/0x20(CVE-2022-48673)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/srp: Set scmnd->result only when scmnd is not NULL
This change fixes the following kernel NULL pointer dereference which is reproduced by blktests srp/007 occasionally.
BUG: kernel NULL pointer dereference, address: 0000000000000170 PGD 0 P4D 0 Oops: 0002 [#1] PREEMPT SMP NOPTI CPU: 0 PID: 9 Comm: kworker/0:1H Kdump: loaded Not tainted 6.0.0-rc1+ #37 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.15.0-29-g6a62e0cb0dfe-prebuilt.qemu.org 04/01/2014 Workqueue: 0x0 (kblockd) RIP: 0010:srp_recv_done+0x176/0x500 [ib_srp] Code: 00 4d 85 ff 0f 84 52 02 00 00 48 c7 82 80 02 00 00 00 00 00 00 4c 89 df 4c 89 14 24 e8 53 d3 4a f6 4c 8b 14 24 41 0f b6 42 13 <41> 89 87 70 01 00 00 41 0f b6 52 12 f6 c2 02 74 44 41 8b 42 1c b9 RSP: 0018:ffffaef7c0003e28 EFLAGS: 00000282 RAX: 0000000000000000 RBX: ffff9bc9486dea60 RCX: 0000000000000000 RDX: 0000000000000102 RSI: ffffffffb76bbd0e RDI: 00000000ffffffff RBP: ffff9bc980099a00 R08: 0000000000000001 R09: 0000000000000001 R10: ffff9bca53ef0000 R11: ffff9bc980099a10 R12: ffff9bc956e14000 R13: ffff9bc9836b9cb0 R14: ffff9bc9557b4480 R15: 0000000000000000 FS: 0000000000000000(0000) GS:ffff9bc97ec00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000000000170 CR3: 0000000007e04000 CR4: 00000000000006f0 Call Trace: <IRQ> __ib_process_cq+0xb7/0x280 [ib_core] ib_poll_handler+0x2b/0x130 [ib_core] irq_poll_softirq+0x93/0x150 __do_softirq+0xee/0x4b8 irq_exit_rcu+0xf7/0x130 sysvec_apic_timer_interrupt+0x8e/0xc0 </IRQ>(CVE-2022-48692)
In the Linux kernel, the following vulnerability has been resolved:
rpmsg: virtio: Free driver_override when rpmsg_remove()
Free driver_override when rpmsg_remove(), otherwise the following memory leak will occur:
unreferenced object 0xffff0000d55d7080 (size 128): comm "kworker/u8:2", pid 56, jiffies 4294893188 (age 214.272s) hex dump (first 32 bytes): 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........ 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................ backtrace: [<000000009c94c9c1>] __kmem_cache_alloc_node+0x1f8/0x320 [<000000002300d89b>] __kmalloc_node_track_caller+0x44/0x70 [<00000000228a60c3>] kstrndup+0x4c/0x90 [<0000000077158695>] driver_set_override+0xd0/0x164 [<000000003e9c4ea5>] rpmsg_register_device_override+0x98/0x170 [<000000001c0c89a8>] rpmsg_ns_register_device+0x24/0x30 [<000000008bbf8fa2>] rpmsg_probe+0x2e0/0x3ec [<00000000e65a68df>] virtio_dev_probe+0x1c0/0x280 [<00000000443331cc>] really_probe+0xbc/0x2dc [<00000000391064b1>] __driver_probe_device+0x78/0xe0 [<00000000a41c9a5b>] driver_probe_device+0xd8/0x160 [<000000009c3bd5df>] __device_attach_driver+0xb8/0x140 [<0000000043cd7614>] bus_for_each_drv+0x7c/0xd4 [<000000003b929a36>] __device_attach+0x9c/0x19c [<00000000a94e0ba8>] device_initial_probe+0x14/0x20 [<000000003c999637>] bus_probe_device+0xa0/0xac(CVE-2023-52670)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: avoid format-overflow warning
With gcc and W=1 option, there's a warning like this:
fs/f2fs/compress.c: In function ‘f2fs_init_page_array_cache’: fs/f2fs/compress.c:1984:47: error: ‘%u’ directive writing between 1 and 7 bytes into a region of size between 5 and 8 [-Werror=format-overflow=] 1984 | sprintf(slab_name, "f2fs_page_array_entry-%u:%u", MAJOR(dev), MINOR(dev)); | ^~
String "f2fs_page_array_entry-%u:%u" can up to 35. The first "%u" can up to 4 and the second "%u" can up to 7, so total size is "24 + 4 + 7 = 35". slab_name's size should be 35 rather than 32.(CVE-2023-52748)
In the Linux kernel, the following vulnerability has been resolved:
i2c: core: Run atomic i2c xfer when !preemptible
Since bae1d3a05a8b, i2c transfers are non-atomic if preemption is disabled. However, non-atomic i2c transfers require preemption (e.g. in wait_for_completion() while waiting for the DMA).
panic() calls preempt_disable_notrace() before calling emergency_restart(). Therefore, if an i2c device is used for the restart, the xfer should be atomic. This avoids warnings like:
[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0 [ 12.676926] Voluntary context switch within RCU read-side critical section! ... [ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114 [ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70 ... [ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58 [ 13.001050] machine_restart from panic+0x2a8/0x32c
Use !preemptible() instead, which is basically the same check as pre-v5.2.(CVE-2023-52791)
In the Linux kernel, the following vulnerability has been resolved:
drm/panel: fix a possible null pointer dereference
In versatile_panel_get_modes(), the return value of drm_mode_duplicate() is assigned to mode, which will lead to a NULL pointer dereference on failure of drm_mode_duplicate(). Add a check to avoid npd.(CVE-2023-52821)
In the Linux kernel, the following vulnerability has been resolved:
media: vidtv: mux: Add check and kfree for kstrdup
Add check for the return value of kstrdup() and return the error if it fails in order to avoid NULL pointer dereference. Moreover, use kfree() in the later error handling in order to avoid memory leak.(CVE-2023-52841)
In the Linux kernel, the following vulnerability has been resolved:
clk: mediatek: clk-mt6779: Add check for mtk_alloc_clk_data
Add the check for the return value of mtk_alloc_clk_data() in order to avoid NULL pointer dereference.(CVE-2023-52873)
In the Linux kernel, the following vulnerability has been resolved:
clk: sunxi-ng: h6: Reparent CPUX during PLL CPUX rate change
While PLL CPUX clock rate change when CPU is running from it works in vast majority of cases, now and then it causes instability. This leads to system crashes and other undefined behaviour. After a lot of testing (30+ hours) while also doing a lot of frequency switches, we can't observe any instability issues anymore when doing reparenting to stable clock like 24 MHz oscillator.(CVE-2023-52882)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nft_set_pipapo: do not free live element
Pablo reports a crash with large batches of elements with a back-to-back add/remove pattern. Quoting Pablo:
add_elem("00000000") timeout 100 ms ... add_elem("0000000X") timeout 100 ms del_elem("0000000X") <---------------- delete one that was just added ... add_elem("00005000") timeout 100 ms
1) nft_pipapo_remove() removes element 0000000X Then, KASAN shows a splat.
Looking at the remove function there is a chance that we will drop a rule that maps to a non-deactivated element.
Removal happens in two steps, first we do a lookup for key k and return the to-be-removed element and mark it as inactive in the next generation. Then, in a second step, the element gets removed from the set/map.
The _remove function does not work correctly if we have more than one element that share the same key.
This can happen if we insert an element into a set when the set already holds an element with same key, but the element mapping to the existing key has timed out or is not active in the next generation.
In such case its possible that removal will unmap the wrong element. If this happens, we will leak the non-deactivated element, it becomes unreachable.
The element that got deactivated (and will be freed later) will remain reachable in the set data structure, this can result in a crash when such an element is retrieved during lookup (stale pointer).
Add a check that the fully matching key does in fact map to the element that we have marked as inactive in the deactivation step. If not, we need to continue searching.
Add a bug/warn trap at the end of the function as well, the remove function must not ever be called with an invisible/unreachable/non-existent element.
v2: avoid uneeded temporary variable (Stefano)(CVE-2024-26924)
In the Linux kernel, the following vulnerability has been resolved:
scsi: core: Fix unremoved procfs host directory regression
Commit fc663711b944 ("scsi: core: Remove the /proc/scsi/${proc_name} directory earlier") fixed a bug related to modules loading/unloading, by adding a call to scsi_proc_hostdir_rm() on scsi_remove_host(). But that led to a potential duplicate call to the hostdir_rm() routine, since it's also called from scsi_host_dev_release(). That triggered a regression report, which was then fixed by commit be03df3d4bfe ("scsi: core: Fix a procfs host directory removal regression"). The fix just dropped the hostdir_rm() call from dev_release().
But it happens that this proc directory is created on scsi_host_alloc(), and that function "pairs" with scsi_host_dev_release(), while scsi_remove_host() pairs with scsi_add_host(). In other words, it seems the reason for removing the proc directory on dev_release() was meant to cover cases in which a SCSI host structure was allocated, but the call to scsi_add_host() didn't happen. And that pattern happens to exist in some error paths, for example.
Syzkaller causes that by using USB raw gadget device, error'ing on usb-storage driver, at usb_stor_probe2(). By checking that path, we can see that the BadDevice label leads to a scsi_host_put() after a SCSI host allocation, but there's no call to scsi_add_host() in such path. That leads to messages like this in dmesg (and a leak of the SCSI host proc structure):
usb-storage 4-1:87.51: USB Mass Storage device detected proc_dir_entry 'scsi/usb-storage' already registered WARNING: CPU: 1 PID: 3519 at fs/proc/generic.c:377 proc_register+0x347/0x4e0 fs/proc/generic.c:376
The proper fix seems to still call scsi_proc_hostdir_rm() on dev_release(), but guard that with the state check for SHOST_CREATED; there is even a comment in scsi_host_dev_release() detailing that: such conditional is meant for cases where the SCSI host was allocated but there was no calls to {add,remove}_host(), like the usb-storage case.
This is what we propose here and with that, the error path of usb-storage does not trigger the warning anymore.(CVE-2024-26935)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: validate request buffer size in smb2_allocate_rsp_buf()
The response buffer should be allocated in smb2_allocate_rsp_buf before validating request. But the fields in payload as well as smb2 header is used in smb2_allocate_rsp_buf(). This patch add simple buffer size validation to avoid potencial out-of-bounds in request buffer.(CVE-2024-26936)
In the Linux kernel, the following vulnerability has been resolved:
ARM: 9359/1: flush: check if the folio is reserved for no-mapping addresses
Since commit a4d5613c4dc6 ("arm: extend pfn_valid to take into account freed memory map alignment") changes the semantics of pfn_valid() to check presence of the memory map for a PFN. A valid page for an address which is reserved but not mapped by the kernel1, the system crashed during some uio test with the following memory layout:
node 0: [mem 0x00000000c0a00000-0x00000000cc8fffff] node 0: [mem 0x00000000d0000000-0x00000000da1fffff] the uio layout is:0xc0900000, 0x100000
the crash backtrace like:
Unable to handle kernel paging request at virtual address bff00000 [...] CPU: 1 PID: 465 Comm: startapp.bin Tainted: G O 5.10.0 #1 Hardware name: Generic DT based system PC is at b15_flush_kern_dcache_area+0x24/0x3c LR is at __sync_icache_dcache+0x6c/0x98 [...] (b15_flush_kern_dcache_area) from (__sync_icache_dcache+0x6c/0x98) (__sync_icache_dcache) from (set_pte_at+0x28/0x54) (set_pte_at) from (remap_pfn_range+0x1a0/0x274) (remap_pfn_range) from (uio_mmap+0x184/0x1b8 [uio]) (uio_mmap [uio]) from (__mmap_region+0x264/0x5f4) (__mmap_region) from (__do_mmap_mm+0x3ec/0x440) (__do_mmap_mm) from (do_mmap+0x50/0x58) (do_mmap) from (vm_mmap_pgoff+0xfc/0x188) (vm_mmap_pgoff) from (ksys_mmap_pgoff+0xac/0xc4) (ksys_mmap_pgoff) from (ret_fast_syscall+0x0/0x5c) Code: e0801001 e2423001 e1c00003 f57ff04f (ee070f3e) ---[ end trace 09cf0734c3805d52 ]--- Kernel panic - not syncing: Fatal exception
So check if PG_reserved was set to solve this issue.
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: fix slab-out-of-bounds in smb_strndup_from_utf16()
If ->NameOffset of smb2_create_req is smaller than Buffer offset of smb2_create_req, slab-out-of-bounds read can happen from smb2_open. This patch set the minimum value of the name offset to the buffer offset to validate name length of smb2_create_req().(CVE-2024-26954)
In the Linux kernel, the following vulnerability has been resolved:
mm: swap: fix race between free_swap_and_cache() and swapoff()
There was previously a theoretical window where swapoff() could run and teardown a swap_info_struct while a call to free_swap_and_cache() was running in another thread. This could cause, amongst other bad possibilities, swap_page_trans_huge_swapped() (called by free_swap_and_cache()) to access the freed memory for swap_map.
This is a theoretical problem and I haven't been able to provoke it from a test case. But there has been agreement based on code review that this is possible (see link below).
Fix it by using get_swap_device()/put_swap_device(), which will stall swapoff(). There was an extra check in _swap_info_get() to confirm that the swap entry was not free. This isn't present in get_swap_device() because it doesn't make sense in general due to the race between getting the reference and swapoff. So I've added an equivalent check directly in free_swap_and_cache().
Details of how to provoke one possible issue (thanks to David Hildenbrand for deriving this):
--8<-----
__swap_entry_free() might be the last user and result in "count == SWAP_HAS_CACHE".
swapoff->try_to_unuse() will stop as soon as soon as si->inuse_pages==0.
So the question is: could someone reclaim the folio and turn si->inuse_pages==0, before we completed swap_page_trans_huge_swapped().
Imagine the following: 2 MiB folio in the swapcache. Only 2 subpages are still references by swap entries.
Process 1 still references subpage 0 via swap entry. Process 2 still references subpage 1 via swap entry.
Process 1 quits. Calls free_swap_and_cache(). -> count == SWAP_HAS_CACHE [then, preempted in the hypervisor etc.]
Process 2 quits. Calls free_swap_and_cache(). -> count == SWAP_HAS_CACHE
Process 2 goes ahead, passes swap_page_trans_huge_swapped(), and calls __try_to_reclaim_swap().
__try_to_reclaim_swap()->folio_free_swap()->delete_from_swap_cache()-> put_swap_folio()->free_swap_slot()->swapcache_free_entries()-> swap_entry_free()->swap_range_free()-> ... WRITE_ONCE(si->inuse_pages, si->inuse_pages - nr_entries);
What stops swapoff to succeed after process 2 reclaimed the swap cache but before process1 finished its call to swap_page_trans_huge_swapped()?
--8<-----(CVE-2024-26960)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: Prevent deadlock while disabling aRFS
When disabling aRFS under the priv->state_lock, any scheduled
aRFS works are canceled using the cancel_work_sync function,
which waits for the work to end if it has already started.
However, while waiting for the work handler, the handler will
try to acquire the state_lock which is already acquired.
The worker acquires the lock to delete the rules if the state is down, which is not the worker's responsibility since disabling aRFS deletes the rules.
Add an aRFS state variable, which indicates whether the aRFS is enabled and prevent adding rules when the aRFS is disabled.
Kernel log:
====================================================== WARNING: possible circular locking dependency detected 6.7.0-rc4_net_next_mlx5_5483eb2 #1 Tainted: G I
ethtool/386089 is trying to acquire lock: ffff88810f21ce68 ((work_completion)(&rule->arfs_work)){+.+.}-{0:0}, at: __flush_work+0x74/0x4e0
but task is already holding lock: ffff8884a1808cc0 (&priv->state_lock){+.+.}-{3:3}, at: mlx5e_ethtool_set_channels+0x53/0x200 [mlx5_core]
which lock already depends on the new lock.
the existing dependency chain (in reverse order) is:
-> #1 (&priv->state_lock){+.+.}-{3:3}: __mutex_lock+0x80/0xc90 arfs_handle_work+0x4b/0x3b0 [mlx5_core] process_one_work+0x1dc/0x4a0 worker_thread+0x1bf/0x3c0 kthread+0xd7/0x100 ret_from_fork+0x2d/0x50 ret_from_fork_asm+0x11/0x20
-> #0 ((work_completion)(&rule->arfs_work)){+.+.}-{0:0}: __lock_acquire+0x17b4/0x2c80 lock_acquire+0xd0/0x2b0 __flush_work+0x7a/0x4e0 __cancel_work_timer+0x131/0x1c0 arfs_del_rules+0x143/0x1e0 [mlx5_core] mlx5e_arfs_disable+0x1b/0x30 [mlx5_core] mlx5e_ethtool_set_channels+0xcb/0x200 [mlx5_core] ethnl_set_channels+0x28f/0x3b0 ethnl_default_set_doit+0xec/0x240 genl_family_rcv_msg_doit+0xd0/0x120 genl_rcv_msg+0x188/0x2c0 netlink_rcv_skb+0x54/0x100 genl_rcv+0x24/0x40 netlink_unicast+0x1a1/0x270 netlink_sendmsg+0x214/0x460 __sock_sendmsg+0x38/0x60 __sys_sendto+0x113/0x170 __x64_sys_sendto+0x20/0x30 do_syscall_64+0x40/0xe0 entry_SYSCALL_64_after_hwframe+0x46/0x4e
other info that might help us debug this:
Possible unsafe locking scenario:
CPU0 CPU1
---- ----
lock(&priv->state_lock); lock((work_completion)(&rule->arfs_work)); lock(&priv->state_lock); lock((work_completion)(&rule->arfs_work));
*** DEADLOCK ***
3 locks held by ethtool/386089: #0: ffffffff82ea7210 (cb_lock){++++}-{3:3}, at: genl_rcv+0x15/0x40 #1: ffffffff82e94c88 (rtnl_mutex){+.+.}-{3:3}, at: ethnl_default_set_doit+0xd3/0x240 #2: ffff8884a1808cc0 (&priv->state_lock){+.+.}-{3:3}, at: mlx5e_ethtool_set_channels+0x53/0x200 [mlx5_core]
stack backtrace: CPU: 15 PID: 386089 Comm: ethtool Tainted: G I 6.7.0-rc4_net_next_mlx5_5483eb2 #1 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014 Call Trace: <TASK> dump_stack_lvl+0x60/0xa0 check_noncircular+0x144/0x160 __lock_acquire+0x17b4/0x2c80 lock_acquire+0xd0/0x2b0 ? __flush_work+0x74/0x4e0 ? save_trace+0x3e/0x360 ? __flush_work+0x74/0x4e0 __flush_work+0x7a/0x4e0 ? __flush_work+0x74/0x4e0 ? __lock_acquire+0xa78/0x2c80 ? lock_acquire+0xd0/0x2b0 ? mark_held_locks+0x49/0x70 __cancel_work_timer+0x131/0x1c0 ? mark_held_locks+0x49/0x70 arfs_del_rules+0x143/0x1e0 [mlx5_core] mlx5e_arfs_disable+0x1b/0x30 [mlx5_core] mlx5e_ethtool_set_channels+0xcb/0x200 [mlx5_core] ethnl_set_channels+0x28f/0x3b0 ethnl_default_set_doit+0xec/0x240 genl_family_rcv_msg_doit+0xd0/0x120 genl_rcv_msg+0x188/0x2c0 ? ethn ---truncated---(CVE-2024-27014)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nft_set_pipapo: walk over current view on netlink dump
The generation mask can be updated while netlink dump is in progress. The pipapo set backend walk iterator cannot rely on it to infer what view of the datastructure is to be used. Add notation to specify if user wants to read/update the set.
Based on patch from Florian Westphal.(CVE-2024-27017)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_tables: Fix potential data-race in __nft_obj_type_get()
nft_unregister_obj() can concurrent with __nft_obj_type_get(), and there is not any protection when iterate over nf_tables_objects list in __nft_obj_type_get(). Therefore, there is potential data-race of nf_tables_objects list entry.
Use list_for_each_entry_rcu() to iterate over nf_tables_objects list in __nft_obj_type_get(), and use rcu_read_lock() in the caller nft_obj_type_get() to protect the entire type query process.(CVE-2024-27019)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix potential NULL pointer dereferences in 'dcn10_set_output_transfer_func()'
The 'stream' pointer is used in dcn10_set_output_transfer_func() before the check if 'stream' is NULL.
Fixes the below: drivers/gpu/drm/amd/amdgpu/../display/dc/hwss/dcn10/dcn10_hwseq.c:1892 dcn10_set_output_transfer_func() warn: variable dereferenced before check 'stream' (see line 1875)(CVE-2024-27044)
In the Linux kernel, the following vulnerability has been resolved:
net: ll_temac: platform_get_resource replaced by wrong function
The function platform_get_resource was replaced with devm_platform_ioremap_resource_byname and is called using 0 as name.
This eventually ends up in platform_get_resource_byname in the call stack, where it causes a null pointer in strcmp.
if (type == resource_type(r) && !strcmp(r->name, name))
It should have been replaced with devm_platform_ioremap_resource.(CVE-2024-35796)
In the Linux kernel, the following vulnerability has been resolved:
soc: fsl: qbman: Use raw spinlock for cgr_lock
smp_call_function always runs its callback in hard IRQ context, even on PREEMPT_RT, where spinlocks can sleep. So we need to use a raw spinlock for cgr_lock to ensure we aren't waiting on a sleeping task.
Although this bug has existed for a while, it was not apparent until commit ef2a8d5478b9 ("net: dpaa: Adjust queue depth on rate change") which invokes smp_call_function_single via qman_update_cgr_safe every time a link goes up or down.(CVE-2024-35819)
In the Linux kernel, the following vulnerability has been resolved:
ubifs: Set page uptodate in the correct place
Page cache reads are lockless, so setting the freshly allocated page uptodate before we've overwritten it with the data it's supposed to have in it will allow a simultaneous reader to see old data. Move the call to SetPageUptodate into ubifs_write_end(), which is after we copied the new data into the page.(CVE-2024-35821)
In the Linux kernel, the following vulnerability has been resolved:
wifi: libertas: fix some memleaks in lbs_allocate_cmd_buffer()
In the for statement of lbs_allocate_cmd_buffer(), if the allocation of cmdarray[i].cmdbuf fails, both cmdarray and cmdarray[i].cmdbuf needs to be freed. Otherwise, there will be memleaks in lbs_allocate_cmd_buffer().(CVE-2024-35828)
In the Linux kernel, the following vulnerability has been resolved:
smb: client: fix UAF in smb2_reconnect_server()
The UAF bug is due to smb2_reconnect_server() accessing a session that is already being teared down by another thread that is executing __cifs_put_smb_ses(). This can happen when (a) the client has connection to the server but no session or (b) another thread ends up setting @ses->ses_status again to something different than SES_EXITING.
To fix this, we need to make sure to unconditionally set @ses->ses_status to SES_EXITING and prevent any other threads from setting a new status while we're still tearing it down.
The following can be reproduced by adding some delay to right after the ipc is freed in __cifs_put_smb_ses() - which will give smb2_reconnect_server() worker a chance to run and then accessing @ses->ipc:
kinit ... mount.cifs //srv/share /mnt/1 -o sec=krb5,nohandlecache,echo_interval=10 [disconnect srv] ls /mnt/1 &>/dev/null sleep 30 kdestroy [reconnect srv] sleep 10 umount /mnt/1 ... CIFS: VFS: Verify user has a krb5 ticket and keyutils is installed CIFS: VFS: \srv Send error in SessSetup = -126 CIFS: VFS: Verify user has a krb5 ticket and keyutils is installed CIFS: VFS: \srv Send error in SessSetup = -126 general protection fault, probably for non-canonical address 0x6b6b6b6b6b6b6b6b: 0000 [#1] PREEMPT SMP NOPTI CPU: 3 PID: 50 Comm: kworker/3:1 Not tainted 6.9.0-rc2 #1 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-1.fc39 04/01/2014 Workqueue: cifsiod smb2_reconnect_server [cifs] RIP: 0010:__list_del_entry_valid_or_report+0x33/0xf0 Code: 4f 08 48 85 d2 74 42 48 85 c9 74 59 48 b8 00 01 00 00 00 00 ad de 48 39 c2 74 61 48 b8 22 01 00 00 00 00 74 69 <48> 8b 01 48 39 f8 75 7b 48 8b 72 08 48 39 c6 0f 85 88 00 00 00 b8 RSP: 0018:ffffc900001bfd70 EFLAGS: 00010a83 RAX: dead000000000122 RBX: ffff88810da53838 RCX: 6b6b6b6b6b6b6b6b RDX: 6b6b6b6b6b6b6b6b RSI: ffffffffc02f6878 RDI: ffff88810da53800 RBP: ffff88810da53800 R08: 0000000000000001 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000001 R12: ffff88810c064000 R13: 0000000000000001 R14: ffff88810c064000 R15: ffff8881039cc000 FS: 0000000000000000(0000) GS:ffff888157c00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007fe3728b1000 CR3: 000000010caa4000 CR4: 0000000000750ef0 PKRU: 55555554 Call Trace: <TASK> ? die_addr+0x36/0x90 ? exc_general_protection+0x1c1/0x3f0 ? asm_exc_general_protection+0x26/0x30 ? __list_del_entry_valid_or_report+0x33/0xf0 __cifs_put_smb_ses+0x1ae/0x500 [cifs] smb2_reconnect_server+0x4ed/0x710 [cifs] process_one_work+0x205/0x6b0 worker_thread+0x191/0x360 ? __pfx_worker_thread+0x10/0x10 kthread+0xe2/0x110 ? __pfx_kthread+0x10/0x10 ret_from_fork+0x34/0x50 ? __pfx_kthread+0x10/0x10 ret_from_fork_asm+0x1a/0x30 </TASK>(CVE-2024-35870)
In the Linux kernel, the following vulnerability has been resolved:
ax25: fix use-after-free bugs caused by ax25_ds_del_timer
When the ax25 device is detaching, the ax25_dev_device_down() calls ax25_ds_del_timer() to cleanup the slave_timer. When the timer handler is running, the ax25_ds_del_timer() that calls del_timer() in it will return directly. As a result, the use-after-free bugs could happen, one of the scenarios is shown below:
(Thread 1) | (Thread 2)
| ax25_ds_timeout()
ax25_dev_device_down() | ax25_ds_del_timer() | del_timer() | ax25_dev_put() //FREE | | ax25_dev-> //USE
In order to mitigate bugs, when the device is detaching, use timer_shutdown_sync() to stop the timer.(CVE-2024-35887)
In the Linux kernel, the following vulnerability has been resolved:
tcp: properly terminate timers for kernel sockets
We had various syzbot reports about tcp timers firing after the corresponding netns has been dismantled.
Fortunately Josef Bacik could trigger the issue more often, and could test a patch I wrote two years ago.
When TCP sockets are closed, we call inet_csk_clear_xmit_timers() to 'stop' the timers.
inet_csk_clear_xmit_timers() can be called from any context, including when socket lock is held. This is the reason it uses sk_stop_timer(), aka del_timer(). This means that ongoing timers might finish much later.
For user sockets, this is fine because each running timer holds a reference on the socket, and the user socket holds a reference on the netns.
For kernel sockets, we risk that the netns is freed before timer can complete, because kernel sockets do not hold reference on the netns.
This patch adds inet_csk_clear_xmit_timers_sync() function that using sk_stop_timer_sync() to make sure all timers are terminated before the kernel socket is released. Modules using kernel sockets close them in their netns exit() handler.
Also add sock_not_owned_by_me() helper to get LOCKDEP support : inet_csk_clear_xmit_timers_sync() must not be called while socket lock is held.
It is very possible we can revert in the future commit 3a58f13a881e ("net: rds: acquire refcount on TCP sockets") which attempted to solve the issue in rds only. (net/smc/af_smc.c and net/mptcp/subflow.c have similar code)
We probably can remove the check_net() tests from tcp_out_of_resources() and __tcp_close() in the future.(CVE-2024-35910)
In the Linux kernel, the following vulnerability has been resolved:
nfc: nci: Fix uninit-value in nci_dev_up and nci_ntf_packet
syzbot reported the following uninit-value access issue 1[2]:
nci_rx_work() parses and processes received packet. When the payload length is zero, each message type handler reads uninitialized payload and KMSAN detects this issue. The receipt of a packet with a zero-size payload is considered unexpected, and therefore, such packets should be silently discarded.
This patch resolved this issue by checking payload size before calling each message type handler codes.(CVE-2024-35915)
In the Linux kernel, the following vulnerability has been resolved:
drm/vc4: don't check if plane->state->fb == state->fb
Currently, when using non-blocking commits, we can see the following kernel warning:
[ 110.908514] ------------[ cut here ]------------ [ 110.908529] refcount_t: underflow; use-after-free. [ 110.908620] WARNING: CPU: 0 PID: 1866 at lib/refcount.c:87 refcount_dec_not_one+0xb8/0xc0 [ 110.908664] Modules linked in: rfcomm snd_seq_dummy snd_hrtimer snd_seq snd_seq_device cmac algif_hash aes_arm64 aes_generic algif_skcipher af_alg bnep hid_logitech_hidpp vc4 brcmfmac hci_uart btbcm brcmutil bluetooth snd_soc_hdmi_codec cfg80211 cec drm_display_helper drm_dma_helper drm_kms_helper snd_soc_core snd_compress snd_pcm_dmaengine fb_sys_fops sysimgblt syscopyarea sysfillrect raspberrypi_hwmon ecdh_generic ecc rfkill libaes i2c_bcm2835 binfmt_misc joydev snd_bcm2835(C) bcm2835_codec(C) bcm2835_isp(C) v4l2_mem2mem videobuf2_dma_contig snd_pcm bcm2835_v4l2(C) raspberrypi_gpiomem bcm2835_mmal_vchiq(C) videobuf2_v4l2 snd_timer videobuf2_vmalloc videobuf2_memops videobuf2_common snd videodev vc_sm_cma(C) mc hid_logitech_dj uio_pdrv_genirq uio i2c_dev drm fuse dm_mod drm_panel_orientation_quirks backlight ip_tables x_tables ipv6 [ 110.909086] CPU: 0 PID: 1866 Comm: kodi.bin Tainted: G C 6.1.66-v8+ #32 [ 110.909104] Hardware name: Raspberry Pi 3 Model B Rev 1.2 (DT) [ 110.909114] pstate: 60000005 (nZCv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--) [ 110.909132] pc : refcount_dec_not_one+0xb8/0xc0 [ 110.909152] lr : refcount_dec_not_one+0xb4/0xc0 [ 110.909170] sp : ffffffc00913b9c0 [ 110.909177] x29: ffffffc00913b9c0 x28: 000000556969bbb0 x27: 000000556990df60 [ 110.909205] x26: 0000000000000002 x25: 0000000000000004 x24: ffffff8004448480 [ 110.909230] x23: ffffff800570b500 x22: ffffff802e03a7bc x21: ffffffecfca68c78 [ 110.909257] x20: ffffff8002b42000 x19: ffffff802e03a600 x18: 0000000000000000 [ 110.909283] x17: 0000000000000011 x16: ffffffffffffffff x15: 0000000000000004 [ 110.909308] x14: 0000000000000fff x13: ffffffed577e47e0 x12: 0000000000000003 [ 110.909333] x11: 0000000000000000 x10: 0000000000000027 x9 : c912d0d083728c00 [ 110.909359] x8 : c912d0d083728c00 x7 : 65646e75203a745f x6 : 746e756f63666572 [ 110.909384] x5 : ffffffed579f62ee x4 : ffffffed579eb01e x3 : 0000000000000000 [ 110.909409] x2 : 0000000000000000 x1 : ffffffc00913b750 x0 : 0000000000000001 [ 110.909434] Call trace: [ 110.909441] refcount_dec_not_one+0xb8/0xc0 [ 110.909461] vc4_bo_dec_usecnt+0x4c/0x1b0 [vc4] [ 110.909903] vc4_cleanup_fb+0x44/0x50 [vc4] [ 110.910315] drm_atomic_helper_cleanup_planes+0x88/0xa4 [drm_kms_helper] [ 110.910669] vc4_atomic_commit_tail+0x390/0x9dc [vc4] [ 110.911079] commit_tail+0xb0/0x164 [drm_kms_helper] [ 110.911397] drm_atomic_helper_commit+0x1d0/0x1f0 [drm_kms_helper] [ 110.911716] drm_atomic_commit+0xb0/0xdc [drm] [ 110.912569] drm_mode_atomic_ioctl+0x348/0x4b8 [drm] [ 110.913330] drm_ioctl_kernel+0xec/0x15c [drm] [ 110.914091] drm_ioctl+0x24c/0x3b0 [drm] [ 110.914850] __arm64_sys_ioctl+0x9c/0xd4 [ 110.914873] invoke_syscall+0x4c/0x114 [ 110.914897] el0_svc_common+0xd0/0x118 [ 110.914917] do_el0_svc+0x38/0xd0 [ 110.914936] el0_svc+0x30/0x8c [ 110.914958] el0t_64_sync_handler+0x84/0xf0 [ 110.914979] el0t_64_sync+0x18c/0x190 [ 110.914996] ---[ end trace 0000000000000000 ]---
This happens because, although prepare_fb and cleanup_fb are
perfectly balanced, we cannot guarantee consistency in the check
plane->state->fb == state->fb. This means that sometimes we can increase
the refcount in prepare_fb and don't decrease it in cleanup_fb. The
opposite can also be true.
In fact, the struct drm_plane .state shouldn't be accessed directly
but instead, the drm_atomic_get_new_plane_state() helper function should
be used. So, we could stick to this check, but using
drm_atomic_get_new_plane_state(). But actually, this check is not re
---truncated---(CVE-2024-35932)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: send: handle path ref underflow in header iterate_inode_ref()
Change BUG_ON to proper error handling if building the path buffer fails. The pointers are not printed so we don't accidentally leak kernel addresses.(CVE-2024-35935)
In the Linux kernel, the following vulnerability has been resolved:
wifi: cfg80211: check A-MSDU format more carefully
If it looks like there's another subframe in the A-MSDU but the header isn't fully there, we can end up reading data out of bounds, only to discard later. Make this a bit more careful and check if the subframe header can even be present.(CVE-2024-35937)
In the Linux kernel, the following vulnerability has been resolved:
drm/panfrost: Fix the error path in panfrost_mmu_map_fault_addr()
Subject: [PATCH] drm/panfrost: Fix the error path in panfrost_mmu_map_fault_addr()
If some the pages or sgt allocation failed, we shouldn't release the pages ref we got earlier, otherwise we will end up with unbalanced get/put_pages() calls. We should instead leave everything in place and let the BO release function deal with extra cleanup when the object is destroyed, or let the fault handler try again next time it's called.(CVE-2024-35951)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: L2CAP: Fix not validating setsockopt user input
Check user input length before copying data.(CVE-2024-35965)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: RFCOMM: Fix not validating setsockopt user input
syzbot reported rfcomm_sock_setsockopt_old() is copying data without checking user input length.
BUG: KASAN: slab-out-of-bounds in copy_from_sockptr_offset include/linux/sockptr.h:49 [inline] BUG: KASAN: slab-out-of-bounds in copy_from_sockptr include/linux/sockptr.h:55 [inline] BUG: KASAN: slab-out-of-bounds in rfcomm_sock_setsockopt_old net/bluetooth/rfcomm/sock.c:632 [inline] BUG: KASAN: slab-out-of-bounds in rfcomm_sock_setsockopt+0x893/0xa70 net/bluetooth/rfcomm/sock.c:673 Read of size 4 at addr ffff8880209a8bc3 by task syz-executor632/5064(CVE-2024-35966)
In the Linux kernel, the following vulnerability has been resolved:
tty: n_gsm: fix possible out-of-bounds in gsm0_receive()
Assuming the following: - side A configures the n_gsm in basic option mode - side B sends the header of a basic option mode frame with data length 1 - side A switches to advanced option mode - side B sends 2 data bytes which exceeds gsm->len Reason: gsm->len is not used in advanced option mode. - side A switches to basic option mode - side B keeps sending until gsm0_receive() writes past gsm->buf Reason: Neither gsm->state nor gsm->len have been reset after reconfiguration.
Fix this by changing gsm->count to gsm->len comparison from equal to less than. Also add upper limit checks against the constant MAX_MRU in gsm0_receive() and gsm1_receive() to harden against memory corruption of gsm->len and gsm->mru.
All other checks remain as we still need to limit the data according to the user configuration and actual payload size.(CVE-2024-36016)
In the Linux kernel, the following vulnerability has been resolved:
tcp: defer shutdown(SEND_SHUTDOWN) for TCP_SYN_RECV sockets
TCP_SYN_RECV state is really special, it is only used by cross-syn connections, mostly used by fuzzers.
In the following crash 1, syzbot managed to trigger a divide by zero in tcp_rcv_space_adjust()
A socket makes the following state transitions, without ever calling tcp_init_transfer(), meaning tcp_init_buffer_space() is also not called.
TCP_CLOSE
connect() TCP_SYN_SENT TCP_SYN_RECV shutdown() -> tcp_shutdown(sk, SEND_SHUTDOWN) TCP_FIN_WAIT1
To fix this issue, change tcp_shutdown() to not perform a TCP_SYN_RECV -> TCP_FIN_WAIT1 transition, which makes no sense anyway.
When tcp_rcv_state_process() later changes socket state from TCP_SYN_RECV to TCP_ESTABLISH, then look at sk->sk_shutdown to finally enter TCP_FIN_WAIT1 state, and send a FIN packet from a sane socket state.
This means tcp_send_fin() can now be called from BH context, and must use GFP_ATOMIC allocations.
1 divide error: 0000 [#1] PREEMPT SMP KASAN NOPTI CPU: 1 PID: 5084 Comm: syz-executor358 Not tainted 6.9.0-rc6-syzkaller-00022-g98369dccd2f8 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024 RIP: 0010:tcp_rcv_space_adjust+0x2df/0x890 net/ipv4/tcp_input.c:767 Code: e3 04 4c 01 eb 48 8b 44 24 38 0f b6 04 10 84 c0 49 89 d5 0f 85 a5 03 00 00 41 8b 8e c8 09 00 00 89 e8 29 c8 48 0f af c3 31 d2 <48> f7 f1 48 8d 1c 43 49 8d 96 76 08 00 00 48 89 d0 48 c1 e8 03 48 RSP: 0018:ffffc900031ef3f0 EFLAGS: 00010246 RAX: 0c677a10441f8f42 RBX: 000000004fb95e7e RCX: 0000000000000000 RDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000000 RBP: 0000000027d4b11f R08: ffffffff89e535a4 R09: 1ffffffff25e6ab7 R10: dffffc0000000000 R11: ffffffff8135e920 R12: ffff88802a9f8d30 R13: dffffc0000000000 R14: ffff88802a9f8d00 R15: 1ffff1100553f2da FS: 00005555775c0380(0000) GS:ffff8880b9500000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f1155bf2304 CR3: 000000002b9f2000 CR4: 0000000000350ef0 Call Trace: <TASK> tcp_recvmsg_locked+0x106d/0x25a0 net/ipv4/tcp.c:2513 tcp_recvmsg+0x25d/0x920 net/ipv4/tcp.c:2578 inet6_recvmsg+0x16a/0x730 net/ipv6/af_inet6.c:680 sock_recvmsg_nosec net/socket.c:1046 [inline] sock_recvmsg+0x109/0x280 net/socket.c:1068 _sysrecvmsg+0x1db/0x470 net/socket.c:2803 _sys_recvmsg net/socket.c:2845 [inline] do_recvmmsg+0x474/0xae0 net/socket.c:2939 __sys_recvmmsg net/socket.c:3018 [inline] __do_sys_recvmmsg net/socket.c:3041 [inline] __se_sys_recvmmsg net/socket.c:3034 [inline] __x64_sys_recvmmsg+0x199/0x250 net/socket.c:3034 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f RIP: 0033:0x7faeb6363db9 Code: 28 00 00 00 75 05 48 83 c4 28 c3 e8 c1 17 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b8 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007ffcc1997168 EFLAGS: 00000246 ORIG_RAX: 000000000000012b RAX: ffffffffffffffda RBX: 0000000000000000 RCX: 00007faeb6363db9 RDX: 0000000000000001 RSI: 0000000020000bc0 RDI: 0000000000000005 RBP: 0000000000000000 R08: 0000000000000000 R09: 000000000000001c R10: 0000000000000122 R11: 0000000000000246 R12: 0000000000000000 R13: 0000000000000000 R14: 0000000000000001 R15: 0000000000000001(CVE-2024-36905)
In the Linux kernel, the following vulnerability has been resolved:
blk-iocost: avoid out of bounds shift
UBSAN catches undefined behavior in blk-iocost, where sometimes iocg->delay is shifted right by a number that is too large, resulting in undefined behavior on some architectures.
[ 186.556576] ------------[ cut here ]------------ UBSAN: shift-out-of-bounds in block/blk-iocost.c:1366:23 shift exponent 64 is too large for 64-bit type 'u64' (aka 'unsigned long long') CPU: 16 PID: 0 Comm: swapper/16 Tainted: G S E N 6.9.0-0_fbk700_debug_rc2_kbuilder_0_gc85af715cac0 #1 Hardware name: Quanta Twin Lakes MP/Twin Lakes Passive MP, BIOS F09_3A23 12/08/2020 Call Trace: <IRQ> dump_stack_lvl+0x8f/0xe0 __ubsan_handle_shift_out_of_bounds+0x22c/0x280 iocg_kick_delay+0x30b/0x310 ioc_timer_fn+0x2fb/0x1f80 __run_timer_base+0x1b6/0x250 ...
Avoid that undefined behavior by simply taking the "delay = 0" branch if the shift is too large.
I am not sure what the symptoms of an undefined value delay will be, but I suspect it could be more than a little annoying to debug.(CVE-2024-36916)
In the Linux kernel, the following vulnerability has been resolved:
scsi: bnx2fc: Remove spin_lock_bh while releasing resources after upload
The session resources are used by FW and driver when session is offloaded, once session is uploaded these resources are not used. The lock is not required as these fields won't be used any longer. The offload and upload calls are sequential, hence lock is not required.
This will suppress following BUG_ON():
[ 449.843143] ------------[ cut here ]------------ [ 449.848302] kernel BUG at mm/vmalloc.c:2727! [ 449.853072] invalid opcode: 0000 [#1] PREEMPT SMP PTI [ 449.858712] CPU: 5 PID: 1996 Comm: kworker/u24:2 Not tainted 5.14.0-118.el9.x86_64 #1 Rebooting. [ 449.867454] Hardware name: Dell Inc. PowerEdge R730/0WCJNT, BIOS 2.3.4 11/08/2016 [ 449.876966] Workqueue: fc_rport_eq fc_rport_work [libfc] [ 449.882910] RIP: 0010:vunmap+0x2e/0x30 [ 449.887098] Code: 00 65 8b 05 14 a2 f0 4a a9 00 ff ff 00 75 1b 55 48 89 fd e8 34 36 79 00 48 85 ed 74 0b 48 89 ef 31 f6 5d e9 14 fc ff ff 5d c3 <0f> 0b 0f 1f 44 00 00 41 57 41 56 49 89 ce 41 55 49 89 fd 41 54 41 [ 449.908054] RSP: 0018:ffffb83d878b3d68 EFLAGS: 00010206 [ 449.913887] RAX: 0000000080000201 RBX: ffff8f4355133550 RCX: 000000000d400005 [ 449.921843] RDX: 0000000000000001 RSI: 0000000000001000 RDI: ffffb83da53f5000 [ 449.929808] RBP: ffff8f4ac6675800 R08: ffffb83d878b3d30 R09: 00000000000efbdf [ 449.937774] R10: 0000000000000003 R11: ffff8f434573e000 R12: 0000000000001000 [ 449.945736] R13: 0000000000001000 R14: ffffb83da53f5000 R15: ffff8f43d4ea3ae0 [ 449.953701] FS: 0000000000000000(0000) GS:ffff8f529fc80000(0000) knlGS:0000000000000000 [ 449.962732] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 449.969138] CR2: 00007f8cf993e150 CR3: 0000000efbe10003 CR4: 00000000003706e0 [ 449.977102] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 449.985065] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 [ 449.993028] Call Trace: [ 449.995756] __iommu_dma_free+0x96/0x100 [ 450.000139] bnx2fc_free_session_resc+0x67/0x240 [bnx2fc] [ 450.006171] bnx2fc_upload_session+0xce/0x100 [bnx2fc] [ 450.011910] bnx2fc_rport_event_handler+0x9f/0x240 [bnx2fc] [ 450.018136] fc_rport_work+0x103/0x5b0 [libfc] [ 450.023103] process_one_work+0x1e8/0x3c0 [ 450.027581] worker_thread+0x50/0x3b0 [ 450.031669] ? rescuer_thread+0x370/0x370 [ 450.036143] kthread+0x149/0x170 [ 450.039744] ? set_kthread_struct+0x40/0x40 [ 450.044411] ret_from_fork+0x22/0x30 [ 450.048404] Modules linked in: vfat msdos fat xfs nfs_layout_nfsv41_files rpcsec_gss_krb5 auth_rpcgss nfsv4 dns_resolver dm_service_time qedf qed crc8 bnx2fc libfcoe libfc scsi_transport_fc intel_rapl_msr intel_rapl_common x86_pkg_temp_thermal intel_powerclamp dcdbas rapl intel_cstate intel_uncore mei_me pcspkr mei ipmi_ssif lpc_ich ipmi_si fuse zram ext4 mbcache jbd2 loop nfsv3 nfs_acl nfs lockd grace fscache netfs irdma ice sd_mod t10_pi sg ib_uverbs ib_core 8021q garp mrp stp llc mgag200 i2c_algo_bit drm_kms_helper syscopyarea sysfillrect sysimgblt mxm_wmi fb_sys_fops cec crct10dif_pclmul ahci crc32_pclmul bnx2x drm ghash_clmulni_intel libahci rfkill i40e libata megaraid_sas mdio wmi sunrpc lrw dm_crypt dm_round_robin dm_multipath dm_snapshot dm_bufio dm_mirror dm_region_hash dm_log dm_zero dm_mod linear raid10 raid456 async_raid6_recov async_memcpy async_pq async_xor async_tx raid6_pq libcrc32c crc32c_intel raid1 raid0 iscsi_ibft squashfs be2iscsi bnx2i cnic uio cxgb4i cxgb4 tls [ 450.048497] libcxgbi libcxgb qla4xxx iscsi_boot_sysfs iscsi_tcp libiscsi_tcp libiscsi scsi_transport_iscsi edd ipmi_devintf ipmi_msghandler [ 450.159753] ---[ end trace 712de2c57c64abc8 ]---(CVE-2024-36919)
In the Linux kernel, the following vulnerability has been resolved:
scsi: lpfc: Move NPIV's transport unregistration to after resource clean up
There are cases after NPIV deletion where the fabric switch still believes the NPIV is logged into the fabric. This occurs when a vport is unregistered before the Remove All DA_ID CT and LOGO ELS are sent to the fabric.
Currently fc_remove_host(), which calls dev_loss_tmo for all D_IDs including the fabric D_ID, removes the last ndlp reference and frees the ndlp rport object. This sometimes causes the race condition where the final DA_ID and LOGO are skipped from being sent to the fabric switch.
Fix by moving the fc_remove_host() and scsi_remove_host() calls after DA_ID and LOGO are sent.(CVE-2024-36952)
In the Linux kernel, the following vulnerability has been resolved:
drm/vmwgfx: Fix invalid reads in fence signaled events
Correctly set the length of the drm_event to the size of the structure that's actually used.
The length of the drm_event was set to the parent structure instead of to the drm_vmw_event_fence which is supposed to be read. drm_read uses the length parameter to copy the event to the user space thus resuling in oob reads.(CVE-2024-36960)
In the Linux kernel, the following vulnerability has been resolved:
Bluetooth: L2CAP: Fix div-by-zero in l2cap_le_flowctl_init()
l2cap_le_flowctl_init() can cause both div-by-zero and an integer overflow since hdev->le_mtu may not fall in the valid range.
Move MTU from hci_dev to hci_conn to validate MTU and stop the connection process earlier if MTU is invalid. Also, add a missing validation in read_buffer_size() and make it return an error value if the validation fails. Now hci_conn_add() returns ERR_PTR() as it can fail due to the both a kzalloc failure and invalid MTU value.
divide error: 0000 [#1] PREEMPT SMP KASAN NOPTI CPU: 0 PID: 67 Comm: kworker/u5:0 Tainted: G W 6.9.0-rc5+ #20 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014 Workqueue: hci0 hci_rx_work RIP: 0010:l2cap_le_flowctl_init+0x19e/0x3f0 net/bluetooth/l2cap_core.c:547 Code: e8 17 17 0c 00 66 41 89 9f 84 00 00 00 bf 01 00 00 00 41 b8 02 00 00 00 4c 89 fe 4c 89 e2 89 d9 e8 27 17 0c 00 44 89 f0 31 d2 <66> f7 f3 89 c3 ff c3 4d 8d b7 88 00 00 00 4c 89 f0 48 c1 e8 03 42 RSP: 0018:ffff88810bc0f858 EFLAGS: 00010246 RAX: 00000000000002a0 RBX: 0000000000000000 RCX: dffffc0000000000 RDX: 0000000000000000 RSI: ffff88810bc0f7c0 RDI: ffffc90002dcb66f RBP: ffff88810bc0f880 R08: aa69db2dda70ff01 R09: 0000ffaaaaaaaaaa R10: 0084000000ffaaaa R11: 0000000000000000 R12: ffff88810d65a084 R13: dffffc0000000000 R14: 00000000000002a0 R15: ffff88810d65a000 FS: 0000000000000000(0000) GS:ffff88811ac00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000020000100 CR3: 0000000103268003 CR4: 0000000000770ef0 PKRU: 55555554 Call Trace: <TASK> l2cap_le_connect_req net/bluetooth/l2cap_core.c:4902 [inline] l2cap_le_sig_cmd net/bluetooth/l2cap_core.c:5420 [inline] l2cap_le_sig_channel net/bluetooth/l2cap_core.c:5486 [inline] l2cap_recv_frame+0xe59d/0x11710 net/bluetooth/l2cap_core.c:6809 l2cap_recv_acldata+0x544/0x10a0 net/bluetooth/l2cap_core.c:7506 hci_acldata_packet net/bluetooth/hci_core.c:3939 [inline] hci_rx_work+0x5e5/0xb20 net/bluetooth/hci_core.c:4176 process_one_work kernel/workqueue.c:3254 [inline] process_scheduled_works+0x90f/0x1530 kernel/workqueue.c:3335 worker_thread+0x926/0xe70 kernel/workqueue.c:3416 kthread+0x2e3/0x380 kernel/kthread.c:388 ret_from_fork+0x5c/0x90 arch/x86/kernel/process.c:147 ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:244 </TASK> Modules linked in: ---[ end trace 0000000000000000 ]---(CVE-2024-36968)
In the Linux kernel, the following vulnerability has been resolved:
net: fix __dst_negative_advice() race
__dst_negative_advice() does not enforce proper RCU rules when sk->dst_cache must be cleared, leading to possible UAF.
RCU rules are that we must first clear sk->sk_dst_cache, then call dst_release(old_dst).
Note that sk_dst_reset(sk) is implementing this protocol correctly, while __dst_negative_advice() uses the wrong order.
Given that ip6_negative_advice() has special logic against RTF_CACHE, this means each of the three ->negative_advice() existing methods must perform the sk_dst_reset() themselves.
Note the check against NULL dst is centralized in __dst_negative_advice(), there is no need to duplicate it in various callbacks.
Many thanks to Clement Lecigne for tracking this issue.
This old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-tools-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"kernel-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"kernel-debuginfo-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"perf-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-209.0.0.117.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-209.0.0.117.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-tools-devel-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"kernel-devel-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"kernel-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"perf-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-209.0.0.117.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-209.0.0.117.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nafs: Fix corruption in reads at fpos 2G-4G from an OpenAFS server\r\n\r\nAFS-3 has two data fetch RPC variants, FS.FetchData and FS.FetchData64, and\nLinux\u0026apos;s afs client switches between them when talking to a non-YFS server\nif the read size, the file position or the sum of the two have the upper 32\nbits set of the 64-bit value.\r\n\r\nThis is a problem, however, since the file position and length fields of\nFS.FetchData are *signed* 32-bit values.\r\n\r\nFix this by capturing the capability bits obtained from the fileserver when\nit\u0026apos;s sent an FS.GetCapabilities RPC, rather than just discarding them, and\nthen picking out the VICED_CAPABILITY_64BITFILES flag. This can then be\nused to decide whether to use FS.FetchData or FS.FetchData64 - and also\nFS.StoreData or FS.StoreData64 - rather than using upper_32_bits() to\nswitch on the parameter values.\r\n\r\nThis capabilities flag could also be used to limit the maximum size of the\nfile, but all servers must be checked for that.\r\n\r\nNote that the issue does not exist with FS.StoreData - that uses *unsigned*\n32-bit values. It\u0026apos;s also not a problem with Auristor servers as its\nYFS.FetchData64 op uses unsigned 64-bit values.\r\n\r\nThis can be tested by cloning a git repo through an OpenAFS client to an\nOpenAFS server and then doing \u0026quot;git status\u0026quot; on it from a Linux afs\nclient[1]. Provided the clone has a pack file that\u0026apos;s in the 2G-4G range,\nthe git status will show errors like:\r\n\r\n\terror: packfile .git/objects/pack/pack-5e813c51d12b6847bbc0fcd97c2bca66da50079c.pack does not match index\n\terror: packfile .git/objects/pack/pack-5e813c51d12b6847bbc0fcd97c2bca66da50079c.pack does not match index\r\n\r\nThis can be observed in the server\u0026apos;s FileLog with something like the\nfollowing appearing:\r\n\r\nSun Aug 29 19:31:39 2021 SRXAFS_FetchData, Fid = 2303380852.491776.3263114, Host 192.168.11.201:7001, Id 1001\nSun Aug 29 19:31:39 2021 CheckRights: len=0, for host=192.168.11.201:7001\nSun Aug 29 19:31:39 2021 FetchData_RXStyle: Pos 18446744071815340032, Len 3154\nSun Aug 29 19:31:39 2021 FetchData_RXStyle: file size 2400758866\n...\nSun Aug 29 19:31:40 2021 SRXAFS_FetchData returns 5\r\n\r\nNote the file position of 18446744071815340032. This is the requested file\nposition sign-extended.(CVE-2021-47366)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/smc: Fix possible access to freed memory in link clear\r\n\r\nAfter modifying the QP to the Error state, all RX WR would be completed\nwith WC in IB_WC_WR_FLUSH_ERR status. Current implementation does not\nwait for it is done, but destroy the QP and free the link group directly.\nSo there is a risk that accessing the freed memory in tasklet context.\r\n\r\nHere is a crash example:\r\n\r\n BUG: unable to handle page fault for address: ffffffff8f220860\n #PF: supervisor write access in kernel mode\n #PF: error_code(0x0002) - not-present page\n PGD f7300e067 P4D f7300e067 PUD f7300f063 PMD 8c4e45063 PTE 800ffff08c9df060\n Oops: 0002 [#1] SMP PTI\n CPU: 1 PID: 0 Comm: swapper/1 Kdump: loaded Tainted: G S OE 5.10.0-0607+ #23\n Hardware name: Inspur NF5280M4/YZMB-00689-101, BIOS 4.1.20 07/09/2018\n RIP: 0010:native_queued_spin_lock_slowpath+0x176/0x1b0\n Code: f3 90 48 8b 32 48 85 f6 74 f6 eb d5 c1 ee 12 83 e0 03 83 ee 01 48 c1 e0 05 48 63 f6 48 05 00 c8 02 00 48 03 04 f5 00 09 98 8e \u0026lt;48\u0026gt; 89 10 8b 42 08 85 c0 75 09 f3 90 8b 42 08 85 c0 74 f7 48 8b 32\n RSP: 0018:ffffb3b6c001ebd8 EFLAGS: 00010086\n RAX: ffffffff8f220860 RBX: 0000000000000246 RCX: 0000000000080000\n RDX: ffff91db1f86c800 RSI: 000000000000173c RDI: ffff91db62bace00\n RBP: ffff91db62bacc00 R08: 0000000000000000 R09: c00000010000028b\n R10: 0000000000055198 R11: ffffb3b6c001ea58 R12: ffff91db80e05010\n R13: 000000000000000a R14: 0000000000000006 R15: 0000000000000040\n FS: 0000000000000000(0000) GS:ffff91db1f840000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: ffffffff8f220860 CR3: 00000001f9580004 CR4: 00000000003706e0\n DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n _raw_spin_lock_irqsave+0x30/0x40\n mlx5_ib_poll_cq+0x4c/0xc50 [mlx5_ib]\n smc_wr_rx_tasklet_fn+0x56/0xa0 [smc]\n tasklet_action_common.isra.21+0x66/0x100\n __do_softirq+0xd5/0x29c\n asm_call_irq_on_stack+0x12/0x20\n \u0026lt;/IRQ\u0026gt;\n do_softirq_own_stack+0x37/0x40\n irq_exit_rcu+0x9d/0xa0\n sysvec_call_function_single+0x34/0x80\n asm_sysvec_call_function_single+0x12/0x20(CVE-2022-48673)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/srp: Set scmnd-\u0026gt;result only when scmnd is not NULL\r\n\r\nThis change fixes the following kernel NULL pointer dereference\nwhich is reproduced by blktests srp/007 occasionally.\r\n\r\nBUG: kernel NULL pointer dereference, address: 0000000000000170\nPGD 0 P4D 0\nOops: 0002 [#1] PREEMPT SMP NOPTI\nCPU: 0 PID: 9 Comm: kworker/0:1H Kdump: loaded Not tainted 6.0.0-rc1+ #37\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.15.0-29-g6a62e0cb0dfe-prebuilt.qemu.org 04/01/2014\nWorkqueue: 0x0 (kblockd)\nRIP: 0010:srp_recv_done+0x176/0x500 [ib_srp]\nCode: 00 4d 85 ff 0f 84 52 02 00 00 48 c7 82 80 02 00 00 00 00 00 00 4c 89 df 4c 89 14 24 e8 53 d3 4a f6 4c 8b 14 24 41 0f b6 42 13 \u0026lt;41\u0026gt; 89 87 70 01 00 00 41 0f b6 52 12 f6 c2 02 74 44 41 8b 42 1c b9\nRSP: 0018:ffffaef7c0003e28 EFLAGS: 00000282\nRAX: 0000000000000000 RBX: ffff9bc9486dea60 RCX: 0000000000000000\nRDX: 0000000000000102 RSI: ffffffffb76bbd0e RDI: 00000000ffffffff\nRBP: ffff9bc980099a00 R08: 0000000000000001 R09: 0000000000000001\nR10: ffff9bca53ef0000 R11: ffff9bc980099a10 R12: ffff9bc956e14000\nR13: ffff9bc9836b9cb0 R14: ffff9bc9557b4480 R15: 0000000000000000\nFS: 0000000000000000(0000) GS:ffff9bc97ec00000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000000000170 CR3: 0000000007e04000 CR4: 00000000000006f0\nCall Trace:\n \u0026lt;IRQ\u0026gt;\n __ib_process_cq+0xb7/0x280 [ib_core]\n ib_poll_handler+0x2b/0x130 [ib_core]\n irq_poll_softirq+0x93/0x150\n __do_softirq+0xee/0x4b8\n irq_exit_rcu+0xf7/0x130\n sysvec_apic_timer_interrupt+0x8e/0xc0\n \u0026lt;/IRQ\u0026gt;(CVE-2022-48692)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nrpmsg: virtio: Free driver_override when rpmsg_remove()\r\n\r\nFree driver_override when rpmsg_remove(), otherwise\nthe following memory leak will occur:\r\n\r\nunreferenced object 0xffff0000d55d7080 (size 128):\n comm \u0026quot;kworker/u8:2\u0026quot;, pid 56, jiffies 4294893188 (age 214.272s)\n hex dump (first 32 bytes):\n 72 70 6d 73 67 5f 6e 73 00 00 00 00 00 00 00 00 rpmsg_ns........\n 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................\n backtrace:\n [\u0026lt;000000009c94c9c1\u0026gt;] __kmem_cache_alloc_node+0x1f8/0x320\n [\u0026lt;000000002300d89b\u0026gt;] __kmalloc_node_track_caller+0x44/0x70\n [\u0026lt;00000000228a60c3\u0026gt;] kstrndup+0x4c/0x90\n [\u0026lt;0000000077158695\u0026gt;] driver_set_override+0xd0/0x164\n [\u0026lt;000000003e9c4ea5\u0026gt;] rpmsg_register_device_override+0x98/0x170\n [\u0026lt;000000001c0c89a8\u0026gt;] rpmsg_ns_register_device+0x24/0x30\n [\u0026lt;000000008bbf8fa2\u0026gt;] rpmsg_probe+0x2e0/0x3ec\n [\u0026lt;00000000e65a68df\u0026gt;] virtio_dev_probe+0x1c0/0x280\n [\u0026lt;00000000443331cc\u0026gt;] really_probe+0xbc/0x2dc\n [\u0026lt;00000000391064b1\u0026gt;] __driver_probe_device+0x78/0xe0\n [\u0026lt;00000000a41c9a5b\u0026gt;] driver_probe_device+0xd8/0x160\n [\u0026lt;000000009c3bd5df\u0026gt;] __device_attach_driver+0xb8/0x140\n [\u0026lt;0000000043cd7614\u0026gt;] bus_for_each_drv+0x7c/0xd4\n [\u0026lt;000000003b929a36\u0026gt;] __device_attach+0x9c/0x19c\n [\u0026lt;00000000a94e0ba8\u0026gt;] device_initial_probe+0x14/0x20\n [\u0026lt;000000003c999637\u0026gt;] bus_probe_device+0xa0/0xac(CVE-2023-52670)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: avoid format-overflow warning\r\n\r\nWith gcc and W=1 option, there\u0026apos;s a warning like this:\r\n\r\nfs/f2fs/compress.c: In function \u2018f2fs_init_page_array_cache\u2019:\nfs/f2fs/compress.c:1984:47: error: \u2018%u\u2019 directive writing between\n1 and 7 bytes into a region of size between 5 and 8\n[-Werror=format-overflow=]\n 1984 | sprintf(slab_name, \u0026quot;f2fs_page_array_entry-%u:%u\u0026quot;, MAJOR(dev),\n\t\tMINOR(dev));\n | ^~\r\n\r\nString \u0026quot;f2fs_page_array_entry-%u:%u\u0026quot; can up to 35. The first \u0026quot;%u\u0026quot; can up\nto 4 and the second \u0026quot;%u\u0026quot; can up to 7, so total size is \u0026quot;24 + 4 + 7 = 35\u0026quot;.\nslab_name\u0026apos;s size should be 35 rather than 32.(CVE-2023-52748)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ni2c: core: Run atomic i2c xfer when !preemptible\r\n\r\nSince bae1d3a05a8b, i2c transfers are non-atomic if preemption is\ndisabled. However, non-atomic i2c transfers require preemption (e.g. in\nwait_for_completion() while waiting for the DMA).\r\n\r\npanic() calls preempt_disable_notrace() before calling\nemergency_restart(). Therefore, if an i2c device is used for the\nrestart, the xfer should be atomic. This avoids warnings like:\r\n\r\n[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0\n[ 12.676926] Voluntary context switch within RCU read-side critical section!\n...\n[ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114\n[ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70\n...\n[ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58\n[ 13.001050] machine_restart from panic+0x2a8/0x32c\r\n\r\nUse !preemptible() instead, which is basically the same check as\npre-v5.2.(CVE-2023-52791)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/panel: fix a possible null pointer dereference\r\n\r\nIn versatile_panel_get_modes(), the return value of drm_mode_duplicate()\nis assigned to mode, which will lead to a NULL pointer dereference\non failure of drm_mode_duplicate(). Add a check to avoid npd.(CVE-2023-52821)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: vidtv: mux: Add check and kfree for kstrdup\r\n\r\nAdd check for the return value of kstrdup() and return the error\nif it fails in order to avoid NULL pointer dereference.\nMoreover, use kfree() in the later error handling in order to avoid\nmemory leak.(CVE-2023-52841)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: mediatek: clk-mt6779: Add check for mtk_alloc_clk_data\r\n\r\nAdd the check for the return value of mtk_alloc_clk_data() in order to\navoid NULL pointer dereference.(CVE-2023-52873)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: sunxi-ng: h6: Reparent CPUX during PLL CPUX rate change\r\n\r\nWhile PLL CPUX clock rate change when CPU is running from it works in\nvast majority of cases, now and then it causes instability. This leads\nto system crashes and other undefined behaviour. After a lot of testing\n(30+ hours) while also doing a lot of frequency switches, we can\u0026apos;t\nobserve any instability issues anymore when doing reparenting to stable\nclock like 24 MHz oscillator.(CVE-2023-52882)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nft_set_pipapo: do not free live element\r\n\r\nPablo reports a crash with large batches of elements with a\nback-to-back add/remove pattern. Quoting Pablo:\r\n\r\n add_elem(\u0026quot;00000000\u0026quot;) timeout 100 ms\n ...\n add_elem(\u0026quot;0000000X\u0026quot;) timeout 100 ms\n del_elem(\u0026quot;0000000X\u0026quot;) \u0026lt;---------------- delete one that was just added\n ...\n add_elem(\u0026quot;00005000\u0026quot;) timeout 100 ms\r\n\r\n 1) nft_pipapo_remove() removes element 0000000X\n Then, KASAN shows a splat.\r\n\r\nLooking at the remove function there is a chance that we will drop a\nrule that maps to a non-deactivated element.\r\n\r\nRemoval happens in two steps, first we do a lookup for key k and return the\nto-be-removed element and mark it as inactive in the next generation.\nThen, in a second step, the element gets removed from the set/map.\r\n\r\nThe _remove function does not work correctly if we have more than one\nelement that share the same key.\r\n\r\nThis can happen if we insert an element into a set when the set already\nholds an element with same key, but the element mapping to the existing\nkey has timed out or is not active in the next generation.\r\n\r\nIn such case its possible that removal will unmap the wrong element.\nIf this happens, we will leak the non-deactivated element, it becomes\nunreachable.\r\n\r\nThe element that got deactivated (and will be freed later) will\nremain reachable in the set data structure, this can result in\na crash when such an element is retrieved during lookup (stale\npointer).\r\n\r\nAdd a check that the fully matching key does in fact map to the element\nthat we have marked as inactive in the deactivation step.\nIf not, we need to continue searching.\r\n\r\nAdd a bug/warn trap at the end of the function as well, the remove\nfunction must not ever be called with an invisible/unreachable/non-existent\nelement.\r\n\r\nv2: avoid uneeded temporary variable (Stefano)(CVE-2024-26924)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: core: Fix unremoved procfs host directory regression\r\n\r\nCommit fc663711b944 (\u0026quot;scsi: core: Remove the /proc/scsi/${proc_name}\ndirectory earlier\u0026quot;) fixed a bug related to modules loading/unloading, by\nadding a call to scsi_proc_hostdir_rm() on scsi_remove_host(). But that led\nto a potential duplicate call to the hostdir_rm() routine, since it\u0026apos;s also\ncalled from scsi_host_dev_release(). That triggered a regression report,\nwhich was then fixed by commit be03df3d4bfe (\u0026quot;scsi: core: Fix a procfs host\ndirectory removal regression\u0026quot;). The fix just dropped the hostdir_rm() call\nfrom dev_release().\r\n\r\nBut it happens that this proc directory is created on scsi_host_alloc(),\nand that function \u0026quot;pairs\u0026quot; with scsi_host_dev_release(), while\nscsi_remove_host() pairs with scsi_add_host(). In other words, it seems the\nreason for removing the proc directory on dev_release() was meant to cover\ncases in which a SCSI host structure was allocated, but the call to\nscsi_add_host() didn\u0026apos;t happen. And that pattern happens to exist in some\nerror paths, for example.\r\n\r\nSyzkaller causes that by using USB raw gadget device, error\u0026apos;ing on\nusb-storage driver, at usb_stor_probe2(). By checking that path, we can see\nthat the BadDevice label leads to a scsi_host_put() after a SCSI host\nallocation, but there\u0026apos;s no call to scsi_add_host() in such path. That leads\nto messages like this in dmesg (and a leak of the SCSI host proc\nstructure):\r\n\r\nusb-storage 4-1:87.51: USB Mass Storage device detected\nproc_dir_entry \u0026apos;scsi/usb-storage\u0026apos; already registered\nWARNING: CPU: 1 PID: 3519 at fs/proc/generic.c:377 proc_register+0x347/0x4e0 fs/proc/generic.c:376\r\n\r\nThe proper fix seems to still call scsi_proc_hostdir_rm() on dev_release(),\nbut guard that with the state check for SHOST_CREATED; there is even a\ncomment in scsi_host_dev_release() detailing that: such conditional is\nmeant for cases where the SCSI host was allocated but there was no calls to\n{add,remove}_host(), like the usb-storage case.\r\n\r\nThis is what we propose here and with that, the error path of usb-storage\ndoes not trigger the warning anymore.(CVE-2024-26935)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: validate request buffer size in smb2_allocate_rsp_buf()\r\n\r\nThe response buffer should be allocated in smb2_allocate_rsp_buf\nbefore validating request. But the fields in payload as well as smb2 header\nis used in smb2_allocate_rsp_buf(). This patch add simple buffer size\nvalidation to avoid potencial out-of-bounds in request buffer.(CVE-2024-26936)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nARM: 9359/1: flush: check if the folio is reserved for no-mapping addresses\r\n\r\nSince commit a4d5613c4dc6 (\u0026quot;arm: extend pfn_valid to take into account\nfreed memory map alignment\u0026quot;) changes the semantics of pfn_valid() to check\npresence of the memory map for a PFN. A valid page for an address which\nis reserved but not mapped by the kernel[1], the system crashed during\nsome uio test with the following memory layout:\r\n\r\n node 0: [mem 0x00000000c0a00000-0x00000000cc8fffff]\n node 0: [mem 0x00000000d0000000-0x00000000da1fffff]\n the uio layout is\uff1a0xc0900000, 0x100000\r\n\r\nthe crash backtrace like:\r\n\r\n Unable to handle kernel paging request at virtual address bff00000\n [...]\n CPU: 1 PID: 465 Comm: startapp.bin Tainted: G O 5.10.0 #1\n Hardware name: Generic DT based system\n PC is at b15_flush_kern_dcache_area+0x24/0x3c\n LR is at __sync_icache_dcache+0x6c/0x98\n [...]\n (b15_flush_kern_dcache_area) from (__sync_icache_dcache+0x6c/0x98)\n (__sync_icache_dcache) from (set_pte_at+0x28/0x54)\n (set_pte_at) from (remap_pfn_range+0x1a0/0x274)\n (remap_pfn_range) from (uio_mmap+0x184/0x1b8 [uio])\n (uio_mmap [uio]) from (__mmap_region+0x264/0x5f4)\n (__mmap_region) from (__do_mmap_mm+0x3ec/0x440)\n (__do_mmap_mm) from (do_mmap+0x50/0x58)\n (do_mmap) from (vm_mmap_pgoff+0xfc/0x188)\n (vm_mmap_pgoff) from (ksys_mmap_pgoff+0xac/0xc4)\n (ksys_mmap_pgoff) from (ret_fast_syscall+0x0/0x5c)\n Code: e0801001 e2423001 e1c00003 f57ff04f (ee070f3e)\n ---[ end trace 09cf0734c3805d52 ]---\n Kernel panic - not syncing: Fatal exception\r\n\r\nSo check if PG_reserved was set to solve this issue.\r\n\r\n[1]: https://lore.kernel.org/lkml/Zbtdue57RO0QScJM@linux.ibm.com/(CVE-2024-26947)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: fix slab-out-of-bounds in smb_strndup_from_utf16()\r\n\r\nIf -\u0026gt;NameOffset of smb2_create_req is smaller than Buffer offset of\nsmb2_create_req, slab-out-of-bounds read can happen from smb2_open.\nThis patch set the minimum value of the name offset to the buffer offset\nto validate name length of smb2_create_req().(CVE-2024-26954)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmm: swap: fix race between free_swap_and_cache() and swapoff()\r\n\r\nThere was previously a theoretical window where swapoff() could run and\nteardown a swap_info_struct while a call to free_swap_and_cache() was\nrunning in another thread. This could cause, amongst other bad\npossibilities, swap_page_trans_huge_swapped() (called by\nfree_swap_and_cache()) to access the freed memory for swap_map.\r\n\r\nThis is a theoretical problem and I haven\u0026apos;t been able to provoke it from a\ntest case. But there has been agreement based on code review that this is\npossible (see link below).\r\n\r\nFix it by using get_swap_device()/put_swap_device(), which will stall\nswapoff(). There was an extra check in _swap_info_get() to confirm that\nthe swap entry was not free. This isn\u0026apos;t present in get_swap_device()\nbecause it doesn\u0026apos;t make sense in general due to the race between getting\nthe reference and swapoff. So I\u0026apos;ve added an equivalent check directly in\nfree_swap_and_cache().\r\n\r\nDetails of how to provoke one possible issue (thanks to David Hildenbrand\nfor deriving this):\r\n\r\n--8\u0026lt;-----\r\n\r\n__swap_entry_free() might be the last user and result in\n\u0026quot;count == SWAP_HAS_CACHE\u0026quot;.\r\n\r\nswapoff-\u0026gt;try_to_unuse() will stop as soon as soon as si-\u0026gt;inuse_pages==0.\r\n\r\nSo the question is: could someone reclaim the folio and turn\nsi-\u0026gt;inuse_pages==0, before we completed swap_page_trans_huge_swapped().\r\n\r\nImagine the following: 2 MiB folio in the swapcache. Only 2 subpages are\nstill references by swap entries.\r\n\r\nProcess 1 still references subpage 0 via swap entry.\nProcess 2 still references subpage 1 via swap entry.\r\n\r\nProcess 1 quits. Calls free_swap_and_cache().\n-\u0026gt; count == SWAP_HAS_CACHE\n[then, preempted in the hypervisor etc.]\r\n\r\nProcess 2 quits. Calls free_swap_and_cache().\n-\u0026gt; count == SWAP_HAS_CACHE\r\n\r\nProcess 2 goes ahead, passes swap_page_trans_huge_swapped(), and calls\n__try_to_reclaim_swap().\r\n\r\n__try_to_reclaim_swap()-\u0026gt;folio_free_swap()-\u0026gt;delete_from_swap_cache()-\u0026gt;\nput_swap_folio()-\u0026gt;free_swap_slot()-\u0026gt;swapcache_free_entries()-\u0026gt;\nswap_entry_free()-\u0026gt;swap_range_free()-\u0026gt;\n...\nWRITE_ONCE(si-\u0026gt;inuse_pages, si-\u0026gt;inuse_pages - nr_entries);\r\n\r\nWhat stops swapoff to succeed after process 2 reclaimed the swap cache\nbut before process1 finished its call to swap_page_trans_huge_swapped()?\r\n\r\n--8\u0026lt;-----(CVE-2024-26960)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/mlx5e: Prevent deadlock while disabling aRFS\r\n\r\nWhen disabling aRFS under the `priv-\u0026gt;state_lock`, any scheduled\naRFS works are canceled using the `cancel_work_sync` function,\nwhich waits for the work to end if it has already started.\nHowever, while waiting for the work handler, the handler will\ntry to acquire the `state_lock` which is already acquired.\r\n\r\nThe worker acquires the lock to delete the rules if the state\nis down, which is not the worker\u0026apos;s responsibility since\ndisabling aRFS deletes the rules.\r\n\r\nAdd an aRFS state variable, which indicates whether the aRFS is\nenabled and prevent adding rules when the aRFS is disabled.\r\n\r\nKernel log:\r\n\r\n======================================================\nWARNING: possible circular locking dependency detected\n6.7.0-rc4_net_next_mlx5_5483eb2 #1 Tainted: G I\n------------------------------------------------------\nethtool/386089 is trying to acquire lock:\nffff88810f21ce68 ((work_completion)(\u0026amp;rule-\u0026gt;arfs_work)){+.+.}-{0:0}, at: __flush_work+0x74/0x4e0\r\n\r\nbut task is already holding lock:\nffff8884a1808cc0 (\u0026amp;priv-\u0026gt;state_lock){+.+.}-{3:3}, at: mlx5e_ethtool_set_channels+0x53/0x200 [mlx5_core]\r\n\r\nwhich lock already depends on the new lock.\r\n\r\nthe existing dependency chain (in reverse order) is:\r\n\r\n-\u0026gt; #1 (\u0026amp;priv-\u0026gt;state_lock){+.+.}-{3:3}:\n __mutex_lock+0x80/0xc90\n arfs_handle_work+0x4b/0x3b0 [mlx5_core]\n process_one_work+0x1dc/0x4a0\n worker_thread+0x1bf/0x3c0\n kthread+0xd7/0x100\n ret_from_fork+0x2d/0x50\n ret_from_fork_asm+0x11/0x20\r\n\r\n-\u0026gt; #0 ((work_completion)(\u0026amp;rule-\u0026gt;arfs_work)){+.+.}-{0:0}:\n __lock_acquire+0x17b4/0x2c80\n lock_acquire+0xd0/0x2b0\n __flush_work+0x7a/0x4e0\n __cancel_work_timer+0x131/0x1c0\n arfs_del_rules+0x143/0x1e0 [mlx5_core]\n mlx5e_arfs_disable+0x1b/0x30 [mlx5_core]\n mlx5e_ethtool_set_channels+0xcb/0x200 [mlx5_core]\n ethnl_set_channels+0x28f/0x3b0\n ethnl_default_set_doit+0xec/0x240\n genl_family_rcv_msg_doit+0xd0/0x120\n genl_rcv_msg+0x188/0x2c0\n netlink_rcv_skb+0x54/0x100\n genl_rcv+0x24/0x40\n netlink_unicast+0x1a1/0x270\n netlink_sendmsg+0x214/0x460\n __sock_sendmsg+0x38/0x60\n __sys_sendto+0x113/0x170\n __x64_sys_sendto+0x20/0x30\n do_syscall_64+0x40/0xe0\n entry_SYSCALL_64_after_hwframe+0x46/0x4e\r\n\r\nother info that might help us debug this:\r\n\r\n Possible unsafe locking scenario:\r\n\r\n CPU0 CPU1\n ---- ----\n lock(\u0026amp;priv-\u0026gt;state_lock);\n lock((work_completion)(\u0026amp;rule-\u0026gt;arfs_work));\n lock(\u0026amp;priv-\u0026gt;state_lock);\n lock((work_completion)(\u0026amp;rule-\u0026gt;arfs_work));\r\n\r\n *** DEADLOCK ***\r\n\r\n3 locks held by ethtool/386089:\n #0: ffffffff82ea7210 (cb_lock){++++}-{3:3}, at: genl_rcv+0x15/0x40\n #1: ffffffff82e94c88 (rtnl_mutex){+.+.}-{3:3}, at: ethnl_default_set_doit+0xd3/0x240\n #2: ffff8884a1808cc0 (\u0026amp;priv-\u0026gt;state_lock){+.+.}-{3:3}, at: mlx5e_ethtool_set_channels+0x53/0x200 [mlx5_core]\r\n\r\nstack backtrace:\nCPU: 15 PID: 386089 Comm: ethtool Tainted: G I 6.7.0-rc4_net_next_mlx5_5483eb2 #1\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014\nCall Trace:\n \u0026lt;TASK\u0026gt;\n dump_stack_lvl+0x60/0xa0\n check_noncircular+0x144/0x160\n __lock_acquire+0x17b4/0x2c80\n lock_acquire+0xd0/0x2b0\n ? __flush_work+0x74/0x4e0\n ? save_trace+0x3e/0x360\n ? __flush_work+0x74/0x4e0\n __flush_work+0x7a/0x4e0\n ? __flush_work+0x74/0x4e0\n ? __lock_acquire+0xa78/0x2c80\n ? lock_acquire+0xd0/0x2b0\n ? mark_held_locks+0x49/0x70\n __cancel_work_timer+0x131/0x1c0\n ? mark_held_locks+0x49/0x70\n arfs_del_rules+0x143/0x1e0 [mlx5_core]\n mlx5e_arfs_disable+0x1b/0x30 [mlx5_core]\n mlx5e_ethtool_set_channels+0xcb/0x200 [mlx5_core]\n ethnl_set_channels+0x28f/0x3b0\n ethnl_default_set_doit+0xec/0x240\n genl_family_rcv_msg_doit+0xd0/0x120\n genl_rcv_msg+0x188/0x2c0\n ? ethn\n---truncated---(CVE-2024-27014)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nft_set_pipapo: walk over current view on netlink dump\r\n\r\nThe generation mask can be updated while netlink dump is in progress.\nThe pipapo set backend walk iterator cannot rely on it to infer what\nview of the datastructure is to be used. Add notation to specify if user\nwants to read/update the set.\r\n\r\nBased on patch from Florian Westphal.(CVE-2024-27017)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnetfilter: nf_tables: Fix potential data-race in __nft_obj_type_get()\r\n\r\nnft_unregister_obj() can concurrent with __nft_obj_type_get(),\nand there is not any protection when iterate over nf_tables_objects\nlist in __nft_obj_type_get(). Therefore, there is potential data-race\nof nf_tables_objects list entry.\r\n\r\nUse list_for_each_entry_rcu() to iterate over nf_tables_objects\nlist in __nft_obj_type_get(), and use rcu_read_lock() in the caller\nnft_obj_type_get() to protect the entire type query process.(CVE-2024-27019)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix potential NULL pointer dereferences in \u0026apos;dcn10_set_output_transfer_func()\u0026apos;\r\n\r\nThe \u0026apos;stream\u0026apos; pointer is used in dcn10_set_output_transfer_func() before\nthe check if \u0026apos;stream\u0026apos; is NULL.\r\n\r\nFixes the below:\ndrivers/gpu/drm/amd/amdgpu/../display/dc/hwss/dcn10/dcn10_hwseq.c:1892 dcn10_set_output_transfer_func() warn: variable dereferenced before check \u0026apos;stream\u0026apos; (see line 1875)(CVE-2024-27044)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: ll_temac: platform_get_resource replaced by wrong function\r\n\r\nThe function platform_get_resource was replaced with\ndevm_platform_ioremap_resource_byname and is called using 0 as name.\r\n\r\nThis eventually ends up in platform_get_resource_byname in the call\nstack, where it causes a null pointer in strcmp.\r\n\r\n\tif (type == resource_type(r) \u0026amp;\u0026amp; !strcmp(r-\u0026gt;name, name))\r\n\r\nIt should have been replaced with devm_platform_ioremap_resource.(CVE-2024-35796)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsoc: fsl: qbman: Use raw spinlock for cgr_lock\r\n\r\nsmp_call_function always runs its callback in hard IRQ context, even on\nPREEMPT_RT, where spinlocks can sleep. So we need to use a raw spinlock\nfor cgr_lock to ensure we aren\u0026apos;t waiting on a sleeping task.\r\n\r\nAlthough this bug has existed for a while, it was not apparent until\ncommit ef2a8d5478b9 (\u0026quot;net: dpaa: Adjust queue depth on rate change\u0026quot;)\nwhich invokes smp_call_function_single via qman_update_cgr_safe every\ntime a link goes up or down.(CVE-2024-35819)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nubifs: Set page uptodate in the correct place\r\n\r\nPage cache reads are lockless, so setting the freshly allocated page\nuptodate before we\u0026apos;ve overwritten it with the data it\u0026apos;s supposed to have\nin it will allow a simultaneous reader to see old data. Move the call\nto SetPageUptodate into ubifs_write_end(), which is after we copied the\nnew data into the page.(CVE-2024-35821)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: libertas: fix some memleaks in lbs_allocate_cmd_buffer()\r\n\r\nIn the for statement of lbs_allocate_cmd_buffer(), if the allocation of\ncmdarray[i].cmdbuf fails, both cmdarray and cmdarray[i].cmdbuf needs to\nbe freed. Otherwise, there will be memleaks in lbs_allocate_cmd_buffer().(CVE-2024-35828)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nsmb: client: fix UAF in smb2_reconnect_server()\r\n\r\nThe UAF bug is due to smb2_reconnect_server() accessing a session that\nis already being teared down by another thread that is executing\n__cifs_put_smb_ses(). This can happen when (a) the client has\nconnection to the server but no session or (b) another thread ends up\nsetting @ses-\u0026gt;ses_status again to something different than\nSES_EXITING.\r\n\r\nTo fix this, we need to make sure to unconditionally set\n@ses-\u0026gt;ses_status to SES_EXITING and prevent any other threads from\nsetting a new status while we\u0026apos;re still tearing it down.\r\n\r\nThe following can be reproduced by adding some delay to right after\nthe ipc is freed in __cifs_put_smb_ses() - which will give\nsmb2_reconnect_server() worker a chance to run and then accessing\n@ses-\u0026gt;ipc:\r\n\r\nkinit ...\nmount.cifs //srv/share /mnt/1 -o sec=krb5,nohandlecache,echo_interval=10\n[disconnect srv]\nls /mnt/1 \u0026amp;\u0026gt;/dev/null\nsleep 30\nkdestroy\n[reconnect srv]\nsleep 10\numount /mnt/1\n...\nCIFS: VFS: Verify user has a krb5 ticket and keyutils is installed\nCIFS: VFS: \\\\srv Send error in SessSetup = -126\nCIFS: VFS: Verify user has a krb5 ticket and keyutils is installed\nCIFS: VFS: \\\\srv Send error in SessSetup = -126\ngeneral protection fault, probably for non-canonical address\n0x6b6b6b6b6b6b6b6b: 0000 [#1] PREEMPT SMP NOPTI\nCPU: 3 PID: 50 Comm: kworker/3:1 Not tainted 6.9.0-rc2 #1\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-1.fc39\n04/01/2014\nWorkqueue: cifsiod smb2_reconnect_server [cifs]\nRIP: 0010:__list_del_entry_valid_or_report+0x33/0xf0\nCode: 4f 08 48 85 d2 74 42 48 85 c9 74 59 48 b8 00 01 00 00 00 00 ad\nde 48 39 c2 74 61 48 b8 22 01 00 00 00 00 74 69 \u0026lt;48\u0026gt; 8b 01 48 39 f8 75\n7b 48 8b 72 08 48 39 c6 0f 85 88 00 00 00 b8\nRSP: 0018:ffffc900001bfd70 EFLAGS: 00010a83\nRAX: dead000000000122 RBX: ffff88810da53838 RCX: 6b6b6b6b6b6b6b6b\nRDX: 6b6b6b6b6b6b6b6b RSI: ffffffffc02f6878 RDI: ffff88810da53800\nRBP: ffff88810da53800 R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000000000000 R11: 0000000000000001 R12: ffff88810c064000\nR13: 0000000000000001 R14: ffff88810c064000 R15: ffff8881039cc000\nFS: 0000000000000000(0000) GS:ffff888157c00000(0000)\nknlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007fe3728b1000 CR3: 000000010caa4000 CR4: 0000000000750ef0\nPKRU: 55555554\nCall Trace:\n \u0026lt;TASK\u0026gt;\n ? die_addr+0x36/0x90\n ? exc_general_protection+0x1c1/0x3f0\n ? asm_exc_general_protection+0x26/0x30\n ? __list_del_entry_valid_or_report+0x33/0xf0\n __cifs_put_smb_ses+0x1ae/0x500 [cifs]\n smb2_reconnect_server+0x4ed/0x710 [cifs]\n process_one_work+0x205/0x6b0\n worker_thread+0x191/0x360\n ? __pfx_worker_thread+0x10/0x10\n kthread+0xe2/0x110\n ? __pfx_kthread+0x10/0x10\n ret_from_fork+0x34/0x50\n ? __pfx_kthread+0x10/0x10\n ret_from_fork_asm+0x1a/0x30\n \u0026lt;/TASK\u0026gt;(CVE-2024-35870)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nax25: fix use-after-free bugs caused by ax25_ds_del_timer\r\n\r\nWhen the ax25 device is detaching, the ax25_dev_device_down()\ncalls ax25_ds_del_timer() to cleanup the slave_timer. When\nthe timer handler is running, the ax25_ds_del_timer() that\ncalls del_timer() in it will return directly. As a result,\nthe use-after-free bugs could happen, one of the scenarios\nis shown below:\r\n\r\n (Thread 1) | (Thread 2)\n | ax25_ds_timeout()\nax25_dev_device_down() |\n ax25_ds_del_timer() |\n del_timer() |\n ax25_dev_put() //FREE |\n | ax25_dev-\u0026gt; //USE\r\n\r\nIn order to mitigate bugs, when the device is detaching, use\ntimer_shutdown_sync() to stop the timer.(CVE-2024-35887)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntcp: properly terminate timers for kernel sockets\r\n\r\nWe had various syzbot reports about tcp timers firing after\nthe corresponding netns has been dismantled.\r\n\r\nFortunately Josef Bacik could trigger the issue more often,\nand could test a patch I wrote two years ago.\r\n\r\nWhen TCP sockets are closed, we call inet_csk_clear_xmit_timers()\nto \u0026apos;stop\u0026apos; the timers.\r\n\r\ninet_csk_clear_xmit_timers() can be called from any context,\nincluding when socket lock is held.\nThis is the reason it uses sk_stop_timer(), aka del_timer().\nThis means that ongoing timers might finish much later.\r\n\r\nFor user sockets, this is fine because each running timer\nholds a reference on the socket, and the user socket holds\na reference on the netns.\r\n\r\nFor kernel sockets, we risk that the netns is freed before\ntimer can complete, because kernel sockets do not hold\nreference on the netns.\r\n\r\nThis patch adds inet_csk_clear_xmit_timers_sync() function\nthat using sk_stop_timer_sync() to make sure all timers\nare terminated before the kernel socket is released.\nModules using kernel sockets close them in their netns exit()\nhandler.\r\n\r\nAlso add sock_not_owned_by_me() helper to get LOCKDEP\nsupport : inet_csk_clear_xmit_timers_sync() must not be called\nwhile socket lock is held.\r\n\r\nIt is very possible we can revert in the future commit\n3a58f13a881e (\u0026quot;net: rds: acquire refcount on TCP sockets\u0026quot;)\nwhich attempted to solve the issue in rds only.\n(net/smc/af_smc.c and net/mptcp/subflow.c have similar code)\r\n\r\nWe probably can remove the check_net() tests from\ntcp_out_of_resources() and __tcp_close() in the future.(CVE-2024-35910)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnfc: nci: Fix uninit-value in nci_dev_up and nci_ntf_packet\r\n\r\nsyzbot reported the following uninit-value access issue [1][2]:\r\n\r\nnci_rx_work() parses and processes received packet. When the payload\nlength is zero, each message type handler reads uninitialized payload\nand KMSAN detects this issue. The receipt of a packet with a zero-size\npayload is considered unexpected, and therefore, such packets should be\nsilently discarded.\r\n\r\nThis patch resolved this issue by checking payload size before calling\neach message type handler codes.(CVE-2024-35915)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/vc4: don\u0026apos;t check if plane-\u0026gt;state-\u0026gt;fb == state-\u0026gt;fb\r\n\r\nCurrently, when using non-blocking commits, we can see the following\nkernel warning:\r\n\r\n[ 110.908514] ------------[ cut here ]------------\n[ 110.908529] refcount_t: underflow; use-after-free.\n[ 110.908620] WARNING: CPU: 0 PID: 1866 at lib/refcount.c:87 refcount_dec_not_one+0xb8/0xc0\n[ 110.908664] Modules linked in: rfcomm snd_seq_dummy snd_hrtimer snd_seq snd_seq_device cmac algif_hash aes_arm64 aes_generic algif_skcipher af_alg bnep hid_logitech_hidpp vc4 brcmfmac hci_uart btbcm brcmutil bluetooth snd_soc_hdmi_codec cfg80211 cec drm_display_helper drm_dma_helper drm_kms_helper snd_soc_core snd_compress snd_pcm_dmaengine fb_sys_fops sysimgblt syscopyarea sysfillrect raspberrypi_hwmon ecdh_generic ecc rfkill libaes i2c_bcm2835 binfmt_misc joydev snd_bcm2835(C) bcm2835_codec(C) bcm2835_isp(C) v4l2_mem2mem videobuf2_dma_contig snd_pcm bcm2835_v4l2(C) raspberrypi_gpiomem bcm2835_mmal_vchiq(C) videobuf2_v4l2 snd_timer videobuf2_vmalloc videobuf2_memops videobuf2_common snd videodev vc_sm_cma(C) mc hid_logitech_dj uio_pdrv_genirq uio i2c_dev drm fuse dm_mod drm_panel_orientation_quirks backlight ip_tables x_tables ipv6\n[ 110.909086] CPU: 0 PID: 1866 Comm: kodi.bin Tainted: G C 6.1.66-v8+ #32\n[ 110.909104] Hardware name: Raspberry Pi 3 Model B Rev 1.2 (DT)\n[ 110.909114] pstate: 60000005 (nZCv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n[ 110.909132] pc : refcount_dec_not_one+0xb8/0xc0\n[ 110.909152] lr : refcount_dec_not_one+0xb4/0xc0\n[ 110.909170] sp : ffffffc00913b9c0\n[ 110.909177] x29: ffffffc00913b9c0 x28: 000000556969bbb0 x27: 000000556990df60\n[ 110.909205] x26: 0000000000000002 x25: 0000000000000004 x24: ffffff8004448480\n[ 110.909230] x23: ffffff800570b500 x22: ffffff802e03a7bc x21: ffffffecfca68c78\n[ 110.909257] x20: ffffff8002b42000 x19: ffffff802e03a600 x18: 0000000000000000\n[ 110.909283] x17: 0000000000000011 x16: ffffffffffffffff x15: 0000000000000004\n[ 110.909308] x14: 0000000000000fff x13: ffffffed577e47e0 x12: 0000000000000003\n[ 110.909333] x11: 0000000000000000 x10: 0000000000000027 x9 : c912d0d083728c00\n[ 110.909359] x8 : c912d0d083728c00 x7 : 65646e75203a745f x6 : 746e756f63666572\n[ 110.909384] x5 : ffffffed579f62ee x4 : ffffffed579eb01e x3 : 0000000000000000\n[ 110.909409] x2 : 0000000000000000 x1 : ffffffc00913b750 x0 : 0000000000000001\n[ 110.909434] Call trace:\n[ 110.909441] refcount_dec_not_one+0xb8/0xc0\n[ 110.909461] vc4_bo_dec_usecnt+0x4c/0x1b0 [vc4]\n[ 110.909903] vc4_cleanup_fb+0x44/0x50 [vc4]\n[ 110.910315] drm_atomic_helper_cleanup_planes+0x88/0xa4 [drm_kms_helper]\n[ 110.910669] vc4_atomic_commit_tail+0x390/0x9dc [vc4]\n[ 110.911079] commit_tail+0xb0/0x164 [drm_kms_helper]\n[ 110.911397] drm_atomic_helper_commit+0x1d0/0x1f0 [drm_kms_helper]\n[ 110.911716] drm_atomic_commit+0xb0/0xdc [drm]\n[ 110.912569] drm_mode_atomic_ioctl+0x348/0x4b8 [drm]\n[ 110.913330] drm_ioctl_kernel+0xec/0x15c [drm]\n[ 110.914091] drm_ioctl+0x24c/0x3b0 [drm]\n[ 110.914850] __arm64_sys_ioctl+0x9c/0xd4\n[ 110.914873] invoke_syscall+0x4c/0x114\n[ 110.914897] el0_svc_common+0xd0/0x118\n[ 110.914917] do_el0_svc+0x38/0xd0\n[ 110.914936] el0_svc+0x30/0x8c\n[ 110.914958] el0t_64_sync_handler+0x84/0xf0\n[ 110.914979] el0t_64_sync+0x18c/0x190\n[ 110.914996] ---[ end trace 0000000000000000 ]---\r\n\r\nThis happens because, although `prepare_fb` and `cleanup_fb` are\nperfectly balanced, we cannot guarantee consistency in the check\nplane-\u0026gt;state-\u0026gt;fb == state-\u0026gt;fb. This means that sometimes we can increase\nthe refcount in `prepare_fb` and don\u0026apos;t decrease it in `cleanup_fb`. The\nopposite can also be true.\r\n\r\nIn fact, the struct drm_plane .state shouldn\u0026apos;t be accessed directly\nbut instead, the `drm_atomic_get_new_plane_state()` helper function should\nbe used. So, we could stick to this check, but using\n`drm_atomic_get_new_plane_state()`. But actually, this check is not re\n---truncated---(CVE-2024-35932)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: send: handle path ref underflow in header iterate_inode_ref()\r\n\r\nChange BUG_ON to proper error handling if building the path buffer\nfails. The pointers are not printed so we don\u0026apos;t accidentally leak kernel\naddresses.(CVE-2024-35935)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: cfg80211: check A-MSDU format more carefully\r\n\r\nIf it looks like there\u0026apos;s another subframe in the A-MSDU\nbut the header isn\u0026apos;t fully there, we can end up reading\ndata out of bounds, only to discard later. Make this a\nbit more careful and check if the subframe header can\neven be present.(CVE-2024-35937)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/panfrost: Fix the error path in panfrost_mmu_map_fault_addr()\r\n\r\nSubject: [PATCH] drm/panfrost: Fix the error path in\n panfrost_mmu_map_fault_addr()\r\n\r\nIf some the pages or sgt allocation failed, we shouldn\u0026apos;t release the\npages ref we got earlier, otherwise we will end up with unbalanced\nget/put_pages() calls. We should instead leave everything in place\nand let the BO release function deal with extra cleanup when the object\nis destroyed, or let the fault handler try again next time it\u0026apos;s called.(CVE-2024-35951)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: L2CAP: Fix not validating setsockopt user input\r\n\r\nCheck user input length before copying data.(CVE-2024-35965)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: RFCOMM: Fix not validating setsockopt user input\r\n\r\nsyzbot reported rfcomm_sock_setsockopt_old() is copying data without\nchecking user input length.\r\n\r\nBUG: KASAN: slab-out-of-bounds in copy_from_sockptr_offset\ninclude/linux/sockptr.h:49 [inline]\nBUG: KASAN: slab-out-of-bounds in copy_from_sockptr\ninclude/linux/sockptr.h:55 [inline]\nBUG: KASAN: slab-out-of-bounds in rfcomm_sock_setsockopt_old\nnet/bluetooth/rfcomm/sock.c:632 [inline]\nBUG: KASAN: slab-out-of-bounds in rfcomm_sock_setsockopt+0x893/0xa70\nnet/bluetooth/rfcomm/sock.c:673\nRead of size 4 at addr ffff8880209a8bc3 by task syz-executor632/5064(CVE-2024-35966)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntty: n_gsm: fix possible out-of-bounds in gsm0_receive()\r\n\r\nAssuming the following:\n- side A configures the n_gsm in basic option mode\n- side B sends the header of a basic option mode frame with data length 1\n- side A switches to advanced option mode\n- side B sends 2 data bytes which exceeds gsm-\u0026gt;len\n Reason: gsm-\u0026gt;len is not used in advanced option mode.\n- side A switches to basic option mode\n- side B keeps sending until gsm0_receive() writes past gsm-\u0026gt;buf\n Reason: Neither gsm-\u0026gt;state nor gsm-\u0026gt;len have been reset after\n reconfiguration.\r\n\r\nFix this by changing gsm-\u0026gt;count to gsm-\u0026gt;len comparison from equal to less\nthan. Also add upper limit checks against the constant MAX_MRU in\ngsm0_receive() and gsm1_receive() to harden against memory corruption of\ngsm-\u0026gt;len and gsm-\u0026gt;mru.\r\n\r\nAll other checks remain as we still need to limit the data according to the\nuser configuration and actual payload size.(CVE-2024-36016)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntcp: defer shutdown(SEND_SHUTDOWN) for TCP_SYN_RECV sockets\r\n\r\nTCP_SYN_RECV state is really special, it is only used by\ncross-syn connections, mostly used by fuzzers.\r\n\r\nIn the following crash [1], syzbot managed to trigger a divide\nby zero in tcp_rcv_space_adjust()\r\n\r\nA socket makes the following state transitions,\nwithout ever calling tcp_init_transfer(),\nmeaning tcp_init_buffer_space() is also not called.\r\n\r\n TCP_CLOSE\nconnect()\n TCP_SYN_SENT\n TCP_SYN_RECV\nshutdown() -\u0026gt; tcp_shutdown(sk, SEND_SHUTDOWN)\n TCP_FIN_WAIT1\r\n\r\nTo fix this issue, change tcp_shutdown() to not\nperform a TCP_SYN_RECV -\u0026gt; TCP_FIN_WAIT1 transition,\nwhich makes no sense anyway.\r\n\r\nWhen tcp_rcv_state_process() later changes socket state\nfrom TCP_SYN_RECV to TCP_ESTABLISH, then look at\nsk-\u0026gt;sk_shutdown to finally enter TCP_FIN_WAIT1 state,\nand send a FIN packet from a sane socket state.\r\n\r\nThis means tcp_send_fin() can now be called from BH\ncontext, and must use GFP_ATOMIC allocations.\r\n\r\n[1]\ndivide error: 0000 [#1] PREEMPT SMP KASAN NOPTI\nCPU: 1 PID: 5084 Comm: syz-executor358 Not tainted 6.9.0-rc6-syzkaller-00022-g98369dccd2f8 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 03/27/2024\n RIP: 0010:tcp_rcv_space_adjust+0x2df/0x890 net/ipv4/tcp_input.c:767\nCode: e3 04 4c 01 eb 48 8b 44 24 38 0f b6 04 10 84 c0 49 89 d5 0f 85 a5 03 00 00 41 8b 8e c8 09 00 00 89 e8 29 c8 48 0f af c3 31 d2 \u0026lt;48\u0026gt; f7 f1 48 8d 1c 43 49 8d 96 76 08 00 00 48 89 d0 48 c1 e8 03 48\nRSP: 0018:ffffc900031ef3f0 EFLAGS: 00010246\nRAX: 0c677a10441f8f42 RBX: 000000004fb95e7e RCX: 0000000000000000\nRDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000000\nRBP: 0000000027d4b11f R08: ffffffff89e535a4 R09: 1ffffffff25e6ab7\nR10: dffffc0000000000 R11: ffffffff8135e920 R12: ffff88802a9f8d30\nR13: dffffc0000000000 R14: ffff88802a9f8d00 R15: 1ffff1100553f2da\nFS: 00005555775c0380(0000) GS:ffff8880b9500000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007f1155bf2304 CR3: 000000002b9f2000 CR4: 0000000000350ef0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n tcp_recvmsg_locked+0x106d/0x25a0 net/ipv4/tcp.c:2513\n tcp_recvmsg+0x25d/0x920 net/ipv4/tcp.c:2578\n inet6_recvmsg+0x16a/0x730 net/ipv6/af_inet6.c:680\n sock_recvmsg_nosec net/socket.c:1046 [inline]\n sock_recvmsg+0x109/0x280 net/socket.c:1068\n ____sys_recvmsg+0x1db/0x470 net/socket.c:2803\n ___sys_recvmsg net/socket.c:2845 [inline]\n do_recvmmsg+0x474/0xae0 net/socket.c:2939\n __sys_recvmmsg net/socket.c:3018 [inline]\n __do_sys_recvmmsg net/socket.c:3041 [inline]\n __se_sys_recvmmsg net/socket.c:3034 [inline]\n __x64_sys_recvmmsg+0x199/0x250 net/socket.c:3034\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xf5/0x240 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\nRIP: 0033:0x7faeb6363db9\nCode: 28 00 00 00 75 05 48 83 c4 28 c3 e8 c1 17 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b8 ff ff ff f7 d8 64 89 01 48\nRSP: 002b:00007ffcc1997168 EFLAGS: 00000246 ORIG_RAX: 000000000000012b\nRAX: ffffffffffffffda RBX: 0000000000000000 RCX: 00007faeb6363db9\nRDX: 0000000000000001 RSI: 0000000020000bc0 RDI: 0000000000000005\nRBP: 0000000000000000 R08: 0000000000000000 R09: 000000000000001c\nR10: 0000000000000122 R11: 0000000000000246 R12: 0000000000000000\nR13: 0000000000000000 R14: 0000000000000001 R15: 0000000000000001(CVE-2024-36905)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nblk-iocost: avoid out of bounds shift\r\n\r\nUBSAN catches undefined behavior in blk-iocost, where sometimes\niocg-\u0026gt;delay is shifted right by a number that is too large,\nresulting in undefined behavior on some architectures.\r\n\r\n[ 186.556576] ------------[ cut here ]------------\nUBSAN: shift-out-of-bounds in block/blk-iocost.c:1366:23\nshift exponent 64 is too large for 64-bit type \u0026apos;u64\u0026apos; (aka \u0026apos;unsigned long long\u0026apos;)\nCPU: 16 PID: 0 Comm: swapper/16 Tainted: G S E N 6.9.0-0_fbk700_debug_rc2_kbuilder_0_gc85af715cac0 #1\nHardware name: Quanta Twin Lakes MP/Twin Lakes Passive MP, BIOS F09_3A23 12/08/2020\nCall Trace:\n \u0026lt;IRQ\u0026gt;\n dump_stack_lvl+0x8f/0xe0\n __ubsan_handle_shift_out_of_bounds+0x22c/0x280\n iocg_kick_delay+0x30b/0x310\n ioc_timer_fn+0x2fb/0x1f80\n __run_timer_base+0x1b6/0x250\n...\r\n\r\nAvoid that undefined behavior by simply taking the\n\u0026quot;delay = 0\u0026quot; branch if the shift is too large.\r\n\r\nI am not sure what the symptoms of an undefined value\ndelay will be, but I suspect it could be more than a\nlittle annoying to debug.(CVE-2024-36916)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: bnx2fc: Remove spin_lock_bh while releasing resources after upload\r\n\r\nThe session resources are used by FW and driver when session is offloaded,\nonce session is uploaded these resources are not used. The lock is not\nrequired as these fields won\u0026apos;t be used any longer. The offload and upload\ncalls are sequential, hence lock is not required.\r\n\r\nThis will suppress following BUG_ON():\r\n\r\n[ 449.843143] ------------[ cut here ]------------\n[ 449.848302] kernel BUG at mm/vmalloc.c:2727!\n[ 449.853072] invalid opcode: 0000 [#1] PREEMPT SMP PTI\n[ 449.858712] CPU: 5 PID: 1996 Comm: kworker/u24:2 Not tainted 5.14.0-118.el9.x86_64 #1\nRebooting.\n[ 449.867454] Hardware name: Dell Inc. PowerEdge R730/0WCJNT, BIOS 2.3.4 11/08/2016\n[ 449.876966] Workqueue: fc_rport_eq fc_rport_work [libfc]\n[ 449.882910] RIP: 0010:vunmap+0x2e/0x30\n[ 449.887098] Code: 00 65 8b 05 14 a2 f0 4a a9 00 ff ff 00 75 1b 55 48 89 fd e8 34 36 79 00 48 85 ed 74 0b 48 89 ef 31 f6 5d e9 14 fc ff ff 5d c3 \u0026lt;0f\u0026gt; 0b 0f 1f 44 00 00 41 57 41 56 49 89 ce 41 55 49 89 fd 41 54 41\n[ 449.908054] RSP: 0018:ffffb83d878b3d68 EFLAGS: 00010206\n[ 449.913887] RAX: 0000000080000201 RBX: ffff8f4355133550 RCX: 000000000d400005\n[ 449.921843] RDX: 0000000000000001 RSI: 0000000000001000 RDI: ffffb83da53f5000\n[ 449.929808] RBP: ffff8f4ac6675800 R08: ffffb83d878b3d30 R09: 00000000000efbdf\n[ 449.937774] R10: 0000000000000003 R11: ffff8f434573e000 R12: 0000000000001000\n[ 449.945736] R13: 0000000000001000 R14: ffffb83da53f5000 R15: ffff8f43d4ea3ae0\n[ 449.953701] FS: 0000000000000000(0000) GS:ffff8f529fc80000(0000) knlGS:0000000000000000\n[ 449.962732] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 449.969138] CR2: 00007f8cf993e150 CR3: 0000000efbe10003 CR4: 00000000003706e0\n[ 449.977102] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n[ 449.985065] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n[ 449.993028] Call Trace:\n[ 449.995756] __iommu_dma_free+0x96/0x100\n[ 450.000139] bnx2fc_free_session_resc+0x67/0x240 [bnx2fc]\n[ 450.006171] bnx2fc_upload_session+0xce/0x100 [bnx2fc]\n[ 450.011910] bnx2fc_rport_event_handler+0x9f/0x240 [bnx2fc]\n[ 450.018136] fc_rport_work+0x103/0x5b0 [libfc]\n[ 450.023103] process_one_work+0x1e8/0x3c0\n[ 450.027581] worker_thread+0x50/0x3b0\n[ 450.031669] ? rescuer_thread+0x370/0x370\n[ 450.036143] kthread+0x149/0x170\n[ 450.039744] ? set_kthread_struct+0x40/0x40\n[ 450.044411] ret_from_fork+0x22/0x30\n[ 450.048404] Modules linked in: vfat msdos fat xfs nfs_layout_nfsv41_files rpcsec_gss_krb5 auth_rpcgss nfsv4 dns_resolver dm_service_time qedf qed crc8 bnx2fc libfcoe libfc scsi_transport_fc intel_rapl_msr intel_rapl_common x86_pkg_temp_thermal intel_powerclamp dcdbas rapl intel_cstate intel_uncore mei_me pcspkr mei ipmi_ssif lpc_ich ipmi_si fuse zram ext4 mbcache jbd2 loop nfsv3 nfs_acl nfs lockd grace fscache netfs irdma ice sd_mod t10_pi sg ib_uverbs ib_core 8021q garp mrp stp llc mgag200 i2c_algo_bit drm_kms_helper syscopyarea sysfillrect sysimgblt mxm_wmi fb_sys_fops cec crct10dif_pclmul ahci crc32_pclmul bnx2x drm ghash_clmulni_intel libahci rfkill i40e libata megaraid_sas mdio wmi sunrpc lrw dm_crypt dm_round_robin dm_multipath dm_snapshot dm_bufio dm_mirror dm_region_hash dm_log dm_zero dm_mod linear raid10 raid456 async_raid6_recov async_memcpy async_pq async_xor async_tx raid6_pq libcrc32c crc32c_intel raid1 raid0 iscsi_ibft squashfs be2iscsi bnx2i cnic uio cxgb4i cxgb4 tls\n[ 450.048497] libcxgbi libcxgb qla4xxx iscsi_boot_sysfs iscsi_tcp libiscsi_tcp libiscsi scsi_transport_iscsi edd ipmi_devintf ipmi_msghandler\n[ 450.159753] ---[ end trace 712de2c57c64abc8 ]---(CVE-2024-36919)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: lpfc: Move NPIV\u0026apos;s transport unregistration to after resource clean up\r\n\r\nThere are cases after NPIV deletion where the fabric switch still believes\nthe NPIV is logged into the fabric. This occurs when a vport is\nunregistered before the Remove All DA_ID CT and LOGO ELS are sent to the\nfabric.\r\n\r\nCurrently fc_remove_host(), which calls dev_loss_tmo for all D_IDs including\nthe fabric D_ID, removes the last ndlp reference and frees the ndlp rport\nobject. This sometimes causes the race condition where the final DA_ID and\nLOGO are skipped from being sent to the fabric switch.\r\n\r\nFix by moving the fc_remove_host() and scsi_remove_host() calls after DA_ID\nand LOGO are sent.(CVE-2024-36952)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/vmwgfx: Fix invalid reads in fence signaled events\r\n\r\nCorrectly set the length of the drm_event to the size of the structure\nthat\u0026apos;s actually used.\r\n\r\nThe length of the drm_event was set to the parent structure instead of\nto the drm_vmw_event_fence which is supposed to be read. drm_read\nuses the length parameter to copy the event to the user space thus\nresuling in oob reads.(CVE-2024-36960)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nBluetooth: L2CAP: Fix div-by-zero in l2cap_le_flowctl_init()\r\n\r\nl2cap_le_flowctl_init() can cause both div-by-zero and an integer\noverflow since hdev-\u0026gt;le_mtu may not fall in the valid range.\r\n\r\nMove MTU from hci_dev to hci_conn to validate MTU and stop the connection\nprocess earlier if MTU is invalid.\nAlso, add a missing validation in read_buffer_size() and make it return\nan error value if the validation fails.\nNow hci_conn_add() returns ERR_PTR() as it can fail due to the both a\nkzalloc failure and invalid MTU value.\r\n\r\ndivide error: 0000 [#1] PREEMPT SMP KASAN NOPTI\nCPU: 0 PID: 67 Comm: kworker/u5:0 Tainted: G W 6.9.0-rc5+ #20\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014\nWorkqueue: hci0 hci_rx_work\nRIP: 0010:l2cap_le_flowctl_init+0x19e/0x3f0 net/bluetooth/l2cap_core.c:547\nCode: e8 17 17 0c 00 66 41 89 9f 84 00 00 00 bf 01 00 00 00 41 b8 02 00 00 00 4c\n89 fe 4c 89 e2 89 d9 e8 27 17 0c 00 44 89 f0 31 d2 \u0026lt;66\u0026gt; f7 f3 89 c3 ff c3 4d 8d\nb7 88 00 00 00 4c 89 f0 48 c1 e8 03 42\nRSP: 0018:ffff88810bc0f858 EFLAGS: 00010246\nRAX: 00000000000002a0 RBX: 0000000000000000 RCX: dffffc0000000000\nRDX: 0000000000000000 RSI: ffff88810bc0f7c0 RDI: ffffc90002dcb66f\nRBP: ffff88810bc0f880 R08: aa69db2dda70ff01 R09: 0000ffaaaaaaaaaa\nR10: 0084000000ffaaaa R11: 0000000000000000 R12: ffff88810d65a084\nR13: dffffc0000000000 R14: 00000000000002a0 R15: ffff88810d65a000\nFS: 0000000000000000(0000) GS:ffff88811ac00000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000020000100 CR3: 0000000103268003 CR4: 0000000000770ef0\nPKRU: 55555554\nCall Trace:\n \u0026lt;TASK\u0026gt;\n l2cap_le_connect_req net/bluetooth/l2cap_core.c:4902 [inline]\n l2cap_le_sig_cmd net/bluetooth/l2cap_core.c:5420 [inline]\n l2cap_le_sig_channel net/bluetooth/l2cap_core.c:5486 [inline]\n l2cap_recv_frame+0xe59d/0x11710 net/bluetooth/l2cap_core.c:6809\n l2cap_recv_acldata+0x544/0x10a0 net/bluetooth/l2cap_core.c:7506\n hci_acldata_packet net/bluetooth/hci_core.c:3939 [inline]\n hci_rx_work+0x5e5/0xb20 net/bluetooth/hci_core.c:4176\n process_one_work kernel/workqueue.c:3254 [inline]\n process_scheduled_works+0x90f/0x1530 kernel/workqueue.c:3335\n worker_thread+0x926/0xe70 kernel/workqueue.c:3416\n kthread+0x2e3/0x380 kernel/kthread.c:388\n ret_from_fork+0x5c/0x90 arch/x86/kernel/process.c:147\n ret_from_fork_asm+0x1a/0x30 arch/x86/entry/entry_64.S:244\n \u0026lt;/TASK\u0026gt;\nModules linked in:\n---[ end trace 0000000000000000 ]---(CVE-2024-36968)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: fix __dst_negative_advice() race\r\n\r\n__dst_negative_advice() does not enforce proper RCU rules when\nsk-\u0026gt;dst_cache must be cleared, leading to possible UAF.\r\n\r\nRCU rules are that we must first clear sk-\u0026gt;sk_dst_cache,\nthen call dst_release(old_dst).\r\n\r\nNote that sk_dst_reset(sk) is implementing this protocol correctly,\nwhile __dst_negative_advice() uses the wrong order.\r\n\r\nGiven that ip6_negative_advice() has special logic\nagainst RTF_CACHE, this means each of the three -\u0026gt;negative_advice()\nexisting methods must perform the sk_dst_reset() themselves.\r\n\r\nNote the check against NULL dst is centralized in\n__dst_negative_advice(), there is no need to duplicate\nit in various callbacks.\r\n\r\nMany thanks to Clement Lecigne for tracking this issue.\r\n\r\nThis old bug became visible after the blamed commit, using UDP sockets.(CVE-2024-36971)",
"id": "OESA-2024-1738",
"modified": "2026-08-06T11:07:12Z",
"published": "2024-06-21T11:07:12Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1738"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47366"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48673"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48692"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52670"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52748"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52791"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52821"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52841"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52873"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52882"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26924"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26935"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26936"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26954"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27014"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27017"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27019"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27044"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35796"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35819"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35821"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35828"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35870"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35887"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35910"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35915"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35932"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35935"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35937"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35951"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35965"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35966"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36016"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36905"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36916"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36919"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36952"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36960"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36968"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36971"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47366",
"CVE-2022-48673",
"CVE-2022-48692",
"CVE-2023-52670",
"CVE-2023-52748",
"CVE-2023-52791",
"CVE-2023-52821",
"CVE-2023-52841",
"CVE-2023-52873",
"CVE-2023-52882",
"CVE-2024-26924",
"CVE-2024-26935",
"CVE-2024-26936",
"CVE-2024-26947",
"CVE-2024-26954",
"CVE-2024-26960",
"CVE-2024-27014",
"CVE-2024-27017",
"CVE-2024-27019",
"CVE-2024-27044",
"CVE-2024-35796",
"CVE-2024-35819",
"CVE-2024-35821",
"CVE-2024-35828",
"CVE-2024-35870",
"CVE-2024-35887",
"CVE-2024-35910",
"CVE-2024-35915",
"CVE-2024-35932",
"CVE-2024-35935",
"CVE-2024-35937",
"CVE-2024-35951",
"CVE-2024-35965",
"CVE-2024-35966",
"CVE-2024-36016",
"CVE-2024-36905",
"CVE-2024-36916",
"CVE-2024-36919",
"CVE-2024-36952",
"CVE-2024-36960",
"CVE-2024-36968",
"CVE-2024-36971"
]
}
OESA-2024-1768 (CVE-2021-47381)
Vulnerability from osv_openeuler – Published: 2024-06-28 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ASoC: SOF: Fix DSP oops stack dump output contents
Fix @buf arg given to hex_dump_to_buffer() and stack address used in dump error output.(CVE-2021-47381)
In the Linux kernel, the following vulnerability has been resolved:
scsi: iscsi: Fix iscsi_task use after free
Commit d39df158518c ("scsi: iscsi: Have abort handler get ref to conn") added iscsi_get_conn()/iscsi_put_conn() calls during abort handling but then also changed the handling of the case where we detect an already completed task where we now end up doing a goto to the common put/cleanup code. This results in a iscsi_task use after free, because the common cleanup code will do a put on the iscsi_task.
This reverts the goto and moves the iscsi_get_conn() to after we've checked if the iscsi_task is valid.(CVE-2021-47427)
In the Linux kernel, the following vulnerability has been resolved:
spi: Fix deadlock when adding SPI controllers on SPI buses
Currently we have a global spi_add_lock which we take when adding new devices so that we can check that we're not trying to reuse a chip select that's already controlled. This means that if the SPI device is itself a SPI controller and triggers the instantiation of further SPI devices we trigger a deadlock as we try to register and instantiate those devices while in the process of doing so for the parent controller and hence already holding the global spi_add_lock. Since we only care about concurrency within a single SPI bus move the lock to be per controller, avoiding the deadlock.
This can be easily triggered in the case of spi-mux.(CVE-2021-47469)
(CVE-2023-39180)
In the Linux kernel, the following vulnerability has been resolved:
powerpc/powernv: Add a null pointer check in opal_powercap_init()
kasprintf() returns a pointer to dynamically allocated memory which can be NULL upon failure.(CVE-2023-52696)
In the Linux kernel, the following vulnerability has been resolved:
i2c: core: Run atomic i2c xfer when !preemptible
Since bae1d3a05a8b, i2c transfers are non-atomic if preemption is disabled. However, non-atomic i2c transfers require preemption (e.g. in wait_for_completion() while waiting for the DMA).
panic() calls preempt_disable_notrace() before calling emergency_restart(). Therefore, if an i2c device is used for the restart, the xfer should be atomic. This avoids warnings like:
[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0 [ 12.676926] Voluntary context switch within RCU read-side critical section! ... [ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114 [ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70 ... [ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58 [ 13.001050] machine_restart from panic+0x2a8/0x32c
Use !preemptible() instead, which is basically the same check as pre-v5.2.(CVE-2023-52791)
In the Linux kernel, the following vulnerability has been resolved:
hid: cp2112: Fix duplicate workqueue initialization
Previously the cp2112 driver called INIT_DELAYED_WORK within cp2112_gpio_irq_startup, resulting in duplicate initilizations of the workqueue on subsequent IRQ startups following an initial request. This resulted in a warning in set_work_data in workqueue.c, as well as a rare NULL dereference within process_one_work in workqueue.c.
Initialize the workqueue within _probe instead.(CVE-2023-52853)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: fix UAF issue in ksmbd_tcp_new_connection()
The race is between the handling of a new TCP connection and
its disconnection. It leads to UAF on struct tcp_transport in
ksmbd_tcp_new_connection() function.(CVE-2024-26592)
In the Linux kernel, the following vulnerability has been resolved:
net/ipv6: avoid possible UAF in ip6_route_mpath_notify()
syzbot found another use-after-free in ip6_route_mpath_notify() [1]
Commit f7225172f25a ("net/ipv6: prevent use after free in ip6_route_mpath_notify") was not able to fix the root cause.
We need to defer the fib6_info_release() calls after ip6_route_mpath_notify(), in the cleanup phase.
[1] BUG: KASAN: slab-use-after-free in rt6_fill_node+0x1460/0x1ac0 Read of size 4 at addr ffff88809a07fc64 by task syz-executor.2/23037
CPU: 0 PID: 23037 Comm: syz-executor.2 Not tainted 6.8.0-rc4-syzkaller-01035-gea7f3cfaa588 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/25/2024 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x1e7/0x2e0 lib/dump_stack.c:106 print_address_description mm/kasan/report.c:377 [inline] print_report+0x167/0x540 mm/kasan/report.c:488 kasan_report+0x142/0x180 mm/kasan/report.c:601 rt6_fill_node+0x1460/0x1ac0 inet6_rt_notify+0x13b/0x290 net/ipv6/route.c:6184 ip6_route_mpath_notify net/ipv6/route.c:5198 [inline] ip6_route_multipath_add net/ipv6/route.c:5404 [inline] inet6_rtm_newroute+0x1d0f/0x2300 net/ipv6/route.c:5517 rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597 netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543 netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline] netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367 netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x221/0x270 net/socket.c:745 _syssendmsg+0x525/0x7d0 net/socket.c:2584 _sys_sendmsg net/socket.c:2638 [inline] __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667 do_syscall_64+0xf9/0x240 entry_SYSCALL_64_after_hwframe+0x6f/0x77 RIP: 0033:0x7f73dd87dda9 Code: 28 00 00 00 75 05 48 83 c4 28 c3 e8 e1 20 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007f73de6550c8 EFLAGS: 00000246 ORIG_RAX: 000000000000002e RAX: ffffffffffffffda RBX: 00007f73dd9ac050 RCX: 00007f73dd87dda9 RDX: 0000000000000000 RSI: 0000000020000140 RDI: 0000000000000005 RBP: 00007f73dd8ca47a R08: 0000000000000000 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000 R13: 000000000000006e R14: 00007f73dd9ac050 R15: 00007ffdbdeb7858 </TASK>
Allocated by task 23037: kasan_save_stack mm/kasan/common.c:47 [inline] kasan_save_track+0x3f/0x80 mm/kasan/common.c:68 poison_kmalloc_redzone mm/kasan/common.c:372 [inline] __kasan_kmalloc+0x98/0xb0 mm/kasan/common.c:389 kasan_kmalloc include/linux/kasan.h:211 [inline] __do_kmalloc_node mm/slub.c:3981 [inline] __kmalloc+0x22e/0x490 mm/slub.c:3994 kmalloc include/linux/slab.h:594 [inline] kzalloc include/linux/slab.h:711 [inline] fib6_info_alloc+0x2e/0xf0 net/ipv6/ip6_fib.c:155 ip6_route_info_create+0x445/0x12b0 net/ipv6/route.c:3758 ip6_route_multipath_add net/ipv6/route.c:5298 [inline] inet6_rtm_newroute+0x744/0x2300 net/ipv6/route.c:5517 rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597 netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543 netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline] netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367 netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x221/0x270 net/socket.c:745 _syssendmsg+0x525/0x7d0 net/socket.c:2584 _sys_sendmsg net/socket.c:2638 [inline] __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667 do_syscall_64+0xf9/0x240 entry_SYSCALL_64_after_hwframe+0x6f/0x77
Freed by task 16: kasan_save_stack mm/kasan/common.c:47 [inline] kasan_save_track+0x3f/0x80 mm/kasan/common.c:68 kasan_save_free_info+0x4e/0x60 mm/kasan/generic.c:640 poison_slab_object+0xa6/0xe0 m ---truncated---(CVE-2024-26852)
In the Linux kernel, the following vulnerability has been resolved:
inet: inet_defrag: prevent sk release while still in use
ip_local_out() and other functions can pass skb->sk as function argument.
If the skb is a fragment and reassembly happens before such function call returns, the sk must not be released.
This affects skb fragments reassembled via netfilter or similar modules, e.g. openvswitch or ct_act.c, when run as part of tx pipeline.
Eric Dumazet made an initial analysis of this bug. Quoting Eric: Calling ip_defrag() in output path is also implying skb_orphan(), which is buggy because output path relies on sk not disappearing.
A relevant old patch about the issue was : 8282f27449bf ("inet: frag: Always orphan skbs inside ip_defrag()")
[..]
net/ipv4/ip_output.c depends on skb->sk being set, and probably to an inet socket, not an arbitrary one.
If we orphan the packet in ipvlan, then downstream things like FQ packet scheduler will not work properly.
We need to change ip_defrag() to only use skb_orphan() when really needed, ie whenever frag_list is going to be used.
Eric suggested to stash sk in fragment queue and made an initial patch. However there is a problem with this:
If skb is refragmented again right after, ip_do_fragment() will copy head->sk to the new fragments, and sets up destructor to sock_wfree. IOW, we have no choice but to fix up sk_wmem accouting to reflect the fully reassembled skb, else wmem will underflow.
This change moves the orphan down into the core, to last possible moment. As ip_defrag_offset is aliased with sk_buff->sk member, we must move the offset into the FRAG_CB, else skb->sk gets clobbered.
This allows to delay the orphaning long enough to learn if the skb has to be queued or if the skb is completing the reasm queue.
In the former case, things work as before, skb is orphaned. This is safe because skb gets queued/stolen and won't continue past reasm engine.
In the latter case, we will steal the skb->sk reference, reattach it to the head skb, and fix up wmem accouting when inet_frag inflates truesize.(CVE-2024-26921)
In the Linux kernel, the following vulnerability has been resolved:
scsi: core: Fix unremoved procfs host directory regression
Commit fc663711b944 ("scsi: core: Remove the /proc/scsi/${proc_name} directory earlier") fixed a bug related to modules loading/unloading, by adding a call to scsi_proc_hostdir_rm() on scsi_remove_host(). But that led to a potential duplicate call to the hostdir_rm() routine, since it's also called from scsi_host_dev_release(). That triggered a regression report, which was then fixed by commit be03df3d4bfe ("scsi: core: Fix a procfs host directory removal regression"). The fix just dropped the hostdir_rm() call from dev_release().
But it happens that this proc directory is created on scsi_host_alloc(), and that function "pairs" with scsi_host_dev_release(), while scsi_remove_host() pairs with scsi_add_host(). In other words, it seems the reason for removing the proc directory on dev_release() was meant to cover cases in which a SCSI host structure was allocated, but the call to scsi_add_host() didn't happen. And that pattern happens to exist in some error paths, for example.
Syzkaller causes that by using USB raw gadget device, error'ing on usb-storage driver, at usb_stor_probe2(). By checking that path, we can see that the BadDevice label leads to a scsi_host_put() after a SCSI host allocation, but there's no call to scsi_add_host() in such path. That leads to messages like this in dmesg (and a leak of the SCSI host proc structure):
usb-storage 4-1:87.51: USB Mass Storage device detected proc_dir_entry 'scsi/usb-storage' already registered WARNING: CPU: 1 PID: 3519 at fs/proc/generic.c:377 proc_register+0x347/0x4e0 fs/proc/generic.c:376
The proper fix seems to still call scsi_proc_hostdir_rm() on dev_release(), but guard that with the state check for SHOST_CREATED; there is even a comment in scsi_host_dev_release() detailing that: such conditional is meant for cases where the SCSI host was allocated but there was no calls to {add,remove}_host(), like the usb-storage case.
This is what we propose here and with that, the error path of usb-storage does not trigger the warning anymore.(CVE-2024-26935)
In the Linux kernel, the following vulnerability has been resolved:
init/main.c: Fix potential static_command_line memory overflow
We allocate memory of size 'xlen + strlen(boot_command_line) + 1' for static_command_line, but the strings copied into static_command_line are extra_command_line and command_line, rather than extra_command_line and boot_command_line.
When strlen(command_line) > strlen(boot_command_line), static_command_line will overflow.
This patch just recovers strlen(command_line) which was miss-consolidated with strlen(boot_command_line) in the commit f5c7310ac73e ("init/main: add checks for the return value of memblock_alloc*()")(CVE-2024-26988)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: fix to avoid potential panic during recovery
During recovery, if FAULT_BLOCK is on, it is possible that f2fs_reserve_new_block() will return -ENOSPC during recovery, then it may trigger panic.
Also, if fault injection rate is 1 and only FAULT_BLOCK fault type is on, it may encounter deadloop in loop of block reservation.
Let's change as below to fix these issues: - remove bug_on() to avoid panic. - limit the loop count of block reservation to avoid potential deadloop.(CVE-2024-27032)
In the Linux kernel, the following vulnerability has been resolved:
clk: Fix clk_core_get NULL dereference
It is possible for clk_core_get to dereference a NULL in the following sequence:
clk_core_get() of_clk_get_hw_from_clkspec() __of_clk_get_hw_from_provider() __clk_get_hw()
__clk_get_hw() can return NULL which is dereferenced by clk_core_get() at hw->core.
Prior to commit dde4eff47c82 ("clk: Look for parents with clkdev based clk_lookups") the check IS_ERR_OR_NULL() was performed which would have caught the NULL.
Reading the description of this function it talks about returning NULL but that cannot be so at the moment.
Update the function to check for hw before dereferencing it and return NULL if hw is NULL.(CVE-2024-27038)
In the Linux kernel, the following vulnerability has been resolved:
net: phy: fix phy_get_internal_delay accessing an empty array
The phy_get_internal_delay function could try to access to an empty array in the case that the driver is calling phy_get_internal_delay without defining delay_values and rx-internal-delay-ps or tx-internal-delay-ps is defined to 0 in the device-tree. This will lead to "unable to handle kernel NULL pointer dereference at virtual address 0". To avoid this kernel oops, the test should be delay >= 0. As there is already delay < 0 test just before, the test could only be size == 0.(CVE-2024-27047)
In the Linux kernel, the following vulnerability has been resolved:
wifi: rtl8xxxu: add cancel_work_sync() for c2hcmd_work
The workqueue might still be running, when the driver is stopped. To avoid a use-after-free, call cancel_work_sync() in rtl8xxxu_stop().(CVE-2024-27052)
In the Linux kernel, the following vulnerability has been resolved:
wifi: wilc1000: fix RCU usage in connect path
With lockdep enabled, calls to the connect function from cfg802.11 layer lead to the following warning:
============================= WARNING: suspicious RCU usage 6.7.0-rc1-wt+ #333 Not tainted
drivers/net/wireless/microchip/wilc1000/hif.c:386 suspicious rcu_dereference_check() usage! [...] stack backtrace: CPU: 0 PID: 100 Comm: wpa_supplicant Not tainted 6.7.0-rc1-wt+ #333 Hardware name: Atmel SAMA5 unwind_backtrace from show_stack+0x18/0x1c show_stack from dump_stack_lvl+0x34/0x48 dump_stack_lvl from wilc_parse_join_bss_param+0x7dc/0x7f4 wilc_parse_join_bss_param from connect+0x2c4/0x648 connect from cfg80211_connect+0x30c/0xb74 cfg80211_connect from nl80211_connect+0x860/0xa94 nl80211_connect from genl_rcv_msg+0x3fc/0x59c genl_rcv_msg from netlink_rcv_skb+0xd0/0x1f8 netlink_rcv_skb from genl_rcv+0x2c/0x3c genl_rcv from netlink_unicast+0x3b0/0x550 netlink_unicast from netlink_sendmsg+0x368/0x688 netlink_sendmsg from _syssendmsg+0x190/0x430 __sys_sendmsg from syssendmsg+0x110/0x158 _sys_sendmsg from sys_sendmsg+0xe8/0x150 sys_sendmsg from ret_fast_syscall+0x0/0x1c
This warning is emitted because in the connect path, when trying to parse target BSS parameters, we dereference a RCU pointer whithout being in RCU critical section. Fix RCU dereference usage by moving it to a RCU read critical section. To avoid wrapping the whole wilc_parse_join_bss_param under the critical section, just use the critical section to copy ies data(CVE-2024-27053)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: fix potential "struct net" leak in inet6_rtm_getaddr()
It seems that if userspace provides a correct IFA_TARGET_NETNSID value but no IFA_ADDRESS and IFA_LOCAL attributes, inet6_rtm_getaddr() returns -EINVAL with an elevated "struct net" refcount.(CVE-2024-27417)
In the Linux kernel, the following vulnerability has been resolved:
genirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline
The absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of interrupt affinity reconfiguration via procfs. Instead, the change is deferred until the next instance of the interrupt being triggered on the original CPU.
When the interrupt next triggers on the original CPU, the new affinity is enforced within __irq_move_irq(). A vector is allocated from the new CPU, but the old vector on the original CPU remains and is not immediately reclaimed. Instead, apicd->move_in_progress is flagged, and the reclaiming process is delayed until the next trigger of the interrupt on the new CPU.
Upon the subsequent triggering of the interrupt on the new CPU, irq_complete_move() adds a task to the old CPU's vector_cleanup list if it remains online. Subsequently, the timer on the old CPU iterates over its vector_cleanup list, reclaiming old vectors.
However, a rare scenario arises if the old CPU is outgoing before the interrupt triggers again on the new CPU.
In that case irq_force_complete_move() is not invoked on the outgoing CPU to reclaim the old apicd->prev_vector because the interrupt isn't currently affine to the outgoing CPU, and irq_needs_fixup() returns false. Even though __vector_schedule_cleanup() is later called on the new CPU, it doesn't reclaim apicd->prev_vector; instead, it simply resets both apicd->move_in_progress and apicd->prev_vector to 0.
As a result, the vector remains unreclaimed in vector_matrix, leading to a CPU vector leak.
To address this issue, move the invocation of irq_force_complete_move() before the irq_needs_fixup() call to reclaim apicd->prev_vector, if the interrupt is currently or used to be affine to the outgoing CPU.
Additionally, reclaim the vector in __vector_schedule_cleanup() as well, following a warning message, although theoretically it should never see apicd->move_in_progress with apicd->prev_cpu pointing to an offline CPU.(CVE-2024-31076)
In the Linux kernel, the following vulnerability has been resolved:
wifi: brcmfmac: Fix use-after-free bug in brcmf_cfg80211_detach
This is the candidate patch of CVE-2023-47233 : https://nvd.nist.gov/vuln/detail/CVE-2023-47233
In brcm80211 driver,it starts with the following invoking chain to start init a timeout worker:
->brcmf_usb_probe ->brcmf_usb_probe_cb ->brcmf_attach ->brcmf_bus_started ->brcmf_cfg80211_attach ->wl_init_priv ->brcmf_init_escan ->INIT_WORK(&cfg->escan_timeout_work, brcmf_cfg80211_escan_timeout_worker);
If we disconnect the USB by hotplug, it will call brcmf_usb_disconnect to make cleanup. The invoking chain is :
brcmf_usb_disconnect ->brcmf_usb_disconnect_cb ->brcmf_detach ->brcmf_cfg80211_detach ->kfree(cfg);
While the timeout woker may still be running. This will cause a use-after-free bug on cfg in brcmf_cfg80211_escan_timeout_worker.
Fix it by deleting the timer and canceling the worker in brcmf_cfg80211_detach.
arend.vanspriel@broadcom.com: keep timer delete as is and cancel work just before free
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: amdgpu_ttm_gart_bind set gtt bound flag
Otherwise after the GTT bo is released, the GTT and gart space is freed but amdgpu_ttm_backend_unbind will not clear the gart page table entry and leave valid mapping entry pointing to the stale system page. Then if GPU access the gart address mistakely, it will read undefined value instead page fault, harder to debug and reproduce the real issue.(CVE-2024-35817)
In the Linux kernel, the following vulnerability has been resolved:
media: tc358743: register v4l2 async device only after successful setup
Ensure the device has been setup correctly before registering the v4l2 async device, thus allowing userspace to access.(CVE-2024-35830)
In the Linux kernel, the following vulnerability has been resolved:
dyndbg: fix old BUG_ON in >control parser
Fix a BUG_ON from 2009. Even if it looks "unreachable" (I didn't really look), lets make sure by removing it, doing pr_err and return -EINVAL instead.(CVE-2024-35947)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix division by zero in setup_dsc_config
When slice_height is 0, the division by slice_height in the calculation of the number of slices will cause a division by zero driver crash. This leaves the kernel in a state that requires a reboot. This patch adds a check to avoid the division by zero.
The stack trace below is for the 6.8.4 Kernel. I reproduced the issue on a Z16 Gen 2 Lenovo Thinkpad with a Apple Studio Display monitor connected via Thunderbolt. The amdgpu driver crashed with this exception when I rebooted the system with the monitor connected.
kernel: ? die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434 arch/x86/kernel/dumpstack.c:447) kernel: ? do_trap (arch/x86/kernel/traps.c:113 arch/x86/kernel/traps.c:154) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? do_error_trap (./arch/x86/include/asm/traps.h:58 arch/x86/kernel/traps.c:175) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? exc_divide_error (arch/x86/kernel/traps.c:194 (discriminator 2)) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? asm_exc_divide_error (./arch/x86/include/asm/idtentry.h:548) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: dc_dsc_compute_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1109) amdgpu
After applying this patch, the driver no longer crashes when the monitor is connected and the system is rebooted. I believe this is the same issue reported for 3113.(CVE-2024-36969)
In the Linux kernel, the following vulnerability has been resolved:
net: sched: sch_multiq: fix possible OOB write in multiq_tune()
q->bands will be assigned to qopt->bands to execute subsequent code logic after kmalloc. So the old q->bands should not be used in kmalloc. Otherwise, an out-of-bounds write will occur.(CVE-2024-36978)
In the Linux kernel, the following vulnerability has been resolved:
net: bridge: xmit: make sure we have at least eth header len bytes
syzbot triggered an uninit value[1] error in bridge device's xmit path by sending a short (less than ETH_HLEN bytes) skb. To fix it check if we can actually pull that amount instead of assuming.
Tested with dropwatch: drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3) origin: software timestamp: Mon May 13 11:31:53 2024 778214037 nsec protocol: 0x88a8 length: 2 original length: 2 drop reason: PKT_TOO_SMALL
[1] BUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 __netdev_start_xmit include/linux/netdevice.h:4903 [inline] netdev_start_xmit include/linux/netdevice.h:4917 [inline] xmit_one net/core/dev.c:3531 [inline] dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547 __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341 dev_queue_xmit include/linux/netdevice.h:3091 [inline] __bpf_tx_skb net/core/filter.c:2136 [inline] __bpf_redirect_common net/core/filter.c:2180 [inline] __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187 _bpfclone_redirect net/core/filter.c:2460 [inline] bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432 _bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997 __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238 bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline] __bpf_prog_run include/linux/filter.h:657 [inline] bpf_prog_run include/linux/filter.h:664 [inline] bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425 bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058 bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269 __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678 __do_sys_bpf kernel/bpf/syscall.c:5767 [inline] __se_sys_bpf kernel/bpf/syscall.c:5765 [inline] __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765 x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Fix UAF for cq async event
The refcount of CQ is not protected by locks. When CQ asynchronous events and CQ destruction are concurrent, CQ may have been released, which will cause UAF.
Use the xa_lock() to protect the CQ refcount.(CVE-2024-38545)
In the Linux kernel, the following vulnerability has been resolved:
drm/mediatek: Add 0 size check to mtk_drm_gem_obj
Add a check to mtk_drm_gem_init if we attempt to allocate a GEM object of 0 bytes. Currently, no such check exists and the kernel will panic if a userspace application attempts to allocate a 0x0 GBM buffer.
Tested by attempting to allocate a 0x0 GBM buffer on an MT8188 and verifying that we now return EINVAL.(CVE-2024-38549)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5: Discard command completions in internal error
Fix use after free when FW completion arrives while device is in internal error state. Avoid calling completion handler in this case, since the device will flush the command interface and trigger all completions manually.
Kernel log: ------------[ cut here ]------------ refcount_t: underflow; use-after-free. ... RIP: 0010:refcount_warn_saturate+0xd8/0xe0 ... Call Trace: <IRQ> ? __warn+0x79/0x120 ? refcount_warn_saturate+0xd8/0xe0 ? report_bug+0x17c/0x190 ? handle_bug+0x3c/0x60 ? exc_invalid_op+0x14/0x70 ? asm_exc_invalid_op+0x16/0x20 ? refcount_warn_saturate+0xd8/0xe0 cmd_ent_put+0x13b/0x160 [mlx5_core] mlx5_cmd_comp_handler+0x5f9/0x670 [mlx5_core] cmd_comp_notifier+0x1f/0x30 [mlx5_core] notifier_call_chain+0x35/0xb0 atomic_notifier_call_chain+0x16/0x20 mlx5_eq_async_int+0xf6/0x290 [mlx5_core] notifier_call_chain+0x35/0xb0 atomic_notifier_call_chain+0x16/0x20 irq_int_handler+0x19/0x30 [mlx5_core] __handle_irq_event_percpu+0x4b/0x160 handle_irq_event+0x2e/0x80 handle_edge_irq+0x98/0x230 __common_interrupt+0x3b/0xa0 common_interrupt+0x7b/0xa0 </IRQ> <TASK> asm_common_interrupt+0x22/0x40(CVE-2024-38555)
In the Linux kernel, the following vulnerability has been resolved:
drivers/perf: hisi_pcie: Fix out-of-bound access when valid event group
The perf tool allows users to create event groups through following cmd [1], but the driver does not check whether the array index is out of bounds when writing data to the event_group array. If the number of events in an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write overflow of event_group array occurs.
Add array index check to fix the possible array out of bounds violation, and return directly when write new events are written to array bounds.
There are 9 different events in an event_group. [1] perf stat -e '{pmu/event1/, ... ,pmu/event9/}'(CVE-2024-38569)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Fix deadlock on SRQ async events.
xa_lock for SRQ table may be required in AEQ. Use xa_store_irq()/ xa_erase_irq() to avoid deadlock.(CVE-2024-38591)
In the Linux kernel, the following vulnerability has been resolved:
ring-buffer: Fix a race between readers and resize checks
The reader code in rb_get_reader_page() swaps a new reader page into the ring buffer by doing cmpxchg on old->list.prev->next to point it to the new page. Following that, if the operation is successful, old->list.next->prev gets updated too. This means the underlying doubly-linked list is temporarily inconsistent, page->prev->next or page->next->prev might not be equal back to page for some page in the ring buffer.
The resize operation in ring_buffer_resize() can be invoked in parallel. It calls rb_check_pages() which can detect the described inconsistency and stop further tracing:
[ 190.271762] ------------[ cut here ]------------ [ 190.271771] WARNING: CPU: 1 PID: 6186 at kernel/trace/ring_buffer.c:1467 rb_check_pages.isra.0+0x6a/0xa0 [ 190.271789] Modules linked in: [...] [ 190.271991] Unloaded tainted modules: intel_uncore_frequency(E):1 skx_edac(E):1 [ 190.272002] CPU: 1 PID: 6186 Comm: cmd.sh Kdump: loaded Tainted: G E 6.9.0-rc6-default #5 158d3e1e6d0b091c34c3b96bfd99a1c58306d79f [ 190.272011] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.16.0-0-gd239552c-rebuilt.opensuse.org 04/01/2014 [ 190.272015] RIP: 0010:rb_check_pages.isra.0+0x6a/0xa0 [ 190.272023] Code: [...] [ 190.272028] RSP: 0018:ffff9c37463abb70 EFLAGS: 00010206 [ 190.272034] RAX: ffff8eba04b6cb80 RBX: 0000000000000007 RCX: ffff8eba01f13d80 [ 190.272038] RDX: ffff8eba01f130c0 RSI: ffff8eba04b6cd00 RDI: ffff8eba0004c700 [ 190.272042] RBP: ffff8eba0004c700 R08: 0000000000010002 R09: 0000000000000000 [ 190.272045] R10: 00000000ffff7f52 R11: ffff8eba7f600000 R12: ffff8eba0004c720 [ 190.272049] R13: ffff8eba00223a00 R14: 0000000000000008 R15: ffff8eba067a8000 [ 190.272053] FS: 00007f1bd64752c0(0000) GS:ffff8eba7f680000(0000) knlGS:0000000000000000 [ 190.272057] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 190.272061] CR2: 00007f1bd6662590 CR3: 000000010291e001 CR4: 0000000000370ef0 [ 190.272070] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 190.272073] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 [ 190.272077] Call Trace: [ 190.272098] <TASK> [ 190.272189] ring_buffer_resize+0x2ab/0x460 [ 190.272199] __tracing_resize_ring_buffer.part.0+0x23/0xa0 [ 190.272206] tracing_resize_ring_buffer+0x65/0x90 [ 190.272216] tracing_entries_write+0x74/0xc0 [ 190.272225] vfs_write+0xf5/0x420 [ 190.272248] ksys_write+0x67/0xe0 [ 190.272256] do_syscall_64+0x82/0x170 [ 190.272363] entry_SYSCALL_64_after_hwframe+0x76/0x7e [ 190.272373] RIP: 0033:0x7f1bd657d263 [ 190.272381] Code: [...] [ 190.272385] RSP: 002b:00007ffe72b643f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000001 [ 190.272391] RAX: ffffffffffffffda RBX: 0000000000000002 RCX: 00007f1bd657d263 [ 190.272395] RDX: 0000000000000002 RSI: 0000555a6eb538e0 RDI: 0000000000000001 [ 190.272398] RBP: 0000555a6eb538e0 R08: 000000000000000a R09: 0000000000000000 [ 190.272401] R10: 0000555a6eb55190 R11: 0000000000000246 R12: 00007f1bd6662500 [ 190.272404] R13: 0000000000000002 R14: 00007f1bd6667c00 R15: 0000000000000002 [ 190.272412] </TASK> [ 190.272414] ---[ end trace 0000000000000000 ]---
Note that ring_buffer_resize() calls rb_check_pages() only if the parent trace_buffer has recording disabled. Recent commit d78ab792705c ("tracing: Stop current tracer when resizing buffer") causes that it is now always the case which makes it more likely to experience this issue.
The window to hit this race is nonetheless very small. To help reproducing it, one can add a delay loop in rb_get_reader_page():
ret = rb_head_page_replace(reader, cpu_buffer->reader_page); if (!ret) goto spin; for (unsigned i = 0; i < 1U << 26; i++) / inserted delay loop / asm volatile ("" : : : "memory"); rb_list_head(reader->list.next)->prev = &cpu_buffer->reader_page->list;
.. ---truncated---(CVE-2024-38601)
In the Linux kernel, the following vulnerability has been resolved:
serial: max3100: Lock port->lock when calling uart_handle_cts_change()
uart_handle_cts_change() has to be called with port lock taken, Since we run it in a separate work, the lock may not be taken at the time of running. Make sure that it's taken by explicitly doing that. Without it we got a splat:
WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0 ... Workqueue: max3100-0 max3100_work [max3100] RIP: 0010:uart_handle_cts_change+0xa6/0xb0 ... max3100_handlerx+0xc5/0x110 [max3100] max3100_work+0x12a/0x340 max3100
In the Linux kernel, the following vulnerability has been resolved:
bpf: Allow delete from sockmap/sockhash only if update is allowed
We have seen an influx of syzkaller reports where a BPF program attached to a tracepoint triggers a locking rule violation by performing a map_delete on a sockmap/sockhash.
We don't intend to support this artificial use scenario. Extend the existing verifier allowed-program-type check for updating sockmap/sockhash to also cover deleting from a map.
From now on only BPF programs which were previously allowed to update sockmap/sockhash can delete from these map types.(CVE-2024-38662)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-tools-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-tools-devel-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"python3-perf-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-source-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.82.0.163.oe2203sp1.src.rpm"
],
"x86_64": [
"kernel-tools-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-debugsource-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.82.0.163.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: SOF: Fix DSP oops stack dump output contents\r\n\r\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output.(CVE-2021-47381)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: iscsi: Fix iscsi_task use after free\r\n\r\nCommit d39df158518c (\u0026quot;scsi: iscsi: Have abort handler get ref to conn\u0026quot;)\nadded iscsi_get_conn()/iscsi_put_conn() calls during abort handling but\nthen also changed the handling of the case where we detect an already\ncompleted task where we now end up doing a goto to the common put/cleanup\ncode. This results in a iscsi_task use after free, because the common\ncleanup code will do a put on the iscsi_task.\r\n\r\nThis reverts the goto and moves the iscsi_get_conn() to after we\u0026apos;ve checked\nif the iscsi_task is valid.(CVE-2021-47427)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nspi: Fix deadlock when adding SPI controllers on SPI buses\r\n\r\nCurrently we have a global spi_add_lock which we take when adding new\ndevices so that we can check that we\u0026apos;re not trying to reuse a chip\nselect that\u0026apos;s already controlled. This means that if the SPI device is\nitself a SPI controller and triggers the instantiation of further SPI\ndevices we trigger a deadlock as we try to register and instantiate\nthose devices while in the process of doing so for the parent controller\nand hence already holding the global spi_add_lock. Since we only care\nabout concurrency within a single SPI bus move the lock to be per\ncontroller, avoiding the deadlock.\r\n\r\nThis can be easily triggered in the case of spi-mux.(CVE-2021-47469)\r\n\r\n(CVE-2023-39180)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc/powernv: Add a null pointer check in opal_powercap_init()\r\n\r\nkasprintf() returns a pointer to dynamically allocated memory\nwhich can be NULL upon failure.(CVE-2023-52696)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ni2c: core: Run atomic i2c xfer when !preemptible\r\n\r\nSince bae1d3a05a8b, i2c transfers are non-atomic if preemption is\ndisabled. However, non-atomic i2c transfers require preemption (e.g. in\nwait_for_completion() while waiting for the DMA).\r\n\r\npanic() calls preempt_disable_notrace() before calling\nemergency_restart(). Therefore, if an i2c device is used for the\nrestart, the xfer should be atomic. This avoids warnings like:\r\n\r\n[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0\n[ 12.676926] Voluntary context switch within RCU read-side critical section!\n...\n[ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114\n[ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70\n...\n[ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58\n[ 13.001050] machine_restart from panic+0x2a8/0x32c\r\n\r\nUse !preemptible() instead, which is basically the same check as\npre-v5.2.(CVE-2023-52791)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhid: cp2112: Fix duplicate workqueue initialization\r\n\r\nPreviously the cp2112 driver called INIT_DELAYED_WORK within\ncp2112_gpio_irq_startup, resulting in duplicate initilizations of the\nworkqueue on subsequent IRQ startups following an initial request. This\nresulted in a warning in set_work_data in workqueue.c, as well as a rare\nNULL dereference within process_one_work in workqueue.c.\r\n\r\nInitialize the workqueue within _probe instead.(CVE-2023-52853)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: fix UAF issue in ksmbd_tcp_new_connection()\r\n\r\nThe race is between the handling of a new TCP connection and\nits disconnection. It leads to UAF on `struct tcp_transport` in\nksmbd_tcp_new_connection() function.(CVE-2024-26592)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/ipv6: avoid possible UAF in ip6_route_mpath_notify()\r\n\r\nsyzbot found another use-after-free in ip6_route_mpath_notify() [1]\r\n\r\nCommit f7225172f25a (\u0026quot;net/ipv6: prevent use after free in\nip6_route_mpath_notify\u0026quot;) was not able to fix the root cause.\r\n\r\nWe need to defer the fib6_info_release() calls after\nip6_route_mpath_notify(), in the cleanup phase.\r\n\r\n[1]\nBUG: KASAN: slab-use-after-free in rt6_fill_node+0x1460/0x1ac0\nRead of size 4 at addr ffff88809a07fc64 by task syz-executor.2/23037\r\n\r\nCPU: 0 PID: 23037 Comm: syz-executor.2 Not tainted 6.8.0-rc4-syzkaller-01035-gea7f3cfaa588 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/25/2024\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x1e7/0x2e0 lib/dump_stack.c:106\n print_address_description mm/kasan/report.c:377 [inline]\n print_report+0x167/0x540 mm/kasan/report.c:488\n kasan_report+0x142/0x180 mm/kasan/report.c:601\n rt6_fill_node+0x1460/0x1ac0\n inet6_rt_notify+0x13b/0x290 net/ipv6/route.c:6184\n ip6_route_mpath_notify net/ipv6/route.c:5198 [inline]\n ip6_route_multipath_add net/ipv6/route.c:5404 [inline]\n inet6_rtm_newroute+0x1d0f/0x2300 net/ipv6/route.c:5517\n rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597\n netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543\n netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline]\n netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367\n netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x221/0x270 net/socket.c:745\n ____sys_sendmsg+0x525/0x7d0 net/socket.c:2584\n ___sys_sendmsg net/socket.c:2638 [inline]\n __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667\n do_syscall_64+0xf9/0x240\n entry_SYSCALL_64_after_hwframe+0x6f/0x77\nRIP: 0033:0x7f73dd87dda9\nCode: 28 00 00 00 75 05 48 83 c4 28 c3 e8 e1 20 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48\nRSP: 002b:00007f73de6550c8 EFLAGS: 00000246 ORIG_RAX: 000000000000002e\nRAX: ffffffffffffffda RBX: 00007f73dd9ac050 RCX: 00007f73dd87dda9\nRDX: 0000000000000000 RSI: 0000000020000140 RDI: 0000000000000005\nRBP: 00007f73dd8ca47a R08: 0000000000000000 R09: 0000000000000000\nR10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000\nR13: 000000000000006e R14: 00007f73dd9ac050 R15: 00007ffdbdeb7858\n \u0026lt;/TASK\u0026gt;\r\n\r\nAllocated by task 23037:\n kasan_save_stack mm/kasan/common.c:47 [inline]\n kasan_save_track+0x3f/0x80 mm/kasan/common.c:68\n poison_kmalloc_redzone mm/kasan/common.c:372 [inline]\n __kasan_kmalloc+0x98/0xb0 mm/kasan/common.c:389\n kasan_kmalloc include/linux/kasan.h:211 [inline]\n __do_kmalloc_node mm/slub.c:3981 [inline]\n __kmalloc+0x22e/0x490 mm/slub.c:3994\n kmalloc include/linux/slab.h:594 [inline]\n kzalloc include/linux/slab.h:711 [inline]\n fib6_info_alloc+0x2e/0xf0 net/ipv6/ip6_fib.c:155\n ip6_route_info_create+0x445/0x12b0 net/ipv6/route.c:3758\n ip6_route_multipath_add net/ipv6/route.c:5298 [inline]\n inet6_rtm_newroute+0x744/0x2300 net/ipv6/route.c:5517\n rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597\n netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543\n netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline]\n netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367\n netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x221/0x270 net/socket.c:745\n ____sys_sendmsg+0x525/0x7d0 net/socket.c:2584\n ___sys_sendmsg net/socket.c:2638 [inline]\n __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667\n do_syscall_64+0xf9/0x240\n entry_SYSCALL_64_after_hwframe+0x6f/0x77\r\n\r\nFreed by task 16:\n kasan_save_stack mm/kasan/common.c:47 [inline]\n kasan_save_track+0x3f/0x80 mm/kasan/common.c:68\n kasan_save_free_info+0x4e/0x60 mm/kasan/generic.c:640\n poison_slab_object+0xa6/0xe0 m\n---truncated---(CVE-2024-26852)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninet: inet_defrag: prevent sk release while still in use\r\n\r\nip_local_out() and other functions can pass skb-\u0026gt;sk as function argument.\r\n\r\nIf the skb is a fragment and reassembly happens before such function call\nreturns, the sk must not be released.\r\n\r\nThis affects skb fragments reassembled via netfilter or similar\nmodules, e.g. openvswitch or ct_act.c, when run as part of tx pipeline.\r\n\r\nEric Dumazet made an initial analysis of this bug. Quoting Eric:\n Calling ip_defrag() in output path is also implying skb_orphan(),\n which is buggy because output path relies on sk not disappearing.\r\n\r\n A relevant old patch about the issue was :\n 8282f27449bf (\u0026quot;inet: frag: Always orphan skbs inside ip_defrag()\u0026quot;)\r\n\r\n [..]\r\n\r\n net/ipv4/ip_output.c depends on skb-\u0026gt;sk being set, and probably to an\n inet socket, not an arbitrary one.\r\n\r\n If we orphan the packet in ipvlan, then downstream things like FQ\n packet scheduler will not work properly.\r\n\r\n We need to change ip_defrag() to only use skb_orphan() when really\n needed, ie whenever frag_list is going to be used.\r\n\r\nEric suggested to stash sk in fragment queue and made an initial patch.\nHowever there is a problem with this:\r\n\r\nIf skb is refragmented again right after, ip_do_fragment() will copy\nhead-\u0026gt;sk to the new fragments, and sets up destructor to sock_wfree.\nIOW, we have no choice but to fix up sk_wmem accouting to reflect the\nfully reassembled skb, else wmem will underflow.\r\n\r\nThis change moves the orphan down into the core, to last possible moment.\nAs ip_defrag_offset is aliased with sk_buff-\u0026gt;sk member, we must move the\noffset into the FRAG_CB, else skb-\u0026gt;sk gets clobbered.\r\n\r\nThis allows to delay the orphaning long enough to learn if the skb has\nto be queued or if the skb is completing the reasm queue.\r\n\r\nIn the former case, things work as before, skb is orphaned. This is\nsafe because skb gets queued/stolen and won\u0026apos;t continue past reasm engine.\r\n\r\nIn the latter case, we will steal the skb-\u0026gt;sk reference, reattach it to\nthe head skb, and fix up wmem accouting when inet_frag inflates truesize.(CVE-2024-26921)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: core: Fix unremoved procfs host directory regression\r\n\r\nCommit fc663711b944 (\u0026quot;scsi: core: Remove the /proc/scsi/${proc_name}\ndirectory earlier\u0026quot;) fixed a bug related to modules loading/unloading, by\nadding a call to scsi_proc_hostdir_rm() on scsi_remove_host(). But that led\nto a potential duplicate call to the hostdir_rm() routine, since it\u0026apos;s also\ncalled from scsi_host_dev_release(). That triggered a regression report,\nwhich was then fixed by commit be03df3d4bfe (\u0026quot;scsi: core: Fix a procfs host\ndirectory removal regression\u0026quot;). The fix just dropped the hostdir_rm() call\nfrom dev_release().\r\n\r\nBut it happens that this proc directory is created on scsi_host_alloc(),\nand that function \u0026quot;pairs\u0026quot; with scsi_host_dev_release(), while\nscsi_remove_host() pairs with scsi_add_host(). In other words, it seems the\nreason for removing the proc directory on dev_release() was meant to cover\ncases in which a SCSI host structure was allocated, but the call to\nscsi_add_host() didn\u0026apos;t happen. And that pattern happens to exist in some\nerror paths, for example.\r\n\r\nSyzkaller causes that by using USB raw gadget device, error\u0026apos;ing on\nusb-storage driver, at usb_stor_probe2(). By checking that path, we can see\nthat the BadDevice label leads to a scsi_host_put() after a SCSI host\nallocation, but there\u0026apos;s no call to scsi_add_host() in such path. That leads\nto messages like this in dmesg (and a leak of the SCSI host proc\nstructure):\r\n\r\nusb-storage 4-1:87.51: USB Mass Storage device detected\nproc_dir_entry \u0026apos;scsi/usb-storage\u0026apos; already registered\nWARNING: CPU: 1 PID: 3519 at fs/proc/generic.c:377 proc_register+0x347/0x4e0 fs/proc/generic.c:376\r\n\r\nThe proper fix seems to still call scsi_proc_hostdir_rm() on dev_release(),\nbut guard that with the state check for SHOST_CREATED; there is even a\ncomment in scsi_host_dev_release() detailing that: such conditional is\nmeant for cases where the SCSI host was allocated but there was no calls to\n{add,remove}_host(), like the usb-storage case.\r\n\r\nThis is what we propose here and with that, the error path of usb-storage\ndoes not trigger the warning anymore.(CVE-2024-26935)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninit/main.c: Fix potential static_command_line memory overflow\r\n\r\nWe allocate memory of size \u0026apos;xlen + strlen(boot_command_line) + 1\u0026apos; for\nstatic_command_line, but the strings copied into static_command_line are\nextra_command_line and command_line, rather than extra_command_line and\nboot_command_line.\r\n\r\nWhen strlen(command_line) \u0026gt; strlen(boot_command_line), static_command_line\nwill overflow.\r\n\r\nThis patch just recovers strlen(command_line) which was miss-consolidated\nwith strlen(boot_command_line) in the commit f5c7310ac73e (\u0026quot;init/main: add\nchecks for the return value of memblock_alloc*()\u0026quot;)(CVE-2024-26988)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: fix to avoid potential panic during recovery\r\n\r\nDuring recovery, if FAULT_BLOCK is on, it is possible that\nf2fs_reserve_new_block() will return -ENOSPC during recovery,\nthen it may trigger panic.\r\n\r\nAlso, if fault injection rate is 1 and only FAULT_BLOCK fault\ntype is on, it may encounter deadloop in loop of block reservation.\r\n\r\nLet\u0026apos;s change as below to fix these issues:\n- remove bug_on() to avoid panic.\n- limit the loop count of block reservation to avoid potential\ndeadloop.(CVE-2024-27032)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: Fix clk_core_get NULL dereference\r\n\r\nIt is possible for clk_core_get to dereference a NULL in the following\nsequence:\r\n\r\nclk_core_get()\n of_clk_get_hw_from_clkspec()\n __of_clk_get_hw_from_provider()\n __clk_get_hw()\r\n\r\n__clk_get_hw() can return NULL which is dereferenced by clk_core_get() at\nhw-\u0026gt;core.\r\n\r\nPrior to commit dde4eff47c82 (\u0026quot;clk: Look for parents with clkdev based\nclk_lookups\u0026quot;) the check IS_ERR_OR_NULL() was performed which would have\ncaught the NULL.\r\n\r\nReading the description of this function it talks about returning NULL but\nthat cannot be so at the moment.\r\n\r\nUpdate the function to check for hw before dereferencing it and return NULL\nif hw is NULL.(CVE-2024-27038)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: phy: fix phy_get_internal_delay accessing an empty array\r\n\r\nThe phy_get_internal_delay function could try to access to an empty\narray in the case that the driver is calling phy_get_internal_delay\nwithout defining delay_values and rx-internal-delay-ps or\ntx-internal-delay-ps is defined to 0 in the device-tree.\nThis will lead to \u0026quot;unable to handle kernel NULL pointer dereference at\nvirtual address 0\u0026quot;. To avoid this kernel oops, the test should be delay\n\u0026gt;= 0. As there is already delay \u0026lt; 0 test just before, the test could\nonly be size == 0.(CVE-2024-27047)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: rtl8xxxu: add cancel_work_sync() for c2hcmd_work\r\n\r\nThe workqueue might still be running, when the driver is stopped. To\navoid a use-after-free, call cancel_work_sync() in rtl8xxxu_stop().(CVE-2024-27052)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: wilc1000: fix RCU usage in connect path\r\n\r\nWith lockdep enabled, calls to the connect function from cfg802.11 layer\nlead to the following warning:\r\n\r\n=============================\nWARNING: suspicious RCU usage\n6.7.0-rc1-wt+ #333 Not tainted\n-----------------------------\ndrivers/net/wireless/microchip/wilc1000/hif.c:386\nsuspicious rcu_dereference_check() usage!\n[...]\nstack backtrace:\nCPU: 0 PID: 100 Comm: wpa_supplicant Not tainted 6.7.0-rc1-wt+ #333\nHardware name: Atmel SAMA5\n unwind_backtrace from show_stack+0x18/0x1c\n show_stack from dump_stack_lvl+0x34/0x48\n dump_stack_lvl from wilc_parse_join_bss_param+0x7dc/0x7f4\n wilc_parse_join_bss_param from connect+0x2c4/0x648\n connect from cfg80211_connect+0x30c/0xb74\n cfg80211_connect from nl80211_connect+0x860/0xa94\n nl80211_connect from genl_rcv_msg+0x3fc/0x59c\n genl_rcv_msg from netlink_rcv_skb+0xd0/0x1f8\n netlink_rcv_skb from genl_rcv+0x2c/0x3c\n genl_rcv from netlink_unicast+0x3b0/0x550\n netlink_unicast from netlink_sendmsg+0x368/0x688\n netlink_sendmsg from ____sys_sendmsg+0x190/0x430\n ____sys_sendmsg from ___sys_sendmsg+0x110/0x158\n ___sys_sendmsg from sys_sendmsg+0xe8/0x150\n sys_sendmsg from ret_fast_syscall+0x0/0x1c\r\n\r\nThis warning is emitted because in the connect path, when trying to parse\ntarget BSS parameters, we dereference a RCU pointer whithout being in RCU\ncritical section.\nFix RCU dereference usage by moving it to a RCU read critical section. To\navoid wrapping the whole wilc_parse_join_bss_param under the critical\nsection, just use the critical section to copy ies data(CVE-2024-27053)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: fix potential \u0026quot;struct net\u0026quot; leak in inet6_rtm_getaddr()\r\n\r\nIt seems that if userspace provides a correct IFA_TARGET_NETNSID value\nbut no IFA_ADDRESS and IFA_LOCAL attributes, inet6_rtm_getaddr()\nreturns -EINVAL with an elevated \u0026quot;struct net\u0026quot; refcount.(CVE-2024-27417)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngenirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline\r\n\r\nThe absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of\ninterrupt affinity reconfiguration via procfs. Instead, the change is\ndeferred until the next instance of the interrupt being triggered on the\noriginal CPU.\r\n\r\nWhen the interrupt next triggers on the original CPU, the new affinity is\nenforced within __irq_move_irq(). A vector is allocated from the new CPU,\nbut the old vector on the original CPU remains and is not immediately\nreclaimed. Instead, apicd-\u0026gt;move_in_progress is flagged, and the reclaiming\nprocess is delayed until the next trigger of the interrupt on the new CPU.\r\n\r\nUpon the subsequent triggering of the interrupt on the new CPU,\nirq_complete_move() adds a task to the old CPU\u0026apos;s vector_cleanup list if it\nremains online. Subsequently, the timer on the old CPU iterates over its\nvector_cleanup list, reclaiming old vectors.\r\n\r\nHowever, a rare scenario arises if the old CPU is outgoing before the\ninterrupt triggers again on the new CPU.\r\n\r\nIn that case irq_force_complete_move() is not invoked on the outgoing CPU\nto reclaim the old apicd-\u0026gt;prev_vector because the interrupt isn\u0026apos;t currently\naffine to the outgoing CPU, and irq_needs_fixup() returns false. Even\nthough __vector_schedule_cleanup() is later called on the new CPU, it\ndoesn\u0026apos;t reclaim apicd-\u0026gt;prev_vector; instead, it simply resets both\napicd-\u0026gt;move_in_progress and apicd-\u0026gt;prev_vector to 0.\r\n\r\nAs a result, the vector remains unreclaimed in vector_matrix, leading to a\nCPU vector leak.\r\n\r\nTo address this issue, move the invocation of irq_force_complete_move()\nbefore the irq_needs_fixup() call to reclaim apicd-\u0026gt;prev_vector, if the\ninterrupt is currently or used to be affine to the outgoing CPU.\r\n\r\nAdditionally, reclaim the vector in __vector_schedule_cleanup() as well,\nfollowing a warning message, although theoretically it should never see\napicd-\u0026gt;move_in_progress with apicd-\u0026gt;prev_cpu pointing to an offline CPU.(CVE-2024-31076)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: brcmfmac: Fix use-after-free bug in brcmf_cfg80211_detach\r\n\r\nThis is the candidate patch of CVE-2023-47233 :\nhttps://nvd.nist.gov/vuln/detail/CVE-2023-47233\r\n\r\nIn brcm80211 driver,it starts with the following invoking chain\nto start init a timeout worker:\r\n\r\n-\u0026gt;brcmf_usb_probe\n -\u0026gt;brcmf_usb_probe_cb\n -\u0026gt;brcmf_attach\n -\u0026gt;brcmf_bus_started\n -\u0026gt;brcmf_cfg80211_attach\n -\u0026gt;wl_init_priv\n -\u0026gt;brcmf_init_escan\n -\u0026gt;INIT_WORK(\u0026amp;cfg-\u0026gt;escan_timeout_work,\n\t\t brcmf_cfg80211_escan_timeout_worker);\r\n\r\nIf we disconnect the USB by hotplug, it will call\nbrcmf_usb_disconnect to make cleanup. The invoking chain is :\r\n\r\nbrcmf_usb_disconnect\n -\u0026gt;brcmf_usb_disconnect_cb\n -\u0026gt;brcmf_detach\n -\u0026gt;brcmf_cfg80211_detach\n -\u0026gt;kfree(cfg);\r\n\r\nWhile the timeout woker may still be running. This will cause\na use-after-free bug on cfg in brcmf_cfg80211_escan_timeout_worker.\r\n\r\nFix it by deleting the timer and canceling the worker in\nbrcmf_cfg80211_detach.\r\n\r\n[arend.vanspriel@broadcom.com: keep timer delete as is and cancel work just before free](CVE-2024-35811)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: amdgpu_ttm_gart_bind set gtt bound flag\r\n\r\nOtherwise after the GTT bo is released, the GTT and gart space is freed\nbut amdgpu_ttm_backend_unbind will not clear the gart page table entry\nand leave valid mapping entry pointing to the stale system page. Then\nif GPU access the gart address mistakely, it will read undefined value\ninstead page fault, harder to debug and reproduce the real issue.(CVE-2024-35817)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: tc358743: register v4l2 async device only after successful setup\r\n\r\nEnsure the device has been setup correctly before registering the v4l2\nasync device, thus allowing userspace to access.(CVE-2024-35830)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndyndbg: fix old BUG_ON in \u0026gt;control parser\r\n\r\nFix a BUG_ON from 2009. Even if it looks \u0026quot;unreachable\u0026quot; (I didn\u0026apos;t\nreally look), lets make sure by removing it, doing pr_err and return\n-EINVAL instead.(CVE-2024-35947)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix division by zero in setup_dsc_config\r\n\r\nWhen slice_height is 0, the division by slice_height in the calculation\nof the number of slices will cause a division by zero driver crash. This\nleaves the kernel in a state that requires a reboot. This patch adds a\ncheck to avoid the division by zero.\r\n\r\nThe stack trace below is for the 6.8.4 Kernel. I reproduced the issue on\na Z16 Gen 2 Lenovo Thinkpad with a Apple Studio Display monitor\nconnected via Thunderbolt. The amdgpu driver crashed with this exception\nwhen I rebooted the system with the monitor connected.\r\n\r\nkernel: ? die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434 arch/x86/kernel/dumpstack.c:447)\nkernel: ? do_trap (arch/x86/kernel/traps.c:113 arch/x86/kernel/traps.c:154)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? do_error_trap (./arch/x86/include/asm/traps.h:58 arch/x86/kernel/traps.c:175)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? exc_divide_error (arch/x86/kernel/traps.c:194 (discriminator 2))\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? asm_exc_divide_error (./arch/x86/include/asm/idtentry.h:548)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: dc_dsc_compute_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1109) amdgpu\r\n\r\nAfter applying this patch, the driver no longer crashes when the monitor\nis connected and the system is rebooted. I believe this is the same\nissue reported for 3113.(CVE-2024-36969)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: sched: sch_multiq: fix possible OOB write in multiq_tune()\r\n\r\nq-\u0026gt;bands will be assigned to qopt-\u0026gt;bands to execute subsequent code logic\nafter kmalloc. So the old q-\u0026gt;bands should not be used in kmalloc.\nOtherwise, an out-of-bounds write will occur.(CVE-2024-36978)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: bridge: xmit: make sure we have at least eth header len bytes\r\n\r\nsyzbot triggered an uninit value[1] error in bridge device\u0026apos;s xmit path\nby sending a short (less than ETH_HLEN bytes) skb. To fix it check if\nwe can actually pull that amount instead of assuming.\r\n\r\nTested with dropwatch:\n drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3)\n origin: software\n timestamp: Mon May 13 11:31:53 2024 778214037 nsec\n protocol: 0x88a8\n length: 2\n original length: 2\n drop reason: PKT_TOO_SMALL\r\n\r\n[1]\nBUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n __netdev_start_xmit include/linux/netdevice.h:4903 [inline]\n netdev_start_xmit include/linux/netdevice.h:4917 [inline]\n xmit_one net/core/dev.c:3531 [inline]\n dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547\n __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341\n dev_queue_xmit include/linux/netdevice.h:3091 [inline]\n __bpf_tx_skb net/core/filter.c:2136 [inline]\n __bpf_redirect_common net/core/filter.c:2180 [inline]\n __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187\n ____bpf_clone_redirect net/core/filter.c:2460 [inline]\n bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432\n ___bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997\n __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238\n bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline]\n __bpf_prog_run include/linux/filter.h:657 [inline]\n bpf_prog_run include/linux/filter.h:664 [inline]\n bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425\n bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058\n bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269\n __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678\n __do_sys_bpf kernel/bpf/syscall.c:5767 [inline]\n __se_sys_bpf kernel/bpf/syscall.c:5765 [inline]\n __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765\n x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Fix UAF for cq async event\r\n\r\nThe refcount of CQ is not protected by locks. When CQ asynchronous\nevents and CQ destruction are concurrent, CQ may have been released,\nwhich will cause UAF.\r\n\r\nUse the xa_lock() to protect the CQ refcount.(CVE-2024-38545)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/mediatek: Add 0 size check to mtk_drm_gem_obj\r\n\r\nAdd a check to mtk_drm_gem_init if we attempt to allocate a GEM object\nof 0 bytes. Currently, no such check exists and the kernel will panic if\na userspace application attempts to allocate a 0x0 GBM buffer.\r\n\r\nTested by attempting to allocate a 0x0 GBM buffer on an MT8188 and\nverifying that we now return EINVAL.(CVE-2024-38549)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/mlx5: Discard command completions in internal error\r\n\r\nFix use after free when FW completion arrives while device is in\ninternal error state. Avoid calling completion handler in this case,\nsince the device will flush the command interface and trigger all\ncompletions manually.\r\n\r\nKernel log:\n------------[ cut here ]------------\nrefcount_t: underflow; use-after-free.\n...\nRIP: 0010:refcount_warn_saturate+0xd8/0xe0\n...\nCall Trace:\n\u0026lt;IRQ\u0026gt;\n? __warn+0x79/0x120\n? refcount_warn_saturate+0xd8/0xe0\n? report_bug+0x17c/0x190\n? handle_bug+0x3c/0x60\n? exc_invalid_op+0x14/0x70\n? asm_exc_invalid_op+0x16/0x20\n? refcount_warn_saturate+0xd8/0xe0\ncmd_ent_put+0x13b/0x160 [mlx5_core]\nmlx5_cmd_comp_handler+0x5f9/0x670 [mlx5_core]\ncmd_comp_notifier+0x1f/0x30 [mlx5_core]\nnotifier_call_chain+0x35/0xb0\natomic_notifier_call_chain+0x16/0x20\nmlx5_eq_async_int+0xf6/0x290 [mlx5_core]\nnotifier_call_chain+0x35/0xb0\natomic_notifier_call_chain+0x16/0x20\nirq_int_handler+0x19/0x30 [mlx5_core]\n__handle_irq_event_percpu+0x4b/0x160\nhandle_irq_event+0x2e/0x80\nhandle_edge_irq+0x98/0x230\n__common_interrupt+0x3b/0xa0\ncommon_interrupt+0x7b/0xa0\n\u0026lt;/IRQ\u0026gt;\n\u0026lt;TASK\u0026gt;\nasm_common_interrupt+0x22/0x40(CVE-2024-38555)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrivers/perf: hisi_pcie: Fix out-of-bound access when valid event group\r\n\r\nThe perf tool allows users to create event groups through following\ncmd [1], but the driver does not check whether the array index is out of\nbounds when writing data to the event_group array. If the number of events\nin an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write\noverflow of event_group array occurs.\r\n\r\nAdd array index check to fix the possible array out of bounds violation,\nand return directly when write new events are written to array bounds.\r\n\r\nThere are 9 different events in an event_group.\n[1] perf stat -e \u0026apos;{pmu/event1/, ... ,pmu/event9/}\u0026apos;(CVE-2024-38569)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Fix deadlock on SRQ async events.\r\n\r\nxa_lock for SRQ table may be required in AEQ. Use xa_store_irq()/\nxa_erase_irq() to avoid deadlock.(CVE-2024-38591)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nring-buffer: Fix a race between readers and resize checks\r\n\r\nThe reader code in rb_get_reader_page() swaps a new reader page into the\nring buffer by doing cmpxchg on old-\u0026gt;list.prev-\u0026gt;next to point it to the\nnew page. Following that, if the operation is successful,\nold-\u0026gt;list.next-\u0026gt;prev gets updated too. This means the underlying\ndoubly-linked list is temporarily inconsistent, page-\u0026gt;prev-\u0026gt;next or\npage-\u0026gt;next-\u0026gt;prev might not be equal back to page for some page in the\nring buffer.\r\n\r\nThe resize operation in ring_buffer_resize() can be invoked in parallel.\nIt calls rb_check_pages() which can detect the described inconsistency\nand stop further tracing:\r\n\r\n[ 190.271762] ------------[ cut here ]------------\n[ 190.271771] WARNING: CPU: 1 PID: 6186 at kernel/trace/ring_buffer.c:1467 rb_check_pages.isra.0+0x6a/0xa0\n[ 190.271789] Modules linked in: [...]\n[ 190.271991] Unloaded tainted modules: intel_uncore_frequency(E):1 skx_edac(E):1\n[ 190.272002] CPU: 1 PID: 6186 Comm: cmd.sh Kdump: loaded Tainted: G E 6.9.0-rc6-default #5 158d3e1e6d0b091c34c3b96bfd99a1c58306d79f\n[ 190.272011] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.16.0-0-gd239552c-rebuilt.opensuse.org 04/01/2014\n[ 190.272015] RIP: 0010:rb_check_pages.isra.0+0x6a/0xa0\n[ 190.272023] Code: [...]\n[ 190.272028] RSP: 0018:ffff9c37463abb70 EFLAGS: 00010206\n[ 190.272034] RAX: ffff8eba04b6cb80 RBX: 0000000000000007 RCX: ffff8eba01f13d80\n[ 190.272038] RDX: ffff8eba01f130c0 RSI: ffff8eba04b6cd00 RDI: ffff8eba0004c700\n[ 190.272042] RBP: ffff8eba0004c700 R08: 0000000000010002 R09: 0000000000000000\n[ 190.272045] R10: 00000000ffff7f52 R11: ffff8eba7f600000 R12: ffff8eba0004c720\n[ 190.272049] R13: ffff8eba00223a00 R14: 0000000000000008 R15: ffff8eba067a8000\n[ 190.272053] FS: 00007f1bd64752c0(0000) GS:ffff8eba7f680000(0000) knlGS:0000000000000000\n[ 190.272057] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 190.272061] CR2: 00007f1bd6662590 CR3: 000000010291e001 CR4: 0000000000370ef0\n[ 190.272070] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n[ 190.272073] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n[ 190.272077] Call Trace:\n[ 190.272098] \u0026lt;TASK\u0026gt;\n[ 190.272189] ring_buffer_resize+0x2ab/0x460\n[ 190.272199] __tracing_resize_ring_buffer.part.0+0x23/0xa0\n[ 190.272206] tracing_resize_ring_buffer+0x65/0x90\n[ 190.272216] tracing_entries_write+0x74/0xc0\n[ 190.272225] vfs_write+0xf5/0x420\n[ 190.272248] ksys_write+0x67/0xe0\n[ 190.272256] do_syscall_64+0x82/0x170\n[ 190.272363] entry_SYSCALL_64_after_hwframe+0x76/0x7e\n[ 190.272373] RIP: 0033:0x7f1bd657d263\n[ 190.272381] Code: [...]\n[ 190.272385] RSP: 002b:00007ffe72b643f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000001\n[ 190.272391] RAX: ffffffffffffffda RBX: 0000000000000002 RCX: 00007f1bd657d263\n[ 190.272395] RDX: 0000000000000002 RSI: 0000555a6eb538e0 RDI: 0000000000000001\n[ 190.272398] RBP: 0000555a6eb538e0 R08: 000000000000000a R09: 0000000000000000\n[ 190.272401] R10: 0000555a6eb55190 R11: 0000000000000246 R12: 00007f1bd6662500\n[ 190.272404] R13: 0000000000000002 R14: 00007f1bd6667c00 R15: 0000000000000002\n[ 190.272412] \u0026lt;/TASK\u0026gt;\n[ 190.272414] ---[ end trace 0000000000000000 ]---\r\n\r\nNote that ring_buffer_resize() calls rb_check_pages() only if the parent\ntrace_buffer has recording disabled. Recent commit d78ab792705c\n(\u0026quot;tracing: Stop current tracer when resizing buffer\u0026quot;) causes that it is\nnow always the case which makes it more likely to experience this issue.\r\n\r\nThe window to hit this race is nonetheless very small. To help\nreproducing it, one can add a delay loop in rb_get_reader_page():\r\n\r\n ret = rb_head_page_replace(reader, cpu_buffer-\u0026gt;reader_page);\n if (!ret)\n \tgoto spin;\n for (unsigned i = 0; i \u0026lt; 1U \u0026lt;\u0026lt; 26; i++) /* inserted delay loop */\n \t__asm__ __volatile__ (\u0026quot;\u0026quot; : : : \u0026quot;memory\u0026quot;);\n rb_list_head(reader-\u0026gt;list.next)-\u0026gt;prev = \u0026amp;cpu_buffer-\u0026gt;reader_page-\u0026gt;list;\r\n\r\n.. \n---truncated---(CVE-2024-38601)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: max3100: Lock port-\u0026gt;lock when calling uart_handle_cts_change()\r\n\r\nuart_handle_cts_change() has to be called with port lock taken,\nSince we run it in a separate work, the lock may not be taken at\nthe time of running. Make sure that it\u0026apos;s taken by explicitly doing\nthat. Without it we got a splat:\r\n\r\n WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0\n ...\n Workqueue: max3100-0 max3100_work [max3100]\n RIP: 0010:uart_handle_cts_change+0xa6/0xb0\n ...\n max3100_handlerx+0xc5/0x110 [max3100]\n max3100_work+0x12a/0x340 [max3100](CVE-2024-38634)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Allow delete from sockmap/sockhash only if update is allowed\r\n\r\nWe have seen an influx of syzkaller reports where a BPF program attached to\na tracepoint triggers a locking rule violation by performing a map_delete\non a sockmap/sockhash.\r\n\r\nWe don\u0026apos;t intend to support this artificial use scenario. Extend the\nexisting verifier allowed-program-type check for updating sockmap/sockhash\nto also cover deleting from a map.\r\n\r\nFrom now on only BPF programs which were previously allowed to update\nsockmap/sockhash can delete from these map types.(CVE-2024-38662)",
"id": "OESA-2024-1768",
"modified": "2026-08-06T11:07:14Z",
"published": "2024-06-28T11:07:14Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1768"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47381"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47427"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47469"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-39180"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52696"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52791"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26592"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26852"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26921"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26935"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26988"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27032"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27038"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27047"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27053"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27417"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-31076"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35811"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35817"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35830"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36969"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36978"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38538"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38545"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38549"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38555"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38569"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38591"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38601"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38634"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38662"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47381",
"CVE-2021-47427",
"CVE-2021-47469",
"CVE-2023-39180",
"CVE-2023-52696",
"CVE-2023-52791",
"CVE-2023-52853",
"CVE-2024-26592",
"CVE-2024-26852",
"CVE-2024-26921",
"CVE-2024-26935",
"CVE-2024-26988",
"CVE-2024-27032",
"CVE-2024-27038",
"CVE-2024-27047",
"CVE-2024-27052",
"CVE-2024-27053",
"CVE-2024-27417",
"CVE-2024-31076",
"CVE-2024-35811",
"CVE-2024-35817",
"CVE-2024-35830",
"CVE-2024-35947",
"CVE-2024-36969",
"CVE-2024-36978",
"CVE-2024-38538",
"CVE-2024-38545",
"CVE-2024-38549",
"CVE-2024-38555",
"CVE-2024-38569",
"CVE-2024-38591",
"CVE-2024-38601",
"CVE-2024-38634",
"CVE-2024-38662"
]
}
RHSA-2024:5101
Vulnerability from csaf_opensuse - Published: 2024-08-08 00:00 - Updated: 2026-09-20 11:41RHSA-2024:5102
Vulnerability from csaf_redhat - Published: 2024-08-08 04:44 - Updated: 2026-09-13 08:28In the Linux kernel, the following vulnerability has been resolved: i2c: core: Run atomic i2c xfer when !preemptible Since bae1d3a05a8b, i2c transfers are non-atomic if preemption is disabled. However, non-atomic i2c transfers require preemption (e.g. in wait_for_completion() while waiting for the DMA). panic() calls preempt_disable_notrace() before calling emergency_restart(). Therefore, if an i2c device is used for the restart, the xfer should be atomic. This avoids warnings like: [ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0 [ 12.676926] Voluntary context switch within RCU read-side critical section! ... [ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114 [ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70 ... [ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58 [ 13.001050] machine_restart from panic+0x2a8/0x32c Use !preemptible() instead, which is basically the same check as pre-v5.2.
RHSA-2024:9315
Vulnerability from csaf_redhat - Published: 2024-11-12 09:11 - Updated: 2026-09-13 08:43In the Linux kernel, the following vulnerability has been resolved: i2c: core: Run atomic i2c xfer when !preemptible Since bae1d3a05a8b, i2c transfers are non-atomic if preemption is disabled. However, non-atomic i2c transfers require preemption (e.g. in wait_for_completion() while waiting for the DMA). panic() calls preempt_disable_notrace() before calling emergency_restart(). Therefore, if an i2c device is used for the restart, the xfer should be atomic. This avoids warnings like: [ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0 [ 12.676926] Voluntary context switch within RCU read-side critical section! ... [ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114 [ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70 ... [ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58 [ 13.001050] machine_restart from panic+0x2a8/0x32c Use !preemptible() instead, which is basically the same check as pre-v5.2.
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.