Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-56704 (GCVE-0-2024-56704)
Vulnerability from cvelistv5 – Published: 2024-12-28 09:46 – Updated: 2026-08-05 11:46- CWE-415 - Double Free
| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
71ebd71921e451f0f942ddfe85d01e31ddc6eb88 , < 692eb06703afc3e24d889d77e94a0e20229f6a4a
(git)
Affected: 71ebd71921e451f0f942ddfe85d01e31ddc6eb88 , < d74b4b297097bd361b8a9abfde9b521ff464ea9c (git) Affected: 71ebd71921e451f0f942ddfe85d01e31ddc6eb88 , < 7f5a2ed5c1810661e6b03f5a4ebf17682cdea850 (git) Affected: 71ebd71921e451f0f942ddfe85d01e31ddc6eb88 , < 4950408793b118cb8075bcee1f033b543fb719fa (git) Affected: 71ebd71921e451f0f942ddfe85d01e31ddc6eb88 , < b9e26059664bd9ebc64a0e8f5216266fc9f84265 (git) Affected: 71ebd71921e451f0f942ddfe85d01e31ddc6eb88 , < 2bb3ee1bf237557daea1d58007d2e1d4a6502ccf (git) Affected: 71ebd71921e451f0f942ddfe85d01e31ddc6eb88 , < d888f5f5d76b2722c267e6bdf51d445d60647b7b (git) Affected: 71ebd71921e451f0f942ddfe85d01e31ddc6eb88 , < 530bc9f03a102fac95b07cda513bfc16ff69e0ee (git) Affected: 71ebd71921e451f0f942ddfe85d01e31ddc6eb88 , < e43c608f40c065b30964f0a806348062991b802d (git) |
guessed | |
| Linux | Linux |
Affected:
4.12
Unaffected: 0 , < 4.12 (semver) Unaffected: 4.19.325 , ≤ 4.19.* (semver) Unaffected: 5.4.287 , ≤ 5.4.* (semver) Unaffected: 5.10.231 , ≤ 5.10.* (semver) Unaffected: 5.15.174 , ≤ 5.15.* (semver) Unaffected: 6.1.120 , ≤ 6.1.* (semver) Unaffected: 6.6.64 , ≤ 6.6.* (semver) Unaffected: 6.11.11 , ≤ 6.11.* (semver) Unaffected: 6.12.2 , ≤ 6.12.* (semver) Unaffected: 6.13 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2024-56704",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-10-01T19:58:47.879822Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-415",
"description": "CWE-415 Double Free",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2025-10-01T20:07:07.289Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
},
{
"providerMetadata": {
"dateUpdated": "2025-11-03T20:52:55.105Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00001.html"
},
{
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00002.html"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/9p/trans_xen.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "692eb06703afc3e24d889d77e94a0e20229f6a4a",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "d74b4b297097bd361b8a9abfde9b521ff464ea9c",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "7f5a2ed5c1810661e6b03f5a4ebf17682cdea850",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "4950408793b118cb8075bcee1f033b543fb719fa",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "b9e26059664bd9ebc64a0e8f5216266fc9f84265",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "2bb3ee1bf237557daea1d58007d2e1d4a6502ccf",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "d888f5f5d76b2722c267e6bdf51d445d60647b7b",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "530bc9f03a102fac95b07cda513bfc16ff69e0ee",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "e43c608f40c065b30964f0a806348062991b802d",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/9p/trans_xen.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.12"
},
{
"lessThan": "4.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.325",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.287",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.231",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.174",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.120",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.11.*",
"status": "unaffected",
"version": "6.11.11",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.2",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.13",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.325",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.287",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.231",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.174",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.120",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.64",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.11.11",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.12.2",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.13",
"versionStartIncluding": "4.12",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\n9p/xen: fix release of IRQ\n\nKernel logs indicate an IRQ was double-freed.\n\nPass correct device ID during IRQ release.\n\n[Dominique: remove confusing variable reset to 0]"
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 8.4,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The Xen 9pfs frontend is reached through hypervisor-mediated grant-shared rings, event channels and xenstore state transitions, not through the network stack, so the attack path is a local read/write/signal channel into the guest kernel rather than a network protocol. Guest-side triggering (driver unbind, device teardown) is likewise local.\nAC:L - The wrong-dev_id `free_irq()` fails deterministically on every single ring teardown, so the WARN, the leaked irqaction and the missing `synchronize_irq()` barrier are guaranteed, and the attacker controls both sides of the resulting race by choosing when to drive the device to Closing/removal while continuously notifying the event channel. No condition lies outside the attacker\u0027s influence.\nPR:N - The realistic attacker is a compromised or malicious 9pfs backend/driver domain, which in Xen\u0027s disaggregated threat model holds zero privileges within the victim guest kernel yet fully controls the xenbus state transitions and event-channel notifications needed to trigger and race the teardown.\nUI:N - Device teardown is driven entirely by backend-initiated xenbus state changes and requires no action from any user in the guest; having a 9pfs device attached is a configuration precondition, not victim interaction.\nS:U - The corrupted memory and the resulting control-flow impact are all inside the victim guest\u0027s own Linux kernel, so the vulnerable and impacted components share one security authority; no VM-escape, IOMMU or sandbox boundary is crossed by the flaw itself.\nC:H - Because `synchronize_irq()` is skipped, `xen_9pfs_front_event_handler()` and the subsequently queued `p9_xen_response()` read `ring-\u003epriv-\u003eclient`, `ring-\u003eintf`, `ring-\u003edata.in` and the `p9_client`/`p9_req_t` structures after `kfree(priv-\u003erings)`/`kfree(priv)`, giving a use-after-free read over reclaimable kernel heap contents, which per guidance is High.\nI:H - `schedule_work(\u0026ring-\u003ework)` writes workqueue list pointers into the freed `xen_9pfs_dataring` allocation and later executes `p9_xen_response()` against attacker-reclaimable memory including the `p9_client` and its callback state, yielding a use-after-free write and control-flow hijack primitive suitable for privilege escalation inside the guest.\nA:H - Every teardown hits `WARN(1, \"Trying to free already-free IRQ\")`, which is an immediate panic under `panic_on_warn`, and the descriptor is freed with a live irqaction attached while the ring memory is released underneath a possibly-running handler, producing oopses and slab corruption; each cycle additionally leaks the `struct irqaction` and its module/PM references."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T11:46:10.332Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/692eb06703afc3e24d889d77e94a0e20229f6a4a"
},
{
"url": "https://git.kernel.org/stable/c/d74b4b297097bd361b8a9abfde9b521ff464ea9c"
},
{
"url": "https://git.kernel.org/stable/c/7f5a2ed5c1810661e6b03f5a4ebf17682cdea850"
},
{
"url": "https://git.kernel.org/stable/c/4950408793b118cb8075bcee1f033b543fb719fa"
},
{
"url": "https://git.kernel.org/stable/c/b9e26059664bd9ebc64a0e8f5216266fc9f84265"
},
{
"url": "https://git.kernel.org/stable/c/2bb3ee1bf237557daea1d58007d2e1d4a6502ccf"
},
{
"url": "https://git.kernel.org/stable/c/d888f5f5d76b2722c267e6bdf51d445d60647b7b"
},
{
"url": "https://git.kernel.org/stable/c/530bc9f03a102fac95b07cda513bfc16ff69e0ee"
},
{
"url": "https://git.kernel.org/stable/c/e43c608f40c065b30964f0a806348062991b802d"
}
],
"title": "9p/xen: fix release of IRQ",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-56704",
"datePublished": "2024-12-28T09:46:25.766Z",
"dateReserved": "2024-12-27T15:00:39.856Z",
"dateUpdated": "2026-08-05T11:46:10.332Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-56704",
"date": "2026-09-20",
"epss": "0.00242",
"percentile": "0.15696"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/9p/trans_xen.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "692eb06703afc3e24d889d77e94a0e20229f6a4a",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "d74b4b297097bd361b8a9abfde9b521ff464ea9c",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "7f5a2ed5c1810661e6b03f5a4ebf17682cdea850",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "4950408793b118cb8075bcee1f033b543fb719fa",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "b9e26059664bd9ebc64a0e8f5216266fc9f84265",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "2bb3ee1bf237557daea1d58007d2e1d4a6502ccf",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "d888f5f5d76b2722c267e6bdf51d445d60647b7b",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "530bc9f03a102fac95b07cda513bfc16ff69e0ee",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "e43c608f40c065b30964f0a806348062991b802d",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/9p/trans_xen.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.12"
},
{
"lessThan": "4.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.325",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.287",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.231",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.174",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.120",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.11.*",
"status": "unaffected",
"version": "6.11.11",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.2",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.13",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "D82AB67D-EDD6-4051-90A4-E9E2918056A7",
"versionEndExcluding": "4.19.325",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E4B15788-D35E-4E5B-A9C0-070AE3729B34",
"versionEndExcluding": "5.4.287",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B5C644CC-2BD7-4E32-BC54-8DCC7ABE9935",
"versionEndExcluding": "5.10.231",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "419FD073-1517-4FD5-8158-F94BC68A1E89",
"versionEndExcluding": "5.15.174",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "09AC6122-E2A4-40FE-9D33-268A1B2EC265",
"versionEndExcluding": "6.1.120",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CA16DEE3-ABEC-4449-9F4A-7A3DC4FC36C7",
"versionEndExcluding": "6.6.64",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "21434379-192D-472F-9B54-D45E3650E893",
"versionEndExcluding": "6.11.11",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "D8882B1B-2ABC-4838-AC1D-DBDBB5764776",
"versionEndExcluding": "6.12.2",
"versionStartIncluding": "6.12",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\n9p/xen: fix release of IRQ\n\nKernel logs indicate an IRQ was double-freed.\n\nPass correct device ID during IRQ release.\n\n[Dominique: remove confusing variable reset to 0]"
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: 9p/xen: se corrige la liberaci\u00f3n de IRQ. Los registros del kernel indican que se liber\u00f3 una IRQ dos veces. Se pasa la identificaci\u00f3n del dispositivo correcta durante la liberaci\u00f3n de IRQ. [Dominique: se elimina la variable confusa que se restablece a 0]"
}
],
"id": "CVE-2024-56704",
"lastModified": "2026-08-04T11:22:22.783",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 8.4,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 2.5,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-56704",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-10-01T19:58:47.879822Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-12-28T10:15:18.817",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2bb3ee1bf237557daea1d58007d2e1d4a6502ccf"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4950408793b118cb8075bcee1f033b543fb719fa"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/530bc9f03a102fac95b07cda513bfc16ff69e0ee"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/692eb06703afc3e24d889d77e94a0e20229f6a4a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/7f5a2ed5c1810661e6b03f5a4ebf17682cdea850"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b9e26059664bd9ebc64a0e8f5216266fc9f84265"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d74b4b297097bd361b8a9abfde9b521ff464ea9c"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d888f5f5d76b2722c267e6bdf51d445d60647b7b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/e43c608f40c065b30964f0a806348062991b802d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00001.html"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00002.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-415"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-415"
}
],
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Important",
"current_release_date": "2026-09-12T12:18:04+00:00",
"cve": "CVE-2024-56704",
"id": "CVE-2024-56704",
"initial_release_date": "2024-12-28T00:00:00+00:00",
"product_status:known_not_affected": "198",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: 9p/xen: fix release of IRQ",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-56704.json",
"version": "3"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2025-11-03T20:52:55.105Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00001.html"
},
{
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00002.html"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2024-56704",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-10-01T19:58:47.879822Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-415",
"description": "CWE-415 Double Free",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2025-10-01T15:47:25.645Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/9p/trans_xen.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "692eb06703afc3e24d889d77e94a0e20229f6a4a",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "d74b4b297097bd361b8a9abfde9b521ff464ea9c",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "7f5a2ed5c1810661e6b03f5a4ebf17682cdea850",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "4950408793b118cb8075bcee1f033b543fb719fa",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "b9e26059664bd9ebc64a0e8f5216266fc9f84265",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "2bb3ee1bf237557daea1d58007d2e1d4a6502ccf",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "d888f5f5d76b2722c267e6bdf51d445d60647b7b",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "530bc9f03a102fac95b07cda513bfc16ff69e0ee",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "e43c608f40c065b30964f0a806348062991b802d",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/9p/trans_xen.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.12"
},
{
"lessThan": "4.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.325",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.287",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.231",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.174",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.120",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.11.*",
"status": "unaffected",
"version": "6.11.11",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.2",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.13",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.325",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.287",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.231",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.174",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.120",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.64",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.11.11",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.12.2",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.13",
"versionStartIncluding": "4.12",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\n9p/xen: fix release of IRQ\n\nKernel logs indicate an IRQ was double-freed.\n\nPass correct device ID during IRQ release.\n\n[Dominique: remove confusing variable reset to 0]"
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 8.4,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The Xen 9pfs frontend is reached through hypervisor-mediated grant-shared rings, event channels and xenstore state transitions, not through the network stack, so the attack path is a local read/write/signal channel into the guest kernel rather than a network protocol. Guest-side triggering (driver unbind, device teardown) is likewise local.\nAC:L - The wrong-dev_id `free_irq()` fails deterministically on every single ring teardown, so the WARN, the leaked irqaction and the missing `synchronize_irq()` barrier are guaranteed, and the attacker controls both sides of the resulting race by choosing when to drive the device to Closing/removal while continuously notifying the event channel. No condition lies outside the attacker\u0027s influence.\nPR:N - The realistic attacker is a compromised or malicious 9pfs backend/driver domain, which in Xen\u0027s disaggregated threat model holds zero privileges within the victim guest kernel yet fully controls the xenbus state transitions and event-channel notifications needed to trigger and race the teardown.\nUI:N - Device teardown is driven entirely by backend-initiated xenbus state changes and requires no action from any user in the guest; having a 9pfs device attached is a configuration precondition, not victim interaction.\nS:U - The corrupted memory and the resulting control-flow impact are all inside the victim guest\u0027s own Linux kernel, so the vulnerable and impacted components share one security authority; no VM-escape, IOMMU or sandbox boundary is crossed by the flaw itself.\nC:H - Because `synchronize_irq()` is skipped, `xen_9pfs_front_event_handler()` and the subsequently queued `p9_xen_response()` read `ring-\u003epriv-\u003eclient`, `ring-\u003eintf`, `ring-\u003edata.in` and the `p9_client`/`p9_req_t` structures after `kfree(priv-\u003erings)`/`kfree(priv)`, giving a use-after-free read over reclaimable kernel heap contents, which per guidance is High.\nI:H - `schedule_work(\u0026ring-\u003ework)` writes workqueue list pointers into the freed `xen_9pfs_dataring` allocation and later executes `p9_xen_response()` against attacker-reclaimable memory including the `p9_client` and its callback state, yielding a use-after-free write and control-flow hijack primitive suitable for privilege escalation inside the guest.\nA:H - Every teardown hits `WARN(1, \"Trying to free already-free IRQ\")`, which is an immediate panic under `panic_on_warn`, and the descriptor is freed with a live irqaction attached while the ring memory is released underneath a possibly-running handler, producing oopses and slab corruption; each cycle additionally leaks the `struct irqaction` and its module/PM references."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T11:46:10.332Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/692eb06703afc3e24d889d77e94a0e20229f6a4a"
},
{
"url": "https://git.kernel.org/stable/c/d74b4b297097bd361b8a9abfde9b521ff464ea9c"
},
{
"url": "https://git.kernel.org/stable/c/7f5a2ed5c1810661e6b03f5a4ebf17682cdea850"
},
{
"url": "https://git.kernel.org/stable/c/4950408793b118cb8075bcee1f033b543fb719fa"
},
{
"url": "https://git.kernel.org/stable/c/b9e26059664bd9ebc64a0e8f5216266fc9f84265"
},
{
"url": "https://git.kernel.org/stable/c/2bb3ee1bf237557daea1d58007d2e1d4a6502ccf"
},
{
"url": "https://git.kernel.org/stable/c/d888f5f5d76b2722c267e6bdf51d445d60647b7b"
},
{
"url": "https://git.kernel.org/stable/c/530bc9f03a102fac95b07cda513bfc16ff69e0ee"
},
{
"url": "https://git.kernel.org/stable/c/e43c608f40c065b30964f0a806348062991b802d"
}
],
"title": "9p/xen: fix release of IRQ",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-56704",
"datePublished": "2024-12-28T09:46:25.766Z",
"dateReserved": "2024-12-27T15:00:39.856Z",
"dateUpdated": "2026-08-05T11:46:10.332Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
CERTFR-2025-AVI-0308
Vulnerability from certfr_avis - Published: 2025-04-11 - Updated: 2025-04-11
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une élévation de privilèges, un contournement de la politique de sécurité et un déni de service.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-23041",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23041"
},
{
"name": "CVE-2021-47101",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47101"
},
{
"name": "CVE-2021-47119",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47119"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2021-47235",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47235"
},
{
"name": "CVE-2021-47320",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47320"
},
{
"name": "CVE-2021-47483",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47483"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2021-47602",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47602"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-42069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42069"
},
{
"name": "CVE-2024-42315",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42315"
},
{
"name": "CVE-2024-43900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43900"
},
{
"name": "CVE-2024-44938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44938"
},
{
"name": "CVE-2024-46784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46784"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46809"
},
{
"name": "CVE-2024-46841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46841"
},
{
"name": "CVE-2024-46871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46871"
},
{
"name": "CVE-2024-47707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47707"
},
{
"name": "CVE-2024-47730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47730"
},
{
"name": "CVE-2024-49950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49950"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-49996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49996"
},
{
"name": "CVE-2024-50055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50055"
},
{
"name": "CVE-2024-50242",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50242"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-50283",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50283"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-49925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49925"
},
{
"name": "CVE-2024-49948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49948"
},
{
"name": "CVE-2024-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49952"
},
{
"name": "CVE-2024-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50121"
},
{
"name": "CVE-2024-50167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50167"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2024-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53096"
},
{
"name": "CVE-2024-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53112"
},
{
"name": "CVE-2024-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53121"
},
{
"name": "CVE-2024-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53138"
},
{
"name": "CVE-2024-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53142"
},
{
"name": "CVE-2024-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53113"
},
{
"name": "CVE-2024-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53119"
},
{
"name": "CVE-2024-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53120"
},
{
"name": "CVE-2024-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53122"
},
{
"name": "CVE-2024-53127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53127"
},
{
"name": "CVE-2024-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53129"
},
{
"name": "CVE-2024-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53130"
},
{
"name": "CVE-2024-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53131"
},
{
"name": "CVE-2024-53135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53135"
},
{
"name": "CVE-2024-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53136"
},
{
"name": "CVE-2024-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53140"
},
{
"name": "CVE-2024-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53099"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2024-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53146"
},
{
"name": "CVE-2024-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53148"
},
{
"name": "CVE-2024-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53150"
},
{
"name": "CVE-2024-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53151"
},
{
"name": "CVE-2024-53155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53155"
},
{
"name": "CVE-2024-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53156"
},
{
"name": "CVE-2024-53157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53157"
},
{
"name": "CVE-2024-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53158"
},
{
"name": "CVE-2024-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53161"
},
{
"name": "CVE-2024-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53171"
},
{
"name": "CVE-2024-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53173"
},
{
"name": "CVE-2024-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53174"
},
{
"name": "CVE-2024-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53180"
},
{
"name": "CVE-2024-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53206"
},
{
"name": "CVE-2024-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53214"
},
{
"name": "CVE-2024-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53215"
},
{
"name": "CVE-2024-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53217"
},
{
"name": "CVE-2024-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53237"
},
{
"name": "CVE-2024-56539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56539"
},
{
"name": "CVE-2024-56562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56562"
},
{
"name": "CVE-2024-56567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56567"
},
{
"name": "CVE-2024-56576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56576"
},
{
"name": "CVE-2024-56605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56605"
},
{
"name": "CVE-2024-56645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56645"
},
{
"name": "CVE-2024-56754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56754"
},
{
"name": "CVE-2024-56756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56756"
},
{
"name": "CVE-2024-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53239"
},
{
"name": "CVE-2024-56548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56548"
},
{
"name": "CVE-2024-56570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56570"
},
{
"name": "CVE-2024-56575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56575"
},
{
"name": "CVE-2024-56598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56598"
},
{
"name": "CVE-2024-56619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56619"
},
{
"name": "CVE-2024-56631",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56631"
},
{
"name": "CVE-2024-56704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56704"
},
{
"name": "CVE-2024-36476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36476"
},
{
"name": "CVE-2024-45828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45828"
},
{
"name": "CVE-2024-47143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47143"
},
{
"name": "CVE-2024-48881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48881"
},
{
"name": "CVE-2024-49998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49998"
},
{
"name": "CVE-2024-50051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50051"
},
{
"name": "CVE-2024-52332",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52332"
},
{
"name": "CVE-2024-53172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53172"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53198"
},
{
"name": "CVE-2024-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53227"
},
{
"name": "CVE-2024-53685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53685"
},
{
"name": "CVE-2024-53690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53690"
},
{
"name": "CVE-2024-55881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55881"
},
{
"name": "CVE-2024-55916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55916"
},
{
"name": "CVE-2024-56369",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56369"
},
{
"name": "CVE-2024-56531",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56531"
},
{
"name": "CVE-2024-56532",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56532"
},
{
"name": "CVE-2024-56533",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56533"
},
{
"name": "CVE-2024-56558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56558"
},
{
"name": "CVE-2024-56568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56568"
},
{
"name": "CVE-2024-56569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56569"
},
{
"name": "CVE-2024-56572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56572"
},
{
"name": "CVE-2024-56574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56574"
},
{
"name": "CVE-2024-56578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56578"
},
{
"name": "CVE-2024-56587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56587"
},
{
"name": "CVE-2024-56589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56589"
},
{
"name": "CVE-2024-56590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56590"
},
{
"name": "CVE-2024-56593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56593"
},
{
"name": "CVE-2024-56594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56594"
},
{
"name": "CVE-2024-56595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56595"
},
{
"name": "CVE-2024-56596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56596"
},
{
"name": "CVE-2024-56597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56597"
},
{
"name": "CVE-2024-56602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56602"
},
{
"name": "CVE-2024-56603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56603"
},
{
"name": "CVE-2024-56606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56606"
},
{
"name": "CVE-2024-56614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56614"
},
{
"name": "CVE-2024-56615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56615"
},
{
"name": "CVE-2024-56616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56616"
},
{
"name": "CVE-2024-56622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56622"
},
{
"name": "CVE-2024-56623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56623"
},
{
"name": "CVE-2024-56625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56625"
},
{
"name": "CVE-2024-56629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56629"
},
{
"name": "CVE-2024-56630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56630"
},
{
"name": "CVE-2024-56634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56634"
},
{
"name": "CVE-2024-56636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56636"
},
{
"name": "CVE-2024-56637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56637"
},
{
"name": "CVE-2024-56642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56642"
},
{
"name": "CVE-2024-56643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56643"
},
{
"name": "CVE-2024-56644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56644"
},
{
"name": "CVE-2024-56648",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56648"
},
{
"name": "CVE-2024-56659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56659"
},
{
"name": "CVE-2024-56662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56662"
},
{
"name": "CVE-2024-56670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56670"
},
{
"name": "CVE-2024-56672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56672"
},
{
"name": "CVE-2024-56678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56678"
},
{
"name": "CVE-2024-56681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56681"
},
{
"name": "CVE-2024-56688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56688"
},
{
"name": "CVE-2024-56690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56690"
},
{
"name": "CVE-2024-56691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56691"
},
{
"name": "CVE-2024-56694",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56694"
},
{
"name": "CVE-2024-56698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56698"
},
{
"name": "CVE-2024-56700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56700"
},
{
"name": "CVE-2024-56701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56701"
},
{
"name": "CVE-2024-56705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56705"
},
{
"name": "CVE-2024-56708",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56708"
},
{
"name": "CVE-2024-56716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56716"
},
{
"name": "CVE-2024-56723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56723"
},
{
"name": "CVE-2024-56724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56724"
},
{
"name": "CVE-2024-56739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56739"
},
{
"name": "CVE-2024-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56745"
},
{
"name": "CVE-2024-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56746"
},
{
"name": "CVE-2024-56747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56747"
},
{
"name": "CVE-2024-56748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56748"
},
{
"name": "CVE-2024-56759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56759"
},
{
"name": "CVE-2024-56767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56767"
},
{
"name": "CVE-2024-56769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56769"
},
{
"name": "CVE-2024-56774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56774"
},
{
"name": "CVE-2024-56776",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56776"
},
{
"name": "CVE-2024-56777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56777"
},
{
"name": "CVE-2024-56778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56778"
},
{
"name": "CVE-2024-56779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56779"
},
{
"name": "CVE-2024-56780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56780"
},
{
"name": "CVE-2024-56787",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56787"
},
{
"name": "CVE-2024-57791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57791"
},
{
"name": "CVE-2024-57792",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57792"
},
{
"name": "CVE-2024-57798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57798"
},
{
"name": "CVE-2024-57838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57838"
},
{
"name": "CVE-2024-57849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57849"
},
{
"name": "CVE-2024-57850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57850"
},
{
"name": "CVE-2024-57874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57874"
},
{
"name": "CVE-2024-57890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57890"
},
{
"name": "CVE-2024-57892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57892"
},
{
"name": "CVE-2024-57896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57896"
},
{
"name": "CVE-2024-57897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57897"
},
{
"name": "CVE-2024-57903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57903"
},
{
"name": "CVE-2024-57904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57904"
},
{
"name": "CVE-2024-57906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57906"
},
{
"name": "CVE-2024-57907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57907"
},
{
"name": "CVE-2024-57908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57908"
},
{
"name": "CVE-2024-57910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57910"
},
{
"name": "CVE-2024-57911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57911"
},
{
"name": "CVE-2024-57912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57912"
},
{
"name": "CVE-2024-57913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57913"
},
{
"name": "CVE-2024-57922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57922"
},
{
"name": "CVE-2024-57929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57929"
},
{
"name": "CVE-2024-57940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57940"
},
{
"name": "CVE-2025-21646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21646"
},
{
"name": "CVE-2024-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50304"
},
{
"name": "CVE-2024-56600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56600"
},
{
"name": "CVE-2024-56601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56601"
},
{
"name": "CVE-2024-56610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56610"
},
{
"name": "CVE-2024-56650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56650"
},
{
"name": "CVE-2024-56658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56658"
},
{
"name": "CVE-2024-56679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56679"
},
{
"name": "CVE-2024-56693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56693"
},
{
"name": "CVE-2024-56715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56715"
},
{
"name": "CVE-2024-56726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56726"
},
{
"name": "CVE-2024-56728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56728"
},
{
"name": "CVE-2024-56763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56763"
},
{
"name": "CVE-2024-57802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57802"
},
{
"name": "CVE-2024-57882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57882"
},
{
"name": "CVE-2024-57884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57884"
},
{
"name": "CVE-2024-57917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57917"
},
{
"name": "CVE-2024-57931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57931"
},
{
"name": "CVE-2024-57938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57938"
},
{
"name": "CVE-2024-57946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57946"
},
{
"name": "CVE-2025-21653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21653"
},
{
"name": "CVE-2025-21664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21664"
},
{
"name": "CVE-2025-21666",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21666"
},
{
"name": "CVE-2025-21669",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21669"
},
{
"name": "CVE-2025-21678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21678"
},
{
"name": "CVE-2024-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53124"
},
{
"name": "CVE-2024-57925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57925"
},
{
"name": "CVE-2024-57939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57939"
},
{
"name": "CVE-2024-57948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57948"
},
{
"name": "CVE-2025-21631",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21631"
},
{
"name": "CVE-2025-21636",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21636"
},
{
"name": "CVE-2025-21637",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21637"
},
{
"name": "CVE-2025-21638",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21638"
},
{
"name": "CVE-2025-21639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21639"
},
{
"name": "CVE-2025-21640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21640"
},
{
"name": "CVE-2025-21648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21648"
},
{
"name": "CVE-2025-21665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21665"
},
{
"name": "CVE-2025-21680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21680"
},
{
"name": "CVE-2025-21683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21683"
},
{
"name": "CVE-2024-56633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56633"
},
{
"name": "CVE-2022-49034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49034"
},
{
"name": "CVE-2024-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53145"
},
{
"name": "CVE-2024-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53165"
},
{
"name": "CVE-2024-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53181"
},
{
"name": "CVE-2024-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53183"
},
{
"name": "CVE-2024-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53184"
},
{
"name": "CVE-2024-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53226"
},
{
"name": "CVE-2024-56720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56720"
},
{
"name": "CVE-2024-57889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57889"
},
{
"name": "CVE-2025-21687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21687"
},
{
"name": "CVE-2025-21689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21689"
},
{
"name": "CVE-2025-21690",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21690"
},
{
"name": "CVE-2025-21692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21692"
},
{
"name": "CVE-2025-21697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21697"
},
{
"name": "CVE-2025-21699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21699"
},
{
"name": "CVE-2025-21700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21700"
},
{
"name": "CVE-2024-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43098"
},
{
"name": "CVE-2024-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47408"
},
{
"name": "CVE-2024-49571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49571"
},
{
"name": "CVE-2024-53680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53680"
},
{
"name": "CVE-2024-56581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56581"
},
{
"name": "CVE-2024-56586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56586"
},
{
"name": "CVE-2024-56626",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56626"
},
{
"name": "CVE-2024-56627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56627"
},
{
"name": "CVE-2024-56640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56640"
},
{
"name": "CVE-2024-56770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56770"
},
{
"name": "CVE-2024-56781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56781"
},
{
"name": "CVE-2024-56785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56785"
},
{
"name": "CVE-2024-57807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57807"
},
{
"name": "CVE-2024-57841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57841"
},
{
"name": "CVE-2024-57900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57900"
},
{
"name": "CVE-2024-57901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57901"
},
{
"name": "CVE-2024-57902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57902"
},
{
"name": "CVE-2024-57951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57951"
},
{
"name": "CVE-2025-21694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21694"
},
{
"name": "CVE-2024-58087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58087"
},
{
"name": "CVE-2021-47122",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47122"
},
{
"name": "CVE-2025-21702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21702"
}
],
"initial_release_date": "2025-04-11T00:00:00",
"last_revision_date": "2025-04-11T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0308",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-04-11T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une \u00e9l\u00e9vation de privil\u00e8ges, un contournement de la politique de s\u00e9curit\u00e9 et un d\u00e9ni de service.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2025-04-07",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7406-5",
"url": "https://ubuntu.com/security/notices/USN-7406-5"
},
{
"published_at": "2025-04-07",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7421-1",
"url": "https://ubuntu.com/security/notices/USN-7421-1"
},
{
"published_at": "2025-04-07",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7420-1",
"url": "https://ubuntu.com/security/notices/USN-7420-1"
},
{
"published_at": "2025-04-07",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7406-6",
"url": "https://ubuntu.com/security/notices/USN-7406-6"
},
{
"published_at": "2025-04-07",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7402-4",
"url": "https://ubuntu.com/security/notices/USN-7402-4"
},
{
"published_at": "2025-04-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7428-2",
"url": "https://ubuntu.com/security/notices/USN-7428-2"
},
{
"published_at": "2025-04-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7402-3",
"url": "https://ubuntu.com/security/notices/USN-7402-3"
},
{
"published_at": "2025-04-07",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7408-4",
"url": "https://ubuntu.com/security/notices/USN-7408-4"
},
{
"published_at": "2025-04-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7429-1",
"url": "https://ubuntu.com/security/notices/USN-7429-1"
},
{
"published_at": "2025-04-07",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7408-3",
"url": "https://ubuntu.com/security/notices/USN-7408-3"
},
{
"published_at": "2025-04-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7428-1",
"url": "https://ubuntu.com/security/notices/USN-7428-1"
},
{
"published_at": "2025-04-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7429-2",
"url": "https://ubuntu.com/security/notices/USN-7429-2"
}
]
}
CERTFR-2025-AVI-0349
Vulnerability from certfr_avis - Published: 2025-04-25 - Updated: 2025-04-25
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et une atteinte à la confidentialité des données
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.10",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-26718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26718"
},
{
"name": "CVE-2021-47119",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47119"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26915"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-40965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40965"
},
{
"name": "CVE-2023-52913",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52913"
},
{
"name": "CVE-2024-41080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41080"
},
{
"name": "CVE-2024-42069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42069"
},
{
"name": "CVE-2024-42291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42291"
},
{
"name": "CVE-2024-42315",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42315"
},
{
"name": "CVE-2024-43900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43900"
},
{
"name": "CVE-2024-44938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44938"
},
{
"name": "CVE-2024-46784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46784"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-42252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42252"
},
{
"name": "CVE-2024-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46809"
},
{
"name": "CVE-2024-46841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46841"
},
{
"name": "CVE-2024-46871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46871"
},
{
"name": "CVE-2024-47707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47707"
},
{
"name": "CVE-2024-47730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47730"
},
{
"name": "CVE-2024-49899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49899"
},
{
"name": "CVE-2024-49906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49906"
},
{
"name": "CVE-2024-49914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49914"
},
{
"name": "CVE-2024-49920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49920"
},
{
"name": "CVE-2024-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49936"
},
{
"name": "CVE-2024-49950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49950"
},
{
"name": "CVE-2024-49972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49972"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-49996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49996"
},
{
"name": "CVE-2024-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50019"
},
{
"name": "CVE-2024-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50020"
},
{
"name": "CVE-2024-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50021"
},
{
"name": "CVE-2024-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50022"
},
{
"name": "CVE-2024-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50023"
},
{
"name": "CVE-2024-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50024"
},
{
"name": "CVE-2024-50025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50025"
},
{
"name": "CVE-2024-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50027"
},
{
"name": "CVE-2024-50028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50028"
},
{
"name": "CVE-2024-50031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50031"
},
{
"name": "CVE-2024-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50033"
},
{
"name": "CVE-2024-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50035"
},
{
"name": "CVE-2024-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50040"
},
{
"name": "CVE-2024-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50041"
},
{
"name": "CVE-2024-50042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50042"
},
{
"name": "CVE-2024-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50044"
},
{
"name": "CVE-2024-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50045"
},
{
"name": "CVE-2024-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50046"
},
{
"name": "CVE-2024-50047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50047"
},
{
"name": "CVE-2024-50048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50048"
},
{
"name": "CVE-2024-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50049"
},
{
"name": "CVE-2024-50055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50055"
},
{
"name": "CVE-2024-50058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50058"
},
{
"name": "CVE-2024-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50059"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2024-50061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50061"
},
{
"name": "CVE-2024-50062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50062"
},
{
"name": "CVE-2024-50063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50063"
},
{
"name": "CVE-2024-50064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50064"
},
{
"name": "CVE-2024-50069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50069"
},
{
"name": "CVE-2024-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50073"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-50075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50075"
},
{
"name": "CVE-2024-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50076"
},
{
"name": "CVE-2024-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50077"
},
{
"name": "CVE-2024-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50078"
},
{
"name": "CVE-2024-50080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50080"
},
{
"name": "CVE-2024-50036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50036"
},
{
"name": "CVE-2024-50067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50067"
},
{
"name": "CVE-2024-50072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50072"
},
{
"name": "CVE-2024-50126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50126"
},
{
"name": "CVE-2024-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50215"
},
{
"name": "CVE-2024-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50218"
},
{
"name": "CVE-2024-50229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50229"
},
{
"name": "CVE-2024-50230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50230"
},
{
"name": "CVE-2024-50232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50232"
},
{
"name": "CVE-2024-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50233"
},
{
"name": "CVE-2024-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50234"
},
{
"name": "CVE-2024-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50235"
},
{
"name": "CVE-2024-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50236"
},
{
"name": "CVE-2024-50237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50237"
},
{
"name": "CVE-2024-50242",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50242"
},
{
"name": "CVE-2024-50243",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50243"
},
{
"name": "CVE-2024-50244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50244"
},
{
"name": "CVE-2024-50245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50245"
},
{
"name": "CVE-2024-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50247"
},
{
"name": "CVE-2024-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50249"
},
{
"name": "CVE-2024-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50250"
},
{
"name": "CVE-2024-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50251"
},
{
"name": "CVE-2024-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50252"
},
{
"name": "CVE-2024-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50255"
},
{
"name": "CVE-2024-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50256"
},
{
"name": "CVE-2024-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50257"
},
{
"name": "CVE-2024-50259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50259"
},
{
"name": "CVE-2024-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50261"
},
{
"name": "CVE-2024-50262",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50262"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50267"
},
{
"name": "CVE-2024-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50268"
},
{
"name": "CVE-2024-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50269"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2024-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50272"
},
{
"name": "CVE-2024-50273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50273"
},
{
"name": "CVE-2024-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50276"
},
{
"name": "CVE-2024-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50278"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50280",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50280"
},
{
"name": "CVE-2024-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50282"
},
{
"name": "CVE-2024-50283",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50283"
},
{
"name": "CVE-2024-50284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50284"
},
{
"name": "CVE-2024-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50286"
},
{
"name": "CVE-2024-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50287"
},
{
"name": "CVE-2024-50290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50290"
},
{
"name": "CVE-2024-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50292"
},
{
"name": "CVE-2024-50295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50295"
},
{
"name": "CVE-2024-50296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50296"
},
{
"name": "CVE-2024-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50299"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53042"
},
{
"name": "CVE-2024-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53043"
},
{
"name": "CVE-2024-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53052"
},
{
"name": "CVE-2024-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53055"
},
{
"name": "CVE-2024-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53058"
},
{
"name": "CVE-2024-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53059"
},
{
"name": "CVE-2024-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53060"
},
{
"name": "CVE-2024-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53061"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53066"
},
{
"name": "CVE-2024-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53072"
},
{
"name": "CVE-2024-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53081"
},
{
"name": "CVE-2024-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53082"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2024-50226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50226"
},
{
"name": "CVE-2024-49925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49925"
},
{
"name": "CVE-2024-50208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50208"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2024-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50142"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-49884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49884"
},
{
"name": "CVE-2024-49893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49893"
},
{
"name": "CVE-2024-49921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49921"
},
{
"name": "CVE-2024-50038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50038"
},
{
"name": "CVE-2024-50039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50039"
},
{
"name": "CVE-2024-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50093"
},
{
"name": "CVE-2024-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50095"
},
{
"name": "CVE-2024-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50096"
},
{
"name": "CVE-2024-50180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50180"
},
{
"name": "CVE-2024-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50184"
},
{
"name": "CVE-2024-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50186"
},
{
"name": "CVE-2024-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50188"
},
{
"name": "CVE-2024-50189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50189"
},
{
"name": "CVE-2024-50191",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50191"
},
{
"name": "CVE-2024-49968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49968"
},
{
"name": "CVE-2024-50009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50009"
},
{
"name": "CVE-2024-50026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50026"
},
{
"name": "CVE-2024-50084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50084"
},
{
"name": "CVE-2024-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50087"
},
{
"name": "CVE-2024-50088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50088"
},
{
"name": "CVE-2024-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50098"
},
{
"name": "CVE-2024-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50101"
},
{
"name": "CVE-2024-50103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50103"
},
{
"name": "CVE-2024-50108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50108"
},
{
"name": "CVE-2024-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50115"
},
{
"name": "CVE-2024-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50116"
},
{
"name": "CVE-2024-50117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50117"
},
{
"name": "CVE-2024-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50121"
},
{
"name": "CVE-2024-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50124"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50127"
},
{
"name": "CVE-2024-50128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50128"
},
{
"name": "CVE-2024-50130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50130"
},
{
"name": "CVE-2024-50131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50131"
},
{
"name": "CVE-2024-50134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50134"
},
{
"name": "CVE-2024-50135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50135"
},
{
"name": "CVE-2024-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50136"
},
{
"name": "CVE-2024-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50138"
},
{
"name": "CVE-2024-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50139"
},
{
"name": "CVE-2024-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50141"
},
{
"name": "CVE-2024-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50145"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2024-50147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50147"
},
{
"name": "CVE-2024-50148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50148"
},
{
"name": "CVE-2024-50150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50150"
},
{
"name": "CVE-2024-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50153"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50155"
},
{
"name": "CVE-2024-50156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50156"
},
{
"name": "CVE-2024-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50158"
},
{
"name": "CVE-2024-50159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50159"
},
{
"name": "CVE-2024-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50160"
},
{
"name": "CVE-2024-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50166"
},
{
"name": "CVE-2024-50167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50167"
},
{
"name": "CVE-2024-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50169"
},
{
"name": "CVE-2024-50171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50171"
},
{
"name": "CVE-2024-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50172"
},
{
"name": "CVE-2024-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50182"
},
{
"name": "CVE-2024-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50183"
},
{
"name": "CVE-2024-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50187"
},
{
"name": "CVE-2024-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50194"
},
{
"name": "CVE-2024-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50195"
},
{
"name": "CVE-2024-50196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50196"
},
{
"name": "CVE-2024-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50198"
},
{
"name": "CVE-2024-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50200"
},
{
"name": "CVE-2024-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50201"
},
{
"name": "CVE-2024-50205",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50205"
},
{
"name": "CVE-2024-50209",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50209"
},
{
"name": "CVE-2024-50210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50210"
},
{
"name": "CVE-2024-50216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50216"
},
{
"name": "CVE-2024-50221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50221"
},
{
"name": "CVE-2024-50224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50224"
},
{
"name": "CVE-2024-50225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50225"
},
{
"name": "CVE-2024-50231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50231"
},
{
"name": "CVE-2024-50240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50240"
},
{
"name": "CVE-2024-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50246"
},
{
"name": "CVE-2024-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50248"
},
{
"name": "CVE-2024-50274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50274"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2024-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50289"
},
{
"name": "CVE-2024-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50298"
},
{
"name": "CVE-2024-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53045"
},
{
"name": "CVE-2024-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53048"
},
{
"name": "CVE-2024-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53051"
},
{
"name": "CVE-2024-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53068"
},
{
"name": "CVE-2024-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53076"
},
{
"name": "CVE-2024-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53079"
},
{
"name": "CVE-2024-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53085"
},
{
"name": "CVE-2024-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53094"
},
{
"name": "CVE-2024-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53095"
},
{
"name": "CVE-2024-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53096"
},
{
"name": "CVE-2024-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53100"
},
{
"name": "CVE-2024-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53101"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53106"
},
{
"name": "CVE-2024-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53108"
},
{
"name": "CVE-2024-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53110"
},
{
"name": "CVE-2024-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53112"
},
{
"name": "CVE-2024-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53114"
},
{
"name": "CVE-2024-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53121"
},
{
"name": "CVE-2024-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53138"
},
{
"name": "CVE-2024-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53142"
},
{
"name": "CVE-2024-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50010"
},
{
"name": "CVE-2024-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50083"
},
{
"name": "CVE-2024-50085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50085"
},
{
"name": "CVE-2024-50086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50086"
},
{
"name": "CVE-2024-50133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50133"
},
{
"name": "CVE-2024-50143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50143"
},
{
"name": "CVE-2024-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50151"
},
{
"name": "CVE-2024-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50162"
},
{
"name": "CVE-2024-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50163"
},
{
"name": "CVE-2024-50168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50168"
},
{
"name": "CVE-2024-50185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50185"
},
{
"name": "CVE-2024-50193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50193"
},
{
"name": "CVE-2024-50199",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50199"
},
{
"name": "CVE-2024-50202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50202"
},
{
"name": "CVE-2024-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53097"
},
{
"name": "CVE-2024-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53113"
},
{
"name": "CVE-2024-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53119"
},
{
"name": "CVE-2024-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53120"
},
{
"name": "CVE-2024-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53122"
},
{
"name": "CVE-2024-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53123"
},
{
"name": "CVE-2024-53127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53127"
},
{
"name": "CVE-2024-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53129"
},
{
"name": "CVE-2024-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53130"
},
{
"name": "CVE-2024-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53131"
},
{
"name": "CVE-2024-53135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53135"
},
{
"name": "CVE-2024-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53136"
},
{
"name": "CVE-2024-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53140"
},
{
"name": "CVE-2024-50203",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50203"
},
{
"name": "CVE-2024-50211",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50211"
},
{
"name": "CVE-2024-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53050"
},
{
"name": "CVE-2024-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53090"
},
{
"name": "CVE-2024-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53099"
},
{
"name": "CVE-2024-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53105"
},
{
"name": "CVE-2024-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53111"
},
{
"name": "CVE-2024-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53117"
},
{
"name": "CVE-2024-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53118"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2024-53126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53126"
},
{
"name": "CVE-2024-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53133"
},
{
"name": "CVE-2024-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53134"
},
{
"name": "CVE-2024-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53146"
},
{
"name": "CVE-2024-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53148"
},
{
"name": "CVE-2024-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53150"
},
{
"name": "CVE-2024-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53151"
},
{
"name": "CVE-2024-53154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53154"
},
{
"name": "CVE-2024-53155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53155"
},
{
"name": "CVE-2024-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53156"
},
{
"name": "CVE-2024-53157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53157"
},
{
"name": "CVE-2024-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53158"
},
{
"name": "CVE-2024-53160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53160"
},
{
"name": "CVE-2024-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53161"
},
{
"name": "CVE-2024-53162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53162"
},
{
"name": "CVE-2024-53166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53166"
},
{
"name": "CVE-2024-53169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53169"
},
{
"name": "CVE-2024-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53171"
},
{
"name": "CVE-2024-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53173"
},
{
"name": "CVE-2024-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53174"
},
{
"name": "CVE-2024-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53180"
},
{
"name": "CVE-2024-53188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53188"
},
{
"name": "CVE-2024-53190",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53190"
},
{
"name": "CVE-2024-53191",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53191"
},
{
"name": "CVE-2024-53200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53200"
},
{
"name": "CVE-2024-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53201"
},
{
"name": "CVE-2024-53202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53202"
},
{
"name": "CVE-2024-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53206"
},
{
"name": "CVE-2024-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53208"
},
{
"name": "CVE-2024-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53209"
},
{
"name": "CVE-2024-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53210"
},
{
"name": "CVE-2024-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53213"
},
{
"name": "CVE-2024-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53214"
},
{
"name": "CVE-2024-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53215"
},
{
"name": "CVE-2024-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53217"
},
{
"name": "CVE-2024-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53222"
},
{
"name": "CVE-2024-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53224"
},
{
"name": "CVE-2024-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53229"
},
{
"name": "CVE-2024-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53234"
},
{
"name": "CVE-2024-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53237"
},
{
"name": "CVE-2024-56539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56539"
},
{
"name": "CVE-2024-56549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56549"
},
{
"name": "CVE-2024-56551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56551"
},
{
"name": "CVE-2024-56562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56562"
},
{
"name": "CVE-2024-56566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56566"
},
{
"name": "CVE-2024-56567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56567"
},
{
"name": "CVE-2024-56576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56576"
},
{
"name": "CVE-2024-56582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56582"
},
{
"name": "CVE-2024-56599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56599"
},
{
"name": "CVE-2024-56604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56604"
},
{
"name": "CVE-2024-56605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56605"
},
{
"name": "CVE-2024-56645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56645"
},
{
"name": "CVE-2024-56752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56752"
},
{
"name": "CVE-2024-56754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56754"
},
{
"name": "CVE-2024-56755",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56755"
},
{
"name": "CVE-2024-56756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56756"
},
{
"name": "CVE-2024-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53239"
},
{
"name": "CVE-2024-56548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56548"
},
{
"name": "CVE-2024-56570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56570"
},
{
"name": "CVE-2024-56575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56575"
},
{
"name": "CVE-2024-56598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56598"
},
{
"name": "CVE-2024-56619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56619"
},
{
"name": "CVE-2024-56631",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56631"
},
{
"name": "CVE-2024-56704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56704"
},
{
"name": "CVE-2024-36476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36476"
},
{
"name": "CVE-2024-45828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45828"
},
{
"name": "CVE-2024-47141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47141"
},
{
"name": "CVE-2024-47143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47143"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2024-48873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48873"
},
{
"name": "CVE-2024-48881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48881"
},
{
"name": "CVE-2024-49569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49569"
},
{
"name": "CVE-2024-49998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49998"
},
{
"name": "CVE-2024-50051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50051"
},
{
"name": "CVE-2024-52332",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52332"
},
{
"name": "CVE-2024-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53091"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2024-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53170"
},
{
"name": "CVE-2024-53172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53172"
},
{
"name": "CVE-2024-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53175"
},
{
"name": "CVE-2024-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53185"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2024-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53195"
},
{
"name": "CVE-2024-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53196"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53198"
},
{
"name": "CVE-2024-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53227"
},
{
"name": "CVE-2024-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53230"
},
{
"name": "CVE-2024-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53231"
},
{
"name": "CVE-2024-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53232"
},
{
"name": "CVE-2024-53233",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53233"
},
{
"name": "CVE-2024-53236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53236"
},
{
"name": "CVE-2024-53685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53685"
},
{
"name": "CVE-2024-53690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53690"
},
{
"name": "CVE-2024-55881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55881"
},
{
"name": "CVE-2024-55916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55916"
},
{
"name": "CVE-2024-56369",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56369"
},
{
"name": "CVE-2024-56531",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56531"
},
{
"name": "CVE-2024-56532",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56532"
},
{
"name": "CVE-2024-56533",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56533"
},
{
"name": "CVE-2024-56538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56538"
},
{
"name": "CVE-2024-56543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56543"
},
{
"name": "CVE-2024-56546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56546"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2024-56558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56558"
},
{
"name": "CVE-2024-56568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56568"
},
{
"name": "CVE-2024-56569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56569"
},
{
"name": "CVE-2024-56572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56572"
},
{
"name": "CVE-2024-56573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56573"
},
{
"name": "CVE-2024-56574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56574"
},
{
"name": "CVE-2024-56577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56577"
},
{
"name": "CVE-2024-56578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56578"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2024-56587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56587"
},
{
"name": "CVE-2024-56588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56588"
},
{
"name": "CVE-2024-56589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56589"
},
{
"name": "CVE-2024-56590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56590"
},
{
"name": "CVE-2024-56593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56593"
},
{
"name": "CVE-2024-56594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56594"
},
{
"name": "CVE-2024-56595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56595"
},
{
"name": "CVE-2024-56596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56596"
},
{
"name": "CVE-2024-56597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56597"
},
{
"name": "CVE-2024-56602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56602"
},
{
"name": "CVE-2024-56603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56603"
},
{
"name": "CVE-2024-56606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56606"
},
{
"name": "CVE-2024-56607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56607"
},
{
"name": "CVE-2024-56609",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56609"
},
{
"name": "CVE-2024-56611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56611"
},
{
"name": "CVE-2024-56614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56614"
},
{
"name": "CVE-2024-56615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56615"
},
{
"name": "CVE-2024-56616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56616"
},
{
"name": "CVE-2024-56620",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56620"
},
{
"name": "CVE-2024-56622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56622"
},
{
"name": "CVE-2024-56623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56623"
},
{
"name": "CVE-2024-56625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56625"
},
{
"name": "CVE-2024-56629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56629"
},
{
"name": "CVE-2024-56630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56630"
},
{
"name": "CVE-2024-56632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56632"
},
{
"name": "CVE-2024-56634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56634"
},
{
"name": "CVE-2024-56635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56635"
},
{
"name": "CVE-2024-56636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56636"
},
{
"name": "CVE-2024-56637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56637"
},
{
"name": "CVE-2024-56641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56641"
},
{
"name": "CVE-2024-56642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56642"
},
{
"name": "CVE-2024-56643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56643"
},
{
"name": "CVE-2024-56644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56644"
},
{
"name": "CVE-2024-56648",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56648"
},
{
"name": "CVE-2024-56649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56649"
},
{
"name": "CVE-2024-56651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56651"
},
{
"name": "CVE-2024-56659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56659"
},
{
"name": "CVE-2024-56662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56662"
},
{
"name": "CVE-2024-56663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56663"
},
{
"name": "CVE-2024-56670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56670"
},
{
"name": "CVE-2024-56672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56672"
},
{
"name": "CVE-2024-56677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56677"
},
{
"name": "CVE-2024-56678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56678"
},
{
"name": "CVE-2024-56681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56681"
},
{
"name": "CVE-2024-56683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56683"
},
{
"name": "CVE-2024-56687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56687"
},
{
"name": "CVE-2024-56688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56688"
},
{
"name": "CVE-2024-56690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56690"
},
{
"name": "CVE-2024-56691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56691"
},
{
"name": "CVE-2024-56694",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56694"
},
{
"name": "CVE-2024-56698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56698"
},
{
"name": "CVE-2024-56700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56700"
},
{
"name": "CVE-2024-56701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56701"
},
{
"name": "CVE-2024-56705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56705"
},
{
"name": "CVE-2024-56708",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56708"
},
{
"name": "CVE-2024-56716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56716"
},
{
"name": "CVE-2024-56722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56722"
},
{
"name": "CVE-2024-56723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56723"
},
{
"name": "CVE-2024-56724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56724"
},
{
"name": "CVE-2024-56729",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56729"
},
{
"name": "CVE-2024-56739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56739"
},
{
"name": "CVE-2024-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56745"
},
{
"name": "CVE-2024-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56746"
},
{
"name": "CVE-2024-56747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56747"
},
{
"name": "CVE-2024-56748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56748"
},
{
"name": "CVE-2024-56759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56759"
},
{
"name": "CVE-2024-56765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56765"
},
{
"name": "CVE-2024-56767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56767"
},
{
"name": "CVE-2024-56769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56769"
},
{
"name": "CVE-2024-56774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56774"
},
{
"name": "CVE-2024-56775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56775"
},
{
"name": "CVE-2024-56776",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56776"
},
{
"name": "CVE-2024-56777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56777"
},
{
"name": "CVE-2024-56778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56778"
},
{
"name": "CVE-2024-56779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56779"
},
{
"name": "CVE-2024-56780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56780"
},
{
"name": "CVE-2024-56787",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56787"
},
{
"name": "CVE-2024-57791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57791"
},
{
"name": "CVE-2024-57792",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57792"
},
{
"name": "CVE-2024-57798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57798"
},
{
"name": "CVE-2024-57838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57838"
},
{
"name": "CVE-2024-57849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57849"
},
{
"name": "CVE-2024-57850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57850"
},
{
"name": "CVE-2024-57874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57874"
},
{
"name": "CVE-2024-57876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57876"
},
{
"name": "CVE-2024-57890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57890"
},
{
"name": "CVE-2024-57892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57892"
},
{
"name": "CVE-2024-57896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57896"
},
{
"name": "CVE-2024-57897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57897"
},
{
"name": "CVE-2024-57903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57903"
},
{
"name": "CVE-2024-57904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57904"
},
{
"name": "CVE-2024-57906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57906"
},
{
"name": "CVE-2024-57907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57907"
},
{
"name": "CVE-2024-57908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57908"
},
{
"name": "CVE-2024-57910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57910"
},
{
"name": "CVE-2024-57911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57911"
},
{
"name": "CVE-2024-57912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57912"
},
{
"name": "CVE-2024-57913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57913"
},
{
"name": "CVE-2024-57922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57922"
},
{
"name": "CVE-2024-57929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57929"
},
{
"name": "CVE-2024-57940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57940"
},
{
"name": "CVE-2025-21646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21646"
},
{
"name": "CVE-2024-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53047"
},
{
"name": "CVE-2024-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50258"
},
{
"name": "CVE-2024-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50304"
},
{
"name": "CVE-2024-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53187"
},
{
"name": "CVE-2024-53203",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53203"
},
{
"name": "CVE-2024-56592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56592"
},
{
"name": "CVE-2024-56600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56600"
},
{
"name": "CVE-2024-56601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56601"
},
{
"name": "CVE-2024-56608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56608"
},
{
"name": "CVE-2024-56610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56610"
},
{
"name": "CVE-2024-56650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56650"
},
{
"name": "CVE-2024-56658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56658"
},
{
"name": "CVE-2024-56679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56679"
},
{
"name": "CVE-2024-56693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56693"
},
{
"name": "CVE-2024-56707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56707"
},
{
"name": "CVE-2024-56715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56715"
},
{
"name": "CVE-2024-56725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56725"
},
{
"name": "CVE-2024-56726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56726"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2024-56728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56728"
},
{
"name": "CVE-2024-56763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56763"
},
{
"name": "CVE-2024-57802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57802"
},
{
"name": "CVE-2024-57882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57882"
},
{
"name": "CVE-2024-57884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57884"
},
{
"name": "CVE-2024-57917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57917"
},
{
"name": "CVE-2024-57931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57931"
},
{
"name": "CVE-2024-57938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57938"
},
{
"name": "CVE-2024-57946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57946"
},
{
"name": "CVE-2025-21653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21653"
},
{
"name": "CVE-2025-21664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21664"
},
{
"name": "CVE-2025-21666",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21666"
},
{
"name": "CVE-2025-21669",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21669"
},
{
"name": "CVE-2025-21670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21670"
},
{
"name": "CVE-2025-21674",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21674"
},
{
"name": "CVE-2025-21675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21675"
},
{
"name": "CVE-2025-21676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21676"
},
{
"name": "CVE-2025-21678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21678"
},
{
"name": "CVE-2025-21682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21682"
},
{
"name": "CVE-2024-50164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50164"
},
{
"name": "CVE-2024-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53124"
},
{
"name": "CVE-2024-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53128"
},
{
"name": "CVE-2024-56703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56703"
},
{
"name": "CVE-2024-57925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57925"
},
{
"name": "CVE-2024-57939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57939"
},
{
"name": "CVE-2024-57948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57948"
},
{
"name": "CVE-2025-21631",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21631"
},
{
"name": "CVE-2025-21636",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21636"
},
{
"name": "CVE-2025-21637",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21637"
},
{
"name": "CVE-2025-21638",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21638"
},
{
"name": "CVE-2025-21639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21639"
},
{
"name": "CVE-2025-21640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21640"
},
{
"name": "CVE-2025-21648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21648"
},
{
"name": "CVE-2025-21665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21665"
},
{
"name": "CVE-2025-21667",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21667"
},
{
"name": "CVE-2025-21668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21668"
},
{
"name": "CVE-2025-21680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21680"
},
{
"name": "CVE-2025-21681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21681"
},
{
"name": "CVE-2025-21683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21683"
},
{
"name": "CVE-2024-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53177"
},
{
"name": "CVE-2024-56633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56633"
},
{
"name": "CVE-2025-21673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21673"
},
{
"name": "CVE-2022-49034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49034"
},
{
"name": "CVE-2024-47711",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47711"
},
{
"name": "CVE-2024-47726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47726"
},
{
"name": "CVE-2024-49865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49865"
},
{
"name": "CVE-2024-50029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50029"
},
{
"name": "CVE-2024-50030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50030"
},
{
"name": "CVE-2024-50056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50056"
},
{
"name": "CVE-2024-50057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50057"
},
{
"name": "CVE-2024-50065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50065"
},
{
"name": "CVE-2024-50066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50066"
},
{
"name": "CVE-2024-50068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50068"
},
{
"name": "CVE-2024-50070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50070"
},
{
"name": "CVE-2024-50090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50090"
},
{
"name": "CVE-2024-50104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50104"
},
{
"name": "CVE-2024-50105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50105"
},
{
"name": "CVE-2024-50107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50107"
},
{
"name": "CVE-2024-50111",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50111"
},
{
"name": "CVE-2024-50112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50112"
},
{
"name": "CVE-2024-50118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50118"
},
{
"name": "CVE-2024-50120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50120"
},
{
"name": "CVE-2024-50137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50137"
},
{
"name": "CVE-2024-50140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50140"
},
{
"name": "CVE-2024-50152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50152"
},
{
"name": "CVE-2024-50170",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50170"
},
{
"name": "CVE-2024-50197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50197"
},
{
"name": "CVE-2024-50206",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50206"
},
{
"name": "CVE-2024-50207",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50207"
},
{
"name": "CVE-2024-50220",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50220"
},
{
"name": "CVE-2024-50222",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50222"
},
{
"name": "CVE-2024-50223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50223"
},
{
"name": "CVE-2024-50238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50238"
},
{
"name": "CVE-2024-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50239"
},
{
"name": "CVE-2024-50263",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50263"
},
{
"name": "CVE-2024-50270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50270"
},
{
"name": "CVE-2024-50285",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50285"
},
{
"name": "CVE-2024-50288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50288"
},
{
"name": "CVE-2024-50291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50291"
},
{
"name": "CVE-2024-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50294"
},
{
"name": "CVE-2024-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50297"
},
{
"name": "CVE-2024-50300",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50300"
},
{
"name": "CVE-2024-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50303"
},
{
"name": "CVE-2024-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53044"
},
{
"name": "CVE-2024-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53046"
},
{
"name": "CVE-2024-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53053"
},
{
"name": "CVE-2024-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53062"
},
{
"name": "CVE-2024-53067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53067"
},
{
"name": "CVE-2024-53083",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53083"
},
{
"name": "CVE-2024-53084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53084"
},
{
"name": "CVE-2024-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53086"
},
{
"name": "CVE-2024-53087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53087"
},
{
"name": "CVE-2024-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53089"
},
{
"name": "CVE-2024-53107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53107"
},
{
"name": "CVE-2024-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53109"
},
{
"name": "CVE-2024-53115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53115"
},
{
"name": "CVE-2024-53139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53139"
},
{
"name": "CVE-2024-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53145"
},
{
"name": "CVE-2024-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53147"
},
{
"name": "CVE-2024-53163",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53163"
},
{
"name": "CVE-2024-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53165"
},
{
"name": "CVE-2024-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53176"
},
{
"name": "CVE-2024-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53178"
},
{
"name": "CVE-2024-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53181"
},
{
"name": "CVE-2024-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53183"
},
{
"name": "CVE-2024-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53184"
},
{
"name": "CVE-2024-53218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53218"
},
{
"name": "CVE-2024-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53219"
},
{
"name": "CVE-2024-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53220"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2024-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53223"
},
{
"name": "CVE-2024-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53226"
},
{
"name": "CVE-2024-53228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53228"
},
{
"name": "CVE-2024-56540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56540"
},
{
"name": "CVE-2024-56545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56545"
},
{
"name": "CVE-2024-56685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56685"
},
{
"name": "CVE-2024-56689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56689"
},
{
"name": "CVE-2024-56692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56692"
},
{
"name": "CVE-2024-56720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56720"
},
{
"name": "CVE-2024-56721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56721"
},
{
"name": "CVE-2024-56742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56742"
},
{
"name": "CVE-2024-56744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56744"
},
{
"name": "CVE-2024-56751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56751"
},
{
"name": "CVE-2025-0927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0927"
},
{
"name": "CVE-2024-56579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56579"
},
{
"name": "CVE-2024-56647",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56647"
},
{
"name": "CVE-2024-57889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57889"
},
{
"name": "CVE-2025-21684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21684"
},
{
"name": "CVE-2025-21687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21687"
},
{
"name": "CVE-2025-21689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21689"
},
{
"name": "CVE-2025-21690",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21690"
},
{
"name": "CVE-2025-21692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21692"
},
{
"name": "CVE-2025-21697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21697"
},
{
"name": "CVE-2025-21699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21699"
},
{
"name": "CVE-2025-21700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21700"
},
{
"name": "CVE-2024-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43098"
},
{
"name": "CVE-2024-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47408"
},
{
"name": "CVE-2024-49571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49571"
},
{
"name": "CVE-2024-53680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53680"
},
{
"name": "CVE-2024-56581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56581"
},
{
"name": "CVE-2024-56586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56586"
},
{
"name": "CVE-2024-56626",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56626"
},
{
"name": "CVE-2024-56627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56627"
},
{
"name": "CVE-2024-56640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56640"
},
{
"name": "CVE-2024-56770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56770"
},
{
"name": "CVE-2024-56781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56781"
},
{
"name": "CVE-2024-56783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56783"
},
{
"name": "CVE-2024-56785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56785"
},
{
"name": "CVE-2024-57807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57807"
},
{
"name": "CVE-2024-57841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57841"
},
{
"name": "CVE-2024-57900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57900"
},
{
"name": "CVE-2024-57901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57901"
},
{
"name": "CVE-2024-57902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57902"
},
{
"name": "CVE-2024-57949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57949"
},
{
"name": "CVE-2024-57951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57951"
},
{
"name": "CVE-2025-21694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21694"
},
{
"name": "CVE-2022-0995",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0995"
},
{
"name": "CVE-2024-41932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41932"
},
{
"name": "CVE-2024-41935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41935"
},
{
"name": "CVE-2024-47794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47794"
},
{
"name": "CVE-2024-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48875"
},
{
"name": "CVE-2024-48876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48876"
},
{
"name": "CVE-2024-56550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56550"
},
{
"name": "CVE-2024-56561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56561"
},
{
"name": "CVE-2024-56565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56565"
},
{
"name": "CVE-2024-56580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56580"
},
{
"name": "CVE-2024-56583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56583"
},
{
"name": "CVE-2024-56613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56613"
},
{
"name": "CVE-2024-56621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56621"
},
{
"name": "CVE-2024-56638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56638"
},
{
"name": "CVE-2024-56771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56771"
},
{
"name": "CVE-2024-56772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56772"
},
{
"name": "CVE-2024-56773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56773"
},
{
"name": "CVE-2024-56782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56782"
},
{
"name": "CVE-2024-56786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56786"
},
{
"name": "CVE-2024-57843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57843"
},
{
"name": "CVE-2024-57872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57872"
},
{
"name": "CVE-2024-58087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58087"
},
{
"name": "CVE-2025-21701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21701"
},
{
"name": "CVE-2025-21703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21703"
},
{
"name": "CVE-2025-21693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21693"
},
{
"name": "CVE-2025-21756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21756"
},
{
"name": "CVE-2025-21831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21831"
},
{
"name": "CVE-2025-21702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21702"
},
{
"name": "CVE-2025-21993",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21993"
},
{
"name": "CVE-2024-44955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44955"
},
{
"name": "CVE-2024-50032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50032"
},
{
"name": "CVE-2024-57950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57950"
},
{
"name": "CVE-2024-57952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57952"
},
{
"name": "CVE-2025-21672",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21672"
},
{
"name": "CVE-2025-21677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21677"
},
{
"name": "CVE-2025-21685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21685"
},
{
"name": "CVE-2025-21691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21691"
},
{
"name": "CVE-2025-21695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21695"
},
{
"name": "CVE-2025-21696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21696"
},
{
"name": "CVE-2025-2312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2312"
}
],
"initial_release_date": "2025-04-25T00:00:00",
"last_revision_date": "2025-04-25T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0349",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-04-25T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7459-1",
"url": "https://ubuntu.com/security/notices/USN-7459-1"
},
{
"published_at": "2025-04-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7451-1",
"url": "https://ubuntu.com/security/notices/USN-7451-1"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7449-2",
"url": "https://ubuntu.com/security/notices/USN-7449-2"
},
{
"published_at": "2025-04-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7450-1",
"url": "https://ubuntu.com/security/notices/USN-7450-1"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7461-1",
"url": "https://ubuntu.com/security/notices/USN-7461-1"
},
{
"published_at": "2025-04-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7453-1",
"url": "https://ubuntu.com/security/notices/USN-7453-1"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7462-1",
"url": "https://ubuntu.com/security/notices/USN-7462-1"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7463-1",
"url": "https://ubuntu.com/security/notices/USN-7463-1"
},
{
"published_at": "2025-04-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7445-1",
"url": "https://ubuntu.com/security/notices/USN-7445-1"
},
{
"published_at": "2025-04-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7448-1",
"url": "https://ubuntu.com/security/notices/USN-7448-1"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7461-2",
"url": "https://ubuntu.com/security/notices/USN-7461-2"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7455-1",
"url": "https://ubuntu.com/security/notices/USN-7455-1"
},
{
"published_at": "2025-04-22",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7402-5",
"url": "https://ubuntu.com/security/notices/USN-7402-5"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7455-2",
"url": "https://ubuntu.com/security/notices/USN-7455-2"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7460-1",
"url": "https://ubuntu.com/security/notices/USN-7460-1"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7462-2",
"url": "https://ubuntu.com/security/notices/USN-7462-2"
},
{
"published_at": "2025-04-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7452-1",
"url": "https://ubuntu.com/security/notices/USN-7452-1"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7458-1",
"url": "https://ubuntu.com/security/notices/USN-7458-1"
},
{
"published_at": "2025-04-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7455-3",
"url": "https://ubuntu.com/security/notices/USN-7455-3"
},
{
"published_at": "2025-04-23",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7449-1",
"url": "https://ubuntu.com/security/notices/USN-7449-1"
}
]
}
CERTFR-2025-AVI-0366
Vulnerability from certfr_avis - Published: 2025-05-02 - Updated: 2025-05-02
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42315",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42315"
},
{
"name": "CVE-2024-43900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43900"
},
{
"name": "CVE-2024-44938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44938"
},
{
"name": "CVE-2024-46784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46784"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46809"
},
{
"name": "CVE-2024-46841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46841"
},
{
"name": "CVE-2024-46871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46871"
},
{
"name": "CVE-2024-47670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47670"
},
{
"name": "CVE-2024-47671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47671"
},
{
"name": "CVE-2024-47672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47672"
},
{
"name": "CVE-2024-47673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47673"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-47685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47685"
},
{
"name": "CVE-2024-47692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47692"
},
{
"name": "CVE-2024-47693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47693"
},
{
"name": "CVE-2024-47695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47695"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47697"
},
{
"name": "CVE-2024-47698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47698"
},
{
"name": "CVE-2024-47699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47699"
},
{
"name": "CVE-2024-47704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47704"
},
{
"name": "CVE-2024-47705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47705"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-47707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47707"
},
{
"name": "CVE-2024-47709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47709"
},
{
"name": "CVE-2024-47710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47710"
},
{
"name": "CVE-2024-47712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47712"
},
{
"name": "CVE-2024-47713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47713"
},
{
"name": "CVE-2024-47718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47718"
},
{
"name": "CVE-2024-47720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47720"
},
{
"name": "CVE-2024-47723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47723"
},
{
"name": "CVE-2024-47728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47728"
},
{
"name": "CVE-2024-47730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47730"
},
{
"name": "CVE-2024-47735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47735"
},
{
"name": "CVE-2024-47737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47737"
},
{
"name": "CVE-2024-47738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47738"
},
{
"name": "CVE-2024-47739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47739"
},
{
"name": "CVE-2024-47742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47742"
},
{
"name": "CVE-2024-47745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47745"
},
{
"name": "CVE-2024-47747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47747"
},
{
"name": "CVE-2024-47748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47748"
},
{
"name": "CVE-2024-47749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47749"
},
{
"name": "CVE-2024-47756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47756"
},
{
"name": "CVE-2024-47757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47757"
},
{
"name": "CVE-2024-49851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49851"
},
{
"name": "CVE-2024-49852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49852"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49858"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-49861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49861"
},
{
"name": "CVE-2024-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49863"
},
{
"name": "CVE-2024-49866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49866"
},
{
"name": "CVE-2024-49867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49867"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2024-49871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49871"
},
{
"name": "CVE-2024-49875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49875"
},
{
"name": "CVE-2024-49877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49877"
},
{
"name": "CVE-2024-49878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49878"
},
{
"name": "CVE-2024-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49879"
},
{
"name": "CVE-2024-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49881"
},
{
"name": "CVE-2024-49882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49882"
},
{
"name": "CVE-2024-49883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49883"
},
{
"name": "CVE-2024-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49886"
},
{
"name": "CVE-2024-49888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49888"
},
{
"name": "CVE-2024-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49890"
},
{
"name": "CVE-2024-49891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49891"
},
{
"name": "CVE-2024-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49892"
},
{
"name": "CVE-2024-49894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49894"
},
{
"name": "CVE-2024-49895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49895"
},
{
"name": "CVE-2024-49896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49896"
},
{
"name": "CVE-2024-49898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49898"
},
{
"name": "CVE-2024-49899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49899"
},
{
"name": "CVE-2024-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49900"
},
{
"name": "CVE-2024-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49901"
},
{
"name": "CVE-2024-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49902"
},
{
"name": "CVE-2024-49903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49903"
},
{
"name": "CVE-2024-49906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49906"
},
{
"name": "CVE-2024-49907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49907"
},
{
"name": "CVE-2024-49909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49909"
},
{
"name": "CVE-2024-49911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49911"
},
{
"name": "CVE-2024-49912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49912"
},
{
"name": "CVE-2024-49913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49913"
},
{
"name": "CVE-2024-49914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49914"
},
{
"name": "CVE-2024-49917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49917"
},
{
"name": "CVE-2024-49918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49918"
},
{
"name": "CVE-2024-49919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49919"
},
{
"name": "CVE-2024-49920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49920"
},
{
"name": "CVE-2024-49922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49922"
},
{
"name": "CVE-2024-49923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49923"
},
{
"name": "CVE-2024-49928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49928"
},
{
"name": "CVE-2024-49929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49929"
},
{
"name": "CVE-2024-49930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49930"
},
{
"name": "CVE-2024-49931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49931"
},
{
"name": "CVE-2024-49933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49933"
},
{
"name": "CVE-2024-49935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49935"
},
{
"name": "CVE-2024-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49936"
},
{
"name": "CVE-2024-49937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49937"
},
{
"name": "CVE-2024-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49938"
},
{
"name": "CVE-2024-49939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49939"
},
{
"name": "CVE-2024-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49946"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2024-49950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49950"
},
{
"name": "CVE-2024-49954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49954"
},
{
"name": "CVE-2024-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49955"
},
{
"name": "CVE-2024-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49957"
},
{
"name": "CVE-2024-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49958"
},
{
"name": "CVE-2024-49959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49959"
},
{
"name": "CVE-2024-49960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49960"
},
{
"name": "CVE-2024-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49961"
},
{
"name": "CVE-2024-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49962"
},
{
"name": "CVE-2024-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49963"
},
{
"name": "CVE-2024-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49965"
},
{
"name": "CVE-2024-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49966"
},
{
"name": "CVE-2024-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49969"
},
{
"name": "CVE-2024-49972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49972"
},
{
"name": "CVE-2024-49973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49973"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49975"
},
{
"name": "CVE-2024-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49981"
},
{
"name": "CVE-2024-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49982"
},
{
"name": "CVE-2024-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49985"
},
{
"name": "CVE-2024-49991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49991"
},
{
"name": "CVE-2024-49996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49996"
},
{
"name": "CVE-2024-50000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50000"
},
{
"name": "CVE-2024-50001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50001"
},
{
"name": "CVE-2024-50002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50002"
},
{
"name": "CVE-2024-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50006"
},
{
"name": "CVE-2024-50007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50007"
},
{
"name": "CVE-2024-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50008"
},
{
"name": "CVE-2024-50013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50013"
},
{
"name": "CVE-2024-50014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50014"
},
{
"name": "CVE-2024-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50015"
},
{
"name": "CVE-2024-50017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50017"
},
{
"name": "CVE-2024-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50019"
},
{
"name": "CVE-2024-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50020"
},
{
"name": "CVE-2024-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50021"
},
{
"name": "CVE-2024-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50022"
},
{
"name": "CVE-2024-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50023"
},
{
"name": "CVE-2024-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50024"
},
{
"name": "CVE-2024-50025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50025"
},
{
"name": "CVE-2024-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50027"
},
{
"name": "CVE-2024-50028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50028"
},
{
"name": "CVE-2024-50031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50031"
},
{
"name": "CVE-2024-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50033"
},
{
"name": "CVE-2024-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50035"
},
{
"name": "CVE-2024-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50040"
},
{
"name": "CVE-2024-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50041"
},
{
"name": "CVE-2024-50042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50042"
},
{
"name": "CVE-2024-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50044"
},
{
"name": "CVE-2024-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50045"
},
{
"name": "CVE-2024-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50046"
},
{
"name": "CVE-2024-50047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50047"
},
{
"name": "CVE-2024-50048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50048"
},
{
"name": "CVE-2024-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50049"
},
{
"name": "CVE-2024-50055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50055"
},
{
"name": "CVE-2024-50058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50058"
},
{
"name": "CVE-2024-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50059"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2024-50061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50061"
},
{
"name": "CVE-2024-50062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50062"
},
{
"name": "CVE-2024-50063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50063"
},
{
"name": "CVE-2024-50064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50064"
},
{
"name": "CVE-2024-50069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50069"
},
{
"name": "CVE-2024-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50073"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-50075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50075"
},
{
"name": "CVE-2024-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50076"
},
{
"name": "CVE-2024-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50077"
},
{
"name": "CVE-2024-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50078"
},
{
"name": "CVE-2024-50080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50080"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2024-50036",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50036"
},
{
"name": "CVE-2024-50067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50067"
},
{
"name": "CVE-2024-50072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50072"
},
{
"name": "CVE-2024-50126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50126"
},
{
"name": "CVE-2024-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50215"
},
{
"name": "CVE-2024-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50218"
},
{
"name": "CVE-2024-50229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50229"
},
{
"name": "CVE-2024-50230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50230"
},
{
"name": "CVE-2024-50232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50232"
},
{
"name": "CVE-2024-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50233"
},
{
"name": "CVE-2024-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50234"
},
{
"name": "CVE-2024-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50235"
},
{
"name": "CVE-2024-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50236"
},
{
"name": "CVE-2024-50237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50237"
},
{
"name": "CVE-2024-50242",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50242"
},
{
"name": "CVE-2024-50243",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50243"
},
{
"name": "CVE-2024-50244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50244"
},
{
"name": "CVE-2024-50245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50245"
},
{
"name": "CVE-2024-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50247"
},
{
"name": "CVE-2024-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50250"
},
{
"name": "CVE-2024-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50251"
},
{
"name": "CVE-2024-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50252"
},
{
"name": "CVE-2024-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50255"
},
{
"name": "CVE-2024-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50256"
},
{
"name": "CVE-2024-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50257"
},
{
"name": "CVE-2024-50259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50259"
},
{
"name": "CVE-2024-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50261"
},
{
"name": "CVE-2024-50262",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50262"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50267"
},
{
"name": "CVE-2024-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50268"
},
{
"name": "CVE-2024-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50269"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2024-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50272"
},
{
"name": "CVE-2024-50273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50273"
},
{
"name": "CVE-2024-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50276"
},
{
"name": "CVE-2024-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50278"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50280",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50280"
},
{
"name": "CVE-2024-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50282"
},
{
"name": "CVE-2024-50283",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50283"
},
{
"name": "CVE-2024-50284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50284"
},
{
"name": "CVE-2024-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50286"
},
{
"name": "CVE-2024-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50287"
},
{
"name": "CVE-2024-50290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50290"
},
{
"name": "CVE-2024-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50292"
},
{
"name": "CVE-2024-50295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50295"
},
{
"name": "CVE-2024-50296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50296"
},
{
"name": "CVE-2024-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50299"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53042"
},
{
"name": "CVE-2024-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53043"
},
{
"name": "CVE-2024-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53052"
},
{
"name": "CVE-2024-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53055"
},
{
"name": "CVE-2024-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53058"
},
{
"name": "CVE-2024-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53059"
},
{
"name": "CVE-2024-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53061"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53066"
},
{
"name": "CVE-2024-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53072"
},
{
"name": "CVE-2024-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53081"
},
{
"name": "CVE-2024-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53082"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2024-50226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50226"
},
{
"name": "CVE-2024-49925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49925"
},
{
"name": "CVE-2024-49945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49945"
},
{
"name": "CVE-2024-50208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50208"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2024-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50142"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-47679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47679"
},
{
"name": "CVE-2024-47690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47690"
},
{
"name": "CVE-2024-47701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47701"
},
{
"name": "CVE-2024-47734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47734"
},
{
"name": "CVE-2024-47740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47740"
},
{
"name": "CVE-2024-49856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49856"
},
{
"name": "CVE-2024-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49868"
},
{
"name": "CVE-2024-49884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49884"
},
{
"name": "CVE-2024-49889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49889"
},
{
"name": "CVE-2024-49893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49893"
},
{
"name": "CVE-2024-49905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49905"
},
{
"name": "CVE-2024-49915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49915"
},
{
"name": "CVE-2024-49921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49921"
},
{
"name": "CVE-2024-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49924"
},
{
"name": "CVE-2024-49927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49927"
},
{
"name": "CVE-2024-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49944"
},
{
"name": "CVE-2024-49948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49948"
},
{
"name": "CVE-2024-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49952"
},
{
"name": "CVE-2024-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49977"
},
{
"name": "CVE-2024-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49983"
},
{
"name": "CVE-2024-49997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49997"
},
{
"name": "CVE-2024-50038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50038"
},
{
"name": "CVE-2024-50039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50039"
},
{
"name": "CVE-2024-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50093"
},
{
"name": "CVE-2024-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50095"
},
{
"name": "CVE-2024-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50096"
},
{
"name": "CVE-2024-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50179"
},
{
"name": "CVE-2024-50180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50180"
},
{
"name": "CVE-2024-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50184"
},
{
"name": "CVE-2024-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50186"
},
{
"name": "CVE-2024-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50188"
},
{
"name": "CVE-2024-50189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50189"
},
{
"name": "CVE-2024-50191",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50191"
},
{
"name": "CVE-2024-47703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47703"
},
{
"name": "CVE-2024-49934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49934"
},
{
"name": "CVE-2024-49968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49968"
},
{
"name": "CVE-2024-49987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49987"
},
{
"name": "CVE-2024-49989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49989"
},
{
"name": "CVE-2024-50009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50009"
},
{
"name": "CVE-2024-50026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50026"
},
{
"name": "CVE-2024-50084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50084"
},
{
"name": "CVE-2024-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50087"
},
{
"name": "CVE-2024-50088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50088"
},
{
"name": "CVE-2024-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50098"
},
{
"name": "CVE-2024-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50101"
},
{
"name": "CVE-2024-50103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50103"
},
{
"name": "CVE-2024-50108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50108"
},
{
"name": "CVE-2024-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50115"
},
{
"name": "CVE-2024-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50116"
},
{
"name": "CVE-2024-50117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50117"
},
{
"name": "CVE-2024-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50121"
},
{
"name": "CVE-2024-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50124"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50127"
},
{
"name": "CVE-2024-50128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50128"
},
{
"name": "CVE-2024-50130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50130"
},
{
"name": "CVE-2024-50131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50131"
},
{
"name": "CVE-2024-50134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50134"
},
{
"name": "CVE-2024-50135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50135"
},
{
"name": "CVE-2024-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50136"
},
{
"name": "CVE-2024-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50138"
},
{
"name": "CVE-2024-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50139"
},
{
"name": "CVE-2024-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50141"
},
{
"name": "CVE-2024-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50145"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2024-50147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50147"
},
{
"name": "CVE-2024-50148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50148"
},
{
"name": "CVE-2024-50150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50150"
},
{
"name": "CVE-2024-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50153"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50155"
},
{
"name": "CVE-2024-50156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50156"
},
{
"name": "CVE-2024-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50158"
},
{
"name": "CVE-2024-50159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50159"
},
{
"name": "CVE-2024-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50160"
},
{
"name": "CVE-2024-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50166"
},
{
"name": "CVE-2024-50167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50167"
},
{
"name": "CVE-2024-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50169"
},
{
"name": "CVE-2024-50171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50171"
},
{
"name": "CVE-2024-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50172"
},
{
"name": "CVE-2024-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50182"
},
{
"name": "CVE-2024-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50183"
},
{
"name": "CVE-2024-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50187"
},
{
"name": "CVE-2024-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50194"
},
{
"name": "CVE-2024-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50195"
},
{
"name": "CVE-2024-50196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50196"
},
{
"name": "CVE-2024-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50198"
},
{
"name": "CVE-2024-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50200"
},
{
"name": "CVE-2024-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50201"
},
{
"name": "CVE-2024-50205",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50205"
},
{
"name": "CVE-2024-50209",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50209"
},
{
"name": "CVE-2024-50216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50216"
},
{
"name": "CVE-2024-50221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50221"
},
{
"name": "CVE-2024-50224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50224"
},
{
"name": "CVE-2024-50225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50225"
},
{
"name": "CVE-2024-50231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50231"
},
{
"name": "CVE-2024-50240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50240"
},
{
"name": "CVE-2024-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50246"
},
{
"name": "CVE-2024-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50248"
},
{
"name": "CVE-2024-50274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50274"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2024-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50289"
},
{
"name": "CVE-2024-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50298"
},
{
"name": "CVE-2024-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53045"
},
{
"name": "CVE-2024-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53048"
},
{
"name": "CVE-2024-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53051"
},
{
"name": "CVE-2024-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53068"
},
{
"name": "CVE-2024-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53076"
},
{
"name": "CVE-2024-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53079"
},
{
"name": "CVE-2024-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53085"
},
{
"name": "CVE-2024-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53094"
},
{
"name": "CVE-2024-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53095"
},
{
"name": "CVE-2024-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53096"
},
{
"name": "CVE-2024-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53100"
},
{
"name": "CVE-2024-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53101"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53106"
},
{
"name": "CVE-2024-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53108"
},
{
"name": "CVE-2024-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53110"
},
{
"name": "CVE-2024-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53112"
},
{
"name": "CVE-2024-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53114"
},
{
"name": "CVE-2024-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53121"
},
{
"name": "CVE-2024-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53138"
},
{
"name": "CVE-2024-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53142"
},
{
"name": "CVE-2024-47678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47678"
},
{
"name": "CVE-2024-49859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49859"
},
{
"name": "CVE-2024-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49978"
},
{
"name": "CVE-2024-49992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49992"
},
{
"name": "CVE-2024-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50010"
},
{
"name": "CVE-2024-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50083"
},
{
"name": "CVE-2024-50085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50085"
},
{
"name": "CVE-2024-50086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50086"
},
{
"name": "CVE-2024-50133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50133"
},
{
"name": "CVE-2024-50143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50143"
},
{
"name": "CVE-2024-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50151"
},
{
"name": "CVE-2024-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50162"
},
{
"name": "CVE-2024-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50163"
},
{
"name": "CVE-2024-50168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50168"
},
{
"name": "CVE-2024-50185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50185"
},
{
"name": "CVE-2024-50193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50193"
},
{
"name": "CVE-2024-50199",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50199"
},
{
"name": "CVE-2024-50202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50202"
},
{
"name": "CVE-2024-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53103"
},
{
"name": "CVE-2024-53113",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53113"
},
{
"name": "CVE-2024-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53119"
},
{
"name": "CVE-2024-53120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53120"
},
{
"name": "CVE-2024-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53122"
},
{
"name": "CVE-2024-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53123"
},
{
"name": "CVE-2024-53127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53127"
},
{
"name": "CVE-2024-53129",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53129"
},
{
"name": "CVE-2024-53130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53130"
},
{
"name": "CVE-2024-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53131"
},
{
"name": "CVE-2024-53135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53135"
},
{
"name": "CVE-2024-53136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53136"
},
{
"name": "CVE-2024-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53140"
},
{
"name": "CVE-2024-53144",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53144"
},
{
"name": "CVE-2024-8805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8805"
},
{
"name": "CVE-2024-50016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50016"
},
{
"name": "CVE-2024-50203",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50203"
},
{
"name": "CVE-2024-50211",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50211"
},
{
"name": "CVE-2024-53050",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53050"
},
{
"name": "CVE-2024-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53090"
},
{
"name": "CVE-2024-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53099"
},
{
"name": "CVE-2024-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53105"
},
{
"name": "CVE-2024-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53111"
},
{
"name": "CVE-2024-53117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53117"
},
{
"name": "CVE-2024-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53118"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2024-53126",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53126"
},
{
"name": "CVE-2024-53133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53133"
},
{
"name": "CVE-2024-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53134"
},
{
"name": "CVE-2024-53141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53141"
},
{
"name": "CVE-2024-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53146"
},
{
"name": "CVE-2024-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53148"
},
{
"name": "CVE-2024-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53150"
},
{
"name": "CVE-2024-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53151"
},
{
"name": "CVE-2024-53154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53154"
},
{
"name": "CVE-2024-53155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53155"
},
{
"name": "CVE-2024-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53156"
},
{
"name": "CVE-2024-53157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53157"
},
{
"name": "CVE-2024-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53158"
},
{
"name": "CVE-2024-53160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53160"
},
{
"name": "CVE-2024-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53161"
},
{
"name": "CVE-2024-53162",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53162"
},
{
"name": "CVE-2024-53166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53166"
},
{
"name": "CVE-2024-53169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53169"
},
{
"name": "CVE-2024-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53171"
},
{
"name": "CVE-2024-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53173"
},
{
"name": "CVE-2024-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53174"
},
{
"name": "CVE-2024-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53180"
},
{
"name": "CVE-2024-53188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53188"
},
{
"name": "CVE-2024-53190",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53190"
},
{
"name": "CVE-2024-53191",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53191"
},
{
"name": "CVE-2024-53200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53200"
},
{
"name": "CVE-2024-53202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53202"
},
{
"name": "CVE-2024-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53206"
},
{
"name": "CVE-2024-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53208"
},
{
"name": "CVE-2024-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53209"
},
{
"name": "CVE-2024-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53210"
},
{
"name": "CVE-2024-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53213"
},
{
"name": "CVE-2024-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53214"
},
{
"name": "CVE-2024-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53215"
},
{
"name": "CVE-2024-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53217"
},
{
"name": "CVE-2024-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53222"
},
{
"name": "CVE-2024-53224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53224"
},
{
"name": "CVE-2024-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53229"
},
{
"name": "CVE-2024-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53234"
},
{
"name": "CVE-2024-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53237"
},
{
"name": "CVE-2024-56539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56539"
},
{
"name": "CVE-2024-56549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56549"
},
{
"name": "CVE-2024-56551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56551"
},
{
"name": "CVE-2024-56562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56562"
},
{
"name": "CVE-2024-56566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56566"
},
{
"name": "CVE-2024-56567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56567"
},
{
"name": "CVE-2024-56576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56576"
},
{
"name": "CVE-2024-56582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56582"
},
{
"name": "CVE-2024-56599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56599"
},
{
"name": "CVE-2024-56604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56604"
},
{
"name": "CVE-2024-56605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56605"
},
{
"name": "CVE-2024-56645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56645"
},
{
"name": "CVE-2024-56752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56752"
},
{
"name": "CVE-2024-56754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56754"
},
{
"name": "CVE-2024-56755",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56755"
},
{
"name": "CVE-2024-56756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56756"
},
{
"name": "CVE-2024-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53239"
},
{
"name": "CVE-2024-56548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56548"
},
{
"name": "CVE-2024-56570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56570"
},
{
"name": "CVE-2024-56575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56575"
},
{
"name": "CVE-2024-56598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56598"
},
{
"name": "CVE-2024-56619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56619"
},
{
"name": "CVE-2024-56631",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56631"
},
{
"name": "CVE-2024-56704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56704"
},
{
"name": "CVE-2024-36476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36476"
},
{
"name": "CVE-2024-45828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45828"
},
{
"name": "CVE-2024-47141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47141"
},
{
"name": "CVE-2024-47143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47143"
},
{
"name": "CVE-2024-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47809"
},
{
"name": "CVE-2024-48873",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48873"
},
{
"name": "CVE-2024-48881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48881"
},
{
"name": "CVE-2024-49569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49569"
},
{
"name": "CVE-2024-49998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49998"
},
{
"name": "CVE-2024-50051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50051"
},
{
"name": "CVE-2024-52332",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52332"
},
{
"name": "CVE-2024-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53091"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2024-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53170"
},
{
"name": "CVE-2024-53172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53172"
},
{
"name": "CVE-2024-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53175"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2024-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53195"
},
{
"name": "CVE-2024-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53196"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53198"
},
{
"name": "CVE-2024-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53227"
},
{
"name": "CVE-2024-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53230"
},
{
"name": "CVE-2024-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53231"
},
{
"name": "CVE-2024-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53232"
},
{
"name": "CVE-2024-53233",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53233"
},
{
"name": "CVE-2024-53236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53236"
},
{
"name": "CVE-2024-53685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53685"
},
{
"name": "CVE-2024-53690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53690"
},
{
"name": "CVE-2024-55881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55881"
},
{
"name": "CVE-2024-55916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55916"
},
{
"name": "CVE-2024-56369",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56369"
},
{
"name": "CVE-2024-56531",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56531"
},
{
"name": "CVE-2024-56532",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56532"
},
{
"name": "CVE-2024-56533",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56533"
},
{
"name": "CVE-2024-56538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56538"
},
{
"name": "CVE-2024-56543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56543"
},
{
"name": "CVE-2024-56546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56546"
},
{
"name": "CVE-2024-56557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56557"
},
{
"name": "CVE-2024-56558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56558"
},
{
"name": "CVE-2024-56568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56568"
},
{
"name": "CVE-2024-56569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56569"
},
{
"name": "CVE-2024-56572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56572"
},
{
"name": "CVE-2024-56573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56573"
},
{
"name": "CVE-2024-56574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56574"
},
{
"name": "CVE-2024-53164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53164"
},
{
"name": "CVE-2024-56577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56577"
},
{
"name": "CVE-2024-56578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56578"
},
{
"name": "CVE-2024-56584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56584"
},
{
"name": "CVE-2024-56587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56587"
},
{
"name": "CVE-2024-56588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56588"
},
{
"name": "CVE-2024-56589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56589"
},
{
"name": "CVE-2024-56590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56590"
},
{
"name": "CVE-2024-56593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56593"
},
{
"name": "CVE-2024-56594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56594"
},
{
"name": "CVE-2024-56595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56595"
},
{
"name": "CVE-2024-56596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56596"
},
{
"name": "CVE-2024-56597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56597"
},
{
"name": "CVE-2024-56602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56602"
},
{
"name": "CVE-2024-56603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56603"
},
{
"name": "CVE-2024-56606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56606"
},
{
"name": "CVE-2024-56607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56607"
},
{
"name": "CVE-2024-56609",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56609"
},
{
"name": "CVE-2024-56611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56611"
},
{
"name": "CVE-2024-56614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56614"
},
{
"name": "CVE-2024-56615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56615"
},
{
"name": "CVE-2024-56616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56616"
},
{
"name": "CVE-2024-56620",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56620"
},
{
"name": "CVE-2024-56622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56622"
},
{
"name": "CVE-2024-56623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56623"
},
{
"name": "CVE-2024-56625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56625"
},
{
"name": "CVE-2024-56629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56629"
},
{
"name": "CVE-2024-56630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56630"
},
{
"name": "CVE-2024-56632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56632"
},
{
"name": "CVE-2024-56634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56634"
},
{
"name": "CVE-2024-56635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56635"
},
{
"name": "CVE-2024-56636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56636"
},
{
"name": "CVE-2024-56637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56637"
},
{
"name": "CVE-2024-56641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56641"
},
{
"name": "CVE-2024-56642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56642"
},
{
"name": "CVE-2024-56643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56643"
},
{
"name": "CVE-2024-56644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56644"
},
{
"name": "CVE-2024-56648",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56648"
},
{
"name": "CVE-2024-56649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56649"
},
{
"name": "CVE-2024-56651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56651"
},
{
"name": "CVE-2024-56659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56659"
},
{
"name": "CVE-2024-56662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56662"
},
{
"name": "CVE-2024-56663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56663"
},
{
"name": "CVE-2024-56670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56670"
},
{
"name": "CVE-2024-56672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56672"
},
{
"name": "CVE-2024-56677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56677"
},
{
"name": "CVE-2024-56678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56678"
},
{
"name": "CVE-2024-56681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56681"
},
{
"name": "CVE-2024-56683",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56683"
},
{
"name": "CVE-2024-56687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56687"
},
{
"name": "CVE-2024-56688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56688"
},
{
"name": "CVE-2024-56690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56690"
},
{
"name": "CVE-2024-56691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56691"
},
{
"name": "CVE-2024-56694",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56694"
},
{
"name": "CVE-2024-56698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56698"
},
{
"name": "CVE-2024-56700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56700"
},
{
"name": "CVE-2024-56701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56701"
},
{
"name": "CVE-2024-56705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56705"
},
{
"name": "CVE-2024-56708",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56708"
},
{
"name": "CVE-2024-56716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56716"
},
{
"name": "CVE-2024-56722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56722"
},
{
"name": "CVE-2024-56723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56723"
},
{
"name": "CVE-2024-56724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56724"
},
{
"name": "CVE-2024-56729",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56729"
},
{
"name": "CVE-2024-56739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56739"
},
{
"name": "CVE-2024-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56745"
},
{
"name": "CVE-2024-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56746"
},
{
"name": "CVE-2024-56747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56747"
},
{
"name": "CVE-2024-56748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56748"
},
{
"name": "CVE-2024-56759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56759"
},
{
"name": "CVE-2024-56765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56765"
},
{
"name": "CVE-2024-56767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56767"
},
{
"name": "CVE-2024-56769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56769"
},
{
"name": "CVE-2024-56774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56774"
},
{
"name": "CVE-2024-56775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56775"
},
{
"name": "CVE-2024-56776",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56776"
},
{
"name": "CVE-2024-56777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56777"
},
{
"name": "CVE-2024-56778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56778"
},
{
"name": "CVE-2024-56779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56779"
},
{
"name": "CVE-2024-56780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56780"
},
{
"name": "CVE-2024-56787",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56787"
},
{
"name": "CVE-2024-57791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57791"
},
{
"name": "CVE-2024-57792",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57792"
},
{
"name": "CVE-2024-57798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57798"
},
{
"name": "CVE-2024-57838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57838"
},
{
"name": "CVE-2024-57849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57849"
},
{
"name": "CVE-2024-57850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57850"
},
{
"name": "CVE-2024-57874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57874"
},
{
"name": "CVE-2024-57876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57876"
},
{
"name": "CVE-2024-57890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57890"
},
{
"name": "CVE-2024-57892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57892"
},
{
"name": "CVE-2024-57896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57896"
},
{
"name": "CVE-2024-57897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57897"
},
{
"name": "CVE-2024-57903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57903"
},
{
"name": "CVE-2024-57904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57904"
},
{
"name": "CVE-2024-57906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57906"
},
{
"name": "CVE-2024-57907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57907"
},
{
"name": "CVE-2024-57908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57908"
},
{
"name": "CVE-2024-57910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57910"
},
{
"name": "CVE-2024-57911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57911"
},
{
"name": "CVE-2024-57912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57912"
},
{
"name": "CVE-2024-57913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57913"
},
{
"name": "CVE-2024-57922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57922"
},
{
"name": "CVE-2024-57929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57929"
},
{
"name": "CVE-2024-57940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57940"
},
{
"name": "CVE-2025-21646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21646"
},
{
"name": "CVE-2024-53047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53047"
},
{
"name": "CVE-2024-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50258"
},
{
"name": "CVE-2024-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50304"
},
{
"name": "CVE-2024-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53187"
},
{
"name": "CVE-2024-53203",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53203"
},
{
"name": "CVE-2024-56592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56592"
},
{
"name": "CVE-2024-56600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56600"
},
{
"name": "CVE-2024-56601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56601"
},
{
"name": "CVE-2024-56608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56608"
},
{
"name": "CVE-2024-56610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56610"
},
{
"name": "CVE-2024-56650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56650"
},
{
"name": "CVE-2024-56658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56658"
},
{
"name": "CVE-2024-56679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56679"
},
{
"name": "CVE-2024-56693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56693"
},
{
"name": "CVE-2024-56707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56707"
},
{
"name": "CVE-2024-56715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56715"
},
{
"name": "CVE-2024-56725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56725"
},
{
"name": "CVE-2024-56726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56726"
},
{
"name": "CVE-2024-56727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56727"
},
{
"name": "CVE-2024-56728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56728"
},
{
"name": "CVE-2024-56763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56763"
},
{
"name": "CVE-2024-57802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57802"
},
{
"name": "CVE-2024-57882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57882"
},
{
"name": "CVE-2024-57884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57884"
},
{
"name": "CVE-2024-57917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57917"
},
{
"name": "CVE-2024-57931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57931"
},
{
"name": "CVE-2024-57938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57938"
},
{
"name": "CVE-2024-57946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57946"
},
{
"name": "CVE-2025-21653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21653"
},
{
"name": "CVE-2025-21664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21664"
},
{
"name": "CVE-2025-21666",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21666"
},
{
"name": "CVE-2025-21669",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21669"
},
{
"name": "CVE-2025-21678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21678"
},
{
"name": "CVE-2024-49994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49994"
},
{
"name": "CVE-2024-50164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50164"
},
{
"name": "CVE-2024-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53124"
},
{
"name": "CVE-2024-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53128"
},
{
"name": "CVE-2024-56703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56703"
},
{
"name": "CVE-2024-57925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57925"
},
{
"name": "CVE-2024-57939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57939"
},
{
"name": "CVE-2024-57948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57948"
},
{
"name": "CVE-2025-21631",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21631"
},
{
"name": "CVE-2025-21636",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21636"
},
{
"name": "CVE-2025-21637",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21637"
},
{
"name": "CVE-2025-21638",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21638"
},
{
"name": "CVE-2025-21639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21639"
},
{
"name": "CVE-2025-21640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21640"
},
{
"name": "CVE-2025-21648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21648"
},
{
"name": "CVE-2025-21665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21665"
},
{
"name": "CVE-2025-21680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21680"
},
{
"name": "CVE-2025-21683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21683"
},
{
"name": "CVE-2024-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53177"
},
{
"name": "CVE-2024-56633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56633"
},
{
"name": "CVE-2022-49034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49034"
},
{
"name": "CVE-2024-47689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47689"
},
{
"name": "CVE-2024-47691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47691"
},
{
"name": "CVE-2024-47711",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47711"
},
{
"name": "CVE-2024-47726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47726"
},
{
"name": "CVE-2024-49865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49865"
},
{
"name": "CVE-2024-49880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49880"
},
{
"name": "CVE-2024-49926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49926"
},
{
"name": "CVE-2024-49988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49988"
},
{
"name": "CVE-2024-50029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50029"
},
{
"name": "CVE-2024-50030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50030"
},
{
"name": "CVE-2024-50056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50056"
},
{
"name": "CVE-2024-50057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50057"
},
{
"name": "CVE-2024-50065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50065"
},
{
"name": "CVE-2024-50066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50066"
},
{
"name": "CVE-2024-50068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50068"
},
{
"name": "CVE-2024-50070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50070"
},
{
"name": "CVE-2024-50090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50090"
},
{
"name": "CVE-2024-50104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50104"
},
{
"name": "CVE-2024-50105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50105"
},
{
"name": "CVE-2024-50107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50107"
},
{
"name": "CVE-2024-50111",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50111"
},
{
"name": "CVE-2024-50112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50112"
},
{
"name": "CVE-2024-50118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50118"
},
{
"name": "CVE-2024-50120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50120"
},
{
"name": "CVE-2024-50137",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50137"
},
{
"name": "CVE-2024-50140",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50140"
},
{
"name": "CVE-2024-50152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50152"
},
{
"name": "CVE-2024-50170",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50170"
},
{
"name": "CVE-2024-50197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50197"
},
{
"name": "CVE-2024-50206",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50206"
},
{
"name": "CVE-2024-50207",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50207"
},
{
"name": "CVE-2024-50220",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50220"
},
{
"name": "CVE-2024-50222",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50222"
},
{
"name": "CVE-2024-50223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50223"
},
{
"name": "CVE-2024-50238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50238"
},
{
"name": "CVE-2024-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50239"
},
{
"name": "CVE-2024-50263",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50263"
},
{
"name": "CVE-2024-50270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50270"
},
{
"name": "CVE-2024-50285",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50285"
},
{
"name": "CVE-2024-50288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50288"
},
{
"name": "CVE-2024-50291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50291"
},
{
"name": "CVE-2024-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50294"
},
{
"name": "CVE-2024-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50297"
},
{
"name": "CVE-2024-50300",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50300"
},
{
"name": "CVE-2024-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50303"
},
{
"name": "CVE-2024-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53044"
},
{
"name": "CVE-2024-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53046"
},
{
"name": "CVE-2024-53053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53053"
},
{
"name": "CVE-2024-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53062"
},
{
"name": "CVE-2024-53067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53067"
},
{
"name": "CVE-2024-53083",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53083"
},
{
"name": "CVE-2024-53084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53084"
},
{
"name": "CVE-2024-53086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53086"
},
{
"name": "CVE-2024-53087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53087"
},
{
"name": "CVE-2024-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53089"
},
{
"name": "CVE-2024-53107",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53107"
},
{
"name": "CVE-2024-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53109"
},
{
"name": "CVE-2024-53115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53115"
},
{
"name": "CVE-2024-53139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53139"
},
{
"name": "CVE-2024-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53145"
},
{
"name": "CVE-2024-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53147"
},
{
"name": "CVE-2024-53163",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53163"
},
{
"name": "CVE-2024-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53165"
},
{
"name": "CVE-2024-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53176"
},
{
"name": "CVE-2024-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53178"
},
{
"name": "CVE-2024-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53181"
},
{
"name": "CVE-2024-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53183"
},
{
"name": "CVE-2024-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53184"
},
{
"name": "CVE-2024-53218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53218"
},
{
"name": "CVE-2024-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53219"
},
{
"name": "CVE-2024-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53220"
},
{
"name": "CVE-2024-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53221"
},
{
"name": "CVE-2024-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53223"
},
{
"name": "CVE-2024-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53226"
},
{
"name": "CVE-2024-53228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53228"
},
{
"name": "CVE-2024-56540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56540"
},
{
"name": "CVE-2024-56545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56545"
},
{
"name": "CVE-2024-56685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56685"
},
{
"name": "CVE-2024-56689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56689"
},
{
"name": "CVE-2024-56692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56692"
},
{
"name": "CVE-2024-56720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56720"
},
{
"name": "CVE-2024-56721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56721"
},
{
"name": "CVE-2024-56742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56742"
},
{
"name": "CVE-2024-56744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56744"
},
{
"name": "CVE-2024-56751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56751"
},
{
"name": "CVE-2025-0927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0927"
},
{
"name": "CVE-2024-56579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56579"
},
{
"name": "CVE-2024-56647",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56647"
},
{
"name": "CVE-2024-57889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57889"
},
{
"name": "CVE-2025-21687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21687"
},
{
"name": "CVE-2025-21689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21689"
},
{
"name": "CVE-2025-21690",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21690"
},
{
"name": "CVE-2025-21692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21692"
},
{
"name": "CVE-2025-21697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21697"
},
{
"name": "CVE-2025-21699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21699"
},
{
"name": "CVE-2025-21700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21700"
},
{
"name": "CVE-2024-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43098"
},
{
"name": "CVE-2024-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47408"
},
{
"name": "CVE-2024-49571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49571"
},
{
"name": "CVE-2024-53680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53680"
},
{
"name": "CVE-2024-56581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56581"
},
{
"name": "CVE-2024-56586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56586"
},
{
"name": "CVE-2024-56626",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56626"
},
{
"name": "CVE-2024-56627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56627"
},
{
"name": "CVE-2024-56640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56640"
},
{
"name": "CVE-2024-56770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56770"
},
{
"name": "CVE-2024-56781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56781"
},
{
"name": "CVE-2024-56785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56785"
},
{
"name": "CVE-2024-57807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57807"
},
{
"name": "CVE-2024-57841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57841"
},
{
"name": "CVE-2024-57900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57900"
},
{
"name": "CVE-2024-57901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57901"
},
{
"name": "CVE-2024-57902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57902"
},
{
"name": "CVE-2024-57951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57951"
},
{
"name": "CVE-2025-21694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21694"
},
{
"name": "CVE-2022-0995",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0995"
},
{
"name": "CVE-2024-41932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41932"
},
{
"name": "CVE-2024-41935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41935"
},
{
"name": "CVE-2024-47794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47794"
},
{
"name": "CVE-2024-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48875"
},
{
"name": "CVE-2024-48876",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48876"
},
{
"name": "CVE-2024-56550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56550"
},
{
"name": "CVE-2024-56565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56565"
},
{
"name": "CVE-2024-56580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56580"
},
{
"name": "CVE-2024-56583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56583"
},
{
"name": "CVE-2024-56613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56613"
},
{
"name": "CVE-2024-56621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56621"
},
{
"name": "CVE-2024-56638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56638"
},
{
"name": "CVE-2024-56771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56771"
},
{
"name": "CVE-2024-56772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56772"
},
{
"name": "CVE-2024-56773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56773"
},
{
"name": "CVE-2024-56782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56782"
},
{
"name": "CVE-2024-56786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56786"
},
{
"name": "CVE-2024-57843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57843"
},
{
"name": "CVE-2024-57872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57872"
},
{
"name": "CVE-2024-58087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58087"
},
{
"name": "CVE-2025-21701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21701"
},
{
"name": "CVE-2025-21703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21703"
},
{
"name": "CVE-2025-21756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21756"
},
{
"name": "CVE-2025-21831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21831"
},
{
"name": "CVE-2025-21702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21702"
},
{
"name": "CVE-2025-21993",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21993"
},
{
"name": "CVE-2024-44955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44955"
},
{
"name": "CVE-2025-2312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2312"
}
],
"initial_release_date": "2025-05-02T00:00:00",
"last_revision_date": "2025-05-02T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0366",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-05-02T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2025-04-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7455-4",
"url": "https://ubuntu.com/security/notices/USN-7455-4"
},
{
"published_at": "2025-04-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7459-2",
"url": "https://ubuntu.com/security/notices/USN-7459-2"
},
{
"published_at": "2025-04-28",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7468-1",
"url": "https://ubuntu.com/security/notices/USN-7468-1"
},
{
"published_at": "2025-04-29",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7455-5",
"url": "https://ubuntu.com/security/notices/USN-7455-5"
}
]
}
CERTFR-2025-AVI-0677
Vulnerability from certfr_avis - Published: 2025-08-12 - Updated: 2025-08-12
De multiples vulnérabilités ont été découvertes dans les produits Siemens. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| Siemens | N/A | SIMATIC PCS neo V6.0 versions antérieures à V6.0 SP1 | ||
| Siemens | N/A | SIMATIC WinCC V17, v18 et V20 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC Control Function Library (CFL) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIPROTEC 5 versions antérieures à 10.0 | ||
| Siemens | N/A | SIMATIC MTP Integrator toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ProSave V17 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Unified Line Coordination toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC TeleControl toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC OA V3.19 versions antérieures à V3.19 P020 | ||
| Siemens | N/A | SIMATIC WinCC flexible ES toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V17 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2024-54678. | ||
| Siemens | N/A | SIMATIC S7-Fail-safe Configuration Tool (S7-FCT) versions antérieures à 4.0.1 | ||
| Siemens | N/A | SIMATIC PCS neo V6.0 toutes versions pour la vulnérabilité CVE-2024-54678 | ||
| Siemens | N/A | SIMATIC eaSie Core Package (6DL5424-0AX00-0AV8) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC MTP CREATOR V2.x et V3.x toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC WinCC OA V3.18 versions antérieures à V3.18 P032 | ||
| Siemens | N/A | TIA Portal Cloud V19 versions antérieures à 5.2.1.1 | ||
| Siemens | N/A | SIMATIC D7-SYS toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC BATCH V10.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ODK 1500S toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2020 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour les vulnérabilités CVE-2025-30033 et CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC S7-1500 Software Controller V2 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | TIA Portal Cloud Connector toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Unified Sequence toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V17 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40759. | ||
| Siemens | N/A | SIMATIC WinCC Runtime Advanced toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Logon V2.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ProSave V19 versions antérieures à V19 Update 4 | ||
| Siemens | N/A | SIMATIC PDM Maintenance Station V5.0 toutes versions pour les vulnérabilités CVE-2025-30033 et CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC Safety Matrix toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Management Console toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SCALANCE XCM-/XRM-/XCH-/XRH-300 family versions antérieures à 3.2 | ||
| Siemens | N/A | SIMATIC BATCH V9.1 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC Process Function Library (PFL) V4.0 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC S7-1500 Software Controller V3 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 CFC V20 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC NET PC Software toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Route Control V9.1 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2022 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC OA V3.20 versions antérieures à V3.20 P008 | ||
| Siemens | N/A | SIMATIC RTLS Locating Manager versions antérieures à 3.3 | ||
| Siemens | N/A | Siprotec 4 7SA6, 7SD5 et 7SD610 versions antérieures à 4.78 | ||
| Siemens | N/A | SIMATIC Automation Tool toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | TIA Portal Cloud V18 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC PDM V9.2 et V9.3 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Runtime Professional toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Visualization Architect (SiVArc) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC eaSie Workflow Skills toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 CFC V19 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC WinCC V19 versions antérieures à V19 Update 4 | ||
| Siemens | N/A | SIMATIC Management Agent toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC V7.5 et V8.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 V5.7 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Automation Tool SDK Windows toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2022 toutes versions pour la vulnérabilité CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V20 versions antérieures à V20 Update 1 | ||
| Siemens | N/A | TIA Portal Cloud V17 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC Energy Suite toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS 7 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2024 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 V19 versions antérieures à V19 Update 4 | ||
| Siemens | N/A | TIA Portal Test Suite V17, v18, v19 et v20 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7-PCT toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Target toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ProSave V18 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC Logon V1.6 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC STEP 7 V17 et V18 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC RTLS Locating Manager versions antérieures à 3.2 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM Advanced versions antérieures à V7.0 Update 1 | ||
| Siemens | N/A | SIMATIC PCS neo V5.0 toutes versions pour la vulnérabilité CVE-2024-54678 | ||
| Siemens | N/A | SIMATIC STEP 7 V20 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | TIA Portal Cloud V20 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | Siprotec 4 toutes versions et tous modèles exceptés 7SA6, 7SD5, 7SD610 pour la vulnérabilité CVE-2024-52504. | ||
| Siemens | N/A | SIMATIC eaSie PCS 7 Skill Package (6DL5424-0BX00-0AV8) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 versions antérieures à 3.2 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V17, V18 et V19 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Unified PC Runtime V18, V19 et V20 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS 7 Advanced Process Faceplates V9.1 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7 F Systems V6.4 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Information Server toutes versions pour la vulnérabilité CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC S7 F Systems V6.3 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC ProSave V20 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS 7 Logic Matrix V9.1 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | WinCC Panel Image Setup toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS neo V4.1 et V5.0 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2024-54678. | ||
| Siemens | N/A | SIMATIC Route Control V10.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC V8.1 versions antérieures à V8.1 Update 3 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SIMATIC PCS neo V6.0 versions ant\u00e9rieures \u00e0 V6.0 SP1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V17, v18 et V20 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Control Function Library (CFL) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPROTEC 5 versions ant\u00e9rieures \u00e0 10.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC MTP Integrator toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V17 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Unified Line Coordination toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC TeleControl toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC OA V3.19 versions ant\u00e9rieures \u00e0 V3.19 P020",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC flexible ES toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V17 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-Fail-safe Configuration Tool (S7-FCT) versions ant\u00e9rieures \u00e0 4.0.1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS neo V6.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC eaSie Core Package (6DL5424-0AX00-0AV8) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC MTP CREATOR V2.x et V3.x toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC OA V3.18 versions ant\u00e9rieures \u00e0 V3.18 P032",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V19 versions ant\u00e9rieures \u00e0 5.2.1.1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC D7-SYS toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC BATCH V10.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ODK 1500S toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2020 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour les vuln\u00e9rabilit\u00e9s CVE-2025-30033 et CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 Software Controller V2 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud Connector toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Unified Sequence toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V17 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40759.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Runtime Advanced toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Logon V2.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V19 versions ant\u00e9rieures \u00e0 V19 Update 4",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PDM Maintenance Station V5.0 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2025-30033 et CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Safety Matrix toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Management Console toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XCM-/XRM-/XCH-/XRH-300 family versions ant\u00e9rieures \u00e0 3.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC BATCH V9.1 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Function Library (PFL) V4.0 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 Software Controller V3 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 CFC V20 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC NET PC Software toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Route Control V9.1 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2022 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC OA V3.20 versions ant\u00e9rieures \u00e0 V3.20 P008",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC RTLS Locating Manager versions ant\u00e9rieures \u00e0 3.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "Siprotec 4 7SA6, 7SD5 et 7SD610 versions ant\u00e9rieures \u00e0 4.78",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Automation Tool toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V18 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PDM V9.2 et V9.3 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Runtime Professional toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Visualization Architect (SiVArc) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC eaSie Workflow Skills toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 CFC V19 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V19 versions ant\u00e9rieures \u00e0 V19 Update 4",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Management Agent toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V7.5 et V8.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V5.7 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Automation Tool SDK Windows toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2022 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V20 versions ant\u00e9rieures \u00e0 V20 Update 1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V17 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Energy Suite toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS 7 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2024 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V19 versions ant\u00e9rieures \u00e0 V19 Update 4",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Test Suite V17, v18, v19 et v20 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PCT toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Target toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V18 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Logon V1.6 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V17 et V18 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC RTLS Locating Manager versions ant\u00e9rieures \u00e0 3.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM Advanced versions ant\u00e9rieures \u00e0 V7.0 Update 1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS neo V5.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V20 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V20 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "Siprotec 4 toutes versions et tous mod\u00e8les except\u00e9s 7SA6, 7SD5, 7SD610 pour la vuln\u00e9rabilit\u00e9 CVE-2024-52504. ",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC eaSie PCS 7 Skill Package (6DL5424-0BX00-0AV8) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 versions ant\u00e9rieures \u00e0 3.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V17, V18 et V19 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Unified PC Runtime V18, V19 et V20 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS 7 Advanced Process Faceplates V9.1 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 F Systems V6.4 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Information Server toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 F Systems V6.3 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V20 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS 7 Logic Matrix V9.1 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "WinCC Panel Image Setup toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS neo V4.1 et V5.0 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Route Control V10.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V8.1 versions ant\u00e9rieures \u00e0 V8.1 Update 3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-44879",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44879"
},
{
"name": "CVE-2023-3567",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3567"
},
{
"name": "CVE-2023-5178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5178"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2023-5717",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5717"
},
{
"name": "CVE-2023-39198",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39198"
},
{
"name": "CVE-2023-45863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45863"
},
{
"name": "CVE-2023-6931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6931"
},
{
"name": "CVE-2023-6606",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6606"
},
{
"name": "CVE-2023-6121",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6121"
},
{
"name": "CVE-2023-51779",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51779"
},
{
"name": "CVE-2023-6932",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6932"
},
{
"name": "CVE-2024-0193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0193"
},
{
"name": "CVE-2023-6040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6040"
},
{
"name": "CVE-2023-46343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46343"
},
{
"name": "CVE-2023-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35827"
},
{
"name": "CVE-2024-0646",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0646"
},
{
"name": "CVE-2023-51782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51782"
},
{
"name": "CVE-2023-51781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51781"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2024-1086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1086"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2023-52597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52597"
},
{
"name": "CVE-2024-26598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26598"
},
{
"name": "CVE-2023-52598",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52598"
},
{
"name": "CVE-2023-52601",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52601"
},
{
"name": "CVE-2023-52600",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52600"
},
{
"name": "CVE-2023-52602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52602"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2023-52606",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52606"
},
{
"name": "CVE-2023-52604",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52604"
},
{
"name": "CVE-2023-52587",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52587"
},
{
"name": "CVE-2023-52599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52599"
},
{
"name": "CVE-2023-52583",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52583"
},
{
"name": "CVE-2023-52603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52603"
},
{
"name": "CVE-2023-52607",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52607"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2023-52595",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52595"
},
{
"name": "CVE-2024-26602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26602"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2023-52475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52475"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26593"
},
{
"name": "CVE-2024-0584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0584"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52617",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52617"
},
{
"name": "CVE-2024-26645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26645"
},
{
"name": "CVE-2024-0841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0841"
},
{
"name": "CVE-2023-52477",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52477"
},
{
"name": "CVE-2023-52504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52504"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2023-52509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52509"
},
{
"name": "CVE-2023-52637",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52637"
},
{
"name": "CVE-2023-52507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52507"
},
{
"name": "CVE-2024-26664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26664"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-52510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52510"
},
{
"name": "CVE-2024-26754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26754"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26606"
},
{
"name": "CVE-2024-26702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26702"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26749"
},
{
"name": "CVE-2024-26688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26688"
},
{
"name": "CVE-2024-26763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26763"
},
{
"name": "CVE-2024-26722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26722"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26779"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26790"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26751"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2024-26910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26910"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26835"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-26825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26825"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40963"
},
{
"name": "CVE-2024-40968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40968"
},
{
"name": "CVE-2024-40971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40971"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2022-48666",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48666"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41020"
},
{
"name": "CVE-2024-41022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41022"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2024-41068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41068"
},
{
"name": "CVE-2024-41077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41077"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42143"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2022-48935",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48935"
},
{
"name": "CVE-2024-43861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43861"
},
{
"name": "CVE-2024-43867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43867"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2024-43879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43879"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2024-43882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43882"
},
{
"name": "CVE-2024-43883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43883"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-43893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43893"
},
{
"name": "CVE-2024-43894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43894"
},
{
"name": "CVE-2024-43907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43907"
},
{
"name": "CVE-2024-43908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43908"
},
{
"name": "CVE-2024-45003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45003"
},
{
"name": "CVE-2024-44987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44987"
},
{
"name": "CVE-2024-44988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44988"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2024-44995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44995"
},
{
"name": "CVE-2024-44998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44998"
},
{
"name": "CVE-2024-44999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44999"
},
{
"name": "CVE-2024-45006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45006"
},
{
"name": "CVE-2024-45008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45008"
},
{
"name": "CVE-2024-45021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45021"
},
{
"name": "CVE-2024-45025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45025"
},
{
"name": "CVE-2024-46673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46673"
},
{
"name": "CVE-2024-46674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46674"
},
{
"name": "CVE-2024-46675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46675"
},
{
"name": "CVE-2024-46676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46676"
},
{
"name": "CVE-2024-46677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46677"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2024-46685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46685"
},
{
"name": "CVE-2024-46689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46689"
},
{
"name": "CVE-2024-46702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46702"
},
{
"name": "CVE-2024-46707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46707"
},
{
"name": "CVE-2024-46713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46713"
},
{
"name": "CVE-2024-46714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46714"
},
{
"name": "CVE-2024-46719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46719"
},
{
"name": "CVE-2024-46721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46721"
},
{
"name": "CVE-2024-46722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46722"
},
{
"name": "CVE-2024-46723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46723"
},
{
"name": "CVE-2024-46724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46724"
},
{
"name": "CVE-2024-46725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46725"
},
{
"name": "CVE-2024-46731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46731"
},
{
"name": "CVE-2024-46737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46737"
},
{
"name": "CVE-2024-46738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46738"
},
{
"name": "CVE-2024-46739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46739"
},
{
"name": "CVE-2024-46740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46740"
},
{
"name": "CVE-2024-46743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46743"
},
{
"name": "CVE-2024-46744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46744"
},
{
"name": "CVE-2024-46745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46745"
},
{
"name": "CVE-2024-46747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46747"
},
{
"name": "CVE-2024-46750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46750"
},
{
"name": "CVE-2024-46755",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46755"
},
{
"name": "CVE-2024-46756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46756"
},
{
"name": "CVE-2024-46757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46757"
},
{
"name": "CVE-2024-46758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46758"
},
{
"name": "CVE-2024-46759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46759"
},
{
"name": "CVE-2024-46761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46761"
},
{
"name": "CVE-2024-46763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46763"
},
{
"name": "CVE-2024-46771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46771"
},
{
"name": "CVE-2024-46777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46777"
},
{
"name": "CVE-2024-46780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46780"
},
{
"name": "CVE-2024-46781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46781"
},
{
"name": "CVE-2024-46782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46782"
},
{
"name": "CVE-2024-46783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46783"
},
{
"name": "CVE-2024-46791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46791"
},
{
"name": "CVE-2024-46798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46798"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2024-46804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46804"
},
{
"name": "CVE-2024-46814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46814"
},
{
"name": "CVE-2024-46815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46815"
},
{
"name": "CVE-2024-46817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46817"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2024-46819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46819"
},
{
"name": "CVE-2024-46822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46822"
},
{
"name": "CVE-2024-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46828"
},
{
"name": "CVE-2024-46829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46829"
},
{
"name": "CVE-2024-46832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46832"
},
{
"name": "CVE-2024-46840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46840"
},
{
"name": "CVE-2024-46844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46844"
},
{
"name": "CVE-2024-43890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43890"
},
{
"name": "CVE-2024-43914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43914"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2024-44944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44944"
},
{
"name": "CVE-2024-44952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44952"
},
{
"name": "CVE-2024-44954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44954"
},
{
"name": "CVE-2024-44960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44960"
},
{
"name": "CVE-2024-44965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44965"
},
{
"name": "CVE-2024-44969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44969"
},
{
"name": "CVE-2024-44971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44971"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2024-47659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47659"
},
{
"name": "CVE-2024-47663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47663"
},
{
"name": "CVE-2024-47667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47667"
},
{
"name": "CVE-2024-47669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47669"
},
{
"name": "CVE-2024-9681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9681"
},
{
"name": "CVE-2023-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52917"
},
{
"name": "CVE-2023-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52919"
},
{
"name": "CVE-2024-47660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47660"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-47685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47685"
},
{
"name": "CVE-2024-47692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47692"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47697"
},
{
"name": "CVE-2024-47698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47698"
},
{
"name": "CVE-2024-47699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47699"
},
{
"name": "CVE-2024-47705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47705"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-47709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47709"
},
{
"name": "CVE-2024-47710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47710"
},
{
"name": "CVE-2024-47712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47712"
},
{
"name": "CVE-2024-47713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47713"
},
{
"name": "CVE-2024-47718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47718"
},
{
"name": "CVE-2024-47723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47723"
},
{
"name": "CVE-2024-47735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47735"
},
{
"name": "CVE-2024-47737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47737"
},
{
"name": "CVE-2024-47739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47739"
},
{
"name": "CVE-2024-47742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47742"
},
{
"name": "CVE-2024-47747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47747"
},
{
"name": "CVE-2024-47748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47748"
},
{
"name": "CVE-2024-47749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47749"
},
{
"name": "CVE-2024-47756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47756"
},
{
"name": "CVE-2024-47757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47757"
},
{
"name": "CVE-2024-49851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49851"
},
{
"name": "CVE-2024-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49858"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49863"
},
{
"name": "CVE-2024-49867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49867"
},
{
"name": "CVE-2024-49875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49875"
},
{
"name": "CVE-2024-49877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49877"
},
{
"name": "CVE-2024-49878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49878"
},
{
"name": "CVE-2024-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49879"
},
{
"name": "CVE-2024-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49881"
},
{
"name": "CVE-2024-49882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49882"
},
{
"name": "CVE-2024-49883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49883"
},
{
"name": "CVE-2024-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49890"
},
{
"name": "CVE-2024-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49892"
},
{
"name": "CVE-2024-49894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49894"
},
{
"name": "CVE-2024-49895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49895"
},
{
"name": "CVE-2024-49896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49896"
},
{
"name": "CVE-2024-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49900"
},
{
"name": "CVE-2024-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49901"
},
{
"name": "CVE-2024-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49902"
},
{
"name": "CVE-2024-49903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49903"
},
{
"name": "CVE-2024-49907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49907"
},
{
"name": "CVE-2024-49913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49913"
},
{
"name": "CVE-2024-49930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49930"
},
{
"name": "CVE-2024-49933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49933"
},
{
"name": "CVE-2024-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49936"
},
{
"name": "CVE-2024-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49938"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2024-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49955"
},
{
"name": "CVE-2024-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49957"
},
{
"name": "CVE-2024-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49958"
},
{
"name": "CVE-2024-49959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49959"
},
{
"name": "CVE-2024-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49962"
},
{
"name": "CVE-2024-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49963"
},
{
"name": "CVE-2024-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49965"
},
{
"name": "CVE-2024-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49966"
},
{
"name": "CVE-2024-49967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49967"
},
{
"name": "CVE-2024-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49969"
},
{
"name": "CVE-2024-49973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49973"
},
{
"name": "CVE-2024-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49975"
},
{
"name": "CVE-2024-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49981"
},
{
"name": "CVE-2024-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49982"
},
{
"name": "CVE-2024-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49985"
},
{
"name": "CVE-2024-49993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49993"
},
{
"name": "CVE-2024-49995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49995"
},
{
"name": "CVE-2024-50001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50001"
},
{
"name": "CVE-2024-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50006"
},
{
"name": "CVE-2024-50007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50007"
},
{
"name": "CVE-2024-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50008"
},
{
"name": "CVE-2024-50013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50013"
},
{
"name": "CVE-2024-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50015"
},
{
"name": "CVE-2024-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50024"
},
{
"name": "CVE-2024-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50033"
},
{
"name": "CVE-2024-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50035"
},
{
"name": "CVE-2024-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50040"
},
{
"name": "CVE-2024-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50044"
},
{
"name": "CVE-2024-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50045"
},
{
"name": "CVE-2024-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50046"
},
{
"name": "CVE-2024-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50049"
},
{
"name": "CVE-2024-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50059"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-44949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44949"
},
{
"name": "CVE-2024-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50218"
},
{
"name": "CVE-2024-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50234"
},
{
"name": "CVE-2024-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50236"
},
{
"name": "CVE-2024-50237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50237"
},
{
"name": "CVE-2024-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50251"
},
{
"name": "CVE-2024-50262",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50262"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50267"
},
{
"name": "CVE-2024-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50268"
},
{
"name": "CVE-2024-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50269"
},
{
"name": "CVE-2024-50273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50273"
},
{
"name": "CVE-2024-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50278"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50282"
},
{
"name": "CVE-2024-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50287"
},
{
"name": "CVE-2024-50290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50290"
},
{
"name": "CVE-2024-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50292"
},
{
"name": "CVE-2024-50295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50295"
},
{
"name": "CVE-2024-50296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50296"
},
{
"name": "CVE-2024-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50299"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53052"
},
{
"name": "CVE-2024-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53057"
},
{
"name": "CVE-2024-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53059"
},
{
"name": "CVE-2024-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53060"
},
{
"name": "CVE-2024-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53061"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53066"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53241"
},
{
"name": "CVE-2024-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53240"
},
{
"name": "CVE-2024-47679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47679"
},
{
"name": "CVE-2024-47701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47701"
},
{
"name": "CVE-2024-47740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47740"
},
{
"name": "CVE-2024-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49868"
},
{
"name": "CVE-2024-49884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49884"
},
{
"name": "CVE-2024-49889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49889"
},
{
"name": "CVE-2024-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49924"
},
{
"name": "CVE-2024-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49944"
},
{
"name": "CVE-2024-49948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49948"
},
{
"name": "CVE-2024-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49952"
},
{
"name": "CVE-2024-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49977"
},
{
"name": "CVE-2024-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49983"
},
{
"name": "CVE-2024-49997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49997"
},
{
"name": "CVE-2024-50039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50039"
},
{
"name": "CVE-2024-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50095"
},
{
"name": "CVE-2024-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50096"
},
{
"name": "CVE-2024-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50179"
},
{
"name": "CVE-2024-50180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50180"
},
{
"name": "CVE-2024-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50181"
},
{
"name": "CVE-2024-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50184"
},
{
"name": "CVE-2024-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50188"
},
{
"name": "CVE-2024-50089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50089"
},
{
"name": "CVE-2024-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50194"
},
{
"name": "CVE-2024-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50195"
},
{
"name": "CVE-2024-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50198"
},
{
"name": "CVE-2024-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50201"
},
{
"name": "CVE-2024-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53101"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50083"
},
{
"name": "CVE-2024-50185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50185"
},
{
"name": "CVE-2024-50193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50193"
},
{
"name": "CVE-2024-50199",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50199"
},
{
"name": "CVE-2024-50202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50202"
},
{
"name": "CVE-2024-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53097"
},
{
"name": "CVE-2024-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53103"
},
{
"name": "CVE-2024-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53146"
},
{
"name": "CVE-2024-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53148"
},
{
"name": "CVE-2024-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53150"
},
{
"name": "CVE-2024-53155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53155"
},
{
"name": "CVE-2024-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53156"
},
{
"name": "CVE-2024-53157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53157"
},
{
"name": "CVE-2024-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53158"
},
{
"name": "CVE-2024-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53161"
},
{
"name": "CVE-2024-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53171"
},
{
"name": "CVE-2024-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53173"
},
{
"name": "CVE-2024-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53174"
},
{
"name": "CVE-2024-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53214"
},
{
"name": "CVE-2024-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53217"
},
{
"name": "CVE-2024-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53237"
},
{
"name": "CVE-2024-56539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56539"
},
{
"name": "CVE-2024-56562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56562"
},
{
"name": "CVE-2024-56567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56567"
},
{
"name": "CVE-2024-56576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56576"
},
{
"name": "CVE-2024-56605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56605"
},
{
"name": "CVE-2024-56645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56645"
},
{
"name": "CVE-2024-56754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56754"
},
{
"name": "CVE-2024-56756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56756"
},
{
"name": "CVE-2024-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53239"
},
{
"name": "CVE-2024-56548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56548"
},
{
"name": "CVE-2024-56570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56570"
},
{
"name": "CVE-2024-56571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56571"
},
{
"name": "CVE-2024-56598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56598"
},
{
"name": "CVE-2024-56619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56619"
},
{
"name": "CVE-2024-56704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56704"
},
{
"name": "CVE-2024-47143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47143"
},
{
"name": "CVE-2024-48881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48881"
},
{
"name": "CVE-2024-50051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50051"
},
{
"name": "CVE-2024-52332",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52332"
},
{
"name": "CVE-2024-53172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53172"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53198"
},
{
"name": "CVE-2024-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53227"
},
{
"name": "CVE-2024-56531",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56531"
},
{
"name": "CVE-2024-56532",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56532"
},
{
"name": "CVE-2024-56533",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56533"
},
{
"name": "CVE-2024-56558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56558"
},
{
"name": "CVE-2024-56568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56568"
},
{
"name": "CVE-2024-56569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56569"
},
{
"name": "CVE-2024-56572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56572"
},
{
"name": "CVE-2024-56574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56574"
},
{
"name": "CVE-2024-56587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56587"
},
{
"name": "CVE-2024-56589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56589"
},
{
"name": "CVE-2024-56593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56593"
},
{
"name": "CVE-2024-56594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56594"
},
{
"name": "CVE-2024-56595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56595"
},
{
"name": "CVE-2024-56596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56596"
},
{
"name": "CVE-2024-56597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56597"
},
{
"name": "CVE-2024-56602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56602"
},
{
"name": "CVE-2024-56603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56603"
},
{
"name": "CVE-2024-56606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56606"
},
{
"name": "CVE-2024-56615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56615"
},
{
"name": "CVE-2024-56623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56623"
},
{
"name": "CVE-2024-56629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56629"
},
{
"name": "CVE-2024-56630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56630"
},
{
"name": "CVE-2024-56634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56634"
},
{
"name": "CVE-2024-56636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56636"
},
{
"name": "CVE-2024-56637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56637"
},
{
"name": "CVE-2024-56642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56642"
},
{
"name": "CVE-2024-56643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56643"
},
{
"name": "CVE-2024-56644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56644"
},
{
"name": "CVE-2024-56648",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56648"
},
{
"name": "CVE-2024-56659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56659"
},
{
"name": "CVE-2024-56661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56661"
},
{
"name": "CVE-2024-56662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56662"
},
{
"name": "CVE-2024-56670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56670"
},
{
"name": "CVE-2024-56681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56681"
},
{
"name": "CVE-2024-56688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56688"
},
{
"name": "CVE-2024-56690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56690"
},
{
"name": "CVE-2024-56691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56691"
},
{
"name": "CVE-2024-56698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56698"
},
{
"name": "CVE-2024-56700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56700"
},
{
"name": "CVE-2024-56701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56701"
},
{
"name": "CVE-2024-56705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56705"
},
{
"name": "CVE-2024-56723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56723"
},
{
"name": "CVE-2024-56724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56724"
},
{
"name": "CVE-2024-56739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56739"
},
{
"name": "CVE-2024-56741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56741"
},
{
"name": "CVE-2024-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56746"
},
{
"name": "CVE-2024-56747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56747"
},
{
"name": "CVE-2024-56748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56748"
},
{
"name": "CVE-2024-56779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56779"
},
{
"name": "CVE-2024-56780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56780"
},
{
"name": "CVE-2024-57874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57874"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2024-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50304"
},
{
"name": "CVE-2024-56600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56600"
},
{
"name": "CVE-2024-56601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56601"
},
{
"name": "CVE-2024-56610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56610"
},
{
"name": "CVE-2024-56650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56650"
},
{
"name": "CVE-2024-56728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56728"
},
{
"name": "CVE-2024-56633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56633"
},
{
"name": "CVE-2022-49034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49034"
},
{
"name": "CVE-2024-49971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49971"
},
{
"name": "CVE-2024-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53145"
},
{
"name": "CVE-2024-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53165"
},
{
"name": "CVE-2024-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53181"
},
{
"name": "CVE-2024-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53183"
},
{
"name": "CVE-2024-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53184"
},
{
"name": "CVE-2024-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53226"
},
{
"name": "CVE-2024-56720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56720"
},
{
"name": "CVE-2024-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43098"
},
{
"name": "CVE-2024-53680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53680"
},
{
"name": "CVE-2024-56581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56581"
},
{
"name": "CVE-2024-56586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56586"
},
{
"name": "CVE-2024-56770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56770"
},
{
"name": "CVE-2024-56781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56781"
},
{
"name": "CVE-2024-56785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56785"
},
{
"name": "CVE-2021-47316",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47316"
},
{
"name": "CVE-2024-54678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54678"
},
{
"name": "CVE-2025-30033",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30033"
},
{
"name": "CVE-2025-30034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30034"
},
{
"name": "CVE-2025-40570",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40570"
},
{
"name": "CVE-2025-40746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40746"
},
{
"name": "CVE-2025-40751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40751"
},
{
"name": "CVE-2025-40752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40752"
},
{
"name": "CVE-2025-40753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40753"
},
{
"name": "CVE-2025-40759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40759"
},
{
"name": "CVE-2025-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47809"
},
{
"name": "CVE-2024-52504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52504"
}
],
"initial_release_date": "2025-08-12T00:00:00",
"last_revision_date": "2025-08-12T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0677",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-08-12T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits Siemens. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits Siemens",
"vendor_advisories": [
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-707630",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-707630.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-331739",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-331739.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-693808",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-693808.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-613116",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-613116.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-493396",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-493396.html"
},
{
"published_at": "2025-08-11",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens ssa-400089",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-400089.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-493787",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-493787.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-894058",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-894058.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-355557",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-355557.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-529291",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-529291.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-282044",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-282044.html"
}
]
}
FKIE_CVE-2024-56704
Vulnerability from fkie_nvd - Published: 2024-12-28 10:15 - Updated: 2026-08-04 11:227.8 (High) - CVSS:3.1/
7.8 (High) - CVSS:3.1/
| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/2bb3ee1bf237557daea1d58007d2e1d4a6502ccf | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/4950408793b118cb8075bcee1f033b543fb719fa | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/530bc9f03a102fac95b07cda513bfc16ff69e0ee | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/692eb06703afc3e24d889d77e94a0e20229f6a4a | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/7f5a2ed5c1810661e6b03f5a4ebf17682cdea850 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/b9e26059664bd9ebc64a0e8f5216266fc9f84265 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/d74b4b297097bd361b8a9abfde9b521ff464ea9c | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/d888f5f5d76b2722c267e6bdf51d445d60647b7b | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/e43c608f40c065b30964f0a806348062991b802d | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://lists.debian.org/debian-lts-announce/2025/03/msg00001.html | ||
| af854a3a-2127-422b-91ae-364da2661108 | https://lists.debian.org/debian-lts-announce/2025/03/msg00002.html |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/9p/trans_xen.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "692eb06703afc3e24d889d77e94a0e20229f6a4a",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "d74b4b297097bd361b8a9abfde9b521ff464ea9c",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "7f5a2ed5c1810661e6b03f5a4ebf17682cdea850",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "4950408793b118cb8075bcee1f033b543fb719fa",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "b9e26059664bd9ebc64a0e8f5216266fc9f84265",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "2bb3ee1bf237557daea1d58007d2e1d4a6502ccf",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "d888f5f5d76b2722c267e6bdf51d445d60647b7b",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "530bc9f03a102fac95b07cda513bfc16ff69e0ee",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
},
{
"lessThan": "e43c608f40c065b30964f0a806348062991b802d",
"status": "affected",
"version": "71ebd71921e451f0f942ddfe85d01e31ddc6eb88",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/9p/trans_xen.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.12"
},
{
"lessThan": "4.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.325",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.287",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.231",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.174",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.120",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.64",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.11.*",
"status": "unaffected",
"version": "6.11.11",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.2",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.13",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "D82AB67D-EDD6-4051-90A4-E9E2918056A7",
"versionEndExcluding": "4.19.325",
"versionStartIncluding": "4.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E4B15788-D35E-4E5B-A9C0-070AE3729B34",
"versionEndExcluding": "5.4.287",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B5C644CC-2BD7-4E32-BC54-8DCC7ABE9935",
"versionEndExcluding": "5.10.231",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "419FD073-1517-4FD5-8158-F94BC68A1E89",
"versionEndExcluding": "5.15.174",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "09AC6122-E2A4-40FE-9D33-268A1B2EC265",
"versionEndExcluding": "6.1.120",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CA16DEE3-ABEC-4449-9F4A-7A3DC4FC36C7",
"versionEndExcluding": "6.6.64",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "21434379-192D-472F-9B54-D45E3650E893",
"versionEndExcluding": "6.11.11",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "D8882B1B-2ABC-4838-AC1D-DBDBB5764776",
"versionEndExcluding": "6.12.2",
"versionStartIncluding": "6.12",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\n9p/xen: fix release of IRQ\n\nKernel logs indicate an IRQ was double-freed.\n\nPass correct device ID during IRQ release.\n\n[Dominique: remove confusing variable reset to 0]"
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: 9p/xen: se corrige la liberaci\u00f3n de IRQ. Los registros del kernel indican que se liber\u00f3 una IRQ dos veces. Se pasa la identificaci\u00f3n del dispositivo correcta durante la liberaci\u00f3n de IRQ. [Dominique: se elimina la variable confusa que se restablece a 0]"
}
],
"id": "CVE-2024-56704",
"lastModified": "2026-08-04T11:22:22.783",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 8.4,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 2.5,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-56704",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "total"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-10-01T19:58:47.879822Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-12-28T10:15:18.817",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2bb3ee1bf237557daea1d58007d2e1d4a6502ccf"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4950408793b118cb8075bcee1f033b543fb719fa"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/530bc9f03a102fac95b07cda513bfc16ff69e0ee"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/692eb06703afc3e24d889d77e94a0e20229f6a4a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/7f5a2ed5c1810661e6b03f5a4ebf17682cdea850"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b9e26059664bd9ebc64a0e8f5216266fc9f84265"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d74b4b297097bd361b8a9abfde9b521ff464ea9c"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/d888f5f5d76b2722c267e6bdf51d445d60647b7b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/e43c608f40c065b30964f0a806348062991b802d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00001.html"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00002.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-415"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-415"
}
],
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
]
}
GHSA-679V-8HV6-2JM9
Vulnerability from github – Published: 2024-12-28 12:30 – Updated: 2025-11-03 21:32In the Linux kernel, the following vulnerability has been resolved:
9p/xen: fix release of IRQ
Kernel logs indicate an IRQ was double-freed.
Pass correct device ID during IRQ release.
[Dominique: remove confusing variable reset to 0]
{
"affected": [],
"aliases": [
"CVE-2024-56704"
],
"database_specific": {
"cwe_ids": [
"CWE-415"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-12-28T10:15:18Z",
"severity": "HIGH"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\n9p/xen: fix release of IRQ\n\nKernel logs indicate an IRQ was double-freed.\n\nPass correct device ID during IRQ release.\n\n[Dominique: remove confusing variable reset to 0]",
"id": "GHSA-679v-8hv6-2jm9",
"modified": "2025-11-03T21:32:01Z",
"published": "2024-12-28T12:30:48Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56704"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2bb3ee1bf237557daea1d58007d2e1d4a6502ccf"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/4950408793b118cb8075bcee1f033b543fb719fa"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/530bc9f03a102fac95b07cda513bfc16ff69e0ee"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/692eb06703afc3e24d889d77e94a0e20229f6a4a"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/7f5a2ed5c1810661e6b03f5a4ebf17682cdea850"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/b9e26059664bd9ebc64a0e8f5216266fc9f84265"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/d74b4b297097bd361b8a9abfde9b521ff464ea9c"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/d888f5f5d76b2722c267e6bdf51d445d60647b7b"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/e43c608f40c065b30964f0a806348062991b802d"
},
{
"type": "WEB",
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00001.html"
},
{
"type": "WEB",
"url": "https://lists.debian.org/debian-lts-announce/2025/03/msg00002.html"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
]
}
ICSA-25-226-07
Vulnerability from csaf_cisa - Published: 2025-08-12 00:00 - Updated: 2026-02-25 07:00MSRC_CVE-2024-56704
Vulnerability from csaf_microsoft - Published: 2024-12-02 00:00 - Updated: 2026-02-19 01:46OESA-2025-1034 (CVE-2022-49034)
Vulnerability from osv_openeuler – Published: 2025-01-10 11:08 – Updated: 2026-08-06 11:08 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved: sh: cpuinfo: Fix a warning for CONFIG_CPUMASK_OFFSTACK When CONFIG_CPUMASK_OFFSTACK and CONFIG_DEBUG_PER_CPU_MAPS are selected, cpu_max_bits_warn() generates a runtime warning similar as below when showing /proc/cpuinfo. Fix this by using nr_cpu_ids (the runtime limit) instead of NR_CPUS to iterate CPUs. [ 3.052463] ------------[ cut here ]------------ [ 3.059679] WARNING: CPU: 3 PID: 1 at include/linux/cpumask.h:108 show_cpuinfo+0x5e8/0x5f0 [ 3.070072] Modules linked in: efivarfs autofs4 [ 3.076257] CPU: 0 PID: 1 Comm: systemd Not tainted 5.19-rc5+ #1052 [ 3.099465] Stack : 9000000100157b08 9000000000f18530 9000000000cf846c 9000000100154000 [ 3.109127] 9000000100157a50 0000000000000000 9000000100157a58 9000000000ef7430 [ 3.118774] 90000001001578e8 0000000000000040 0000000000000020 ffffffffffffffff [ 3.128412] 0000000000aaaaaa 1ab25f00eec96a37 900000010021de80 900000000101c890 [ 3.138056] 0000000000000000 0000000000000000 0000000000000000 0000000000aaaaaa [ 3.147711] ffff8000339dc220 0000000000000001 0000000006ab4000 0000000000000000 [ 3.157364] 900000000101c998 0000000000000004 9000000000ef7430 0000000000000000 [ 3.167012] 0000000000000009 000000000000006c 0000000000000000 0000000000000000 [ 3.176641] 9000000000d3de08 9000000001639390 90000000002086d8 00007ffff0080286 [ 3.186260] 00000000000000b0 0000000000000004 0000000000000000 0000000000071c1c [ 3.195868] ... [ 3.199917] Call Trace: [ 3.203941] [<90000000002086d8>] show_stack+0x38/0x14c [ 3.210666] [<9000000000cf846c>] dump_stack_lvl+0x60/0x88 [ 3.217625] [<900000000023d268>] __warn+0xd0/0x100 [ 3.223958] [<9000000000cf3c90>] warn_slowpath_fmt+0x7c/0xcc [ 3.231150] [<9000000000210220>] show_cpuinfo+0x5e8/0x5f0 [ 3.238080] [<90000000004f578c>] seq_read_iter+0x354/0x4b4 [ 3.245098] [<90000000004c2e90>] new_sync_read+0x17c/0x1c4 [ 3.252114] [<90000000004c5174>] vfs_read+0x138/0x1d0 [ 3.258694] [<90000000004c55f8>] ksys_read+0x70/0x100 [ 3.265265] [<9000000000cfde9c>] do_syscall+0x7c/0x94 [ 3.271820] [<9000000000202fe4>] handle_syscall+0xc4/0x160 [ 3.281824] ---[ end trace 8b484262b4b8c24c ]---(CVE-2022-49034)
In the Linux kernel, the following vulnerability has been resolved: media: s5p_cec: limit msg.len to CEC_MAX_MSG_SIZE I expect that the hardware will have limited this to 16, but just in case it hasn't, check for this corner case.(CVE-2022-49035)
In the Linux kernel, the following vulnerability has been resolved: tcp: check skb is non-NULL in tcp_rto_delta_us() We have some machines running stock Ubuntu 20.04.6 which is their 5.4.0-174-generic kernel that are running ceph and recently hit a null ptr dereference in tcp_rearm_rto(). Initially hitting it from the TLP path, but then later we also saw it getting hit from the RACK case as well. Here are examples of the oops messages we saw in each of those cases: Jul 26 15:05:02 rx [11061395.780353] BUG: kernel NULL pointer dereference, address: 0000000000000020 Jul 26 15:05:02 rx [11061395.787572] #PF: supervisor read access in kernel mode Jul 26 15:05:02 rx [11061395.792971] #PF: error_code(0x0000) - not-present page Jul 26 15:05:02 rx [11061395.798362] PGD 0 P4D 0 Jul 26 15:05:02 rx [11061395.801164] Oops: 0000 [#1] SMP NOPTI Jul 26 15:05:02 rx [11061395.805091] CPU: 0 PID: 9180 Comm: msgr-worker-1 Tainted: G W 5.4.0-174-generic #193-Ubuntu Jul 26 15:05:02 rx [11061395.814996] Hardware name: Supermicro SMC 2x26 os-gen8 64C NVME-Y 256G/H12SSW-NTR, BIOS 2.5.V1.2U.NVMe.UEFI 05/09/2023 Jul 26 15:05:02 rx [11061395.825952] RIP: 0010:tcp_rearm_rto+0xe4/0x160 Jul 26 15:05:02 rx [11061395.830656] Code: 87 ca 04 00 00 00 5b 41 5c 41 5d 5d c3 c3 49 8b bc 24 40 06 00 00 eb 8d 48 bb cf f7 53 e3 a5 9b c4 20 4c 89 ef e8 0c fe 0e 00 <48> 8b 78 20 48 c1 ef 03 48 89 f8 41 8b bc 24 80 04 00 00 48 f7 e3 Jul 26 15:05:02 rx [11061395.849665] RSP: 0018:ffffb75d40003e08 EFLAGS: 00010246 Jul 26 15:05:02 rx [11061395.855149] RAX: 0000000000000000 RBX: 20c49ba5e353f7cf RCX: 0000000000000000 Jul 26 15:05:02 rx [11061395.862542] RDX: 0000000062177c30 RSI: 000000000000231c RDI: ffff9874ad283a60 Jul 26 15:05:02 rx [11061395.869933] RBP: ffffb75d40003e20 R08: 0000000000000000 R09: ffff987605e20aa8 Jul 26 15:05:02 rx [11061395.877318] R10: ffffb75d40003f00 R11: ffffb75d4460f740 R12: ffff9874ad283900 Jul 26 15:05:02 rx [11061395.884710] R13: ffff9874ad283a60 R14: ffff9874ad283980 R15: ffff9874ad283d30 Jul 26 15:05:02 rx [11061395.892095] FS: 00007f1ef4a2e700(0000) GS:ffff987605e00000(0000) knlGS:0000000000000000 Jul 26 15:05:02 rx [11061395.900438] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 Jul 26 15:05:02 rx [11061395.906435] CR2: 0000000000000020 CR3: 0000003e450ba003 CR4: 0000000000760ef0 Jul 26 15:05:02 rx [11061395.913822] PKRU: 55555554 Jul 26 15:05:02 rx [11061395.916786] Call Trace: Jul 26 15:05:02 rx [11061395.919488] Jul 26 15:05:02 rx [11061395.921765] ? show_regs.cold+0x1a/0x1f Jul 26 15:05:02 rx [11061395.925859] ? __die+0x90/0xd9 Jul 26 15:05:02 rx [11061395.929169] ? no_context+0x196/0x380 Jul 26 15:05:02 rx [11061395.933088] ? ip6_protocol_deliver_rcu+0x4e0/0x4e0 Jul 26 15:05:02 rx [11061395.938216] ? ip6_sublist_rcv_finish+0x3d/0x50 Jul 26 15:05:02 rx [11061395.943000] ? __bad_area_nosemaphore+0x50/0x1a0 Jul 26 15:05:02 rx [11061395.947873] ? bad_area_nosemaphore+0x16/0x20 Jul 26 15:05:02 rx [11061395.952486] ? do_user_addr_fault+0x267/0x450 Jul 26 15:05:02 rx [11061395.957104] ? ipv6_list_rcv+0x112/0x140 Jul 26 15:05:02 rx [11061395.961279] ? __do_page_fault+0x58/0x90 Jul 26 15:05:02 rx [11061395.965458] ? do_page_fault+0x2c/0xe0 Jul 26 15:05:02 rx [11061395.969465] ? page_fault+0x34/0x40 Jul 26 15:05:02 rx [11061395.973217] ? tcp_rearm_rto+0xe4/0x160 Jul 26 15:05:02 rx [11061395.977313] ? tcp_rearm_rto+0xe4/0x160 Jul 26 15:05:02 rx [11061395.981408] tcp_send_loss_probe+0x10b/0x220 Jul 26 15:05:02 rx [11061395.985937] tcp_write_timer_handler+0x1b4/0x240 Jul 26 15:05:02 rx [11061395.990809] tcp_write_timer+0x9e/0xe0 Jul 26 15:05:02 rx [11061395.994814] ? tcp_write_timer_handler+0x240/0x240 Jul 26 15:05:02 rx [11061395.999866] call_timer_fn+0x32/0x130 Jul 26 15:05:02 rx [11061396.003782] __run_timers.part.0+0x180/0x280 Jul 26 15:05:02 rx [11061396.008309] ? recalibrate_cpu_khz+0x10/0x10 Jul 26 15:05:02 rx [11061396.012841] ? native_x2apic_icr_write+0x30/0x30 Jul 26 15:05:02 rx [11061396.017718] ? lapic_next_even ---truncated---(CVE-2024-47684)
In the Linux kernel, the following vulnerability has been resolved: xfrm: validate new SA's prefixlen using SA family when sel.family is unset This expands the validation introduced in commit 07bf7908950a ("xfrm: Validate address prefix lengths in the xfrm selector.") syzbot created an SA with usersa.sel.family = AF_UNSPEC usersa.sel.prefixlen_s = 128 usersa.family = AF_INET Because of the AF_UNSPEC selector, verify_newsa_info doesn't put limits on prefixlen_{s,d}. But then copy_from_user_state sets x->sel.family to usersa.family (AF_INET). Do the same conversion in verify_newsa_info before validating prefixlen_{s,d}, since that's how prefixlen is going to be used later on.(CVE-2024-50142)
In the Linux kernel, the following vulnerability has been resolved: vsock/virtio: Initialization of the dangling pointer occurring in vsk->trans During loopback communication, a dangling pointer can be created in vsk->trans, potentially leading to a Use-After-Free condition. This issue is resolved by initializing vsk->trans to NULL.(CVE-2024-50264)
In the Linux kernel, the following vulnerability has been resolved: hv_sock: Initializing vsk->trans to NULL to prevent a dangling pointer When hvs is released, there is a possibility that vsk->trans may not be initialized to NULL, which could lead to a dangling pointer. This issue is resolved by initializing vsk->trans to NULL.(CVE-2024-53103)
In the Linux kernel, the following vulnerability has been resolved: net: fix data-races around sk->sk_forward_alloc Syzkaller reported this warning: ------------[ cut here ]------------ WARNING: CPU: 0 PID: 16 at net/ipv4/af_inet.c:156 inet_sock_destruct+0x1c5/0x1e0 Modules linked in: CPU: 0 UID: 0 PID: 16 Comm: ksoftirqd/0 Not tainted 6.12.0-rc5 #26 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014 RIP: 0010:inet_sock_destruct+0x1c5/0x1e0 Code: 24 12 4c 89 e2 5b 48 c7 c7 98 ec bb 82 41 5c e9 d1 18 17 ff 4c 89 e6 5b 48 c7 c7 d0 ec bb 82 41 5c e9 bf 18 17 ff 0f 0b eb 83 <0f> 0b eb 97 0f 0b eb 87 0f 0b e9 68 ff ff ff 66 66 2e 0f 1f 84 00 RSP: 0018:ffffc9000008bd90 EFLAGS: 00010206 RAX: 0000000000000300 RBX: ffff88810b172a90 RCX: 0000000000000007 RDX: 0000000000000002 RSI: 0000000000000300 RDI: ffff88810b172a00 RBP: ffff88810b172a00 R08: ffff888104273c00 R09: 0000000000100007 R10: 0000000000020000 R11: 0000000000000006 R12: ffff88810b172a00 R13: 0000000000000004 R14: 0000000000000000 R15: ffff888237c31f78 FS: 0000000000000000(0000) GS:ffff888237c00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007ffc63fecac8 CR3: 000000000342e000 CR4: 00000000000006f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> ? __warn+0x88/0x130 ? inet_sock_destruct+0x1c5/0x1e0 ? report_bug+0x18e/0x1a0 ? handle_bug+0x53/0x90 ? exc_invalid_op+0x18/0x70 ? asm_exc_invalid_op+0x1a/0x20 ? inet_sock_destruct+0x1c5/0x1e0 __sk_destruct+0x2a/0x200 rcu_do_batch+0x1aa/0x530 ? rcu_do_batch+0x13b/0x530 rcu_core+0x159/0x2f0 handle_softirqs+0xd3/0x2b0 ? __pfx_smpboot_thread_fn+0x10/0x10 run_ksoftirqd+0x25/0x30 smpboot_thread_fn+0xdd/0x1d0 kthread+0xd3/0x100 ? __pfx_kthread+0x10/0x10 ret_from_fork+0x34/0x50 ? __pfx_kthread+0x10/0x10 ret_from_fork_asm+0x1a/0x30 </TASK> ---[ end trace 0000000000000000 ]--- Its possible that two threads call tcp_v6_do_rcv()/sk_forward_alloc_add() concurrently when sk->sk_state == TCP_LISTEN with sk->sk_lock unlocked, which triggers a data-race around sk->sk_forward_alloc: tcp_v6_rcv tcp_v6_do_rcv skb_clone_and_charge_r sk_rmem_schedule __sk_mem_schedule sk_forward_alloc_add() skb_set_owner_r sk_mem_charge sk_forward_alloc_add() __kfree_skb skb_release_all skb_release_head_state sock_rfree sk_mem_uncharge sk_forward_alloc_add() sk_mem_reclaim // set local var reclaimable __sk_mem_reclaim sk_forward_alloc_add() In this syzkaller testcase, two threads call tcp_v6_do_rcv() with skb->truesize=768, the sk_forward_alloc changes like this: (cpu 1) | (cpu 2) | sk_forward_alloc ... | ... | 0 __sk_mem_schedule() | | +4096 = 4096 | __sk_mem_schedule() | +4096 = 8192 sk_mem_charge() | | -768 = 7424 | sk_mem_charge() | -768 = 6656 ... | ... | sk_mem_uncharge() | | +768 = 7424 reclaimable=7424 | | | sk_mem_uncharge() | +768 = 8192 | reclaimable=8192 | __sk_mem_reclaim() | | -4096 = 4096 | __sk_mem_reclaim() | -8192 = -4096 != 0 The skb_clone_and_charge_r() should not be called in tcp_v6_do_rcv() when sk->sk_state is TCP_LISTEN, it happens later in tcp_v6_syn_recv_sock(). Fix the same issue in dccp_v6_do_rcv().(CVE-2024-53124)
In the Linux kernel, the following vulnerability has been resolved: netlink: terminate outstanding dump on socket close Netlink supports iterative dumping of data. It provides the families the following ops: - start - (optional) kicks off the dumping process - dump - actual dump helper, keeps getting called until it returns 0 - done - (optional) pairs with .start, can be used for cleanup The whole process is asynchronous and the repeated calls to .dump don't actually happen in a tight loop, but rather are triggered in response to recvmsg() on the socket. This gives the user full control over the dump, but also means that the user can close the socket without getting to the end of the dump. To make sure .start is always paired with .done we check if there is an ongoing dump before freeing the socket, and if so call .done. The complication is that sockets can get freed from BH and .done is allowed to sleep. So we use a workqueue to defer the call, when needed. Unfortunately this does not work correctly. What we defer is not the cleanup but rather releasing a reference on the socket. We have no guarantee that we own the last reference, if someone else holds the socket they may release it in BH and we're back to square one. The whole dance, however, appears to be unnecessary. Only the user can interact with dumps, so we can clean up when socket is closed. And close always happens in process context. Some async code may still access the socket after close, queue notification skbs to it etc. but no dumps can start, end or otherwise make progress. Delete the workqueue and flush the dump state directly from the release handler. Note that further cleanup is possible in -next, for instance we now always call .done before releasing the main module reference, so dump doesn't have to take a reference of its own.(CVE-2024-53140)
In the Linux kernel, the following vulnerability has been resolved: netfilter: ipset: add missing range check in bitmap_ip_uadt When tb[IPSET_ATTR_IP_TO] is not present but tb[IPSET_ATTR_CIDR] exists, the values of ip and ip_to are slightly swapped. Therefore, the range check for ip should be done later, but this part is missing and it seems that the vulnerability occurs. So we should add missing range checks and remove unnecessary range checks.(CVE-2024-53141)
In the Linux kernel, the following vulnerability has been resolved: NFSD: Prevent a potential integer overflow If the tag length is >= U32_MAX - 3 then the "length + 4" addition can result in an integer overflow. Address this by splitting the decoding into several steps so that decode_cb_compound4res() does not have to perform arithmetic on the unsafe length value.(CVE-2024-53146)
In the Linux kernel, the following vulnerability has been resolved: soc: qcom: geni-se: fix array underflow in geni_se_clk_tbl_get() This loop is supposed to break if the frequency returned from clk_round_rate() is the same as on the previous iteration. However, that check doesn't make sense on the first iteration through the loop. It leads to reading before the start of these->clk_perf_tbl[] array.(CVE-2024-53158)
In the Linux kernel, the following vulnerability has been resolved: sh: intc: Fix use-after-free bug in register_intc_controller() In the error handling for this function, d is freed without ever removing it from intc_list which would lead to a use after free. To fix this, let's only add it to the list after everything has succeeded.(CVE-2024-53165)
In the Linux kernel, the following vulnerability has been resolved: NFSv4.0: Fix a use-after-free problem in the asynchronous open() Yang Erkun reports that when two threads are opening files at the same time, and are forced to abort before a reply is seen, then the call to nfs_release_seqid() in nfs4_opendata_free() can result in a use-after-free of the pointer to the defunct rpc task of the other thread. The fix is to ensure that if the RPC call is aborted before the call to nfs_wait_on_sequence() is complete, then we must call nfs_release_seqid() in nfs4_open_release() before the rpc_task is freed.(CVE-2024-53173)
In the Linux kernel, the following vulnerability has been resolved: um: net: Do not use drvdata in release The drvdata is not available in release. Let's just use container_of() to get the uml_net instance. Otherwise, removing a network device will result in a crash: RIP: 0033:net_device_release+0x10/0x6f RSP: 00000000e20c7c40 EFLAGS: 00010206 RAX: 000000006002e4e7 RBX: 00000000600f1baf RCX: 00000000624074e0 RDX: 0000000062778000 RSI: 0000000060551c80 RDI: 00000000627af028 RBP: 00000000e20c7c50 R08: 00000000603ad594 R09: 00000000e20c7b70 R10: 000000000000135a R11: 00000000603ad422 R12: 0000000000000000 R13: 0000000062c7af00 R14: 0000000062406d60 R15: 00000000627700b6 Kernel panic - not syncing: Segfault with no mm CPU: 0 UID: 0 PID: 29 Comm: kworker/0:2 Not tainted 6.12.0-rc6-g59b723cd2adb #1 Workqueue: events mc_work_proc Stack: 627af028 62c7af00 e20c7c80 60276fcd 62778000 603f5820 627af028 00000000 e20c7cb0 603a2bcd 627af000 62770010 Call Trace: [<60276fcd>] device_release+0x70/0xba [<603a2bcd>] kobject_put+0xba/0xe7 [<60277265>] put_device+0x19/0x1c [<60281266>] platform_device_put+0x26/0x29 [<60281e5f>] platform_device_unregister+0x2c/0x2e [<6002ec9c>] net_remove+0x63/0x69 [<60031316>] ? mconsole_reply+0x0/0x50 [<600310c8>] mconsole_remove+0x160/0x1cc [<60087d40>] ? __remove_hrtimer+0x38/0x74 [<60087ff8>] ? hrtimer_try_to_cancel+0x8c/0x98 [<6006b3cf>] ? dl_server_stop+0x3f/0x48 [<6006b390>] ? dl_server_stop+0x0/0x48 [<600672e8>] ? dequeue_entities+0x327/0x390 [<60038fa6>] ? um_set_signals+0x0/0x43 [<6003070c>] mc_work_proc+0x77/0x91 [<60057664>] process_scheduled_works+0x1b3/0x2dd [<60055f32>] ? assign_work+0x0/0x58 [<60057f0a>] worker_thread+0x1e9/0x293 [<6005406f>] ? set_pf_worker+0x0/0x64 [<6005d65d>] ? arch_local_irq_save+0x0/0x2d [<6005d748>] ? kthread_exit+0x0/0x3a [<60057d21>] ? worker_thread+0x0/0x293 [<6005dbf1>] kthread+0x126/0x12b [<600219c5>] new_thread_handler+0x85/0xb6(CVE-2024-53183)
In the Linux kernel, the following vulnerability has been resolved: um: ubd: Do not use drvdata in release The drvdata is not available in release. Let's just use container_of() to get the ubd instance. Otherwise, removing a ubd device will result in a crash: RIP: 0033:blk_mq_free_tag_set+0x1f/0xba RSP: 00000000e2083bf0 EFLAGS: 00010246 RAX: 000000006021463a RBX: 0000000000000348 RCX: 0000000062604d00 RDX: 0000000004208060 RSI: 00000000605241a0 RDI: 0000000000000348 RBP: 00000000e2083c10 R08: 0000000062414010 R09: 00000000601603f7 R10: 000000000000133a R11: 000000006038c4bd R12: 0000000000000000 R13: 0000000060213a5c R14: 0000000062405d20 R15: 00000000604f7aa0 Kernel panic - not syncing: Segfault with no mm CPU: 0 PID: 17 Comm: kworker/0:1 Not tainted 6.8.0-rc3-00107-gba3f67c11638 #1 Workqueue: events mc_work_proc Stack: 00000000 604f7ef0 62c5d000 62405d20 e2083c30 6002c776 6002c755 600e47ff e2083c60 6025ffe3 04208060 603d36e0 Call Trace: [<6002c776>] ubd_device_release+0x21/0x55 [<6002c755>] ? ubd_device_release+0x0/0x55 [<600e47ff>] ? kfree+0x0/0x100 [<6025ffe3>] device_release+0x70/0xba [<60381d6a>] kobject_put+0xb5/0xe2 [<6026027b>] put_device+0x19/0x1c [<6026a036>] platform_device_put+0x26/0x29 [<6026ac5a>] platform_device_unregister+0x2c/0x2e [<6002c52e>] ubd_remove+0xb8/0xd6 [<6002bb74>] ? mconsole_reply+0x0/0x50 [<6002b926>] mconsole_remove+0x160/0x1cc [<6002bbbc>] ? mconsole_reply+0x48/0x50 [<6003379c>] ? um_set_signals+0x3b/0x43 [<60061c55>] ? update_min_vruntime+0x14/0x70 [<6006251f>] ? dequeue_task_fair+0x164/0x235 [<600620aa>] ? update_cfs_group+0x0/0x40 [<603a0e77>] ? __schedule+0x0/0x3ed [<60033761>] ? um_set_signals+0x0/0x43 [<6002af6a>] mc_work_proc+0x77/0x91 [<600520b4>] process_scheduled_works+0x1af/0x2c3 [<6004ede3>] ? assign_work+0x0/0x58 [<600527a1>] worker_thread+0x2f7/0x37a [<6004ee3b>] ? set_pf_worker+0x0/0x64 [<6005765d>] ? arch_local_irq_save+0x0/0x2d [<60058e07>] ? kthread_exit+0x0/0x3a [<600524aa>] ? worker_thread+0x0/0x37a [<60058f9f>] kthread+0x130/0x135 [<6002068e>] new_thread_handler+0x85/0xb6(CVE-2024-53184)
In the Linux kernel, the following vulnerability has been resolved: PCI: Fix use-after-free of slot->bus on hot remove Dennis reports a boot crash on recent Lenovo laptops with a USB4 dock. Since commit 0fc70886569c ("thunderbolt: Reset USB4 v2 host router") and commit 59a54c5f3dbd ("thunderbolt: Reset topology created by the boot firmware"), USB4 v2 and v1 Host Routers are reset on probe of the thunderbolt driver. The reset clears the Presence Detect State and Data Link Layer Link Active bits at the USB4 Host Router's Root Port and thus causes hot removal of the dock. The crash occurs when pciehp is unbound from one of the dock's Downstream Ports: pciehp creates a pci_slot on bind and destroys it on unbind. The pci_slot contains a pointer to the pci_bus below the Downstream Port, but a reference on that pci_bus is never acquired. The pci_bus is destroyed before the pci_slot, so a use-after-free ensues when pci_slot_release() accesses slot->bus. In principle this should not happen because pci_stop_bus_device() unbinds pciehp (and therefore destroys the pci_slot) before the pci_bus is destroyed by pci_remove_bus_device(). However the stacktrace provided by Dennis shows that pciehp is unbound from pci_remove_bus_device() instead of pci_stop_bus_device(). To understand the significance of this, one needs to know that the PCI core uses a two step process to remove a portion of the hierarchy: It first unbinds all drivers in the sub-hierarchy in pci_stop_bus_device() and then actually removes the devices in pci_remove_bus_device(). There is no precaution to prevent driver binding in-between pci_stop_bus_device() and pci_remove_bus_device(). In Dennis' case, it seems removal of the hierarchy by pciehp races with driver binding by pci_bus_add_devices(). pciehp is bound to the Downstream Port after pci_stop_bus_device() has run, so it is unbound by pci_remove_bus_device() instead of pci_stop_bus_device(). Because the pci_bus has already been destroyed at that point, accesses to it result in a use-after-free. One might conclude that driver binding needs to be prevented after pci_stop_bus_device() has run. However it seems risky that pci_slot points to pci_bus without holding a reference. Solely relying on correct ordering of driver unbind versus pci_bus destruction is certainly not defensive programming. If pci_slot has a need to access data in pci_bus, it ought to acquire a reference. Amend pci_create_slot() accordingly. Dennis reports that the crash is not reproducible with this change. Abridged stacktrace: pcieport 0000:00:07.0: PME: Signaling with IRQ 156 pcieport 0000:00:07.0: pciehp: Slot #12 AttnBtn- PwrCtrl- MRL- AttnInd- PwrInd- HotPlug+ Surprise+ Interlock- NoCompl+ IbPresDis- LLActRep+ pci_bus 0000:20: dev 00, created physical slot 12 pcieport 0000:00:07.0: pciehp: Slot(12): Card not present ... pcieport 0000:21:02.0: pciehp: pcie_disable_notification: SLOTCTRL d8 write cmd 0 Oops: general protection fault, probably for non-canonical address 0x6b6b6b6b6b6b6b6b: 0000 [#1] PREEMPT SMP NOPTI CPU: 13 UID: 0 PID: 134 Comm: irq/156-pciehp Not tainted 6.11.0-devel+ #1 RIP: 0010:dev_driver_string+0x12/0x40 pci_destroy_slot pciehp_remove pcie_port_remove_service device_release_driver_internal bus_remove_device device_del device_unregister remove_iter device_for_each_child pcie_portdrv_remove pci_device_remove device_release_driver_internal bus_remove_device device_del pci_remove_bus_device (recursive invocation) pci_remove_bus_device pciehp_unconfigure_device pciehp_disable_slot pciehp_handle_presence_or_link_change pciehp_ist(CVE-2024-53194)
In the Linux kernel, the following vulnerability has been resolved: ALSA: usb-audio: Fix potential out-of-bound accesses for Extigy and Mbox devices A bogus device can provide a bNumConfigurations value that exceeds the initial value used in usb_get_configuration for allocating dev->config. This can lead to out-of-bounds accesses later, e.g. in usb_destroy_configuration.(CVE-2024-53197)
In the Linux kernel, the following vulnerability has been resolved: vfio/pci: Properly hide first-in-list PCIe extended capability There are cases where a PCIe extended capability should be hidden from the user. For example, an unknown capability (i.e., capability with ID greater than PCI_EXT_CAP_ID_MAX) or a capability that is intentionally chosen to be hidden from the user. Hiding a capability is done by virtualizing and modifying the 'Next Capability Offset' field of the previous capability so it points to the capability after the one that should be hidden. The special case where the first capability in the list should be hidden is handled differently because there is no previous capability that can be modified. In this case, the capability ID and version are zeroed while leaving the next pointer intact. This hides the capability and leaves an anchor for the rest of the capability list. However, today, hiding the first capability in the list is not done properly if the capability is unknown, as struct vfio_pci_core_device->pci_config_map is set to the capability ID during initialization but the capability ID is not properly checked later when used in vfio_config_do_rw(). This leads to the following warning [1] and to an out-of-bounds access to ecap_perms array. Fix it by checking cap_id in vfio_config_do_rw(), and if it is greater than PCI_EXT_CAP_ID_MAX, use an alternative struct perm_bits for direct read only access instead of the ecap_perms array. Note that this is safe since the above is the only case where cap_id can exceed PCI_EXT_CAP_ID_MAX (except for the special capabilities, which are already checked before). [1] WARNING: CPU: 118 PID: 5329 at drivers/vfio/pci/vfio_pci_config.c:1900 vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] CPU: 118 UID: 0 PID: 5329 Comm: simx-qemu-syste Not tainted 6.12.0+ #1 (snip) Call Trace: <TASK> ? show_regs+0x69/0x80 ? __warn+0x8d/0x140 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? report_bug+0x18f/0x1a0 ? handle_bug+0x63/0xa0 ? exc_invalid_op+0x19/0x70 ? asm_exc_invalid_op+0x1b/0x20 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? vfio_pci_config_rw+0x244/0x430 [vfio_pci_core] vfio_pci_rw+0x101/0x1b0 [vfio_pci_core] vfio_pci_core_read+0x1d/0x30 [vfio_pci_core] vfio_device_fops_read+0x27/0x40 [vfio] vfs_read+0xbd/0x340 ? vfio_device_fops_unl_ioctl+0xbb/0x740 [vfio] ? __rseq_handle_notify_resume+0xa4/0x4b0 __x64_sys_pread64+0x96/0xc0 x64_sys_call+0x1c3d/0x20d0 do_syscall_64+0x4d/0x120 entry_SYSCALL_64_after_hwframe+0x76/0x7e(CVE-2024-53214)
In the Linux kernel, the following vulnerability has been resolved: NFSD: Prevent NULL dereference in nfsd4_process_cb_update() @ses is initialized to NULL. If __nfsd4_find_backchannel() finds no available backchannel session, setup_callback_client() will try to dereference @ses and segfault.(CVE-2024-53217)
In the Linux kernel, the following vulnerability has been resolved: ALSA: 6fire: Release resources at card release The current 6fire code tries to release the resources right after the call of usb6fire_chip_abort(). But at this moment, the card object might be still in use (as we're calling snd_card_free_when_closed()). For avoid potential UAFs, move the release of resources to the card's private_free instead of the manual call of usb6fire_chip_destroy() at the USB disconnect callback.(CVE-2024-53239)
In the Linux kernel, the following vulnerability has been resolved: ALSA: caiaq: Use snd_card_free_when_closed() at disconnection The USB disconnect callback is supposed to be short and not too-long waiting. OTOH, the current code uses snd_card_free() at disconnection, but this waits for the close of all used fds, hence it can take long. It eventually blocks the upper layer USB ioctls, which may trigger a soft lockup. An easy workaround is to replace snd_card_free() with snd_card_free_when_closed(). This variant returns immediately while the release of resources is done asynchronously by the card device release at the last close. This patch also splits the code to the disconnect and the free phases; the former is called immediately at the USB disconnect callback while the latter is called from the card destructor.(CVE-2024-56531)
In the Linux kernel, the following vulnerability has been resolved: ALSA: us122l: Use snd_card_free_when_closed() at disconnection The USB disconnect callback is supposed to be short and not too-long waiting. OTOH, the current code uses snd_card_free() at disconnection, but this waits for the close of all used fds, hence it can take long. It eventually blocks the upper layer USB ioctls, which may trigger a soft lockup. An easy workaround is to replace snd_card_free() with snd_card_free_when_closed(). This variant returns immediately while the release of resources is done asynchronously by the card device release at the last close. The loop of us122l->mmap_count check is dropped as well. The check is useless for the asynchronous operation with *_when_closed().(CVE-2024-56532)
In the Linux kernel, the following vulnerability has been resolved: wifi: mwifiex: Fix memcpy() field-spanning write warning in mwifiex_config_scan() Replace one-element array with a flexible-array member in struct mwifiex_ie_types_wildcard_ssid_params to fix the following warning on a MT8173 Chromebook (mt8173-elm-hana): [ 356.775250] ------------[ cut here ]------------ [ 356.784543] memcpy: detected field-spanning write (size 6) of single field "wildcard_ssid_tlv->ssid" at drivers/net/wireless/marvell/mwifiex/scan.c:904 (size 1) [ 356.813403] WARNING: CPU: 3 PID: 742 at drivers/net/wireless/marvell/mwifiex/scan.c:904 mwifiex_scan_networks+0x4fc/0xf28 [mwifiex] The "(size 6)" above is exactly the length of the SSID of the network this device was connected to. The source of the warning looks like: ssid_len = user_scan_in->ssid_list[i].ssid_len; [...] memcpy(wildcard_ssid_tlv->ssid, user_scan_in->ssid_list[i].ssid, ssid_len); There is a #define WILDCARD_SSID_TLV_MAX_SIZE that uses sizeof() on this struct, but it already didn't account for the size of the one-element array, so it doesn't need to be changed.(CVE-2024-56539)
In the Linux kernel, the following vulnerability has been resolved: crypto: bcm - add error check in the ahash_hmac_init function The ahash_init functions may return fails. The ahash_hmac_init should not return ok when ahash_init returns error. For an example, ahash_init will return -ENOMEM when allocation memory is error.(CVE-2024-56681)
In the Linux kernel, the following vulnerability has been resolved: media: wl128x: Fix atomicity violation in fmc_send_cmd() Atomicity violation occurs when the fmc_send_cmd() function is executed simultaneously with the modification of the fmdev->resp_skb value. Consider a scenario where, after passing the validity check within the function, a non-null fmdev->resp_skb variable is assigned a null value. This results in an invalid fmdev->resp_skb variable passing the validity check. As seen in the later part of the function, skb = fmdev->resp_skb; when the invalid fmdev->resp_skb passes the check, a null pointer dereference error may occur at line 478, evt_hdr = (void *)skb->data; To address this issue, it is recommended to include the validity check of fmdev->resp_skb within the locked section of the function. This modification ensures that the value of fmdev->resp_skb does not change during the validation process, thereby maintaining its validity. This possible bug is found by an experimental static analysis tool developed by our team. This tool analyzes the locking APIs to extract function pairs that can be concurrently executed, and then analyzes the instructions in the paired functions to identify possible concurrency bugs including data races and atomicity violations.(CVE-2024-56700)
In the Linux kernel, the following vulnerability has been resolved: 9p/xen: fix release of IRQ Kernel logs indicate an IRQ was double-freed. Pass correct device ID during IRQ release. Dominique: remove confusing variable reset to 0
In the Linux kernel, the following vulnerability has been resolved: fbdev: sh7760fb: Fix a possible memory leak in sh7760fb_alloc_mem() When information such as info->screen_base is not ready, calling sh7760fb_free_mem() does not release memory correctly. Call dma_free_coherent() instead.(CVE-2024-56746)
In the Linux kernel, the following vulnerability has been resolved: scsi: qedi: Fix a possible memory leak in qedi_alloc_and_init_sb() Hook "qedi_ops->common->sb_init = qed_sb_init" does not release the DMA memory sb_virt when it fails. Add dma_free_coherent() to free it. This is the same way as qedr_alloc_mem_sb() and qede_alloc_mem_sb().(CVE-2024-56747)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2501.1.0.0311.oe2003sp4.src.rpm"
],
"x86_64": [
"bpftool-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2501.1.0.0311.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2501.1.0.0311.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: sh: cpuinfo: Fix a warning for CONFIG_CPUMASK_OFFSTACK When CONFIG_CPUMASK_OFFSTACK and CONFIG_DEBUG_PER_CPU_MAPS are selected, cpu_max_bits_warn() generates a runtime warning similar as below when showing /proc/cpuinfo. Fix this by using nr_cpu_ids (the runtime limit) instead of NR_CPUS to iterate CPUs. [ 3.052463] ------------[ cut here ]------------ [ 3.059679] WARNING: CPU: 3 PID: 1 at include/linux/cpumask.h:108 show_cpuinfo+0x5e8/0x5f0 [ 3.070072] Modules linked in: efivarfs autofs4 [ 3.076257] CPU: 0 PID: 1 Comm: systemd Not tainted 5.19-rc5+ #1052 [ 3.099465] Stack : 9000000100157b08 9000000000f18530 9000000000cf846c 9000000100154000 [ 3.109127] 9000000100157a50 0000000000000000 9000000100157a58 9000000000ef7430 [ 3.118774] 90000001001578e8 0000000000000040 0000000000000020 ffffffffffffffff [ 3.128412] 0000000000aaaaaa 1ab25f00eec96a37 900000010021de80 900000000101c890 [ 3.138056] 0000000000000000 0000000000000000 0000000000000000 0000000000aaaaaa [ 3.147711] ffff8000339dc220 0000000000000001 0000000006ab4000 0000000000000000 [ 3.157364] 900000000101c998 0000000000000004 9000000000ef7430 0000000000000000 [ 3.167012] 0000000000000009 000000000000006c 0000000000000000 0000000000000000 [ 3.176641] 9000000000d3de08 9000000001639390 90000000002086d8 00007ffff0080286 [ 3.186260] 00000000000000b0 0000000000000004 0000000000000000 0000000000071c1c [ 3.195868] ... [ 3.199917] Call Trace: [ 3.203941] [\u0026lt;90000000002086d8\u0026gt;] show_stack+0x38/0x14c [ 3.210666] [\u0026lt;9000000000cf846c\u0026gt;] dump_stack_lvl+0x60/0x88 [ 3.217625] [\u0026lt;900000000023d268\u0026gt;] __warn+0xd0/0x100 [ 3.223958] [\u0026lt;9000000000cf3c90\u0026gt;] warn_slowpath_fmt+0x7c/0xcc [ 3.231150] [\u0026lt;9000000000210220\u0026gt;] show_cpuinfo+0x5e8/0x5f0 [ 3.238080] [\u0026lt;90000000004f578c\u0026gt;] seq_read_iter+0x354/0x4b4 [ 3.245098] [\u0026lt;90000000004c2e90\u0026gt;] new_sync_read+0x17c/0x1c4 [ 3.252114] [\u0026lt;90000000004c5174\u0026gt;] vfs_read+0x138/0x1d0 [ 3.258694] [\u0026lt;90000000004c55f8\u0026gt;] ksys_read+0x70/0x100 [ 3.265265] [\u0026lt;9000000000cfde9c\u0026gt;] do_syscall+0x7c/0x94 [ 3.271820] [\u0026lt;9000000000202fe4\u0026gt;] handle_syscall+0xc4/0x160 [ 3.281824] ---[ end trace 8b484262b4b8c24c ]---(CVE-2022-49034)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: media: s5p_cec: limit msg.len to CEC_MAX_MSG_SIZE I expect that the hardware will have limited this to 16, but just in case it hasn\u0026apos;t, check for this corner case.(CVE-2022-49035)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: tcp: check skb is non-NULL in tcp_rto_delta_us() We have some machines running stock Ubuntu 20.04.6 which is their 5.4.0-174-generic kernel that are running ceph and recently hit a null ptr dereference in tcp_rearm_rto(). Initially hitting it from the TLP path, but then later we also saw it getting hit from the RACK case as well. Here are examples of the oops messages we saw in each of those cases: Jul 26 15:05:02 rx [11061395.780353] BUG: kernel NULL pointer dereference, address: 0000000000000020 Jul 26 15:05:02 rx [11061395.787572] #PF: supervisor read access in kernel mode Jul 26 15:05:02 rx [11061395.792971] #PF: error_code(0x0000) - not-present page Jul 26 15:05:02 rx [11061395.798362] PGD 0 P4D 0 Jul 26 15:05:02 rx [11061395.801164] Oops: 0000 [#1] SMP NOPTI Jul 26 15:05:02 rx [11061395.805091] CPU: 0 PID: 9180 Comm: msgr-worker-1 Tainted: G W 5.4.0-174-generic #193-Ubuntu Jul 26 15:05:02 rx [11061395.814996] Hardware name: Supermicro SMC 2x26 os-gen8 64C NVME-Y 256G/H12SSW-NTR, BIOS 2.5.V1.2U.NVMe.UEFI 05/09/2023 Jul 26 15:05:02 rx [11061395.825952] RIP: 0010:tcp_rearm_rto+0xe4/0x160 Jul 26 15:05:02 rx [11061395.830656] Code: 87 ca 04 00 00 00 5b 41 5c 41 5d 5d c3 c3 49 8b bc 24 40 06 00 00 eb 8d 48 bb cf f7 53 e3 a5 9b c4 20 4c 89 ef e8 0c fe 0e 00 \u0026lt;48\u0026gt; 8b 78 20 48 c1 ef 03 48 89 f8 41 8b bc 24 80 04 00 00 48 f7 e3 Jul 26 15:05:02 rx [11061395.849665] RSP: 0018:ffffb75d40003e08 EFLAGS: 00010246 Jul 26 15:05:02 rx [11061395.855149] RAX: 0000000000000000 RBX: 20c49ba5e353f7cf RCX: 0000000000000000 Jul 26 15:05:02 rx [11061395.862542] RDX: 0000000062177c30 RSI: 000000000000231c RDI: ffff9874ad283a60 Jul 26 15:05:02 rx [11061395.869933] RBP: ffffb75d40003e20 R08: 0000000000000000 R09: ffff987605e20aa8 Jul 26 15:05:02 rx [11061395.877318] R10: ffffb75d40003f00 R11: ffffb75d4460f740 R12: ffff9874ad283900 Jul 26 15:05:02 rx [11061395.884710] R13: ffff9874ad283a60 R14: ffff9874ad283980 R15: ffff9874ad283d30 Jul 26 15:05:02 rx [11061395.892095] FS: 00007f1ef4a2e700(0000) GS:ffff987605e00000(0000) knlGS:0000000000000000 Jul 26 15:05:02 rx [11061395.900438] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 Jul 26 15:05:02 rx [11061395.906435] CR2: 0000000000000020 CR3: 0000003e450ba003 CR4: 0000000000760ef0 Jul 26 15:05:02 rx [11061395.913822] PKRU: 55555554 Jul 26 15:05:02 rx [11061395.916786] Call Trace: Jul 26 15:05:02 rx [11061395.919488] Jul 26 15:05:02 rx [11061395.921765] ? show_regs.cold+0x1a/0x1f Jul 26 15:05:02 rx [11061395.925859] ? __die+0x90/0xd9 Jul 26 15:05:02 rx [11061395.929169] ? no_context+0x196/0x380 Jul 26 15:05:02 rx [11061395.933088] ? ip6_protocol_deliver_rcu+0x4e0/0x4e0 Jul 26 15:05:02 rx [11061395.938216] ? ip6_sublist_rcv_finish+0x3d/0x50 Jul 26 15:05:02 rx [11061395.943000] ? __bad_area_nosemaphore+0x50/0x1a0 Jul 26 15:05:02 rx [11061395.947873] ? bad_area_nosemaphore+0x16/0x20 Jul 26 15:05:02 rx [11061395.952486] ? do_user_addr_fault+0x267/0x450 Jul 26 15:05:02 rx [11061395.957104] ? ipv6_list_rcv+0x112/0x140 Jul 26 15:05:02 rx [11061395.961279] ? __do_page_fault+0x58/0x90 Jul 26 15:05:02 rx [11061395.965458] ? do_page_fault+0x2c/0xe0 Jul 26 15:05:02 rx [11061395.969465] ? page_fault+0x34/0x40 Jul 26 15:05:02 rx [11061395.973217] ? tcp_rearm_rto+0xe4/0x160 Jul 26 15:05:02 rx [11061395.977313] ? tcp_rearm_rto+0xe4/0x160 Jul 26 15:05:02 rx [11061395.981408] tcp_send_loss_probe+0x10b/0x220 Jul 26 15:05:02 rx [11061395.985937] tcp_write_timer_handler+0x1b4/0x240 Jul 26 15:05:02 rx [11061395.990809] tcp_write_timer+0x9e/0xe0 Jul 26 15:05:02 rx [11061395.994814] ? tcp_write_timer_handler+0x240/0x240 Jul 26 15:05:02 rx [11061395.999866] call_timer_fn+0x32/0x130 Jul 26 15:05:02 rx [11061396.003782] __run_timers.part.0+0x180/0x280 Jul 26 15:05:02 rx [11061396.008309] ? recalibrate_cpu_khz+0x10/0x10 Jul 26 15:05:02 rx [11061396.012841] ? native_x2apic_icr_write+0x30/0x30 Jul 26 15:05:02 rx [11061396.017718] ? lapic_next_even ---truncated---(CVE-2024-47684)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: xfrm: validate new SA\u0026apos;s prefixlen using SA family when sel.family is unset This expands the validation introduced in commit 07bf7908950a (\u0026quot;xfrm: Validate address prefix lengths in the xfrm selector.\u0026quot;) syzbot created an SA with usersa.sel.family = AF_UNSPEC usersa.sel.prefixlen_s = 128 usersa.family = AF_INET Because of the AF_UNSPEC selector, verify_newsa_info doesn\u0026apos;t put limits on prefixlen_{s,d}. But then copy_from_user_state sets x-\u0026gt;sel.family to usersa.family (AF_INET). Do the same conversion in verify_newsa_info before validating prefixlen_{s,d}, since that\u0026apos;s how prefixlen is going to be used later on.(CVE-2024-50142)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: vsock/virtio: Initialization of the dangling pointer occurring in vsk-\u0026gt;trans During loopback communication, a dangling pointer can be created in vsk-\u0026gt;trans, potentially leading to a Use-After-Free condition. This issue is resolved by initializing vsk-\u0026gt;trans to NULL.(CVE-2024-50264)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: hv_sock: Initializing vsk-\u0026gt;trans to NULL to prevent a dangling pointer When hvs is released, there is a possibility that vsk-\u0026gt;trans may not be initialized to NULL, which could lead to a dangling pointer. This issue is resolved by initializing vsk-\u0026gt;trans to NULL.(CVE-2024-53103)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: net: fix data-races around sk-\u0026gt;sk_forward_alloc Syzkaller reported this warning: ------------[ cut here ]------------ WARNING: CPU: 0 PID: 16 at net/ipv4/af_inet.c:156 inet_sock_destruct+0x1c5/0x1e0 Modules linked in: CPU: 0 UID: 0 PID: 16 Comm: ksoftirqd/0 Not tainted 6.12.0-rc5 #26 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1 04/01/2014 RIP: 0010:inet_sock_destruct+0x1c5/0x1e0 Code: 24 12 4c 89 e2 5b 48 c7 c7 98 ec bb 82 41 5c e9 d1 18 17 ff 4c 89 e6 5b 48 c7 c7 d0 ec bb 82 41 5c e9 bf 18 17 ff 0f 0b eb 83 \u0026lt;0f\u0026gt; 0b eb 97 0f 0b eb 87 0f 0b e9 68 ff ff ff 66 66 2e 0f 1f 84 00 RSP: 0018:ffffc9000008bd90 EFLAGS: 00010206 RAX: 0000000000000300 RBX: ffff88810b172a90 RCX: 0000000000000007 RDX: 0000000000000002 RSI: 0000000000000300 RDI: ffff88810b172a00 RBP: ffff88810b172a00 R08: ffff888104273c00 R09: 0000000000100007 R10: 0000000000020000 R11: 0000000000000006 R12: ffff88810b172a00 R13: 0000000000000004 R14: 0000000000000000 R15: ffff888237c31f78 FS: 0000000000000000(0000) GS:ffff888237c00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007ffc63fecac8 CR3: 000000000342e000 CR4: 00000000000006f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: \u0026lt;TASK\u0026gt; ? __warn+0x88/0x130 ? inet_sock_destruct+0x1c5/0x1e0 ? report_bug+0x18e/0x1a0 ? handle_bug+0x53/0x90 ? exc_invalid_op+0x18/0x70 ? asm_exc_invalid_op+0x1a/0x20 ? inet_sock_destruct+0x1c5/0x1e0 __sk_destruct+0x2a/0x200 rcu_do_batch+0x1aa/0x530 ? rcu_do_batch+0x13b/0x530 rcu_core+0x159/0x2f0 handle_softirqs+0xd3/0x2b0 ? __pfx_smpboot_thread_fn+0x10/0x10 run_ksoftirqd+0x25/0x30 smpboot_thread_fn+0xdd/0x1d0 kthread+0xd3/0x100 ? __pfx_kthread+0x10/0x10 ret_from_fork+0x34/0x50 ? __pfx_kthread+0x10/0x10 ret_from_fork_asm+0x1a/0x30 \u0026lt;/TASK\u0026gt; ---[ end trace 0000000000000000 ]--- Its possible that two threads call tcp_v6_do_rcv()/sk_forward_alloc_add() concurrently when sk-\u0026gt;sk_state == TCP_LISTEN with sk-\u0026gt;sk_lock unlocked, which triggers a data-race around sk-\u0026gt;sk_forward_alloc: tcp_v6_rcv tcp_v6_do_rcv skb_clone_and_charge_r sk_rmem_schedule __sk_mem_schedule sk_forward_alloc_add() skb_set_owner_r sk_mem_charge sk_forward_alloc_add() __kfree_skb skb_release_all skb_release_head_state sock_rfree sk_mem_uncharge sk_forward_alloc_add() sk_mem_reclaim // set local var reclaimable __sk_mem_reclaim sk_forward_alloc_add() In this syzkaller testcase, two threads call tcp_v6_do_rcv() with skb-\u0026gt;truesize=768, the sk_forward_alloc changes like this: (cpu 1) | (cpu 2) | sk_forward_alloc ... | ... | 0 __sk_mem_schedule() | | +4096 = 4096 | __sk_mem_schedule() | +4096 = 8192 sk_mem_charge() | | -768 = 7424 | sk_mem_charge() | -768 = 6656 ... | ... | sk_mem_uncharge() | | +768 = 7424 reclaimable=7424 | | | sk_mem_uncharge() | +768 = 8192 | reclaimable=8192 | __sk_mem_reclaim() | | -4096 = 4096 | __sk_mem_reclaim() | -8192 = -4096 != 0 The skb_clone_and_charge_r() should not be called in tcp_v6_do_rcv() when sk-\u0026gt;sk_state is TCP_LISTEN, it happens later in tcp_v6_syn_recv_sock(). Fix the same issue in dccp_v6_do_rcv().(CVE-2024-53124)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: netlink: terminate outstanding dump on socket close Netlink supports iterative dumping of data. It provides the families the following ops: - start - (optional) kicks off the dumping process - dump - actual dump helper, keeps getting called until it returns 0 - done - (optional) pairs with .start, can be used for cleanup The whole process is asynchronous and the repeated calls to .dump don\u0026apos;t actually happen in a tight loop, but rather are triggered in response to recvmsg() on the socket. This gives the user full control over the dump, but also means that the user can close the socket without getting to the end of the dump. To make sure .start is always paired with .done we check if there is an ongoing dump before freeing the socket, and if so call .done. The complication is that sockets can get freed from BH and .done is allowed to sleep. So we use a workqueue to defer the call, when needed. Unfortunately this does not work correctly. What we defer is not the cleanup but rather releasing a reference on the socket. We have no guarantee that we own the last reference, if someone else holds the socket they may release it in BH and we\u0026apos;re back to square one. The whole dance, however, appears to be unnecessary. Only the user can interact with dumps, so we can clean up when socket is closed. And close always happens in process context. Some async code may still access the socket after close, queue notification skbs to it etc. but no dumps can start, end or otherwise make progress. Delete the workqueue and flush the dump state directly from the release handler. Note that further cleanup is possible in -next, for instance we now always call .done before releasing the main module reference, so dump doesn\u0026apos;t have to take a reference of its own.(CVE-2024-53140)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: netfilter: ipset: add missing range check in bitmap_ip_uadt When tb[IPSET_ATTR_IP_TO] is not present but tb[IPSET_ATTR_CIDR] exists, the values of ip and ip_to are slightly swapped. Therefore, the range check for ip should be done later, but this part is missing and it seems that the vulnerability occurs. So we should add missing range checks and remove unnecessary range checks.(CVE-2024-53141)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: NFSD: Prevent a potential integer overflow If the tag length is \u0026gt;= U32_MAX - 3 then the \u0026quot;length + 4\u0026quot; addition can result in an integer overflow. Address this by splitting the decoding into several steps so that decode_cb_compound4res() does not have to perform arithmetic on the unsafe length value.(CVE-2024-53146)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: soc: qcom: geni-se: fix array underflow in geni_se_clk_tbl_get() This loop is supposed to break if the frequency returned from clk_round_rate() is the same as on the previous iteration. However, that check doesn\u0026apos;t make sense on the first iteration through the loop. It leads to reading before the start of these-\u0026gt;clk_perf_tbl[] array.(CVE-2024-53158)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: sh: intc: Fix use-after-free bug in register_intc_controller() In the error handling for this function, d is freed without ever removing it from intc_list which would lead to a use after free. To fix this, let\u0026apos;s only add it to the list after everything has succeeded.(CVE-2024-53165)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: NFSv4.0: Fix a use-after-free problem in the asynchronous open() Yang Erkun reports that when two threads are opening files at the same time, and are forced to abort before a reply is seen, then the call to nfs_release_seqid() in nfs4_opendata_free() can result in a use-after-free of the pointer to the defunct rpc task of the other thread. The fix is to ensure that if the RPC call is aborted before the call to nfs_wait_on_sequence() is complete, then we must call nfs_release_seqid() in nfs4_open_release() before the rpc_task is freed.(CVE-2024-53173)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: um: net: Do not use drvdata in release The drvdata is not available in release. Let\u0026apos;s just use container_of() to get the uml_net instance. Otherwise, removing a network device will result in a crash: RIP: 0033:net_device_release+0x10/0x6f RSP: 00000000e20c7c40 EFLAGS: 00010206 RAX: 000000006002e4e7 RBX: 00000000600f1baf RCX: 00000000624074e0 RDX: 0000000062778000 RSI: 0000000060551c80 RDI: 00000000627af028 RBP: 00000000e20c7c50 R08: 00000000603ad594 R09: 00000000e20c7b70 R10: 000000000000135a R11: 00000000603ad422 R12: 0000000000000000 R13: 0000000062c7af00 R14: 0000000062406d60 R15: 00000000627700b6 Kernel panic - not syncing: Segfault with no mm CPU: 0 UID: 0 PID: 29 Comm: kworker/0:2 Not tainted 6.12.0-rc6-g59b723cd2adb #1 Workqueue: events mc_work_proc Stack: 627af028 62c7af00 e20c7c80 60276fcd 62778000 603f5820 627af028 00000000 e20c7cb0 603a2bcd 627af000 62770010 Call Trace: [\u0026lt;60276fcd\u0026gt;] device_release+0x70/0xba [\u0026lt;603a2bcd\u0026gt;] kobject_put+0xba/0xe7 [\u0026lt;60277265\u0026gt;] put_device+0x19/0x1c [\u0026lt;60281266\u0026gt;] platform_device_put+0x26/0x29 [\u0026lt;60281e5f\u0026gt;] platform_device_unregister+0x2c/0x2e [\u0026lt;6002ec9c\u0026gt;] net_remove+0x63/0x69 [\u0026lt;60031316\u0026gt;] ? mconsole_reply+0x0/0x50 [\u0026lt;600310c8\u0026gt;] mconsole_remove+0x160/0x1cc [\u0026lt;60087d40\u0026gt;] ? __remove_hrtimer+0x38/0x74 [\u0026lt;60087ff8\u0026gt;] ? hrtimer_try_to_cancel+0x8c/0x98 [\u0026lt;6006b3cf\u0026gt;] ? dl_server_stop+0x3f/0x48 [\u0026lt;6006b390\u0026gt;] ? dl_server_stop+0x0/0x48 [\u0026lt;600672e8\u0026gt;] ? dequeue_entities+0x327/0x390 [\u0026lt;60038fa6\u0026gt;] ? um_set_signals+0x0/0x43 [\u0026lt;6003070c\u0026gt;] mc_work_proc+0x77/0x91 [\u0026lt;60057664\u0026gt;] process_scheduled_works+0x1b3/0x2dd [\u0026lt;60055f32\u0026gt;] ? assign_work+0x0/0x58 [\u0026lt;60057f0a\u0026gt;] worker_thread+0x1e9/0x293 [\u0026lt;6005406f\u0026gt;] ? set_pf_worker+0x0/0x64 [\u0026lt;6005d65d\u0026gt;] ? arch_local_irq_save+0x0/0x2d [\u0026lt;6005d748\u0026gt;] ? kthread_exit+0x0/0x3a [\u0026lt;60057d21\u0026gt;] ? worker_thread+0x0/0x293 [\u0026lt;6005dbf1\u0026gt;] kthread+0x126/0x12b [\u0026lt;600219c5\u0026gt;] new_thread_handler+0x85/0xb6(CVE-2024-53183)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: um: ubd: Do not use drvdata in release The drvdata is not available in release. Let\u0026apos;s just use container_of() to get the ubd instance. Otherwise, removing a ubd device will result in a crash: RIP: 0033:blk_mq_free_tag_set+0x1f/0xba RSP: 00000000e2083bf0 EFLAGS: 00010246 RAX: 000000006021463a RBX: 0000000000000348 RCX: 0000000062604d00 RDX: 0000000004208060 RSI: 00000000605241a0 RDI: 0000000000000348 RBP: 00000000e2083c10 R08: 0000000062414010 R09: 00000000601603f7 R10: 000000000000133a R11: 000000006038c4bd R12: 0000000000000000 R13: 0000000060213a5c R14: 0000000062405d20 R15: 00000000604f7aa0 Kernel panic - not syncing: Segfault with no mm CPU: 0 PID: 17 Comm: kworker/0:1 Not tainted 6.8.0-rc3-00107-gba3f67c11638 #1 Workqueue: events mc_work_proc Stack: 00000000 604f7ef0 62c5d000 62405d20 e2083c30 6002c776 6002c755 600e47ff e2083c60 6025ffe3 04208060 603d36e0 Call Trace: [\u0026lt;6002c776\u0026gt;] ubd_device_release+0x21/0x55 [\u0026lt;6002c755\u0026gt;] ? ubd_device_release+0x0/0x55 [\u0026lt;600e47ff\u0026gt;] ? kfree+0x0/0x100 [\u0026lt;6025ffe3\u0026gt;] device_release+0x70/0xba [\u0026lt;60381d6a\u0026gt;] kobject_put+0xb5/0xe2 [\u0026lt;6026027b\u0026gt;] put_device+0x19/0x1c [\u0026lt;6026a036\u0026gt;] platform_device_put+0x26/0x29 [\u0026lt;6026ac5a\u0026gt;] platform_device_unregister+0x2c/0x2e [\u0026lt;6002c52e\u0026gt;] ubd_remove+0xb8/0xd6 [\u0026lt;6002bb74\u0026gt;] ? mconsole_reply+0x0/0x50 [\u0026lt;6002b926\u0026gt;] mconsole_remove+0x160/0x1cc [\u0026lt;6002bbbc\u0026gt;] ? mconsole_reply+0x48/0x50 [\u0026lt;6003379c\u0026gt;] ? um_set_signals+0x3b/0x43 [\u0026lt;60061c55\u0026gt;] ? update_min_vruntime+0x14/0x70 [\u0026lt;6006251f\u0026gt;] ? dequeue_task_fair+0x164/0x235 [\u0026lt;600620aa\u0026gt;] ? update_cfs_group+0x0/0x40 [\u0026lt;603a0e77\u0026gt;] ? __schedule+0x0/0x3ed [\u0026lt;60033761\u0026gt;] ? um_set_signals+0x0/0x43 [\u0026lt;6002af6a\u0026gt;] mc_work_proc+0x77/0x91 [\u0026lt;600520b4\u0026gt;] process_scheduled_works+0x1af/0x2c3 [\u0026lt;6004ede3\u0026gt;] ? assign_work+0x0/0x58 [\u0026lt;600527a1\u0026gt;] worker_thread+0x2f7/0x37a [\u0026lt;6004ee3b\u0026gt;] ? set_pf_worker+0x0/0x64 [\u0026lt;6005765d\u0026gt;] ? arch_local_irq_save+0x0/0x2d [\u0026lt;60058e07\u0026gt;] ? kthread_exit+0x0/0x3a [\u0026lt;600524aa\u0026gt;] ? worker_thread+0x0/0x37a [\u0026lt;60058f9f\u0026gt;] kthread+0x130/0x135 [\u0026lt;6002068e\u0026gt;] new_thread_handler+0x85/0xb6(CVE-2024-53184)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: PCI: Fix use-after-free of slot-\u0026gt;bus on hot remove Dennis reports a boot crash on recent Lenovo laptops with a USB4 dock. Since commit 0fc70886569c (\u0026quot;thunderbolt: Reset USB4 v2 host router\u0026quot;) and commit 59a54c5f3dbd (\u0026quot;thunderbolt: Reset topology created by the boot firmware\u0026quot;), USB4 v2 and v1 Host Routers are reset on probe of the thunderbolt driver. The reset clears the Presence Detect State and Data Link Layer Link Active bits at the USB4 Host Router\u0026apos;s Root Port and thus causes hot removal of the dock. The crash occurs when pciehp is unbound from one of the dock\u0026apos;s Downstream Ports: pciehp creates a pci_slot on bind and destroys it on unbind. The pci_slot contains a pointer to the pci_bus below the Downstream Port, but a reference on that pci_bus is never acquired. The pci_bus is destroyed before the pci_slot, so a use-after-free ensues when pci_slot_release() accesses slot-\u0026gt;bus. In principle this should not happen because pci_stop_bus_device() unbinds pciehp (and therefore destroys the pci_slot) before the pci_bus is destroyed by pci_remove_bus_device(). However the stacktrace provided by Dennis shows that pciehp is unbound from pci_remove_bus_device() instead of pci_stop_bus_device(). To understand the significance of this, one needs to know that the PCI core uses a two step process to remove a portion of the hierarchy: It first unbinds all drivers in the sub-hierarchy in pci_stop_bus_device() and then actually removes the devices in pci_remove_bus_device(). There is no precaution to prevent driver binding in-between pci_stop_bus_device() and pci_remove_bus_device(). In Dennis\u0026apos; case, it seems removal of the hierarchy by pciehp races with driver binding by pci_bus_add_devices(). pciehp is bound to the Downstream Port after pci_stop_bus_device() has run, so it is unbound by pci_remove_bus_device() instead of pci_stop_bus_device(). Because the pci_bus has already been destroyed at that point, accesses to it result in a use-after-free. One might conclude that driver binding needs to be prevented after pci_stop_bus_device() has run. However it seems risky that pci_slot points to pci_bus without holding a reference. Solely relying on correct ordering of driver unbind versus pci_bus destruction is certainly not defensive programming. If pci_slot has a need to access data in pci_bus, it ought to acquire a reference. Amend pci_create_slot() accordingly. Dennis reports that the crash is not reproducible with this change. Abridged stacktrace: pcieport 0000:00:07.0: PME: Signaling with IRQ 156 pcieport 0000:00:07.0: pciehp: Slot #12 AttnBtn- PwrCtrl- MRL- AttnInd- PwrInd- HotPlug+ Surprise+ Interlock- NoCompl+ IbPresDis- LLActRep+ pci_bus 0000:20: dev 00, created physical slot 12 pcieport 0000:00:07.0: pciehp: Slot(12): Card not present ... pcieport 0000:21:02.0: pciehp: pcie_disable_notification: SLOTCTRL d8 write cmd 0 Oops: general protection fault, probably for non-canonical address 0x6b6b6b6b6b6b6b6b: 0000 [#1] PREEMPT SMP NOPTI CPU: 13 UID: 0 PID: 134 Comm: irq/156-pciehp Not tainted 6.11.0-devel+ #1 RIP: 0010:dev_driver_string+0x12/0x40 pci_destroy_slot pciehp_remove pcie_port_remove_service device_release_driver_internal bus_remove_device device_del device_unregister remove_iter device_for_each_child pcie_portdrv_remove pci_device_remove device_release_driver_internal bus_remove_device device_del pci_remove_bus_device (recursive invocation) pci_remove_bus_device pciehp_unconfigure_device pciehp_disable_slot pciehp_handle_presence_or_link_change pciehp_ist(CVE-2024-53194)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: ALSA: usb-audio: Fix potential out-of-bound accesses for Extigy and Mbox devices A bogus device can provide a bNumConfigurations value that exceeds the initial value used in usb_get_configuration for allocating dev-\u0026gt;config. This can lead to out-of-bounds accesses later, e.g. in usb_destroy_configuration.(CVE-2024-53197)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: vfio/pci: Properly hide first-in-list PCIe extended capability There are cases where a PCIe extended capability should be hidden from the user. For example, an unknown capability (i.e., capability with ID greater than PCI_EXT_CAP_ID_MAX) or a capability that is intentionally chosen to be hidden from the user. Hiding a capability is done by virtualizing and modifying the \u0026apos;Next Capability Offset\u0026apos; field of the previous capability so it points to the capability after the one that should be hidden. The special case where the first capability in the list should be hidden is handled differently because there is no previous capability that can be modified. In this case, the capability ID and version are zeroed while leaving the next pointer intact. This hides the capability and leaves an anchor for the rest of the capability list. However, today, hiding the first capability in the list is not done properly if the capability is unknown, as struct vfio_pci_core_device-\u0026gt;pci_config_map is set to the capability ID during initialization but the capability ID is not properly checked later when used in vfio_config_do_rw(). This leads to the following warning [1] and to an out-of-bounds access to ecap_perms array. Fix it by checking cap_id in vfio_config_do_rw(), and if it is greater than PCI_EXT_CAP_ID_MAX, use an alternative struct perm_bits for direct read only access instead of the ecap_perms array. Note that this is safe since the above is the only case where cap_id can exceed PCI_EXT_CAP_ID_MAX (except for the special capabilities, which are already checked before). [1] WARNING: CPU: 118 PID: 5329 at drivers/vfio/pci/vfio_pci_config.c:1900 vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] CPU: 118 UID: 0 PID: 5329 Comm: simx-qemu-syste Not tainted 6.12.0+ #1 (snip) Call Trace: \u0026lt;TASK\u0026gt; ? show_regs+0x69/0x80 ? __warn+0x8d/0x140 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? report_bug+0x18f/0x1a0 ? handle_bug+0x63/0xa0 ? exc_invalid_op+0x19/0x70 ? asm_exc_invalid_op+0x1b/0x20 ? vfio_pci_config_rw+0x395/0x430 [vfio_pci_core] ? vfio_pci_config_rw+0x244/0x430 [vfio_pci_core] vfio_pci_rw+0x101/0x1b0 [vfio_pci_core] vfio_pci_core_read+0x1d/0x30 [vfio_pci_core] vfio_device_fops_read+0x27/0x40 [vfio] vfs_read+0xbd/0x340 ? vfio_device_fops_unl_ioctl+0xbb/0x740 [vfio] ? __rseq_handle_notify_resume+0xa4/0x4b0 __x64_sys_pread64+0x96/0xc0 x64_sys_call+0x1c3d/0x20d0 do_syscall_64+0x4d/0x120 entry_SYSCALL_64_after_hwframe+0x76/0x7e(CVE-2024-53214)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: NFSD: Prevent NULL dereference in nfsd4_process_cb_update() @ses is initialized to NULL. If __nfsd4_find_backchannel() finds no available backchannel session, setup_callback_client() will try to dereference @ses and segfault.(CVE-2024-53217)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: ALSA: 6fire: Release resources at card release The current 6fire code tries to release the resources right after the call of usb6fire_chip_abort(). But at this moment, the card object might be still in use (as we\u0026apos;re calling snd_card_free_when_closed()). For avoid potential UAFs, move the release of resources to the card\u0026apos;s private_free instead of the manual call of usb6fire_chip_destroy() at the USB disconnect callback.(CVE-2024-53239)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: ALSA: caiaq: Use snd_card_free_when_closed() at disconnection The USB disconnect callback is supposed to be short and not too-long waiting. OTOH, the current code uses snd_card_free() at disconnection, but this waits for the close of all used fds, hence it can take long. It eventually blocks the upper layer USB ioctls, which may trigger a soft lockup. An easy workaround is to replace snd_card_free() with snd_card_free_when_closed(). This variant returns immediately while the release of resources is done asynchronously by the card device release at the last close. This patch also splits the code to the disconnect and the free phases; the former is called immediately at the USB disconnect callback while the latter is called from the card destructor.(CVE-2024-56531)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: ALSA: us122l: Use snd_card_free_when_closed() at disconnection The USB disconnect callback is supposed to be short and not too-long waiting. OTOH, the current code uses snd_card_free() at disconnection, but this waits for the close of all used fds, hence it can take long. It eventually blocks the upper layer USB ioctls, which may trigger a soft lockup. An easy workaround is to replace snd_card_free() with snd_card_free_when_closed(). This variant returns immediately while the release of resources is done asynchronously by the card device release at the last close. The loop of us122l-\u0026gt;mmap_count check is dropped as well. The check is useless for the asynchronous operation with *_when_closed().(CVE-2024-56532)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: wifi: mwifiex: Fix memcpy() field-spanning write warning in mwifiex_config_scan() Replace one-element array with a flexible-array member in `struct mwifiex_ie_types_wildcard_ssid_params` to fix the following warning on a MT8173 Chromebook (mt8173-elm-hana): [ 356.775250] ------------[ cut here ]------------ [ 356.784543] memcpy: detected field-spanning write (size 6) of single field \u0026quot;wildcard_ssid_tlv-\u0026gt;ssid\u0026quot; at drivers/net/wireless/marvell/mwifiex/scan.c:904 (size 1) [ 356.813403] WARNING: CPU: 3 PID: 742 at drivers/net/wireless/marvell/mwifiex/scan.c:904 mwifiex_scan_networks+0x4fc/0xf28 [mwifiex] The \u0026quot;(size 6)\u0026quot; above is exactly the length of the SSID of the network this device was connected to. The source of the warning looks like: ssid_len = user_scan_in-\u0026gt;ssid_list[i].ssid_len; [...] memcpy(wildcard_ssid_tlv-\u0026gt;ssid, user_scan_in-\u0026gt;ssid_list[i].ssid, ssid_len); There is a #define WILDCARD_SSID_TLV_MAX_SIZE that uses sizeof() on this struct, but it already didn\u0026apos;t account for the size of the one-element array, so it doesn\u0026apos;t need to be changed.(CVE-2024-56539)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: crypto: bcm - add error check in the ahash_hmac_init function The ahash_init functions may return fails. The ahash_hmac_init should not return ok when ahash_init returns error. For an example, ahash_init will return -ENOMEM when allocation memory is error.(CVE-2024-56681)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: media: wl128x: Fix atomicity violation in fmc_send_cmd() Atomicity violation occurs when the fmc_send_cmd() function is executed simultaneously with the modification of the fmdev-\u0026gt;resp_skb value. Consider a scenario where, after passing the validity check within the function, a non-null fmdev-\u0026gt;resp_skb variable is assigned a null value. This results in an invalid fmdev-\u0026gt;resp_skb variable passing the validity check. As seen in the later part of the function, skb = fmdev-\u0026gt;resp_skb; when the invalid fmdev-\u0026gt;resp_skb passes the check, a null pointer dereference error may occur at line 478, evt_hdr = (void *)skb-\u0026gt;data; To address this issue, it is recommended to include the validity check of fmdev-\u0026gt;resp_skb within the locked section of the function. This modification ensures that the value of fmdev-\u0026gt;resp_skb does not change during the validation process, thereby maintaining its validity. This possible bug is found by an experimental static analysis tool developed by our team. This tool analyzes the locking APIs to extract function pairs that can be concurrently executed, and then analyzes the instructions in the paired functions to identify possible concurrency bugs including data races and atomicity violations.(CVE-2024-56700)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: 9p/xen: fix release of IRQ Kernel logs indicate an IRQ was double-freed. Pass correct device ID during IRQ release. [Dominique: remove confusing variable reset to 0](CVE-2024-56704)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: fbdev: sh7760fb: Fix a possible memory leak in sh7760fb_alloc_mem() When information such as info-\u0026gt;screen_base is not ready, calling sh7760fb_free_mem() does not release memory correctly. Call dma_free_coherent() instead.(CVE-2024-56746)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved: scsi: qedi: Fix a possible memory leak in qedi_alloc_and_init_sb() Hook \u0026quot;qedi_ops-\u0026gt;common-\u0026gt;sb_init = qed_sb_init\u0026quot; does not release the DMA memory sb_virt when it fails. Add dma_free_coherent() to free it. This is the same way as qedr_alloc_mem_sb() and qede_alloc_mem_sb().(CVE-2024-56747)",
"id": "OESA-2025-1034",
"modified": "2026-08-06T11:08:07Z",
"published": "2025-01-10T11:08:07Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-1034"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-49034"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-49035"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-47684"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50142"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50264"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53103"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53124"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53140"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53141"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53146"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53158"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53165"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53173"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53183"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53184"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53194"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53197"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53214"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53217"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53239"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56531"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56532"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56539"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56681"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56700"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56704"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56746"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56747"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:A/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-49034",
"CVE-2022-49035",
"CVE-2024-47684",
"CVE-2024-50142",
"CVE-2024-50264",
"CVE-2024-53103",
"CVE-2024-53124",
"CVE-2024-53140",
"CVE-2024-53141",
"CVE-2024-53146",
"CVE-2024-53158",
"CVE-2024-53165",
"CVE-2024-53173",
"CVE-2024-53183",
"CVE-2024-53184",
"CVE-2024-53194",
"CVE-2024-53197",
"CVE-2024-53214",
"CVE-2024-53217",
"CVE-2024-53239",
"CVE-2024-56531",
"CVE-2024-56532",
"CVE-2024-56539",
"CVE-2024-56681",
"CVE-2024-56700",
"CVE-2024-56704",
"CVE-2024-56746",
"CVE-2024-56747"
]
}
OESA-2025-1095 (CVE-2023-52480)
Vulnerability from osv_openeuler – Published: 2025-02-08 11:08 – Updated: 2026-08-06 11:08 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: fix race condition between session lookup and expire
Thread A + Thread B ksmbd_session_lookup | smb2_sess_setup sess = xa_load | | | xa_erase(&conn->sessions, sess->id); | | ksmbd_session_destroy(sess) --> kfree(sess) | // UAF! | sess->last_active = jiffies | +
This patch add rwsem to fix race condition between ksmbd_session_lookup and ksmbd_expire_session.(CVE-2023-52480)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/siw: Fix connection failure handling
In case immediate MPA request processing fails, the newly created endpoint unlinks the listening endpoint and is ready to be dropped. This special case was not handled correctly by the code handling the later TCP socket close, causing a NULL dereference crash in siw_cm_work_handler() when dereferencing a NULL listener. We now also cancel the useless MPA timeout, if immediate MPA request processing fails.
This patch furthermore simplifies MPA processing in general: Scheduling a useless TCP socket read in sk_data_ready() upcall is now surpressed, if the socket is already moved out of TCP_ESTABLISHED state.(CVE-2023-52513)
In the Linux kernel, the following vulnerability has been resolved:
PM / devfreq: Fix buffer overflow in trans_stat_show
Fix buffer overflow in trans_stat_show().
Convert simple snprintf to the more secure scnprintf with size of PAGE_SIZE.
Add condition checking if we are exceeding PAGE_SIZE and exit early from loop. Also add at the end a warning that we exceeded PAGE_SIZE and that stats is disabled.
Return -EFBIG in the case where we don't have enough space to write the full transition table.
Also document in the ABI that this function can return -EFBIG error.(CVE-2023-52614)
In the Linux kernel, the following vulnerability has been resolved:
iio: adc: ad7091r: Allow users to configure device events
AD7091R-5 devices are supported by the ad7091r-5 driver together with the ad7091r-base driver. Those drivers declared iio events for notifying user space when ADC readings fall bellow the thresholds of low limit registers or above the values set in high limit registers. However, to configure iio events and their thresholds, a set of callback functions must be implemented and those were not present until now. The consequence of trying to configure ad7091r-5 events without the proper callback functions was a null pointer dereference in the kernel because the pointers to the callback functions were not set.
Implement event configuration callbacks allowing users to read/write event thresholds and enable/disable event generation.
Since the event spec structs are generic to AD7091R devices, also move those from the ad7091r-5 driver the base driver so they can be reused when support for ad7091r-2/-4/-8 be added.(CVE-2023-52627)
In the Linux kernel, the following vulnerability has been resolved:
drm/i915: Fix potential context UAFs
gem_context_register() makes the context visible to userspace, and which point a separate thread can trigger the I915_GEM_CONTEXT_DESTROY ioctl. So we need to ensure that nothing uses the ctx ptr after this. And we need to ensure that adding the ctx to the xarray is the last thing that gem_context_register() does with the ctx pointer.
[tursulin: Stable and fixes tags add/tidy.] (cherry picked from commit bed4b455cf5374e68879be56971c1da563bcd90c)(CVE-2023-52913)
A race condition was found in the Linux kernel's net/bluetooth device driver in conn_info_{min,max}_age_set() function. This can result in integrity overflow issue, possibly leading to bluetooth connection abnormality or denial of service.
(CVE-2024-24857)
A race condition was found in the Linux kernel's net/bluetooth in sniff_{min,max}_interval_set() function. This can result in a bluetooth sniffing exception issue, possibly leading denial of service.
(CVE-2024-24859)
In the Linux kernel, the following vulnerability has been resolved:
xhci: handle isoc Babble and Buffer Overrun events properly
xHCI 4.9 explicitly forbids assuming that the xHC has released its ownership of a multi-TRB TD when it reports an error on one of the early TRBs. Yet the driver makes such assumption and releases the TD, allowing the remaining TRBs to be freed or overwritten by new TDs.
The xHC should also report completion of the final TRB due to its IOC flag being set by us, regardless of prior errors. This event cannot be recognized if the TD has already been freed earlier, resulting in "Transfer event TRB DMA ptr not part of current TD" error message.
Fix this by reusing the logic for processing isoc Transaction Errors. This also handles hosts which fail to report the final completion.
Fix transfer length reporting on Babble errors. They may be caused by device malfunction, no guarantee that the buffer has been filled.(CVE-2024-26659)
In the Linux kernel, the following vulnerability has been resolved:
hwmon: (coretemp) Fix out-of-bounds memory access
Fix a bug that pdata->cpu_map[] is set before out-of-bounds check. The problem might be triggered on systems with more than 128 cores per package.(CVE-2024-26664)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nft_ct: sanitize layer 3 and 4 protocol number in custom expectations
- Disallow families other than NFPROTO_{IPV4,IPV6,INET}.
- Disallow layer 4 protocol with no ports, since destination port is a mandatory attribute for this object.(CVE-2024-26673)
In the Linux kernel, the following vulnerability has been resolved:
usb: roles: fix NULL pointer issue when put module's reference
In current design, usb role class driver will get usb_role_switch parent's module reference after the user get usb_role_switch device and put the reference after the user put the usb_role_switch device. However, the parent device of usb_role_switch may be removed before the user put the usb_role_switch. If so, then, NULL pointer issue will be met when the user put the parent module's reference.
This will save the module pointer in structure of usb_role_switch. Then, we don't need to find module by iterating long relations.(CVE-2024-26747)
In the Linux kernel, the following vulnerability has been resolved:
usb: cdns3: fix memory double free when handle zero packet
829 if (request->complete) { 830 spin_unlock(&priv_dev->lock); 831 usb_gadget_giveback_request(&priv_ep->endpoint, 832 request); 833 spin_lock(&priv_dev->lock); 834 } 835 836 if (request->buf == priv_dev->zlp_buf) 837 cdns3_gadget_ep_free_request(&priv_ep->endpoint, request);
Driver append an additional zero packet request when queue a packet, which length mod max packet size is 0. When transfer complete, run to line 831, usb_gadget_giveback_request() will free this requestion. 836 condition is true, so cdns3_gadget_ep_free_request() free this request again.
Log:
[ 1920.140696][ T150] BUG: KFENCE: use-after-free read in cdns3_gadget_giveback+0x134/0x2c0 [cdns3] [ 1920.140696][ T150] [ 1920.151837][ T150] Use-after-free read at 0x000000003d1cd10b (in kfence-#36): [ 1920.159082][ T150] cdns3_gadget_giveback+0x134/0x2c0 [cdns3] [ 1920.164988][ T150] cdns3_transfer_completed+0x438/0x5f8 [cdns3]
Add check at line 829, skip call usb_gadget_giveback_request() if it is additional zero length packet request. Needn't call usb_gadget_giveback_request() because it is allocated in this driver.(CVE-2024-26748)
In the Linux kernel, the following vulnerability has been resolved:
usb: cdns3: fixed memory use after free at cdns3_gadget_ep_disable()
... cdns3_gadget_ep_free_request(&priv_ep->endpoint, &priv_req->request); list_del_init(&priv_req->list); ...
'priv_req' actually free at cdns3_gadget_ep_free_request(). But list_del_init() use priv_req->list after it.
[ 1542.642868][ T534] BUG: KFENCE: use-after-free read in __list_del_entry_valid+0x10/0xd4 [ 1542.642868][ T534] [ 1542.653162][ T534] Use-after-free read at 0x000000009ed0ba99 (in kfence-#3): [ 1542.660311][ T534] __list_del_entry_valid+0x10/0xd4 [ 1542.665375][ T534] cdns3_gadget_ep_disable+0x1f8/0x388 [cdns3] [ 1542.671571][ T534] usb_ep_disable+0x44/0xe4 [ 1542.675948][ T534] ffs_func_eps_disable+0x64/0xc8 [ 1542.680839][ T534] ffs_func_set_alt+0x74/0x368 [ 1542.685478][ T534] ffs_func_disable+0x18/0x28
Move list_del_init() before cdns3_gadget_ep_free_request() to resolve this problem.(CVE-2024-26749)
In the Linux kernel, the following vulnerability has been resolved:
crypto: virtio/akcipher - Fix stack overflow on memcpy
sizeof(struct virtio_crypto_akcipher_session_para) is less than sizeof(struct virtio_crypto_op_ctrl_req::u), copying more bytes from stack variable leads stack overflow. Clang reports this issue by commands: make -j CC=clang-14 mrproper >/dev/null 2>&1 make -j O=/tmp/crypto-build CC=clang-14 allmodconfig >/dev/null 2>&1 make -j O=/tmp/crypto-build W=1 CC=clang-14 drivers/crypto/virtio/ virtio_crypto_akcipher_algs.o(CVE-2024-26753)
In the Linux kernel, the following vulnerability has been resolved:
mptcp: fix possible deadlock in subflow diag
Syzbot and Eric reported a lockdep splat in the subflow diag:
WARNING: possible circular locking dependency detected 6.8.0-rc4-syzkaller-00212-g40b9385dd8e6 #0 Not tainted
syz-executor.2/24141 is trying to acquire lock: ffff888045870130 (k-sk_lock-AF_INET6){+.+.}-{0:0}, at: tcp_diag_put_ulp net/ipv4/tcp_diag.c:100 [inline] ffff888045870130 (k-sk_lock-AF_INET6){+.+.}-{0:0}, at: tcp_diag_get_aux+0x738/0x830 net/ipv4/tcp_diag.c:137
but task is already holding lock: ffffc9000135e488 (&h->lhash2[i].lock){+.+.}-{2:2}, at: spin_lock include/linux/spinlock.h:351 [inline] ffffc9000135e488 (&h->lhash2[i].lock){+.+.}-{2:2}, at: inet_diag_dump_icsk+0x39f/0x1f80 net/ipv4/inet_diag.c:1038
which lock already depends on the new lock.
the existing dependency chain (in reverse order) is:
-> #1 (&h->lhash2[i].lock){+.+.}-{2:2}: lock_acquire+0x1e3/0x530 kernel/locking/lockdep.c:5754 __raw_spin_lock include/linux/spinlock_api_smp.h:133 [inline] _raw_spin_lock+0x2e/0x40 kernel/locking/spinlock.c:154 spin_lock include/linux/spinlock.h:351 [inline] __inet_hash+0x335/0xbe0 net/ipv4/inet_hashtables.c:743 inet_csk_listen_start+0x23a/0x320 net/ipv4/inet_connection_sock.c:1261 __inet_listen_sk+0x2a2/0x770 net/ipv4/af_inet.c:217 inet_listen+0xa3/0x110 net/ipv4/af_inet.c:239 rds_tcp_listen_init+0x3fd/0x5a0 net/rds/tcp_listen.c:316 rds_tcp_init_net+0x141/0x320 net/rds/tcp.c:577 ops_init+0x352/0x610 net/core/net_namespace.c:136 __register_pernet_operations net/core/net_namespace.c:1214 [inline] register_pernet_operations+0x2cb/0x660 net/core/net_namespace.c:1283 register_pernet_device+0x33/0x80 net/core/net_namespace.c:1370 rds_tcp_init+0x62/0xd0 net/rds/tcp.c:735 do_one_initcall+0x238/0x830 init/main.c:1236 do_initcall_level+0x157/0x210 init/main.c:1298 do_initcalls+0x3f/0x80 init/main.c:1314 kernel_init_freeable+0x42f/0x5d0 init/main.c:1551 kernel_init+0x1d/0x2a0 init/main.c:1441 ret_from_fork+0x4b/0x80 arch/x86/kernel/process.c:147 ret_from_fork_asm+0x1b/0x30 arch/x86/entry/entry_64.S:242
-> #0 (k-sk_lock-AF_INET6){+.+.}-{0:0}: check_prev_add kernel/locking/lockdep.c:3134 [inline] check_prevs_add kernel/locking/lockdep.c:3253 [inline] validate_chain+0x18ca/0x58e0 kernel/locking/lockdep.c:3869 __lock_acquire+0x1345/0x1fd0 kernel/locking/lockdep.c:5137 lock_acquire+0x1e3/0x530 kernel/locking/lockdep.c:5754 lock_sock_fast include/net/sock.h:1723 [inline] subflow_get_info+0x166/0xd20 net/mptcp/diag.c:28 tcp_diag_put_ulp net/ipv4/tcp_diag.c:100 [inline] tcp_diag_get_aux+0x738/0x830 net/ipv4/tcp_diag.c:137 inet_sk_diag_fill+0x10ed/0x1e00 net/ipv4/inet_diag.c:345 inet_diag_dump_icsk+0x55b/0x1f80 net/ipv4/inet_diag.c:1061 __inet_diag_dump+0x211/0x3a0 net/ipv4/inet_diag.c:1263 inet_diag_dump_compat+0x1c1/0x2d0 net/ipv4/inet_diag.c:1371 netlink_dump+0x59b/0xc80 net/netlink/af_netlink.c:2264 __netlink_dump_start+0x5df/0x790 net/netlink/af_netlink.c:2370 netlink_dump_start include/linux/netlink.h:338 [inline] inet_diag_rcv_msg_compat+0x209/0x4c0 net/ipv4/inet_diag.c:1405 sock_diag_rcv_msg+0xe7/0x410 netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543 sock_diag_rcv+0x2a/0x40 net/core/sock_diag.c:280 netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline] netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367 netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x221/0x270 net/socket.c:745 _syssendmsg+0x525/0x7d0 net/socket.c:2584 _sys_sendmsg net/socket.c:2638 [inline] __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667 do_syscall_64+0xf9/0x240 entry_SYSCALL_64_after_hwframe+0x6f/0x77
As noted by Eric we can break the lock dependency chain avoid dumping ---truncated---(CVE-2024-26781)
In the Linux kernel, the following vulnerability has been resolved:
dmaengine: fsl-qdma: fix SoC may hang on 16 byte unaligned read
There is chip (ls1028a) errata:
The SoC may hang on 16 byte unaligned read transactions by QDMA.
Unaligned read transactions initiated by QDMA may stall in the NOC (Network On-Chip), causing a deadlock condition. Stalled transactions will trigger completion timeouts in PCIe controller.
Workaround: Enable prefetch by setting the source descriptor prefetchable bit ( SD[PF] = 1 ).
Implement this workaround.(CVE-2024-26790)
In the Linux kernel, the following vulnerability has been resolved:
gtp: fix use-after-free and null-ptr-deref in gtp_newlink()
The gtp_link_ops operations structure for the subsystem must be registered after registering the gtp_net_ops pernet operations structure.
Syzkaller hit 'general protection fault in gtp_genl_dump_pdp' bug:
[ 1010.702740] gtp: GTP module unloaded [ 1010.715877] general protection fault, probably for non-canonical address 0xdffffc0000000001: 0000 [#1] SMP KASAN NOPTI [ 1010.715888] KASAN: null-ptr-deref in range [0x0000000000000008-0x000000000000000f] [ 1010.715895] CPU: 1 PID: 128616 Comm: a.out Not tainted 6.8.0-rc6-std-def-alt1 #1 [ 1010.715899] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.0-alt1 04/01/2014 [ 1010.715908] RIP: 0010:gtp_newlink+0x4d7/0x9c0 [gtp] [ 1010.715915] Code: 80 3c 02 00 0f 85 41 04 00 00 48 8b bb d8 05 00 00 e8 ed f6 ff ff 48 89 c2 48 89 c5 48 b8 00 00 00 00 00 fc ff df 48 c1 ea 03 <80> 3c 02 00 0f 85 4f 04 00 00 4c 89 e2 4c 8b 6d 00 48 b8 00 00 00 [ 1010.715920] RSP: 0018:ffff888020fbf180 EFLAGS: 00010203 [ 1010.715929] RAX: dffffc0000000000 RBX: ffff88800399c000 RCX: 0000000000000000 [ 1010.715933] RDX: 0000000000000001 RSI: ffffffff84805280 RDI: 0000000000000282 [ 1010.715938] RBP: 000000000000000d R08: 0000000000000001 R09: 0000000000000000 [ 1010.715942] R10: 0000000000000001 R11: 0000000000000001 R12: ffff88800399cc80 [ 1010.715947] R13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000400 [ 1010.715953] FS: 00007fd1509ab5c0(0000) GS:ffff88805b300000(0000) knlGS:0000000000000000 [ 1010.715958] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 1010.715962] CR2: 0000000000000000 CR3: 000000001c07a000 CR4: 0000000000750ee0 [ 1010.715968] PKRU: 55555554 [ 1010.715972] Call Trace: [ 1010.715985] ? __die_body.cold+0x1a/0x1f [ 1010.715995] ? die_addr+0x43/0x70 [ 1010.716002] ? exc_general_protection+0x199/0x2f0 [ 1010.716016] ? asm_exc_general_protection+0x1e/0x30 [ 1010.716026] ? gtp_newlink+0x4d7/0x9c0 [gtp] [ 1010.716034] ? gtp_net_exit+0x150/0x150 [gtp] [ 1010.716042] __rtnl_newlink+0x1063/0x1700 [ 1010.716051] ? rtnl_setlink+0x3c0/0x3c0 [ 1010.716063] ? is_bpf_text_address+0xc0/0x1f0 [ 1010.716070] ? kernel_text_address.part.0+0xbb/0xd0 [ 1010.716076] ? __kernel_text_address+0x56/0xa0 [ 1010.716084] ? unwind_get_return_address+0x5a/0xa0 [ 1010.716091] ? create_prof_cpu_mask+0x30/0x30 [ 1010.716098] ? arch_stack_walk+0x9e/0xf0 [ 1010.716106] ? stack_trace_save+0x91/0xd0 [ 1010.716113] ? stack_trace_consume_entry+0x170/0x170 [ 1010.716121] ? __lock_acquire+0x15c5/0x5380 [ 1010.716139] ? mark_held_locks+0x9e/0xe0 [ 1010.716148] ? kmem_cache_alloc_trace+0x35f/0x3c0 [ 1010.716155] ? __rtnl_newlink+0x1700/0x1700 [ 1010.716160] rtnl_newlink+0x69/0xa0 [ 1010.716166] rtnetlink_rcv_msg+0x43b/0xc50 [ 1010.716172] ? rtnl_fdb_dump+0x9f0/0x9f0 [ 1010.716179] ? lock_acquire+0x1fe/0x560 [ 1010.716188] ? netlink_deliver_tap+0x12f/0xd50 [ 1010.716196] netlink_rcv_skb+0x14d/0x440 [ 1010.716202] ? rtnl_fdb_dump+0x9f0/0x9f0 [ 1010.716208] ? netlink_ack+0xab0/0xab0 [ 1010.716213] ? netlink_deliver_tap+0x202/0xd50 [ 1010.716220] ? netlink_deliver_tap+0x218/0xd50 [ 1010.716226] ? __virt_addr_valid+0x30b/0x590 [ 1010.716233] netlink_unicast+0x54b/0x800 [ 1010.716240] ? netlink_attachskb+0x870/0x870 [ 1010.716248] ? __check_object_size+0x2de/0x3b0 [ 1010.716254] netlink_sendmsg+0x938/0xe40 [ 1010.716261] ? netlink_unicast+0x800/0x800 [ 1010.716269] ? __import_iovec+0x292/0x510 [ 1010.716276] ? netlink_unicast+0x800/0x800 [ 1010.716284] __sock_sendmsg+0x159/0x190 [ 1010.716290] _syssendmsg+0x712/0x880 [ 1010.716297] ? sock_write_iter+0x3d0/0x3d0 [ 1010.716304] ? ia32_sys_recvmmsg+0x270/0x270 [ 1010.716309] ? lock_acquire+0x1fe/0x560 [ 1010.716315] ? drain_array_locked+0x90/0x90 [ 1010.716324] ___sys_sendmsg+0xf8/0x170 [ 1010.716331] ? sendmsg_copy_msghdr+0x170/0x170 [ 1010.716337] ? lockdep_init_map ---truncated---(CVE-2024-26793)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: fix potencial out-of-bounds when buffer offset is invalid
I found potencial out-of-bounds when buffer offset fields of a few requests is invalid. This patch set the minimum value of buffer offset field to ->Buffer offset to validate buffer length.(CVE-2024-26952)
In the Linux kernel, the following vulnerability has been resolved:
clk: Get runtime PM before walking tree during disable_unused
Doug reported [1] the following hung task:
INFO: task swapper/0:1 blocked for more than 122 seconds. Not tainted 5.15.149-21875-gf795ebc40eb8 #1 "echo 0 > /proc/sys/kernel/hung_task_timeout_secs" disables this message. task:swapper/0 state:D stack: 0 pid: 1 ppid: 0 flags:0x00000008 Call trace: __switch_to+0xf4/0x1f4 __schedule+0x418/0xb80 schedule+0x5c/0x10c rpm_resume+0xe0/0x52c rpm_resume+0x178/0x52c __pm_runtime_resume+0x58/0x98 clk_pm_runtime_get+0x30/0xb0 clk_disable_unused_subtree+0x58/0x208 clk_disable_unused_subtree+0x38/0x208 clk_disable_unused_subtree+0x38/0x208 clk_disable_unused_subtree+0x38/0x208 clk_disable_unused_subtree+0x38/0x208 clk_disable_unused+0x4c/0xe4 do_one_initcall+0xcc/0x2d8 do_initcall_level+0xa4/0x148 do_initcalls+0x5c/0x9c do_basic_setup+0x24/0x30 kernel_init_freeable+0xec/0x164 kernel_init+0x28/0x120 ret_from_fork+0x10/0x20 INFO: task kworker/u16:0:9 blocked for more than 122 seconds. Not tainted 5.15.149-21875-gf795ebc40eb8 #1 "echo 0 > /proc/sys/kernel/hung_task_timeout_secs" disables this message. task:kworker/u16:0 state:D stack: 0 pid: 9 ppid: 2 flags:0x00000008 Workqueue: events_unbound deferred_probe_work_func Call trace: __switch_to+0xf4/0x1f4 __schedule+0x418/0xb80 schedule+0x5c/0x10c schedule_preempt_disabled+0x2c/0x48 __mutex_lock+0x238/0x488 __mutex_lock_slowpath+0x1c/0x28 mutex_lock+0x50/0x74 clk_prepare_lock+0x7c/0x9c clk_core_prepare_lock+0x20/0x44 clk_prepare+0x24/0x30 clk_bulk_prepare+0x40/0xb0 mdss_runtime_resume+0x54/0x1c8 pm_generic_runtime_resume+0x30/0x44 __genpd_runtime_resume+0x68/0x7c genpd_runtime_resume+0x108/0x1f4 __rpm_callback+0x84/0x144 rpm_callback+0x30/0x88 rpm_resume+0x1f4/0x52c rpm_resume+0x178/0x52c __pm_runtime_resume+0x58/0x98 __device_attach+0xe0/0x170 device_initial_probe+0x1c/0x28 bus_probe_device+0x3c/0x9c device_add+0x644/0x814 mipi_dsi_device_register_full+0xe4/0x170 devm_mipi_dsi_device_register_full+0x28/0x70 ti_sn_bridge_probe+0x1dc/0x2c0 auxiliary_bus_probe+0x4c/0x94 really_probe+0xcc/0x2c8 __driver_probe_device+0xa8/0x130 driver_probe_device+0x48/0x110 __device_attach_driver+0xa4/0xcc bus_for_each_drv+0x8c/0xd8 __device_attach+0xf8/0x170 device_initial_probe+0x1c/0x28 bus_probe_device+0x3c/0x9c deferred_probe_work_func+0x9c/0xd8 process_one_work+0x148/0x518 worker_thread+0x138/0x350 kthread+0x138/0x1e0 ret_from_fork+0x10/0x20
The first thread is walking the clk tree and calling clk_pm_runtime_get() to power on devices required to read the clk hardware via struct clk_ops::is_enabled(). This thread holds the clk prepare_lock, and is trying to runtime PM resume a device, when it finds that the device is in the process of resuming so the thread schedule()s away waiting for the device to finish resuming before continuing. The second thread is runtime PM resuming the same device, but the runtime resume callback is calling clk_prepare(), trying to grab the prepare_lock waiting on the first thread.
This is a classic ABBA deadlock. To properly fix the deadlock, we must never runtime PM resume or suspend a device with the clk prepare_lock held. Actually doing that is near impossible today because the global prepare_lock would have to be dropped in the middle of the tree, the device runtime PM resumed/suspended, and then the prepare_lock grabbed again to ensure consistency of the clk tree topology. If anything changes with the clk tree in the meantime, we've lost and will need to start the operation all over again.
Luckily, most of the time we're simply incrementing or decrementing the runtime PM count on an active device, so we don't have the chance to schedule away with the prepare_lock held. Let's fix this immediate problem that can be ---truncated---(CVE-2024-27004)
In the Linux kernel, the following vulnerability has been resolved:
fpga: bridge: add owner module and take its refcount
The current implementation of the fpga bridge assumes that the low-level module registers a driver for the parent device and uses its owner pointer to take the module's refcount. This approach is problematic since it can lead to a null pointer dereference while attempting to get the bridge if the parent device does not have a driver.
To address this problem, add a module owner pointer to the fpga_bridge struct and use it to take the module's refcount. Modify the function for registering a bridge to take an additional owner module parameter and rename it to avoid conflicts. Use the old function name for a helper macro that automatically sets the module that registers the bridge as the owner. This ensures compatibility with existing low-level control modules and reduces the chances of registering a bridge without setting the owner.
Also, update the documentation to keep it consistent with the new interface for registering an fpga bridge.
Other changes: opportunistically move put_device() from __fpga_bridge_get() to fpga_bridge_get() and of_fpga_bridge_get() to improve code clarity since the bridge device is taken in these functions.(CVE-2024-36479)
In the Linux kernel, the following vulnerability has been resolved:
net: relax socket state check at accept time.
Christoph reported the following splat:
WARNING: CPU: 1 PID: 772 at net/ipv4/af_inet.c:761 __inet_accept+0x1f4/0x4a0 Modules linked in: CPU: 1 PID: 772 Comm: syz-executor510 Not tainted 6.9.0-rc7-g7da7119fe22b #56 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.11.0-2.el7 04/01/2014 RIP: 0010:__inet_accept+0x1f4/0x4a0 net/ipv4/af_inet.c:759 Code: 04 38 84 c0 0f 85 87 00 00 00 41 c7 04 24 03 00 00 00 48 83 c4 10 5b 41 5c 41 5d 41 5e 41 5f 5d c3 cc cc cc cc e8 ec b7 da fd <0f> 0b e9 7f fe ff ff e8 e0 b7 da fd 0f 0b e9 fe fe ff ff 89 d9 80 RSP: 0018:ffffc90000c2fc58 EFLAGS: 00010293 RAX: ffffffff836bdd14 RBX: 0000000000000000 RCX: ffff888104668000 RDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000000 RBP: dffffc0000000000 R08: ffffffff836bdb89 R09: fffff52000185f64 R10: dffffc0000000000 R11: fffff52000185f64 R12: dffffc0000000000 R13: 1ffff92000185f98 R14: ffff88810754d880 R15: ffff8881007b7800 FS: 000000001c772880(0000) GS:ffff88811b280000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007fb9fcf2e178 CR3: 00000001045d2002 CR4: 0000000000770ef0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 PKRU: 55555554 Call Trace: <TASK> inet_accept+0x138/0x1d0 net/ipv4/af_inet.c:786 do_accept+0x435/0x620 net/socket.c:1929 __sys_accept4_file net/socket.c:1969 [inline] __sys_accept4+0x9b/0x110 net/socket.c:1999 __do_sys_accept net/socket.c:2016 [inline] __se_sys_accept net/socket.c:2013 [inline] __x64_sys_accept+0x7d/0x90 net/socket.c:2013 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0x58/0x100 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x76/0x7e RIP: 0033:0x4315f9 Code: fd ff 48 81 c4 80 00 00 00 e9 f1 fe ff ff 0f 1f 00 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 0f 83 ab b4 fd ff c3 66 2e 0f 1f 84 00 00 00 00 RSP: 002b:00007ffdb26d9c78 EFLAGS: 00000246 ORIG_RAX: 000000000000002b RAX: ffffffffffffffda RBX: 0000000000400300 RCX: 00000000004315f9 RDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000004 RBP: 00000000006e1018 R08: 0000000000400300 R09: 0000000000400300 R10: 0000000000400300 R11: 0000000000000246 R12: 0000000000000000 R13: 000000000040cdf0 R14: 000000000040ce80 R15: 0000000000000055 </TASK>
The reproducer invokes shutdown() before entering the listener status. After commit 94062790aedb ("tcp: defer shutdown(SEND_SHUTDOWN) for TCP_SYN_RECV sockets"), the above causes the child to reach the accept syscall in FIN_WAIT1 status.
Eric noted we can relax the existing assertion in __inet_accept()(CVE-2024-36484)
In the Linux kernel, the following vulnerability has been resolved:
fpga: manager: add owner module and take its refcount
The current implementation of the fpga manager assumes that the low-level module registers a driver for the parent device and uses its owner pointer to take the module's refcount. This approach is problematic since it can lead to a null pointer dereference while attempting to get the manager if the parent device does not have a driver.
To address this problem, add a module owner pointer to the fpga_manager struct and use it to take the module's refcount. Modify the functions for registering the manager to take an additional owner module parameter and rename them to avoid conflicts. Use the old function names for helper macros that automatically set the module that registers the manager as the owner. This ensures compatibility with existing low-level control modules and reduces the chances of registering a manager without setting the owner.
Also, update the documentation to keep it consistent with the new interface for registering an fpga manager.
Other changes: opportunistically move put_device() from __fpga_mgr_get() to fpga_mgr_get() and of_fpga_mgr_get() to improve code clarity since the manager device is taken in these functions.(CVE-2024-37021)
In the Linux kernel, the following vulnerability has been resolved:
i2c: lpi2c: Avoid calling clk_get_rate during transfer
Instead of repeatedly calling clk_get_rate for each transfer, lock the clock rate and cache the value. A deadlock has been observed while adding tlv320aic32x4 audio codec to the system. When this clock provider adds its clock, the clk mutex is locked already, it needs to access i2c, which in return needs the mutex for clk_get_rate as well.(CVE-2024-40965)
In the Linux kernel, the following vulnerability has been resolved:
arm64: probes: Fix uprobes for big-endian kernels
The arm64 uprobes code is broken for big-endian kernels as it doesn't convert the in-memory instruction encoding (which is always little-endian) into the kernel's native endianness before analyzing and simulating instructions. This may result in a few distinct problems:
-
The kernel may may erroneously reject probing an instruction which can safely be probed.
-
The kernel may erroneously erroneously permit stepping an instruction out-of-line when that instruction cannot be stepped out-of-line safely.
-
The kernel may erroneously simulate instruction incorrectly dur to interpretting the byte-swapped encoding.
The endianness mismatch isn't caught by the compiler or sparse because:
-
The arch_uprobe::{insn,ixol} fields are encoded as arrays of u8, so the compiler and sparse have no idea these contain a little-endian 32-bit value. The core uprobes code populates these with a memcpy() which similarly does not handle endianness.
-
While the uprobe_opcode_t type is an alias for __le32, both arch_uprobe_analyze_insn() and arch_uprobe_skip_sstep() cast from u8[] to the similarly-named probe_opcode_t, which is an alias for u32. Hence there is no endianness conversion warning.
Fix this by changing the arch_uprobe::{insn,ixol} fields to __le32 and adding the appropriate __le32_to_cpu() conversions prior to consuming the instruction encoding. The core uprobes copies these fields as opaque ranges of bytes, and so is unaffected by this change.
At the same time, remove MAX_UINSN_BYTES and consistently use AARCH64_INSN_SIZE for clarity.
Tested with the following:
| #include <stdio.h> | #include <stdbool.h> | | #define noinline attribute((noinline)) | | static noinline void adrp_self(void) | { | void addr; | | asm volatile( | " adrp %x0, adrp_self\n" | " add %x0, %x0, :lo12:adrp_self\n" | : "=r" (addr)); | } | | | int main(int argc, char argv) | { | void ptr = adrp_self(); | bool equal = (ptr == adrp_self); | | printf("adrp_self => %p\n" | "adrp_self() => %p\n" | "%s\n", | adrp_self, ptr, equal ? "EQUAL" : "NOT EQUAL"); | | return 0; | }
.... where the adrp_self() function was compiled to:
| 00000000004007e0 <adrp_self>: | 4007e0: 90000000 adrp x0, 400000 <__ehdr_start> | 4007e4: 911f8000 add x0, x0, #0x7e0 | 4007e8: d65f03c0 ret
Before this patch, the ADRP is not recognized, and is assumed to be steppable, resulting in corruption of the result:
| # ./adrp-self | adrp_self => 0x4007e0 | adrp_self() => 0x4007e0 | EQUAL | # echo 'p /root/adrp-self:0x007e0' > /sys/kernel/tracing/uprobe_events | # echo 1 > /sys/kernel/tracing/events/uprobes/enable | # ./adrp-self | adrp_self => 0x4007e0 | adrp_self() => 0xffffffffff7e0 | NOT EQUAL
After this patch, the ADRP is correctly recognized and simulated:
| # ./adrp-self | adrp_self => 0x4007e0 | adrp_self() => 0x4007e0 | EQUAL | # | # echo 'p /root/adrp-self:0x007e0' > /sys/kernel/tracing/uprobe_events | # echo 1 > /sys/kernel/tracing/events/uprobes/enable | # ./adrp-self | adrp_self => 0x4007e0 | adrp_self() => 0x4007e0 | EQUAL(CVE-2024-50194)
In the Linux kernel, the following vulnerability has been resolved:
dm cache: fix flushing uninitialized delayed_work on cache_ctr error
An unexpected WARN_ON from flush_work() may occur when cache creation fails, caused by destroying the uninitialized delayed_work waker in the error path of cache_create(). For example, the warning appears on the superblock checksum error.
Reproduce steps:
dmsetup create cmeta --table "0 8192 linear /dev/sdc 0" dmsetup create cdata --table "0 65536 linear /dev/sdc 8192" dmsetup create corig --table "0 524288 linear /dev/sdc 262144" dd if=/dev/urandom of=/dev/mapper/cmeta bs=4k count=1 oflag=direct dmsetup create cache --table "0 524288 cache /dev/mapper/cmeta \ /dev/mapper/cdata /dev/mapper/corig 128 2 metadata2 writethrough smq 0"
Kernel logs:
(snip) WARNING: CPU: 0 PID: 84 at kernel/workqueue.c:4178 __flush_work+0x5d4/0x890
Fix by pulling out the cancel_delayed_work_sync() from the constructor's error path. This patch doesn't affect the use-after-free fix for concurrent dm_resume and dm_destroy (commit 6a459d8edbdb ("dm cache: Fix UAF in destroy()")) as cache_dtr is not changed.(CVE-2024-50280)
In the Linux kernel, the following vulnerability has been resolved:
nilfs2: fix null-ptr-deref in block_touch_buffer tracepoint
Patch series "nilfs2: fix null-ptr-deref bugs on block tracepoints".
This series fixes null pointer dereference bugs that occur when using nilfs2 and two block-related tracepoints.
This patch (of 2):
It has been reported that when using "block:block_touch_buffer" tracepoint, touch_buffer() called from __nilfs_get_folio_block() causes a NULL pointer dereference, or a general protection fault when KASAN is enabled.
This happens because since the tracepoint was added in touch_buffer(), it references the dev_t member bh->b_bdev->bd_dev regardless of whether the buffer head has a pointer to a block_device structure. In the current implementation, the block_device structure is set after the function returns to the caller.
Here, touch_buffer() is used to mark the folio/page that owns the buffer head as accessed, but the common search helper for folio/page used by the caller function was optimized to mark the folio/page as accessed when it was reimplemented a long time ago, eliminating the need to call touch_buffer() here in the first place.
So this solves the issue by eliminating the touch_buffer() call itself.(CVE-2024-53131)
In the Linux kernel, the following vulnerability has been resolved:
um: net: Do not use drvdata in release
The drvdata is not available in release. Let's just use container_of() to get the uml_net instance. Otherwise, removing a network device will result in a crash:
RIP: 0033:net_device_release+0x10/0x6f RSP: 00000000e20c7c40 EFLAGS: 00010206 RAX: 000000006002e4e7 RBX: 00000000600f1baf RCX: 00000000624074e0 RDX: 0000000062778000 RSI: 0000000060551c80 RDI: 00000000627af028 RBP: 00000000e20c7c50 R08: 00000000603ad594 R09: 00000000e20c7b70 R10: 000000000000135a R11: 00000000603ad422 R12: 0000000000000000 R13: 0000000062c7af00 R14: 0000000062406d60 R15: 00000000627700b6 Kernel panic - not syncing: Segfault with no mm CPU: 0 UID: 0 PID: 29 Comm: kworker/0:2 Not tainted 6.12.0-rc6-g59b723cd2adb #1 Workqueue: events mc_work_proc Stack: 627af028 62c7af00 e20c7c80 60276fcd 62778000 603f5820 627af028 00000000 e20c7cb0 603a2bcd 627af000 62770010 Call Trace: [<60276fcd>] device_release+0x70/0xba [<603a2bcd>] kobject_put+0xba/0xe7 [<60277265>] put_device+0x19/0x1c [<60281266>] platform_device_put+0x26/0x29 [<60281e5f>] platform_device_unregister+0x2c/0x2e [<6002ec9c>] net_remove+0x63/0x69 [<60031316>] ? mconsole_reply+0x0/0x50 [<600310c8>] mconsole_remove+0x160/0x1cc [<60087d40>] ? __remove_hrtimer+0x38/0x74 [<60087ff8>] ? hrtimer_try_to_cancel+0x8c/0x98 [<6006b3cf>] ? dl_server_stop+0x3f/0x48 [<6006b390>] ? dl_server_stop+0x0/0x48 [<600672e8>] ? dequeue_entities+0x327/0x390 [<60038fa6>] ? um_set_signals+0x0/0x43 [<6003070c>] mc_work_proc+0x77/0x91 [<60057664>] process_scheduled_works+0x1b3/0x2dd [<60055f32>] ? assign_work+0x0/0x58 [<60057f0a>] worker_thread+0x1e9/0x293 [<6005406f>] ? set_pf_worker+0x0/0x64 [<6005d65d>] ? arch_local_irq_save+0x0/0x2d [<6005d748>] ? kthread_exit+0x0/0x3a [<60057d21>] ? worker_thread+0x0/0x293 [<6005dbf1>] kthread+0x126/0x12b [<600219c5>] new_thread_handler+0x85/0xb6(CVE-2024-53183)
In the Linux kernel, the following vulnerability has been resolved:
xen: Fix the issue of resource not being properly released in xenbus_dev_probe()
This patch fixes an issue in the function xenbus_dev_probe(). In the xenbus_dev_probe() function, within the if (err) branch at line 313, the program incorrectly returns err directly without releasing the resources allocated by err = drv->probe(dev, id). As the return value is non-zero, the upper layers assume the processing logic has failed. However, the probe operation was performed earlier without a corresponding remove operation. Since the probe actually allocates resources, failing to perform the remove operation could lead to problems.
To fix this issue, we followed the resource release logic of the xenbus_dev_remove() function by adding a new block fail_remove before the fail_put block. After entering the branch if (err) at line 313, the function will use a goto statement to jump to the fail_remove block, ensuring that the previously acquired resources are correctly released, thus preventing the reference count leak.
This bug was identified by an experimental static analysis tool developed by our team. The tool specializes in analyzing reference count operations and detecting potential issues where resources are not properly managed. In this case, the tool flagged the missing release operation as a potential problem, which led to the development of this patch.(CVE-2024-53198)
In the Linux kernel, the following vulnerability has been resolved:drm/amd/display: Fix null check for pipe_ctx->plane_state in dcn20_program_pipeThis commit addresses a null pointer dereference issue indcn20_program_pipe(). Previously, commit 8e4ed3cf1642 ( drm/amd/display:Add null check for pipe_ctx->plane_state in dcn20_program_pipe )partially fixed the null pointer dereference issue. However, indcn20_update_dchubp_dpp(), the variable pipe_ctx is passed in, andplane_state is accessed again through pipe_ctx. Multiple if statementsdirectly call attributes of plane_state, leading to potential nullpointer dereference issues. This patch adds necessary null checks toensure stability.(CVE-2024-53201)
In the Linux kernel, the following vulnerability has been resolved:
wifi: mwifiex: Fix memcpy() field-spanning write warning in mwifiex_config_scan()
Replace one-element array with a flexible-array member in struct
mwifiex_ie_types_wildcard_ssid_params to fix the following warning
on a MT8173 Chromebook (mt8173-elm-hana):
[ 356.775250] ------------[ cut here ]------------ [ 356.784543] memcpy: detected field-spanning write (size 6) of single field "wildcard_ssid_tlv->ssid" at drivers/net/wireless/marvell/mwifiex/scan.c:904 (size 1) [ 356.813403] WARNING: CPU: 3 PID: 742 at drivers/net/wireless/marvell/mwifiex/scan.c:904 mwifiex_scan_networks+0x4fc/0xf28 [mwifiex]
The "(size 6)" above is exactly the length of the SSID of the network this device was connected to. The source of the warning looks like:
ssid_len = user_scan_in->ssid_list[i].ssid_len;
[...]
memcpy(wildcard_ssid_tlv->ssid,
user_scan_in->ssid_list[i].ssid, ssid_len);
There is a #define WILDCARD_SSID_TLV_MAX_SIZE that uses sizeof() on this struct, but it already didn't account for the size of the one-element array, so it doesn't need to be changed.(CVE-2024-56539)
In the Linux kernel, the following vulnerability has been resolved:
media: uvcvideo: Require entities to have a non-zero unique ID
Per UVC 1.1+ specification 3.7.2, units and terminals must have a non-zero unique ID.
Each Unit and Terminal within the video function is assigned a unique
identification number, the Unit ID (UID) or Terminal ID (TID), contained in
the bUnitID or bTerminalID field of the descriptor. The value 0x00 is
reserved for undefined ID,
So, deny allocating an entity with ID 0 or an ID that belongs to a unit that is already added to the list of entities.
This also prevents some syzkaller reproducers from triggering warnings due to a chain of entities referring to themselves. In one particular case, an Output Unit is connected to an Input Unit, both with the same ID of 1. But when looking up for the source ID of the Output Unit, that same entity is found instead of the input entity, which leads to such warnings.
In another case, a backward chain was considered finished as the source ID was 0. Later on, that entity was found, but its pads were not valid.
Here is a sample stack trace for one of those cases.
[ 20.650953] usb 1-1: new high-speed USB device number 2 using dummy_hcd [ 20.830206] usb 1-1: Using ep0 maxpacket: 8 [ 20.833501] usb 1-1: config 0 descriptor?? [ 21.038518] usb 1-1: string descriptor 0 read error: -71 [ 21.038893] usb 1-1: Found UVC 0.00 device <unnamed> (2833:0201) [ 21.039299] uvcvideo 1-1:0.0: Entity type for entity Output 1 was not initialized! [ 21.041583] uvcvideo 1-1:0.0: Entity type for entity Input 1 was not initialized! [ 21.042218] ------------[ cut here ]------------ [ 21.042536] WARNING: CPU: 0 PID: 9 at drivers/media/mc/mc-entity.c:1147 media_create_pad_link+0x2c4/0x2e0 [ 21.043195] Modules linked in: [ 21.043535] CPU: 0 UID: 0 PID: 9 Comm: kworker/0:1 Not tainted 6.11.0-rc7-00030-g3480e43aeccf #444 [ 21.044101] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.15.0-1 04/01/2014 [ 21.044639] Workqueue: usb_hub_wq hub_event [ 21.045100] RIP: 0010:media_create_pad_link+0x2c4/0x2e0 [ 21.045508] Code: fe e8 20 01 00 00 b8 f4 ff ff ff 48 83 c4 30 5b 41 5c 41 5d 41 5e 41 5f 5d c3 cc cc cc cc 0f 0b eb e9 0f 0b eb 0a 0f 0b eb 06 <0f> 0b eb 02 0f 0b b8 ea ff ff ff eb d4 66 2e 0f 1f 84 00 00 00 00 [ 21.046801] RSP: 0018:ffffc9000004b318 EFLAGS: 00010246 [ 21.047227] RAX: ffff888004e5d458 RBX: 0000000000000000 RCX: ffffffff818fccf1 [ 21.047719] RDX: 000000000000007b RSI: 0000000000000000 RDI: ffff888004313290 [ 21.048241] RBP: ffff888004313290 R08: 0001ffffffffffff R09: 0000000000000000 [ 21.048701] R10: 0000000000000013 R11: 0001888004313290 R12: 0000000000000003 [ 21.049138] R13: ffff888004313080 R14: ffff888004313080 R15: 0000000000000000 [ 21.049648] FS: 0000000000000000(0000) GS:ffff88803ec00000(0000) knlGS:0000000000000000 [ 21.050271] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 21.050688] CR2: 0000592cc27635b0 CR3: 000000000431c000 CR4: 0000000000750ef0 [ 21.051136] PKRU: 55555554 [ 21.051331] Call Trace: [ 21.051480] <TASK> [ 21.051611] ? __warn+0xc4/0x210 [ 21.051861] ? media_create_pad_link+0x2c4/0x2e0 [ 21.052252] ? report_bug+0x11b/0x1a0 [ 21.052540] ? trace_hardirqs_on+0x31/0x40 [ 21.052901] ? handle_bug+0x3d/0x70 [ 21.053197] ? exc_invalid_op+0x1a/0x50 [ 21.053511] ? asm_exc_invalid_op+0x1a/0x20 [ 21.053924] ? media_create_pad_link+0x91/0x2e0 [ 21.054364] ? media_create_pad_link+0x2c4/0x2e0 [ 21.054834] ? media_create_pad_link+0x91/0x2e0 [ 21.055131] ? _raw_spin_unlock+0x1e/0x40 [ 21.055441] ? __v4l2_device_register_subdev+0x202/0x210 [ 21.055837] uvc_mc_register_entities+0x358/0x400 [ 21.056144] uvc_register_chains+0x1fd/0x290 [ 21.056413] uvc_probe+0x380e/0x3dc0 [ 21.056676] ? __lock_acquire+0x5aa/0x26e0 [ 21.056946] ? find_held_lock+0x33/0xa0 [ 21.057196] ? kernfs_activate+0x70/0x80 [ 21.057533] ? usb_match_dy ---truncated---(CVE-2024-56571)
In the Linux kernel, the following vulnerability has been resolved:
scsi: hisi_sas: Create all dump files during debugfs initialization
For the current debugfs of hisi_sas, after user triggers dump, the driver allocate memory space to save the register information and create debugfs files to display the saved information. In this process, the debugfs files created after each dump.
Therefore, when the dump is triggered while the driver is unbind, the following hang occurs:
[67840.853907] Unable to handle kernel NULL pointer dereference at virtual address 00000000000000a0 [67840.862947] Mem abort info: [67840.865855] ESR = 0x0000000096000004 [67840.869713] EC = 0x25: DABT (current EL), IL = 32 bits [67840.875125] SET = 0, FnV = 0 [67840.878291] EA = 0, S1PTW = 0 [67840.881545] FSC = 0x04: level 0 translation fault [67840.886528] Data abort info: [67840.889524] ISV = 0, ISS = 0x00000004, ISS2 = 0x00000000 [67840.895117] CM = 0, WnR = 0, TnD = 0, TagAccess = 0 [67840.900284] GCS = 0, Overlay = 0, DirtyBit = 0, Xs = 0 [67840.905709] user pgtable: 4k pages, 48-bit VAs, pgdp=0000002803a1f000 [67840.912263] [00000000000000a0] pgd=0000000000000000, p4d=0000000000000000 [67840.919177] Internal error: Oops: 0000000096000004 [#1] PREEMPT SMP [67840.996435] pstate: 80400009 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--) [67841.003628] pc : down_write+0x30/0x98 [67841.007546] lr : start_creating.part.0+0x60/0x198 [67841.012495] sp : ffff8000b979ba20 [67841.016046] x29: ffff8000b979ba20 x28: 0000000000000010 x27: 0000000000024b40 [67841.023412] x26: 0000000000000012 x25: ffff20202b355ae8 x24: ffff20202b35a8c8 [67841.030779] x23: ffffa36877928208 x22: ffffa368b4972240 x21: ffff8000b979bb18 [67841.038147] x20: ffff00281dc1e3c0 x19: fffffffffffffffe x18: 0000000000000020 [67841.045515] x17: 0000000000000000 x16: ffffa368b128a530 x15: ffffffffffffffff [67841.052888] x14: ffff8000b979bc18 x13: ffffffffffffffff x12: ffff8000b979bb18 [67841.060263] x11: 0000000000000000 x10: 0000000000000000 x9 : ffffa368b1289b18 [67841.067640] x8 : 0000000000000012 x7 : 0000000000000000 x6 : 00000000000003a9 [67841.075014] x5 : 0000000000000000 x4 : ffff002818c5cb00 x3 : 0000000000000001 [67841.082388] x2 : 0000000000000000 x1 : ffff002818c5cb00 x0 : 00000000000000a0 [67841.089759] Call trace: [67841.092456] down_write+0x30/0x98 [67841.096017] start_creating.part.0+0x60/0x198 [67841.100613] debugfs_create_dir+0x48/0x1f8 [67841.104950] debugfs_create_files_v3_hw+0x88/0x348 [hisi_sas_v3_hw] [67841.111447] debugfs_snapshot_regs_v3_hw+0x708/0x798 [hisi_sas_v3_hw] [67841.118111] debugfs_trigger_dump_v3_hw_write+0x9c/0x120 [hisi_sas_v3_hw] [67841.125115] full_proxy_write+0x68/0xc8 [67841.129175] vfs_write+0xd8/0x3f0 [67841.132708] ksys_write+0x70/0x108 [67841.136317] __arm64_sys_write+0x24/0x38 [67841.140440] invoke_syscall+0x50/0x128 [67841.144385] el0_svc_common.constprop.0+0xc8/0xf0 [67841.149273] do_el0_svc+0x24/0x38 [67841.152773] el0_svc+0x38/0xd8 [67841.156009] el0t_64_sync_handler+0xc0/0xc8 [67841.160361] el0t_64_sync+0x1a4/0x1a8 [67841.164189] Code: b9000882 d2800002 d2800023 f9800011 (c85ffc05) [67841.170443] ---[ end trace 0000000000000000 ]---
To fix this issue, create all directories and files during debugfs initialization. In this way, the driver only needs to allocate memory space to save information each time the user triggers dumping.(CVE-2024-56588)
In the Linux kernel, the following vulnerability has been resolved:
kcsan: Turn report_filterlist_lock into a raw_spinlock
Ran Xiaokai reports that with a KCSAN-enabled PREEMPT_RT kernel, we can see splats like:
| BUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48 | in_atomic(): 1, irqs_disabled(): 1, non_block: 0, pid: 0, name: swapper/1 | preempt_count: 10002, expected: 0 | RCU nest depth: 0, expected: 0 | no locks held by swapper/1/0. | irq event stamp: 156674 | hardirqs last enabled at (156673): [<ffffffff81130bd9>] do_idle+0x1f9/0x240 | hardirqs last disabled at (156674): [<ffffffff82254f84>] sysvec_apic_timer_interrupt+0x14/0xc0 | softirqs last enabled at (0): [<ffffffff81099f47>] copy_process+0xfc7/0x4b60 | softirqs last disabled at (0): [<0000000000000000>] 0x0 | Preemption disabled at: | [<ffffffff814a3e2a>] paint_ptr+0x2a/0x90 | CPU: 1 UID: 0 PID: 0 Comm: swapper/1 Not tainted 6.11.0+ #3 | Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.12.0-0-ga698c8995f-prebuilt.qemu.org 04/01/2014 | Call Trace: | <IRQ> | dump_stack_lvl+0x7e/0xc0 | dump_stack+0x1d/0x30 | __might_resched+0x1a2/0x270 | rt_spin_lock+0x68/0x170 | kcsan_skip_report_debugfs+0x43/0xe0 | print_report+0xb5/0x590 | kcsan_report_known_origin+0x1b1/0x1d0 | kcsan_setup_watchpoint+0x348/0x650 | __tsan_unaligned_write1+0x16d/0x1d0 | hrtimer_interrupt+0x3d6/0x430 | __sysvec_apic_timer_interrupt+0xe8/0x3a0 | sysvec_apic_timer_interrupt+0x97/0xc0 | </IRQ>
On a detected data race, KCSAN's reporting logic checks if it should filter the report. That list is protected by the report_filterlist_lock non-raw spinlock which may sleep on RT kernels.
Since KCSAN may report data races in any context, convert it to a raw_spinlock.
This requires being careful about when to allocate memory for the filter list itself which can be done via KCSAN's debugfs interface. Concurrent modification of the filter list via debugfs should be rare: the chosen strategy is to optimistically pre-allocate memory before the critical section and discard if unused.(CVE-2024-56610)
In the Linux kernel, the following vulnerability has been resolved:
mm/mempolicy: fix migrate_to_node() assuming there is at least one VMA in a MM
We currently assume that there is at least one VMA in a MM, which isn't true.
So we might end up having find_vma() return NULL, to then de-reference NULL. So properly handle find_vma() returning NULL.
This fixes the report:
Oops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] PREEMPT SMP KASAN PTI KASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007] CPU: 1 UID: 0 PID: 6021 Comm: syz-executor284 Not tainted 6.12.0-rc7-syzkaller-00187-gf868cd251776 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 10/30/2024 RIP: 0010:migrate_to_node mm/mempolicy.c:1090 [inline] RIP: 0010:do_migrate_pages+0x403/0x6f0 mm/mempolicy.c:1194 Code: ... RSP: 0018:ffffc9000375fd08 EFLAGS: 00010246 RAX: 0000000000000000 RBX: ffffc9000375fd78 RCX: 0000000000000000 RDX: ffff88807e171300 RSI: dffffc0000000000 RDI: ffff88803390c044 RBP: ffff88807e171428 R08: 0000000000000014 R09: fffffbfff2039ef1 R10: ffffffff901cf78f R11: 0000000000000000 R12: 0000000000000003 R13: ffffc9000375fe90 R14: ffffc9000375fe98 R15: ffffc9000375fdf8 FS: 00005555919e1380(0000) GS:ffff8880b8700000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00005555919e1ca8 CR3: 000000007f12a000 CR4: 00000000003526f0 DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 Call Trace: <TASK> kernel_migrate_pages+0x5b2/0x750 mm/mempolicy.c:1709 __do_sys_migrate_pages mm/mempolicy.c:1727 [inline] __se_sys_migrate_pages mm/mempolicy.c:1723 [inline] __x64_sys_migrate_pages+0x96/0x100 mm/mempolicy.c:1723 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcd/0x250 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f
akpm@linux-foundation.org: add unlikely()
In the Linux kernel, the following vulnerability has been resolved:
scsi: qla2xxx: Fix use after free on unload
System crash is observed with stack trace warning of use after free. There are 2 signals to tell dpc_thread to terminate (UNLOADING flag and kthread_stop).
On setting the UNLOADING flag when dpc_thread happens to run at the time and sees the flag, this causes dpc_thread to exit and clean up itself. When kthread_stop is called for final cleanup, this causes use after free.
Remove UNLOADING signal to terminate dpc_thread. Use the kthread_stop as the main signal to exit dpc_thread.
[596663.812935] kernel BUG at mm/slub.c:294! [596663.812950] invalid opcode: 0000 [#1] SMP PTI [596663.812957] CPU: 13 PID: 1475935 Comm: rmmod Kdump: loaded Tainted: G IOE --------- - - 4.18.0-240.el8.x86_64 #1 [596663.812960] Hardware name: HP ProLiant DL380p Gen8, BIOS P70 08/20/2012 [596663.812974] RIP: 0010:__slab_free+0x17d/0x360
... [596663.813008] Call Trace: [596663.813022] ? __dentry_kill+0x121/0x170 [596663.813030] ? _cond_resched+0x15/0x30 [596663.813034] ? _cond_resched+0x15/0x30 [596663.813039] ? wait_for_completion+0x35/0x190 [596663.813048] ? try_to_wake_up+0x63/0x540 [596663.813055] free_task+0x5a/0x60 [596663.813061] kthread_stop+0xf3/0x100 [596663.813103] qla2x00_remove_one+0x284/0x440 qla2xxx
In the Linux kernel, the following vulnerability has been resolved:
sunrpc: clear XPRT_SOCK_UPD_TIMEOUT when reset transport
Since transport->sock has been set to NULL during reset transport, XPRT_SOCK_UPD_TIMEOUT also needs to be cleared. Otherwise, the xs_tcp_set_socket_timeouts() may be triggered in xs_tcp_send_request() to dereference the transport->sock that has been set to NULL.(CVE-2024-56688)
In the Linux kernel, the following vulnerability has been resolved:
9p/xen: fix release of IRQ
Kernel logs indicate an IRQ was double-freed.
Pass correct device ID during IRQ release.
Dominique: remove confusing variable reset to 0
In the Linux kernel, the following vulnerability has been resolved:
ionic: Fix netdev notifier unregister on failure
If register_netdev() fails, then the driver leaks the netdev notifier. Fix this by calling ionic_lif_unregister() on register_netdev() failure. This will also call ionic_lif_unregister_phc() if it has already been registered.(CVE-2024-56715)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: sh7760fb: Fix a possible memory leak in sh7760fb_alloc_mem()
When information such as info->screen_base is not ready, calling sh7760fb_free_mem() does not release memory correctly. Call dma_free_coherent() instead.(CVE-2024-56746)
In the Linux kernel, the following vulnerability has been resolved:
ocfs2: fix slab-use-after-free due to dangling pointer dqi_priv
When mounting ocfs2 and then remounting it as read-only, a slab-use-after-free occurs after the user uses a syscall to quota_getnextquota. Specifically, sb_dqinfo(sb, type)->dqi_priv is the dangling pointer.
During the remounting process, the pointer dqi_priv is freed but is never set as null leaving it to be accessed. Additionally, the read-only option for remounting sets the DQUOT_SUSPENDED flag instead of setting the DQUOT_USAGE_ENABLED flags. Moreover, later in the process of getting the next quota, the function ocfs2_get_next_id is called and only checks the quota usage flags and not the quota suspended flags.
To fix this, I set dqi_priv to null when it is freed after remounting with read-only and put a check for DQUOT_SUSPENDED in ocfs2_get_next_id.
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"kernel-debuginfo-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"kernel-tools-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"perf-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-248.0.0.150.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-248.0.0.150.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"kernel-devel-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"kernel-tools-devel-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"perf-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-248.0.0.150.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-248.0.0.150.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nksmbd: fix race condition between session lookup and expire\n\n Thread A + Thread B\n ksmbd_session_lookup | smb2_sess_setup\n sess = xa_load |\n |\n | xa_erase(\u0026amp;conn-\u0026gt;sessions, sess-\u0026gt;id);\n |\n | ksmbd_session_destroy(sess) --\u0026gt; kfree(sess)\n |\n // UAF! |\n sess-\u0026gt;last_active = jiffies |\n +\n\nThis patch add rwsem to fix race condition between ksmbd_session_lookup\nand ksmbd_expire_session.(CVE-2023-52480)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/siw: Fix connection failure handling\n\nIn case immediate MPA request processing fails, the newly\ncreated endpoint unlinks the listening endpoint and is\nready to be dropped. This special case was not handled\ncorrectly by the code handling the later TCP socket close,\ncausing a NULL dereference crash in siw_cm_work_handler()\nwhen dereferencing a NULL listener. We now also cancel\nthe useless MPA timeout, if immediate MPA request\nprocessing fails.\n\nThis patch furthermore simplifies MPA processing in general:\nScheduling a useless TCP socket read in sk_data_ready() upcall\nis now surpressed, if the socket is already moved out of\nTCP_ESTABLISHED state.(CVE-2023-52513)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nPM / devfreq: Fix buffer overflow in trans_stat_show\n\nFix buffer overflow in trans_stat_show().\n\nConvert simple snprintf to the more secure scnprintf with size of\nPAGE_SIZE.\n\nAdd condition checking if we are exceeding PAGE_SIZE and exit early from\nloop. Also add at the end a warning that we exceeded PAGE_SIZE and that\nstats is disabled.\n\nReturn -EFBIG in the case where we don\u0026apos;t have enough space to write the\nfull transition table.\n\nAlso document in the ABI that this function can return -EFBIG error.(CVE-2023-52614)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niio: adc: ad7091r: Allow users to configure device events\n\nAD7091R-5 devices are supported by the ad7091r-5 driver together with\nthe ad7091r-base driver. Those drivers declared iio events for notifying\nuser space when ADC readings fall bellow the thresholds of low limit\nregisters or above the values set in high limit registers.\nHowever, to configure iio events and their thresholds, a set of callback\nfunctions must be implemented and those were not present until now.\nThe consequence of trying to configure ad7091r-5 events without the\nproper callback functions was a null pointer dereference in the kernel\nbecause the pointers to the callback functions were not set.\n\nImplement event configuration callbacks allowing users to read/write\nevent thresholds and enable/disable event generation.\n\nSince the event spec structs are generic to AD7091R devices, also move\nthose from the ad7091r-5 driver the base driver so they can be reused\nwhen support for ad7091r-2/-4/-8 be added.(CVE-2023-52627)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/i915: Fix potential context UAFs\n\ngem_context_register() makes the context visible to userspace, and which\npoint a separate thread can trigger the I915_GEM_CONTEXT_DESTROY ioctl.\nSo we need to ensure that nothing uses the ctx ptr after this. And we\nneed to ensure that adding the ctx to the xarray is the *last* thing\nthat gem_context_register() does with the ctx pointer.\n\n[tursulin: Stable and fixes tags add/tidy.]\n(cherry picked from commit bed4b455cf5374e68879be56971c1da563bcd90c)(CVE-2023-52913)\n\nA race condition was found in the Linux kernel\u0026apos;s net/bluetooth device driver in conn_info_{min,max}_age_set() function. This can result in integrity overflow issue, possibly leading to bluetooth connection abnormality or denial of service.\n\n\n\n\n(CVE-2024-24857)\n\nA race condition was found in the Linux kernel\u0026apos;s net/bluetooth in sniff_{min,max}_interval_set() function. This can result in a bluetooth sniffing exception issue, possibly leading denial of service.\n\n\n\n\n\n\n\n(CVE-2024-24859)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxhci: handle isoc Babble and Buffer Overrun events properly\n\nxHCI 4.9 explicitly forbids assuming that the xHC has released its\nownership of a multi-TRB TD when it reports an error on one of the\nearly TRBs. Yet the driver makes such assumption and releases the TD,\nallowing the remaining TRBs to be freed or overwritten by new TDs.\n\nThe xHC should also report completion of the final TRB due to its IOC\nflag being set by us, regardless of prior errors. This event cannot\nbe recognized if the TD has already been freed earlier, resulting in\n\u0026quot;Transfer event TRB DMA ptr not part of current TD\u0026quot; error message.\n\nFix this by reusing the logic for processing isoc Transaction Errors.\nThis also handles hosts which fail to report the final completion.\n\nFix transfer length reporting on Babble errors. They may be caused by\ndevice malfunction, no guarantee that the buffer has been filled.(CVE-2024-26659)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nhwmon: (coretemp) Fix out-of-bounds memory access\n\nFix a bug that pdata-\u0026gt;cpu_map[] is set before out-of-bounds check.\nThe problem might be triggered on systems with more than 128 cores per\npackage.(CVE-2024-26664)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nft_ct: sanitize layer 3 and 4 protocol number in custom expectations\n\n- Disallow families other than NFPROTO_{IPV4,IPV6,INET}.\n- Disallow layer 4 protocol with no ports, since destination port is a\n mandatory attribute for this object.(CVE-2024-26673)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: roles: fix NULL pointer issue when put module\u0026apos;s reference\n\nIn current design, usb role class driver will get usb_role_switch parent\u0026apos;s\nmodule reference after the user get usb_role_switch device and put the\nreference after the user put the usb_role_switch device. However, the\nparent device of usb_role_switch may be removed before the user put the\nusb_role_switch. If so, then, NULL pointer issue will be met when the user\nput the parent module\u0026apos;s reference.\n\nThis will save the module pointer in structure of usb_role_switch. Then,\nwe don\u0026apos;t need to find module by iterating long relations.(CVE-2024-26747)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: cdns3: fix memory double free when handle zero packet\n\n829 if (request-\u0026gt;complete) {\n830 spin_unlock(\u0026amp;priv_dev-\u0026gt;lock);\n831 usb_gadget_giveback_request(\u0026amp;priv_ep-\u0026gt;endpoint,\n832 request);\n833 spin_lock(\u0026amp;priv_dev-\u0026gt;lock);\n834 }\n835\n836 if (request-\u0026gt;buf == priv_dev-\u0026gt;zlp_buf)\n837 cdns3_gadget_ep_free_request(\u0026amp;priv_ep-\u0026gt;endpoint, request);\n\nDriver append an additional zero packet request when queue a packet, which\nlength mod max packet size is 0. When transfer complete, run to line 831,\nusb_gadget_giveback_request() will free this requestion. 836 condition is\ntrue, so cdns3_gadget_ep_free_request() free this request again.\n\nLog:\n\n[ 1920.140696][ T150] BUG: KFENCE: use-after-free read in cdns3_gadget_giveback+0x134/0x2c0 [cdns3]\n[ 1920.140696][ T150]\n[ 1920.151837][ T150] Use-after-free read at 0x000000003d1cd10b (in kfence-#36):\n[ 1920.159082][ T150] cdns3_gadget_giveback+0x134/0x2c0 [cdns3]\n[ 1920.164988][ T150] cdns3_transfer_completed+0x438/0x5f8 [cdns3]\n\nAdd check at line 829, skip call usb_gadget_giveback_request() if it is\nadditional zero length packet request. Needn\u0026apos;t call\nusb_gadget_giveback_request() because it is allocated in this driver.(CVE-2024-26748)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: cdns3: fixed memory use after free at cdns3_gadget_ep_disable()\n\n ...\n cdns3_gadget_ep_free_request(\u0026amp;priv_ep-\u0026gt;endpoint, \u0026amp;priv_req-\u0026gt;request);\n list_del_init(\u0026amp;priv_req-\u0026gt;list);\n ...\n\n\u0026apos;priv_req\u0026apos; actually free at cdns3_gadget_ep_free_request(). But\nlist_del_init() use priv_req-\u0026gt;list after it.\n\n[ 1542.642868][ T534] BUG: KFENCE: use-after-free read in __list_del_entry_valid+0x10/0xd4\n[ 1542.642868][ T534]\n[ 1542.653162][ T534] Use-after-free read at 0x000000009ed0ba99 (in kfence-#3):\n[ 1542.660311][ T534] __list_del_entry_valid+0x10/0xd4\n[ 1542.665375][ T534] cdns3_gadget_ep_disable+0x1f8/0x388 [cdns3]\n[ 1542.671571][ T534] usb_ep_disable+0x44/0xe4\n[ 1542.675948][ T534] ffs_func_eps_disable+0x64/0xc8\n[ 1542.680839][ T534] ffs_func_set_alt+0x74/0x368\n[ 1542.685478][ T534] ffs_func_disable+0x18/0x28\n\nMove list_del_init() before cdns3_gadget_ep_free_request() to resolve this\nproblem.(CVE-2024-26749)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncrypto: virtio/akcipher - Fix stack overflow on memcpy\n\nsizeof(struct virtio_crypto_akcipher_session_para) is less than\nsizeof(struct virtio_crypto_op_ctrl_req::u), copying more bytes from\nstack variable leads stack overflow. Clang reports this issue by\ncommands:\nmake -j CC=clang-14 mrproper \u0026gt;/dev/null 2\u0026gt;\u0026amp;1\nmake -j O=/tmp/crypto-build CC=clang-14 allmodconfig \u0026gt;/dev/null 2\u0026gt;\u0026amp;1\nmake -j O=/tmp/crypto-build W=1 CC=clang-14 drivers/crypto/virtio/\n virtio_crypto_akcipher_algs.o(CVE-2024-26753)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmptcp: fix possible deadlock in subflow diag\n\nSyzbot and Eric reported a lockdep splat in the subflow diag:\n\n WARNING: possible circular locking dependency detected\n 6.8.0-rc4-syzkaller-00212-g40b9385dd8e6 #0 Not tainted\n\n syz-executor.2/24141 is trying to acquire lock:\n ffff888045870130 (k-sk_lock-AF_INET6){+.+.}-{0:0}, at:\n tcp_diag_put_ulp net/ipv4/tcp_diag.c:100 [inline]\n ffff888045870130 (k-sk_lock-AF_INET6){+.+.}-{0:0}, at:\n tcp_diag_get_aux+0x738/0x830 net/ipv4/tcp_diag.c:137\n\n but task is already holding lock:\n ffffc9000135e488 (\u0026amp;h-\u0026gt;lhash2[i].lock){+.+.}-{2:2}, at: spin_lock\n include/linux/spinlock.h:351 [inline]\n ffffc9000135e488 (\u0026amp;h-\u0026gt;lhash2[i].lock){+.+.}-{2:2}, at:\n inet_diag_dump_icsk+0x39f/0x1f80 net/ipv4/inet_diag.c:1038\n\n which lock already depends on the new lock.\n\n the existing dependency chain (in reverse order) is:\n\n -\u0026gt; #1 (\u0026amp;h-\u0026gt;lhash2[i].lock){+.+.}-{2:2}:\n lock_acquire+0x1e3/0x530 kernel/locking/lockdep.c:5754\n __raw_spin_lock include/linux/spinlock_api_smp.h:133 [inline]\n _raw_spin_lock+0x2e/0x40 kernel/locking/spinlock.c:154\n spin_lock include/linux/spinlock.h:351 [inline]\n __inet_hash+0x335/0xbe0 net/ipv4/inet_hashtables.c:743\n inet_csk_listen_start+0x23a/0x320 net/ipv4/inet_connection_sock.c:1261\n __inet_listen_sk+0x2a2/0x770 net/ipv4/af_inet.c:217\n inet_listen+0xa3/0x110 net/ipv4/af_inet.c:239\n rds_tcp_listen_init+0x3fd/0x5a0 net/rds/tcp_listen.c:316\n rds_tcp_init_net+0x141/0x320 net/rds/tcp.c:577\n ops_init+0x352/0x610 net/core/net_namespace.c:136\n __register_pernet_operations net/core/net_namespace.c:1214 [inline]\n register_pernet_operations+0x2cb/0x660 net/core/net_namespace.c:1283\n register_pernet_device+0x33/0x80 net/core/net_namespace.c:1370\n rds_tcp_init+0x62/0xd0 net/rds/tcp.c:735\n do_one_initcall+0x238/0x830 init/main.c:1236\n do_initcall_level+0x157/0x210 init/main.c:1298\n do_initcalls+0x3f/0x80 init/main.c:1314\n kernel_init_freeable+0x42f/0x5d0 init/main.c:1551\n kernel_init+0x1d/0x2a0 init/main.c:1441\n ret_from_fork+0x4b/0x80 arch/x86/kernel/process.c:147\n ret_from_fork_asm+0x1b/0x30 arch/x86/entry/entry_64.S:242\n\n -\u0026gt; #0 (k-sk_lock-AF_INET6){+.+.}-{0:0}:\n check_prev_add kernel/locking/lockdep.c:3134 [inline]\n check_prevs_add kernel/locking/lockdep.c:3253 [inline]\n validate_chain+0x18ca/0x58e0 kernel/locking/lockdep.c:3869\n __lock_acquire+0x1345/0x1fd0 kernel/locking/lockdep.c:5137\n lock_acquire+0x1e3/0x530 kernel/locking/lockdep.c:5754\n lock_sock_fast include/net/sock.h:1723 [inline]\n subflow_get_info+0x166/0xd20 net/mptcp/diag.c:28\n tcp_diag_put_ulp net/ipv4/tcp_diag.c:100 [inline]\n tcp_diag_get_aux+0x738/0x830 net/ipv4/tcp_diag.c:137\n inet_sk_diag_fill+0x10ed/0x1e00 net/ipv4/inet_diag.c:345\n inet_diag_dump_icsk+0x55b/0x1f80 net/ipv4/inet_diag.c:1061\n __inet_diag_dump+0x211/0x3a0 net/ipv4/inet_diag.c:1263\n inet_diag_dump_compat+0x1c1/0x2d0 net/ipv4/inet_diag.c:1371\n netlink_dump+0x59b/0xc80 net/netlink/af_netlink.c:2264\n __netlink_dump_start+0x5df/0x790 net/netlink/af_netlink.c:2370\n netlink_dump_start include/linux/netlink.h:338 [inline]\n inet_diag_rcv_msg_compat+0x209/0x4c0 net/ipv4/inet_diag.c:1405\n sock_diag_rcv_msg+0xe7/0x410\n netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543\n sock_diag_rcv+0x2a/0x40 net/core/sock_diag.c:280\n netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline]\n netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367\n netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x221/0x270 net/socket.c:745\n ____sys_sendmsg+0x525/0x7d0 net/socket.c:2584\n ___sys_sendmsg net/socket.c:2638 [inline]\n __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667\n do_syscall_64+0xf9/0x240\n entry_SYSCALL_64_after_hwframe+0x6f/0x77\n\nAs noted by Eric we can break the lock dependency chain avoid\ndumping \n---truncated---(CVE-2024-26781)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndmaengine: fsl-qdma: fix SoC may hang on 16 byte unaligned read\n\nThere is chip (ls1028a) errata:\n\nThe SoC may hang on 16 byte unaligned read transactions by QDMA.\n\nUnaligned read transactions initiated by QDMA may stall in the NOC\n(Network On-Chip), causing a deadlock condition. Stalled transactions will\ntrigger completion timeouts in PCIe controller.\n\nWorkaround:\nEnable prefetch by setting the source descriptor prefetchable bit\n( SD[PF] = 1 ).\n\nImplement this workaround.(CVE-2024-26790)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ngtp: fix use-after-free and null-ptr-deref in gtp_newlink()\n\nThe gtp_link_ops operations structure for the subsystem must be\nregistered after registering the gtp_net_ops pernet operations structure.\n\nSyzkaller hit \u0026apos;general protection fault in gtp_genl_dump_pdp\u0026apos; bug:\n\n[ 1010.702740] gtp: GTP module unloaded\n[ 1010.715877] general protection fault, probably for non-canonical address 0xdffffc0000000001: 0000 [#1] SMP KASAN NOPTI\n[ 1010.715888] KASAN: null-ptr-deref in range [0x0000000000000008-0x000000000000000f]\n[ 1010.715895] CPU: 1 PID: 128616 Comm: a.out Not tainted 6.8.0-rc6-std-def-alt1 #1\n[ 1010.715899] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.0-alt1 04/01/2014\n[ 1010.715908] RIP: 0010:gtp_newlink+0x4d7/0x9c0 [gtp]\n[ 1010.715915] Code: 80 3c 02 00 0f 85 41 04 00 00 48 8b bb d8 05 00 00 e8 ed f6 ff ff 48 89 c2 48 89 c5 48 b8 00 00 00 00 00 fc ff df 48 c1 ea 03 \u0026lt;80\u0026gt; 3c 02 00 0f 85 4f 04 00 00 4c 89 e2 4c 8b 6d 00 48 b8 00 00 00\n[ 1010.715920] RSP: 0018:ffff888020fbf180 EFLAGS: 00010203\n[ 1010.715929] RAX: dffffc0000000000 RBX: ffff88800399c000 RCX: 0000000000000000\n[ 1010.715933] RDX: 0000000000000001 RSI: ffffffff84805280 RDI: 0000000000000282\n[ 1010.715938] RBP: 000000000000000d R08: 0000000000000001 R09: 0000000000000000\n[ 1010.715942] R10: 0000000000000001 R11: 0000000000000001 R12: ffff88800399cc80\n[ 1010.715947] R13: 0000000000000000 R14: 0000000000000000 R15: 0000000000000400\n[ 1010.715953] FS: 00007fd1509ab5c0(0000) GS:ffff88805b300000(0000) knlGS:0000000000000000\n[ 1010.715958] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 1010.715962] CR2: 0000000000000000 CR3: 000000001c07a000 CR4: 0000000000750ee0\n[ 1010.715968] PKRU: 55555554\n[ 1010.715972] Call Trace:\n[ 1010.715985] ? __die_body.cold+0x1a/0x1f\n[ 1010.715995] ? die_addr+0x43/0x70\n[ 1010.716002] ? exc_general_protection+0x199/0x2f0\n[ 1010.716016] ? asm_exc_general_protection+0x1e/0x30\n[ 1010.716026] ? gtp_newlink+0x4d7/0x9c0 [gtp]\n[ 1010.716034] ? gtp_net_exit+0x150/0x150 [gtp]\n[ 1010.716042] __rtnl_newlink+0x1063/0x1700\n[ 1010.716051] ? rtnl_setlink+0x3c0/0x3c0\n[ 1010.716063] ? is_bpf_text_address+0xc0/0x1f0\n[ 1010.716070] ? kernel_text_address.part.0+0xbb/0xd0\n[ 1010.716076] ? __kernel_text_address+0x56/0xa0\n[ 1010.716084] ? unwind_get_return_address+0x5a/0xa0\n[ 1010.716091] ? create_prof_cpu_mask+0x30/0x30\n[ 1010.716098] ? arch_stack_walk+0x9e/0xf0\n[ 1010.716106] ? stack_trace_save+0x91/0xd0\n[ 1010.716113] ? stack_trace_consume_entry+0x170/0x170\n[ 1010.716121] ? __lock_acquire+0x15c5/0x5380\n[ 1010.716139] ? mark_held_locks+0x9e/0xe0\n[ 1010.716148] ? kmem_cache_alloc_trace+0x35f/0x3c0\n[ 1010.716155] ? __rtnl_newlink+0x1700/0x1700\n[ 1010.716160] rtnl_newlink+0x69/0xa0\n[ 1010.716166] rtnetlink_rcv_msg+0x43b/0xc50\n[ 1010.716172] ? rtnl_fdb_dump+0x9f0/0x9f0\n[ 1010.716179] ? lock_acquire+0x1fe/0x560\n[ 1010.716188] ? netlink_deliver_tap+0x12f/0xd50\n[ 1010.716196] netlink_rcv_skb+0x14d/0x440\n[ 1010.716202] ? rtnl_fdb_dump+0x9f0/0x9f0\n[ 1010.716208] ? netlink_ack+0xab0/0xab0\n[ 1010.716213] ? netlink_deliver_tap+0x202/0xd50\n[ 1010.716220] ? netlink_deliver_tap+0x218/0xd50\n[ 1010.716226] ? __virt_addr_valid+0x30b/0x590\n[ 1010.716233] netlink_unicast+0x54b/0x800\n[ 1010.716240] ? netlink_attachskb+0x870/0x870\n[ 1010.716248] ? __check_object_size+0x2de/0x3b0\n[ 1010.716254] netlink_sendmsg+0x938/0xe40\n[ 1010.716261] ? netlink_unicast+0x800/0x800\n[ 1010.716269] ? __import_iovec+0x292/0x510\n[ 1010.716276] ? netlink_unicast+0x800/0x800\n[ 1010.716284] __sock_sendmsg+0x159/0x190\n[ 1010.716290] ____sys_sendmsg+0x712/0x880\n[ 1010.716297] ? sock_write_iter+0x3d0/0x3d0\n[ 1010.716304] ? __ia32_sys_recvmmsg+0x270/0x270\n[ 1010.716309] ? lock_acquire+0x1fe/0x560\n[ 1010.716315] ? drain_array_locked+0x90/0x90\n[ 1010.716324] ___sys_sendmsg+0xf8/0x170\n[ 1010.716331] ? sendmsg_copy_msghdr+0x170/0x170\n[ 1010.716337] ? lockdep_init_map\n---truncated---(CVE-2024-26793)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nksmbd: fix potencial out-of-bounds when buffer offset is invalid\n\nI found potencial out-of-bounds when buffer offset fields of a few requests\nis invalid. This patch set the minimum value of buffer offset field to\n-\u0026gt;Buffer offset to validate buffer length.(CVE-2024-26952)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nclk: Get runtime PM before walking tree during disable_unused\n\nDoug reported [1] the following hung task:\n\n INFO: task swapper/0:1 blocked for more than 122 seconds.\n Not tainted 5.15.149-21875-gf795ebc40eb8 #1\n \u0026quot;echo 0 \u0026gt; /proc/sys/kernel/hung_task_timeout_secs\u0026quot; disables this message.\n task:swapper/0 state:D stack: 0 pid: 1 ppid: 0 flags:0x00000008\n Call trace:\n __switch_to+0xf4/0x1f4\n __schedule+0x418/0xb80\n schedule+0x5c/0x10c\n rpm_resume+0xe0/0x52c\n rpm_resume+0x178/0x52c\n __pm_runtime_resume+0x58/0x98\n clk_pm_runtime_get+0x30/0xb0\n clk_disable_unused_subtree+0x58/0x208\n clk_disable_unused_subtree+0x38/0x208\n clk_disable_unused_subtree+0x38/0x208\n clk_disable_unused_subtree+0x38/0x208\n clk_disable_unused_subtree+0x38/0x208\n clk_disable_unused+0x4c/0xe4\n do_one_initcall+0xcc/0x2d8\n do_initcall_level+0xa4/0x148\n do_initcalls+0x5c/0x9c\n do_basic_setup+0x24/0x30\n kernel_init_freeable+0xec/0x164\n kernel_init+0x28/0x120\n ret_from_fork+0x10/0x20\n INFO: task kworker/u16:0:9 blocked for more than 122 seconds.\n Not tainted 5.15.149-21875-gf795ebc40eb8 #1\n \u0026quot;echo 0 \u0026gt; /proc/sys/kernel/hung_task_timeout_secs\u0026quot; disables this message.\n task:kworker/u16:0 state:D stack: 0 pid: 9 ppid: 2 flags:0x00000008\n Workqueue: events_unbound deferred_probe_work_func\n Call trace:\n __switch_to+0xf4/0x1f4\n __schedule+0x418/0xb80\n schedule+0x5c/0x10c\n schedule_preempt_disabled+0x2c/0x48\n __mutex_lock+0x238/0x488\n __mutex_lock_slowpath+0x1c/0x28\n mutex_lock+0x50/0x74\n clk_prepare_lock+0x7c/0x9c\n clk_core_prepare_lock+0x20/0x44\n clk_prepare+0x24/0x30\n clk_bulk_prepare+0x40/0xb0\n mdss_runtime_resume+0x54/0x1c8\n pm_generic_runtime_resume+0x30/0x44\n __genpd_runtime_resume+0x68/0x7c\n genpd_runtime_resume+0x108/0x1f4\n __rpm_callback+0x84/0x144\n rpm_callback+0x30/0x88\n rpm_resume+0x1f4/0x52c\n rpm_resume+0x178/0x52c\n __pm_runtime_resume+0x58/0x98\n __device_attach+0xe0/0x170\n device_initial_probe+0x1c/0x28\n bus_probe_device+0x3c/0x9c\n device_add+0x644/0x814\n mipi_dsi_device_register_full+0xe4/0x170\n devm_mipi_dsi_device_register_full+0x28/0x70\n ti_sn_bridge_probe+0x1dc/0x2c0\n auxiliary_bus_probe+0x4c/0x94\n really_probe+0xcc/0x2c8\n __driver_probe_device+0xa8/0x130\n driver_probe_device+0x48/0x110\n __device_attach_driver+0xa4/0xcc\n bus_for_each_drv+0x8c/0xd8\n __device_attach+0xf8/0x170\n device_initial_probe+0x1c/0x28\n bus_probe_device+0x3c/0x9c\n deferred_probe_work_func+0x9c/0xd8\n process_one_work+0x148/0x518\n worker_thread+0x138/0x350\n kthread+0x138/0x1e0\n ret_from_fork+0x10/0x20\n\nThe first thread is walking the clk tree and calling\nclk_pm_runtime_get() to power on devices required to read the clk\nhardware via struct clk_ops::is_enabled(). This thread holds the clk\nprepare_lock, and is trying to runtime PM resume a device, when it finds\nthat the device is in the process of resuming so the thread schedule()s\naway waiting for the device to finish resuming before continuing. The\nsecond thread is runtime PM resuming the same device, but the runtime\nresume callback is calling clk_prepare(), trying to grab the\nprepare_lock waiting on the first thread.\n\nThis is a classic ABBA deadlock. To properly fix the deadlock, we must\nnever runtime PM resume or suspend a device with the clk prepare_lock\nheld. Actually doing that is near impossible today because the global\nprepare_lock would have to be dropped in the middle of the tree, the\ndevice runtime PM resumed/suspended, and then the prepare_lock grabbed\nagain to ensure consistency of the clk tree topology. If anything\nchanges with the clk tree in the meantime, we\u0026apos;ve lost and will need to\nstart the operation all over again.\n\nLuckily, most of the time we\u0026apos;re simply incrementing or decrementing the\nruntime PM count on an active device, so we don\u0026apos;t have the chance to\nschedule away with the prepare_lock held. Let\u0026apos;s fix this immediate\nproblem that can be\n---truncated---(CVE-2024-27004)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfpga: bridge: add owner module and take its refcount\n\nThe current implementation of the fpga bridge assumes that the low-level\nmodule registers a driver for the parent device and uses its owner pointer\nto take the module\u0026apos;s refcount. This approach is problematic since it can\nlead to a null pointer dereference while attempting to get the bridge if\nthe parent device does not have a driver.\n\nTo address this problem, add a module owner pointer to the fpga_bridge\nstruct and use it to take the module\u0026apos;s refcount. Modify the function for\nregistering a bridge to take an additional owner module parameter and\nrename it to avoid conflicts. Use the old function name for a helper macro\nthat automatically sets the module that registers the bridge as the owner.\nThis ensures compatibility with existing low-level control modules and\nreduces the chances of registering a bridge without setting the owner.\n\nAlso, update the documentation to keep it consistent with the new interface\nfor registering an fpga bridge.\n\nOther changes: opportunistically move put_device() from __fpga_bridge_get()\nto fpga_bridge_get() and of_fpga_bridge_get() to improve code clarity since\nthe bridge device is taken in these functions.(CVE-2024-36479)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: relax socket state check at accept time.\n\nChristoph reported the following splat:\n\nWARNING: CPU: 1 PID: 772 at net/ipv4/af_inet.c:761 __inet_accept+0x1f4/0x4a0\nModules linked in:\nCPU: 1 PID: 772 Comm: syz-executor510 Not tainted 6.9.0-rc7-g7da7119fe22b #56\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.11.0-2.el7 04/01/2014\nRIP: 0010:__inet_accept+0x1f4/0x4a0 net/ipv4/af_inet.c:759\nCode: 04 38 84 c0 0f 85 87 00 00 00 41 c7 04 24 03 00 00 00 48 83 c4 10 5b 41 5c 41 5d 41 5e 41 5f 5d c3 cc cc cc cc e8 ec b7 da fd \u0026lt;0f\u0026gt; 0b e9 7f fe ff ff e8 e0 b7 da fd 0f 0b e9 fe fe ff ff 89 d9 80\nRSP: 0018:ffffc90000c2fc58 EFLAGS: 00010293\nRAX: ffffffff836bdd14 RBX: 0000000000000000 RCX: ffff888104668000\nRDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000000\nRBP: dffffc0000000000 R08: ffffffff836bdb89 R09: fffff52000185f64\nR10: dffffc0000000000 R11: fffff52000185f64 R12: dffffc0000000000\nR13: 1ffff92000185f98 R14: ffff88810754d880 R15: ffff8881007b7800\nFS: 000000001c772880(0000) GS:ffff88811b280000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00007fb9fcf2e178 CR3: 00000001045d2002 CR4: 0000000000770ef0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nPKRU: 55555554\nCall Trace:\n \u0026lt;TASK\u0026gt;\n inet_accept+0x138/0x1d0 net/ipv4/af_inet.c:786\n do_accept+0x435/0x620 net/socket.c:1929\n __sys_accept4_file net/socket.c:1969 [inline]\n __sys_accept4+0x9b/0x110 net/socket.c:1999\n __do_sys_accept net/socket.c:2016 [inline]\n __se_sys_accept net/socket.c:2013 [inline]\n __x64_sys_accept+0x7d/0x90 net/socket.c:2013\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0x58/0x100 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x76/0x7e\nRIP: 0033:0x4315f9\nCode: fd ff 48 81 c4 80 00 00 00 e9 f1 fe ff ff 0f 1f 00 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 0f 83 ab b4 fd ff c3 66 2e 0f 1f 84 00 00 00 00\nRSP: 002b:00007ffdb26d9c78 EFLAGS: 00000246 ORIG_RAX: 000000000000002b\nRAX: ffffffffffffffda RBX: 0000000000400300 RCX: 00000000004315f9\nRDX: 0000000000000000 RSI: 0000000000000000 RDI: 0000000000000004\nRBP: 00000000006e1018 R08: 0000000000400300 R09: 0000000000400300\nR10: 0000000000400300 R11: 0000000000000246 R12: 0000000000000000\nR13: 000000000040cdf0 R14: 000000000040ce80 R15: 0000000000000055\n \u0026lt;/TASK\u0026gt;\n\nThe reproducer invokes shutdown() before entering the listener status.\nAfter commit 94062790aedb (\u0026quot;tcp: defer shutdown(SEND_SHUTDOWN) for\nTCP_SYN_RECV sockets\u0026quot;), the above causes the child to reach the accept\nsyscall in FIN_WAIT1 status.\n\nEric noted we can relax the existing assertion in __inet_accept()(CVE-2024-36484)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfpga: manager: add owner module and take its refcount\n\nThe current implementation of the fpga manager assumes that the low-level\nmodule registers a driver for the parent device and uses its owner pointer\nto take the module\u0026apos;s refcount. This approach is problematic since it can\nlead to a null pointer dereference while attempting to get the manager if\nthe parent device does not have a driver.\n\nTo address this problem, add a module owner pointer to the fpga_manager\nstruct and use it to take the module\u0026apos;s refcount. Modify the functions for\nregistering the manager to take an additional owner module parameter and\nrename them to avoid conflicts. Use the old function names for helper\nmacros that automatically set the module that registers the manager as the\nowner. This ensures compatibility with existing low-level control modules\nand reduces the chances of registering a manager without setting the owner.\n\nAlso, update the documentation to keep it consistent with the new interface\nfor registering an fpga manager.\n\nOther changes: opportunistically move put_device() from __fpga_mgr_get() to\nfpga_mgr_get() and of_fpga_mgr_get() to improve code clarity since the\nmanager device is taken in these functions.(CVE-2024-37021)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ni2c: lpi2c: Avoid calling clk_get_rate during transfer\n\nInstead of repeatedly calling clk_get_rate for each transfer, lock\nthe clock rate and cache the value.\nA deadlock has been observed while adding tlv320aic32x4 audio codec to\nthe system. When this clock provider adds its clock, the clk mutex is\nlocked already, it needs to access i2c, which in return needs the mutex\nfor clk_get_rate as well.(CVE-2024-40965)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\narm64: probes: Fix uprobes for big-endian kernels\n\nThe arm64 uprobes code is broken for big-endian kernels as it doesn\u0026apos;t\nconvert the in-memory instruction encoding (which is always\nlittle-endian) into the kernel\u0026apos;s native endianness before analyzing and\nsimulating instructions. This may result in a few distinct problems:\n\n* The kernel may may erroneously reject probing an instruction which can\n safely be probed.\n\n* The kernel may erroneously erroneously permit stepping an\n instruction out-of-line when that instruction cannot be stepped\n out-of-line safely.\n\n* The kernel may erroneously simulate instruction incorrectly dur to\n interpretting the byte-swapped encoding.\n\nThe endianness mismatch isn\u0026apos;t caught by the compiler or sparse because:\n\n* The arch_uprobe::{insn,ixol} fields are encoded as arrays of u8, so\n the compiler and sparse have no idea these contain a little-endian\n 32-bit value. The core uprobes code populates these with a memcpy()\n which similarly does not handle endianness.\n\n* While the uprobe_opcode_t type is an alias for __le32, both\n arch_uprobe_analyze_insn() and arch_uprobe_skip_sstep() cast from u8[]\n to the similarly-named probe_opcode_t, which is an alias for u32.\n Hence there is no endianness conversion warning.\n\nFix this by changing the arch_uprobe::{insn,ixol} fields to __le32 and\nadding the appropriate __le32_to_cpu() conversions prior to consuming\nthe instruction encoding. The core uprobes copies these fields as opaque\nranges of bytes, and so is unaffected by this change.\n\nAt the same time, remove MAX_UINSN_BYTES and consistently use\nAARCH64_INSN_SIZE for clarity.\n\nTested with the following:\n\n| #include \u0026lt;stdio.h\u0026gt;\n| #include \u0026lt;stdbool.h\u0026gt;\n|\n| #define noinline __attribute__((noinline))\n|\n| static noinline void *adrp_self(void)\n| {\n| void *addr;\n|\n| asm volatile(\n| \u0026quot; adrp %x0, adrp_self\\n\u0026quot;\n| \u0026quot; add %x0, %x0, :lo12:adrp_self\\n\u0026quot;\n| : \u0026quot;=r\u0026quot; (addr));\n| }\n|\n|\n| int main(int argc, char *argv)\n| {\n| void *ptr = adrp_self();\n| bool equal = (ptr == adrp_self);\n|\n| printf(\u0026quot;adrp_self =\u0026gt; %p\\n\u0026quot;\n| \u0026quot;adrp_self() =\u0026gt; %p\\n\u0026quot;\n| \u0026quot;%s\\n\u0026quot;,\n| adrp_self, ptr, equal ? \u0026quot;EQUAL\u0026quot; : \u0026quot;NOT EQUAL\u0026quot;);\n|\n| return 0;\n| }\n\n.... where the adrp_self() function was compiled to:\n\n| 00000000004007e0 \u0026lt;adrp_self\u0026gt;:\n| 4007e0: 90000000 adrp x0, 400000 \u0026lt;__ehdr_start\u0026gt;\n| 4007e4: 911f8000 add x0, x0, #0x7e0\n| 4007e8: d65f03c0 ret\n\nBefore this patch, the ADRP is not recognized, and is assumed to be\nsteppable, resulting in corruption of the result:\n\n| # ./adrp-self\n| adrp_self =\u0026gt; 0x4007e0\n| adrp_self() =\u0026gt; 0x4007e0\n| EQUAL\n| # echo \u0026apos;p /root/adrp-self:0x007e0\u0026apos; \u0026gt; /sys/kernel/tracing/uprobe_events\n| # echo 1 \u0026gt; /sys/kernel/tracing/events/uprobes/enable\n| # ./adrp-self\n| adrp_self =\u0026gt; 0x4007e0\n| adrp_self() =\u0026gt; 0xffffffffff7e0\n| NOT EQUAL\n\nAfter this patch, the ADRP is correctly recognized and simulated:\n\n| # ./adrp-self\n| adrp_self =\u0026gt; 0x4007e0\n| adrp_self() =\u0026gt; 0x4007e0\n| EQUAL\n| #\n| # echo \u0026apos;p /root/adrp-self:0x007e0\u0026apos; \u0026gt; /sys/kernel/tracing/uprobe_events\n| # echo 1 \u0026gt; /sys/kernel/tracing/events/uprobes/enable\n| # ./adrp-self\n| adrp_self =\u0026gt; 0x4007e0\n| adrp_self() =\u0026gt; 0x4007e0\n| EQUAL(CVE-2024-50194)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndm cache: fix flushing uninitialized delayed_work on cache_ctr error\n\nAn unexpected WARN_ON from flush_work() may occur when cache creation\nfails, caused by destroying the uninitialized delayed_work waker in the\nerror path of cache_create(). For example, the warning appears on the\nsuperblock checksum error.\n\nReproduce steps:\n\ndmsetup create cmeta --table \u0026quot;0 8192 linear /dev/sdc 0\u0026quot;\ndmsetup create cdata --table \u0026quot;0 65536 linear /dev/sdc 8192\u0026quot;\ndmsetup create corig --table \u0026quot;0 524288 linear /dev/sdc 262144\u0026quot;\ndd if=/dev/urandom of=/dev/mapper/cmeta bs=4k count=1 oflag=direct\ndmsetup create cache --table \u0026quot;0 524288 cache /dev/mapper/cmeta \\\n/dev/mapper/cdata /dev/mapper/corig 128 2 metadata2 writethrough smq 0\u0026quot;\n\nKernel logs:\n\n(snip)\nWARNING: CPU: 0 PID: 84 at kernel/workqueue.c:4178 __flush_work+0x5d4/0x890\n\nFix by pulling out the cancel_delayed_work_sync() from the constructor\u0026apos;s\nerror path. This patch doesn\u0026apos;t affect the use-after-free fix for\nconcurrent dm_resume and dm_destroy (commit 6a459d8edbdb (\u0026quot;dm cache: Fix\nUAF in destroy()\u0026quot;)) as cache_dtr is not changed.(CVE-2024-50280)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnilfs2: fix null-ptr-deref in block_touch_buffer tracepoint\n\nPatch series \u0026quot;nilfs2: fix null-ptr-deref bugs on block tracepoints\u0026quot;.\n\nThis series fixes null pointer dereference bugs that occur when using\nnilfs2 and two block-related tracepoints.\n\n\nThis patch (of 2):\n\nIt has been reported that when using \u0026quot;block:block_touch_buffer\u0026quot;\ntracepoint, touch_buffer() called from __nilfs_get_folio_block() causes a\nNULL pointer dereference, or a general protection fault when KASAN is\nenabled.\n\nThis happens because since the tracepoint was added in touch_buffer(), it\nreferences the dev_t member bh-\u0026gt;b_bdev-\u0026gt;bd_dev regardless of whether the\nbuffer head has a pointer to a block_device structure. In the current\nimplementation, the block_device structure is set after the function\nreturns to the caller.\n\nHere, touch_buffer() is used to mark the folio/page that owns the buffer\nhead as accessed, but the common search helper for folio/page used by the\ncaller function was optimized to mark the folio/page as accessed when it\nwas reimplemented a long time ago, eliminating the need to call\ntouch_buffer() here in the first place.\n\nSo this solves the issue by eliminating the touch_buffer() call itself.(CVE-2024-53131)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\num: net: Do not use drvdata in release\n\nThe drvdata is not available in release. Let\u0026apos;s just use container_of()\nto get the uml_net instance. Otherwise, removing a network device will\nresult in a crash:\n\nRIP: 0033:net_device_release+0x10/0x6f\nRSP: 00000000e20c7c40 EFLAGS: 00010206\nRAX: 000000006002e4e7 RBX: 00000000600f1baf RCX: 00000000624074e0\nRDX: 0000000062778000 RSI: 0000000060551c80 RDI: 00000000627af028\nRBP: 00000000e20c7c50 R08: 00000000603ad594 R09: 00000000e20c7b70\nR10: 000000000000135a R11: 00000000603ad422 R12: 0000000000000000\nR13: 0000000062c7af00 R14: 0000000062406d60 R15: 00000000627700b6\nKernel panic - not syncing: Segfault with no mm\nCPU: 0 UID: 0 PID: 29 Comm: kworker/0:2 Not tainted 6.12.0-rc6-g59b723cd2adb #1\nWorkqueue: events mc_work_proc\nStack:\n 627af028 62c7af00 e20c7c80 60276fcd\n 62778000 603f5820 627af028 00000000\n e20c7cb0 603a2bcd 627af000 62770010\nCall Trace:\n [\u0026lt;60276fcd\u0026gt;] device_release+0x70/0xba\n [\u0026lt;603a2bcd\u0026gt;] kobject_put+0xba/0xe7\n [\u0026lt;60277265\u0026gt;] put_device+0x19/0x1c\n [\u0026lt;60281266\u0026gt;] platform_device_put+0x26/0x29\n [\u0026lt;60281e5f\u0026gt;] platform_device_unregister+0x2c/0x2e\n [\u0026lt;6002ec9c\u0026gt;] net_remove+0x63/0x69\n [\u0026lt;60031316\u0026gt;] ? mconsole_reply+0x0/0x50\n [\u0026lt;600310c8\u0026gt;] mconsole_remove+0x160/0x1cc\n [\u0026lt;60087d40\u0026gt;] ? __remove_hrtimer+0x38/0x74\n [\u0026lt;60087ff8\u0026gt;] ? hrtimer_try_to_cancel+0x8c/0x98\n [\u0026lt;6006b3cf\u0026gt;] ? dl_server_stop+0x3f/0x48\n [\u0026lt;6006b390\u0026gt;] ? dl_server_stop+0x0/0x48\n [\u0026lt;600672e8\u0026gt;] ? dequeue_entities+0x327/0x390\n [\u0026lt;60038fa6\u0026gt;] ? um_set_signals+0x0/0x43\n [\u0026lt;6003070c\u0026gt;] mc_work_proc+0x77/0x91\n [\u0026lt;60057664\u0026gt;] process_scheduled_works+0x1b3/0x2dd\n [\u0026lt;60055f32\u0026gt;] ? assign_work+0x0/0x58\n [\u0026lt;60057f0a\u0026gt;] worker_thread+0x1e9/0x293\n [\u0026lt;6005406f\u0026gt;] ? set_pf_worker+0x0/0x64\n [\u0026lt;6005d65d\u0026gt;] ? arch_local_irq_save+0x0/0x2d\n [\u0026lt;6005d748\u0026gt;] ? kthread_exit+0x0/0x3a\n [\u0026lt;60057d21\u0026gt;] ? worker_thread+0x0/0x293\n [\u0026lt;6005dbf1\u0026gt;] kthread+0x126/0x12b\n [\u0026lt;600219c5\u0026gt;] new_thread_handler+0x85/0xb6(CVE-2024-53183)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxen: Fix the issue of resource not being properly released in xenbus_dev_probe()\n\nThis patch fixes an issue in the function xenbus_dev_probe(). In the\nxenbus_dev_probe() function, within the if (err) branch at line 313, the\nprogram incorrectly returns err directly without releasing the resources\nallocated by err = drv-\u0026gt;probe(dev, id). As the return value is non-zero,\nthe upper layers assume the processing logic has failed. However, the probe\noperation was performed earlier without a corresponding remove operation.\nSince the probe actually allocates resources, failing to perform the remove\noperation could lead to problems.\n\nTo fix this issue, we followed the resource release logic of the\nxenbus_dev_remove() function by adding a new block fail_remove before the\nfail_put block. After entering the branch if (err) at line 313, the\nfunction will use a goto statement to jump to the fail_remove block,\nensuring that the previously acquired resources are correctly released,\nthus preventing the reference count leak.\n\nThis bug was identified by an experimental static analysis tool developed\nby our team. The tool specializes in analyzing reference count operations\nand detecting potential issues where resources are not properly managed.\nIn this case, the tool flagged the missing release operation as a\npotential problem, which led to the development of this patch.(CVE-2024-53198)\n\nIn the Linux kernel, the following vulnerability has been resolved:drm/amd/display: Fix null check for pipe_ctx-\u0026gt;plane_state in dcn20_program_pipeThis commit addresses a null pointer dereference issue indcn20_program_pipe(). Previously, commit 8e4ed3cf1642 ( drm/amd/display:Add null check for pipe_ctx-\u0026gt;plane_state in dcn20_program_pipe )partially fixed the null pointer dereference issue. However, indcn20_update_dchubp_dpp(), the variable pipe_ctx is passed in, andplane_state is accessed again through pipe_ctx. Multiple if statementsdirectly call attributes of plane_state, leading to potential nullpointer dereference issues. This patch adds necessary null checks toensure stability.(CVE-2024-53201)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: mwifiex: Fix memcpy() field-spanning write warning in mwifiex_config_scan()\n\nReplace one-element array with a flexible-array member in `struct\nmwifiex_ie_types_wildcard_ssid_params` to fix the following warning\non a MT8173 Chromebook (mt8173-elm-hana):\n\n[ 356.775250] ------------[ cut here ]------------\n[ 356.784543] memcpy: detected field-spanning write (size 6) of single field \u0026quot;wildcard_ssid_tlv-\u0026gt;ssid\u0026quot; at drivers/net/wireless/marvell/mwifiex/scan.c:904 (size 1)\n[ 356.813403] WARNING: CPU: 3 PID: 742 at drivers/net/wireless/marvell/mwifiex/scan.c:904 mwifiex_scan_networks+0x4fc/0xf28 [mwifiex]\n\nThe \u0026quot;(size 6)\u0026quot; above is exactly the length of the SSID of the network\nthis device was connected to. The source of the warning looks like:\n\n ssid_len = user_scan_in-\u0026gt;ssid_list[i].ssid_len;\n [...]\n memcpy(wildcard_ssid_tlv-\u0026gt;ssid,\n user_scan_in-\u0026gt;ssid_list[i].ssid, ssid_len);\n\nThere is a #define WILDCARD_SSID_TLV_MAX_SIZE that uses sizeof() on this\nstruct, but it already didn\u0026apos;t account for the size of the one-element\narray, so it doesn\u0026apos;t need to be changed.(CVE-2024-56539)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmedia: uvcvideo: Require entities to have a non-zero unique ID\n\nPer UVC 1.1+ specification 3.7.2, units and terminals must have a non-zero\nunique ID.\n\n```\nEach Unit and Terminal within the video function is assigned a unique\nidentification number, the Unit ID (UID) or Terminal ID (TID), contained in\nthe bUnitID or bTerminalID field of the descriptor. The value 0x00 is\nreserved for undefined ID,\n```\n\nSo, deny allocating an entity with ID 0 or an ID that belongs to a unit\nthat is already added to the list of entities.\n\nThis also prevents some syzkaller reproducers from triggering warnings due\nto a chain of entities referring to themselves. In one particular case, an\nOutput Unit is connected to an Input Unit, both with the same ID of 1. But\nwhen looking up for the source ID of the Output Unit, that same entity is\nfound instead of the input entity, which leads to such warnings.\n\nIn another case, a backward chain was considered finished as the source ID\nwas 0. Later on, that entity was found, but its pads were not valid.\n\nHere is a sample stack trace for one of those cases.\n\n[ 20.650953] usb 1-1: new high-speed USB device number 2 using dummy_hcd\n[ 20.830206] usb 1-1: Using ep0 maxpacket: 8\n[ 20.833501] usb 1-1: config 0 descriptor??\n[ 21.038518] usb 1-1: string descriptor 0 read error: -71\n[ 21.038893] usb 1-1: Found UVC 0.00 device \u0026lt;unnamed\u0026gt; (2833:0201)\n[ 21.039299] uvcvideo 1-1:0.0: Entity type for entity Output 1 was not initialized!\n[ 21.041583] uvcvideo 1-1:0.0: Entity type for entity Input 1 was not initialized!\n[ 21.042218] ------------[ cut here ]------------\n[ 21.042536] WARNING: CPU: 0 PID: 9 at drivers/media/mc/mc-entity.c:1147 media_create_pad_link+0x2c4/0x2e0\n[ 21.043195] Modules linked in:\n[ 21.043535] CPU: 0 UID: 0 PID: 9 Comm: kworker/0:1 Not tainted 6.11.0-rc7-00030-g3480e43aeccf #444\n[ 21.044101] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.15.0-1 04/01/2014\n[ 21.044639] Workqueue: usb_hub_wq hub_event\n[ 21.045100] RIP: 0010:media_create_pad_link+0x2c4/0x2e0\n[ 21.045508] Code: fe e8 20 01 00 00 b8 f4 ff ff ff 48 83 c4 30 5b 41 5c 41 5d 41 5e 41 5f 5d c3 cc cc cc cc 0f 0b eb e9 0f 0b eb 0a 0f 0b eb 06 \u0026lt;0f\u0026gt; 0b eb 02 0f 0b b8 ea ff ff ff eb d4 66 2e 0f 1f 84 00 00 00 00\n[ 21.046801] RSP: 0018:ffffc9000004b318 EFLAGS: 00010246\n[ 21.047227] RAX: ffff888004e5d458 RBX: 0000000000000000 RCX: ffffffff818fccf1\n[ 21.047719] RDX: 000000000000007b RSI: 0000000000000000 RDI: ffff888004313290\n[ 21.048241] RBP: ffff888004313290 R08: 0001ffffffffffff R09: 0000000000000000\n[ 21.048701] R10: 0000000000000013 R11: 0001888004313290 R12: 0000000000000003\n[ 21.049138] R13: ffff888004313080 R14: ffff888004313080 R15: 0000000000000000\n[ 21.049648] FS: 0000000000000000(0000) GS:ffff88803ec00000(0000) knlGS:0000000000000000\n[ 21.050271] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 21.050688] CR2: 0000592cc27635b0 CR3: 000000000431c000 CR4: 0000000000750ef0\n[ 21.051136] PKRU: 55555554\n[ 21.051331] Call Trace:\n[ 21.051480] \u0026lt;TASK\u0026gt;\n[ 21.051611] ? __warn+0xc4/0x210\n[ 21.051861] ? media_create_pad_link+0x2c4/0x2e0\n[ 21.052252] ? report_bug+0x11b/0x1a0\n[ 21.052540] ? trace_hardirqs_on+0x31/0x40\n[ 21.052901] ? handle_bug+0x3d/0x70\n[ 21.053197] ? exc_invalid_op+0x1a/0x50\n[ 21.053511] ? asm_exc_invalid_op+0x1a/0x20\n[ 21.053924] ? media_create_pad_link+0x91/0x2e0\n[ 21.054364] ? media_create_pad_link+0x2c4/0x2e0\n[ 21.054834] ? media_create_pad_link+0x91/0x2e0\n[ 21.055131] ? _raw_spin_unlock+0x1e/0x40\n[ 21.055441] ? __v4l2_device_register_subdev+0x202/0x210\n[ 21.055837] uvc_mc_register_entities+0x358/0x400\n[ 21.056144] uvc_register_chains+0x1fd/0x290\n[ 21.056413] uvc_probe+0x380e/0x3dc0\n[ 21.056676] ? __lock_acquire+0x5aa/0x26e0\n[ 21.056946] ? find_held_lock+0x33/0xa0\n[ 21.057196] ? kernfs_activate+0x70/0x80\n[ 21.057533] ? usb_match_dy\n---truncated---(CVE-2024-56571)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: hisi_sas: Create all dump files during debugfs initialization\n\nFor the current debugfs of hisi_sas, after user triggers dump, the\ndriver allocate memory space to save the register information and create\ndebugfs files to display the saved information. In this process, the\ndebugfs files created after each dump.\n\nTherefore, when the dump is triggered while the driver is unbind, the\nfollowing hang occurs:\n\n[67840.853907] Unable to handle kernel NULL pointer dereference at virtual address 00000000000000a0\n[67840.862947] Mem abort info:\n[67840.865855] ESR = 0x0000000096000004\n[67840.869713] EC = 0x25: DABT (current EL), IL = 32 bits\n[67840.875125] SET = 0, FnV = 0\n[67840.878291] EA = 0, S1PTW = 0\n[67840.881545] FSC = 0x04: level 0 translation fault\n[67840.886528] Data abort info:\n[67840.889524] ISV = 0, ISS = 0x00000004, ISS2 = 0x00000000\n[67840.895117] CM = 0, WnR = 0, TnD = 0, TagAccess = 0\n[67840.900284] GCS = 0, Overlay = 0, DirtyBit = 0, Xs = 0\n[67840.905709] user pgtable: 4k pages, 48-bit VAs, pgdp=0000002803a1f000\n[67840.912263] [00000000000000a0] pgd=0000000000000000, p4d=0000000000000000\n[67840.919177] Internal error: Oops: 0000000096000004 [#1] PREEMPT SMP\n[67840.996435] pstate: 80400009 (Nzcv daif +PAN -UAO -TCO -DIT -SSBS BTYPE=--)\n[67841.003628] pc : down_write+0x30/0x98\n[67841.007546] lr : start_creating.part.0+0x60/0x198\n[67841.012495] sp : ffff8000b979ba20\n[67841.016046] x29: ffff8000b979ba20 x28: 0000000000000010 x27: 0000000000024b40\n[67841.023412] x26: 0000000000000012 x25: ffff20202b355ae8 x24: ffff20202b35a8c8\n[67841.030779] x23: ffffa36877928208 x22: ffffa368b4972240 x21: ffff8000b979bb18\n[67841.038147] x20: ffff00281dc1e3c0 x19: fffffffffffffffe x18: 0000000000000020\n[67841.045515] x17: 0000000000000000 x16: ffffa368b128a530 x15: ffffffffffffffff\n[67841.052888] x14: ffff8000b979bc18 x13: ffffffffffffffff x12: ffff8000b979bb18\n[67841.060263] x11: 0000000000000000 x10: 0000000000000000 x9 : ffffa368b1289b18\n[67841.067640] x8 : 0000000000000012 x7 : 0000000000000000 x6 : 00000000000003a9\n[67841.075014] x5 : 0000000000000000 x4 : ffff002818c5cb00 x3 : 0000000000000001\n[67841.082388] x2 : 0000000000000000 x1 : ffff002818c5cb00 x0 : 00000000000000a0\n[67841.089759] Call trace:\n[67841.092456] down_write+0x30/0x98\n[67841.096017] start_creating.part.0+0x60/0x198\n[67841.100613] debugfs_create_dir+0x48/0x1f8\n[67841.104950] debugfs_create_files_v3_hw+0x88/0x348 [hisi_sas_v3_hw]\n[67841.111447] debugfs_snapshot_regs_v3_hw+0x708/0x798 [hisi_sas_v3_hw]\n[67841.118111] debugfs_trigger_dump_v3_hw_write+0x9c/0x120 [hisi_sas_v3_hw]\n[67841.125115] full_proxy_write+0x68/0xc8\n[67841.129175] vfs_write+0xd8/0x3f0\n[67841.132708] ksys_write+0x70/0x108\n[67841.136317] __arm64_sys_write+0x24/0x38\n[67841.140440] invoke_syscall+0x50/0x128\n[67841.144385] el0_svc_common.constprop.0+0xc8/0xf0\n[67841.149273] do_el0_svc+0x24/0x38\n[67841.152773] el0_svc+0x38/0xd8\n[67841.156009] el0t_64_sync_handler+0xc0/0xc8\n[67841.160361] el0t_64_sync+0x1a4/0x1a8\n[67841.164189] Code: b9000882 d2800002 d2800023 f9800011 (c85ffc05)\n[67841.170443] ---[ end trace 0000000000000000 ]---\n\nTo fix this issue, create all directories and files during debugfs\ninitialization. In this way, the driver only needs to allocate memory\nspace to save information each time the user triggers dumping.(CVE-2024-56588)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nkcsan: Turn report_filterlist_lock into a raw_spinlock\n\nRan Xiaokai reports that with a KCSAN-enabled PREEMPT_RT kernel, we can see\nsplats like:\n\n| BUG: sleeping function called from invalid context at kernel/locking/spinlock_rt.c:48\n| in_atomic(): 1, irqs_disabled(): 1, non_block: 0, pid: 0, name: swapper/1\n| preempt_count: 10002, expected: 0\n| RCU nest depth: 0, expected: 0\n| no locks held by swapper/1/0.\n| irq event stamp: 156674\n| hardirqs last enabled at (156673): [\u0026lt;ffffffff81130bd9\u0026gt;] do_idle+0x1f9/0x240\n| hardirqs last disabled at (156674): [\u0026lt;ffffffff82254f84\u0026gt;] sysvec_apic_timer_interrupt+0x14/0xc0\n| softirqs last enabled at (0): [\u0026lt;ffffffff81099f47\u0026gt;] copy_process+0xfc7/0x4b60\n| softirqs last disabled at (0): [\u0026lt;0000000000000000\u0026gt;] 0x0\n| Preemption disabled at:\n| [\u0026lt;ffffffff814a3e2a\u0026gt;] paint_ptr+0x2a/0x90\n| CPU: 1 UID: 0 PID: 0 Comm: swapper/1 Not tainted 6.11.0+ #3\n| Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.12.0-0-ga698c8995f-prebuilt.qemu.org 04/01/2014\n| Call Trace:\n| \u0026lt;IRQ\u0026gt;\n| dump_stack_lvl+0x7e/0xc0\n| dump_stack+0x1d/0x30\n| __might_resched+0x1a2/0x270\n| rt_spin_lock+0x68/0x170\n| kcsan_skip_report_debugfs+0x43/0xe0\n| print_report+0xb5/0x590\n| kcsan_report_known_origin+0x1b1/0x1d0\n| kcsan_setup_watchpoint+0x348/0x650\n| __tsan_unaligned_write1+0x16d/0x1d0\n| hrtimer_interrupt+0x3d6/0x430\n| __sysvec_apic_timer_interrupt+0xe8/0x3a0\n| sysvec_apic_timer_interrupt+0x97/0xc0\n| \u0026lt;/IRQ\u0026gt;\n\nOn a detected data race, KCSAN\u0026apos;s reporting logic checks if it should\nfilter the report. That list is protected by the report_filterlist_lock\n*non-raw* spinlock which may sleep on RT kernels.\n\nSince KCSAN may report data races in any context, convert it to a\nraw_spinlock.\n\nThis requires being careful about when to allocate memory for the filter\nlist itself which can be done via KCSAN\u0026apos;s debugfs interface. Concurrent\nmodification of the filter list via debugfs should be rare: the chosen\nstrategy is to optimistically pre-allocate memory before the critical\nsection and discard if unused.(CVE-2024-56610)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmm/mempolicy: fix migrate_to_node() assuming there is at least one VMA in a MM\n\nWe currently assume that there is at least one VMA in a MM, which isn\u0026apos;t\ntrue.\n\nSo we might end up having find_vma() return NULL, to then de-reference\nNULL. So properly handle find_vma() returning NULL.\n\nThis fixes the report:\n\nOops: general protection fault, probably for non-canonical address 0xdffffc0000000000: 0000 [#1] PREEMPT SMP KASAN PTI\nKASAN: null-ptr-deref in range [0x0000000000000000-0x0000000000000007]\nCPU: 1 UID: 0 PID: 6021 Comm: syz-executor284 Not tainted 6.12.0-rc7-syzkaller-00187-gf868cd251776 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 10/30/2024\nRIP: 0010:migrate_to_node mm/mempolicy.c:1090 [inline]\nRIP: 0010:do_migrate_pages+0x403/0x6f0 mm/mempolicy.c:1194\nCode: ...\nRSP: 0018:ffffc9000375fd08 EFLAGS: 00010246\nRAX: 0000000000000000 RBX: ffffc9000375fd78 RCX: 0000000000000000\nRDX: ffff88807e171300 RSI: dffffc0000000000 RDI: ffff88803390c044\nRBP: ffff88807e171428 R08: 0000000000000014 R09: fffffbfff2039ef1\nR10: ffffffff901cf78f R11: 0000000000000000 R12: 0000000000000003\nR13: ffffc9000375fe90 R14: ffffc9000375fe98 R15: ffffc9000375fdf8\nFS: 00005555919e1380(0000) GS:ffff8880b8700000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 00005555919e1ca8 CR3: 000000007f12a000 CR4: 00000000003526f0\nDR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\nDR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\nCall Trace:\n \u0026lt;TASK\u0026gt;\n kernel_migrate_pages+0x5b2/0x750 mm/mempolicy.c:1709\n __do_sys_migrate_pages mm/mempolicy.c:1727 [inline]\n __se_sys_migrate_pages mm/mempolicy.c:1723 [inline]\n __x64_sys_migrate_pages+0x96/0x100 mm/mempolicy.c:1723\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcd/0x250 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n\n[akpm@linux-foundation.org: add unlikely()](CVE-2024-56611)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: qla2xxx: Fix use after free on unload\n\nSystem crash is observed with stack trace warning of use after\nfree. There are 2 signals to tell dpc_thread to terminate (UNLOADING\nflag and kthread_stop).\n\nOn setting the UNLOADING flag when dpc_thread happens to run at the time\nand sees the flag, this causes dpc_thread to exit and clean up\nitself. When kthread_stop is called for final cleanup, this causes use\nafter free.\n\nRemove UNLOADING signal to terminate dpc_thread. Use the kthread_stop\nas the main signal to exit dpc_thread.\n\n[596663.812935] kernel BUG at mm/slub.c:294!\n[596663.812950] invalid opcode: 0000 [#1] SMP PTI\n[596663.812957] CPU: 13 PID: 1475935 Comm: rmmod Kdump: loaded Tainted: G IOE --------- - - 4.18.0-240.el8.x86_64 #1\n[596663.812960] Hardware name: HP ProLiant DL380p Gen8, BIOS P70 08/20/2012\n[596663.812974] RIP: 0010:__slab_free+0x17d/0x360\n\n...\n[596663.813008] Call Trace:\n[596663.813022] ? __dentry_kill+0x121/0x170\n[596663.813030] ? _cond_resched+0x15/0x30\n[596663.813034] ? _cond_resched+0x15/0x30\n[596663.813039] ? wait_for_completion+0x35/0x190\n[596663.813048] ? try_to_wake_up+0x63/0x540\n[596663.813055] free_task+0x5a/0x60\n[596663.813061] kthread_stop+0xf3/0x100\n[596663.813103] qla2x00_remove_one+0x284/0x440 [qla2xxx](CVE-2024-56623)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsunrpc: clear XPRT_SOCK_UPD_TIMEOUT when reset transport\n\nSince transport-\u0026gt;sock has been set to NULL during reset transport,\nXPRT_SOCK_UPD_TIMEOUT also needs to be cleared. Otherwise, the\nxs_tcp_set_socket_timeouts() may be triggered in xs_tcp_send_request()\nto dereference the transport-\u0026gt;sock that has been set to NULL.(CVE-2024-56688)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\n9p/xen: fix release of IRQ\n\nKernel logs indicate an IRQ was double-freed.\n\nPass correct device ID during IRQ release.\n\n[Dominique: remove confusing variable reset to 0](CVE-2024-56704)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nionic: Fix netdev notifier unregister on failure\n\nIf register_netdev() fails, then the driver leaks the netdev notifier.\nFix this by calling ionic_lif_unregister() on register_netdev()\nfailure. This will also call ionic_lif_unregister_phc() if it has\nalready been registered.(CVE-2024-56715)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfbdev: sh7760fb: Fix a possible memory leak in sh7760fb_alloc_mem()\n\nWhen information such as info-\u0026gt;screen_base is not ready, calling\nsh7760fb_free_mem() does not release memory correctly. Call\ndma_free_coherent() instead.(CVE-2024-56746)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nocfs2: fix slab-use-after-free due to dangling pointer dqi_priv\n\nWhen mounting ocfs2 and then remounting it as read-only, a\nslab-use-after-free occurs after the user uses a syscall to\nquota_getnextquota. Specifically, sb_dqinfo(sb, type)-\u0026gt;dqi_priv is the\ndangling pointer.\n\nDuring the remounting process, the pointer dqi_priv is freed but is never\nset as null leaving it to be accessed. Additionally, the read-only option\nfor remounting sets the DQUOT_SUSPENDED flag instead of setting the\nDQUOT_USAGE_ENABLED flags. Moreover, later in the process of getting the\nnext quota, the function ocfs2_get_next_id is called and only checks the\nquota usage flags and not the quota suspended flags.\n\nTo fix this, I set dqi_priv to null when it is freed after remounting with\nread-only and put a check for DQUOT_SUSPENDED in ocfs2_get_next_id.\n\n[akpm@linux-foundation.org: coding-style cleanups](CVE-2024-57892)",
"id": "OESA-2025-1095",
"modified": "2026-08-06T11:08:11Z",
"published": "2025-02-08T11:08:11Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-1095"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52480"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52513"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52614"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52627"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52913"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-24857"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-24859"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26659"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26664"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26673"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26747"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26748"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26749"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26753"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26781"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26790"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26793"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26952"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27004"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36479"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36484"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-37021"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-40965"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50194"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-50280"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53131"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53183"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53198"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53201"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56539"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56571"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56588"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56610"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56611"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56623"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56688"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56704"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56715"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-56746"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-57892"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:A/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2023-52480",
"CVE-2023-52513",
"CVE-2023-52614",
"CVE-2023-52627",
"CVE-2023-52913",
"CVE-2024-24857",
"CVE-2024-24859",
"CVE-2024-26659",
"CVE-2024-26664",
"CVE-2024-26673",
"CVE-2024-26747",
"CVE-2024-26748",
"CVE-2024-26749",
"CVE-2024-26753",
"CVE-2024-26781",
"CVE-2024-26790",
"CVE-2024-26793",
"CVE-2024-26952",
"CVE-2024-27004",
"CVE-2024-36479",
"CVE-2024-36484",
"CVE-2024-37021",
"CVE-2024-40965",
"CVE-2024-50194",
"CVE-2024-50280",
"CVE-2024-53131",
"CVE-2024-53183",
"CVE-2024-53198",
"CVE-2024-53201",
"CVE-2024-56539",
"CVE-2024-56571",
"CVE-2024-56588",
"CVE-2024-56610",
"CVE-2024-56611",
"CVE-2024-56623",
"CVE-2024-56688",
"CVE-2024-56704",
"CVE-2024-56715",
"CVE-2024-56746",
"CVE-2024-57892"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.