Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-26773 (GCVE-0-2024-26773)
Vulnerability from cvelistv5 – Published: 2024-04-03 17:00 – Updated: 2026-08-05 11:27| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
163a203ddb36c36d4a1c942aececda0cc8d06aa7 , < 21f8cfe79f776287459343e9cfa6055af61328ea
(git)
Affected: 163a203ddb36c36d4a1c942aececda0cc8d06aa7 , < 260fc96283c0f594de18a1b045faf6d8fb42874d (git) Affected: 163a203ddb36c36d4a1c942aececda0cc8d06aa7 , < 927794a02169778c9c2e7b25c768ab3ea8c1dc03 (git) Affected: 163a203ddb36c36d4a1c942aececda0cc8d06aa7 , < 4c21fa60a6f4606f6214a38f50612b17b2f738f5 (git) Affected: 163a203ddb36c36d4a1c942aececda0cc8d06aa7 , < f97e75fa4e12b0aa0224e83fcbda8853ac2adf36 (git) Affected: 163a203ddb36c36d4a1c942aececda0cc8d06aa7 , < 0184747b552d6b5a14db3b7fcc3b792ce64dedd1 (git) Affected: 163a203ddb36c36d4a1c942aececda0cc8d06aa7 , < a2576ae9a35c078e488f2c573e9e6821d651fbbe (git) Affected: 163a203ddb36c36d4a1c942aececda0cc8d06aa7 , < 4530b3660d396a646aad91a787b6ab37cf604b53 (git) |
guessed | |
| Linux | Linux |
Affected:
3.12
Unaffected: 0 , < 3.12 (semver) Unaffected: 4.19.308 , ≤ 4.19.* (semver) Unaffected: 5.4.270 , ≤ 5.4.* (semver) Unaffected: 5.10.211 , ≤ 5.10.* (semver) Unaffected: 5.15.150 , ≤ 5.15.* (semver) Unaffected: 6.1.80 , ≤ 6.1.* (semver) Unaffected: 6.6.19 , ≤ 6.6.* (semver) Unaffected: 6.7.7 , ≤ 6.7.* (semver) Unaffected: 6.8 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-26773",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-04-03T18:50:26.209110Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-04T17:49:10.181Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
},
{
"providerMetadata": {
"dateUpdated": "2024-08-02T00:14:13.512Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
},
{
"tags": [
"x_transferred"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00017.html"
},
{
"tags": [
"x_transferred"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/ext4/mballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "21f8cfe79f776287459343e9cfa6055af61328ea",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "260fc96283c0f594de18a1b045faf6d8fb42874d",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "927794a02169778c9c2e7b25c768ab3ea8c1dc03",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "4c21fa60a6f4606f6214a38f50612b17b2f738f5",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "f97e75fa4e12b0aa0224e83fcbda8853ac2adf36",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "0184747b552d6b5a14db3b7fcc3b792ce64dedd1",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "a2576ae9a35c078e488f2c573e9e6821d651fbbe",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "4530b3660d396a646aad91a787b6ab37cf604b53",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/ext4/mballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "3.12"
},
{
"lessThan": "3.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.308",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.270",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.211",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.150",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.80",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.19",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.7.*",
"status": "unaffected",
"version": "6.7.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.8",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.308",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.270",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.211",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.150",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.80",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.19",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.7.7",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.8",
"versionStartIncluding": "3.12",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\n\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\n\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0027t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u003eac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group"
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The vulnerable allocator is reached only through local filesystem operations (`write()`, `fallocate()`, truncate/extend) on a mounted ext4 filesystem via `ext4_mb_new_blocks()` \u2192 `ext4_mb_regular_allocator()`. No network protocol handler parses data that reaches this code directly.\nAC:L - The attacker drives both sides of the window \u2014 many concurrent writer threads on the same block group both create the allocation pressure that forces the `ac_b_ex.fe_len \u003e 0 \u0026\u0026 !AC_STATUS_FOUND` fallback into `ext4_mb_try_best_found()` and supply the concurrent free/scan that flags the group corrupt \u2014 and the same-thread path (corruption detected inside `ext4_mb_complex_scan_group()`, `break`, then the fallback allocation) needs no race at all; the sequence can be retried indefinitely at no cost.\nPR:L - Only an unprivileged local account with write access to any ext4 mount (`/tmp`, `/home`, an app data partition on Android/embedded) is needed; no capability, mount privilege, or fs-specific permission is consulted on the allocation path.\nUI:N - Once a group is flagged corrupt \u2014 by media aging on eMMC/flash in embedded and automotive deployments, by a prior detected double-free, or by the free-count mismatch the attacker\u0027s own concurrent allocation traffic provokes \u2014 exploitation is entirely the attacker\u0027s own syscalls, with no victim mount or file access required.\nS:U - The damaged resources are the ext4 block bitmap, buddy state, and file data, all managed by the same kernel security authority as the vulnerable code; no hypervisor, IOMMU, or sandbox boundary is crossed.\nC:H - Allocating from a group whose bitmap is known-inconsistent hands the attacker\u0027s file blocks that are still referenced by other inodes \u2014 the double-free detector\u0027s case is exactly \"this block is still owned by another file\" \u2014 so simply reading the attacker\u0027s own new file discloses other users\u0027 and system files\u0027 on-disk contents.\nI:H - The same double allocation lets attacker-controlled writes land on blocks belonging to other users\u0027 files and, where the bitmap accounting is wrong for metadata blocks, on ext4 metadata (inode table, bitmaps), corrupting foreign data and inode fields in a way that is leverageable for privilege escalation.\nA:H - Operating on the inconsistent buddy triggers `BUG_ON(ord \u003c= 0)` / `BUG_ON((start \u003e\u003e ord) \u003e= max)` in `mb_mark_used()`, `bb_free`/`bb_fragments` underflow feeding the divide-by-zero in `mb_update_avg_fragment_size()`, and `ext4_grp_locked_error()`, which forces the filesystem read-only by default and panics the kernel with `errors=panic`."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T11:27:10.867Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
}
],
"title": "ext4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-26773",
"datePublished": "2024-04-03T17:00:59.757Z",
"dateReserved": "2024-02-19T14:20:24.176Z",
"dateUpdated": "2026-08-05T11:27:10.867Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-26773",
"date": "2026-09-22",
"epss": "0.00312",
"percentile": "0.24272"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/ext4/mballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "21f8cfe79f776287459343e9cfa6055af61328ea",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "260fc96283c0f594de18a1b045faf6d8fb42874d",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "927794a02169778c9c2e7b25c768ab3ea8c1dc03",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "4c21fa60a6f4606f6214a38f50612b17b2f738f5",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "f97e75fa4e12b0aa0224e83fcbda8853ac2adf36",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "0184747b552d6b5a14db3b7fcc3b792ce64dedd1",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "a2576ae9a35c078e488f2c573e9e6821d651fbbe",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "4530b3660d396a646aad91a787b6ab37cf604b53",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/ext4/mballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "3.12"
},
{
"lessThan": "3.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.308",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.270",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.211",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.150",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.80",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.19",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.7.*",
"status": "unaffected",
"version": "6.7.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.8",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B6FB6042-3E0F-4A36-8DED-B3C350612BDC",
"versionEndExcluding": "4.19.308",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "5D8044B1-C7E8-44A4-9F03-A4D7BCDB1721",
"versionEndExcluding": "5.4.270",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "7DDA4DCF-671D-415D-94DF-6E3C77DF0704",
"versionEndExcluding": "5.10.211",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CB6C60DE-9E0C-46C5-904D-D4F4031F8E95",
"versionEndExcluding": "5.15.150",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BA7850CE-97C9-4408-A348-6173296BCA2B",
"versionEndExcluding": "6.1.80",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "8D82004C-B2AE-4048-9344-32EFF65953B0",
"versionEndExcluding": "6.6.19",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "575EE16B-67F2-4B5B-B5F8-1877715C898B",
"versionEndExcluding": "6.7.7",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.8:rc1:*:*:*:*:*:*",
"matchCriteriaId": "B9F4EA73-0894-400F-A490-3A397AB7A517",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.8:rc2:*:*:*:*:*:*",
"matchCriteriaId": "056BD938-0A27-4569-B391-30578B309EE3",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
},
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:debian:debian_linux:10.0:*:*:*:*:*:*:*",
"matchCriteriaId": "07B237A9-69A3-4A9C-9DA0-4E06BD37AE73",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\n\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\n\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0027t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u003eac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group"
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: ext4: evite asignar bloques de un grupo da\u00f1ado en ext4_mb_try_best_found() Determine si el mapa de bits del bloque del grupo est\u00e1 da\u00f1ado antes de usar ac_b_ex en ext4_mb_try_best_found() para evitar asignar bloques de un grupo con un bloque da\u00f1ado mapa de bits en la siguiente concurrencia y empeorando la situaci\u00f3n. ext4_mb_regular_allocator ext4_lock_group(sb, group) ext4_mb_good_group // verifica si el bbitmap del grupo est\u00e1 da\u00f1ado ext4_mb_complex_scan_group // El grupo de escaneo obtiene ac_b_ex pero no lo usa ext4_unlock_group(sb, group) ext4_mark_group_bitmap_corrupted(group) // El mapa de bits del bloque se corrompi\u00f3 durante // el grupo desbloquea la brecha. ext4_mb_try_best_found ext4_lock_group(ac-\u0026gt;ac_sb, group) ext4_mb_use_best_found mb_mark_used // Asignaci\u00f3n de bloques en un grupo da\u00f1ado de mapa de bits de bloques"
}
],
"id": "CVE-2024-26773",
"lastModified": "2026-08-04T11:17:03.457",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-26773",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-04-03T18:50:26.209110Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-04-03T17:15:53.080",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00017.html"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-08-04T19:10:35+00:00",
"cve": "CVE-2024-26773",
"id": "CVE-2024-26773",
"initial_release_date": "2024-04-03T00:00:00+00:00",
"product_status:fixed": "929",
"product_status:known_affected": "64",
"product_status:known_not_affected": "9",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: ext4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-26773.json",
"version": "3"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T00:14:13.512Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
},
{
"tags": [
"x_transferred"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00017.html"
},
{
"tags": [
"x_transferred"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-26773",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-04-03T18:50:26.209110Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-05-23T19:01:21.835Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/ext4/mballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "21f8cfe79f776287459343e9cfa6055af61328ea",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "260fc96283c0f594de18a1b045faf6d8fb42874d",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "927794a02169778c9c2e7b25c768ab3ea8c1dc03",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "4c21fa60a6f4606f6214a38f50612b17b2f738f5",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "f97e75fa4e12b0aa0224e83fcbda8853ac2adf36",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "0184747b552d6b5a14db3b7fcc3b792ce64dedd1",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "a2576ae9a35c078e488f2c573e9e6821d651fbbe",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "4530b3660d396a646aad91a787b6ab37cf604b53",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/ext4/mballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "3.12"
},
{
"lessThan": "3.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.308",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.270",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.211",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.150",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.80",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.19",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.7.*",
"status": "unaffected",
"version": "6.7.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.8",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.308",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.270",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.211",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.150",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.80",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.19",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.7.7",
"versionStartIncluding": "3.12",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.8",
"versionStartIncluding": "3.12",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\n\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\n\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0027t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u003eac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group"
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The vulnerable allocator is reached only through local filesystem operations (`write()`, `fallocate()`, truncate/extend) on a mounted ext4 filesystem via `ext4_mb_new_blocks()` \u2192 `ext4_mb_regular_allocator()`. No network protocol handler parses data that reaches this code directly.\nAC:L - The attacker drives both sides of the window \u2014 many concurrent writer threads on the same block group both create the allocation pressure that forces the `ac_b_ex.fe_len \u003e 0 \u0026\u0026 !AC_STATUS_FOUND` fallback into `ext4_mb_try_best_found()` and supply the concurrent free/scan that flags the group corrupt \u2014 and the same-thread path (corruption detected inside `ext4_mb_complex_scan_group()`, `break`, then the fallback allocation) needs no race at all; the sequence can be retried indefinitely at no cost.\nPR:L - Only an unprivileged local account with write access to any ext4 mount (`/tmp`, `/home`, an app data partition on Android/embedded) is needed; no capability, mount privilege, or fs-specific permission is consulted on the allocation path.\nUI:N - Once a group is flagged corrupt \u2014 by media aging on eMMC/flash in embedded and automotive deployments, by a prior detected double-free, or by the free-count mismatch the attacker\u0027s own concurrent allocation traffic provokes \u2014 exploitation is entirely the attacker\u0027s own syscalls, with no victim mount or file access required.\nS:U - The damaged resources are the ext4 block bitmap, buddy state, and file data, all managed by the same kernel security authority as the vulnerable code; no hypervisor, IOMMU, or sandbox boundary is crossed.\nC:H - Allocating from a group whose bitmap is known-inconsistent hands the attacker\u0027s file blocks that are still referenced by other inodes \u2014 the double-free detector\u0027s case is exactly \"this block is still owned by another file\" \u2014 so simply reading the attacker\u0027s own new file discloses other users\u0027 and system files\u0027 on-disk contents.\nI:H - The same double allocation lets attacker-controlled writes land on blocks belonging to other users\u0027 files and, where the bitmap accounting is wrong for metadata blocks, on ext4 metadata (inode table, bitmaps), corrupting foreign data and inode fields in a way that is leverageable for privilege escalation.\nA:H - Operating on the inconsistent buddy triggers `BUG_ON(ord \u003c= 0)` / `BUG_ON((start \u003e\u003e ord) \u003e= max)` in `mb_mark_used()`, `bb_free`/`bb_fragments` underflow feeding the divide-by-zero in `mb_update_avg_fragment_size()`, and `ext4_grp_locked_error()`, which forces the filesystem read-only by default and panics the kernel with `errors=panic`."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T11:27:10.867Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
}
],
"title": "ext4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-26773",
"datePublished": "2024-04-03T17:00:59.757Z",
"dateReserved": "2024-02-19T14:20:24.176Z",
"dateUpdated": "2026-08-05T11:27:10.867Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
CERTFR-2025-AVI-0677
Vulnerability from certfr_avis - Published: 2025-08-12 - Updated: 2025-08-12
De multiples vulnérabilités ont été découvertes dans les produits Siemens. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| Siemens | N/A | SIMATIC PCS neo V6.0 versions antérieures à V6.0 SP1 | ||
| Siemens | N/A | SIMATIC WinCC V17, v18 et V20 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC Control Function Library (CFL) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIPROTEC 5 versions antérieures à 10.0 | ||
| Siemens | N/A | SIMATIC MTP Integrator toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ProSave V17 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Unified Line Coordination toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC TeleControl toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC OA V3.19 versions antérieures à V3.19 P020 | ||
| Siemens | N/A | SIMATIC WinCC flexible ES toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V17 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2024-54678. | ||
| Siemens | N/A | SIMATIC S7-Fail-safe Configuration Tool (S7-FCT) versions antérieures à 4.0.1 | ||
| Siemens | N/A | SIMATIC PCS neo V6.0 toutes versions pour la vulnérabilité CVE-2024-54678 | ||
| Siemens | N/A | SIMATIC eaSie Core Package (6DL5424-0AX00-0AV8) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC MTP CREATOR V2.x et V3.x toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC WinCC OA V3.18 versions antérieures à V3.18 P032 | ||
| Siemens | N/A | TIA Portal Cloud V19 versions antérieures à 5.2.1.1 | ||
| Siemens | N/A | SIMATIC D7-SYS toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC BATCH V10.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ODK 1500S toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2020 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour les vulnérabilités CVE-2025-30033 et CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC S7-1500 Software Controller V2 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | TIA Portal Cloud Connector toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Unified Sequence toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V17 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40759. | ||
| Siemens | N/A | SIMATIC WinCC Runtime Advanced toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Logon V2.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ProSave V19 versions antérieures à V19 Update 4 | ||
| Siemens | N/A | SIMATIC PDM Maintenance Station V5.0 toutes versions pour les vulnérabilités CVE-2025-30033 et CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC Safety Matrix toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Management Console toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SCALANCE XCM-/XRM-/XCH-/XRH-300 family versions antérieures à 3.2 | ||
| Siemens | N/A | SIMATIC BATCH V9.1 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC Process Function Library (PFL) V4.0 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC S7-1500 Software Controller V3 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 CFC V20 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC NET PC Software toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Route Control V9.1 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2022 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC OA V3.20 versions antérieures à V3.20 P008 | ||
| Siemens | N/A | SIMATIC RTLS Locating Manager versions antérieures à 3.3 | ||
| Siemens | N/A | Siprotec 4 7SA6, 7SD5 et 7SD610 versions antérieures à 4.78 | ||
| Siemens | N/A | SIMATIC Automation Tool toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | TIA Portal Cloud V18 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC PDM V9.2 et V9.3 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Runtime Professional toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Visualization Architect (SiVArc) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC eaSie Workflow Skills toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 CFC V19 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC WinCC V19 versions antérieures à V19 Update 4 | ||
| Siemens | N/A | SIMATIC Management Agent toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC V7.5 et V8.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 V5.7 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Automation Tool SDK Windows toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2022 toutes versions pour la vulnérabilité CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V20 versions antérieures à V20 Update 1 | ||
| Siemens | N/A | TIA Portal Cloud V17 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC Energy Suite toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS 7 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Process Historian 2024 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC STEP 7 V19 versions antérieures à V19 Update 4 | ||
| Siemens | N/A | TIA Portal Test Suite V17, v18, v19 et v20 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7-PCT toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Target toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC ProSave V18 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC Logon V1.6 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC STEP 7 V17 et V18 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | SIMATIC RTLS Locating Manager versions antérieures à 3.2 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM Advanced versions antérieures à V7.0 Update 1 | ||
| Siemens | N/A | SIMATIC PCS neo V5.0 toutes versions pour la vulnérabilité CVE-2024-54678 | ||
| Siemens | N/A | SIMATIC STEP 7 V20 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | TIA Portal Cloud V20 toutes versions pour les vulnérabilités CVE-2024-54678 et CVE-2025-40759 | ||
| Siemens | N/A | Siprotec 4 toutes versions et tous modèles exceptés 7SA6, 7SD5, 7SD610 pour la vulnérabilité CVE-2024-52504. | ||
| Siemens | N/A | SIMATIC eaSie PCS 7 Skill Package (6DL5424-0BX00-0AV8) toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 versions antérieures à 3.2 | ||
| Siemens | N/A | SIMATIC S7-PLCSIM V17, V18 et V19 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC Unified PC Runtime V18, V19 et V20 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS 7 Advanced Process Faceplates V9.1 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC S7 F Systems V6.4 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC Information Server toutes versions pour la vulnérabilité CVE-2025-47809 | ||
| Siemens | N/A | SIMATIC S7 F Systems V6.3 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-30033. | ||
| Siemens | N/A | SIMATIC ProSave V20 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS 7 Logic Matrix V9.1 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | WinCC Panel Image Setup toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC PCS neo V4.1 et V5.0 toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2024-54678. | ||
| Siemens | N/A | SIMATIC Route Control V10.0 toutes versions pour la vulnérabilité CVE-2025-30033 | ||
| Siemens | N/A | SIMATIC WinCC V8.1 versions antérieures à V8.1 Update 3 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SIMATIC PCS neo V6.0 versions ant\u00e9rieures \u00e0 V6.0 SP1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V17, v18 et V20 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Control Function Library (CFL) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPROTEC 5 versions ant\u00e9rieures \u00e0 10.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC MTP Integrator toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V17 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Unified Line Coordination toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC TeleControl toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC OA V3.19 versions ant\u00e9rieures \u00e0 V3.19 P020",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC flexible ES toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V17 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-Fail-safe Configuration Tool (S7-FCT) versions ant\u00e9rieures \u00e0 4.0.1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS neo V6.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC eaSie Core Package (6DL5424-0AX00-0AV8) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC MTP CREATOR V2.x et V3.x toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC OA V3.18 versions ant\u00e9rieures \u00e0 V3.18 P032",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V19 versions ant\u00e9rieures \u00e0 5.2.1.1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC D7-SYS toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC BATCH V10.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ODK 1500S toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2020 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour les vuln\u00e9rabilit\u00e9s CVE-2025-30033 et CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 Software Controller V2 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud Connector toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Unified Sequence toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V17 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40759.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Runtime Advanced toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Logon V2.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V19 versions ant\u00e9rieures \u00e0 V19 Update 4",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PDM Maintenance Station V5.0 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2025-30033 et CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Safety Matrix toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Management Console toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XCM-/XRM-/XCH-/XRH-300 family versions ant\u00e9rieures \u00e0 3.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC BATCH V9.1 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Function Library (PFL) V4.0 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 Software Controller V3 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 CFC V20 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC NET PC Software toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Route Control V9.1 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2022 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC OA V3.20 versions ant\u00e9rieures \u00e0 V3.20 P008",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC RTLS Locating Manager versions ant\u00e9rieures \u00e0 3.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "Siprotec 4 7SA6, 7SD5 et 7SD610 versions ant\u00e9rieures \u00e0 4.78",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Automation Tool toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V18 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PDM V9.2 et V9.3 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Runtime Professional toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Visualization Architect (SiVArc) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC eaSie Workflow Skills toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 CFC V19 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V19 versions ant\u00e9rieures \u00e0 V19 Update 4",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Management Agent toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V7.5 et V8.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V5.7 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Automation Tool SDK Windows toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2022 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V20 versions ant\u00e9rieures \u00e0 V20 Update 1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V17 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Energy Suite toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS 7 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Process Historian 2024 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V19 versions ant\u00e9rieures \u00e0 V19 Update 4",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Test Suite V17, v18, v19 et v20 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PCT toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Target toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V18 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Logon V1.6 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V17 et V18 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC RTLS Locating Manager versions ant\u00e9rieures \u00e0 3.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM Advanced versions ant\u00e9rieures \u00e0 V7.0 Update 1",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS neo V5.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC STEP 7 V20 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "TIA Portal Cloud V20 toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2024-54678 et CVE-2025-40759",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "Siprotec 4 toutes versions et tous mod\u00e8les except\u00e9s 7SA6, 7SD5, 7SD610 pour la vuln\u00e9rabilit\u00e9 CVE-2024-52504. ",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC eaSie PCS 7 Skill Package (6DL5424-0BX00-0AV8) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XC-300/XR-300/XC-400/XR-500WG/XR-500 versions ant\u00e9rieures \u00e0 3.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-PLCSIM V17, V18 et V19 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC Unified PC Runtime V18, V19 et V20 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS 7 Advanced Process Faceplates V9.1 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 F Systems V6.4 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Information Server toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-47809",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 F Systems V6.3 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ProSave V20 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS 7 Logic Matrix V9.1 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "WinCC Panel Image Setup toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC PCS neo V4.1 et V5.0 toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2024-54678.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Route Control V10.0 toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-30033",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC WinCC V8.1 versions ant\u00e9rieures \u00e0 V8.1 Update 3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2021-44879",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44879"
},
{
"name": "CVE-2023-3567",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3567"
},
{
"name": "CVE-2023-5178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5178"
},
{
"name": "CVE-2023-5678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5678"
},
{
"name": "CVE-2023-5717",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5717"
},
{
"name": "CVE-2023-39198",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39198"
},
{
"name": "CVE-2023-45863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45863"
},
{
"name": "CVE-2023-6931",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6931"
},
{
"name": "CVE-2023-6606",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6606"
},
{
"name": "CVE-2023-6121",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6121"
},
{
"name": "CVE-2023-51779",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51779"
},
{
"name": "CVE-2023-6932",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6932"
},
{
"name": "CVE-2024-0193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0193"
},
{
"name": "CVE-2023-6040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6040"
},
{
"name": "CVE-2023-46343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46343"
},
{
"name": "CVE-2023-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35827"
},
{
"name": "CVE-2024-0646",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0646"
},
{
"name": "CVE-2023-51782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51782"
},
{
"name": "CVE-2023-51781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51781"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2024-1086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1086"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2023-52597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52597"
},
{
"name": "CVE-2024-26598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26598"
},
{
"name": "CVE-2023-52598",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52598"
},
{
"name": "CVE-2023-52601",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52601"
},
{
"name": "CVE-2023-52600",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52600"
},
{
"name": "CVE-2023-52602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52602"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2024-26581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26581"
},
{
"name": "CVE-2023-52606",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52606"
},
{
"name": "CVE-2023-52604",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52604"
},
{
"name": "CVE-2023-52587",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52587"
},
{
"name": "CVE-2023-52599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52599"
},
{
"name": "CVE-2023-52583",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52583"
},
{
"name": "CVE-2023-52603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52603"
},
{
"name": "CVE-2023-52607",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52607"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2023-52595",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52595"
},
{
"name": "CVE-2024-26602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26602"
},
{
"name": "CVE-2023-52340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52340"
},
{
"name": "CVE-2023-52475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52475"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2023-52502",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52502"
},
{
"name": "CVE-2024-26593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26593"
},
{
"name": "CVE-2024-0584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0584"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52617",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52617"
},
{
"name": "CVE-2024-26645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26645"
},
{
"name": "CVE-2024-0841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0841"
},
{
"name": "CVE-2023-52477",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52477"
},
{
"name": "CVE-2023-52504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52504"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2023-52509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52509"
},
{
"name": "CVE-2023-52637",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52637"
},
{
"name": "CVE-2023-52507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52507"
},
{
"name": "CVE-2024-26664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26664"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-52510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52510"
},
{
"name": "CVE-2024-26754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26754"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2024-26606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26606"
},
{
"name": "CVE-2024-26702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26702"
},
{
"name": "CVE-2024-26766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26766"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2024-26752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26752"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26749"
},
{
"name": "CVE-2024-26688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26688"
},
{
"name": "CVE-2024-26763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26763"
},
{
"name": "CVE-2024-26722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26722"
},
{
"name": "CVE-2024-26777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26777"
},
{
"name": "CVE-2024-26779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26779"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2024-26788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26788"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26778",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26778"
},
{
"name": "CVE-2024-26790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26790"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26751"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2023-52581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52581"
},
{
"name": "CVE-2024-26839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26839"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2024-26910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26910"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26835"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-26825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26825"
},
{
"name": "CVE-2023-52433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52433"
},
{
"name": "CVE-2023-52654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52654"
},
{
"name": "CVE-2023-52655",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52655"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39484"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39495",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39495"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40905"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40963"
},
{
"name": "CVE-2024-40968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40968"
},
{
"name": "CVE-2024-40971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40971"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40980"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41000"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2022-48666",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48666"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2024-41020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41020"
},
{
"name": "CVE-2024-41022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41022"
},
{
"name": "CVE-2024-41034",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41034"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2024-41046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41046"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2024-41068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41068"
},
{
"name": "CVE-2024-41077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41077"
},
{
"name": "CVE-2024-42101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42101"
},
{
"name": "CVE-2024-42143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42143"
},
{
"name": "CVE-2024-42148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42148"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2024-42153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42153"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-42232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42232"
},
{
"name": "CVE-2024-42236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42236"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2024-42247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42247"
},
{
"name": "CVE-2024-42082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42082"
},
{
"name": "CVE-2023-52887",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52887"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2024-42076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42076"
},
{
"name": "CVE-2024-42077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42077"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2024-42086",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42086"
},
{
"name": "CVE-2024-42087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42087"
},
{
"name": "CVE-2024-42092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42092"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2024-42095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42095"
},
{
"name": "CVE-2022-48935",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48935"
},
{
"name": "CVE-2024-43861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43861"
},
{
"name": "CVE-2024-43867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43867"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2024-43879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43879"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2024-43882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43882"
},
{
"name": "CVE-2024-43883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43883"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-43893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43893"
},
{
"name": "CVE-2024-43894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43894"
},
{
"name": "CVE-2024-43907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43907"
},
{
"name": "CVE-2024-43908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43908"
},
{
"name": "CVE-2024-45003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45003"
},
{
"name": "CVE-2024-44987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44987"
},
{
"name": "CVE-2024-44988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44988"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2024-44995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44995"
},
{
"name": "CVE-2024-44998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44998"
},
{
"name": "CVE-2024-44999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44999"
},
{
"name": "CVE-2024-45006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45006"
},
{
"name": "CVE-2024-45008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45008"
},
{
"name": "CVE-2024-45021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45021"
},
{
"name": "CVE-2024-45025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45025"
},
{
"name": "CVE-2024-46673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46673"
},
{
"name": "CVE-2024-46674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46674"
},
{
"name": "CVE-2024-46675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46675"
},
{
"name": "CVE-2024-46676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46676"
},
{
"name": "CVE-2024-46677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46677"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2024-46685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46685"
},
{
"name": "CVE-2024-46689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46689"
},
{
"name": "CVE-2024-46702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46702"
},
{
"name": "CVE-2024-46707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46707"
},
{
"name": "CVE-2024-46713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46713"
},
{
"name": "CVE-2024-46714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46714"
},
{
"name": "CVE-2024-46719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46719"
},
{
"name": "CVE-2024-46721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46721"
},
{
"name": "CVE-2024-46722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46722"
},
{
"name": "CVE-2024-46723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46723"
},
{
"name": "CVE-2024-46724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46724"
},
{
"name": "CVE-2024-46725",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46725"
},
{
"name": "CVE-2024-46731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46731"
},
{
"name": "CVE-2024-46737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46737"
},
{
"name": "CVE-2024-46738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46738"
},
{
"name": "CVE-2024-46739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46739"
},
{
"name": "CVE-2024-46740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46740"
},
{
"name": "CVE-2024-46743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46743"
},
{
"name": "CVE-2024-46744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46744"
},
{
"name": "CVE-2024-46745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46745"
},
{
"name": "CVE-2024-46747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46747"
},
{
"name": "CVE-2024-46750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46750"
},
{
"name": "CVE-2024-46755",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46755"
},
{
"name": "CVE-2024-46756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46756"
},
{
"name": "CVE-2024-46757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46757"
},
{
"name": "CVE-2024-46758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46758"
},
{
"name": "CVE-2024-46759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46759"
},
{
"name": "CVE-2024-46761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46761"
},
{
"name": "CVE-2024-46763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46763"
},
{
"name": "CVE-2024-46771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46771"
},
{
"name": "CVE-2024-46777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46777"
},
{
"name": "CVE-2024-46780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46780"
},
{
"name": "CVE-2024-46781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46781"
},
{
"name": "CVE-2024-46782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46782"
},
{
"name": "CVE-2024-46783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46783"
},
{
"name": "CVE-2024-46791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46791"
},
{
"name": "CVE-2024-46798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46798"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2024-46804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46804"
},
{
"name": "CVE-2024-46814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46814"
},
{
"name": "CVE-2024-46815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46815"
},
{
"name": "CVE-2024-46817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46817"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2024-46819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46819"
},
{
"name": "CVE-2024-46822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46822"
},
{
"name": "CVE-2024-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46828"
},
{
"name": "CVE-2024-46829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46829"
},
{
"name": "CVE-2024-46832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46832"
},
{
"name": "CVE-2024-46840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46840"
},
{
"name": "CVE-2024-46844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46844"
},
{
"name": "CVE-2024-43890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43890"
},
{
"name": "CVE-2024-43914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43914"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2024-44944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44944"
},
{
"name": "CVE-2024-44952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44952"
},
{
"name": "CVE-2024-44954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44954"
},
{
"name": "CVE-2024-44960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44960"
},
{
"name": "CVE-2024-44965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44965"
},
{
"name": "CVE-2024-44969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44969"
},
{
"name": "CVE-2024-44971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44971"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2024-47659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47659"
},
{
"name": "CVE-2024-47663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47663"
},
{
"name": "CVE-2024-47667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47667"
},
{
"name": "CVE-2024-47669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47669"
},
{
"name": "CVE-2024-9681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9681"
},
{
"name": "CVE-2023-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52917"
},
{
"name": "CVE-2023-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52919"
},
{
"name": "CVE-2024-47660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47660"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-47685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47685"
},
{
"name": "CVE-2024-47692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47692"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47697"
},
{
"name": "CVE-2024-47698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47698"
},
{
"name": "CVE-2024-47699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47699"
},
{
"name": "CVE-2024-47705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47705"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-47709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47709"
},
{
"name": "CVE-2024-47710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47710"
},
{
"name": "CVE-2024-47712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47712"
},
{
"name": "CVE-2024-47713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47713"
},
{
"name": "CVE-2024-47718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47718"
},
{
"name": "CVE-2024-47723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47723"
},
{
"name": "CVE-2024-47735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47735"
},
{
"name": "CVE-2024-47737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47737"
},
{
"name": "CVE-2024-47739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47739"
},
{
"name": "CVE-2024-47742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47742"
},
{
"name": "CVE-2024-47747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47747"
},
{
"name": "CVE-2024-47748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47748"
},
{
"name": "CVE-2024-47749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47749"
},
{
"name": "CVE-2024-47756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47756"
},
{
"name": "CVE-2024-47757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47757"
},
{
"name": "CVE-2024-49851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49851"
},
{
"name": "CVE-2024-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49858"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49863"
},
{
"name": "CVE-2024-49867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49867"
},
{
"name": "CVE-2024-49875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49875"
},
{
"name": "CVE-2024-49877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49877"
},
{
"name": "CVE-2024-49878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49878"
},
{
"name": "CVE-2024-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49879"
},
{
"name": "CVE-2024-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49881"
},
{
"name": "CVE-2024-49882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49882"
},
{
"name": "CVE-2024-49883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49883"
},
{
"name": "CVE-2024-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49890"
},
{
"name": "CVE-2024-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49892"
},
{
"name": "CVE-2024-49894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49894"
},
{
"name": "CVE-2024-49895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49895"
},
{
"name": "CVE-2024-49896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49896"
},
{
"name": "CVE-2024-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49900"
},
{
"name": "CVE-2024-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49901"
},
{
"name": "CVE-2024-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49902"
},
{
"name": "CVE-2024-49903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49903"
},
{
"name": "CVE-2024-49907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49907"
},
{
"name": "CVE-2024-49913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49913"
},
{
"name": "CVE-2024-49930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49930"
},
{
"name": "CVE-2024-49933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49933"
},
{
"name": "CVE-2024-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49936"
},
{
"name": "CVE-2024-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49938"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2024-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49955"
},
{
"name": "CVE-2024-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49957"
},
{
"name": "CVE-2024-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49958"
},
{
"name": "CVE-2024-49959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49959"
},
{
"name": "CVE-2024-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49962"
},
{
"name": "CVE-2024-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49963"
},
{
"name": "CVE-2024-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49965"
},
{
"name": "CVE-2024-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49966"
},
{
"name": "CVE-2024-49967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49967"
},
{
"name": "CVE-2024-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49969"
},
{
"name": "CVE-2024-49973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49973"
},
{
"name": "CVE-2024-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49975"
},
{
"name": "CVE-2024-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49981"
},
{
"name": "CVE-2024-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49982"
},
{
"name": "CVE-2024-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49985"
},
{
"name": "CVE-2024-49993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49993"
},
{
"name": "CVE-2024-49995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49995"
},
{
"name": "CVE-2024-50001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50001"
},
{
"name": "CVE-2024-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50006"
},
{
"name": "CVE-2024-50007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50007"
},
{
"name": "CVE-2024-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50008"
},
{
"name": "CVE-2024-50013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50013"
},
{
"name": "CVE-2024-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50015"
},
{
"name": "CVE-2024-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50024"
},
{
"name": "CVE-2024-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50033"
},
{
"name": "CVE-2024-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50035"
},
{
"name": "CVE-2024-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50040"
},
{
"name": "CVE-2024-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50044"
},
{
"name": "CVE-2024-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50045"
},
{
"name": "CVE-2024-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50046"
},
{
"name": "CVE-2024-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50049"
},
{
"name": "CVE-2024-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50059"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-44949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44949"
},
{
"name": "CVE-2024-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50218"
},
{
"name": "CVE-2024-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50234"
},
{
"name": "CVE-2024-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50236"
},
{
"name": "CVE-2024-50237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50237"
},
{
"name": "CVE-2024-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50251"
},
{
"name": "CVE-2024-50262",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50262"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50267"
},
{
"name": "CVE-2024-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50268"
},
{
"name": "CVE-2024-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50269"
},
{
"name": "CVE-2024-50273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50273"
},
{
"name": "CVE-2024-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50278"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50282"
},
{
"name": "CVE-2024-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50287"
},
{
"name": "CVE-2024-50290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50290"
},
{
"name": "CVE-2024-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50292"
},
{
"name": "CVE-2024-50295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50295"
},
{
"name": "CVE-2024-50296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50296"
},
{
"name": "CVE-2024-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50299"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53052"
},
{
"name": "CVE-2024-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53057"
},
{
"name": "CVE-2024-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53059"
},
{
"name": "CVE-2024-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53060"
},
{
"name": "CVE-2024-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53061"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53066"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53241"
},
{
"name": "CVE-2024-53240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53240"
},
{
"name": "CVE-2024-47679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47679"
},
{
"name": "CVE-2024-47701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47701"
},
{
"name": "CVE-2024-47740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47740"
},
{
"name": "CVE-2024-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49868"
},
{
"name": "CVE-2024-49884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49884"
},
{
"name": "CVE-2024-49889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49889"
},
{
"name": "CVE-2024-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49924"
},
{
"name": "CVE-2024-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49944"
},
{
"name": "CVE-2024-49948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49948"
},
{
"name": "CVE-2024-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49952"
},
{
"name": "CVE-2024-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49977"
},
{
"name": "CVE-2024-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49983"
},
{
"name": "CVE-2024-49997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49997"
},
{
"name": "CVE-2024-50039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50039"
},
{
"name": "CVE-2024-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50095"
},
{
"name": "CVE-2024-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50096"
},
{
"name": "CVE-2024-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50179"
},
{
"name": "CVE-2024-50180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50180"
},
{
"name": "CVE-2024-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50181"
},
{
"name": "CVE-2024-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50184"
},
{
"name": "CVE-2024-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50188"
},
{
"name": "CVE-2024-50089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50089"
},
{
"name": "CVE-2024-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50194"
},
{
"name": "CVE-2024-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50195"
},
{
"name": "CVE-2024-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50198"
},
{
"name": "CVE-2024-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50201"
},
{
"name": "CVE-2024-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53101"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50083"
},
{
"name": "CVE-2024-50185",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50185"
},
{
"name": "CVE-2024-50193",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50193"
},
{
"name": "CVE-2024-50199",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50199"
},
{
"name": "CVE-2024-50202",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50202"
},
{
"name": "CVE-2024-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53097"
},
{
"name": "CVE-2024-53103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53103"
},
{
"name": "CVE-2024-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53146"
},
{
"name": "CVE-2024-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53148"
},
{
"name": "CVE-2024-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53150"
},
{
"name": "CVE-2024-53155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53155"
},
{
"name": "CVE-2024-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53156"
},
{
"name": "CVE-2024-53157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53157"
},
{
"name": "CVE-2024-53158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53158"
},
{
"name": "CVE-2024-53161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53161"
},
{
"name": "CVE-2024-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53171"
},
{
"name": "CVE-2024-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53173"
},
{
"name": "CVE-2024-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53174"
},
{
"name": "CVE-2024-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53214"
},
{
"name": "CVE-2024-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53217"
},
{
"name": "CVE-2024-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53237"
},
{
"name": "CVE-2024-56539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56539"
},
{
"name": "CVE-2024-56562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56562"
},
{
"name": "CVE-2024-56567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56567"
},
{
"name": "CVE-2024-56576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56576"
},
{
"name": "CVE-2024-56605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56605"
},
{
"name": "CVE-2024-56645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56645"
},
{
"name": "CVE-2024-56754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56754"
},
{
"name": "CVE-2024-56756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56756"
},
{
"name": "CVE-2024-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53239"
},
{
"name": "CVE-2024-56548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56548"
},
{
"name": "CVE-2024-56570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56570"
},
{
"name": "CVE-2024-56571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56571"
},
{
"name": "CVE-2024-56598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56598"
},
{
"name": "CVE-2024-56619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56619"
},
{
"name": "CVE-2024-56704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56704"
},
{
"name": "CVE-2024-47143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47143"
},
{
"name": "CVE-2024-48881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48881"
},
{
"name": "CVE-2024-50051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50051"
},
{
"name": "CVE-2024-52332",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52332"
},
{
"name": "CVE-2024-53172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53172"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-53198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53198"
},
{
"name": "CVE-2024-53227",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53227"
},
{
"name": "CVE-2024-56531",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56531"
},
{
"name": "CVE-2024-56532",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56532"
},
{
"name": "CVE-2024-56533",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56533"
},
{
"name": "CVE-2024-56558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56558"
},
{
"name": "CVE-2024-56568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56568"
},
{
"name": "CVE-2024-56569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56569"
},
{
"name": "CVE-2024-56572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56572"
},
{
"name": "CVE-2024-56574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56574"
},
{
"name": "CVE-2024-56587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56587"
},
{
"name": "CVE-2024-56589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56589"
},
{
"name": "CVE-2024-56593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56593"
},
{
"name": "CVE-2024-56594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56594"
},
{
"name": "CVE-2024-56595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56595"
},
{
"name": "CVE-2024-56596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56596"
},
{
"name": "CVE-2024-56597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56597"
},
{
"name": "CVE-2024-56602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56602"
},
{
"name": "CVE-2024-56603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56603"
},
{
"name": "CVE-2024-56606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56606"
},
{
"name": "CVE-2024-56615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56615"
},
{
"name": "CVE-2024-56623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56623"
},
{
"name": "CVE-2024-56629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56629"
},
{
"name": "CVE-2024-56630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56630"
},
{
"name": "CVE-2024-56634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56634"
},
{
"name": "CVE-2024-56636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56636"
},
{
"name": "CVE-2024-56637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56637"
},
{
"name": "CVE-2024-56642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56642"
},
{
"name": "CVE-2024-56643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56643"
},
{
"name": "CVE-2024-56644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56644"
},
{
"name": "CVE-2024-56648",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56648"
},
{
"name": "CVE-2024-56659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56659"
},
{
"name": "CVE-2024-56661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56661"
},
{
"name": "CVE-2024-56662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56662"
},
{
"name": "CVE-2024-56670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56670"
},
{
"name": "CVE-2024-56681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56681"
},
{
"name": "CVE-2024-56688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56688"
},
{
"name": "CVE-2024-56690",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56690"
},
{
"name": "CVE-2024-56691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56691"
},
{
"name": "CVE-2024-56698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56698"
},
{
"name": "CVE-2024-56700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56700"
},
{
"name": "CVE-2024-56701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56701"
},
{
"name": "CVE-2024-56705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56705"
},
{
"name": "CVE-2024-56723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56723"
},
{
"name": "CVE-2024-56724",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56724"
},
{
"name": "CVE-2024-56739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56739"
},
{
"name": "CVE-2024-56741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56741"
},
{
"name": "CVE-2024-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56746"
},
{
"name": "CVE-2024-56747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56747"
},
{
"name": "CVE-2024-56748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56748"
},
{
"name": "CVE-2024-56779",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56779"
},
{
"name": "CVE-2024-56780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56780"
},
{
"name": "CVE-2024-57874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57874"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2024-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50304"
},
{
"name": "CVE-2024-56600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56600"
},
{
"name": "CVE-2024-56601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56601"
},
{
"name": "CVE-2024-56610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56610"
},
{
"name": "CVE-2024-56650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56650"
},
{
"name": "CVE-2024-56728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56728"
},
{
"name": "CVE-2024-56633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56633"
},
{
"name": "CVE-2022-49034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49034"
},
{
"name": "CVE-2024-49971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49971"
},
{
"name": "CVE-2024-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53145"
},
{
"name": "CVE-2024-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53165"
},
{
"name": "CVE-2024-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53181"
},
{
"name": "CVE-2024-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53183"
},
{
"name": "CVE-2024-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53184"
},
{
"name": "CVE-2024-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53226"
},
{
"name": "CVE-2024-56720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56720"
},
{
"name": "CVE-2024-43098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43098"
},
{
"name": "CVE-2024-53680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53680"
},
{
"name": "CVE-2024-56581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56581"
},
{
"name": "CVE-2024-56586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56586"
},
{
"name": "CVE-2024-56770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56770"
},
{
"name": "CVE-2024-56781",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56781"
},
{
"name": "CVE-2024-56785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56785"
},
{
"name": "CVE-2021-47316",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47316"
},
{
"name": "CVE-2024-54678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54678"
},
{
"name": "CVE-2025-30033",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30033"
},
{
"name": "CVE-2025-30034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30034"
},
{
"name": "CVE-2025-40570",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40570"
},
{
"name": "CVE-2025-40746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40746"
},
{
"name": "CVE-2025-40751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40751"
},
{
"name": "CVE-2025-40752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40752"
},
{
"name": "CVE-2025-40753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40753"
},
{
"name": "CVE-2025-40759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40759"
},
{
"name": "CVE-2025-47809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47809"
},
{
"name": "CVE-2024-52504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52504"
}
],
"initial_release_date": "2025-08-12T00:00:00",
"last_revision_date": "2025-08-12T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0677",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-08-12T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits Siemens. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits Siemens",
"vendor_advisories": [
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-707630",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-707630.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-331739",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-331739.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-693808",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-693808.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-613116",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-613116.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-493396",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-493396.html"
},
{
"published_at": "2025-08-11",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens ssa-400089",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-400089.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-493787",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-493787.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-894058",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-894058.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-355557",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-355557.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-529291",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-529291.html"
},
{
"published_at": "2025-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-282044",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-282044.html"
}
]
}
CERTFR-2026-AVI-1165
Vulnerability from certfr_avis - Published: 2026-09-11 - Updated: 2026-09-11
De multiples vulnérabilités ont été découvertes dans les produits IBM. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| IBM | Db2 | Db2 Common Container sans le correctif de sécurité 1159cn3 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 15.0.x antérieures à 15.0.1.14 | ||
| IBM | QRadar Hub | QRadar Hub versions antérieures à 3.9.1 | ||
| IBM | WebSphere Application Server | WebSphere Application Server Liberty versions antérieures à 26.0.0.10 (disponibilité prévue pour le quatrième trimestre 2026) | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 12.10 antérieures à InformixHQ 3.3.1 | ||
| IBM | Informix Dynamic Server | Informix Dynamic Server versions 14.10.x antérieures à 14.10.xC14 | ||
| IBM | Db2 | Db2 versions V11.5.x sans le correctif de sécurité DT495924, DT474170, DT495462, DT470425 et DT501356 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Bridge versions antérieures à 1.1.5.2 | ||
| IBM | Db2 | Db2 Warehouse on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Sterling Partner Engagement Manager Standard Edition | Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x antérieures à 6.2.4.5 | ||
| IBM | Db2 | Db2 Developer Extension versions 1.1.x antérieures à 1.1.2 | ||
| IBM | Sterling Partner Engagement Manager Essentials Edition | Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x antérieures à 6.3.0.3 | ||
| IBM | Db2 | Db2 on Cloud Pak for Data versions antérieures à v5.4 patch 6 | ||
| IBM | Db2 | Db2 versions V12.1 sans le correctif de sécurité DT495924, DT495462 et DT474170 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Db2 Common Container sans le correctif de s\u00e9curit\u00e9 1159cn3",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 15.0.x ant\u00e9rieures \u00e0 15.0.1.14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "QRadar Hub versions ant\u00e9rieures \u00e0 3.9.1",
"product": {
"name": "QRadar Hub",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "WebSphere Application Server Liberty versions ant\u00e9rieures \u00e0 26.0.0.10 (disponibilit\u00e9 pr\u00e9vue pour le quatri\u00e8me trimestre 2026)",
"product": {
"name": "WebSphere Application Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 12.10 ant\u00e9rieures \u00e0 InformixHQ 3.3.1",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Informix Dynamic Server versions 14.10.x ant\u00e9rieures \u00e0 14.10.xC14",
"product": {
"name": "Informix Dynamic Server",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V11.5.x sans le correctif de s\u00e9curit\u00e9 DT495924, DT474170, DT495462, DT470425 et DT501356",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Bridge versions ant\u00e9rieures \u00e0 1.1.5.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Warehouse on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Standard Edition versions 6.2.4.x ant\u00e9rieures \u00e0 6.2.4.5",
"product": {
"name": "Sterling Partner Engagement Manager Standard Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 Developer Extension versions 1.1.x ant\u00e9rieures \u00e0 1.1.2",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Sterling Partner Engagement Manager Essentials Edition versions 6.3.0.x ant\u00e9rieures \u00e0 6.3.0.3",
"product": {
"name": "Sterling Partner Engagement Manager Essentials Edition",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 on Cloud Pak for Data versions ant\u00e9rieures \u00e0 v5.4 patch 6",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
},
{
"description": "Db2 versions V12.1 sans le correctif de s\u00e9curit\u00e9 DT495924, DT495462 et DT474170",
"product": {
"name": "Db2",
"vendor": {
"name": "IBM",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2026-75595",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75595"
},
{
"name": "CVE-2026-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49978"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2023-52471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52471"
},
{
"name": "CVE-2026-5588",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5588"
},
{
"name": "CVE-2021-33036",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33036"
},
{
"name": "CVE-2021-44906",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-44906"
},
{
"name": "CVE-2026-54264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54264"
},
{
"name": "CVE-2024-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50142"
},
{
"name": "CVE-2026-59651",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59651"
},
{
"name": "CVE-2026-45819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45819"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2026-50557",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50557"
},
{
"name": "CVE-2024-41093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41093"
},
{
"name": "CVE-2026-59295",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59295"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2023-43642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-43642"
},
{
"name": "CVE-2021-21409",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21409"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2018-14042",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14042"
},
{
"name": "CVE-2024-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35939"
},
{
"name": "CVE-2025-2534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2534"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2026-41254",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41254"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-39503",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39503"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-42246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42246"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2026-16480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16480"
},
{
"name": "CVE-2018-1334",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1334"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2024-26974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26974"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2026-32990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-32990"
},
{
"name": "CVE-2024-26595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26595"
},
{
"name": "CVE-2026-50645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50645"
},
{
"name": "CVE-2026-22610",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22610"
},
{
"name": "CVE-2024-42292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42292"
},
{
"name": "CVE-2026-42041",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42041"
},
{
"name": "CVE-2014-125087",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-125087"
},
{
"name": "CVE-2026-14686",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14686"
},
{
"name": "CVE-2026-68763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68763"
},
{
"name": "CVE-2023-1370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1370"
},
{
"name": "CVE-2026-45416",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45416"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-33201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33201"
},
{
"name": "CVE-2026-10050",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10050"
},
{
"name": "CVE-2024-27010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27010"
},
{
"name": "CVE-2024-42284",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42284"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2026-53666",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53666"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2026-59648",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59648"
},
{
"name": "CVE-2026-69153",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69153"
},
{
"name": "CVE-2026-3621",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-3621"
},
{
"name": "CVE-2026-43515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43515"
},
{
"name": "CVE-2026-42402",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42402"
},
{
"name": "CVE-2021-47304",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47304"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2022-48632",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48632"
},
{
"name": "CVE-2026-43868",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43868"
},
{
"name": "CVE-2026-50560",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50560"
},
{
"name": "CVE-2024-26586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26586"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2015-5237",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-5237"
},
{
"name": "CVE-2026-71290",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71290"
},
{
"name": "CVE-2019-10099",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-10099"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2026-41716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41716"
},
{
"name": "CVE-2018-11760",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11760"
},
{
"name": "CVE-2026-15328",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15328"
},
{
"name": "CVE-2026-59645",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59645"
},
{
"name": "CVE-2022-45688",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45688"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-23944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23944"
},
{
"name": "CVE-2022-33891",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33891"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2026-13006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13006"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2018-8024",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8024"
},
{
"name": "CVE-2021-47284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47284"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2024-49350",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49350"
},
{
"name": "CVE-2022-48619",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48619"
},
{
"name": "CVE-2024-46679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46679"
},
{
"name": "CVE-2025-66412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66412"
},
{
"name": "CVE-2025-36131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36131"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2026-54514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54514"
},
{
"name": "CVE-2023-52756",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52756"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2018-14040",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14040"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2026-77414",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77414"
},
{
"name": "CVE-2020-11988",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11988"
},
{
"name": "CVE-2021-46939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46939"
},
{
"name": "CVE-2025-56200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-56200"
},
{
"name": "CVE-2024-37071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37071"
},
{
"name": "CVE-2026-77413",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77413"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2026-54399",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54399"
},
{
"name": "CVE-2026-53668",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53668"
},
{
"name": "CVE-2024-41038",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41038"
},
{
"name": "CVE-2025-30065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30065"
},
{
"name": "CVE-2026-16243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16243"
},
{
"name": "CVE-2016-4055",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-4055"
},
{
"name": "CVE-2026-9171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9171"
},
{
"name": "CVE-2026-67214",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67214"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2024-25638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25638"
},
{
"name": "CVE-2026-12185",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12185"
},
{
"name": "CVE-2026-59921",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59921"
},
{
"name": "CVE-2024-47118",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47118"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2026-47010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47010"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2023-45288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45288"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2026-14685",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14685"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-45178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45178"
},
{
"name": "CVE-2026-54171",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54171"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2022-31160",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31160"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2020-10683",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10683"
},
{
"name": "CVE-2018-1273",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1273"
},
{
"name": "CVE-2026-41239",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41239"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2026-33814",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33814"
},
{
"name": "CVE-2023-28746",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28746"
},
{
"name": "CVE-2026-47891",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47891"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2024-42114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42114"
},
{
"name": "CVE-2020-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26945"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2026-68569",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68569"
},
{
"name": "CVE-2026-59084",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59084"
},
{
"name": "CVE-2026-65183",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65183"
},
{
"name": "CVE-2024-35897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35897"
},
{
"name": "CVE-2026-14257",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14257"
},
{
"name": "CVE-2026-41901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41901"
},
{
"name": "CVE-2026-73088",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73088"
},
{
"name": "CVE-2023-52478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52478"
},
{
"name": "CVE-2024-23945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23945"
},
{
"name": "CVE-2021-41182",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41182"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2022-25647",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25647"
},
{
"name": "CVE-2026-9072",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9072"
},
{
"name": "CVE-2022-26612",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26612"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2026-18097",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18097"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-42084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42084"
},
{
"name": "CVE-2021-47455",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47455"
},
{
"name": "CVE-2023-52492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52492"
},
{
"name": "CVE-2022-36364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36364"
},
{
"name": "CVE-2026-73089",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73089"
},
{
"name": "CVE-2023-34610",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34610"
},
{
"name": "CVE-2026-47057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47057"
},
{
"name": "CVE-2024-47561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47561"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-31881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31881"
},
{
"name": "CVE-2019-11358",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-11358"
},
{
"name": "CVE-2026-69152",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69152"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2026-68525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68525"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2026-59901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59901"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-35839",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35839"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2026-14525",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14525"
},
{
"name": "CVE-2026-67313",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67313"
},
{
"name": "CVE-2020-13955",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-13955"
},
{
"name": "CVE-2024-42154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42154"
},
{
"name": "CVE-2024-42228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42228"
},
{
"name": "CVE-2026-8858",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8858"
},
{
"name": "CVE-2026-42580",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42580"
},
{
"name": "CVE-2021-47352",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47352"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2026-41691",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41691"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-43889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43889"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-26859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26859"
},
{
"name": "CVE-2026-65637",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65637"
},
{
"name": "CVE-2018-8009",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8009"
},
{
"name": "CVE-2026-50163",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50163"
},
{
"name": "CVE-2026-67315",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67315"
},
{
"name": "CVE-2026-54516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54516"
},
{
"name": "CVE-2026-55223",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55223"
},
{
"name": "CVE-2025-7962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7962"
},
{
"name": "CVE-2026-18499",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18499"
},
{
"name": "CVE-2019-20444",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20444"
},
{
"name": "CVE-2026-54515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54515"
},
{
"name": "CVE-2026-5516",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5516"
},
{
"name": "CVE-2023-34462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34462"
},
{
"name": "CVE-2024-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41007"
},
{
"name": "CVE-2026-41721",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41721"
},
{
"name": "CVE-2018-1313",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1313"
},
{
"name": "CVE-2026-16221",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16221"
},
{
"name": "CVE-2023-34454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34454"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2022-46337",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-46337"
},
{
"name": "CVE-2026-6790",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6790"
},
{
"name": "CVE-2026-65911",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65911"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2026-18401",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18401"
},
{
"name": "CVE-2021-35516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35516"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26686"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2023-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44487"
},
{
"name": "CVE-2024-29857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29857"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-26645",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26645"
},
{
"name": "CVE-2026-66143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66143"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-42240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42240"
},
{
"name": "CVE-2026-66144",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66144"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2026-44494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44494"
},
{
"name": "CVE-2023-26049",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26049"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2026-42585",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42585"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-45018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45018"
},
{
"name": "CVE-2026-12860",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12860"
},
{
"name": "CVE-2026-10571",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10571"
},
{
"name": "CVE-2024-34447",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34447"
},
{
"name": "CVE-2026-65901",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65901"
},
{
"name": "CVE-2026-11541",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11541"
},
{
"name": "CVE-2014-3578",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-3578"
},
{
"name": "CVE-2026-41635",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41635"
},
{
"name": "CVE-2024-43871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43871"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2024-31880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31880"
},
{
"name": "CVE-2024-29025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29025"
},
{
"name": "CVE-2024-43880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43880"
},
{
"name": "CVE-2021-47461",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47461"
},
{
"name": "CVE-2026-11546",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11546"
},
{
"name": "CVE-2026-42036",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42036"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2026-64607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64607"
},
{
"name": "CVE-2026-59652",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59652"
},
{
"name": "CVE-2024-27042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27042"
},
{
"name": "CVE-2023-34453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34453"
},
{
"name": "CVE-2024-26669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26669"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27043"
},
{
"name": "CVE-2024-41761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41761"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2026-65903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65903"
},
{
"name": "CVE-2021-47311",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47311"
},
{
"name": "CVE-2026-65900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65900"
},
{
"name": "CVE-2026-66010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66010"
},
{
"name": "CVE-2026-52746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-52746"
},
{
"name": "CVE-2024-28762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28762"
},
{
"name": "CVE-2023-3635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3635"
},
{
"name": "CVE-2026-43827",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43827"
},
{
"name": "CVE-2026-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50184"
},
{
"name": "CVE-2026-47885",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47885"
},
{
"name": "CVE-2026-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50169"
},
{
"name": "CVE-2021-47287",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47287"
},
{
"name": "CVE-2021-47338",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47338"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2026-47065",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47065"
},
{
"name": "CVE-2026-55831",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55831"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2023-5072",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5072"
},
{
"name": "CVE-2026-47841",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47841"
},
{
"name": "CVE-2021-23337",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23337"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2026-41707",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41707"
},
{
"name": "CVE-2021-23369",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-23369"
},
{
"name": "CVE-2026-77415",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77415"
},
{
"name": "CVE-2026-42403",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42403"
},
{
"name": "CVE-2024-41056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41056"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2022-31777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31777"
},
{
"name": "CVE-2019-14893",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-14893"
},
{
"name": "CVE-2026-10534",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10534"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2026-59880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59880"
},
{
"name": "CVE-2026-65432",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65432"
},
{
"name": "CVE-2026-59894",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59894"
},
{
"name": "CVE-2019-0231",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0231"
},
{
"name": "CVE-2023-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50298"
},
{
"name": "CVE-2026-15057",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15057"
},
{
"name": "CVE-2026-41607",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41607"
},
{
"name": "CVE-2024-26308",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26308"
},
{
"name": "CVE-2025-1992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1992"
},
{
"name": "CVE-2026-44248",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44248"
},
{
"name": "CVE-2018-20676",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20676"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-31141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31141"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2025-13755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13755"
},
{
"name": "CVE-2025-62718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62718"
},
{
"name": "CVE-2025-36136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36136"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-26931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26931"
},
{
"name": "CVE-2021-47560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47560"
},
{
"name": "CVE-2026-49458",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49458"
},
{
"name": "CVE-2026-4800",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4800"
},
{
"name": "CVE-2024-40974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40974"
},
{
"name": "CVE-2026-42584",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42584"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2026-4410",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-4410"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2026-44249",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44249"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2026-41284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41284"
},
{
"name": "CVE-2025-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36008"
},
{
"name": "CVE-2026-59647",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59647"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2021-35517",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35517"
},
{
"name": "CVE-2024-30172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30172"
},
{
"name": "CVE-2026-42577",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42577"
},
{
"name": "CVE-2026-58059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58059"
},
{
"name": "CVE-2026-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48978"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2021-47385",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47385"
},
{
"name": "CVE-2026-75596",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75596"
},
{
"name": "CVE-2026-8484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8484"
},
{
"name": "CVE-2026-8763",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8763"
},
{
"name": "CVE-2026-6051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6051"
},
{
"name": "CVE-2026-44598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44598"
},
{
"name": "CVE-2023-52486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52486"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2025-14917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14917"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2026-15325",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15325"
},
{
"name": "CVE-2021-47073",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47073"
},
{
"name": "CVE-2026-69247",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69247"
},
{
"name": "CVE-2026-49268",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49268"
},
{
"name": "CVE-2024-36124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36124"
},
{
"name": "CVE-2021-47579",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47579"
},
{
"name": "CVE-2026-33671",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33671"
},
{
"name": "CVE-2026-14976",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14976"
},
{
"name": "CVE-2026-5598",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-5598"
},
{
"name": "CVE-2025-68470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68470"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2026-65182",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65182"
},
{
"name": "CVE-2018-11087",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11087"
},
{
"name": "CVE-2026-42033",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42033"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2026-42035",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42035"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2026-18446",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18446"
},
{
"name": "CVE-2026-44495",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44495"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2026-41695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41695"
},
{
"name": "CVE-2024-23454",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23454"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2026-22740",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22740"
},
{
"name": "CVE-2026-47890",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47890"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2022-3510",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3510"
},
{
"name": "CVE-2026-59903",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59903"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2022-3509",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3509"
},
{
"name": "CVE-2026-14684",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14684"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2026-56746",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56746"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40983"
},
{
"name": "CVE-2021-37137",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37137"
},
{
"name": "CVE-2026-10842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10842"
},
{
"name": "CVE-2021-47236",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47236"
},
{
"name": "CVE-2023-51074",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51074"
},
{
"name": "CVE-2024-53122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53122"
},
{
"name": "CVE-2021-47373",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47373"
},
{
"name": "CVE-2026-9496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9496"
},
{
"name": "CVE-2026-34478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34478"
},
{
"name": "CVE-2026-42586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42586"
},
{
"name": "CVE-2026-35091",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35091"
},
{
"name": "CVE-2024-57807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57807"
},
{
"name": "CVE-2025-30474",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30474"
},
{
"name": "CVE-2024-41008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41008"
},
{
"name": "CVE-2026-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40984"
},
{
"name": "CVE-2021-41973",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41973"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2024-8184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8184"
},
{
"name": "CVE-2026-54428",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54428"
},
{
"name": "CVE-2026-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50162"
},
{
"name": "CVE-2026-42043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42043"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2025-11143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11143"
},
{
"name": "CVE-2026-15055",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15055"
},
{
"name": "CVE-2026-8646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8646"
},
{
"name": "CVE-2026-45822",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45822"
},
{
"name": "CVE-2025-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36006"
},
{
"name": "CVE-2026-40477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40477"
},
{
"name": "CVE-2023-35701",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-35701"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2026-47834",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47834"
},
{
"name": "CVE-2026-34480",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34480"
},
{
"name": "CVE-2026-14682",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14682"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2018-20677",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-20677"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2026-84305",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-84305"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2026-73180",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-73180"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2026-59869",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59869"
},
{
"name": "CVE-2026-47887",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47887"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2025-36186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36186"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2026-62243",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-62243"
},
{
"name": "CVE-2023-22946",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-22946"
},
{
"name": "CVE-2026-65904",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65904"
},
{
"name": "CVE-2026-58061",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58061"
},
{
"name": "CVE-2025-12758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12758"
},
{
"name": "CVE-2026-40175",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40175"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2026-69151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-69151"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-41005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41005"
},
{
"name": "CVE-2024-44935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44935"
},
{
"name": "CVE-2026-27970",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27970"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2026-9320",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9320"
},
{
"name": "CVE-2026-49459",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49459"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2021-36090",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36090"
},
{
"name": "CVE-2021-27568",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27568"
},
{
"name": "CVE-2026-6053",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6053"
},
{
"name": "CVE-2024-41039",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41039"
},
{
"name": "CVE-2024-23953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23953"
},
{
"name": "CVE-2026-54265",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54265"
},
{
"name": "CVE-2025-68161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68161"
},
{
"name": "CVE-2023-52451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52451"
},
{
"name": "CVE-2024-41097",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41097"
},
{
"name": "CVE-2021-38296",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38296"
},
{
"name": "CVE-2025-21785",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21785"
},
{
"name": "CVE-2022-24823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24823"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-26649",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26649"
},
{
"name": "CVE-2026-56624",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56624"
},
{
"name": "CVE-2023-34455",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34455"
},
{
"name": "CVE-2021-41184",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41184"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-29131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29131"
},
{
"name": "CVE-2021-41183",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-41183"
},
{
"name": "CVE-2024-42225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42225"
},
{
"name": "CVE-2024-29869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29869"
},
{
"name": "CVE-2026-41240",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41240"
},
{
"name": "CVE-2026-67317",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67317"
},
{
"name": "CVE-2026-40478",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40478"
},
{
"name": "CVE-2026-22748",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22748"
},
{
"name": "CVE-2025-33012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33012"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2026-34479",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34479"
},
{
"name": "CVE-2024-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52804"
},
{
"name": "CVE-2026-43828",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43828"
},
{
"name": "CVE-2026-42040",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42040"
},
{
"name": "CVE-2023-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36478"
},
{
"name": "CVE-2021-37136",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37136"
},
{
"name": "CVE-2018-1330",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1330"
},
{
"name": "CVE-2026-47027",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47027"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2026-47058",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47058"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-42244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42244"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2026-16441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16441"
},
{
"name": "CVE-2024-6763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6763"
},
{
"name": "CVE-2026-6052",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6052"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2026-14981",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14981"
},
{
"name": "CVE-2026-58060",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58060"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2021-21295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21295"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2026-42778",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42778"
},
{
"name": "CVE-2026-14683",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14683"
},
{
"name": "CVE-2021-47527",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47527"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2026-14529",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14529"
},
{
"name": "CVE-2019-0204",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-0204"
},
{
"name": "CVE-2024-26851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26851"
},
{
"name": "CVE-2022-2047",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2047"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2018-11793",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-11793"
},
{
"name": "CVE-2026-22741",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22741"
},
{
"name": "CVE-2023-39410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39410"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-25710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25710"
},
{
"name": "CVE-2026-12802",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12802"
},
{
"name": "CVE-2024-26837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26837"
},
{
"name": "CVE-2024-7254",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7254"
},
{
"name": "CVE-2024-46695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46695"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2020-9492",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9492"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2026-40181",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40181"
},
{
"name": "CVE-2023-52700",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52700"
},
{
"name": "CVE-2025-14923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14923"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2026-10649",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10649"
},
{
"name": "CVE-2026-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50020"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-29133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-29133"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2026-54512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54512"
},
{
"name": "CVE-2026-58063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58063"
},
{
"name": "CVE-2026-57819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-57819"
},
{
"name": "CVE-2026-42578",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42578"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2021-47495",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47495"
},
{
"name": "CVE-2024-35910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35910"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2022-48757",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48757"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2026-65899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65899"
},
{
"name": "CVE-2026-43514",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43514"
},
{
"name": "CVE-2026-45773",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45773"
},
{
"name": "CVE-2026-67319",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67319"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2026-10532",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10532"
},
{
"name": "CVE-2023-52470",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52470"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2022-24785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-24785"
},
{
"name": "CVE-2025-2518",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-2518"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2023-46120",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46120"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-57979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57979"
},
{
"name": "CVE-2024-52046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52046"
},
{
"name": "CVE-2021-43797",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43797"
},
{
"name": "CVE-2026-70907",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-70907"
},
{
"name": "CVE-2026-48589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48589"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2021-37404",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37404"
},
{
"name": "CVE-2021-47386",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47386"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2026-42404",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42404"
},
{
"name": "CVE-2024-41092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41092"
},
{
"name": "CVE-2022-45787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45787"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2018-1199",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1199"
},
{
"name": "CVE-2024-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-14041"
},
{
"name": "CVE-2021-47412",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47412"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2026-41586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41586"
},
{
"name": "CVE-2026-16192",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16192"
},
{
"name": "CVE-2024-5569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5569"
},
{
"name": "CVE-2026-2950",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2950"
},
{
"name": "CVE-2016-6811",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-6811"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2026-68945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68945"
},
{
"name": "CVE-2024-42238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42238"
},
{
"name": "CVE-2023-44981",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-44981"
},
{
"name": "CVE-2026-40895",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40895"
},
{
"name": "CVE-2026-47063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47063"
},
{
"name": "CVE-2025-1493",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1493"
},
{
"name": "CVE-2026-12816",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12816"
},
{
"name": "CVE-2021-47466",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47466"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-43830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43830"
},
{
"name": "CVE-2026-59083",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59083"
},
{
"name": "CVE-2025-27553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27553"
},
{
"name": "CVE-2024-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47535"
},
{
"name": "CVE-2026-45772",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45772"
},
{
"name": "CVE-2023-52428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52428"
},
{
"name": "CVE-2021-47289",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47289"
},
{
"name": "CVE-2023-52730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52730"
},
{
"name": "CVE-2024-42090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42090"
},
{
"name": "CVE-2026-41606",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41606"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2026-59888",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59888"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2026-10543",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10543"
},
{
"name": "CVE-2023-6040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6040"
},
{
"name": "CVE-2026-13149",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13149"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2026-47021",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47021"
},
{
"name": "CVE-2024-41042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41042"
},
{
"name": "CVE-2024-6485",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6485"
},
{
"name": "CVE-2026-47842",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47842"
},
{
"name": "CVE-2025-3050",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3050"
},
{
"name": "CVE-2023-40167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40167"
},
{
"name": "CVE-2018-1274",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1274"
},
{
"name": "CVE-2021-47383",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47383"
},
{
"name": "CVE-2026-59898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59898"
},
{
"name": "CVE-2026-16440",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16440"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2026-64958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-64958"
},
{
"name": "CVE-2024-9823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9823"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2026-66422",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66422"
},
{
"name": "CVE-2024-26939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26939"
},
{
"name": "CVE-2021-22569",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22569"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-36489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36489"
},
{
"name": "CVE-2024-41762",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41762"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2023-6378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6378"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2021-47384",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47384"
},
{
"name": "CVE-2026-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41006"
},
{
"name": "CVE-2026-41711",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41711"
},
{
"name": "CVE-2021-47321",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47321"
},
{
"name": "CVE-2026-45205",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45205"
},
{
"name": "CVE-2026-27830",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27830"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47018",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47018"
},
{
"name": "CVE-2026-44487",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44487"
},
{
"name": "CVE-2026-13506",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13506"
},
{
"name": "CVE-2024-26640",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26640"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2026-2482",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2482"
},
{
"name": "CVE-2026-11897",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11897"
},
{
"name": "CVE-2026-35092",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-35092"
},
{
"name": "CVE-2026-42038",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42038"
},
{
"name": "CVE-2026-49844",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-49844"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2021-46972",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46972"
},
{
"name": "CVE-2026-18096",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-18096"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2022-34169",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34169"
},
{
"name": "CVE-2026-2332",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2332"
},
{
"name": "CVE-2026-1561",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1561"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2026-42039",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42039"
},
{
"name": "CVE-2026-59879",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59879"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2026-46968",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-46968"
},
{
"name": "CVE-2026-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40972"
},
{
"name": "CVE-2024-43892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43892"
},
{
"name": "CVE-2026-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50010"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2023-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36479"
},
{
"name": "CVE-2024-50256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50256"
},
{
"name": "CVE-2026-59296",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59296"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2026-33672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-33672"
},
{
"name": "CVE-2026-75838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-75838"
},
{
"name": "CVE-2018-14041",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-14041"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2026-40983",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40983"
},
{
"name": "CVE-2024-24549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24549"
},
{
"name": "CVE-2026-42581",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42581"
},
{
"name": "CVE-2021-47408",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47408"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2025-0915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0915"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-29267",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29267"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2026-42779",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42779"
},
{
"name": "CVE-2021-47097",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47097"
},
{
"name": "CVE-2024-42322",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42322"
},
{
"name": "CVE-2026-43513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43513"
},
{
"name": "CVE-2023-28370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28370"
},
{
"name": "CVE-2024-42094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42094"
},
{
"name": "CVE-2026-54517",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54517"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26843"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2026-25639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25639"
},
{
"name": "CVE-2026-40973",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-40973"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2020-11022",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11022"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2026-15064",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15064"
},
{
"name": "CVE-2026-42044",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42044"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2021-31684",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-31684"
},
{
"name": "CVE-2025-25193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25193"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2026-8620",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8620"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2026-65905",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65905"
},
{
"name": "CVE-2026-16439",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-16439"
},
{
"name": "CVE-2025-14915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14915"
},
{
"name": "CVE-2026-56745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56745"
},
{
"name": "CVE-2018-16487",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-16487"
},
{
"name": "CVE-2026-8633",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8633"
},
{
"name": "CVE-2022-31159",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-31159"
},
{
"name": "CVE-2026-11714",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11714"
},
{
"name": "CVE-2016-10735",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-10735"
},
{
"name": "CVE-2024-52903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52903"
},
{
"name": "CVE-2026-47838",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47838"
},
{
"name": "CVE-2021-42550",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-42550"
},
{
"name": "CVE-2017-18214",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-18214"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2026-59642",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59642"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2023-52703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52703"
},
{
"name": "CVE-2024-40679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40679"
},
{
"name": "CVE-2026-42034",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42034"
},
{
"name": "CVE-2026-47884",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47884"
},
{
"name": "CVE-2026-41417",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41417"
},
{
"name": "CVE-2026-61308",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-61308"
},
{
"name": "CVE-2025-23215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23215"
},
{
"name": "CVE-2026-48043",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-48043"
},
{
"name": "CVE-2026-9322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9322"
},
{
"name": "CVE-2024-41055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41055"
},
{
"name": "CVE-2026-87958",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-87958"
},
{
"name": "CVE-2026-22745",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22745"
},
{
"name": "CVE-2024-30171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-30171"
},
{
"name": "CVE-2026-42587",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42587"
},
{
"name": "CVE-2026-54513",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54513"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2021-47491",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47491"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2025-14914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14914"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2023-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52922"
},
{
"name": "CVE-2026-65927",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65927"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2026-9563",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9563"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2026-54518",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54518"
},
{
"name": "CVE-2020-9480",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-9480"
},
{
"name": "CVE-2024-36114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36114"
},
{
"name": "CVE-2026-47244",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47244"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2026-13676",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13676"
},
{
"name": "CVE-2024-26759",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26759"
},
{
"name": "CVE-2026-54297",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54297"
},
{
"name": "CVE-2026-53434",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53434"
},
{
"name": "CVE-2011-4969",
"url": "https://www.cve.org/CVERecord?id=CVE-2011-4969"
},
{
"name": "CVE-2026-60589",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60589"
},
{
"name": "CVE-2026-67312",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67312"
},
{
"name": "CVE-2026-6938",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6938"
},
{
"name": "CVE-2025-8916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8916"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2026-66142",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-66142"
},
{
"name": "CVE-2025-8885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8885"
},
{
"name": "CVE-2023-52464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52464"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2026-10051",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10051"
},
{
"name": "CVE-2026-53669",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-53669"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2026-41409",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41409"
},
{
"name": "CVE-2018-1259",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1259"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2026-6322",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6322"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2026-8400",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8400"
},
{
"name": "CVE-2026-45623",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-45623"
},
{
"name": "CVE-2026-14980",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-14980"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2023-24998",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24998"
},
{
"name": "CVE-2024-26894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26894"
},
{
"name": "CVE-2026-58062",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-58062"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2026-12143",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12143"
},
{
"name": "CVE-2026-67318",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67318"
},
{
"name": "CVE-2026-59893",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59893"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2021-21290",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-21290"
},
{
"name": "CVE-2024-41035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41035"
},
{
"name": "CVE-2023-52560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52560"
},
{
"name": "CVE-2026-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-50151"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-41065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41065"
},
{
"name": "CVE-2026-44486",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44486"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2026-42264",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42264"
},
{
"name": "CVE-2026-12803",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12803"
},
{
"name": "CVE-2021-47069",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47069"
},
{
"name": "CVE-2026-8384",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-8384"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2023-2976",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2976"
},
{
"name": "CVE-2026-59650",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59650"
},
{
"name": "CVE-2025-1000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1000"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2021-47548",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47548"
},
{
"name": "CVE-2026-44496",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44496"
},
{
"name": "CVE-2018-8023",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8023"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2026-44492",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44492"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2021-47393",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47393"
},
{
"name": "CVE-2026-54225",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54225"
},
{
"name": "CVE-2026-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-39865"
},
{
"name": "CVE-2026-41238",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41238"
},
{
"name": "CVE-2026-47877",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47877"
},
{
"name": "CVE-2023-52522",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52522"
},
{
"name": "CVE-2026-43512",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-43512"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2020-26555",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26555"
},
{
"name": "CVE-2021-47497",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47497"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2021-22570",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22570"
},
{
"name": "CVE-2026-47883",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47883"
},
{
"name": "CVE-2021-35515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35515"
},
{
"name": "CVE-2024-44990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44990"
},
{
"name": "CVE-2026-41007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41007"
},
{
"name": "CVE-2026-42037",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42037"
},
{
"name": "CVE-2022-40898",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40898"
},
{
"name": "CVE-2024-42265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42265"
},
{
"name": "CVE-2021-46984",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46984"
},
{
"name": "CVE-2026-55760",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55760"
},
{
"name": "CVE-2024-2201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2201"
},
{
"name": "CVE-2023-26048",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26048"
},
{
"name": "CVE-2026-42498",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42498"
},
{
"name": "CVE-2026-42042",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-42042"
},
{
"name": "CVE-2024-42152",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42152"
},
{
"name": "CVE-2026-9071",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9071"
},
{
"name": "CVE-2017-7669",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7669"
},
{
"name": "CVE-2026-67213",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67213"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2026-55833",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-55833"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2024-45663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45663"
},
{
"name": "CVE-2026-13586",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-13586"
},
{
"name": "CVE-2025-33134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-33134"
},
{
"name": "CVE-2021-47101",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47101"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2023-26112",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26112"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2026-9370",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-9370"
},
{
"name": "CVE-2021-47310",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47310"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2023-52626",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52626"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2026-11806",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-11806"
},
{
"name": "CVE-2023-52476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52476"
},
{
"name": "CVE-2024-42301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42301"
},
{
"name": "CVE-2026-12590",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-12590"
},
{
"name": "CVE-2026-34477",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34477"
},
{
"name": "CVE-2026-65902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65902"
},
{
"name": "CVE-2023-52463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52463"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2026-56819",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-56819"
},
{
"name": "CVE-2026-54284",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-54284"
},
{
"name": "CVE-2026-6321",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-6321"
},
{
"name": "CVE-2022-3171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3171"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2021-47456",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47456"
},
{
"name": "CVE-2026-44490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44490"
},
{
"name": "CVE-2016-7103",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-7103"
},
{
"name": "CVE-2015-9251",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-9251"
},
{
"name": "CVE-2026-59639",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59639"
},
{
"name": "CVE-2026-86093",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-86093"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2026-10852",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-10852"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2026-28338",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28338"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2010-5312",
"url": "https://www.cve.org/CVERecord?id=CVE-2010-5312"
},
{
"name": "CVE-2026-68494",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-68494"
},
{
"name": "CVE-2024-26810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26810"
},
{
"name": "CVE-2023-52530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52530"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2012-6708",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-6708"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2021-47356",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47356"
},
{
"name": "CVE-2020-7656",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-7656"
},
{
"name": "CVE-2018-8013",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-8013"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2026-29063",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-29063"
},
{
"name": "CVE-2026-60147",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-60147"
},
{
"name": "CVE-2026-47889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47889"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2019-16869",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-16869"
},
{
"name": "CVE-2023-52648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52648"
},
{
"name": "CVE-2026-15280",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-15280"
},
{
"name": "CVE-2026-67316",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-67316"
},
{
"name": "CVE-2025-14813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14813"
},
{
"name": "CVE-2022-41881",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41881"
},
{
"name": "CVE-2025-13465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13465"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2026-44488",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-44488"
},
{
"name": "CVE-2024-42237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42237"
},
{
"name": "CVE-2021-47353",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47353"
},
{
"name": "CVE-2023-52707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52707"
},
{
"name": "CVE-2026-59899",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59899"
},
{
"name": "CVE-2026-1718",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1718"
},
{
"name": "CVE-2026-71491",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-71491"
},
{
"name": "CVE-2026-34481",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-34481"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-27011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27011"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2021-47257",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47257"
},
{
"name": "CVE-2026-38969",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-38969"
},
{
"name": "CVE-2026-19880",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-19880"
},
{
"name": "CVE-2024-46858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46858"
},
{
"name": "CVE-2026-47059",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-47059"
},
{
"name": "CVE-2022-25168",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25168"
},
{
"name": "CVE-2026-41293",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-41293"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-44989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44989"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2026-77310",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-77310"
},
{
"name": "CVE-2024-57699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57699"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2026-65898",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-65898"
},
{
"name": "CVE-2020-11023",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11023"
},
{
"name": "CVE-2023-5090",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5090"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2021-46909",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46909"
},
{
"name": "CVE-2019-8331",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-8331"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2018-1000632",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1000632"
},
{
"name": "CVE-2019-20445",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-20445"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2026-59889",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-59889"
},
{
"name": "CVE-2025-36185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-36185"
},
{
"name": "CVE-2025-11226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11226"
}
],
"initial_release_date": "2026-09-11T00:00:00",
"last_revision_date": "2026-09-11T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-1165",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-09-11T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Injection de code indirecte \u00e0 distance (XSS)"
},
{
"description": "Injection de requ\u00eates ill\u00e9gitimes par rebond (CSRF)"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Falsification de requ\u00eates c\u00f4t\u00e9 serveur (SSRF)"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits IBM. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits IBM",
"vendor_advisories": [
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286777",
"url": "https://www.ibm.com/support/pages/node/7286777"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286776",
"url": "https://www.ibm.com/support/pages/node/7286776"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286990",
"url": "https://www.ibm.com/support/pages/node/7286990"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286976",
"url": "https://www.ibm.com/support/pages/node/7286976"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286993",
"url": "https://www.ibm.com/support/pages/node/7286993"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286782",
"url": "https://www.ibm.com/support/pages/node/7286782"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286515",
"url": "https://www.ibm.com/support/pages/node/7286515"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286646",
"url": "https://www.ibm.com/support/pages/node/7286646"
},
{
"published_at": "2026-09-11",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7287136",
"url": "https://www.ibm.com/support/pages/node/7287136"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286986",
"url": "https://www.ibm.com/support/pages/node/7286986"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286982",
"url": "https://www.ibm.com/support/pages/node/7286982"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286775",
"url": "https://www.ibm.com/support/pages/node/7286775"
},
{
"published_at": "2026-09-10",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286987",
"url": "https://www.ibm.com/support/pages/node/7286987"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286910",
"url": "https://www.ibm.com/support/pages/node/7286910"
},
{
"published_at": "2026-09-07",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286516",
"url": "https://www.ibm.com/support/pages/node/7286516"
},
{
"published_at": "2026-09-09",
"title": "Bulletin de s\u00e9curit\u00e9 IBM 7286909",
"url": "https://www.ibm.com/support/pages/node/7286909"
}
]
}
FKIE_CVE-2024-26773
Vulnerability from fkie_nvd - Published: 2024-04-03 17:15 - Updated: 2026-08-04 11:175.5 (Medium) - CVSS:3.1/
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 6.8 | |
| linux | linux_kernel | 6.8 | |
| debian | debian_linux | 10.0 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/ext4/mballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "21f8cfe79f776287459343e9cfa6055af61328ea",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "260fc96283c0f594de18a1b045faf6d8fb42874d",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "927794a02169778c9c2e7b25c768ab3ea8c1dc03",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "4c21fa60a6f4606f6214a38f50612b17b2f738f5",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "f97e75fa4e12b0aa0224e83fcbda8853ac2adf36",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "0184747b552d6b5a14db3b7fcc3b792ce64dedd1",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "a2576ae9a35c078e488f2c573e9e6821d651fbbe",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
},
{
"lessThan": "4530b3660d396a646aad91a787b6ab37cf604b53",
"status": "affected",
"version": "163a203ddb36c36d4a1c942aececda0cc8d06aa7",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/ext4/mballoc.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "3.12"
},
{
"lessThan": "3.12",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.308",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.270",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.211",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.150",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.80",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.19",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.7.*",
"status": "unaffected",
"version": "6.7.7",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.8",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B6FB6042-3E0F-4A36-8DED-B3C350612BDC",
"versionEndExcluding": "4.19.308",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "5D8044B1-C7E8-44A4-9F03-A4D7BCDB1721",
"versionEndExcluding": "5.4.270",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "7DDA4DCF-671D-415D-94DF-6E3C77DF0704",
"versionEndExcluding": "5.10.211",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CB6C60DE-9E0C-46C5-904D-D4F4031F8E95",
"versionEndExcluding": "5.15.150",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BA7850CE-97C9-4408-A348-6173296BCA2B",
"versionEndExcluding": "6.1.80",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "8D82004C-B2AE-4048-9344-32EFF65953B0",
"versionEndExcluding": "6.6.19",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "575EE16B-67F2-4B5B-B5F8-1877715C898B",
"versionEndExcluding": "6.7.7",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.8:rc1:*:*:*:*:*:*",
"matchCriteriaId": "B9F4EA73-0894-400F-A490-3A397AB7A517",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.8:rc2:*:*:*:*:*:*",
"matchCriteriaId": "056BD938-0A27-4569-B391-30578B309EE3",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
},
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:debian:debian_linux:10.0:*:*:*:*:*:*:*",
"matchCriteriaId": "07B237A9-69A3-4A9C-9DA0-4E06BD37AE73",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\n\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\n\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0027t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u003eac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group"
},
{
"lang": "es",
"value": "En el kernel de Linux, se resolvi\u00f3 la siguiente vulnerabilidad: ext4: evite asignar bloques de un grupo da\u00f1ado en ext4_mb_try_best_found() Determine si el mapa de bits del bloque del grupo est\u00e1 da\u00f1ado antes de usar ac_b_ex en ext4_mb_try_best_found() para evitar asignar bloques de un grupo con un bloque da\u00f1ado mapa de bits en la siguiente concurrencia y empeorando la situaci\u00f3n. ext4_mb_regular_allocator ext4_lock_group(sb, group) ext4_mb_good_group // verifica si el bbitmap del grupo est\u00e1 da\u00f1ado ext4_mb_complex_scan_group // El grupo de escaneo obtiene ac_b_ex pero no lo usa ext4_unlock_group(sb, group) ext4_mark_group_bitmap_corrupted(group) // El mapa de bits del bloque se corrompi\u00f3 durante // el grupo desbloquea la brecha. ext4_mb_try_best_found ext4_lock_group(ac-\u0026gt;ac_sb, group) ext4_mb_use_best_found mb_mark_used // Asignaci\u00f3n de bloques en un grupo da\u00f1ado de mapa de bits de bloques"
}
],
"id": "CVE-2024-26773",
"lastModified": "2026-08-04T11:17:03.457",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-26773",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-04-03T18:50:26.209110Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-04-03T17:15:53.080",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00017.html"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List"
],
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-J648-RGV6-CCC8
Vulnerability from github – Published: 2024-04-03 18:30 – Updated: 2025-03-18 18:30In the Linux kernel, the following vulnerability has been resolved:
ext4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()
Determine if the group block bitmap is corrupted before using ac_b_ex in ext4_mb_try_best_found() to avoid allocating blocks from a group with a corrupted block bitmap in the following concurrency and making the situation worse.
ext4_mb_regular_allocator ext4_lock_group(sb, group) ext4_mb_good_group // check if the group bbitmap is corrupted ext4_mb_complex_scan_group // Scan group gets ac_b_ex but doesn't use it ext4_unlock_group(sb, group) ext4_mark_group_bitmap_corrupted(group) // The block bitmap was corrupted during // the group unlock gap. ext4_mb_try_best_found ext4_lock_group(ac->ac_sb, group) ext4_mb_use_best_found mb_mark_used // Allocating blocks in block bitmap corrupted group
{
"affected": [],
"aliases": [
"CVE-2024-26773"
],
"database_specific": {
"cwe_ids": [],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-04-03T17:15:53Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\n\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\n\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0027t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u003eac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group",
"id": "GHSA-j648-rgv6-ccc8",
"modified": "2025-03-18T18:30:40Z",
"published": "2024-04-03T18:30:43Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26773"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"type": "WEB",
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00017.html"
},
{
"type": "WEB",
"url": "https://lists.debian.org/debian-lts-announce/2024/06/msg00020.html"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
GSD-2024-26773
Vulnerability from gsd - Updated: 2024-02-20 06:02{
"gsd": {
"metadata": {
"exploitCode": "unknown",
"remediation": "unknown",
"reportConfidence": "confirmed",
"type": "vulnerability"
},
"osvSchema": {
"aliases": [
"CVE-2024-26773"
],
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\n\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\n\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0027t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u003eac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group",
"id": "GSD-2024-26773",
"modified": "2024-02-20T06:02:29.116429Z",
"schema_version": "1.4.0"
}
},
"namespaces": {
"cve.org": {
"CVE_data_meta": {
"ASSIGNER": "cve@kernel.org",
"ID": "CVE-2024-26773",
"STATE": "PUBLIC"
},
"affects": {
"vendor": {
"vendor_data": [
{
"product": {
"product_data": [
{
"product_name": "Linux",
"version": {
"version_data": [
{
"version_affected": "\u003c",
"version_name": "1da177e4c3f4",
"version_value": "21f8cfe79f77"
},
{
"version_value": "not down converted",
"x_cve_json_5_version_data": {
"defaultStatus": "affected",
"versions": [
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.308",
"versionType": "custom"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.270",
"versionType": "custom"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.211",
"versionType": "custom"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.150",
"versionType": "custom"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.80",
"versionType": "custom"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.19",
"versionType": "custom"
},
{
"lessThanOrEqual": "6.7.*",
"status": "unaffected",
"version": "6.7.7",
"versionType": "custom"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.8",
"versionType": "original_commit_for_fix"
}
]
}
}
]
}
}
]
},
"vendor_name": "Linux"
}
]
}
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "eng",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\n\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\n\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0027t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u003eac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group"
}
]
},
"generator": {
"engine": "bippy-d3b290d2becc"
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "eng",
"value": "n/a"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea",
"refsource": "MISC",
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"name": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d",
"refsource": "MISC",
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"name": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03",
"refsource": "MISC",
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"name": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5",
"refsource": "MISC",
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"name": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36",
"refsource": "MISC",
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
},
{
"name": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1",
"refsource": "MISC",
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"name": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe",
"refsource": "MISC",
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"name": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53",
"refsource": "MISC",
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
}
]
}
},
"nvd.nist.gov": {
"cve": {
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\n\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\n\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0027t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u003eac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group"
}
],
"id": "CVE-2024-26773",
"lastModified": "2024-04-03T17:24:18.150",
"metrics": {},
"published": "2024-04-03T17:15:53.080",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/0184747b552d6b5a14db3b7fcc3b792ce64dedd1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/21f8cfe79f776287459343e9cfa6055af61328ea"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/260fc96283c0f594de18a1b045faf6d8fb42874d"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/4530b3660d396a646aad91a787b6ab37cf604b53"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/4c21fa60a6f4606f6214a38f50612b17b2f738f5"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/927794a02169778c9c2e7b25c768ab3ea8c1dc03"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/a2576ae9a35c078e488f2c573e9e6821d651fbbe"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"url": "https://git.kernel.org/stable/c/f97e75fa4e12b0aa0224e83fcbda8853ac2adf36"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Awaiting Analysis"
}
}
}
}
ICSA-23-348-10
Vulnerability from csaf_cisa - Published: 2023-12-12 00:00 - Updated: 2025-08-12 00:00ICSA-25-226-15
Vulnerability from csaf_cisa - Published: 2025-08-12 00:00 - Updated: 2026-02-25 07:00OESA-2024-1520 (CVE-2024-25739)
Vulnerability from osv_openeuler – Published: 2024-05-10 11:06 – Updated: 2026-08-06 11:06 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
create_empty_lvol in drivers/mtd/ubi/vtbl.c in the Linux kernel through 6.7.4 can attempt to allocate zero bytes, and crash, because of a missing check for ubi->leb_size.(CVE-2024-25739)
In the Linux kernel, the following vulnerability has been resolved:
drm/bridge: sii902x: Fix probing race issue
A null pointer dereference crash has been observed rarely on TI platforms using sii9022 bridge:
[ 53.271356] sii902x_get_edid+0x34/0x70 [sii902x] [ 53.276066] sii902x_bridge_get_edid+0x14/0x20 [sii902x] [ 53.281381] drm_bridge_get_edid+0x20/0x34 [drm] [ 53.286305] drm_bridge_connector_get_modes+0x8c/0xcc [drm_kms_helper] [ 53.292955] drm_helper_probe_single_connector_modes+0x190/0x538 [drm_kms_helper] [ 53.300510] drm_client_modeset_probe+0x1f0/0xbd4 [drm] [ 53.305958] __drm_fb_helper_initial_config_and_unlock+0x50/0x510 [drm_kms_helper] [ 53.313611] drm_fb_helper_initial_config+0x48/0x58 [drm_kms_helper] [ 53.320039] drm_fbdev_dma_client_hotplug+0x84/0xd4 [drm_dma_helper] [ 53.326401] drm_client_register+0x5c/0xa0 [drm] [ 53.331216] drm_fbdev_dma_setup+0xc8/0x13c [drm_dma_helper] [ 53.336881] tidss_probe+0x128/0x264 [tidss] [ 53.341174] platform_probe+0x68/0xc4 [ 53.344841] really_probe+0x188/0x3c4 [ 53.348501] __driver_probe_device+0x7c/0x16c [ 53.352854] driver_probe_device+0x3c/0x10c [ 53.357033] __device_attach_driver+0xbc/0x158 [ 53.361472] bus_for_each_drv+0x88/0xe8 [ 53.365303] __device_attach+0xa0/0x1b4 [ 53.369135] device_initial_probe+0x14/0x20 [ 53.373314] bus_probe_device+0xb0/0xb4 [ 53.377145] deferred_probe_work_func+0xcc/0x124 [ 53.381757] process_one_work+0x1f0/0x518 [ 53.385770] worker_thread+0x1e8/0x3dc [ 53.389519] kthread+0x11c/0x120 [ 53.392750] ret_from_fork+0x10/0x20
The issue here is as follows:
- tidss probes, but is deferred as sii902x is still missing.
- sii902x starts probing and enters sii902x_init().
- sii902x calls drm_bridge_add(). Now the sii902x bridge is ready from DRM's perspective.
- sii902x calls sii902x_audio_codec_init() and platform_device_register_data()
- The registration of the audio platform device causes probing of the deferred devices.
- tidss probes, which eventually causes sii902x_bridge_get_edid() to be called.
- sii902x_bridge_get_edid() tries to use the i2c to read the edid. However, the sii902x driver has not set up the i2c part yet, leading to the crash.
Fix this by moving the drm_bridge_add() to the end of the sii902x_init(), which is also at the very end of sii902x_probe().(CVE-2024-26607)
In the Linux kernel, the following vulnerability has been resolved:
tcp: make sure init the accept_queue's spinlocks once
When I run syz's reproduction C program locally, it causes the following issue: pvqspinlock: lock 0xffff9d181cd5c660 has corrupted value 0x0! WARNING: CPU: 19 PID: 21160 at __pv_queued_spin_unlock_slowpath (kernel/locking/qspinlock_paravirt.h:508) Hardware name: Red Hat KVM, BIOS 0.5.1 01/01/2011 RIP: 0010:__pv_queued_spin_unlock_slowpath (kernel/locking/qspinlock_paravirt.h:508) Code: 73 56 3a ff 90 c3 cc cc cc cc 8b 05 bb 1f 48 01 85 c0 74 05 c3 cc cc cc cc 8b 17 48 89 fe 48 c7 c7 30 20 ce 8f e8 ad 56 42 ff <0f> 0b c3 cc cc cc cc 0f 0b 0f 1f 40 00 90 90 90 90 90 90 90 90 90 RSP: 0018:ffffa8d200604cb8 EFLAGS: 00010282 RAX: 0000000000000000 RBX: 0000000000000000 RCX: ffff9d1ef60e0908 RDX: 00000000ffffffd8 RSI: 0000000000000027 RDI: ffff9d1ef60e0900 RBP: ffff9d181cd5c280 R08: 0000000000000000 R09: 00000000ffff7fff R10: ffffa8d200604b68 R11: ffffffff907dcdc8 R12: 0000000000000000 R13: ffff9d181cd5c660 R14: ffff9d1813a3f330 R15: 0000000000001000 FS: 00007fa110184640(0000) GS:ffff9d1ef60c0000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000020000000 CR3: 000000011f65e000 CR4: 00000000000006f0 Call Trace: <IRQ> _raw_spin_unlock (kernel/locking/spinlock.c:186) inet_csk_reqsk_queue_add (net/ipv4/inet_connection_sock.c:1321) inet_csk_complete_hashdance (net/ipv4/inet_connection_sock.c:1358) tcp_check_req (net/ipv4/tcp_minisocks.c:868) tcp_v4_rcv (net/ipv4/tcp_ipv4.c:2260) ip_protocol_deliver_rcu (net/ipv4/ip_input.c:205) ip_local_deliver_finish (net/ipv4/ip_input.c:234) __netif_receive_skb_one_core (net/core/dev.c:5529) process_backlog (./include/linux/rcupdate.h:779) __napi_poll (net/core/dev.c:6533) net_rx_action (net/core/dev.c:6604) __do_softirq (./arch/x86/include/asm/jump_label.h:27) do_softirq (kernel/softirq.c:454 kernel/softirq.c:441) </IRQ> <TASK> __local_bh_enable_ip (kernel/softirq.c:381) __dev_queue_xmit (net/core/dev.c:4374) ip_finish_output2 (./include/net/neighbour.h:540 net/ipv4/ip_output.c:235) __ip_queue_xmit (net/ipv4/ip_output.c:535) __tcp_transmit_skb (net/ipv4/tcp_output.c:1462) tcp_rcv_synsent_state_process (net/ipv4/tcp_input.c:6469) tcp_rcv_state_process (net/ipv4/tcp_input.c:6657) tcp_v4_do_rcv (net/ipv4/tcp_ipv4.c:1929) __release_sock (./include/net/sock.h:1121 net/core/sock.c:2968) release_sock (net/core/sock.c:3536) inet_wait_for_connect (net/ipv4/af_inet.c:609) __inet_stream_connect (net/ipv4/af_inet.c:702) inet_stream_connect (net/ipv4/af_inet.c:748) __sys_connect (./include/linux/file.h:45 net/socket.c:2064) __x64_sys_connect (net/socket.c:2073 net/socket.c:2070 net/socket.c:2070) do_syscall_64 (arch/x86/entry/common.c:51 arch/x86/entry/common.c:82) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:129) RIP: 0033:0x7fa10ff05a3d Code: 5b 41 5c c3 66 0f 1f 84 00 00 00 00 00 f3 0f 1e fa 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 8b 0d ab a3 0e 00 f7 d8 64 89 01 48 RSP: 002b:00007fa110183de8 EFLAGS: 00000202 ORIG_RAX: 000000000000002a RAX: ffffffffffffffda RBX: 0000000020000054 RCX: 00007fa10ff05a3d RDX: 000000000000001c RSI: 0000000020000040 RDI: 0000000000000003 RBP: 00007fa110183e20 R08: 0000000000000000 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000202 R12: 00007fa110184640 R13: 0000000000000000 R14: 00007fa10fe8b060 R15: 00007fff73e23b20 </TASK>
The issue triggering process is analyzed as follows:
Thread A Thread B
tcp_v4_rcv //receive ack TCP packet inet_shutdown
tcp_check_req tcp_disconnect //disconnect sock
... tcp_set_state(sk, TCP_CLOSE)
inet_csk_complete_hashdance ...
inet_csk_reqsk_queue_add
---truncated---(CVE-2024-26614)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: don't abort filesystem when attempting to snapshot deleted subvolume
If the source file descriptor to the snapshot ioctl refers to a deleted subvolume, we get the following abort:
BTRFS: Transaction aborted (error -2) WARNING: CPU: 0 PID: 833 at fs/btrfs/transaction.c:1875 create_pending_snapshot+0x1040/0x1190 [btrfs] Modules linked in: pata_acpi btrfs ata_piix libata scsi_mod virtio_net blake2b_generic xor net_failover virtio_rng failover scsi_common rng_core raid6_pq libcrc32c CPU: 0 PID: 833 Comm: t_snapshot_dele Not tainted 6.7.0-rc6 #2 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014 RIP: 0010:create_pending_snapshot+0x1040/0x1190 [btrfs] RSP: 0018:ffffa09c01337af8 EFLAGS: 00010282 RAX: 0000000000000000 RBX: ffff9982053e7c78 RCX: 0000000000000027 RDX: ffff99827dc20848 RSI: 0000000000000001 RDI: ffff99827dc20840 RBP: ffffa09c01337c00 R08: 0000000000000000 R09: ffffa09c01337998 R10: 0000000000000003 R11: ffffffffb96da248 R12: fffffffffffffffe R13: ffff99820535bb28 R14: ffff99820b7bd000 R15: ffff99820381ea80 FS: 00007fe20aadabc0(0000) GS:ffff99827dc00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000559a120b502f CR3: 00000000055b6000 CR4: 00000000000006f0 Call Trace: <TASK> ? create_pending_snapshot+0x1040/0x1190 [btrfs] ? __warn+0x81/0x130 ? create_pending_snapshot+0x1040/0x1190 [btrfs] ? report_bug+0x171/0x1a0 ? handle_bug+0x3a/0x70 ? exc_invalid_op+0x17/0x70 ? asm_exc_invalid_op+0x1a/0x20 ? create_pending_snapshot+0x1040/0x1190 [btrfs] ? create_pending_snapshot+0x1040/0x1190 [btrfs] create_pending_snapshots+0x92/0xc0 [btrfs] btrfs_commit_transaction+0x66b/0xf40 [btrfs] btrfs_mksubvol+0x301/0x4d0 [btrfs] btrfs_mksnapshot+0x80/0xb0 [btrfs] __btrfs_ioctl_snap_create+0x1c2/0x1d0 [btrfs] btrfs_ioctl_snap_create_v2+0xc4/0x150 [btrfs] btrfs_ioctl+0x8a6/0x2650 [btrfs] ? kmem_cache_free+0x22/0x340 ? do_sys_openat2+0x97/0xe0 __x64_sys_ioctl+0x97/0xd0 do_syscall_64+0x46/0xf0 entry_SYSCALL_64_after_hwframe+0x6e/0x76 RIP: 0033:0x7fe20abe83af RSP: 002b:00007ffe6eff1360 EFLAGS: 00000246 ORIG_RAX: 0000000000000010 RAX: ffffffffffffffda RBX: 0000000000000004 RCX: 00007fe20abe83af RDX: 00007ffe6eff23c0 RSI: 0000000050009417 RDI: 0000000000000003 RBP: 0000000000000003 R08: 0000000000000000 R09: 00007fe20ad16cd0 R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000 R13: 00007ffe6eff13c0 R14: 00007fe20ad45000 R15: 0000559a120b6d58 </TASK> ---[ end trace 0000000000000000 ]--- BTRFS: error (device vdc: state A) in create_pending_snapshot:1875: errno=-2 No such entry BTRFS info (device vdc: state EA): forced readonly BTRFS warning (device vdc: state EA): Skipping commit of aborted transaction. BTRFS: error (device vdc: state EA) in cleanup_transaction:2055: errno=-2 No such entry
This happens because create_pending_snapshot() initializes the new root item as a copy of the source root item. This includes the refs field, which is 0 for a deleted subvolume. The call to btrfs_insert_root() therefore inserts a root with refs == 0. btrfs_get_new_fs_root() then finds the root and returns -ENOENT if refs == 0, which causes create_pending_snapshot() to abort.
Fix it by checking the source root's refs before attempting the snapshot, but after locking subvol_sem to avoid racing with deletion.(CVE-2024-26644)
In the Linux kernel, the following vulnerability has been resolved:
hv_netvsc: Fix race condition between netvsc_probe and netvsc_remove
In commit ac5047671758 ("hv_netvsc: Disable NAPI before closing the VMBus channel"), napi_disable was getting called for all channels, including all subchannels without confirming if they are enabled or not.
This caused hv_netvsc getting hung at napi_disable, when netvsc_probe() has finished running but nvdev->subchan_work has not started yet. netvsc_subchan_work() -> rndis_set_subchannel() has not created the sub-channels and because of that netvsc_sc_open() is not running. netvsc_remove() calls cancel_work_sync(&nvdev->subchan_work), for which netvsc_subchan_work did not run.
netif_napi_add() sets the bit NAPI_STATE_SCHED because it ensures NAPI cannot be scheduled. Then netvsc_sc_open() -> napi_enable will clear the NAPIF_STATE_SCHED bit, so it can be scheduled. napi_disable() does the opposite.
Now during netvsc_device_remove(), when napi_disable is called for those subchannels, napi_disable gets stuck on infinite msleep.
This fix addresses this problem by ensuring that napi_disable() is not getting called for non-enabled NAPI struct. But netif_napi_del() is still necessary for these non-enabled NAPI struct for cleanup purpose.
Call trace: [ 654.559417] task:modprobe state:D stack: 0 pid: 2321 ppid: 1091 flags:0x00004002 [ 654.568030] Call Trace: [ 654.571221] <TASK> [ 654.573790] __schedule+0x2d6/0x960 [ 654.577733] schedule+0x69/0xf0 [ 654.581214] schedule_timeout+0x87/0x140 [ 654.585463] ? __bpf_trace_tick_stop+0x20/0x20 [ 654.590291] msleep+0x2d/0x40 [ 654.593625] napi_disable+0x2b/0x80 [ 654.597437] netvsc_device_remove+0x8a/0x1f0 [hv_netvsc] [ 654.603935] rndis_filter_device_remove+0x194/0x1c0 [hv_netvsc] [ 654.611101] ? do_wait_intr+0xb0/0xb0 [ 654.615753] netvsc_remove+0x7c/0x120 [hv_netvsc] [ 654.621675] vmbus_remove+0x27/0x40 hv_vmbus
In the Linux kernel, the following vulnerability has been resolved:
afs: Increase buffer size in afs_update_volume_status()
The max length of volume->vid value is 20 characters. So increase idbuf[] size up to 24 to avoid overflow.
Found by Linux Verification Center (linuxtesting.org) with SVACE.
DH: Actually, it's 20 + NUL, so increase it to 24 and use snprintf()
In the Linux kernel, the following vulnerability has been resolved:
ARM: ep93xx: Add terminator to gpiod_lookup_table
Without the terminator, if a con_id is passed to gpio_find() that does not exist in the lookup table the function will not stop looping correctly, and eventually cause an oops.(CVE-2024-26751)
In the Linux kernel, the following vulnerability has been resolved:
fs/aio: Restrict kiocb_set_cancel_fn() to I/O submitted via libaio
If kiocb_set_cancel_fn() is called for I/O submitted via io_uring, the following kernel warning appears:
WARNING: CPU: 3 PID: 368 at fs/aio.c:598 kiocb_set_cancel_fn+0x9c/0xa8 Call trace: kiocb_set_cancel_fn+0x9c/0xa8 ffs_epfile_read_iter+0x144/0x1d0 io_read+0x19c/0x498 io_issue_sqe+0x118/0x27c io_submit_sqes+0x25c/0x5fc __arm64_sys_io_uring_enter+0x104/0xab0 invoke_syscall+0x58/0x11c el0_svc_common+0xb4/0xf4 do_el0_svc+0x2c/0xb0 el0_svc+0x2c/0xa4 el0t_64_sync_handler+0x68/0xb4 el0t_64_sync+0x1a4/0x1a8
Fix this by setting the IOCB_AIO_RW flag for read and write I/O that is submitted by libaio.(CVE-2024-26764)
In the Linux kernel, the following vulnerability has been resolved:
ext4: avoid allocating blocks from corrupted group in ext4_mb_find_by_goal()
Places the logic for checking if the group's block bitmap is corrupt under the protection of the group lock to avoid allocating blocks from the group with a corrupted block bitmap.(CVE-2024-26772)
In the Linux kernel, the following vulnerability has been resolved:
ext4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()
Determine if the group block bitmap is corrupted before using ac_b_ex in ext4_mb_try_best_found() to avoid allocating blocks from a group with a corrupted block bitmap in the following concurrency and making the situation worse.
ext4_mb_regular_allocator ext4_lock_group(sb, group) ext4_mb_good_group // check if the group bbitmap is corrupted ext4_mb_complex_scan_group // Scan group gets ac_b_ex but doesn't use it ext4_unlock_group(sb, group) ext4_mark_group_bitmap_corrupted(group) // The block bitmap was corrupted during // the group unlock gap. ext4_mb_try_best_found ext4_lock_group(ac->ac_sb, group) ext4_mb_use_best_found mb_mark_used // Allocating blocks in block bitmap corrupted group(CVE-2024-26773)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: sis: Error out if pixclock equals zero
The userspace program could pass any values to the driver through ioctl() interface. If the driver doesn't check the value of pixclock, it may cause divide-by-zero error.
In sisfb_check_var(), var->pixclock is used as a divisor to caculate drate before it is checked against zero. Fix this by checking it at the beginning.
This is similar to CVE-2022-3061 in i740fb which was fixed by commit 15cf0b8.(CVE-2024-26777)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: savage: Error out if pixclock equals zero
The userspace program could pass any values to the driver through ioctl() interface. If the driver doesn't check the value of pixclock, it may cause divide-by-zero error.
Although pixclock is checked in savagefb_decode_var(), but it is not checked properly in savagefb_probe(). Fix this by checking whether pixclock is zero in the function savagefb_check_var() before info->var.pixclock is used as the divisor.
This is similar to CVE-2022-3061 in i740fb which was fixed by commit 15cf0b8.(CVE-2024-26778)
In the Linux kernel, the following vulnerability has been resolved:
dmaengine: fsl-qdma: init irq after reg initialization
Initialize the qDMA irqs after the registers are configured so that interrupts that may have been pending from a primary kernel don't get processed by the irq handler before it is ready to and cause panic with the following trace:
Call trace: fsl_qdma_queue_handler+0xf8/0x3e8 __handle_irq_event_percpu+0x78/0x2b0 handle_irq_event_percpu+0x1c/0x68 handle_irq_event+0x44/0x78 handle_fasteoi_irq+0xc8/0x178 generic_handle_irq+0x24/0x38 __handle_domain_irq+0x90/0x100 gic_handle_irq+0x5c/0xb8 el1_irq+0xb8/0x180 _raw_spin_unlock_irqrestore+0x14/0x40 __setup_irq+0x4bc/0x798 request_threaded_irq+0xd8/0x190 devm_request_threaded_irq+0x74/0xe8 fsl_qdma_probe+0x4d4/0xca8 platform_drv_probe+0x50/0xa0 really_probe+0xe0/0x3f8 driver_probe_device+0x64/0x130 device_driver_attach+0x6c/0x78 __driver_attach+0xbc/0x158 bus_for_each_dev+0x5c/0x98 driver_attach+0x20/0x28 bus_add_driver+0x158/0x220 driver_register+0x60/0x110 __platform_driver_register+0x44/0x50 fsl_qdma_driver_init+0x18/0x20 do_one_initcall+0x48/0x258 kernel_init_freeable+0x1a4/0x23c kernel_init+0x10/0xf8 ret_from_fork+0x10/0x18(CVE-2024-26788)
In the Linux kernel, the following vulnerability has been resolved:
vfio/pci: Lock external INTx masking ops
Mask operations through config space changes to DisINTx may race INTx configuration changes via ioctl. Create wrappers that add locking for paths outside of the core interrupt code.
In particular, irq_type is updated holding igate, therefore testing is_intx() requires holding igate. For example clearing DisINTx from config space can otherwise race changes of the interrupt configuration.
This aligns interfaces which may trigger the INTx eventfd into two camps, one side serialized by igate and the other only enabled while INTx is configured. A subsequent patch introduces synchronization for the latter flows.(CVE-2024-26810)
In the Linux kernel, the following vulnerability has been resolved:
bpf: Fix stackmap overflow check on 32-bit arches
The stackmap code relies on roundup_pow_of_two() to compute the number of hash buckets, and contains an overflow check by checking if the resulting value is 0. However, on 32-bit arches, the roundup code itself can overflow by doing a 32-bit left-shift of an unsigned long value, which is undefined behaviour, so it is not guaranteed to truncate neatly. This was triggered by syzbot on the DEVMAP_HASH type, which contains the same check, copied from the hashtab code.
The commit in the fixes tag actually attempted to fix this, but the fix did not account for the UB, so the fix only works on CPUs where an overflow does result in a neat truncation to zero, which is not guaranteed. Checking the value before rounding does not have this problem.(CVE-2024-26883)
In the Linux kernel, the following vulnerability has been resolved:
bpf: Fix hashtab overflow check on 32-bit arches
The hashtab code relies on roundup_pow_of_two() to compute the number of hash buckets, and contains an overflow check by checking if the resulting value is 0. However, on 32-bit arches, the roundup code itself can overflow by doing a 32-bit left-shift of an unsigned long value, which is undefined behaviour, so it is not guaranteed to truncate neatly. This was triggered by syzbot on the DEVMAP_HASH type, which contains the same check, copied from the hashtab code. So apply the same fix to hashtab, by moving the overflow check to before the roundup.(CVE-2024-26884)
In the Linux kernel, the following vulnerability has been resolved:
bpf: Fix DEVMAP_HASH overflow check on 32-bit arches
The devmap code allocates a number hash buckets equal to the next power of two of the max_entries value provided when creating the map. When rounding up to the next power of two, the 32-bit variable storing the number of buckets can overflow, and the code checks for overflow by checking if the truncated 32-bit value is equal to 0. However, on 32-bit arches the rounding up itself can overflow mid-way through, because it ends up doing a left-shift of 32 bits on an unsigned long value. If the size of an unsigned long is four bytes, this is undefined behaviour, so there is no guarantee that we'll end up with a nice and tidy 0-value at the end.
Syzbot managed to turn this into a crash on arm32 by creating a DEVMAP_HASH with max_entries > 0x80000000 and then trying to update it. Fix this by moving the overflow check to before the rounding up operation.(CVE-2024-26885)
In the Linux kernel, the following vulnerability has been resolved:
vfio/pci: Disable auto-enable of exclusive INTx IRQ
Currently for devices requiring masking at the irqchip for INTx, ie. devices without DisINTx support, the IRQ is enabled in request_irq() and subsequently disabled as necessary to align with the masked status flag. This presents a window where the interrupt could fire between these events, resulting in the IRQ incrementing the disable depth twice. This would be unrecoverable for a user since the masked flag prevents nested enables through vfio.
Instead, invert the logic using IRQF_NO_AUTOEN such that exclusive INTx is never auto-enabled, then unmask as required.(CVE-2024-27437)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"perf-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"kernel-devel-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"kernel-tools-devel-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"kernel-debugsource-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"perf-debuginfo-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"kernel-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"kernel-debuginfo-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"python3-perf-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"kernel-headers-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"kernel-source-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"kernel-tools-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-153.53.0.131.oe2203sp2.aarch64.rpm"
],
"src": [
"kernel-5.10.0-153.53.0.131.oe2203sp2.src.rpm"
],
"x86_64": [
"kernel-headers-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"kernel-tools-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"kernel-source-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"python3-perf-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"perf-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"perf-debuginfo-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"kernel-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"kernel-tools-devel-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"kernel-debuginfo-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"kernel-debugsource-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm",
"kernel-devel-5.10.0-153.53.0.131.oe2203sp2.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP2",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP2"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-153.53.0.131.oe2203sp2"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\ncreate_empty_lvol in drivers/mtd/ubi/vtbl.c in the Linux kernel through 6.7.4 can attempt to allocate zero bytes, and crash, because of a missing check for ubi-\u0026gt;leb_size.(CVE-2024-25739)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/bridge: sii902x: Fix probing race issue\r\n\r\nA null pointer dereference crash has been observed rarely on TI\nplatforms using sii9022 bridge:\r\n\r\n[ 53.271356] sii902x_get_edid+0x34/0x70 [sii902x]\n[ 53.276066] sii902x_bridge_get_edid+0x14/0x20 [sii902x]\n[ 53.281381] drm_bridge_get_edid+0x20/0x34 [drm]\n[ 53.286305] drm_bridge_connector_get_modes+0x8c/0xcc [drm_kms_helper]\n[ 53.292955] drm_helper_probe_single_connector_modes+0x190/0x538 [drm_kms_helper]\n[ 53.300510] drm_client_modeset_probe+0x1f0/0xbd4 [drm]\n[ 53.305958] __drm_fb_helper_initial_config_and_unlock+0x50/0x510 [drm_kms_helper]\n[ 53.313611] drm_fb_helper_initial_config+0x48/0x58 [drm_kms_helper]\n[ 53.320039] drm_fbdev_dma_client_hotplug+0x84/0xd4 [drm_dma_helper]\n[ 53.326401] drm_client_register+0x5c/0xa0 [drm]\n[ 53.331216] drm_fbdev_dma_setup+0xc8/0x13c [drm_dma_helper]\n[ 53.336881] tidss_probe+0x128/0x264 [tidss]\n[ 53.341174] platform_probe+0x68/0xc4\n[ 53.344841] really_probe+0x188/0x3c4\n[ 53.348501] __driver_probe_device+0x7c/0x16c\n[ 53.352854] driver_probe_device+0x3c/0x10c\n[ 53.357033] __device_attach_driver+0xbc/0x158\n[ 53.361472] bus_for_each_drv+0x88/0xe8\n[ 53.365303] __device_attach+0xa0/0x1b4\n[ 53.369135] device_initial_probe+0x14/0x20\n[ 53.373314] bus_probe_device+0xb0/0xb4\n[ 53.377145] deferred_probe_work_func+0xcc/0x124\n[ 53.381757] process_one_work+0x1f0/0x518\n[ 53.385770] worker_thread+0x1e8/0x3dc\n[ 53.389519] kthread+0x11c/0x120\n[ 53.392750] ret_from_fork+0x10/0x20\r\n\r\nThe issue here is as follows:\r\n\r\n- tidss probes, but is deferred as sii902x is still missing.\n- sii902x starts probing and enters sii902x_init().\n- sii902x calls drm_bridge_add(). Now the sii902x bridge is ready from\n DRM\u0026apos;s perspective.\n- sii902x calls sii902x_audio_codec_init() and\n platform_device_register_data()\n- The registration of the audio platform device causes probing of the\n deferred devices.\n- tidss probes, which eventually causes sii902x_bridge_get_edid() to be\n called.\n- sii902x_bridge_get_edid() tries to use the i2c to read the edid.\n However, the sii902x driver has not set up the i2c part yet, leading\n to the crash.\r\n\r\nFix this by moving the drm_bridge_add() to the end of the\nsii902x_init(), which is also at the very end of sii902x_probe().(CVE-2024-26607)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntcp: make sure init the accept_queue\u0026apos;s spinlocks once\r\n\r\nWhen I run syz\u0026apos;s reproduction C program locally, it causes the following\nissue:\npvqspinlock: lock 0xffff9d181cd5c660 has corrupted value 0x0!\nWARNING: CPU: 19 PID: 21160 at __pv_queued_spin_unlock_slowpath (kernel/locking/qspinlock_paravirt.h:508)\nHardware name: Red Hat KVM, BIOS 0.5.1 01/01/2011\nRIP: 0010:__pv_queued_spin_unlock_slowpath (kernel/locking/qspinlock_paravirt.h:508)\nCode: 73 56 3a ff 90 c3 cc cc cc cc 8b 05 bb 1f 48 01 85 c0 74 05 c3 cc cc cc cc 8b 17 48 89 fe 48 c7 c7\n30 20 ce 8f e8 ad 56 42 ff \u0026lt;0f\u0026gt; 0b c3 cc cc cc cc 0f 0b 0f 1f 40 00 90 90 90 90 90 90 90 90 90\nRSP: 0018:ffffa8d200604cb8 EFLAGS: 00010282\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: ffff9d1ef60e0908\nRDX: 00000000ffffffd8 RSI: 0000000000000027 RDI: ffff9d1ef60e0900\nRBP: ffff9d181cd5c280 R08: 0000000000000000 R09: 00000000ffff7fff\nR10: ffffa8d200604b68 R11: ffffffff907dcdc8 R12: 0000000000000000\nR13: ffff9d181cd5c660 R14: ffff9d1813a3f330 R15: 0000000000001000\nFS: 00007fa110184640(0000) GS:ffff9d1ef60c0000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000020000000 CR3: 000000011f65e000 CR4: 00000000000006f0\nCall Trace:\n\u0026lt;IRQ\u0026gt;\n _raw_spin_unlock (kernel/locking/spinlock.c:186)\n inet_csk_reqsk_queue_add (net/ipv4/inet_connection_sock.c:1321)\n inet_csk_complete_hashdance (net/ipv4/inet_connection_sock.c:1358)\n tcp_check_req (net/ipv4/tcp_minisocks.c:868)\n tcp_v4_rcv (net/ipv4/tcp_ipv4.c:2260)\n ip_protocol_deliver_rcu (net/ipv4/ip_input.c:205)\n ip_local_deliver_finish (net/ipv4/ip_input.c:234)\n __netif_receive_skb_one_core (net/core/dev.c:5529)\n process_backlog (./include/linux/rcupdate.h:779)\n __napi_poll (net/core/dev.c:6533)\n net_rx_action (net/core/dev.c:6604)\n __do_softirq (./arch/x86/include/asm/jump_label.h:27)\n do_softirq (kernel/softirq.c:454 kernel/softirq.c:441)\n\u0026lt;/IRQ\u0026gt;\n\u0026lt;TASK\u0026gt;\n __local_bh_enable_ip (kernel/softirq.c:381)\n __dev_queue_xmit (net/core/dev.c:4374)\n ip_finish_output2 (./include/net/neighbour.h:540 net/ipv4/ip_output.c:235)\n __ip_queue_xmit (net/ipv4/ip_output.c:535)\n __tcp_transmit_skb (net/ipv4/tcp_output.c:1462)\n tcp_rcv_synsent_state_process (net/ipv4/tcp_input.c:6469)\n tcp_rcv_state_process (net/ipv4/tcp_input.c:6657)\n tcp_v4_do_rcv (net/ipv4/tcp_ipv4.c:1929)\n __release_sock (./include/net/sock.h:1121 net/core/sock.c:2968)\n release_sock (net/core/sock.c:3536)\n inet_wait_for_connect (net/ipv4/af_inet.c:609)\n __inet_stream_connect (net/ipv4/af_inet.c:702)\n inet_stream_connect (net/ipv4/af_inet.c:748)\n __sys_connect (./include/linux/file.h:45 net/socket.c:2064)\n __x64_sys_connect (net/socket.c:2073 net/socket.c:2070 net/socket.c:2070)\n do_syscall_64 (arch/x86/entry/common.c:51 arch/x86/entry/common.c:82)\n entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:129)\n RIP: 0033:0x7fa10ff05a3d\n Code: 5b 41 5c c3 66 0f 1f 84 00 00 00 00 00 f3 0f 1e fa 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89\n c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 8b 0d ab a3 0e 00 f7 d8 64 89 01 48\n RSP: 002b:00007fa110183de8 EFLAGS: 00000202 ORIG_RAX: 000000000000002a\n RAX: ffffffffffffffda RBX: 0000000020000054 RCX: 00007fa10ff05a3d\n RDX: 000000000000001c RSI: 0000000020000040 RDI: 0000000000000003\n RBP: 00007fa110183e20 R08: 0000000000000000 R09: 0000000000000000\n R10: 0000000000000000 R11: 0000000000000202 R12: 00007fa110184640\n R13: 0000000000000000 R14: 00007fa10fe8b060 R15: 00007fff73e23b20\n\u0026lt;/TASK\u0026gt;\r\n\r\nThe issue triggering process is analyzed as follows:\nThread A Thread B\ntcp_v4_rcv\t//receive ack TCP packet inet_shutdown\n tcp_check_req tcp_disconnect //disconnect sock\n ... tcp_set_state(sk, TCP_CLOSE)\n inet_csk_complete_hashdance ...\n inet_csk_reqsk_queue_add \n---truncated---(CVE-2024-26614)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: don\u0026apos;t abort filesystem when attempting to snapshot deleted subvolume\r\n\r\nIf the source file descriptor to the snapshot ioctl refers to a deleted\nsubvolume, we get the following abort:\r\n\r\n BTRFS: Transaction aborted (error -2)\n WARNING: CPU: 0 PID: 833 at fs/btrfs/transaction.c:1875 create_pending_snapshot+0x1040/0x1190 [btrfs]\n Modules linked in: pata_acpi btrfs ata_piix libata scsi_mod virtio_net blake2b_generic xor net_failover virtio_rng failover scsi_common rng_core raid6_pq libcrc32c\n CPU: 0 PID: 833 Comm: t_snapshot_dele Not tainted 6.7.0-rc6 #2\n Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014\n RIP: 0010:create_pending_snapshot+0x1040/0x1190 [btrfs]\n RSP: 0018:ffffa09c01337af8 EFLAGS: 00010282\n RAX: 0000000000000000 RBX: ffff9982053e7c78 RCX: 0000000000000027\n RDX: ffff99827dc20848 RSI: 0000000000000001 RDI: ffff99827dc20840\n RBP: ffffa09c01337c00 R08: 0000000000000000 R09: ffffa09c01337998\n R10: 0000000000000003 R11: ffffffffb96da248 R12: fffffffffffffffe\n R13: ffff99820535bb28 R14: ffff99820b7bd000 R15: ffff99820381ea80\n FS: 00007fe20aadabc0(0000) GS:ffff99827dc00000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 0000559a120b502f CR3: 00000000055b6000 CR4: 00000000000006f0\n Call Trace:\n \u0026lt;TASK\u0026gt;\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n ? __warn+0x81/0x130\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n ? report_bug+0x171/0x1a0\n ? handle_bug+0x3a/0x70\n ? exc_invalid_op+0x17/0x70\n ? asm_exc_invalid_op+0x1a/0x20\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n create_pending_snapshots+0x92/0xc0 [btrfs]\n btrfs_commit_transaction+0x66b/0xf40 [btrfs]\n btrfs_mksubvol+0x301/0x4d0 [btrfs]\n btrfs_mksnapshot+0x80/0xb0 [btrfs]\n __btrfs_ioctl_snap_create+0x1c2/0x1d0 [btrfs]\n btrfs_ioctl_snap_create_v2+0xc4/0x150 [btrfs]\n btrfs_ioctl+0x8a6/0x2650 [btrfs]\n ? kmem_cache_free+0x22/0x340\n ? do_sys_openat2+0x97/0xe0\n __x64_sys_ioctl+0x97/0xd0\n do_syscall_64+0x46/0xf0\n entry_SYSCALL_64_after_hwframe+0x6e/0x76\n RIP: 0033:0x7fe20abe83af\n RSP: 002b:00007ffe6eff1360 EFLAGS: 00000246 ORIG_RAX: 0000000000000010\n RAX: ffffffffffffffda RBX: 0000000000000004 RCX: 00007fe20abe83af\n RDX: 00007ffe6eff23c0 RSI: 0000000050009417 RDI: 0000000000000003\n RBP: 0000000000000003 R08: 0000000000000000 R09: 00007fe20ad16cd0\n R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000\n R13: 00007ffe6eff13c0 R14: 00007fe20ad45000 R15: 0000559a120b6d58\n \u0026lt;/TASK\u0026gt;\n ---[ end trace 0000000000000000 ]---\n BTRFS: error (device vdc: state A) in create_pending_snapshot:1875: errno=-2 No such entry\n BTRFS info (device vdc: state EA): forced readonly\n BTRFS warning (device vdc: state EA): Skipping commit of aborted transaction.\n BTRFS: error (device vdc: state EA) in cleanup_transaction:2055: errno=-2 No such entry\r\n\r\nThis happens because create_pending_snapshot() initializes the new root\nitem as a copy of the source root item. This includes the refs field,\nwhich is 0 for a deleted subvolume. The call to btrfs_insert_root()\ntherefore inserts a root with refs == 0. btrfs_get_new_fs_root() then\nfinds the root and returns -ENOENT if refs == 0, which causes\ncreate_pending_snapshot() to abort.\r\n\r\nFix it by checking the source root\u0026apos;s refs before attempting the\nsnapshot, but after locking subvol_sem to avoid racing with deletion.(CVE-2024-26644)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhv_netvsc: Fix race condition between netvsc_probe and netvsc_remove\r\n\r\nIn commit ac5047671758 (\u0026quot;hv_netvsc: Disable NAPI before closing the\nVMBus channel\u0026quot;), napi_disable was getting called for all channels,\nincluding all subchannels without confirming if they are enabled or not.\r\n\r\nThis caused hv_netvsc getting hung at napi_disable, when netvsc_probe()\nhas finished running but nvdev-\u0026gt;subchan_work has not started yet.\nnetvsc_subchan_work() -\u0026gt; rndis_set_subchannel() has not created the\nsub-channels and because of that netvsc_sc_open() is not running.\nnetvsc_remove() calls cancel_work_sync(\u0026amp;nvdev-\u0026gt;subchan_work), for which\nnetvsc_subchan_work did not run.\r\n\r\nnetif_napi_add() sets the bit NAPI_STATE_SCHED because it ensures NAPI\ncannot be scheduled. Then netvsc_sc_open() -\u0026gt; napi_enable will clear the\nNAPIF_STATE_SCHED bit, so it can be scheduled. napi_disable() does the\nopposite.\r\n\r\nNow during netvsc_device_remove(), when napi_disable is called for those\nsubchannels, napi_disable gets stuck on infinite msleep.\r\n\r\nThis fix addresses this problem by ensuring that napi_disable() is not\ngetting called for non-enabled NAPI struct.\nBut netif_napi_del() is still necessary for these non-enabled NAPI struct\nfor cleanup purpose.\r\n\r\nCall trace:\n[ 654.559417] task:modprobe state:D stack: 0 pid: 2321 ppid: 1091 flags:0x00004002\n[ 654.568030] Call Trace:\n[ 654.571221] \u0026lt;TASK\u0026gt;\n[ 654.573790] __schedule+0x2d6/0x960\n[ 654.577733] schedule+0x69/0xf0\n[ 654.581214] schedule_timeout+0x87/0x140\n[ 654.585463] ? __bpf_trace_tick_stop+0x20/0x20\n[ 654.590291] msleep+0x2d/0x40\n[ 654.593625] napi_disable+0x2b/0x80\n[ 654.597437] netvsc_device_remove+0x8a/0x1f0 [hv_netvsc]\n[ 654.603935] rndis_filter_device_remove+0x194/0x1c0 [hv_netvsc]\n[ 654.611101] ? do_wait_intr+0xb0/0xb0\n[ 654.615753] netvsc_remove+0x7c/0x120 [hv_netvsc]\n[ 654.621675] vmbus_remove+0x27/0x40 [hv_vmbus](CVE-2024-26698)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nafs: Increase buffer size in afs_update_volume_status()\r\n\r\nThe max length of volume-\u0026gt;vid value is 20 characters.\nSo increase idbuf[] size up to 24 to avoid overflow.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.\r\n\r\n[DH: Actually, it\u0026apos;s 20 + NUL, so increase it to 24 and use snprintf()](CVE-2024-26736)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nARM: ep93xx: Add terminator to gpiod_lookup_table\r\n\r\nWithout the terminator, if a con_id is passed to gpio_find() that\ndoes not exist in the lookup table the function will not stop looping\ncorrectly, and eventually cause an oops.(CVE-2024-26751)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/aio: Restrict kiocb_set_cancel_fn() to I/O submitted via libaio\r\n\r\nIf kiocb_set_cancel_fn() is called for I/O submitted via io_uring, the\nfollowing kernel warning appears:\r\n\r\nWARNING: CPU: 3 PID: 368 at fs/aio.c:598 kiocb_set_cancel_fn+0x9c/0xa8\nCall trace:\n kiocb_set_cancel_fn+0x9c/0xa8\n ffs_epfile_read_iter+0x144/0x1d0\n io_read+0x19c/0x498\n io_issue_sqe+0x118/0x27c\n io_submit_sqes+0x25c/0x5fc\n __arm64_sys_io_uring_enter+0x104/0xab0\n invoke_syscall+0x58/0x11c\n el0_svc_common+0xb4/0xf4\n do_el0_svc+0x2c/0xb0\n el0_svc+0x2c/0xa4\n el0t_64_sync_handler+0x68/0xb4\n el0t_64_sync+0x1a4/0x1a8\r\n\r\nFix this by setting the IOCB_AIO_RW flag for read and write I/O that is\nsubmitted by libaio.(CVE-2024-26764)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: avoid allocating blocks from corrupted group in ext4_mb_find_by_goal()\r\n\r\nPlaces the logic for checking if the group\u0026apos;s block bitmap is corrupt under\nthe protection of the group lock to avoid allocating blocks from the group\nwith a corrupted block bitmap.(CVE-2024-26772)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\r\n\r\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\r\n\r\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0026apos;t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u0026gt;ac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group(CVE-2024-26773)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfbdev: sis: Error out if pixclock equals zero\r\n\r\nThe userspace program could pass any values to the driver through\nioctl() interface. If the driver doesn\u0026apos;t check the value of pixclock,\nit may cause divide-by-zero error.\r\n\r\nIn sisfb_check_var(), var-\u0026gt;pixclock is used as a divisor to caculate\ndrate before it is checked against zero. Fix this by checking it\nat the beginning.\r\n\r\nThis is similar to CVE-2022-3061 in i740fb which was fixed by\ncommit 15cf0b8.(CVE-2024-26777)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfbdev: savage: Error out if pixclock equals zero\r\n\r\nThe userspace program could pass any values to the driver through\nioctl() interface. If the driver doesn\u0026apos;t check the value of pixclock,\nit may cause divide-by-zero error.\r\n\r\nAlthough pixclock is checked in savagefb_decode_var(), but it is not\nchecked properly in savagefb_probe(). Fix this by checking whether\npixclock is zero in the function savagefb_check_var() before\ninfo-\u0026gt;var.pixclock is used as the divisor.\r\n\r\nThis is similar to CVE-2022-3061 in i740fb which was fixed by\ncommit 15cf0b8.(CVE-2024-26778)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndmaengine: fsl-qdma: init irq after reg initialization\r\n\r\nInitialize the qDMA irqs after the registers are configured so that\ninterrupts that may have been pending from a primary kernel don\u0026apos;t get\nprocessed by the irq handler before it is ready to and cause panic with\nthe following trace:\r\n\r\n Call trace:\n fsl_qdma_queue_handler+0xf8/0x3e8\n __handle_irq_event_percpu+0x78/0x2b0\n handle_irq_event_percpu+0x1c/0x68\n handle_irq_event+0x44/0x78\n handle_fasteoi_irq+0xc8/0x178\n generic_handle_irq+0x24/0x38\n __handle_domain_irq+0x90/0x100\n gic_handle_irq+0x5c/0xb8\n el1_irq+0xb8/0x180\n _raw_spin_unlock_irqrestore+0x14/0x40\n __setup_irq+0x4bc/0x798\n request_threaded_irq+0xd8/0x190\n devm_request_threaded_irq+0x74/0xe8\n fsl_qdma_probe+0x4d4/0xca8\n platform_drv_probe+0x50/0xa0\n really_probe+0xe0/0x3f8\n driver_probe_device+0x64/0x130\n device_driver_attach+0x6c/0x78\n __driver_attach+0xbc/0x158\n bus_for_each_dev+0x5c/0x98\n driver_attach+0x20/0x28\n bus_add_driver+0x158/0x220\n driver_register+0x60/0x110\n __platform_driver_register+0x44/0x50\n fsl_qdma_driver_init+0x18/0x20\n do_one_initcall+0x48/0x258\n kernel_init_freeable+0x1a4/0x23c\n kernel_init+0x10/0xf8\n ret_from_fork+0x10/0x18(CVE-2024-26788)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvfio/pci: Lock external INTx masking ops\r\n\r\nMask operations through config space changes to DisINTx may race INTx\nconfiguration changes via ioctl. Create wrappers that add locking for\npaths outside of the core interrupt code.\r\n\r\nIn particular, irq_type is updated holding igate, therefore testing\nis_intx() requires holding igate. For example clearing DisINTx from\nconfig space can otherwise race changes of the interrupt configuration.\r\n\r\nThis aligns interfaces which may trigger the INTx eventfd into two\ncamps, one side serialized by igate and the other only enabled while\nINTx is configured. A subsequent patch introduces synchronization for\nthe latter flows.(CVE-2024-26810)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Fix stackmap overflow check on 32-bit arches\r\n\r\nThe stackmap code relies on roundup_pow_of_two() to compute the number\nof hash buckets, and contains an overflow check by checking if the\nresulting value is 0. However, on 32-bit arches, the roundup code itself\ncan overflow by doing a 32-bit left-shift of an unsigned long value,\nwhich is undefined behaviour, so it is not guaranteed to truncate\nneatly. This was triggered by syzbot on the DEVMAP_HASH type, which\ncontains the same check, copied from the hashtab code.\r\n\r\nThe commit in the fixes tag actually attempted to fix this, but the fix\ndid not account for the UB, so the fix only works on CPUs where an\noverflow does result in a neat truncation to zero, which is not\nguaranteed. Checking the value before rounding does not have this\nproblem.(CVE-2024-26883)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Fix hashtab overflow check on 32-bit arches\r\n\r\nThe hashtab code relies on roundup_pow_of_two() to compute the number of\nhash buckets, and contains an overflow check by checking if the\nresulting value is 0. However, on 32-bit arches, the roundup code itself\ncan overflow by doing a 32-bit left-shift of an unsigned long value,\nwhich is undefined behaviour, so it is not guaranteed to truncate\nneatly. This was triggered by syzbot on the DEVMAP_HASH type, which\ncontains the same check, copied from the hashtab code. So apply the same\nfix to hashtab, by moving the overflow check to before the roundup.(CVE-2024-26884)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Fix DEVMAP_HASH overflow check on 32-bit arches\r\n\r\nThe devmap code allocates a number hash buckets equal to the next power\nof two of the max_entries value provided when creating the map. When\nrounding up to the next power of two, the 32-bit variable storing the\nnumber of buckets can overflow, and the code checks for overflow by\nchecking if the truncated 32-bit value is equal to 0. However, on 32-bit\narches the rounding up itself can overflow mid-way through, because it\nends up doing a left-shift of 32 bits on an unsigned long value. If the\nsize of an unsigned long is four bytes, this is undefined behaviour, so\nthere is no guarantee that we\u0026apos;ll end up with a nice and tidy 0-value at\nthe end.\r\n\r\nSyzbot managed to turn this into a crash on arm32 by creating a\nDEVMAP_HASH with max_entries \u0026gt; 0x80000000 and then trying to update it.\nFix this by moving the overflow check to before the rounding up\noperation.(CVE-2024-26885)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvfio/pci: Disable auto-enable of exclusive INTx IRQ\r\n\r\nCurrently for devices requiring masking at the irqchip for INTx, ie.\ndevices without DisINTx support, the IRQ is enabled in request_irq()\nand subsequently disabled as necessary to align with the masked status\nflag. This presents a window where the interrupt could fire between\nthese events, resulting in the IRQ incrementing the disable depth twice.\nThis would be unrecoverable for a user since the masked flag prevents\nnested enables through vfio.\r\n\r\nInstead, invert the logic using IRQF_NO_AUTOEN such that exclusive INTx\nis never auto-enabled, then unmask as required.(CVE-2024-27437)",
"id": "OESA-2024-1520",
"modified": "2026-08-06T11:06:57Z",
"published": "2024-05-10T11:06:57Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1520"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-25739"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26607"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26614"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26644"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26698"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26736"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26751"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26764"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26772"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26773"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26777"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26778"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26788"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26810"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26883"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26884"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26885"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27437"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2024-25739",
"CVE-2024-26607",
"CVE-2024-26614",
"CVE-2024-26644",
"CVE-2024-26698",
"CVE-2024-26736",
"CVE-2024-26751",
"CVE-2024-26764",
"CVE-2024-26772",
"CVE-2024-26773",
"CVE-2024-26777",
"CVE-2024-26778",
"CVE-2024-26788",
"CVE-2024-26810",
"CVE-2024-26883",
"CVE-2024-26884",
"CVE-2024-26885",
"CVE-2024-27437"
]
}
OESA-2024-1524 (CVE-2024-25739)
Vulnerability from osv_openeuler – Published: 2024-05-10 11:06 – Updated: 2026-08-06 11:06 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
create_empty_lvol in drivers/mtd/ubi/vtbl.c in the Linux kernel through 6.7.4 can attempt to allocate zero bytes, and crash, because of a missing check for ubi->leb_size.(CVE-2024-25739)
In the Linux kernel, the following vulnerability has been resolved:
drm/bridge: sii902x: Fix probing race issue
A null pointer dereference crash has been observed rarely on TI platforms using sii9022 bridge:
[ 53.271356] sii902x_get_edid+0x34/0x70 [sii902x] [ 53.276066] sii902x_bridge_get_edid+0x14/0x20 [sii902x] [ 53.281381] drm_bridge_get_edid+0x20/0x34 [drm] [ 53.286305] drm_bridge_connector_get_modes+0x8c/0xcc [drm_kms_helper] [ 53.292955] drm_helper_probe_single_connector_modes+0x190/0x538 [drm_kms_helper] [ 53.300510] drm_client_modeset_probe+0x1f0/0xbd4 [drm] [ 53.305958] __drm_fb_helper_initial_config_and_unlock+0x50/0x510 [drm_kms_helper] [ 53.313611] drm_fb_helper_initial_config+0x48/0x58 [drm_kms_helper] [ 53.320039] drm_fbdev_dma_client_hotplug+0x84/0xd4 [drm_dma_helper] [ 53.326401] drm_client_register+0x5c/0xa0 [drm] [ 53.331216] drm_fbdev_dma_setup+0xc8/0x13c [drm_dma_helper] [ 53.336881] tidss_probe+0x128/0x264 [tidss] [ 53.341174] platform_probe+0x68/0xc4 [ 53.344841] really_probe+0x188/0x3c4 [ 53.348501] __driver_probe_device+0x7c/0x16c [ 53.352854] driver_probe_device+0x3c/0x10c [ 53.357033] __device_attach_driver+0xbc/0x158 [ 53.361472] bus_for_each_drv+0x88/0xe8 [ 53.365303] __device_attach+0xa0/0x1b4 [ 53.369135] device_initial_probe+0x14/0x20 [ 53.373314] bus_probe_device+0xb0/0xb4 [ 53.377145] deferred_probe_work_func+0xcc/0x124 [ 53.381757] process_one_work+0x1f0/0x518 [ 53.385770] worker_thread+0x1e8/0x3dc [ 53.389519] kthread+0x11c/0x120 [ 53.392750] ret_from_fork+0x10/0x20
The issue here is as follows:
- tidss probes, but is deferred as sii902x is still missing.
- sii902x starts probing and enters sii902x_init().
- sii902x calls drm_bridge_add(). Now the sii902x bridge is ready from DRM's perspective.
- sii902x calls sii902x_audio_codec_init() and platform_device_register_data()
- The registration of the audio platform device causes probing of the deferred devices.
- tidss probes, which eventually causes sii902x_bridge_get_edid() to be called.
- sii902x_bridge_get_edid() tries to use the i2c to read the edid. However, the sii902x driver has not set up the i2c part yet, leading to the crash.
Fix this by moving the drm_bridge_add() to the end of the sii902x_init(), which is also at the very end of sii902x_probe().(CVE-2024-26607)
In the Linux kernel, the following vulnerability has been resolved:
tcp: make sure init the accept_queue's spinlocks once
When I run syz's reproduction C program locally, it causes the following issue: pvqspinlock: lock 0xffff9d181cd5c660 has corrupted value 0x0! WARNING: CPU: 19 PID: 21160 at __pv_queued_spin_unlock_slowpath (kernel/locking/qspinlock_paravirt.h:508) Hardware name: Red Hat KVM, BIOS 0.5.1 01/01/2011 RIP: 0010:__pv_queued_spin_unlock_slowpath (kernel/locking/qspinlock_paravirt.h:508) Code: 73 56 3a ff 90 c3 cc cc cc cc 8b 05 bb 1f 48 01 85 c0 74 05 c3 cc cc cc cc 8b 17 48 89 fe 48 c7 c7 30 20 ce 8f e8 ad 56 42 ff <0f> 0b c3 cc cc cc cc 0f 0b 0f 1f 40 00 90 90 90 90 90 90 90 90 90 RSP: 0018:ffffa8d200604cb8 EFLAGS: 00010282 RAX: 0000000000000000 RBX: 0000000000000000 RCX: ffff9d1ef60e0908 RDX: 00000000ffffffd8 RSI: 0000000000000027 RDI: ffff9d1ef60e0900 RBP: ffff9d181cd5c280 R08: 0000000000000000 R09: 00000000ffff7fff R10: ffffa8d200604b68 R11: ffffffff907dcdc8 R12: 0000000000000000 R13: ffff9d181cd5c660 R14: ffff9d1813a3f330 R15: 0000000000001000 FS: 00007fa110184640(0000) GS:ffff9d1ef60c0000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000000020000000 CR3: 000000011f65e000 CR4: 00000000000006f0 Call Trace: <IRQ> _raw_spin_unlock (kernel/locking/spinlock.c:186) inet_csk_reqsk_queue_add (net/ipv4/inet_connection_sock.c:1321) inet_csk_complete_hashdance (net/ipv4/inet_connection_sock.c:1358) tcp_check_req (net/ipv4/tcp_minisocks.c:868) tcp_v4_rcv (net/ipv4/tcp_ipv4.c:2260) ip_protocol_deliver_rcu (net/ipv4/ip_input.c:205) ip_local_deliver_finish (net/ipv4/ip_input.c:234) __netif_receive_skb_one_core (net/core/dev.c:5529) process_backlog (./include/linux/rcupdate.h:779) __napi_poll (net/core/dev.c:6533) net_rx_action (net/core/dev.c:6604) __do_softirq (./arch/x86/include/asm/jump_label.h:27) do_softirq (kernel/softirq.c:454 kernel/softirq.c:441) </IRQ> <TASK> __local_bh_enable_ip (kernel/softirq.c:381) __dev_queue_xmit (net/core/dev.c:4374) ip_finish_output2 (./include/net/neighbour.h:540 net/ipv4/ip_output.c:235) __ip_queue_xmit (net/ipv4/ip_output.c:535) __tcp_transmit_skb (net/ipv4/tcp_output.c:1462) tcp_rcv_synsent_state_process (net/ipv4/tcp_input.c:6469) tcp_rcv_state_process (net/ipv4/tcp_input.c:6657) tcp_v4_do_rcv (net/ipv4/tcp_ipv4.c:1929) __release_sock (./include/net/sock.h:1121 net/core/sock.c:2968) release_sock (net/core/sock.c:3536) inet_wait_for_connect (net/ipv4/af_inet.c:609) __inet_stream_connect (net/ipv4/af_inet.c:702) inet_stream_connect (net/ipv4/af_inet.c:748) __sys_connect (./include/linux/file.h:45 net/socket.c:2064) __x64_sys_connect (net/socket.c:2073 net/socket.c:2070 net/socket.c:2070) do_syscall_64 (arch/x86/entry/common.c:51 arch/x86/entry/common.c:82) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:129) RIP: 0033:0x7fa10ff05a3d Code: 5b 41 5c c3 66 0f 1f 84 00 00 00 00 00 f3 0f 1e fa 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 8b 0d ab a3 0e 00 f7 d8 64 89 01 48 RSP: 002b:00007fa110183de8 EFLAGS: 00000202 ORIG_RAX: 000000000000002a RAX: ffffffffffffffda RBX: 0000000020000054 RCX: 00007fa10ff05a3d RDX: 000000000000001c RSI: 0000000020000040 RDI: 0000000000000003 RBP: 00007fa110183e20 R08: 0000000000000000 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000202 R12: 00007fa110184640 R13: 0000000000000000 R14: 00007fa10fe8b060 R15: 00007fff73e23b20 </TASK>
The issue triggering process is analyzed as follows:
Thread A Thread B
tcp_v4_rcv //receive ack TCP packet inet_shutdown
tcp_check_req tcp_disconnect //disconnect sock
... tcp_set_state(sk, TCP_CLOSE)
inet_csk_complete_hashdance ...
inet_csk_reqsk_queue_add
---truncated---(CVE-2024-26614)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: don't abort filesystem when attempting to snapshot deleted subvolume
If the source file descriptor to the snapshot ioctl refers to a deleted subvolume, we get the following abort:
BTRFS: Transaction aborted (error -2) WARNING: CPU: 0 PID: 833 at fs/btrfs/transaction.c:1875 create_pending_snapshot+0x1040/0x1190 [btrfs] Modules linked in: pata_acpi btrfs ata_piix libata scsi_mod virtio_net blake2b_generic xor net_failover virtio_rng failover scsi_common rng_core raid6_pq libcrc32c CPU: 0 PID: 833 Comm: t_snapshot_dele Not tainted 6.7.0-rc6 #2 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014 RIP: 0010:create_pending_snapshot+0x1040/0x1190 [btrfs] RSP: 0018:ffffa09c01337af8 EFLAGS: 00010282 RAX: 0000000000000000 RBX: ffff9982053e7c78 RCX: 0000000000000027 RDX: ffff99827dc20848 RSI: 0000000000000001 RDI: ffff99827dc20840 RBP: ffffa09c01337c00 R08: 0000000000000000 R09: ffffa09c01337998 R10: 0000000000000003 R11: ffffffffb96da248 R12: fffffffffffffffe R13: ffff99820535bb28 R14: ffff99820b7bd000 R15: ffff99820381ea80 FS: 00007fe20aadabc0(0000) GS:ffff99827dc00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000559a120b502f CR3: 00000000055b6000 CR4: 00000000000006f0 Call Trace: <TASK> ? create_pending_snapshot+0x1040/0x1190 [btrfs] ? __warn+0x81/0x130 ? create_pending_snapshot+0x1040/0x1190 [btrfs] ? report_bug+0x171/0x1a0 ? handle_bug+0x3a/0x70 ? exc_invalid_op+0x17/0x70 ? asm_exc_invalid_op+0x1a/0x20 ? create_pending_snapshot+0x1040/0x1190 [btrfs] ? create_pending_snapshot+0x1040/0x1190 [btrfs] create_pending_snapshots+0x92/0xc0 [btrfs] btrfs_commit_transaction+0x66b/0xf40 [btrfs] btrfs_mksubvol+0x301/0x4d0 [btrfs] btrfs_mksnapshot+0x80/0xb0 [btrfs] __btrfs_ioctl_snap_create+0x1c2/0x1d0 [btrfs] btrfs_ioctl_snap_create_v2+0xc4/0x150 [btrfs] btrfs_ioctl+0x8a6/0x2650 [btrfs] ? kmem_cache_free+0x22/0x340 ? do_sys_openat2+0x97/0xe0 __x64_sys_ioctl+0x97/0xd0 do_syscall_64+0x46/0xf0 entry_SYSCALL_64_after_hwframe+0x6e/0x76 RIP: 0033:0x7fe20abe83af RSP: 002b:00007ffe6eff1360 EFLAGS: 00000246 ORIG_RAX: 0000000000000010 RAX: ffffffffffffffda RBX: 0000000000000004 RCX: 00007fe20abe83af RDX: 00007ffe6eff23c0 RSI: 0000000050009417 RDI: 0000000000000003 RBP: 0000000000000003 R08: 0000000000000000 R09: 00007fe20ad16cd0 R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000 R13: 00007ffe6eff13c0 R14: 00007fe20ad45000 R15: 0000559a120b6d58 </TASK> ---[ end trace 0000000000000000 ]--- BTRFS: error (device vdc: state A) in create_pending_snapshot:1875: errno=-2 No such entry BTRFS info (device vdc: state EA): forced readonly BTRFS warning (device vdc: state EA): Skipping commit of aborted transaction. BTRFS: error (device vdc: state EA) in cleanup_transaction:2055: errno=-2 No such entry
This happens because create_pending_snapshot() initializes the new root item as a copy of the source root item. This includes the refs field, which is 0 for a deleted subvolume. The call to btrfs_insert_root() therefore inserts a root with refs == 0. btrfs_get_new_fs_root() then finds the root and returns -ENOENT if refs == 0, which causes create_pending_snapshot() to abort.
Fix it by checking the source root's refs before attempting the snapshot, but after locking subvol_sem to avoid racing with deletion.(CVE-2024-26644)
In the Linux kernel, the following vulnerability has been resolved:
hv_netvsc: Fix race condition between netvsc_probe and netvsc_remove
In commit ac5047671758 ("hv_netvsc: Disable NAPI before closing the VMBus channel"), napi_disable was getting called for all channels, including all subchannels without confirming if they are enabled or not.
This caused hv_netvsc getting hung at napi_disable, when netvsc_probe() has finished running but nvdev->subchan_work has not started yet. netvsc_subchan_work() -> rndis_set_subchannel() has not created the sub-channels and because of that netvsc_sc_open() is not running. netvsc_remove() calls cancel_work_sync(&nvdev->subchan_work), for which netvsc_subchan_work did not run.
netif_napi_add() sets the bit NAPI_STATE_SCHED because it ensures NAPI cannot be scheduled. Then netvsc_sc_open() -> napi_enable will clear the NAPIF_STATE_SCHED bit, so it can be scheduled. napi_disable() does the opposite.
Now during netvsc_device_remove(), when napi_disable is called for those subchannels, napi_disable gets stuck on infinite msleep.
This fix addresses this problem by ensuring that napi_disable() is not getting called for non-enabled NAPI struct. But netif_napi_del() is still necessary for these non-enabled NAPI struct for cleanup purpose.
Call trace: [ 654.559417] task:modprobe state:D stack: 0 pid: 2321 ppid: 1091 flags:0x00004002 [ 654.568030] Call Trace: [ 654.571221] <TASK> [ 654.573790] __schedule+0x2d6/0x960 [ 654.577733] schedule+0x69/0xf0 [ 654.581214] schedule_timeout+0x87/0x140 [ 654.585463] ? __bpf_trace_tick_stop+0x20/0x20 [ 654.590291] msleep+0x2d/0x40 [ 654.593625] napi_disable+0x2b/0x80 [ 654.597437] netvsc_device_remove+0x8a/0x1f0 [hv_netvsc] [ 654.603935] rndis_filter_device_remove+0x194/0x1c0 [hv_netvsc] [ 654.611101] ? do_wait_intr+0xb0/0xb0 [ 654.615753] netvsc_remove+0x7c/0x120 [hv_netvsc] [ 654.621675] vmbus_remove+0x27/0x40 hv_vmbus
In the Linux kernel, the following vulnerability has been resolved:
afs: Increase buffer size in afs_update_volume_status()
The max length of volume->vid value is 20 characters. So increase idbuf[] size up to 24 to avoid overflow.
Found by Linux Verification Center (linuxtesting.org) with SVACE.
DH: Actually, it's 20 + NUL, so increase it to 24 and use snprintf()
In the Linux kernel, the following vulnerability has been resolved:
ARM: ep93xx: Add terminator to gpiod_lookup_table
Without the terminator, if a con_id is passed to gpio_find() that does not exist in the lookup table the function will not stop looping correctly, and eventually cause an oops.(CVE-2024-26751)
In the Linux kernel, the following vulnerability has been resolved:
fs/aio: Restrict kiocb_set_cancel_fn() to I/O submitted via libaio
If kiocb_set_cancel_fn() is called for I/O submitted via io_uring, the following kernel warning appears:
WARNING: CPU: 3 PID: 368 at fs/aio.c:598 kiocb_set_cancel_fn+0x9c/0xa8 Call trace: kiocb_set_cancel_fn+0x9c/0xa8 ffs_epfile_read_iter+0x144/0x1d0 io_read+0x19c/0x498 io_issue_sqe+0x118/0x27c io_submit_sqes+0x25c/0x5fc __arm64_sys_io_uring_enter+0x104/0xab0 invoke_syscall+0x58/0x11c el0_svc_common+0xb4/0xf4 do_el0_svc+0x2c/0xb0 el0_svc+0x2c/0xa4 el0t_64_sync_handler+0x68/0xb4 el0t_64_sync+0x1a4/0x1a8
Fix this by setting the IOCB_AIO_RW flag for read and write I/O that is submitted by libaio.(CVE-2024-26764)
In the Linux kernel, the following vulnerability has been resolved:
ext4: avoid allocating blocks from corrupted group in ext4_mb_find_by_goal()
Places the logic for checking if the group's block bitmap is corrupt under the protection of the group lock to avoid allocating blocks from the group with a corrupted block bitmap.(CVE-2024-26772)
In the Linux kernel, the following vulnerability has been resolved:
ext4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()
Determine if the group block bitmap is corrupted before using ac_b_ex in ext4_mb_try_best_found() to avoid allocating blocks from a group with a corrupted block bitmap in the following concurrency and making the situation worse.
ext4_mb_regular_allocator ext4_lock_group(sb, group) ext4_mb_good_group // check if the group bbitmap is corrupted ext4_mb_complex_scan_group // Scan group gets ac_b_ex but doesn't use it ext4_unlock_group(sb, group) ext4_mark_group_bitmap_corrupted(group) // The block bitmap was corrupted during // the group unlock gap. ext4_mb_try_best_found ext4_lock_group(ac->ac_sb, group) ext4_mb_use_best_found mb_mark_used // Allocating blocks in block bitmap corrupted group(CVE-2024-26773)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: sis: Error out if pixclock equals zero
The userspace program could pass any values to the driver through ioctl() interface. If the driver doesn't check the value of pixclock, it may cause divide-by-zero error.
In sisfb_check_var(), var->pixclock is used as a divisor to caculate drate before it is checked against zero. Fix this by checking it at the beginning.
This is similar to CVE-2022-3061 in i740fb which was fixed by commit 15cf0b8.(CVE-2024-26777)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: savage: Error out if pixclock equals zero
The userspace program could pass any values to the driver through ioctl() interface. If the driver doesn't check the value of pixclock, it may cause divide-by-zero error.
Although pixclock is checked in savagefb_decode_var(), but it is not checked properly in savagefb_probe(). Fix this by checking whether pixclock is zero in the function savagefb_check_var() before info->var.pixclock is used as the divisor.
This is similar to CVE-2022-3061 in i740fb which was fixed by commit 15cf0b8.(CVE-2024-26778)
In the Linux kernel, the following vulnerability has been resolved:
dmaengine: fsl-qdma: init irq after reg initialization
Initialize the qDMA irqs after the registers are configured so that interrupts that may have been pending from a primary kernel don't get processed by the irq handler before it is ready to and cause panic with the following trace:
Call trace: fsl_qdma_queue_handler+0xf8/0x3e8 __handle_irq_event_percpu+0x78/0x2b0 handle_irq_event_percpu+0x1c/0x68 handle_irq_event+0x44/0x78 handle_fasteoi_irq+0xc8/0x178 generic_handle_irq+0x24/0x38 __handle_domain_irq+0x90/0x100 gic_handle_irq+0x5c/0xb8 el1_irq+0xb8/0x180 _raw_spin_unlock_irqrestore+0x14/0x40 __setup_irq+0x4bc/0x798 request_threaded_irq+0xd8/0x190 devm_request_threaded_irq+0x74/0xe8 fsl_qdma_probe+0x4d4/0xca8 platform_drv_probe+0x50/0xa0 really_probe+0xe0/0x3f8 driver_probe_device+0x64/0x130 device_driver_attach+0x6c/0x78 __driver_attach+0xbc/0x158 bus_for_each_dev+0x5c/0x98 driver_attach+0x20/0x28 bus_add_driver+0x158/0x220 driver_register+0x60/0x110 __platform_driver_register+0x44/0x50 fsl_qdma_driver_init+0x18/0x20 do_one_initcall+0x48/0x258 kernel_init_freeable+0x1a4/0x23c kernel_init+0x10/0xf8 ret_from_fork+0x10/0x18(CVE-2024-26788)
In the Linux kernel, the following vulnerability has been resolved:
vfio/pci: Lock external INTx masking ops
Mask operations through config space changes to DisINTx may race INTx configuration changes via ioctl. Create wrappers that add locking for paths outside of the core interrupt code.
In particular, irq_type is updated holding igate, therefore testing is_intx() requires holding igate. For example clearing DisINTx from config space can otherwise race changes of the interrupt configuration.
This aligns interfaces which may trigger the INTx eventfd into two camps, one side serialized by igate and the other only enabled while INTx is configured. A subsequent patch introduces synchronization for the latter flows.(CVE-2024-26810)
In the Linux kernel, the following vulnerability has been resolved:
bpf: Fix stackmap overflow check on 32-bit arches
The stackmap code relies on roundup_pow_of_two() to compute the number of hash buckets, and contains an overflow check by checking if the resulting value is 0. However, on 32-bit arches, the roundup code itself can overflow by doing a 32-bit left-shift of an unsigned long value, which is undefined behaviour, so it is not guaranteed to truncate neatly. This was triggered by syzbot on the DEVMAP_HASH type, which contains the same check, copied from the hashtab code.
The commit in the fixes tag actually attempted to fix this, but the fix did not account for the UB, so the fix only works on CPUs where an overflow does result in a neat truncation to zero, which is not guaranteed. Checking the value before rounding does not have this problem.(CVE-2024-26883)
In the Linux kernel, the following vulnerability has been resolved:
bpf: Fix hashtab overflow check on 32-bit arches
The hashtab code relies on roundup_pow_of_two() to compute the number of hash buckets, and contains an overflow check by checking if the resulting value is 0. However, on 32-bit arches, the roundup code itself can overflow by doing a 32-bit left-shift of an unsigned long value, which is undefined behaviour, so it is not guaranteed to truncate neatly. This was triggered by syzbot on the DEVMAP_HASH type, which contains the same check, copied from the hashtab code. So apply the same fix to hashtab, by moving the overflow check to before the roundup.(CVE-2024-26884)
In the Linux kernel, the following vulnerability has been resolved:
bpf: Fix DEVMAP_HASH overflow check on 32-bit arches
The devmap code allocates a number hash buckets equal to the next power of two of the max_entries value provided when creating the map. When rounding up to the next power of two, the 32-bit variable storing the number of buckets can overflow, and the code checks for overflow by checking if the truncated 32-bit value is equal to 0. However, on 32-bit arches the rounding up itself can overflow mid-way through, because it ends up doing a left-shift of 32 bits on an unsigned long value. If the size of an unsigned long is four bytes, this is undefined behaviour, so there is no guarantee that we'll end up with a nice and tidy 0-value at the end.
Syzbot managed to turn this into a crash on arm32 by creating a DEVMAP_HASH with max_entries > 0x80000000 and then trying to update it. Fix this by moving the overflow check to before the rounding up operation.(CVE-2024-26885)
In the Linux kernel, the following vulnerability has been resolved:
vfio/pci: Disable auto-enable of exclusive INTx IRQ
Currently for devices requiring masking at the irqchip for INTx, ie. devices without DisINTx support, the IRQ is enabled in request_irq() and subsequently disabled as necessary to align with the masked status flag. This presents a window where the interrupt could fire between these events, resulting in the IRQ incrementing the disable depth twice. This would be unrecoverable for a user since the masked flag prevents nested enables through vfio.
Instead, invert the logic using IRQF_NO_AUTOEN such that exclusive INTx is never auto-enabled, then unmask as required.(CVE-2024-27437)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-tools-devel-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"kernel-debugsource-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"kernel-devel-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"bpftool-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"kernel-debuginfo-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"kernel-source-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"kernel-tools-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"kernel-headers-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"kernel-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"bpftool-debuginfo-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"python3-perf-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"perf-5.10.0-60.136.0.163.oe2203.aarch64.rpm",
"perf-debuginfo-5.10.0-60.136.0.163.oe2203.aarch64.rpm"
],
"src": [
"kernel-5.10.0-60.136.0.163.oe2203.src.rpm"
],
"x86_64": [
"kernel-headers-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"kernel-devel-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"kernel-tools-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"bpftool-debuginfo-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"perf-debuginfo-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"kernel-tools-devel-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"kernel-debugsource-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"kernel-source-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"kernel-debuginfo-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"python3-perf-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"kernel-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"bpftool-5.10.0-60.136.0.163.oe2203.x86_64.rpm",
"perf-5.10.0-60.136.0.163.oe2203.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-60.136.0.163.oe2203"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\ncreate_empty_lvol in drivers/mtd/ubi/vtbl.c in the Linux kernel through 6.7.4 can attempt to allocate zero bytes, and crash, because of a missing check for ubi-\u0026gt;leb_size.(CVE-2024-25739)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/bridge: sii902x: Fix probing race issue\r\n\r\nA null pointer dereference crash has been observed rarely on TI\nplatforms using sii9022 bridge:\r\n\r\n[ 53.271356] sii902x_get_edid+0x34/0x70 [sii902x]\n[ 53.276066] sii902x_bridge_get_edid+0x14/0x20 [sii902x]\n[ 53.281381] drm_bridge_get_edid+0x20/0x34 [drm]\n[ 53.286305] drm_bridge_connector_get_modes+0x8c/0xcc [drm_kms_helper]\n[ 53.292955] drm_helper_probe_single_connector_modes+0x190/0x538 [drm_kms_helper]\n[ 53.300510] drm_client_modeset_probe+0x1f0/0xbd4 [drm]\n[ 53.305958] __drm_fb_helper_initial_config_and_unlock+0x50/0x510 [drm_kms_helper]\n[ 53.313611] drm_fb_helper_initial_config+0x48/0x58 [drm_kms_helper]\n[ 53.320039] drm_fbdev_dma_client_hotplug+0x84/0xd4 [drm_dma_helper]\n[ 53.326401] drm_client_register+0x5c/0xa0 [drm]\n[ 53.331216] drm_fbdev_dma_setup+0xc8/0x13c [drm_dma_helper]\n[ 53.336881] tidss_probe+0x128/0x264 [tidss]\n[ 53.341174] platform_probe+0x68/0xc4\n[ 53.344841] really_probe+0x188/0x3c4\n[ 53.348501] __driver_probe_device+0x7c/0x16c\n[ 53.352854] driver_probe_device+0x3c/0x10c\n[ 53.357033] __device_attach_driver+0xbc/0x158\n[ 53.361472] bus_for_each_drv+0x88/0xe8\n[ 53.365303] __device_attach+0xa0/0x1b4\n[ 53.369135] device_initial_probe+0x14/0x20\n[ 53.373314] bus_probe_device+0xb0/0xb4\n[ 53.377145] deferred_probe_work_func+0xcc/0x124\n[ 53.381757] process_one_work+0x1f0/0x518\n[ 53.385770] worker_thread+0x1e8/0x3dc\n[ 53.389519] kthread+0x11c/0x120\n[ 53.392750] ret_from_fork+0x10/0x20\r\n\r\nThe issue here is as follows:\r\n\r\n- tidss probes, but is deferred as sii902x is still missing.\n- sii902x starts probing and enters sii902x_init().\n- sii902x calls drm_bridge_add(). Now the sii902x bridge is ready from\n DRM\u0026apos;s perspective.\n- sii902x calls sii902x_audio_codec_init() and\n platform_device_register_data()\n- The registration of the audio platform device causes probing of the\n deferred devices.\n- tidss probes, which eventually causes sii902x_bridge_get_edid() to be\n called.\n- sii902x_bridge_get_edid() tries to use the i2c to read the edid.\n However, the sii902x driver has not set up the i2c part yet, leading\n to the crash.\r\n\r\nFix this by moving the drm_bridge_add() to the end of the\nsii902x_init(), which is also at the very end of sii902x_probe().(CVE-2024-26607)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ntcp: make sure init the accept_queue\u0026apos;s spinlocks once\r\n\r\nWhen I run syz\u0026apos;s reproduction C program locally, it causes the following\nissue:\npvqspinlock: lock 0xffff9d181cd5c660 has corrupted value 0x0!\nWARNING: CPU: 19 PID: 21160 at __pv_queued_spin_unlock_slowpath (kernel/locking/qspinlock_paravirt.h:508)\nHardware name: Red Hat KVM, BIOS 0.5.1 01/01/2011\nRIP: 0010:__pv_queued_spin_unlock_slowpath (kernel/locking/qspinlock_paravirt.h:508)\nCode: 73 56 3a ff 90 c3 cc cc cc cc 8b 05 bb 1f 48 01 85 c0 74 05 c3 cc cc cc cc 8b 17 48 89 fe 48 c7 c7\n30 20 ce 8f e8 ad 56 42 ff \u0026lt;0f\u0026gt; 0b c3 cc cc cc cc 0f 0b 0f 1f 40 00 90 90 90 90 90 90 90 90 90\nRSP: 0018:ffffa8d200604cb8 EFLAGS: 00010282\nRAX: 0000000000000000 RBX: 0000000000000000 RCX: ffff9d1ef60e0908\nRDX: 00000000ffffffd8 RSI: 0000000000000027 RDI: ffff9d1ef60e0900\nRBP: ffff9d181cd5c280 R08: 0000000000000000 R09: 00000000ffff7fff\nR10: ffffa8d200604b68 R11: ffffffff907dcdc8 R12: 0000000000000000\nR13: ffff9d181cd5c660 R14: ffff9d1813a3f330 R15: 0000000000001000\nFS: 00007fa110184640(0000) GS:ffff9d1ef60c0000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000000020000000 CR3: 000000011f65e000 CR4: 00000000000006f0\nCall Trace:\n\u0026lt;IRQ\u0026gt;\n _raw_spin_unlock (kernel/locking/spinlock.c:186)\n inet_csk_reqsk_queue_add (net/ipv4/inet_connection_sock.c:1321)\n inet_csk_complete_hashdance (net/ipv4/inet_connection_sock.c:1358)\n tcp_check_req (net/ipv4/tcp_minisocks.c:868)\n tcp_v4_rcv (net/ipv4/tcp_ipv4.c:2260)\n ip_protocol_deliver_rcu (net/ipv4/ip_input.c:205)\n ip_local_deliver_finish (net/ipv4/ip_input.c:234)\n __netif_receive_skb_one_core (net/core/dev.c:5529)\n process_backlog (./include/linux/rcupdate.h:779)\n __napi_poll (net/core/dev.c:6533)\n net_rx_action (net/core/dev.c:6604)\n __do_softirq (./arch/x86/include/asm/jump_label.h:27)\n do_softirq (kernel/softirq.c:454 kernel/softirq.c:441)\n\u0026lt;/IRQ\u0026gt;\n\u0026lt;TASK\u0026gt;\n __local_bh_enable_ip (kernel/softirq.c:381)\n __dev_queue_xmit (net/core/dev.c:4374)\n ip_finish_output2 (./include/net/neighbour.h:540 net/ipv4/ip_output.c:235)\n __ip_queue_xmit (net/ipv4/ip_output.c:535)\n __tcp_transmit_skb (net/ipv4/tcp_output.c:1462)\n tcp_rcv_synsent_state_process (net/ipv4/tcp_input.c:6469)\n tcp_rcv_state_process (net/ipv4/tcp_input.c:6657)\n tcp_v4_do_rcv (net/ipv4/tcp_ipv4.c:1929)\n __release_sock (./include/net/sock.h:1121 net/core/sock.c:2968)\n release_sock (net/core/sock.c:3536)\n inet_wait_for_connect (net/ipv4/af_inet.c:609)\n __inet_stream_connect (net/ipv4/af_inet.c:702)\n inet_stream_connect (net/ipv4/af_inet.c:748)\n __sys_connect (./include/linux/file.h:45 net/socket.c:2064)\n __x64_sys_connect (net/socket.c:2073 net/socket.c:2070 net/socket.c:2070)\n do_syscall_64 (arch/x86/entry/common.c:51 arch/x86/entry/common.c:82)\n entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:129)\n RIP: 0033:0x7fa10ff05a3d\n Code: 5b 41 5c c3 66 0f 1f 84 00 00 00 00 00 f3 0f 1e fa 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89\n c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 8b 0d ab a3 0e 00 f7 d8 64 89 01 48\n RSP: 002b:00007fa110183de8 EFLAGS: 00000202 ORIG_RAX: 000000000000002a\n RAX: ffffffffffffffda RBX: 0000000020000054 RCX: 00007fa10ff05a3d\n RDX: 000000000000001c RSI: 0000000020000040 RDI: 0000000000000003\n RBP: 00007fa110183e20 R08: 0000000000000000 R09: 0000000000000000\n R10: 0000000000000000 R11: 0000000000000202 R12: 00007fa110184640\n R13: 0000000000000000 R14: 00007fa10fe8b060 R15: 00007fff73e23b20\n\u0026lt;/TASK\u0026gt;\r\n\r\nThe issue triggering process is analyzed as follows:\nThread A Thread B\ntcp_v4_rcv\t//receive ack TCP packet inet_shutdown\n tcp_check_req tcp_disconnect //disconnect sock\n ... tcp_set_state(sk, TCP_CLOSE)\n inet_csk_complete_hashdance ...\n inet_csk_reqsk_queue_add \n---truncated---(CVE-2024-26614)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: don\u0026apos;t abort filesystem when attempting to snapshot deleted subvolume\r\n\r\nIf the source file descriptor to the snapshot ioctl refers to a deleted\nsubvolume, we get the following abort:\r\n\r\n BTRFS: Transaction aborted (error -2)\n WARNING: CPU: 0 PID: 833 at fs/btrfs/transaction.c:1875 create_pending_snapshot+0x1040/0x1190 [btrfs]\n Modules linked in: pata_acpi btrfs ata_piix libata scsi_mod virtio_net blake2b_generic xor net_failover virtio_rng failover scsi_common rng_core raid6_pq libcrc32c\n CPU: 0 PID: 833 Comm: t_snapshot_dele Not tainted 6.7.0-rc6 #2\n Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014\n RIP: 0010:create_pending_snapshot+0x1040/0x1190 [btrfs]\n RSP: 0018:ffffa09c01337af8 EFLAGS: 00010282\n RAX: 0000000000000000 RBX: ffff9982053e7c78 RCX: 0000000000000027\n RDX: ffff99827dc20848 RSI: 0000000000000001 RDI: ffff99827dc20840\n RBP: ffffa09c01337c00 R08: 0000000000000000 R09: ffffa09c01337998\n R10: 0000000000000003 R11: ffffffffb96da248 R12: fffffffffffffffe\n R13: ffff99820535bb28 R14: ffff99820b7bd000 R15: ffff99820381ea80\n FS: 00007fe20aadabc0(0000) GS:ffff99827dc00000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 0000559a120b502f CR3: 00000000055b6000 CR4: 00000000000006f0\n Call Trace:\n \u0026lt;TASK\u0026gt;\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n ? __warn+0x81/0x130\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n ? report_bug+0x171/0x1a0\n ? handle_bug+0x3a/0x70\n ? exc_invalid_op+0x17/0x70\n ? asm_exc_invalid_op+0x1a/0x20\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n create_pending_snapshots+0x92/0xc0 [btrfs]\n btrfs_commit_transaction+0x66b/0xf40 [btrfs]\n btrfs_mksubvol+0x301/0x4d0 [btrfs]\n btrfs_mksnapshot+0x80/0xb0 [btrfs]\n __btrfs_ioctl_snap_create+0x1c2/0x1d0 [btrfs]\n btrfs_ioctl_snap_create_v2+0xc4/0x150 [btrfs]\n btrfs_ioctl+0x8a6/0x2650 [btrfs]\n ? kmem_cache_free+0x22/0x340\n ? do_sys_openat2+0x97/0xe0\n __x64_sys_ioctl+0x97/0xd0\n do_syscall_64+0x46/0xf0\n entry_SYSCALL_64_after_hwframe+0x6e/0x76\n RIP: 0033:0x7fe20abe83af\n RSP: 002b:00007ffe6eff1360 EFLAGS: 00000246 ORIG_RAX: 0000000000000010\n RAX: ffffffffffffffda RBX: 0000000000000004 RCX: 00007fe20abe83af\n RDX: 00007ffe6eff23c0 RSI: 0000000050009417 RDI: 0000000000000003\n RBP: 0000000000000003 R08: 0000000000000000 R09: 00007fe20ad16cd0\n R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000\n R13: 00007ffe6eff13c0 R14: 00007fe20ad45000 R15: 0000559a120b6d58\n \u0026lt;/TASK\u0026gt;\n ---[ end trace 0000000000000000 ]---\n BTRFS: error (device vdc: state A) in create_pending_snapshot:1875: errno=-2 No such entry\n BTRFS info (device vdc: state EA): forced readonly\n BTRFS warning (device vdc: state EA): Skipping commit of aborted transaction.\n BTRFS: error (device vdc: state EA) in cleanup_transaction:2055: errno=-2 No such entry\r\n\r\nThis happens because create_pending_snapshot() initializes the new root\nitem as a copy of the source root item. This includes the refs field,\nwhich is 0 for a deleted subvolume. The call to btrfs_insert_root()\ntherefore inserts a root with refs == 0. btrfs_get_new_fs_root() then\nfinds the root and returns -ENOENT if refs == 0, which causes\ncreate_pending_snapshot() to abort.\r\n\r\nFix it by checking the source root\u0026apos;s refs before attempting the\nsnapshot, but after locking subvol_sem to avoid racing with deletion.(CVE-2024-26644)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhv_netvsc: Fix race condition between netvsc_probe and netvsc_remove\r\n\r\nIn commit ac5047671758 (\u0026quot;hv_netvsc: Disable NAPI before closing the\nVMBus channel\u0026quot;), napi_disable was getting called for all channels,\nincluding all subchannels without confirming if they are enabled or not.\r\n\r\nThis caused hv_netvsc getting hung at napi_disable, when netvsc_probe()\nhas finished running but nvdev-\u0026gt;subchan_work has not started yet.\nnetvsc_subchan_work() -\u0026gt; rndis_set_subchannel() has not created the\nsub-channels and because of that netvsc_sc_open() is not running.\nnetvsc_remove() calls cancel_work_sync(\u0026amp;nvdev-\u0026gt;subchan_work), for which\nnetvsc_subchan_work did not run.\r\n\r\nnetif_napi_add() sets the bit NAPI_STATE_SCHED because it ensures NAPI\ncannot be scheduled. Then netvsc_sc_open() -\u0026gt; napi_enable will clear the\nNAPIF_STATE_SCHED bit, so it can be scheduled. napi_disable() does the\nopposite.\r\n\r\nNow during netvsc_device_remove(), when napi_disable is called for those\nsubchannels, napi_disable gets stuck on infinite msleep.\r\n\r\nThis fix addresses this problem by ensuring that napi_disable() is not\ngetting called for non-enabled NAPI struct.\nBut netif_napi_del() is still necessary for these non-enabled NAPI struct\nfor cleanup purpose.\r\n\r\nCall trace:\n[ 654.559417] task:modprobe state:D stack: 0 pid: 2321 ppid: 1091 flags:0x00004002\n[ 654.568030] Call Trace:\n[ 654.571221] \u0026lt;TASK\u0026gt;\n[ 654.573790] __schedule+0x2d6/0x960\n[ 654.577733] schedule+0x69/0xf0\n[ 654.581214] schedule_timeout+0x87/0x140\n[ 654.585463] ? __bpf_trace_tick_stop+0x20/0x20\n[ 654.590291] msleep+0x2d/0x40\n[ 654.593625] napi_disable+0x2b/0x80\n[ 654.597437] netvsc_device_remove+0x8a/0x1f0 [hv_netvsc]\n[ 654.603935] rndis_filter_device_remove+0x194/0x1c0 [hv_netvsc]\n[ 654.611101] ? do_wait_intr+0xb0/0xb0\n[ 654.615753] netvsc_remove+0x7c/0x120 [hv_netvsc]\n[ 654.621675] vmbus_remove+0x27/0x40 [hv_vmbus](CVE-2024-26698)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nafs: Increase buffer size in afs_update_volume_status()\r\n\r\nThe max length of volume-\u0026gt;vid value is 20 characters.\nSo increase idbuf[] size up to 24 to avoid overflow.\r\n\r\nFound by Linux Verification Center (linuxtesting.org) with SVACE.\r\n\r\n[DH: Actually, it\u0026apos;s 20 + NUL, so increase it to 24 and use snprintf()](CVE-2024-26736)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nARM: ep93xx: Add terminator to gpiod_lookup_table\r\n\r\nWithout the terminator, if a con_id is passed to gpio_find() that\ndoes not exist in the lookup table the function will not stop looping\ncorrectly, and eventually cause an oops.(CVE-2024-26751)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/aio: Restrict kiocb_set_cancel_fn() to I/O submitted via libaio\r\n\r\nIf kiocb_set_cancel_fn() is called for I/O submitted via io_uring, the\nfollowing kernel warning appears:\r\n\r\nWARNING: CPU: 3 PID: 368 at fs/aio.c:598 kiocb_set_cancel_fn+0x9c/0xa8\nCall trace:\n kiocb_set_cancel_fn+0x9c/0xa8\n ffs_epfile_read_iter+0x144/0x1d0\n io_read+0x19c/0x498\n io_issue_sqe+0x118/0x27c\n io_submit_sqes+0x25c/0x5fc\n __arm64_sys_io_uring_enter+0x104/0xab0\n invoke_syscall+0x58/0x11c\n el0_svc_common+0xb4/0xf4\n do_el0_svc+0x2c/0xb0\n el0_svc+0x2c/0xa4\n el0t_64_sync_handler+0x68/0xb4\n el0t_64_sync+0x1a4/0x1a8\r\n\r\nFix this by setting the IOCB_AIO_RW flag for read and write I/O that is\nsubmitted by libaio.(CVE-2024-26764)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: avoid allocating blocks from corrupted group in ext4_mb_find_by_goal()\r\n\r\nPlaces the logic for checking if the group\u0026apos;s block bitmap is corrupt under\nthe protection of the group lock to avoid allocating blocks from the group\nwith a corrupted block bitmap.(CVE-2024-26772)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\r\n\r\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\r\n\r\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0026apos;t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u0026gt;ac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group(CVE-2024-26773)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfbdev: sis: Error out if pixclock equals zero\r\n\r\nThe userspace program could pass any values to the driver through\nioctl() interface. If the driver doesn\u0026apos;t check the value of pixclock,\nit may cause divide-by-zero error.\r\n\r\nIn sisfb_check_var(), var-\u0026gt;pixclock is used as a divisor to caculate\ndrate before it is checked against zero. Fix this by checking it\nat the beginning.\r\n\r\nThis is similar to CVE-2022-3061 in i740fb which was fixed by\ncommit 15cf0b8.(CVE-2024-26777)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfbdev: savage: Error out if pixclock equals zero\r\n\r\nThe userspace program could pass any values to the driver through\nioctl() interface. If the driver doesn\u0026apos;t check the value of pixclock,\nit may cause divide-by-zero error.\r\n\r\nAlthough pixclock is checked in savagefb_decode_var(), but it is not\nchecked properly in savagefb_probe(). Fix this by checking whether\npixclock is zero in the function savagefb_check_var() before\ninfo-\u0026gt;var.pixclock is used as the divisor.\r\n\r\nThis is similar to CVE-2022-3061 in i740fb which was fixed by\ncommit 15cf0b8.(CVE-2024-26778)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndmaengine: fsl-qdma: init irq after reg initialization\r\n\r\nInitialize the qDMA irqs after the registers are configured so that\ninterrupts that may have been pending from a primary kernel don\u0026apos;t get\nprocessed by the irq handler before it is ready to and cause panic with\nthe following trace:\r\n\r\n Call trace:\n fsl_qdma_queue_handler+0xf8/0x3e8\n __handle_irq_event_percpu+0x78/0x2b0\n handle_irq_event_percpu+0x1c/0x68\n handle_irq_event+0x44/0x78\n handle_fasteoi_irq+0xc8/0x178\n generic_handle_irq+0x24/0x38\n __handle_domain_irq+0x90/0x100\n gic_handle_irq+0x5c/0xb8\n el1_irq+0xb8/0x180\n _raw_spin_unlock_irqrestore+0x14/0x40\n __setup_irq+0x4bc/0x798\n request_threaded_irq+0xd8/0x190\n devm_request_threaded_irq+0x74/0xe8\n fsl_qdma_probe+0x4d4/0xca8\n platform_drv_probe+0x50/0xa0\n really_probe+0xe0/0x3f8\n driver_probe_device+0x64/0x130\n device_driver_attach+0x6c/0x78\n __driver_attach+0xbc/0x158\n bus_for_each_dev+0x5c/0x98\n driver_attach+0x20/0x28\n bus_add_driver+0x158/0x220\n driver_register+0x60/0x110\n __platform_driver_register+0x44/0x50\n fsl_qdma_driver_init+0x18/0x20\n do_one_initcall+0x48/0x258\n kernel_init_freeable+0x1a4/0x23c\n kernel_init+0x10/0xf8\n ret_from_fork+0x10/0x18(CVE-2024-26788)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvfio/pci: Lock external INTx masking ops\r\n\r\nMask operations through config space changes to DisINTx may race INTx\nconfiguration changes via ioctl. Create wrappers that add locking for\npaths outside of the core interrupt code.\r\n\r\nIn particular, irq_type is updated holding igate, therefore testing\nis_intx() requires holding igate. For example clearing DisINTx from\nconfig space can otherwise race changes of the interrupt configuration.\r\n\r\nThis aligns interfaces which may trigger the INTx eventfd into two\ncamps, one side serialized by igate and the other only enabled while\nINTx is configured. A subsequent patch introduces synchronization for\nthe latter flows.(CVE-2024-26810)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Fix stackmap overflow check on 32-bit arches\r\n\r\nThe stackmap code relies on roundup_pow_of_two() to compute the number\nof hash buckets, and contains an overflow check by checking if the\nresulting value is 0. However, on 32-bit arches, the roundup code itself\ncan overflow by doing a 32-bit left-shift of an unsigned long value,\nwhich is undefined behaviour, so it is not guaranteed to truncate\nneatly. This was triggered by syzbot on the DEVMAP_HASH type, which\ncontains the same check, copied from the hashtab code.\r\n\r\nThe commit in the fixes tag actually attempted to fix this, but the fix\ndid not account for the UB, so the fix only works on CPUs where an\noverflow does result in a neat truncation to zero, which is not\nguaranteed. Checking the value before rounding does not have this\nproblem.(CVE-2024-26883)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Fix hashtab overflow check on 32-bit arches\r\n\r\nThe hashtab code relies on roundup_pow_of_two() to compute the number of\nhash buckets, and contains an overflow check by checking if the\nresulting value is 0. However, on 32-bit arches, the roundup code itself\ncan overflow by doing a 32-bit left-shift of an unsigned long value,\nwhich is undefined behaviour, so it is not guaranteed to truncate\nneatly. This was triggered by syzbot on the DEVMAP_HASH type, which\ncontains the same check, copied from the hashtab code. So apply the same\nfix to hashtab, by moving the overflow check to before the roundup.(CVE-2024-26884)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Fix DEVMAP_HASH overflow check on 32-bit arches\r\n\r\nThe devmap code allocates a number hash buckets equal to the next power\nof two of the max_entries value provided when creating the map. When\nrounding up to the next power of two, the 32-bit variable storing the\nnumber of buckets can overflow, and the code checks for overflow by\nchecking if the truncated 32-bit value is equal to 0. However, on 32-bit\narches the rounding up itself can overflow mid-way through, because it\nends up doing a left-shift of 32 bits on an unsigned long value. If the\nsize of an unsigned long is four bytes, this is undefined behaviour, so\nthere is no guarantee that we\u0026apos;ll end up with a nice and tidy 0-value at\nthe end.\r\n\r\nSyzbot managed to turn this into a crash on arm32 by creating a\nDEVMAP_HASH with max_entries \u0026gt; 0x80000000 and then trying to update it.\nFix this by moving the overflow check to before the rounding up\noperation.(CVE-2024-26885)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvfio/pci: Disable auto-enable of exclusive INTx IRQ\r\n\r\nCurrently for devices requiring masking at the irqchip for INTx, ie.\ndevices without DisINTx support, the IRQ is enabled in request_irq()\nand subsequently disabled as necessary to align with the masked status\nflag. This presents a window where the interrupt could fire between\nthese events, resulting in the IRQ incrementing the disable depth twice.\nThis would be unrecoverable for a user since the masked flag prevents\nnested enables through vfio.\r\n\r\nInstead, invert the logic using IRQF_NO_AUTOEN such that exclusive INTx\nis never auto-enabled, then unmask as required.(CVE-2024-27437)",
"id": "OESA-2024-1524",
"modified": "2026-08-06T11:06:58Z",
"published": "2024-05-10T11:06:58Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1524"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-25739"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26607"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26614"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26644"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26698"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26736"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26751"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26764"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26772"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26773"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26777"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26778"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26788"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26810"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26883"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26884"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26885"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27437"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2024-25739",
"CVE-2024-26607",
"CVE-2024-26614",
"CVE-2024-26644",
"CVE-2024-26698",
"CVE-2024-26736",
"CVE-2024-26751",
"CVE-2024-26764",
"CVE-2024-26772",
"CVE-2024-26773",
"CVE-2024-26777",
"CVE-2024-26778",
"CVE-2024-26788",
"CVE-2024-26810",
"CVE-2024-26883",
"CVE-2024-26884",
"CVE-2024-26885",
"CVE-2024-27437"
]
}
OESA-2024-1526 (CVE-2021-47121)
Vulnerability from osv_openeuler – Published: 2024-05-10 11:06 – Updated: 2026-08-06 11:06 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
net: caif: fix memory leak in cfusbl_device_notify
In case of caif_enroll_dev() fail, allocated link_support won't be assigned to the corresponding structure. So simply free allocated pointer in case of error.(CVE-2021-47121)
In the Linux kernel, the following vulnerability has been resolved:
net: fujitsu: fix potential null-ptr-deref
In fmvj18x_get_hwinfo(), if ioremap fails there will be NULL pointer deref. To fix this, check the return value of ioremap and return -1 to the caller in case of failure.(CVE-2021-47149)
In the Linux kernel, the following vulnerability has been resolved:
scsi: lpfc: Fix link down processing to address NULL pointer dereference
If an FC link down transition while PLOGIs are outstanding to fabric well known addresses, outstanding ABTS requests may result in a NULL pointer dereference. Driver unload requests may hang with repeated "2878" log messages.
The Link down processing results in ABTS requests for outstanding ELS requests. The Abort WQEs are sent for the ELSs before the driver had set the link state to down. Thus the driver is sending the Abort with the expectation that an ABTS will be sent on the wire. The Abort request is stalled waiting for the link to come up. In some conditions the driver may auto-complete the ELSs thus if the link does come up, the Abort completions may reference an invalid structure.
Fix by ensuring that Abort set the flag to avoid link traffic if issued due to conditions where the link failed.(CVE-2021-47183)
In the Linux kernel, the following vulnerability has been resolved:
cfg80211: call cfg80211_stop_ap when switch from P2P_GO type
If the userspace tools switch from NL80211_IFTYPE_P2P_GO to NL80211_IFTYPE_ADHOC via send_msg(NL80211_CMD_SET_INTERFACE), it does not call the cleanup cfg80211_stop_ap(), this leads to the initialization of in-use data. For example, this path re-init the sdata->assigned_chanctx_list while it is still an element of assigned_vifs list, and makes that linked list corrupt.(CVE-2021-47194)
In the Linux kernel, the following vulnerability has been resolved:
usb: typec: tipd: Remove WARN_ON in tps6598x_block_read
Calling tps6598x_block_read with a higher than allowed len can be handled by just returning an error. There's no need to crash systems with panic-on-warn enabled.(CVE-2021-47210)
In the Linux kernel, the following vulnerability has been resolved:
pstore/ram: Fix crash when setting number of cpus to an odd number
When the number of cpu cores is adjusted to 7 or other odd numbers, the zone size will become an odd number. The address of the zone will become: addr of zone0 = BASE addr of zone1 = BASE + zone_size addr of zone2 = BASE + zone_size*2 ... The address of zone1/3/5/7 will be mapped to non-alignment va. Eventually crashes will occur when accessing these va.
So, use ALIGN_DOWN() to make sure the zone size is even to avoid this bug.(CVE-2023-52619)
A race condition was found in the Linux kernel's bluetooth device driver in {min,max}_key_size_set() function. This can result in a null pointer dereference issue, possibly leading to a kernel panic or denial of service issue.
(CVE-2024-24860)
In the Linux kernel, the following vulnerability has been resolved:
ip6_tunnel: fix NEXTHDR_FRAGMENT handling in ip6_tnl_parse_tlv_enc_lim()
syzbot pointed out [1] that NEXTHDR_FRAGMENT handling is broken.
Reading frag_off can only be done if we pulled enough bytes to skb->head. Currently we might access garbage.
[1] BUG: KMSAN: uninit-value in ip6_tnl_parse_tlv_enc_lim+0x94f/0xbb0 ip6_tnl_parse_tlv_enc_lim+0x94f/0xbb0 ipxip6_tnl_xmit net/ipv6/ip6_tunnel.c:1326 [inline] ip6_tnl_start_xmit+0xab2/0x1a70 net/ipv6/ip6_tunnel.c:1432 __netdev_start_xmit include/linux/netdevice.h:4940 [inline] netdev_start_xmit include/linux/netdevice.h:4954 [inline] xmit_one net/core/dev.c:3548 [inline] dev_hard_start_xmit+0x247/0xa10 net/core/dev.c:3564 __dev_queue_xmit+0x33b8/0x5130 net/core/dev.c:4349 dev_queue_xmit include/linux/netdevice.h:3134 [inline] neigh_connected_output+0x569/0x660 net/core/neighbour.c:1592 neigh_output include/net/neighbour.h:542 [inline] ip6_finish_output2+0x23a9/0x2b30 net/ipv6/ip6_output.c:137 ip6_finish_output+0x855/0x12b0 net/ipv6/ip6_output.c:222 NF_HOOK_COND include/linux/netfilter.h:303 [inline] ip6_output+0x323/0x610 net/ipv6/ip6_output.c:243 dst_output include/net/dst.h:451 [inline] ip6_local_out+0xe9/0x140 net/ipv6/output_core.c:155 ip6_send_skb net/ipv6/ip6_output.c:1952 [inline] ip6_push_pending_frames+0x1f9/0x560 net/ipv6/ip6_output.c:1972 rawv6_push_pending_frames+0xbe8/0xdf0 net/ipv6/raw.c:582 rawv6_sendmsg+0x2b66/0x2e70 net/ipv6/raw.c:920 inet_sendmsg+0x105/0x190 net/ipv4/af_inet.c:847 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg net/socket.c:745 [inline] _syssendmsg+0x9c2/0xd60 net/socket.c:2584 _sys_sendmsg+0x28d/0x3c0 net/socket.c:2638 __sys_sendmsg net/socket.c:2667 [inline] __do_sys_sendmsg net/socket.c:2676 [inline] __se_sys_sendmsg net/socket.c:2674 [inline] __x64_sys_sendmsg+0x307/0x490 net/socket.c:2674 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0x44/0x110 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x63/0x6b
Uninit was created at: slab_post_alloc_hook+0x129/0xa70 mm/slab.h:768 slab_alloc_node mm/slub.c:3478 [inline] __kmem_cache_alloc_node+0x5c9/0x970 mm/slub.c:3517 __do_kmalloc_node mm/slab_common.c:1006 [inline] __kmalloc_node_track_caller+0x118/0x3c0 mm/slab_common.c:1027 kmalloc_reserve+0x249/0x4a0 net/core/skbuff.c:582 pskb_expand_head+0x226/0x1a00 net/core/skbuff.c:2098 __pskb_pull_tail+0x13b/0x2310 net/core/skbuff.c:2655 pskb_may_pull_reason include/linux/skbuff.h:2673 [inline] pskb_may_pull include/linux/skbuff.h:2681 [inline] ip6_tnl_parse_tlv_enc_lim+0x901/0xbb0 net/ipv6/ip6_tunnel.c:408 ipxip6_tnl_xmit net/ipv6/ip6_tunnel.c:1326 [inline] ip6_tnl_start_xmit+0xab2/0x1a70 net/ipv6/ip6_tunnel.c:1432 __netdev_start_xmit include/linux/netdevice.h:4940 [inline] netdev_start_xmit include/linux/netdevice.h:4954 [inline] xmit_one net/core/dev.c:3548 [inline] dev_hard_start_xmit+0x247/0xa10 net/core/dev.c:3564 __dev_queue_xmit+0x33b8/0x5130 net/core/dev.c:4349 dev_queue_xmit include/linux/netdevice.h:3134 [inline] neigh_connected_output+0x569/0x660 net/core/neighbour.c:1592 neigh_output include/net/neighbour.h:542 [inline] ip6_finish_output2+0x23a9/0x2b30 net/ipv6/ip6_output.c:137 ip6_finish_output+0x855/0x12b0 net/ipv6/ip6_output.c:222 NF_HOOK_COND include/linux/netfilter.h:303 [inline] ip6_output+0x323/0x610 net/ipv6/ip6_output.c:243 dst_output include/net/dst.h:451 [inline] ip6_local_out+0xe9/0x140 net/ipv6/output_core.c:155 ip6_send_skb net/ipv6/ip6_output.c:1952 [inline] ip6_push_pending_frames+0x1f9/0x560 net/ipv6/ip6_output.c:1972 rawv6_push_pending_frames+0xbe8/0xdf0 net/ipv6/raw.c:582 rawv6_sendmsg+0x2b66/0x2e70 net/ipv6/raw.c:920 inet_sendmsg+0x105/0x190 net/ipv4/af_inet.c:847 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg net/socket.c:745 [inline] _syssendmsg+0x9c2/0xd60 net/socket.c:2584 _sys_sendmsg+0x28d/0x3c0 net/socket.c:2638 __sys_sendmsg net/socket.c:2667 [inline] __do_sys_sendms ---truncated---(CVE-2024-26633)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: don't abort filesystem when attempting to snapshot deleted subvolume
If the source file descriptor to the snapshot ioctl refers to a deleted subvolume, we get the following abort:
BTRFS: Transaction aborted (error -2) WARNING: CPU: 0 PID: 833 at fs/btrfs/transaction.c:1875 create_pending_snapshot+0x1040/0x1190 [btrfs] Modules linked in: pata_acpi btrfs ata_piix libata scsi_mod virtio_net blake2b_generic xor net_failover virtio_rng failover scsi_common rng_core raid6_pq libcrc32c CPU: 0 PID: 833 Comm: t_snapshot_dele Not tainted 6.7.0-rc6 #2 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014 RIP: 0010:create_pending_snapshot+0x1040/0x1190 [btrfs] RSP: 0018:ffffa09c01337af8 EFLAGS: 00010282 RAX: 0000000000000000 RBX: ffff9982053e7c78 RCX: 0000000000000027 RDX: ffff99827dc20848 RSI: 0000000000000001 RDI: ffff99827dc20840 RBP: ffffa09c01337c00 R08: 0000000000000000 R09: ffffa09c01337998 R10: 0000000000000003 R11: ffffffffb96da248 R12: fffffffffffffffe R13: ffff99820535bb28 R14: ffff99820b7bd000 R15: ffff99820381ea80 FS: 00007fe20aadabc0(0000) GS:ffff99827dc00000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000559a120b502f CR3: 00000000055b6000 CR4: 00000000000006f0 Call Trace: <TASK> ? create_pending_snapshot+0x1040/0x1190 [btrfs] ? __warn+0x81/0x130 ? create_pending_snapshot+0x1040/0x1190 [btrfs] ? report_bug+0x171/0x1a0 ? handle_bug+0x3a/0x70 ? exc_invalid_op+0x17/0x70 ? asm_exc_invalid_op+0x1a/0x20 ? create_pending_snapshot+0x1040/0x1190 [btrfs] ? create_pending_snapshot+0x1040/0x1190 [btrfs] create_pending_snapshots+0x92/0xc0 [btrfs] btrfs_commit_transaction+0x66b/0xf40 [btrfs] btrfs_mksubvol+0x301/0x4d0 [btrfs] btrfs_mksnapshot+0x80/0xb0 [btrfs] __btrfs_ioctl_snap_create+0x1c2/0x1d0 [btrfs] btrfs_ioctl_snap_create_v2+0xc4/0x150 [btrfs] btrfs_ioctl+0x8a6/0x2650 [btrfs] ? kmem_cache_free+0x22/0x340 ? do_sys_openat2+0x97/0xe0 __x64_sys_ioctl+0x97/0xd0 do_syscall_64+0x46/0xf0 entry_SYSCALL_64_after_hwframe+0x6e/0x76 RIP: 0033:0x7fe20abe83af RSP: 002b:00007ffe6eff1360 EFLAGS: 00000246 ORIG_RAX: 0000000000000010 RAX: ffffffffffffffda RBX: 0000000000000004 RCX: 00007fe20abe83af RDX: 00007ffe6eff23c0 RSI: 0000000050009417 RDI: 0000000000000003 RBP: 0000000000000003 R08: 0000000000000000 R09: 00007fe20ad16cd0 R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000 R13: 00007ffe6eff13c0 R14: 00007fe20ad45000 R15: 0000559a120b6d58 </TASK> ---[ end trace 0000000000000000 ]--- BTRFS: error (device vdc: state A) in create_pending_snapshot:1875: errno=-2 No such entry BTRFS info (device vdc: state EA): forced readonly BTRFS warning (device vdc: state EA): Skipping commit of aborted transaction. BTRFS: error (device vdc: state EA) in cleanup_transaction:2055: errno=-2 No such entry
This happens because create_pending_snapshot() initializes the new root item as a copy of the source root item. This includes the refs field, which is 0 for a deleted subvolume. The call to btrfs_insert_root() therefore inserts a root with refs == 0. btrfs_get_new_fs_root() then finds the root and returns -ENOENT if refs == 0, which causes create_pending_snapshot() to abort.
Fix it by checking the source root's refs before attempting the snapshot, but after locking subvol_sem to avoid racing with deletion.(CVE-2024-26644)
In the Linux kernel, the following vulnerability has been resolved:
ARM: ep93xx: Add terminator to gpiod_lookup_table
Without the terminator, if a con_id is passed to gpio_find() that does not exist in the lookup table the function will not stop looping correctly, and eventually cause an oops.(CVE-2024-26751)
In the Linux kernel, the following vulnerability has been resolved:
fs/aio: Restrict kiocb_set_cancel_fn() to I/O submitted via libaio
If kiocb_set_cancel_fn() is called for I/O submitted via io_uring, the following kernel warning appears:
WARNING: CPU: 3 PID: 368 at fs/aio.c:598 kiocb_set_cancel_fn+0x9c/0xa8 Call trace: kiocb_set_cancel_fn+0x9c/0xa8 ffs_epfile_read_iter+0x144/0x1d0 io_read+0x19c/0x498 io_issue_sqe+0x118/0x27c io_submit_sqes+0x25c/0x5fc __arm64_sys_io_uring_enter+0x104/0xab0 invoke_syscall+0x58/0x11c el0_svc_common+0xb4/0xf4 do_el0_svc+0x2c/0xb0 el0_svc+0x2c/0xa4 el0t_64_sync_handler+0x68/0xb4 el0t_64_sync+0x1a4/0x1a8
Fix this by setting the IOCB_AIO_RW flag for read and write I/O that is submitted by libaio.(CVE-2024-26764)
In the Linux kernel, the following vulnerability has been resolved:
ext4: avoid allocating blocks from corrupted group in ext4_mb_find_by_goal()
Places the logic for checking if the group's block bitmap is corrupt under the protection of the group lock to avoid allocating blocks from the group with a corrupted block bitmap.(CVE-2024-26772)
In the Linux kernel, the following vulnerability has been resolved:
ext4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()
Determine if the group block bitmap is corrupted before using ac_b_ex in ext4_mb_try_best_found() to avoid allocating blocks from a group with a corrupted block bitmap in the following concurrency and making the situation worse.
ext4_mb_regular_allocator ext4_lock_group(sb, group) ext4_mb_good_group // check if the group bbitmap is corrupted ext4_mb_complex_scan_group // Scan group gets ac_b_ex but doesn't use it ext4_unlock_group(sb, group) ext4_mark_group_bitmap_corrupted(group) // The block bitmap was corrupted during // the group unlock gap. ext4_mb_try_best_found ext4_lock_group(ac->ac_sb, group) ext4_mb_use_best_found mb_mark_used // Allocating blocks in block bitmap corrupted group(CVE-2024-26773)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: sis: Error out if pixclock equals zero
The userspace program could pass any values to the driver through ioctl() interface. If the driver doesn't check the value of pixclock, it may cause divide-by-zero error.
In sisfb_check_var(), var->pixclock is used as a divisor to caculate drate before it is checked against zero. Fix this by checking it at the beginning.
This is similar to CVE-2022-3061 in i740fb which was fixed by commit 15cf0b8.(CVE-2024-26777)
In the Linux kernel, the following vulnerability has been resolved:
fbdev: savage: Error out if pixclock equals zero
The userspace program could pass any values to the driver through ioctl() interface. If the driver doesn't check the value of pixclock, it may cause divide-by-zero error.
Although pixclock is checked in savagefb_decode_var(), but it is not checked properly in savagefb_probe(). Fix this by checking whether pixclock is zero in the function savagefb_check_var() before info->var.pixclock is used as the divisor.
This is similar to CVE-2022-3061 in i740fb which was fixed by commit 15cf0b8.(CVE-2024-26778)
In the Linux kernel, the following vulnerability has been resolved:
vfio/pci: Lock external INTx masking ops
Mask operations through config space changes to DisINTx may race INTx configuration changes via ioctl. Create wrappers that add locking for paths outside of the core interrupt code.
In particular, irq_type is updated holding igate, therefore testing is_intx() requires holding igate. For example clearing DisINTx from config space can otherwise race changes of the interrupt configuration.
This aligns interfaces which may trigger the INTx eventfd into two camps, one side serialized by igate and the other only enabled while INTx is configured. A subsequent patch introduces synchronization for the latter flows.(CVE-2024-26810)
In the Linux kernel, the following vulnerability has been resolved:
bpf: Fix hashtab overflow check on 32-bit arches
The hashtab code relies on roundup_pow_of_two() to compute the number of hash buckets, and contains an overflow check by checking if the resulting value is 0. However, on 32-bit arches, the roundup code itself can overflow by doing a 32-bit left-shift of an unsigned long value, which is undefined behaviour, so it is not guaranteed to truncate neatly. This was triggered by syzbot on the DEVMAP_HASH type, which contains the same check, copied from the hashtab code. So apply the same fix to hashtab, by moving the overflow check to before the roundup.(CVE-2024-26884)
In the Linux kernel, the following vulnerability has been resolved:
vfio/pci: Disable auto-enable of exclusive INTx IRQ
Currently for devices requiring masking at the irqchip for INTx, ie. devices without DisINTx support, the IRQ is enabled in request_irq() and subsequently disabled as necessary to align with the masked status flag. This presents a window where the interrupt could fire between these events, resulting in the IRQ incrementing the disable depth twice. This would be unrecoverable for a user since the masked flag prevents nested enables through vfio.
Instead, invert the logic using IRQF_NO_AUTOEN such that exclusive INTx is never auto-enabled, then unmask as required.(CVE-2024-27437)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"python2-perf-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"bpftool-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2405.1.0.0275.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2405.1.0.0275.oe2003sp4.src.rpm"
],
"x86_64": [
"kernel-tools-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"bpftool-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2405.1.0.0275.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2405.1.0.0275.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: caif: fix memory leak in cfusbl_device_notify\r\n\r\nIn case of caif_enroll_dev() fail, allocated\nlink_support won\u0026apos;t be assigned to the corresponding\nstructure. So simply free allocated pointer in case\nof error.(CVE-2021-47121)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: fujitsu: fix potential null-ptr-deref\r\n\r\nIn fmvj18x_get_hwinfo(), if ioremap fails there will be NULL pointer\nderef. To fix this, check the return value of ioremap and return -1\nto the caller in case of failure.(CVE-2021-47149)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: lpfc: Fix link down processing to address NULL pointer dereference\r\n\r\nIf an FC link down transition while PLOGIs are outstanding to fabric well\nknown addresses, outstanding ABTS requests may result in a NULL pointer\ndereference. Driver unload requests may hang with repeated \u0026quot;2878\u0026quot; log\nmessages.\r\n\r\nThe Link down processing results in ABTS requests for outstanding ELS\nrequests. The Abort WQEs are sent for the ELSs before the driver had set\nthe link state to down. Thus the driver is sending the Abort with the\nexpectation that an ABTS will be sent on the wire. The Abort request is\nstalled waiting for the link to come up. In some conditions the driver may\nauto-complete the ELSs thus if the link does come up, the Abort completions\nmay reference an invalid structure.\r\n\r\nFix by ensuring that Abort set the flag to avoid link traffic if issued due\nto conditions where the link failed.(CVE-2021-47183)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ncfg80211: call cfg80211_stop_ap when switch from P2P_GO type\r\n\r\nIf the userspace tools switch from NL80211_IFTYPE_P2P_GO to\nNL80211_IFTYPE_ADHOC via send_msg(NL80211_CMD_SET_INTERFACE), it\ndoes not call the cleanup cfg80211_stop_ap(), this leads to the\ninitialization of in-use data. For example, this path re-init the\nsdata-\u0026gt;assigned_chanctx_list while it is still an element of\nassigned_vifs list, and makes that linked list corrupt.(CVE-2021-47194)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nusb: typec: tipd: Remove WARN_ON in tps6598x_block_read\r\n\r\nCalling tps6598x_block_read with a higher than allowed len can be\nhandled by just returning an error. There\u0026apos;s no need to crash systems\nwith panic-on-warn enabled.(CVE-2021-47210)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npstore/ram: Fix crash when setting number of cpus to an odd number\r\n\r\nWhen the number of cpu cores is adjusted to 7 or other odd numbers,\nthe zone size will become an odd number.\nThe address of the zone will become:\n addr of zone0 = BASE\n addr of zone1 = BASE + zone_size\n addr of zone2 = BASE + zone_size*2\n ...\nThe address of zone1/3/5/7 will be mapped to non-alignment va.\nEventually crashes will occur when accessing these va.\r\n\r\nSo, use ALIGN_DOWN() to make sure the zone size is even\nto avoid this bug.(CVE-2023-52619)\r\n\r\nA race condition was found in the Linux kernel\u0026apos;s bluetooth device driver in {min,max}_key_size_set() function. This can result in a null pointer dereference issue, possibly leading to a kernel panic or denial of service issue.\r\n\r\n\r\n\r\n\n(CVE-2024-24860)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nip6_tunnel: fix NEXTHDR_FRAGMENT handling in ip6_tnl_parse_tlv_enc_lim()\r\n\r\nsyzbot pointed out [1] that NEXTHDR_FRAGMENT handling is broken.\r\n\r\nReading frag_off can only be done if we pulled enough bytes\nto skb-\u0026gt;head. Currently we might access garbage.\r\n\r\n[1]\nBUG: KMSAN: uninit-value in ip6_tnl_parse_tlv_enc_lim+0x94f/0xbb0\nip6_tnl_parse_tlv_enc_lim+0x94f/0xbb0\nipxip6_tnl_xmit net/ipv6/ip6_tunnel.c:1326 [inline]\nip6_tnl_start_xmit+0xab2/0x1a70 net/ipv6/ip6_tunnel.c:1432\n__netdev_start_xmit include/linux/netdevice.h:4940 [inline]\nnetdev_start_xmit include/linux/netdevice.h:4954 [inline]\nxmit_one net/core/dev.c:3548 [inline]\ndev_hard_start_xmit+0x247/0xa10 net/core/dev.c:3564\n__dev_queue_xmit+0x33b8/0x5130 net/core/dev.c:4349\ndev_queue_xmit include/linux/netdevice.h:3134 [inline]\nneigh_connected_output+0x569/0x660 net/core/neighbour.c:1592\nneigh_output include/net/neighbour.h:542 [inline]\nip6_finish_output2+0x23a9/0x2b30 net/ipv6/ip6_output.c:137\nip6_finish_output+0x855/0x12b0 net/ipv6/ip6_output.c:222\nNF_HOOK_COND include/linux/netfilter.h:303 [inline]\nip6_output+0x323/0x610 net/ipv6/ip6_output.c:243\ndst_output include/net/dst.h:451 [inline]\nip6_local_out+0xe9/0x140 net/ipv6/output_core.c:155\nip6_send_skb net/ipv6/ip6_output.c:1952 [inline]\nip6_push_pending_frames+0x1f9/0x560 net/ipv6/ip6_output.c:1972\nrawv6_push_pending_frames+0xbe8/0xdf0 net/ipv6/raw.c:582\nrawv6_sendmsg+0x2b66/0x2e70 net/ipv6/raw.c:920\ninet_sendmsg+0x105/0x190 net/ipv4/af_inet.c:847\nsock_sendmsg_nosec net/socket.c:730 [inline]\n__sock_sendmsg net/socket.c:745 [inline]\n____sys_sendmsg+0x9c2/0xd60 net/socket.c:2584\n___sys_sendmsg+0x28d/0x3c0 net/socket.c:2638\n__sys_sendmsg net/socket.c:2667 [inline]\n__do_sys_sendmsg net/socket.c:2676 [inline]\n__se_sys_sendmsg net/socket.c:2674 [inline]\n__x64_sys_sendmsg+0x307/0x490 net/socket.c:2674\ndo_syscall_x64 arch/x86/entry/common.c:52 [inline]\ndo_syscall_64+0x44/0x110 arch/x86/entry/common.c:83\nentry_SYSCALL_64_after_hwframe+0x63/0x6b\r\n\r\nUninit was created at:\nslab_post_alloc_hook+0x129/0xa70 mm/slab.h:768\nslab_alloc_node mm/slub.c:3478 [inline]\n__kmem_cache_alloc_node+0x5c9/0x970 mm/slub.c:3517\n__do_kmalloc_node mm/slab_common.c:1006 [inline]\n__kmalloc_node_track_caller+0x118/0x3c0 mm/slab_common.c:1027\nkmalloc_reserve+0x249/0x4a0 net/core/skbuff.c:582\npskb_expand_head+0x226/0x1a00 net/core/skbuff.c:2098\n__pskb_pull_tail+0x13b/0x2310 net/core/skbuff.c:2655\npskb_may_pull_reason include/linux/skbuff.h:2673 [inline]\npskb_may_pull include/linux/skbuff.h:2681 [inline]\nip6_tnl_parse_tlv_enc_lim+0x901/0xbb0 net/ipv6/ip6_tunnel.c:408\nipxip6_tnl_xmit net/ipv6/ip6_tunnel.c:1326 [inline]\nip6_tnl_start_xmit+0xab2/0x1a70 net/ipv6/ip6_tunnel.c:1432\n__netdev_start_xmit include/linux/netdevice.h:4940 [inline]\nnetdev_start_xmit include/linux/netdevice.h:4954 [inline]\nxmit_one net/core/dev.c:3548 [inline]\ndev_hard_start_xmit+0x247/0xa10 net/core/dev.c:3564\n__dev_queue_xmit+0x33b8/0x5130 net/core/dev.c:4349\ndev_queue_xmit include/linux/netdevice.h:3134 [inline]\nneigh_connected_output+0x569/0x660 net/core/neighbour.c:1592\nneigh_output include/net/neighbour.h:542 [inline]\nip6_finish_output2+0x23a9/0x2b30 net/ipv6/ip6_output.c:137\nip6_finish_output+0x855/0x12b0 net/ipv6/ip6_output.c:222\nNF_HOOK_COND include/linux/netfilter.h:303 [inline]\nip6_output+0x323/0x610 net/ipv6/ip6_output.c:243\ndst_output include/net/dst.h:451 [inline]\nip6_local_out+0xe9/0x140 net/ipv6/output_core.c:155\nip6_send_skb net/ipv6/ip6_output.c:1952 [inline]\nip6_push_pending_frames+0x1f9/0x560 net/ipv6/ip6_output.c:1972\nrawv6_push_pending_frames+0xbe8/0xdf0 net/ipv6/raw.c:582\nrawv6_sendmsg+0x2b66/0x2e70 net/ipv6/raw.c:920\ninet_sendmsg+0x105/0x190 net/ipv4/af_inet.c:847\nsock_sendmsg_nosec net/socket.c:730 [inline]\n__sock_sendmsg net/socket.c:745 [inline]\n____sys_sendmsg+0x9c2/0xd60 net/socket.c:2584\n___sys_sendmsg+0x28d/0x3c0 net/socket.c:2638\n__sys_sendmsg net/socket.c:2667 [inline]\n__do_sys_sendms\n---truncated---(CVE-2024-26633)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbtrfs: don\u0026apos;t abort filesystem when attempting to snapshot deleted subvolume\r\n\r\nIf the source file descriptor to the snapshot ioctl refers to a deleted\nsubvolume, we get the following abort:\r\n\r\n BTRFS: Transaction aborted (error -2)\n WARNING: CPU: 0 PID: 833 at fs/btrfs/transaction.c:1875 create_pending_snapshot+0x1040/0x1190 [btrfs]\n Modules linked in: pata_acpi btrfs ata_piix libata scsi_mod virtio_net blake2b_generic xor net_failover virtio_rng failover scsi_common rng_core raid6_pq libcrc32c\n CPU: 0 PID: 833 Comm: t_snapshot_dele Not tainted 6.7.0-rc6 #2\n Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.3-1.fc39 04/01/2014\n RIP: 0010:create_pending_snapshot+0x1040/0x1190 [btrfs]\n RSP: 0018:ffffa09c01337af8 EFLAGS: 00010282\n RAX: 0000000000000000 RBX: ffff9982053e7c78 RCX: 0000000000000027\n RDX: ffff99827dc20848 RSI: 0000000000000001 RDI: ffff99827dc20840\n RBP: ffffa09c01337c00 R08: 0000000000000000 R09: ffffa09c01337998\n R10: 0000000000000003 R11: ffffffffb96da248 R12: fffffffffffffffe\n R13: ffff99820535bb28 R14: ffff99820b7bd000 R15: ffff99820381ea80\n FS: 00007fe20aadabc0(0000) GS:ffff99827dc00000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 0000559a120b502f CR3: 00000000055b6000 CR4: 00000000000006f0\n Call Trace:\n \u0026lt;TASK\u0026gt;\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n ? __warn+0x81/0x130\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n ? report_bug+0x171/0x1a0\n ? handle_bug+0x3a/0x70\n ? exc_invalid_op+0x17/0x70\n ? asm_exc_invalid_op+0x1a/0x20\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n ? create_pending_snapshot+0x1040/0x1190 [btrfs]\n create_pending_snapshots+0x92/0xc0 [btrfs]\n btrfs_commit_transaction+0x66b/0xf40 [btrfs]\n btrfs_mksubvol+0x301/0x4d0 [btrfs]\n btrfs_mksnapshot+0x80/0xb0 [btrfs]\n __btrfs_ioctl_snap_create+0x1c2/0x1d0 [btrfs]\n btrfs_ioctl_snap_create_v2+0xc4/0x150 [btrfs]\n btrfs_ioctl+0x8a6/0x2650 [btrfs]\n ? kmem_cache_free+0x22/0x340\n ? do_sys_openat2+0x97/0xe0\n __x64_sys_ioctl+0x97/0xd0\n do_syscall_64+0x46/0xf0\n entry_SYSCALL_64_after_hwframe+0x6e/0x76\n RIP: 0033:0x7fe20abe83af\n RSP: 002b:00007ffe6eff1360 EFLAGS: 00000246 ORIG_RAX: 0000000000000010\n RAX: ffffffffffffffda RBX: 0000000000000004 RCX: 00007fe20abe83af\n RDX: 00007ffe6eff23c0 RSI: 0000000050009417 RDI: 0000000000000003\n RBP: 0000000000000003 R08: 0000000000000000 R09: 00007fe20ad16cd0\n R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000\n R13: 00007ffe6eff13c0 R14: 00007fe20ad45000 R15: 0000559a120b6d58\n \u0026lt;/TASK\u0026gt;\n ---[ end trace 0000000000000000 ]---\n BTRFS: error (device vdc: state A) in create_pending_snapshot:1875: errno=-2 No such entry\n BTRFS info (device vdc: state EA): forced readonly\n BTRFS warning (device vdc: state EA): Skipping commit of aborted transaction.\n BTRFS: error (device vdc: state EA) in cleanup_transaction:2055: errno=-2 No such entry\r\n\r\nThis happens because create_pending_snapshot() initializes the new root\nitem as a copy of the source root item. This includes the refs field,\nwhich is 0 for a deleted subvolume. The call to btrfs_insert_root()\ntherefore inserts a root with refs == 0. btrfs_get_new_fs_root() then\nfinds the root and returns -ENOENT if refs == 0, which causes\ncreate_pending_snapshot() to abort.\r\n\r\nFix it by checking the source root\u0026apos;s refs before attempting the\nsnapshot, but after locking subvol_sem to avoid racing with deletion.(CVE-2024-26644)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nARM: ep93xx: Add terminator to gpiod_lookup_table\r\n\r\nWithout the terminator, if a con_id is passed to gpio_find() that\ndoes not exist in the lookup table the function will not stop looping\ncorrectly, and eventually cause an oops.(CVE-2024-26751)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfs/aio: Restrict kiocb_set_cancel_fn() to I/O submitted via libaio\r\n\r\nIf kiocb_set_cancel_fn() is called for I/O submitted via io_uring, the\nfollowing kernel warning appears:\r\n\r\nWARNING: CPU: 3 PID: 368 at fs/aio.c:598 kiocb_set_cancel_fn+0x9c/0xa8\nCall trace:\n kiocb_set_cancel_fn+0x9c/0xa8\n ffs_epfile_read_iter+0x144/0x1d0\n io_read+0x19c/0x498\n io_issue_sqe+0x118/0x27c\n io_submit_sqes+0x25c/0x5fc\n __arm64_sys_io_uring_enter+0x104/0xab0\n invoke_syscall+0x58/0x11c\n el0_svc_common+0xb4/0xf4\n do_el0_svc+0x2c/0xb0\n el0_svc+0x2c/0xa4\n el0t_64_sync_handler+0x68/0xb4\n el0t_64_sync+0x1a4/0x1a8\r\n\r\nFix this by setting the IOCB_AIO_RW flag for read and write I/O that is\nsubmitted by libaio.(CVE-2024-26764)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: avoid allocating blocks from corrupted group in ext4_mb_find_by_goal()\r\n\r\nPlaces the logic for checking if the group\u0026apos;s block bitmap is corrupt under\nthe protection of the group lock to avoid allocating blocks from the group\nwith a corrupted block bitmap.(CVE-2024-26772)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\next4: avoid allocating blocks from corrupted group in ext4_mb_try_best_found()\r\n\r\nDetermine if the group block bitmap is corrupted before using ac_b_ex in\next4_mb_try_best_found() to avoid allocating blocks from a group with a\ncorrupted block bitmap in the following concurrency and making the\nsituation worse.\r\n\r\next4_mb_regular_allocator\n ext4_lock_group(sb, group)\n ext4_mb_good_group\n // check if the group bbitmap is corrupted\n ext4_mb_complex_scan_group\n // Scan group gets ac_b_ex but doesn\u0026apos;t use it\n ext4_unlock_group(sb, group)\n ext4_mark_group_bitmap_corrupted(group)\n // The block bitmap was corrupted during\n // the group unlock gap.\n ext4_mb_try_best_found\n ext4_lock_group(ac-\u0026gt;ac_sb, group)\n ext4_mb_use_best_found\n mb_mark_used\n // Allocating blocks in block bitmap corrupted group(CVE-2024-26773)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfbdev: sis: Error out if pixclock equals zero\r\n\r\nThe userspace program could pass any values to the driver through\nioctl() interface. If the driver doesn\u0026apos;t check the value of pixclock,\nit may cause divide-by-zero error.\r\n\r\nIn sisfb_check_var(), var-\u0026gt;pixclock is used as a divisor to caculate\ndrate before it is checked against zero. Fix this by checking it\nat the beginning.\r\n\r\nThis is similar to CVE-2022-3061 in i740fb which was fixed by\ncommit 15cf0b8.(CVE-2024-26777)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nfbdev: savage: Error out if pixclock equals zero\r\n\r\nThe userspace program could pass any values to the driver through\nioctl() interface. If the driver doesn\u0026apos;t check the value of pixclock,\nit may cause divide-by-zero error.\r\n\r\nAlthough pixclock is checked in savagefb_decode_var(), but it is not\nchecked properly in savagefb_probe(). Fix this by checking whether\npixclock is zero in the function savagefb_check_var() before\ninfo-\u0026gt;var.pixclock is used as the divisor.\r\n\r\nThis is similar to CVE-2022-3061 in i740fb which was fixed by\ncommit 15cf0b8.(CVE-2024-26778)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvfio/pci: Lock external INTx masking ops\r\n\r\nMask operations through config space changes to DisINTx may race INTx\nconfiguration changes via ioctl. Create wrappers that add locking for\npaths outside of the core interrupt code.\r\n\r\nIn particular, irq_type is updated holding igate, therefore testing\nis_intx() requires holding igate. For example clearing DisINTx from\nconfig space can otherwise race changes of the interrupt configuration.\r\n\r\nThis aligns interfaces which may trigger the INTx eventfd into two\ncamps, one side serialized by igate and the other only enabled while\nINTx is configured. A subsequent patch introduces synchronization for\nthe latter flows.(CVE-2024-26810)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Fix hashtab overflow check on 32-bit arches\r\n\r\nThe hashtab code relies on roundup_pow_of_two() to compute the number of\nhash buckets, and contains an overflow check by checking if the\nresulting value is 0. However, on 32-bit arches, the roundup code itself\ncan overflow by doing a 32-bit left-shift of an unsigned long value,\nwhich is undefined behaviour, so it is not guaranteed to truncate\nneatly. This was triggered by syzbot on the DEVMAP_HASH type, which\ncontains the same check, copied from the hashtab code. So apply the same\nfix to hashtab, by moving the overflow check to before the roundup.(CVE-2024-26884)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nvfio/pci: Disable auto-enable of exclusive INTx IRQ\r\n\r\nCurrently for devices requiring masking at the irqchip for INTx, ie.\ndevices without DisINTx support, the IRQ is enabled in request_irq()\nand subsequently disabled as necessary to align with the masked status\nflag. This presents a window where the interrupt could fire between\nthese events, resulting in the IRQ incrementing the disable depth twice.\nThis would be unrecoverable for a user since the masked flag prevents\nnested enables through vfio.\r\n\r\nInstead, invert the logic using IRQF_NO_AUTOEN such that exclusive INTx\nis never auto-enabled, then unmask as required.(CVE-2024-27437)",
"id": "OESA-2024-1526",
"modified": "2026-08-06T11:06:58Z",
"published": "2024-05-10T11:06:58Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1526"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47121"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47149"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47183"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47194"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47210"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52619"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-24860"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26633"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26644"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26751"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26764"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26772"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26773"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26777"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26778"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26810"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26884"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27437"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47121",
"CVE-2021-47149",
"CVE-2021-47183",
"CVE-2021-47194",
"CVE-2021-47210",
"CVE-2023-52619",
"CVE-2024-24860",
"CVE-2024-26633",
"CVE-2024-26644",
"CVE-2024-26751",
"CVE-2024-26764",
"CVE-2024-26772",
"CVE-2024-26773",
"CVE-2024-26777",
"CVE-2024-26778",
"CVE-2024-26810",
"CVE-2024-26884",
"CVE-2024-27437"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.