Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2025-39738 (GCVE-0-2025-39738)
Vulnerability from cvelistv5 – Published: 2025-09-11 16:52 – Updated: 2026-08-05 12:04| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
638331fa56caeaa8b4d31cc1dfbe0ce989bcff67 , < fa086b1398cf7e5f7dee7241bd5f2855cb5df8dc
(git)
Affected: 638331fa56caeaa8b4d31cc1dfbe0ce989bcff67 , < fcb1f77b8ed8795608ca7a1f6505e2b07236c1f3 (git) Affected: 638331fa56caeaa8b4d31cc1dfbe0ce989bcff67 , < f83d4c81bda3b7d1813268ab77408f7a0ce691ff (git) Affected: 638331fa56caeaa8b4d31cc1dfbe0ce989bcff67 , < 39a93e1c9dbf7e11632efeb20fcf0fc1dcf64d51 (git) Affected: 638331fa56caeaa8b4d31cc1dfbe0ce989bcff67 , < 125e94a4b76b7b75d194f85bedd628097d2121f0 (git) Affected: 638331fa56caeaa8b4d31cc1dfbe0ce989bcff67 , < 4e403bd8e127d40dc7c05f06ee969c1ba1537ec5 (git) Affected: 638331fa56caeaa8b4d31cc1dfbe0ce989bcff67 , < 4289b494ac553e74e86fed1c66b2bf9530bc1082 (git) |
guessed | |
| Linux | Linux |
Affected:
5.11
Unaffected: 0 , < 5.11 (semver) Unaffected: 5.15.190 , ≤ 5.15.* (semver) Unaffected: 6.1.149 , ≤ 6.1.* (semver) Unaffected: 6.6.103 , ≤ 6.6.* (semver) Unaffected: 6.12.43 , ≤ 6.12.* (semver) Unaffected: 6.15.11 , ≤ 6.15.* (semver) Unaffected: 6.16.2 , ≤ 6.16.* (semver) Unaffected: 6.17 , ≤ * (original_commit_for_fix) |
guessed | |
| Siemens | SIMATIC CN 4100 |
Affected:
0 , < V5.0
(custom)
|
guessed |
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2025-11-03T17:42:55.377Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"url": "https://lists.debian.org/debian-lts-announce/2025/10/msg00008.html"
}
],
"title": "CVE Program Container"
},
{
"affected": [
{
"defaultStatus": "unknown",
"product": "SIMATIC CN 4100",
"vendor": "Siemens",
"versions": [
{
"lessThan": "V5.0",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-05-12T12:06:40.831Z",
"orgId": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e",
"shortName": "siemens-SADP"
},
"references": [
{
"url": "https://cert-portal.siemens.com/productcert/html/ssa-032379.html"
}
],
"x_adpType": "supplier"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/btrfs/relocation.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "fa086b1398cf7e5f7dee7241bd5f2855cb5df8dc",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "fcb1f77b8ed8795608ca7a1f6505e2b07236c1f3",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "f83d4c81bda3b7d1813268ab77408f7a0ce691ff",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "39a93e1c9dbf7e11632efeb20fcf0fc1dcf64d51",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "125e94a4b76b7b75d194f85bedd628097d2121f0",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "4e403bd8e127d40dc7c05f06ee969c1ba1537ec5",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "4289b494ac553e74e86fed1c66b2bf9530bc1082",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/btrfs/relocation.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.11"
},
{
"lessThan": "5.11",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.190",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.149",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.103",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.43",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.15.*",
"status": "unaffected",
"version": "6.15.11",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.16.*",
"status": "unaffected",
"version": "6.16.2",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.17",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.190",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.149",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.103",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.12.43",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.15.11",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.16.2",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.17",
"versionStartIncluding": "5.11",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: do not allow relocation of partially dropped subvolumes\n\n[BUG]\nThere is an internal report that balance triggered transaction abort,\nwith the following call trace:\n\n item 85 key (594509824 169 0) itemoff 12599 itemsize 33\n extent refs 1 gen 197740 flags 2\n ref#0: tree block backref root 7\n item 86 key (594558976 169 0) itemoff 12566 itemsize 33\n extent refs 1 gen 197522 flags 2\n ref#0: tree block backref root 7\n ...\n BTRFS error (device loop0): extent item not found for insert, bytenr 594526208 num_bytes 16384 parent 449921024 root_objectid 934 owner 1 offset 0\n BTRFS error (device loop0): failed to run delayed ref for logical 594526208 num_bytes 16384 type 182 action 1 ref_mod 1: -117\n ------------[ cut here ]------------\n BTRFS: Transaction aborted (error -117)\n WARNING: CPU: 1 PID: 6963 at ../fs/btrfs/extent-tree.c:2168 btrfs_run_delayed_refs+0xfa/0x110 [btrfs]\n\nAnd btrfs check doesn\u0027t report anything wrong related to the extent\ntree.\n\n[CAUSE]\nThe cause is a little complex, firstly the extent tree indeed doesn\u0027t\nhave the backref for 594526208.\n\nThe extent tree only have the following two backrefs around that bytenr\non-disk:\n\n item 65 key (594509824 METADATA_ITEM 0) itemoff 13880 itemsize 33\n refs 1 gen 197740 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n item 66 key (594558976 METADATA_ITEM 0) itemoff 13847 itemsize 33\n refs 1 gen 197522 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n\nBut the such missing backref item is not an corruption on disk, as the\noffending delayed ref belongs to subvolume 934, and that subvolume is\nbeing dropped:\n\n item 0 key (934 ROOT_ITEM 198229) itemoff 15844 itemsize 439\n generation 198229 root_dirid 256 bytenr 10741039104 byte_limit 0 bytes_used 345571328\n last_snapshot 198229 flags 0x1000000000001(RDONLY) refs 0\n drop_progress key (206324 EXTENT_DATA 2711650304) drop_level 2\n level 2 generation_v2 198229\n\nAnd that offending tree block 594526208 is inside the dropped range of\nthat subvolume. That explains why there is no backref item for that\nbytenr and why btrfs check is not reporting anything wrong.\n\nBut this also shows another problem, as btrfs will do all the orphan\nsubvolume cleanup at a read-write mount.\n\nSo half-dropped subvolume should not exist after an RW mount, and\nbalance itself is also exclusive to subvolume cleanup, meaning we\nshouldn\u0027t hit a subvolume half-dropped during relocation.\n\nThe root cause is, there is no orphan item for this subvolume.\nIn fact there are 5 subvolumes from around 2021 that have the same\nproblem.\n\nIt looks like the original report has some older kernels running, and\ncaused those zombie subvolumes.\n\nThankfully upstream commit 8d488a8c7ba2 (\"btrfs: fix subvolume/snapshot\ndeletion not triggered on mount\") has long fixed the bug.\n\n[ENHANCEMENT]\nFor repairing such old fs, btrfs-progs will be enhanced.\n\nConsidering how delayed the problem will show up (at run delayed ref\ntime) and at that time we have to abort transaction already, it is too\nlate.\n\nInstead here we reject any half-dropped subvolume for reloc tree at the\nearliest time, preventing confusion and extra time wasted on debugging\nsimilar bugs."
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.3,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:L/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The vulnerable path is reached only by mounting a btrfs image containing a partially-dropped subvolume and then relocating a block group (balance/device shrink ioctl or the in-kernel background reclaim worker). There is no network or adjacent exposure \u2014 the attack surface is local filesystem media/ioctl.\nAC:L - An attacker supplying the filesystem image fully controls the required on-disk state (root item with non-zero drop_progress and no orphan item) and can size the fs so that any relocation touches the affected block group; the trigger is deterministic with no race or uncontrolled condition.\nPR:L - Balance nominally gates on CAP_SYS_ADMIN, but an unprivileged local user can introduce the crafted image on typical desktop/NAS deployments via udisks2 loop-setup/removable-media auto-mount, and on zoned btrfs the relocation itself is performed by the kernel\u0027s automatic block-group reclaim with no privileges at all.\nUI:N - No action by a second user is required \u2014 the attacker mounts their own image, and relocation is driven either by the kernel\u0027s own periodic/zoned block-group reclaim worker or by routine scheduled maintenance balance (e.g. btrfsmaintenance), not by an interactive victim action.\nS:U - The damage is confined to the btrfs filesystem and the kernel of the same host; no VM, IOMMU, container, or sandbox security boundary is crossed.\nC:L - Mis-dropped extent references can prematurely free still-referenced extents, producing cross-linked extents where one file\u0027s blocks become readable through another\u0027s, and the failure path dumps extent-tree leaf contents to the kernel log; this is indirect, bounded disclosure rather than an arbitrary read primitive.\nI:H - As the fix states, relocating a half-dropped subvolume makes the kernel attempt to drop references for extents that were already dropped, corrupting extent refcounts and allowing in-use metadata/data extents to be freed and reallocated, which can arbitrarily corrupt other files\u0027 and subvolumes\u0027 on-disk data.\nA:H - The bug reliably produces a WARNING splat in btrfs_run_delayed_refs() and a transaction abort (-EUCLEAN), which forces the entire filesystem read-only for the remaining uptime; on panic_on_warn kernels the WARN escalates to a full panic."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T12:04:56.657Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/fa086b1398cf7e5f7dee7241bd5f2855cb5df8dc"
},
{
"url": "https://git.kernel.org/stable/c/fcb1f77b8ed8795608ca7a1f6505e2b07236c1f3"
},
{
"url": "https://git.kernel.org/stable/c/f83d4c81bda3b7d1813268ab77408f7a0ce691ff"
},
{
"url": "https://git.kernel.org/stable/c/39a93e1c9dbf7e11632efeb20fcf0fc1dcf64d51"
},
{
"url": "https://git.kernel.org/stable/c/125e94a4b76b7b75d194f85bedd628097d2121f0"
},
{
"url": "https://git.kernel.org/stable/c/4e403bd8e127d40dc7c05f06ee969c1ba1537ec5"
},
{
"url": "https://git.kernel.org/stable/c/4289b494ac553e74e86fed1c66b2bf9530bc1082"
}
],
"title": "btrfs: do not allow relocation of partially dropped subvolumes",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2025-39738",
"datePublished": "2025-09-11T16:52:13.228Z",
"dateReserved": "2025-04-16T07:20:57.119Z",
"dateUpdated": "2026-08-05T12:04:56.657Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2025-39738",
"date": "2026-09-28",
"epss": "0.00169",
"percentile": "0.05599"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/btrfs/relocation.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "fa086b1398cf7e5f7dee7241bd5f2855cb5df8dc",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "fcb1f77b8ed8795608ca7a1f6505e2b07236c1f3",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "f83d4c81bda3b7d1813268ab77408f7a0ce691ff",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "39a93e1c9dbf7e11632efeb20fcf0fc1dcf64d51",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "125e94a4b76b7b75d194f85bedd628097d2121f0",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "4e403bd8e127d40dc7c05f06ee969c1ba1537ec5",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "4289b494ac553e74e86fed1c66b2bf9530bc1082",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/btrfs/relocation.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.11"
},
{
"lessThan": "5.11",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.190",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.149",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.103",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.43",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.15.*",
"status": "unaffected",
"version": "6.15.11",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.16.*",
"status": "unaffected",
"version": "6.16.2",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.17",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
},
{
"affectedData": [
{
"defaultStatus": "unknown",
"product": "SIMATIC CN 4100",
"vendor": "Siemens",
"versions": [
{
"lessThan": "V5.0",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "37696BCE-E60F-4750-AF90-704743E640AD",
"versionEndExcluding": "5.15.190",
"versionStartIncluding": "5.11.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FDBE8280-8983-4D2D-943D-2E6D0104E2D8",
"versionEndExcluding": "6.1.149",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F2293654-7169-49B5-8D0D-EE51EF8B8E48",
"versionEndExcluding": "6.6.103",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "472C5F87-2BF3-4FAB-9B21-DA7513977363",
"versionEndExcluding": "6.12.43",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BC242347-F722-43AE-B910-BE0B22386977",
"versionEndExcluding": "6.15.11",
"versionStartIncluding": "6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BD7C087D-2415-4521-B624-30003352F899",
"versionEndExcluding": "6.16.2",
"versionStartIncluding": "6.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:-:*:*:*:*:*:*",
"matchCriteriaId": "7AD3510E-E8FA-47F3-9AD5-D8EA4A2719D1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc3:*:*:*:*:*:*",
"matchCriteriaId": "18C82C96-2853-4DFE-93AD-F6E59B4129CA",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc4:*:*:*:*:*:*",
"matchCriteriaId": "A330B043-47EA-4D06-82BF-153A1735FC11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc5:*:*:*:*:*:*",
"matchCriteriaId": "F0EE963C-B36C-4143-96A9-65BCA7D8F2EF",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc6:*:*:*:*:*:*",
"matchCriteriaId": "B511E2F6-2917-4797-8909-8F7EA4870C7B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc7:*:*:*:*:*:*",
"matchCriteriaId": "E9FA9D80-C790-41EA-8A21-DF7B170465E0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.17:rc1:*:*:*:*:*:*",
"matchCriteriaId": "327D22EF-390B-454C-BD31-2ED23C998A1C",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
},
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:debian:debian_linux:11.0:*:*:*:*:*:*:*",
"matchCriteriaId": "FA6FEEC2-9F11-4643-8827-749718254FED",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: do not allow relocation of partially dropped subvolumes\n\n[BUG]\nThere is an internal report that balance triggered transaction abort,\nwith the following call trace:\n\n item 85 key (594509824 169 0) itemoff 12599 itemsize 33\n extent refs 1 gen 197740 flags 2\n ref#0: tree block backref root 7\n item 86 key (594558976 169 0) itemoff 12566 itemsize 33\n extent refs 1 gen 197522 flags 2\n ref#0: tree block backref root 7\n ...\n BTRFS error (device loop0): extent item not found for insert, bytenr 594526208 num_bytes 16384 parent 449921024 root_objectid 934 owner 1 offset 0\n BTRFS error (device loop0): failed to run delayed ref for logical 594526208 num_bytes 16384 type 182 action 1 ref_mod 1: -117\n ------------[ cut here ]------------\n BTRFS: Transaction aborted (error -117)\n WARNING: CPU: 1 PID: 6963 at ../fs/btrfs/extent-tree.c:2168 btrfs_run_delayed_refs+0xfa/0x110 [btrfs]\n\nAnd btrfs check doesn\u0027t report anything wrong related to the extent\ntree.\n\n[CAUSE]\nThe cause is a little complex, firstly the extent tree indeed doesn\u0027t\nhave the backref for 594526208.\n\nThe extent tree only have the following two backrefs around that bytenr\non-disk:\n\n item 65 key (594509824 METADATA_ITEM 0) itemoff 13880 itemsize 33\n refs 1 gen 197740 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n item 66 key (594558976 METADATA_ITEM 0) itemoff 13847 itemsize 33\n refs 1 gen 197522 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n\nBut the such missing backref item is not an corruption on disk, as the\noffending delayed ref belongs to subvolume 934, and that subvolume is\nbeing dropped:\n\n item 0 key (934 ROOT_ITEM 198229) itemoff 15844 itemsize 439\n generation 198229 root_dirid 256 bytenr 10741039104 byte_limit 0 bytes_used 345571328\n last_snapshot 198229 flags 0x1000000000001(RDONLY) refs 0\n drop_progress key (206324 EXTENT_DATA 2711650304) drop_level 2\n level 2 generation_v2 198229\n\nAnd that offending tree block 594526208 is inside the dropped range of\nthat subvolume. That explains why there is no backref item for that\nbytenr and why btrfs check is not reporting anything wrong.\n\nBut this also shows another problem, as btrfs will do all the orphan\nsubvolume cleanup at a read-write mount.\n\nSo half-dropped subvolume should not exist after an RW mount, and\nbalance itself is also exclusive to subvolume cleanup, meaning we\nshouldn\u0027t hit a subvolume half-dropped during relocation.\n\nThe root cause is, there is no orphan item for this subvolume.\nIn fact there are 5 subvolumes from around 2021 that have the same\nproblem.\n\nIt looks like the original report has some older kernels running, and\ncaused those zombie subvolumes.\n\nThankfully upstream commit 8d488a8c7ba2 (\"btrfs: fix subvolume/snapshot\ndeletion not triggered on mount\") has long fixed the bug.\n\n[ENHANCEMENT]\nFor repairing such old fs, btrfs-progs will be enhanced.\n\nConsidering how delayed the problem will show up (at run delayed ref\ntime) and at that time we have to abort transaction already, it is too\nlate.\n\nInstead here we reject any half-dropped subvolume for reloc tree at the\nearliest time, preventing confusion and extra time wasted on debugging\nsimilar bugs."
}
],
"id": "CVE-2025-39738",
"lastModified": "2026-07-30T06:23:43.617",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.3,
"baseSeverity": "HIGH",
"confidentialityImpact": "LOW",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:L/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.5,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2025-09-11T17:15:35.443",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/125e94a4b76b7b75d194f85bedd628097d2121f0"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/39a93e1c9dbf7e11632efeb20fcf0fc1dcf64d51"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4289b494ac553e74e86fed1c66b2bf9530bc1082"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4e403bd8e127d40dc7c05f06ee969c1ba1537ec5"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f83d4c81bda3b7d1813268ab77408f7a0ce691ff"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/fa086b1398cf7e5f7dee7241bd5f2855cb5df8dc"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/fcb1f77b8ed8795608ca7a1f6505e2b07236c1f3"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Third Party Advisory"
],
"url": "https://lists.debian.org/debian-lts-announce/2025/10/msg00008.html"
},
{
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-032379.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-07-30T08:58:30+00:00",
"cve": "CVE-2025-39738",
"id": "CVE-2025-39738",
"initial_release_date": "2025-09-11T00:00:00+00:00",
"product_status:known_affected": "42",
"product_status:known_not_affected": "232",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: Linux kernel: Denial of Service in Btrfs due to relocation of partially dropped subvolumes",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2025/cve-2025-39738.json",
"version": "3"
}
}
}
CERTFR-2026-AVI-0218
Vulnerability from certfr_avis - Published: 2026-02-26 - Updated: 2026-02-26
De multiples vulnérabilités ont été découvertes dans les produits VMware. Certaines d'entre elles permettent à un attaquant de provoquer un déni de service à distance, une atteinte à la confidentialité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| VMware | Tanzu Kubernetes Runtime | Platform Services pour Tanzu Platform versions antérieures à 10.3.5 | ||
| VMware | Tanzu Kubernetes Runtime | Tanzu Hub versions antérieures à 10.3.5 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 16.x antérieures à 16.12.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions antérieures à 4.3.2 sur Kubernetes | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 18.x antérieures à 18.2.0 | ||
| VMware | Tanzu Kubernetes Runtime | Stemcells (Ubuntu Noble) versions antérieures à 1.238.x | ||
| VMware | Workstation | Workstation versions antérieures à 25H2u1 | ||
| VMware | Fusion | Fusion versions antérieures à 25H2u1 sur MacOS | ||
| VMware | Tanzu Kubernetes Runtime | Stemcells (Ubuntu Jammy) versions antérieures à 1.1065.x | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 15.x antérieures à 15.16.0 | ||
| VMware | Tanzu Kubernetes Runtime | Stemcells (Windows) versions antérieures à 2019.95.x | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions 17.x antérieures à 17.8.0 | ||
| VMware | Tanzu Data Intelligence | Tanzu pour Postgres versions antérieures à 14.21.0 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Platform Services pour Tanzu Platform versions ant\u00e9rieures \u00e0 10.3.5",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu Hub versions ant\u00e9rieures \u00e0 10.3.5",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 16.x ant\u00e9rieures \u00e0 16.12.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions ant\u00e9rieures \u00e0 4.3.2 sur Kubernetes",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 18.x ant\u00e9rieures \u00e0 18.2.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Stemcells (Ubuntu Noble) versions ant\u00e9rieures \u00e0 1.238.x",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Workstation versions ant\u00e9rieures \u00e0 25H2u1",
"product": {
"name": "Workstation",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Fusion versions ant\u00e9rieures \u00e0 25H2u1 sur MacOS",
"product": {
"name": "Fusion",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Stemcells (Ubuntu Jammy) versions ant\u00e9rieures \u00e0 1.1065.x",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 15.x ant\u00e9rieures \u00e0 15.16.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Stemcells (Windows) versions ant\u00e9rieures \u00e0 2019.95.x",
"product": {
"name": "Tanzu Kubernetes Runtime",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions 17.x ant\u00e9rieures \u00e0 17.8.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
},
{
"description": "Tanzu pour Postgres versions ant\u00e9rieures \u00e0 14.21.0",
"product": {
"name": "Tanzu Data Intelligence",
"vendor": {
"name": "VMware",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2019-25013",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-25013"
},
{
"name": "CVE-2017-9937",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-9937"
},
{
"name": "CVE-2025-6395",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6395"
},
{
"name": "CVE-2026-22722",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22722"
},
{
"name": "CVE-2023-52356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52356"
},
{
"name": "CVE-2013-4235",
"url": "https://www.cve.org/CVERecord?id=CVE-2013-4235"
},
{
"name": "CVE-2025-8715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8715"
},
{
"name": "CVE-2017-3613",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3613"
},
{
"name": "CVE-2021-22898",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22898"
},
{
"name": "CVE-2025-38490",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38490"
},
{
"name": "CVE-2025-37850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37850"
},
{
"name": "CVE-2025-66865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66865"
},
{
"name": "CVE-2022-35252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35252"
},
{
"name": "CVE-2005-0602",
"url": "https://www.cve.org/CVERecord?id=CVE-2005-0602"
},
{
"name": "CVE-2025-61730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61730"
},
{
"name": "CVE-2025-38485",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38485"
},
{
"name": "CVE-2025-22026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22026"
},
{
"name": "CVE-2025-39987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39987"
},
{
"name": "CVE-2025-62727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62727"
},
{
"name": "CVE-2015-4789",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4789"
},
{
"name": "CVE-2025-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38579"
},
{
"name": "CVE-2025-37761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37761"
},
{
"name": "CVE-2025-21861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21861"
},
{
"name": "CVE-2025-37865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37865"
},
{
"name": "CVE-2025-38328",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38328"
},
{
"name": "CVE-2026-21933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21933"
},
{
"name": "CVE-2025-58183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58183"
},
{
"name": "CVE-2024-7006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7006"
},
{
"name": "CVE-2026-21932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21932"
},
{
"name": "CVE-2023-3316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3316"
},
{
"name": "CVE-2025-15282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15282"
},
{
"name": "CVE-2025-38711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38711"
},
{
"name": "CVE-2025-38487",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38487"
},
{
"name": "CVE-2024-9681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9681"
},
{
"name": "CVE-2025-58190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58190"
},
{
"name": "CVE-2025-37775",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37775"
},
{
"name": "CVE-2025-38335",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38335"
},
{
"name": "CVE-2024-11168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11168"
},
{
"name": "CVE-2025-38304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38304"
},
{
"name": "CVE-2025-37892",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37892"
},
{
"name": "CVE-2025-38100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38100"
},
{
"name": "CVE-2025-37859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37859"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2025-1372",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1372"
},
{
"name": "CVE-2025-8851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8851"
},
{
"name": "CVE-2025-38043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38043"
},
{
"name": "CVE-2025-68973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68973"
},
{
"name": "CVE-2025-38471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38471"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-37792",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37792"
},
{
"name": "CVE-2022-3626",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3626"
},
{
"name": "CVE-2024-28834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28834"
},
{
"name": "CVE-2021-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-38604"
},
{
"name": "CVE-2001-1268",
"url": "https://www.cve.org/CVERecord?id=CVE-2001-1268"
},
{
"name": "CVE-2024-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37891"
},
{
"name": "CVE-2025-38108",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38108"
},
{
"name": "CVE-2025-38230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38230"
},
{
"name": "CVE-2025-38229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38229"
},
{
"name": "CVE-2023-46218",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46218"
},
{
"name": "CVE-2025-40055",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40055"
},
{
"name": "CVE-2025-38158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38158"
},
{
"name": "CVE-2025-37872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37872"
},
{
"name": "CVE-2025-9714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9714"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2026-22801",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22801"
},
{
"name": "CVE-2025-39876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39876"
},
{
"name": "CVE-2025-40029",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40029"
},
{
"name": "CVE-2025-38279",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38279"
},
{
"name": "CVE-2025-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38561"
},
{
"name": "CVE-2014-8141",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-8141"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2022-2255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2255"
},
{
"name": "CVE-2025-10148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10148"
},
{
"name": "CVE-2025-25724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25724"
},
{
"name": "CVE-2025-27818",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27818"
},
{
"name": "CVE-2025-14087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14087"
},
{
"name": "CVE-2025-40048",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40048"
},
{
"name": "CVE-2025-5222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5222"
},
{
"name": "CVE-2025-38147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38147"
},
{
"name": "CVE-2023-6780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6780"
},
{
"name": "CVE-2022-48468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48468"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2025-38286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38286"
},
{
"name": "CVE-2025-40219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40219"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-38501",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38501"
},
{
"name": "CVE-2025-38474",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38474"
},
{
"name": "CVE-2025-7545",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7545"
},
{
"name": "CVE-2025-37979",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37979"
},
{
"name": "CVE-2025-40043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40043"
},
{
"name": "CVE-2024-3220",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3220"
},
{
"name": "CVE-2022-3599",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3599"
},
{
"name": "CVE-2025-37777",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37777"
},
{
"name": "CVE-2021-39537",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-39537"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-37936",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37936"
},
{
"name": "CVE-2015-4787",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4787"
},
{
"name": "CVE-2022-27781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27781"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2021-22925",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22925"
},
{
"name": "CVE-2025-37766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37766"
},
{
"name": "CVE-2022-47008",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47008"
},
{
"name": "CVE-2023-0796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0796"
},
{
"name": "CVE-2025-38104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38104"
},
{
"name": "CVE-2025-37844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37844"
},
{
"name": "CVE-2016-0682",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-0682"
},
{
"name": "CVE-2025-21931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21931"
},
{
"name": "CVE-2025-37871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37871"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2025-39716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39716"
},
{
"name": "CVE-2025-39702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39702"
},
{
"name": "CVE-2025-39973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39973"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-22872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22872"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-8941",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8941"
},
{
"name": "CVE-2023-52425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52425"
},
{
"name": "CVE-2025-38163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38163"
},
{
"name": "CVE-2025-22126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22126"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38109"
},
{
"name": "CVE-2023-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38546"
},
{
"name": "CVE-2025-39779",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39779"
},
{
"name": "CVE-2025-66866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66866"
},
{
"name": "CVE-2025-28164",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-28164"
},
{
"name": "CVE-2025-37755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37755"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2025-39943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39943"
},
{
"name": "CVE-2025-39945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39945"
},
{
"name": "CVE-2025-11840",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11840"
},
{
"name": "CVE-2025-11731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11731"
},
{
"name": "CVE-2024-33602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33602"
},
{
"name": "CVE-2022-47629",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47629"
},
{
"name": "CVE-2025-39883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39883"
},
{
"name": "CVE-2025-39720",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39720"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38388"
},
{
"name": "CVE-2022-48554",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48554"
},
{
"name": "CVE-2022-0563",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0563"
},
{
"name": "CVE-2025-38157",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38157"
},
{
"name": "CVE-2025-4056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4056"
},
{
"name": "CVE-2025-37790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37790"
},
{
"name": "CVE-2024-28757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28757"
},
{
"name": "CVE-2020-29562",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-29562"
},
{
"name": "CVE-2025-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38417"
},
{
"name": "CVE-2025-0913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0913"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2015-4776",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4776"
},
{
"name": "CVE-2025-38323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38323"
},
{
"name": "CVE-2025-40019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40019"
},
{
"name": "CVE-2017-3616",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3616"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-27817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27817"
},
{
"name": "CVE-2023-30086",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30086"
},
{
"name": "CVE-2025-40240",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40240"
},
{
"name": "CVE-2025-38219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38219"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2015-4785",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4785"
},
{
"name": "CVE-2025-38099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38099"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-37758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37758"
},
{
"name": "CVE-2022-32208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32208"
},
{
"name": "CVE-2025-40081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40081"
},
{
"name": "CVE-2025-38087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38087"
},
{
"name": "CVE-2025-47907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47907"
},
{
"name": "CVE-2025-1181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1181"
},
{
"name": "CVE-2022-41409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-41409"
},
{
"name": "CVE-2023-25586",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25586"
},
{
"name": "CVE-2024-12797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12797"
},
{
"name": "CVE-2024-58011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58011"
},
{
"name": "CVE-2025-12084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12084"
},
{
"name": "CVE-2025-38039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38039"
},
{
"name": "CVE-2017-20052",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-20052"
},
{
"name": "CVE-2025-40026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40026"
},
{
"name": "CVE-2025-40153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40153"
},
{
"name": "CVE-2025-0840",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0840"
},
{
"name": "CVE-2022-2057",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2057"
},
{
"name": "CVE-2023-45853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45853"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2024-47611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47611"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2025-40121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40121"
},
{
"name": "CVE-2025-45582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-45582"
},
{
"name": "CVE-2025-11468",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11468"
},
{
"name": "CVE-2025-40204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40204"
},
{
"name": "CVE-2025-37852",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37852"
},
{
"name": "CVE-2025-37841",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37841"
},
{
"name": "CVE-2025-40171",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40171"
},
{
"name": "CVE-2025-37918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37918"
},
{
"name": "CVE-2025-37917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37917"
},
{
"name": "CVE-2025-38290",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38290"
},
{
"name": "CVE-2021-22901",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22901"
},
{
"name": "CVE-2025-38063",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38063"
},
{
"name": "CVE-2021-3998",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3998"
},
{
"name": "CVE-2025-1179",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1179"
},
{
"name": "CVE-2025-37770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37770"
},
{
"name": "CVE-2025-37773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37773"
},
{
"name": "CVE-2023-26965",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26965"
},
{
"name": "CVE-2023-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2602"
},
{
"name": "CVE-2025-6069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6069"
},
{
"name": "CVE-2017-10140",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-10140"
},
{
"name": "CVE-2024-6232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6232"
},
{
"name": "CVE-2025-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38578"
},
{
"name": "CVE-2025-38675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38675"
},
{
"name": "CVE-2025-39911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39911"
},
{
"name": "CVE-2025-69419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69419"
},
{
"name": "CVE-2025-6052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6052"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38708",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38708"
},
{
"name": "CVE-2025-37961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37961"
},
{
"name": "CVE-2025-40125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40125"
},
{
"name": "CVE-2023-52426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52426"
},
{
"name": "CVE-2025-38313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38313"
},
{
"name": "CVE-2025-38336",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38336"
},
{
"name": "CVE-2025-40349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40349"
},
{
"name": "CVE-2025-6075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6075"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2022-2058",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2058"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38061",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38061"
},
{
"name": "CVE-2024-45492",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45492"
},
{
"name": "CVE-2025-37983",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37983"
},
{
"name": "CVE-2015-4764",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4764"
},
{
"name": "CVE-2025-38127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38127"
},
{
"name": "CVE-2026-22715",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22715"
},
{
"name": "CVE-2020-1752",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-1752"
},
{
"name": "CVE-2025-38375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38375"
},
{
"name": "CVE-2025-37784",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37784"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2015-4779",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4779"
},
{
"name": "CVE-2025-4330",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4330"
},
{
"name": "CVE-2025-40187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40187"
},
{
"name": "CVE-2025-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37920"
},
{
"name": "CVE-2025-58185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58185"
},
{
"name": "CVE-2025-37815",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37815"
},
{
"name": "CVE-2025-38686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38686"
},
{
"name": "CVE-2025-37819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37819"
},
{
"name": "CVE-2025-49794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49794"
},
{
"name": "CVE-2024-57970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57970"
},
{
"name": "CVE-2025-39913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39913"
},
{
"name": "CVE-2024-9287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9287"
},
{
"name": "CVE-2022-32207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32207"
},
{
"name": "CVE-2025-40092",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40092"
},
{
"name": "CVE-2022-47007",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47007"
},
{
"name": "CVE-2025-4138",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4138"
},
{
"name": "CVE-2025-61731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61731"
},
{
"name": "CVE-2022-3627",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3627"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2025-39967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39967"
},
{
"name": "CVE-2023-36632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36632"
},
{
"name": "CVE-2025-38463",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38463"
},
{
"name": "CVE-2025-40115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40115"
},
{
"name": "CVE-2023-25433",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25433"
},
{
"name": "CVE-2025-38112",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38112"
},
{
"name": "CVE-2025-66863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66863"
},
{
"name": "CVE-2015-4780",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4780"
},
{
"name": "CVE-2025-38521",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38521"
},
{
"name": "CVE-2025-38023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38023"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-38282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38282"
},
{
"name": "CVE-2024-56171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56171"
},
{
"name": "CVE-2025-39689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39689"
},
{
"name": "CVE-2025-38215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38215"
},
{
"name": "CVE-2022-3598",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3598"
},
{
"name": "CVE-2023-0798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0798"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-37943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37943"
},
{
"name": "CVE-2025-37745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37745"
},
{
"name": "CVE-2025-8176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8176"
},
{
"name": "CVE-2025-13837",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13837"
},
{
"name": "CVE-2025-39731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39731"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38653"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-37789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37789"
},
{
"name": "CVE-2025-24970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24970"
},
{
"name": "CVE-2022-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38476"
},
{
"name": "CVE-2021-45078",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-45078"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2022-3515",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3515"
},
{
"name": "CVE-2025-38004",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38004"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-39949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39949"
},
{
"name": "CVE-2015-7696",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-7696"
},
{
"name": "CVE-2022-4285",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4285"
},
{
"name": "CVE-2025-38387",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38387"
},
{
"name": "CVE-2015-4754",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4754"
},
{
"name": "CVE-2025-38362",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38362"
},
{
"name": "CVE-2022-27776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27776"
},
{
"name": "CVE-2023-45322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45322"
},
{
"name": "CVE-2025-40173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40173"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2026-22716",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22716"
},
{
"name": "CVE-2024-8176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8176"
},
{
"name": "CVE-2025-38371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38371"
},
{
"name": "CVE-2023-2731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2731"
},
{
"name": "CVE-2025-58767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58767"
},
{
"name": "CVE-2024-56538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56538"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2021-35939",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35939"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2024-38819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38819"
},
{
"name": "CVE-2023-0803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0803"
},
{
"name": "CVE-2025-37867",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37867"
},
{
"name": "CVE-2025-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23160"
},
{
"name": "CVE-2025-6176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6176"
},
{
"name": "CVE-2022-47695",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47695"
},
{
"name": "CVE-2025-38295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38295"
},
{
"name": "CVE-2025-15367",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15367"
},
{
"name": "CVE-2025-38461",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38461"
},
{
"name": "CVE-2025-37857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37857"
},
{
"name": "CVE-2023-30774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30774"
},
{
"name": "CVE-2024-13176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13176"
},
{
"name": "CVE-2025-37842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37842"
},
{
"name": "CVE-2025-39953",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39953"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2025-15467",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15467"
},
{
"name": "CVE-2024-58251",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58251"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2026-2006",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2006"
},
{
"name": "CVE-2023-28322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28322"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-1180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1180"
},
{
"name": "CVE-2025-38060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38060"
},
{
"name": "CVE-2025-40167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40167"
},
{
"name": "CVE-2025-38159",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38159"
},
{
"name": "CVE-2021-3421",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3421"
},
{
"name": "CVE-2025-38066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38066"
},
{
"name": "CVE-2025-4373",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4373"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2015-4790",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4790"
},
{
"name": "CVE-2026-0994",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0994"
},
{
"name": "CVE-2025-39969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39969"
},
{
"name": "CVE-2025-37744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37744"
},
{
"name": "CVE-2025-4598",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4598"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-40194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40194"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38305"
},
{
"name": "CVE-2025-37884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37884"
},
{
"name": "CVE-2025-38067",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38067"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38699"
},
{
"name": "CVE-2025-37927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37927"
},
{
"name": "CVE-2025-38707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38707"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2025-37897",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37897"
},
{
"name": "CVE-2016-9840",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-9840"
},
{
"name": "CVE-2025-37911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37911"
},
{
"name": "CVE-2025-40245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40245"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2023-6779",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6779"
},
{
"name": "CVE-2025-37869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37869"
},
{
"name": "CVE-2025-39692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39692"
},
{
"name": "CVE-2025-5115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5115"
},
{
"name": "CVE-2023-53107",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53107"
},
{
"name": "CVE-2024-13009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13009"
},
{
"name": "CVE-2022-49043",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49043"
},
{
"name": "CVE-2025-55198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55198"
},
{
"name": "CVE-2021-46195",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46195"
},
{
"name": "CVE-2015-2624",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2624"
},
{
"name": "CVE-2023-29491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29491"
},
{
"name": "CVE-2025-38068",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38068"
},
{
"name": "CVE-2025-38436",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38436"
},
{
"name": "CVE-2025-37930",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37930"
},
{
"name": "CVE-2025-38401",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38401"
},
{
"name": "CVE-2025-38677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38677"
},
{
"name": "CVE-2025-38097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38097"
},
{
"name": "CVE-2021-20266",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20266"
},
{
"name": "CVE-2025-1182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1182"
},
{
"name": "CVE-2025-37810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37810"
},
{
"name": "CVE-2025-38253",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38253"
},
{
"name": "CVE-2025-38123",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38123"
},
{
"name": "CVE-2025-38338",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38338"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38239"
},
{
"name": "CVE-2025-1371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1371"
},
{
"name": "CVE-2025-40001",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40001"
},
{
"name": "CVE-2022-40897",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40897"
},
{
"name": "CVE-2026-1485",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1485"
},
{
"name": "CVE-2025-0938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0938"
},
{
"name": "CVE-2022-27782",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27782"
},
{
"name": "CVE-2008-0888",
"url": "https://www.cve.org/CVERecord?id=CVE-2008-0888"
},
{
"name": "CVE-2019-13232",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-13232"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38027",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38027"
},
{
"name": "CVE-2025-38102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38102"
},
{
"name": "CVE-2024-33600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33600"
},
{
"name": "CVE-2015-2654",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2654"
},
{
"name": "CVE-2022-1210",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1210"
},
{
"name": "CVE-2025-40035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40035"
},
{
"name": "CVE-2025-38283",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38283"
},
{
"name": "CVE-2023-25584",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25584"
},
{
"name": "CVE-2025-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23159"
},
{
"name": "CVE-2025-39988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39988"
},
{
"name": "CVE-2026-2005",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2005"
},
{
"name": "CVE-2025-38455",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38455"
},
{
"name": "CVE-2015-4778",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4778"
},
{
"name": "CVE-2025-1152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1152"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2025-38015",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38015"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-11082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11082"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-38449",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38449"
},
{
"name": "CVE-2025-40233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40233"
},
{
"name": "CVE-2023-32636",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32636"
},
{
"name": "CVE-2025-37853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37853"
},
{
"name": "CVE-2023-6277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6277"
},
{
"name": "CVE-2025-38126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38126"
},
{
"name": "CVE-2025-48060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48060"
},
{
"name": "CVE-2025-38149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38149"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-38399",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38399"
},
{
"name": "CVE-2025-40020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40020"
},
{
"name": "CVE-2025-38065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38065"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-40188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40188"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2023-3618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3618"
},
{
"name": "CVE-2025-38412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38412"
},
{
"name": "CVE-2025-38031",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38031"
},
{
"name": "CVE-2023-4813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4813"
},
{
"name": "CVE-2017-3617",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3617"
},
{
"name": "CVE-2025-14512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14512"
},
{
"name": "CVE-2025-38293",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38293"
},
{
"name": "CVE-2025-58057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58057"
},
{
"name": "CVE-2025-1149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1149"
},
{
"name": "CVE-2025-38648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38648"
},
{
"name": "CVE-2025-38278",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38278"
},
{
"name": "CVE-2025-8291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8291"
},
{
"name": "CVE-2025-37764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37764"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2017-3615",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3615"
},
{
"name": "CVE-2022-44840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-44840"
},
{
"name": "CVE-2023-28320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28320"
},
{
"name": "CVE-2025-37741",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37741"
},
{
"name": "CVE-2026-22795",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22795"
},
{
"name": "CVE-2025-38053",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38053"
},
{
"name": "CVE-2025-27587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27587"
},
{
"name": "CVE-2026-0988",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0988"
},
{
"name": "CVE-2025-8534",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8534"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2025-61727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61727"
},
{
"name": "CVE-2025-37912",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37912"
},
{
"name": "CVE-2025-38482",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38482"
},
{
"name": "CVE-2023-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39810"
},
{
"name": "CVE-2025-37820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37820"
},
{
"name": "CVE-2025-37985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37985"
},
{
"name": "CVE-2025-1390",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1390"
},
{
"name": "CVE-2024-33599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33599"
},
{
"name": "CVE-2024-0743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0743"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-37787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37787"
},
{
"name": "CVE-2026-21925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21925"
},
{
"name": "CVE-2025-38008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38008"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2025-64718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64718"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2025-38034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38034"
},
{
"name": "CVE-2017-3608",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3608"
},
{
"name": "CVE-2025-38135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38135"
},
{
"name": "CVE-2023-28484",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28484"
},
{
"name": "CVE-2025-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38619"
},
{
"name": "CVE-2019-2708",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-2708"
},
{
"name": "CVE-2025-38312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38312"
},
{
"name": "CVE-2025-38095",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38095"
},
{
"name": "CVE-2016-0692",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-0692"
},
{
"name": "CVE-2025-37878",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37878"
},
{
"name": "CVE-2025-39737",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39737"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2021-46174",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46174"
},
{
"name": "CVE-2026-0861",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0861"
},
{
"name": "CVE-2025-40049",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40049"
},
{
"name": "CVE-2023-0802",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0802"
},
{
"name": "CVE-2023-53164",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53164"
},
{
"name": "CVE-2025-47910",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47910"
},
{
"name": "CVE-2021-22924",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22924"
},
{
"name": "CVE-2023-47038",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47038"
},
{
"name": "CVE-2025-38363",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38363"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38319",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38319"
},
{
"name": "CVE-2020-10878",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10878"
},
{
"name": "CVE-2022-0529",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0529"
},
{
"name": "CVE-2015-4782",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4782"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2022-2056",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2056"
},
{
"name": "CVE-2023-26966",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-26966"
},
{
"name": "CVE-2025-40070",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40070"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2025-38457",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38457"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-37813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37813"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38212",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38212"
},
{
"name": "CVE-2025-40106",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40106"
},
{
"name": "CVE-2017-3610",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3610"
},
{
"name": "CVE-2025-38298",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38298"
},
{
"name": "CVE-2022-43552",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43552"
},
{
"name": "CVE-2025-5915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5915"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2022-48065",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48065"
},
{
"name": "CVE-2025-38024",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38024"
},
{
"name": "CVE-2025-38496",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38496"
},
{
"name": "CVE-2022-49063",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49063"
},
{
"name": "CVE-2025-5917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5917"
},
{
"name": "CVE-2025-38078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38078"
},
{
"name": "CVE-2022-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47696"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2024-45490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45490"
},
{
"name": "CVE-2024-51744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-51744"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2021-22947",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22947"
},
{
"name": "CVE-2025-40205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40205"
},
{
"name": "CVE-2015-4788",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4788"
},
{
"name": "CVE-2025-38169",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38169"
},
{
"name": "CVE-2025-37931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37931"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38211"
},
{
"name": "CVE-2025-6965",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6965"
},
{
"name": "CVE-2023-28319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28319"
},
{
"name": "CVE-2025-10966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10966"
},
{
"name": "CVE-2021-22922",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22922"
},
{
"name": "CVE-2025-38057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38057"
},
{
"name": "CVE-2024-45491",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45491"
},
{
"name": "CVE-2025-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50182"
},
{
"name": "CVE-2025-47906",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47906"
},
{
"name": "CVE-2020-2981",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-2981"
},
{
"name": "CVE-2025-37887",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37887"
},
{
"name": "CVE-2025-38077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38077"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2022-22576",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-22576"
},
{
"name": "CVE-2025-37861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37861"
},
{
"name": "CVE-2025-38120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38120"
},
{
"name": "CVE-2025-38285",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38285"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-37938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37938"
},
{
"name": "CVE-2025-38005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38005"
},
{
"name": "CVE-2025-38368",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38368"
},
{
"name": "CVE-2025-59375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59375"
},
{
"name": "CVE-2025-31133",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-31133"
},
{
"name": "CVE-2022-35205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35205"
},
{
"name": "CVE-2025-8194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8194"
},
{
"name": "CVE-2025-38161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38161"
},
{
"name": "CVE-2025-38331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38331"
},
{
"name": "CVE-2025-38354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38354"
},
{
"name": "CVE-2016-3418",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-3418"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2022-29824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29824"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2024-11053",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-11053"
},
{
"name": "CVE-2025-38696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38696"
},
{
"name": "CVE-2024-7264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-7264"
},
{
"name": "CVE-2025-38274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38274"
},
{
"name": "CVE-2025-40027",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40027"
},
{
"name": "CVE-2025-64505",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64505"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2021-4214",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4214"
},
{
"name": "CVE-2025-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-50181"
},
{
"name": "CVE-2015-2656",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2656"
},
{
"name": "CVE-2025-37874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37874"
},
{
"name": "CVE-2025-38115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38115"
},
{
"name": "CVE-2025-66382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66382"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2021-22946",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22946"
},
{
"name": "CVE-2023-0767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0767"
},
{
"name": "CVE-2025-37988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37988"
},
{
"name": "CVE-2025-1795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1795"
},
{
"name": "CVE-2025-23158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23158"
},
{
"name": "CVE-2017-3612",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3612"
},
{
"name": "CVE-2025-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23144"
},
{
"name": "CVE-2025-38153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38153"
},
{
"name": "CVE-2025-37969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37969"
},
{
"name": "CVE-2025-69421",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69421"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-37816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37816"
},
{
"name": "CVE-2025-37742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37742"
},
{
"name": "CVE-2025-4517",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4517"
},
{
"name": "CVE-2025-58188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58188"
},
{
"name": "CVE-2025-37765",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37765"
},
{
"name": "CVE-2016-9843",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-9843"
},
{
"name": "CVE-2025-1178",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1178"
},
{
"name": "CVE-2025-38395",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38395"
},
{
"name": "CVE-2025-37921",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37921"
},
{
"name": "CVE-2023-29499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29499"
},
{
"name": "CVE-2025-38507",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38507"
},
{
"name": "CVE-2025-39989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39989"
},
{
"name": "CVE-2025-38337",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38337"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38258"
},
{
"name": "CVE-2024-1013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1013"
},
{
"name": "CVE-2025-37828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37828"
},
{
"name": "CVE-2025-4674",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4674"
},
{
"name": "CVE-2025-30258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30258"
},
{
"name": "CVE-2025-1176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1176"
},
{
"name": "CVE-2025-37769",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37769"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2024-56406",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56406"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-39970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39970"
},
{
"name": "CVE-2025-38086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38086"
},
{
"name": "CVE-2025-37935",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37935"
},
{
"name": "CVE-2025-38396",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38396"
},
{
"name": "CVE-2025-23161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23161"
},
{
"name": "CVE-2025-38407",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38407"
},
{
"name": "CVE-2025-39994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39994"
},
{
"name": "CVE-2015-4784",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4784"
},
{
"name": "CVE-2025-12119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12119"
},
{
"name": "CVE-2023-4527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4527"
},
{
"name": "CVE-2025-38493",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38493"
},
{
"name": "CVE-2025-37803",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37803"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2024-56433",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56433"
},
{
"name": "CVE-2025-37824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37824"
},
{
"name": "CVE-2023-34410",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-34410"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2023-4156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4156"
},
{
"name": "CVE-2014-8139",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-8139"
},
{
"name": "CVE-2025-47911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47911"
},
{
"name": "CVE-2022-29526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29526"
},
{
"name": "CVE-2025-38003",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38003"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-28162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-28162"
},
{
"name": "CVE-2025-38007",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38007"
},
{
"name": "CVE-2025-37923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37923"
},
{
"name": "CVE-2025-40088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40088"
},
{
"name": "CVE-2025-40220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40220"
},
{
"name": "CVE-2022-2519",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2519"
},
{
"name": "CVE-2025-38142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38142"
},
{
"name": "CVE-2022-23990",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23990"
},
{
"name": "CVE-2022-49920",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49920"
},
{
"name": "CVE-2025-37739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37739"
},
{
"name": "CVE-2022-0530",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0530"
},
{
"name": "CVE-2025-13151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13151"
},
{
"name": "CVE-2025-38478",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38478"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-39788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39788"
},
{
"name": "CVE-2025-22058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22058"
},
{
"name": "CVE-2025-37831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37831"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-4435",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4435"
},
{
"name": "CVE-2025-38269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38269"
},
{
"name": "CVE-2025-38079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38079"
},
{
"name": "CVE-2025-37940",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37940"
},
{
"name": "CVE-2022-28391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28391"
},
{
"name": "CVE-2021-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46828"
},
{
"name": "CVE-2023-2804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2804"
},
{
"name": "CVE-2025-37945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37945"
},
{
"name": "CVE-2025-6141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6141"
},
{
"name": "CVE-2025-40109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40109"
},
{
"name": "CVE-2024-13978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-13978"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2025-40006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40006"
},
{
"name": "CVE-2025-12383",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12383"
},
{
"name": "CVE-2025-38652",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38652"
},
{
"name": "CVE-2025-38110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38110"
},
{
"name": "CVE-2025-38422",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38422"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2021-3520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3520"
},
{
"name": "CVE-2025-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39698"
},
{
"name": "CVE-2025-64506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64506"
},
{
"name": "CVE-2025-37915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37915"
},
{
"name": "CVE-2025-6020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6020"
},
{
"name": "CVE-2015-2626",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2626"
},
{
"name": "CVE-2025-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23146"
},
{
"name": "CVE-2022-48064",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48064"
},
{
"name": "CVE-2025-37903",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37903"
},
{
"name": "CVE-2025-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52881"
},
{
"name": "CVE-2025-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23142"
},
{
"name": "CVE-2020-10029",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10029"
},
{
"name": "CVE-2025-7425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7425"
},
{
"name": "CVE-2022-36227",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36227"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-40011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40011"
},
{
"name": "CVE-2025-21883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21883"
},
{
"name": "CVE-2025-38303",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38303"
},
{
"name": "CVE-2023-29469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29469"
},
{
"name": "CVE-2024-5535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5535"
},
{
"name": "CVE-2025-38074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38074"
},
{
"name": "CVE-2023-52355",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52355"
},
{
"name": "CVE-2025-40085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40085"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38232"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-40231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40231"
},
{
"name": "CVE-2021-36770",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36770"
},
{
"name": "CVE-2025-38324",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38324"
},
{
"name": "CVE-2025-22868",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22868"
},
{
"name": "CVE-2021-36976",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-36976"
},
{
"name": "CVE-2025-38018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38018"
},
{
"name": "CVE-2023-3164",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3164"
},
{
"name": "CVE-2022-3597",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3597"
},
{
"name": "CVE-2023-27535",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27535"
},
{
"name": "CVE-2022-27775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27775"
},
{
"name": "CVE-2024-12718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12718"
},
{
"name": "CVE-2025-37830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37830"
},
{
"name": "CVE-2018-25032",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-25032"
},
{
"name": "CVE-2025-3360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3360"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-37991",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37991"
},
{
"name": "CVE-2026-22796",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22796"
},
{
"name": "CVE-2025-64720",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64720"
},
{
"name": "CVE-2025-38425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38425"
},
{
"name": "CVE-2022-3970",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3970"
},
{
"name": "CVE-2025-9165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9165"
},
{
"name": "CVE-2023-30571",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30571"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2025-61724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61724"
},
{
"name": "CVE-2025-37978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37978"
},
{
"name": "CVE-2025-37781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37781"
},
{
"name": "CVE-2024-5642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-5642"
},
{
"name": "CVE-2024-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3219"
},
{
"name": "CVE-2015-4781",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4781"
},
{
"name": "CVE-2025-38210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38210"
},
{
"name": "CVE-2025-38542",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38542"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-38344",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38344"
},
{
"name": "CVE-2025-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23145"
},
{
"name": "CVE-2025-23143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23143"
},
{
"name": "CVE-2021-3999",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3999"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2025-38322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38322"
},
{
"name": "CVE-2025-38088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38088"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2025-37823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37823"
},
{
"name": "CVE-2022-27774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-27774"
},
{
"name": "CVE-2025-38332",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38332"
},
{
"name": "CVE-2025-38386",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38386"
},
{
"name": "CVE-2025-61732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61732"
},
{
"name": "CVE-2017-3605",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3605"
},
{
"name": "CVE-2025-61723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61723"
},
{
"name": "CVE-2025-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38385"
},
{
"name": "CVE-2022-40303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40303"
},
{
"name": "CVE-2025-11083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11083"
},
{
"name": "CVE-2025-37952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37952"
},
{
"name": "CVE-2023-45803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-45803"
},
{
"name": "CVE-2024-6763",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6763"
},
{
"name": "CVE-2023-0801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0801"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-37793",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37793"
},
{
"name": "CVE-2020-10543",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-10543"
},
{
"name": "CVE-2025-1377",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1377"
},
{
"name": "CVE-2025-37740",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37740"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2022-4645",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4645"
},
{
"name": "CVE-2025-38174",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38174"
},
{
"name": "CVE-2025-8713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8713"
},
{
"name": "CVE-2025-37826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37826"
},
{
"name": "CVE-2025-37986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37986"
},
{
"name": "CVE-2025-37829",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37829"
},
{
"name": "CVE-2025-46394",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-46394"
},
{
"name": "CVE-2025-66471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66471"
},
{
"name": "CVE-2025-38409",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38409"
},
{
"name": "CVE-2025-6170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6170"
},
{
"name": "CVE-2022-3479",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3479"
},
{
"name": "CVE-2021-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35937"
},
{
"name": "CVE-2025-9900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9900"
},
{
"name": "CVE-2025-40183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40183"
},
{
"name": "CVE-2025-38019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38019"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-14017",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14017"
},
{
"name": "CVE-2023-40745",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40745"
},
{
"name": "CVE-2026-21441",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21441"
},
{
"name": "CVE-2024-45337",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45337"
},
{
"name": "CVE-2025-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23151"
},
{
"name": "CVE-2025-38037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38037"
},
{
"name": "CVE-2017-3609",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3609"
},
{
"name": "CVE-2025-39998",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39998"
},
{
"name": "CVE-2014-9636",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-9636"
},
{
"name": "CVE-2025-13836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13836"
},
{
"name": "CVE-2017-3611",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3611"
},
{
"name": "CVE-2022-2521",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2521"
},
{
"name": "CVE-2023-28321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28321"
},
{
"name": "CVE-2025-37796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37796"
},
{
"name": "CVE-2025-37962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37962"
},
{
"name": "CVE-2026-1002",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1002"
},
{
"name": "CVE-2025-40134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40134"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2023-25435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25435"
},
{
"name": "CVE-2025-37799",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37799"
},
{
"name": "CVE-2022-29155",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29155"
},
{
"name": "CVE-2025-61725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61725"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2026-25210",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25210"
},
{
"name": "CVE-2022-2309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2309"
},
{
"name": "CVE-2025-39968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39968"
},
{
"name": "CVE-2023-33285",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-33285"
},
{
"name": "CVE-2024-52533",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-52533"
},
{
"name": "CVE-2025-38342",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38342"
},
{
"name": "CVE-2025-65018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-65018"
},
{
"name": "CVE-2025-39795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39795"
},
{
"name": "CVE-2015-4777",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4777"
},
{
"name": "CVE-2025-37801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37801"
},
{
"name": "CVE-2025-7039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7039"
},
{
"name": "CVE-2025-38167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38167"
},
{
"name": "CVE-2025-37883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37883"
},
{
"name": "CVE-2025-37863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37863"
},
{
"name": "CVE-2023-0687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0687"
},
{
"name": "CVE-2025-37901",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37901"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2022-32221",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32221"
},
{
"name": "CVE-2025-37811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37811"
},
{
"name": "CVE-2022-37434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-37434"
},
{
"name": "CVE-2025-38257",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38257"
},
{
"name": "CVE-2022-29458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-29458"
},
{
"name": "CVE-2023-5156",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5156"
},
{
"name": "CVE-2025-22104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22104"
},
{
"name": "CVE-2025-37864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37864"
},
{
"name": "CVE-2021-32256",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-32256"
},
{
"name": "CVE-2025-38307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38307"
},
{
"name": "CVE-2025-11081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11081"
},
{
"name": "CVE-2025-55163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55163"
},
{
"name": "CVE-2025-37916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37916"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-39986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39986"
},
{
"name": "CVE-2026-22184",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22184"
},
{
"name": "CVE-2025-37767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37767"
},
{
"name": "CVE-2025-5918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5918"
},
{
"name": "CVE-2025-39955",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39955"
},
{
"name": "CVE-2025-66293",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66293"
},
{
"name": "CVE-2017-3614",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3614"
},
{
"name": "CVE-2025-37989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37989"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-38326",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38326"
},
{
"name": "CVE-2025-38055",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38055"
},
{
"name": "CVE-2025-12818",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12818"
},
{
"name": "CVE-2025-38129",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38129"
},
{
"name": "CVE-2025-32990",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32990"
},
{
"name": "CVE-2025-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38384"
},
{
"name": "CVE-2025-38334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38334"
},
{
"name": "CVE-2025-38728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38728"
},
{
"name": "CVE-2025-38424",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38424"
},
{
"name": "CVE-2025-38430",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38430"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2021-22897",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22897"
},
{
"name": "CVE-2025-39734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39734"
},
{
"name": "CVE-2025-38089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38089"
},
{
"name": "CVE-2025-40078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40078"
},
{
"name": "CVE-2025-38382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38382"
},
{
"name": "CVE-2025-15366",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15366"
},
{
"name": "CVE-2023-2603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2603"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-4802",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4802"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-40116",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40116"
},
{
"name": "CVE-2025-68249",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68249"
},
{
"name": "CVE-2026-0990",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0990"
},
{
"name": "CVE-2025-38124",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38124"
},
{
"name": "CVE-2025-39934",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39934"
},
{
"name": "CVE-2025-37925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37925"
},
{
"name": "CVE-2026-0865",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0865"
},
{
"name": "CVE-2024-9143",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-9143"
},
{
"name": "CVE-2023-0799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0799"
},
{
"name": "CVE-2020-12723",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12723"
},
{
"name": "CVE-2025-39683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39683"
},
{
"name": "CVE-2025-38420",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38420"
},
{
"name": "CVE-2025-38071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38071"
},
{
"name": "CVE-2021-3521",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3521"
},
{
"name": "CVE-2025-40179",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40179"
},
{
"name": "CVE-2025-37972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37972"
},
{
"name": "CVE-2025-38183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38183"
},
{
"name": "CVE-2025-40127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40127"
},
{
"name": "CVE-2025-37768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37768"
},
{
"name": "CVE-2025-39794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39794"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2024-33601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33601"
},
{
"name": "CVE-2025-32989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32989"
},
{
"name": "CVE-2022-48063",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48063"
},
{
"name": "CVE-2024-53589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53589"
},
{
"name": "CVE-2025-37984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37984"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-39996",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39996"
},
{
"name": "CVE-2025-37856",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37856"
},
{
"name": "CVE-2025-38107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38107"
},
{
"name": "CVE-2025-22874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22874"
},
{
"name": "CVE-2023-32181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32181"
},
{
"name": "CVE-2025-38292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38292"
},
{
"name": "CVE-2025-40053",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40053"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2026-24515",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-24515"
},
{
"name": "CVE-2025-38222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38222"
},
{
"name": "CVE-2025-38010",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38010"
},
{
"name": "CVE-2025-38197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38197"
},
{
"name": "CVE-2025-39951",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39951"
},
{
"name": "CVE-2025-38468",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38468"
},
{
"name": "CVE-2022-1271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1271"
},
{
"name": "CVE-2025-40120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40120"
},
{
"name": "CVE-2024-28085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28085"
},
{
"name": "CVE-2025-11495",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11495"
},
{
"name": "CVE-2025-38688",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38688"
},
{
"name": "CVE-2025-38333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38333"
},
{
"name": "CVE-2019-9076",
"url": "https://www.cve.org/CVERecord?id=CVE-2019-9076"
},
{
"name": "CVE-2025-37970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37970"
},
{
"name": "CVE-2025-55199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55199"
},
{
"name": "CVE-2025-21884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21884"
},
{
"name": "CVE-2025-37905",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37905"
},
{
"name": "CVE-2025-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38390"
},
{
"name": "CVE-2025-38013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38013"
},
{
"name": "CVE-2021-20205",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20205"
},
{
"name": "CVE-2025-38059",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38059"
},
{
"name": "CVE-2025-5025",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5025"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-37956",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37956"
},
{
"name": "CVE-2025-40243",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40243"
},
{
"name": "CVE-2025-38148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38148"
},
{
"name": "CVE-2025-38467",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38467"
},
{
"name": "CVE-2024-34459",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34459"
},
{
"name": "CVE-2025-38117",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38117"
},
{
"name": "CVE-2025-38094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38094"
},
{
"name": "CVE-2025-49795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49795"
},
{
"name": "CVE-2025-14104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14104"
},
{
"name": "CVE-2014-9913",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-9913"
},
{
"name": "CVE-2025-38072",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38072"
},
{
"name": "CVE-2024-37407",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37407"
},
{
"name": "CVE-2015-4775",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4775"
},
{
"name": "CVE-2025-37967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37967"
},
{
"name": "CVE-2025-38300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38300"
},
{
"name": "CVE-2016-0694",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-0694"
},
{
"name": "CVE-2025-38289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38289"
},
{
"name": "CVE-2023-6228",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6228"
},
{
"name": "CVE-2021-46848",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46848"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-1376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1376"
},
{
"name": "CVE-2025-47912",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47912"
},
{
"name": "CVE-2025-37949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37949"
},
{
"name": "CVE-2001-1269",
"url": "https://www.cve.org/CVERecord?id=CVE-2001-1269"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38373",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38373"
},
{
"name": "CVE-2025-11414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11414"
},
{
"name": "CVE-2025-38489",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38489"
},
{
"name": "CVE-2025-66861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66861"
},
{
"name": "CVE-2025-37957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37957"
},
{
"name": "CVE-2024-22365",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22365"
},
{
"name": "CVE-2025-38058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38058"
},
{
"name": "CVE-2025-38483",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38483"
},
{
"name": "CVE-2025-38369",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38369"
},
{
"name": "CVE-2024-47535",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47535"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38122",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38122"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2023-0795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0795"
},
{
"name": "CVE-2025-68160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68160"
},
{
"name": "CVE-2015-2583",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2583"
},
{
"name": "CVE-2025-38173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38173"
},
{
"name": "CVE-2021-29390",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-29390"
},
{
"name": "CVE-2024-2236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2236"
},
{
"name": "CVE-2025-38143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38143"
},
{
"name": "CVE-2025-45768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-45768"
},
{
"name": "CVE-2025-38098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38098"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-1365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1365"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2024-25062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25062"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-40118",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40118"
},
{
"name": "CVE-2022-32205",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32205"
},
{
"name": "CVE-2025-38718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38718"
},
{
"name": "CVE-2023-27534",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27534"
},
{
"name": "CVE-2024-2398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2398"
},
{
"name": "CVE-2025-38392",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38392"
},
{
"name": "CVE-2025-60753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-60753"
},
{
"name": "CVE-2025-39673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39673"
},
{
"name": "CVE-2023-27536",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27536"
},
{
"name": "CVE-2025-52565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-52565"
},
{
"name": "CVE-2025-38259",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38259"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2015-4783",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4783"
},
{
"name": "CVE-2025-40021",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40021"
},
{
"name": "CVE-2025-67735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-67735"
},
{
"name": "CVE-2025-38156",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38156"
},
{
"name": "CVE-2015-4774",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4774"
},
{
"name": "CVE-2025-37951",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37951"
},
{
"name": "CVE-2023-50495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-50495"
},
{
"name": "CVE-2025-37840",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37840"
},
{
"name": "CVE-2017-11164",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-11164"
},
{
"name": "CVE-2025-37947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37947"
},
{
"name": "CVE-2025-61728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61728"
},
{
"name": "CVE-2022-43551",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43551"
},
{
"name": "CVE-2025-68972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68972"
},
{
"name": "CVE-2025-26519",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-26519"
},
{
"name": "CVE-2025-38416",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38416"
},
{
"name": "CVE-2025-58186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58186"
},
{
"name": "CVE-2025-37846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37846"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-40044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40044"
},
{
"name": "CVE-2025-13034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13034"
},
{
"name": "CVE-2021-20284",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20284"
},
{
"name": "CVE-2025-8714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8714"
},
{
"name": "CVE-2025-38343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38343"
},
{
"name": "CVE-2023-27533",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27533"
},
{
"name": "CVE-2025-40105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40105"
},
{
"name": "CVE-2025-38202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38202"
},
{
"name": "CVE-2017-7500",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7500"
},
{
"name": "CVE-2025-9086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9086"
},
{
"name": "CVE-2025-40112",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40112"
},
{
"name": "CVE-2025-22101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22101"
},
{
"name": "CVE-2021-32292",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-32292"
},
{
"name": "CVE-2025-38374",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38374"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-38194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38194"
},
{
"name": "CVE-2025-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38549"
},
{
"name": "CVE-2024-10041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-10041"
},
{
"name": "CVE-2023-1972",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1972"
},
{
"name": "CVE-2025-8869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8869"
},
{
"name": "CVE-2025-58187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58187"
},
{
"name": "CVE-2022-34903",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34903"
},
{
"name": "CVE-2022-2953",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2953"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2024-20696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-20696"
},
{
"name": "CVE-2025-38101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38101"
},
{
"name": "CVE-2023-32573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32573"
},
{
"name": "CVE-2025-37982",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37982"
},
{
"name": "CVE-2025-37992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37992"
},
{
"name": "CVE-2025-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38577"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2020-19726",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-19726"
},
{
"name": "CVE-2022-3219",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3219"
},
{
"name": "CVE-2025-39971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39971"
},
{
"name": "CVE-2025-38299",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38299"
},
{
"name": "CVE-2025-40154",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40154"
},
{
"name": "CVE-2025-13601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-13601"
},
{
"name": "CVE-2025-12817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12817"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-4673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4673"
},
{
"name": "CVE-2022-47010",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47010"
},
{
"name": "CVE-2025-38704",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38704"
},
{
"name": "CVE-2025-38348",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38348"
},
{
"name": "CVE-2020-22916",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-22916"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-5916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5916"
},
{
"name": "CVE-2025-38040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38040"
},
{
"name": "CVE-2025-38265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38265"
},
{
"name": "CVE-2025-23149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23149"
},
{
"name": "CVE-2022-33070",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-33070"
},
{
"name": "CVE-2025-38403",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38403"
},
{
"name": "CVE-2022-23308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23308"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-58056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58056"
},
{
"name": "CVE-2025-37914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37914"
},
{
"name": "CVE-2025-22871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22871"
},
{
"name": "CVE-2025-10911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-10911"
},
{
"name": "CVE-2025-32988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32988"
},
{
"name": "CVE-2022-28805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28805"
},
{
"name": "CVE-2025-37873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37873"
},
{
"name": "CVE-2024-57360",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57360"
},
{
"name": "CVE-2025-37928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37928"
},
{
"name": "CVE-2017-3604",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3604"
},
{
"name": "CVE-2023-0804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0804"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-37922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37922"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2024-38828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38828"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2023-27538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-27538"
},
{
"name": "CVE-2025-39687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39687"
},
{
"name": "CVE-2025-37794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37794"
},
{
"name": "CVE-2023-4641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4641"
},
{
"name": "CVE-2025-14524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14524"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-27113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-27113"
},
{
"name": "CVE-2025-38246",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38246"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-38220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38220"
},
{
"name": "CVE-2025-38405",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38405"
},
{
"name": "CVE-2026-0915",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0915"
},
{
"name": "CVE-2025-15281",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15281"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-38090",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38090"
},
{
"name": "CVE-2022-23218",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23218"
},
{
"name": "CVE-2025-38429",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38429"
},
{
"name": "CVE-2022-25236",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-25236"
},
{
"name": "CVE-2023-30775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-30775"
},
{
"name": "CVE-2025-38225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38225"
},
{
"name": "CVE-2025-47913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47913"
},
{
"name": "CVE-2025-38155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38155"
},
{
"name": "CVE-2023-0797",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0797"
},
{
"name": "CVE-2025-37977",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37977"
},
{
"name": "CVE-2023-37369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37369"
},
{
"name": "CVE-2024-48615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-48615"
},
{
"name": "CVE-2025-38365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38365"
},
{
"name": "CVE-2025-38415",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38415"
},
{
"name": "CVE-2024-55549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-55549"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-37973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37973"
},
{
"name": "CVE-2025-68750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68750"
},
{
"name": "CVE-2025-38260",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38260"
},
{
"name": "CVE-2024-6119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6119"
},
{
"name": "CVE-2025-37827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37827"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38244"
},
{
"name": "CVE-2023-1916",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1916"
},
{
"name": "CVE-2025-38080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38080"
},
{
"name": "CVE-2025-40126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40126"
},
{
"name": "CVE-2025-39972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39972"
},
{
"name": "CVE-2025-37748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37748"
},
{
"name": "CVE-2025-38364",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38364"
},
{
"name": "CVE-2025-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38615"
},
{
"name": "CVE-2025-58181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58181"
},
{
"name": "CVE-2025-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40909"
},
{
"name": "CVE-2023-25588",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25588"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-37836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37836"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2017-3607",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3607"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2022-2520",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2520"
},
{
"name": "CVE-2025-8959",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8959"
},
{
"name": "CVE-2025-37944",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37944"
},
{
"name": "CVE-2025-47914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47914"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38494",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38494"
},
{
"name": "CVE-2025-39753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39753"
},
{
"name": "CVE-2025-69418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69418"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38193"
},
{
"name": "CVE-2025-38400",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38400"
},
{
"name": "CVE-2025-4516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4516"
},
{
"name": "CVE-2025-38136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38136"
},
{
"name": "CVE-2025-66864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66864"
},
{
"name": "CVE-2025-58058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58058"
},
{
"name": "CVE-2025-22869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22869"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-37771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37771"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-40200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40200"
},
{
"name": "CVE-2025-38236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38236"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-37975",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37975"
},
{
"name": "CVE-2023-41175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-41175"
},
{
"name": "CVE-2025-40124",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40124"
},
{
"name": "CVE-2025-38347",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38347"
},
{
"name": "CVE-2025-39776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39776"
},
{
"name": "CVE-2025-1150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1150"
},
{
"name": "CVE-2025-39880",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39880"
},
{
"name": "CVE-2025-37998",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37998"
},
{
"name": "CVE-2025-38198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38198"
},
{
"name": "CVE-2025-58189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-58189"
},
{
"name": "CVE-2025-6021",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6021"
},
{
"name": "CVE-2025-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23163"
},
{
"name": "CVE-2025-40094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40094"
},
{
"name": "CVE-2025-37968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37968"
},
{
"name": "CVE-2025-38376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38376"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2022-26280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26280"
},
{
"name": "CVE-2025-0665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0665"
},
{
"name": "CVE-2025-38437",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38437"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2024-4603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4603"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38048",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38048"
},
{
"name": "CVE-2025-25193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-25193"
},
{
"name": "CVE-2024-8096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8096"
},
{
"name": "CVE-2012-0880",
"url": "https://www.cve.org/CVERecord?id=CVE-2012-0880"
},
{
"name": "CVE-2023-3576",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3576"
},
{
"name": "CVE-2023-4806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4806"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2026-21945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21945"
},
{
"name": "CVE-2023-47039",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47039"
},
{
"name": "CVE-2025-39736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39736"
},
{
"name": "CVE-2025-37757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37757"
},
{
"name": "CVE-2018-9996",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-9996"
},
{
"name": "CVE-2023-31484",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31484"
},
{
"name": "CVE-2025-8225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8225"
},
{
"name": "CVE-2023-29383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-29383"
},
{
"name": "CVE-2022-32206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-32206"
},
{
"name": "CVE-2025-8224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8224"
},
{
"name": "CVE-2024-50602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50602"
},
{
"name": "CVE-2015-7697",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-7697"
},
{
"name": "CVE-2025-38009",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38009"
},
{
"name": "CVE-2025-22870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22870"
},
{
"name": "CVE-2025-40215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40215"
},
{
"name": "CVE-2025-40111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40111"
},
{
"name": "CVE-2025-38081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38081"
},
{
"name": "CVE-2025-37809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37809"
},
{
"name": "CVE-2025-40068",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40068"
},
{
"name": "CVE-2025-5245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5245"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-38406",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38406"
},
{
"name": "CVE-2021-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35942"
},
{
"name": "CVE-2025-40042",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40042"
},
{
"name": "CVE-2025-32415",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32415"
},
{
"name": "CVE-2025-24855",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24855"
},
{
"name": "CVE-2025-37817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37817"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-5889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5889"
},
{
"name": "CVE-2025-22102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22102"
},
{
"name": "CVE-2025-37987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37987"
},
{
"name": "CVE-2024-23337",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23337"
},
{
"name": "CVE-2016-0689",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-0689"
},
{
"name": "CVE-2025-37749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37749"
},
{
"name": "CVE-2026-22695",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22695"
},
{
"name": "CVE-2026-23490",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-23490"
},
{
"name": "CVE-2025-11966",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11966"
},
{
"name": "CVE-2024-36331",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36331"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2014-8140",
"url": "https://www.cve.org/CVERecord?id=CVE-2014-8140"
},
{
"name": "CVE-2026-0992",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0992"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2022-47011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47011"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-37772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37772"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2025-38214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38214"
},
{
"name": "CVE-2025-12194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-12194"
},
{
"name": "CVE-2021-3549",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3549"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-37994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37994"
},
{
"name": "CVE-2025-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38551"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38218",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38218"
},
{
"name": "CVE-2025-66564",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66564"
},
{
"name": "CVE-2025-38349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38349"
},
{
"name": "CVE-2025-5244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5244"
},
{
"name": "CVE-2021-37972",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-37972"
},
{
"name": "CVE-2025-1352",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1352"
},
{
"name": "CVE-2024-4741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4741"
},
{
"name": "CVE-2021-33574",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-33574"
},
{
"name": "CVE-2018-1000035",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-1000035"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2023-4863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4863"
},
{
"name": "CVE-2025-48924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48924"
},
{
"name": "CVE-2025-38393",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38393"
},
{
"name": "CVE-2024-26256",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26256"
},
{
"name": "CVE-2021-3326",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-3326"
},
{
"name": "CVE-2021-22926",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22926"
},
{
"name": "CVE-2025-32414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-32414"
},
{
"name": "CVE-2025-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37891"
},
{
"name": "CVE-2025-38249",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38249"
},
{
"name": "CVE-2025-38716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38716"
},
{
"name": "CVE-2025-39937",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39937"
},
{
"name": "CVE-2025-37858",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37858"
},
{
"name": "CVE-2023-40403",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-40403"
},
{
"name": "CVE-2025-22013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22013"
},
{
"name": "CVE-2025-38154",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38154"
},
{
"name": "CVE-2025-38469",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38469"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2021-30560",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-30560"
},
{
"name": "CVE-2025-1153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1153"
},
{
"name": "CVE-2025-62408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-62408"
},
{
"name": "CVE-2025-40060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40060"
},
{
"name": "CVE-2026-2003",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2003"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-38389",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38389"
},
{
"name": "CVE-2025-38448",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38448"
},
{
"name": "CVE-2022-48281",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48281"
},
{
"name": "CVE-2021-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-35938"
},
{
"name": "CVE-2025-15079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15079"
},
{
"name": "CVE-2025-37780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37780"
},
{
"name": "CVE-2025-37995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37995"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-37754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37754"
},
{
"name": "CVE-2025-1632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1632"
},
{
"name": "CVE-2025-11412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11412"
},
{
"name": "CVE-2025-38497",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38497"
},
{
"name": "CVE-2025-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23156"
},
{
"name": "CVE-2025-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23157"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38165"
},
{
"name": "CVE-2022-28321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28321"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-38495",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38495"
},
{
"name": "CVE-2025-37808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37808"
},
{
"name": "CVE-2017-3606",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-3606"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38052"
},
{
"name": "CVE-2025-38377",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38377"
},
{
"name": "CVE-2024-3651",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-3651"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2022-40090",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40090"
},
{
"name": "CVE-2025-68121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68121"
},
{
"name": "CVE-2023-25434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25434"
},
{
"name": "CVE-2024-12243",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12243"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38462",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38462"
},
{
"name": "CVE-2025-38428",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38428"
},
{
"name": "CVE-2018-13410",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-13410"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-38262",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38262"
},
{
"name": "CVE-2025-60876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-60876"
},
{
"name": "CVE-2025-38138",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38138"
},
{
"name": "CVE-2025-38035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38035"
},
{
"name": "CVE-2025-14819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14819"
},
{
"name": "CVE-2025-37759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37759"
},
{
"name": "CVE-2025-24928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-24928"
},
{
"name": "CVE-2025-38414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38414"
},
{
"name": "CVE-2022-35206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-35206"
},
{
"name": "CVE-2025-0395",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0395"
},
{
"name": "CVE-2025-11065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11065"
},
{
"name": "CVE-2025-37933",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37933"
},
{
"name": "CVE-2025-38310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38310"
},
{
"name": "CVE-2015-4786",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-4786"
},
{
"name": "CVE-2025-37886",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37886"
},
{
"name": "CVE-2022-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-38533"
},
{
"name": "CVE-2025-37963",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37963"
},
{
"name": "CVE-2025-40297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40297"
},
{
"name": "CVE-2026-1484",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1484"
},
{
"name": "CVE-2022-40304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-40304"
},
{
"name": "CVE-2025-38226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38226"
},
{
"name": "CVE-2025-4947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-4947"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-40178",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40178"
},
{
"name": "CVE-2023-4911",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4911"
},
{
"name": "CVE-2025-38443",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38443"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-0725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0725"
},
{
"name": "CVE-2025-37800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37800"
},
{
"name": "CVE-2025-39985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39985"
},
{
"name": "CVE-2025-61726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61726"
},
{
"name": "CVE-2023-36660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-36660"
},
{
"name": "CVE-2025-37900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37900"
},
{
"name": "CVE-2025-7424",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7424"
},
{
"name": "CVE-2025-1094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1094"
},
{
"name": "CVE-2023-25585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-25585"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-37805",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37805"
},
{
"name": "CVE-2021-22923",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22923"
},
{
"name": "CVE-2025-41254",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-41254"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-37990",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37990"
},
{
"name": "CVE-2020-12762",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-12762"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-3198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-3198"
},
{
"name": "CVE-2025-38180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38180"
},
{
"name": "CVE-2025-53864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53864"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2026-2007",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2007"
},
{
"name": "CVE-2025-38145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38145"
},
{
"name": "CVE-2023-2953",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2953"
},
{
"name": "CVE-2024-4032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-4032"
},
{
"name": "CVE-2025-37948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37948"
},
{
"name": "CVE-2021-27645",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-27645"
},
{
"name": "CVE-2025-38166",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38166"
},
{
"name": "CVE-2025-37862",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37862"
},
{
"name": "CVE-2025-38321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38321"
},
{
"name": "CVE-2024-28835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28835"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-37960",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37960"
},
{
"name": "CVE-2025-38045",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38045"
},
{
"name": "CVE-2025-38051",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38051"
},
{
"name": "CVE-2025-59419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-59419"
},
{
"name": "CVE-2025-49796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-49796"
},
{
"name": "CVE-2022-34526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-34526"
},
{
"name": "CVE-2025-8058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8058"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-37763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37763"
},
{
"name": "CVE-2025-11839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11839"
},
{
"name": "CVE-2025-37954",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37954"
},
{
"name": "CVE-2024-8244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8244"
},
{
"name": "CVE-2025-22128",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22128"
},
{
"name": "CVE-2026-1489",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-1489"
},
{
"name": "CVE-2025-37839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37839"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-38277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38277"
},
{
"name": "CVE-2025-37913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37913"
},
{
"name": "CVE-2025-39756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39756"
},
{
"name": "CVE-2025-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38539"
},
{
"name": "CVE-2026-2004",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2004"
},
{
"name": "CVE-2026-0672",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0672"
},
{
"name": "CVE-2025-8732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8732"
},
{
"name": "CVE-2025-38044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38044"
},
{
"name": "CVE-2022-1586",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1586"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2026-0900",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0900"
},
{
"name": "CVE-2020-16599",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-16599"
},
{
"name": "CVE-2021-46822",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-46822"
},
{
"name": "CVE-2022-45703",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45703"
},
{
"name": "CVE-2025-38200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38200"
},
{
"name": "CVE-2025-38480",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38480"
},
{
"name": "CVE-2025-38346",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38346"
},
{
"name": "CVE-2025-30204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-30204"
},
{
"name": "CVE-2025-37959",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37959"
},
{
"name": "CVE-2025-38191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38191"
},
{
"name": "CVE-2025-39946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39946"
},
{
"name": "CVE-2025-38062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38062"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-5914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-5914"
},
{
"name": "CVE-2023-39804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39804"
},
{
"name": "CVE-2025-21919",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21919"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38131"
},
{
"name": "CVE-2023-2908",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2908"
},
{
"name": "CVE-2023-39615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39615"
},
{
"name": "CVE-2017-7501",
"url": "https://www.cve.org/CVERecord?id=CVE-2017-7501"
},
{
"name": "CVE-2022-47673",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-47673"
},
{
"name": "CVE-2023-31486",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31486"
},
{
"name": "CVE-2025-39980",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39980"
},
{
"name": "CVE-2021-20197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-20197"
},
{
"name": "CVE-2023-24056",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24056"
},
{
"name": "CVE-2026-0902",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0902"
},
{
"name": "CVE-2013-0340",
"url": "https://www.cve.org/CVERecord?id=CVE-2013-0340"
},
{
"name": "CVE-2025-37851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37851"
},
{
"name": "CVE-2025-38481",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38481"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2023-32611",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32611"
},
{
"name": "CVE-2024-38816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38816"
},
{
"name": "CVE-2026-22717",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22717"
},
{
"name": "CVE-2024-34397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34397"
},
{
"name": "CVE-2025-38320",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38320"
},
{
"name": "CVE-2025-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53057"
},
{
"name": "CVE-2025-1151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1151"
},
{
"name": "CVE-2025-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38625"
},
{
"name": "CVE-2025-38164",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38164"
},
{
"name": "CVE-2025-8177",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8177"
},
{
"name": "CVE-2025-29480",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-29480"
},
{
"name": "CVE-2025-40346",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40346"
},
{
"name": "CVE-2025-38264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38264"
},
{
"name": "CVE-2023-1999",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1999"
},
{
"name": "CVE-2020-27618",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-27618"
},
{
"name": "CVE-2025-39676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39676"
},
{
"name": "CVE-2025-37980",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37980"
},
{
"name": "CVE-2023-0800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0800"
},
{
"name": "CVE-2025-7546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7546"
},
{
"name": "CVE-2025-38280",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38280"
},
{
"name": "CVE-2023-5388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5388"
},
{
"name": "CVE-2025-1148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-1148"
},
{
"name": "CVE-2025-37788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37788"
},
{
"name": "CVE-2025-38427",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38427"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2022-23219",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-23219"
},
{
"name": "CVE-2015-2640",
"url": "https://www.cve.org/CVERecord?id=CVE-2015-2640"
},
{
"name": "CVE-2025-37879",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37879"
},
{
"name": "CVE-2025-38217",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38217"
},
{
"name": "CVE-2023-5752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5752"
},
{
"name": "CVE-2025-40030",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40030"
},
{
"name": "CVE-2025-40244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40244"
},
{
"name": "CVE-2025-66862",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66862"
},
{
"name": "CVE-2025-37881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37881"
},
{
"name": "CVE-2025-39995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39995"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39715"
},
{
"name": "CVE-2025-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38569"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2023-1579",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1579"
},
{
"name": "CVE-2025-68119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68119"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2021-4217",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4217"
},
{
"name": "CVE-2023-32643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32643"
},
{
"name": "CVE-2025-37909",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37909"
},
{
"name": "CVE-2025-38700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38700"
},
{
"name": "CVE-2021-43396",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43396"
},
{
"name": "CVE-2025-37849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37849"
},
{
"name": "CVE-2025-38162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38162"
},
{
"name": "CVE-2025-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53066"
},
{
"name": "CVE-2025-22873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22873"
},
{
"name": "CVE-2025-38532",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38532"
},
{
"name": "CVE-2024-2961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-2961"
},
{
"name": "CVE-2025-39712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39712"
},
{
"name": "CVE-2024-12133",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-12133"
},
{
"name": "CVE-2025-37812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37812"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2021-22945",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-22945"
},
{
"name": "CVE-2025-37875",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37875"
},
{
"name": "CVE-2025-38410",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38410"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2023-42366",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42366"
},
{
"name": "CVE-2025-39781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39781"
},
{
"name": "CVE-2025-0167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-0167"
},
{
"name": "CVE-2026-25547",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25547"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2023-38197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38197"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2025-69420",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-69420"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-64702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-64702"
},
{
"name": "CVE-2025-47273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47273"
},
{
"name": "CVE-2025-40140",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40140"
},
{
"name": "CVE-2025-38020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38020"
},
{
"name": "CVE-2025-15224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-15224"
},
{
"name": "CVE-2025-40223",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40223"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23140"
},
{
"name": "CVE-2025-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23150"
},
{
"name": "CVE-2025-38460",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38460"
},
{
"name": "CVE-2025-38182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38182"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2024-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53114"
},
{
"name": "CVE-2025-38275",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38275"
},
{
"name": "CVE-2022-48303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48303"
},
{
"name": "CVE-2025-38345",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38345"
},
{
"name": "CVE-2024-37371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37371"
},
{
"name": "CVE-2023-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38545"
},
{
"name": "CVE-2021-43618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43618"
},
{
"name": "CVE-2026-0989",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-0989"
},
{
"name": "CVE-2025-38170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38170"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-22115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22115"
},
{
"name": "CVE-2025-22120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22120"
},
{
"name": "CVE-2025-61729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61729"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-38231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38231"
},
{
"name": "CVE-2022-26488",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-26488"
},
{
"name": "CVE-2025-37854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37854"
},
{
"name": "CVE-2025-11494",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-11494"
},
{
"name": "CVE-2024-6345",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-6345"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2018-18384",
"url": "https://www.cve.org/CVERecord?id=CVE-2018-18384"
},
{
"name": "CVE-2025-38473",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38473"
},
{
"name": "CVE-2025-38113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38113"
},
{
"name": "CVE-2020-11023",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-11023"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2023-32665",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-32665"
},
{
"name": "CVE-2025-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23148"
},
{
"name": "CVE-2025-38361",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38361"
},
{
"name": "CVE-2025-38470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38470"
},
{
"name": "CVE-2023-23916",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-23916"
},
{
"name": "CVE-2025-38181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38181"
},
{
"name": "CVE-2025-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38391"
},
{
"name": "CVE-2025-38248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38248"
},
{
"name": "CVE-2025-66418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-66418"
},
{
"name": "CVE-2025-40351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40351"
},
{
"name": "CVE-2022-3570",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3570"
},
{
"name": "CVE-2016-9844",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-9844"
},
{
"name": "CVE-2025-40087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40087"
},
{
"name": "CVE-2025-23147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23147"
},
{
"name": "CVE-2024-8088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8088"
},
{
"name": "CVE-2025-48734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48734"
},
{
"name": "CVE-2025-39752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39752"
},
{
"name": "CVE-2026-25646",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25646"
}
],
"initial_release_date": "2026-02-26T00:00:00",
"last_revision_date": "2026-02-26T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0218",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-02-26T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits VMware. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer un d\u00e9ni de service \u00e0 distance, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits VMware",
"vendor_advisories": [
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37096",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37096"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37092",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37092"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37102",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37102"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37078",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37078"
},
{
"published_at": "2026-02-26",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37109",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37109"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37087",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37087"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37090",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37090"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37077",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37077"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37098",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37098"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37079",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37079"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37101",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37101"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37104",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37104"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37080",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37080"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37097",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37097"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37083",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37083"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37086",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37086"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37082",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37082"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37100",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37100"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37099",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37099"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37081",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37081"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37089",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37089"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37076",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37076"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37088",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37088"
},
{
"published_at": "2026-02-26",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 36986",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/36986"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware DSA-2025-27",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37103"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37084",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37084"
},
{
"published_at": "2026-02-26",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37110",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37110"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37093",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37093"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37085",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37085"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37095",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37095"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 VMware 37094",
"url": "https://support.broadcom.com/web/ecx/support-content-notification/-/external/content/SecurityAdvisories/0/37094"
}
]
}
CERTFR-2026-AVI-0227
Vulnerability from certfr_avis - Published: 2026-02-27 - Updated: 2026-02-27
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, une atteinte à l'intégrité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 25.10",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2025-40296",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40296"
},
{
"name": "CVE-2025-40225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40225"
},
{
"name": "CVE-2025-40166",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40166"
},
{
"name": "CVE-2025-40273",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40273"
},
{
"name": "CVE-2025-40064",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40064"
},
{
"name": "CVE-2025-38490",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38490"
},
{
"name": "CVE-2025-37850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37850"
},
{
"name": "CVE-2025-38485",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38485"
},
{
"name": "CVE-2025-22026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22026"
},
{
"name": "CVE-2025-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38579"
},
{
"name": "CVE-2025-68196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68196"
},
{
"name": "CVE-2025-37761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37761"
},
{
"name": "CVE-2025-37865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37865"
},
{
"name": "CVE-2025-38328",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38328"
},
{
"name": "CVE-2025-40156",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40156"
},
{
"name": "CVE-2025-38711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38711"
},
{
"name": "CVE-2025-38487",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38487"
},
{
"name": "CVE-2025-40137",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40137"
},
{
"name": "CVE-2025-37775",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37775"
},
{
"name": "CVE-2025-38335",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38335"
},
{
"name": "CVE-2025-38304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38304"
},
{
"name": "CVE-2025-37892",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37892"
},
{
"name": "CVE-2025-38100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38100"
},
{
"name": "CVE-2025-37859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37859"
},
{
"name": "CVE-2025-40002",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40002"
},
{
"name": "CVE-2025-40057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40057"
},
{
"name": "CVE-2025-38043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38043"
},
{
"name": "CVE-2025-38471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38471"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-37792",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37792"
},
{
"name": "CVE-2025-68240",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68240"
},
{
"name": "CVE-2025-38108",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38108"
},
{
"name": "CVE-2025-38230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38230"
},
{
"name": "CVE-2025-38229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38229"
},
{
"name": "CVE-2025-40055",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40055"
},
{
"name": "CVE-2025-38158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38158"
},
{
"name": "CVE-2025-37872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37872"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2025-40314",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40314"
},
{
"name": "CVE-2025-40029",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40029"
},
{
"name": "CVE-2025-40037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40037"
},
{
"name": "CVE-2025-38279",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38279"
},
{
"name": "CVE-2025-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38561"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2025-40306",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40306"
},
{
"name": "CVE-2025-68210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68210"
},
{
"name": "CVE-2025-40239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40239"
},
{
"name": "CVE-2025-40147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40147"
},
{
"name": "CVE-2025-40048",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40048"
},
{
"name": "CVE-2025-38147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38147"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2025-38286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38286"
},
{
"name": "CVE-2025-40219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40219"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-68200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68200"
},
{
"name": "CVE-2025-38501",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38501"
},
{
"name": "CVE-2025-38474",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38474"
},
{
"name": "CVE-2025-37979",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37979"
},
{
"name": "CVE-2025-40043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40043"
},
{
"name": "CVE-2025-68176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68176"
},
{
"name": "CVE-2025-37777",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37777"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-68199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68199"
},
{
"name": "CVE-2025-37936",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37936"
},
{
"name": "CVE-2025-68204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68204"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-37766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37766"
},
{
"name": "CVE-2025-38104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38104"
},
{
"name": "CVE-2025-37844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37844"
},
{
"name": "CVE-2025-21931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21931"
},
{
"name": "CVE-2025-37871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37871"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2025-39716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39716"
},
{
"name": "CVE-2025-39702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39702"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-38163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38163"
},
{
"name": "CVE-2025-22126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22126"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38109"
},
{
"name": "CVE-2025-39779",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39779"
},
{
"name": "CVE-2025-37755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37755"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2025-68246",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68246"
},
{
"name": "CVE-2025-40287",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40287"
},
{
"name": "CVE-2025-39720",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39720"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-40100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40100"
},
{
"name": "CVE-2025-40285",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40285"
},
{
"name": "CVE-2025-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38388"
},
{
"name": "CVE-2025-38157",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38157"
},
{
"name": "CVE-2025-40063",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40063"
},
{
"name": "CVE-2025-37790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37790"
},
{
"name": "CVE-2025-40208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40208"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2025-38323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38323"
},
{
"name": "CVE-2025-40019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40019"
},
{
"name": "CVE-2025-40039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40039"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-40240",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40240"
},
{
"name": "CVE-2025-38219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38219"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-38099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38099"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-40117",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40117"
},
{
"name": "CVE-2025-37758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37758"
},
{
"name": "CVE-2025-40081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40081"
},
{
"name": "CVE-2025-38087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38087"
},
{
"name": "CVE-2025-38039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38039"
},
{
"name": "CVE-2025-40153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40153"
},
{
"name": "CVE-2025-40103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40103"
},
{
"name": "CVE-2025-40294",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40294"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2025-40356",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40356"
},
{
"name": "CVE-2025-40121",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40121"
},
{
"name": "CVE-2025-40312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40312"
},
{
"name": "CVE-2025-40204",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40204"
},
{
"name": "CVE-2025-37852",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37852"
},
{
"name": "CVE-2025-37841",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37841"
},
{
"name": "CVE-2025-40171",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40171"
},
{
"name": "CVE-2025-37918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37918"
},
{
"name": "CVE-2025-37917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37917"
},
{
"name": "CVE-2025-38290",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38290"
},
{
"name": "CVE-2025-68243",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68243"
},
{
"name": "CVE-2025-38063",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38063"
},
{
"name": "CVE-2025-37770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37770"
},
{
"name": "CVE-2025-37773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37773"
},
{
"name": "CVE-2025-68175",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68175"
},
{
"name": "CVE-2025-40221",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40221"
},
{
"name": "CVE-2025-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38578"
},
{
"name": "CVE-2025-40139",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40139"
},
{
"name": "CVE-2025-40056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40056"
},
{
"name": "CVE-2025-38675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38675"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38708",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38708"
},
{
"name": "CVE-2025-37961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37961"
},
{
"name": "CVE-2025-68248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68248"
},
{
"name": "CVE-2025-40125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40125"
},
{
"name": "CVE-2025-40350",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40350"
},
{
"name": "CVE-2025-40309",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40309"
},
{
"name": "CVE-2025-38313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38313"
},
{
"name": "CVE-2025-38336",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38336"
},
{
"name": "CVE-2025-40349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40349"
},
{
"name": "CVE-2025-40052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40052"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2025-40343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40343"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38061",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38061"
},
{
"name": "CVE-2025-68173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68173"
},
{
"name": "CVE-2025-37983",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37983"
},
{
"name": "CVE-2025-38127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38127"
},
{
"name": "CVE-2025-38375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38375"
},
{
"name": "CVE-2025-37784",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37784"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-40308",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40308"
},
{
"name": "CVE-2025-40187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40187"
},
{
"name": "CVE-2025-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37920"
},
{
"name": "CVE-2025-40315",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40315"
},
{
"name": "CVE-2025-37815",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37815"
},
{
"name": "CVE-2025-38686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38686"
},
{
"name": "CVE-2025-37819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37819"
},
{
"name": "CVE-2025-40092",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40092"
},
{
"name": "CVE-2025-40298",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40298"
},
{
"name": "CVE-2025-40355",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40355"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2025-68186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68186"
},
{
"name": "CVE-2025-40054",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40054"
},
{
"name": "CVE-2025-68184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68184"
},
{
"name": "CVE-2024-36357",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36357"
},
{
"name": "CVE-2025-38463",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38463"
},
{
"name": "CVE-2025-40115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40115"
},
{
"name": "CVE-2025-38112",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38112"
},
{
"name": "CVE-2025-38521",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38521"
},
{
"name": "CVE-2025-38023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38023"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-38282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38282"
},
{
"name": "CVE-2025-39689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39689"
},
{
"name": "CVE-2025-38215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38215"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-37943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37943"
},
{
"name": "CVE-2025-37745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37745"
},
{
"name": "CVE-2025-40058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40058"
},
{
"name": "CVE-2025-39731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39731"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38653"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-37789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37789"
},
{
"name": "CVE-2025-40347",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40347"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38004",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38004"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-40198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40198"
},
{
"name": "CVE-2025-68310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68310"
},
{
"name": "CVE-2025-68179",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68179"
},
{
"name": "CVE-2025-40145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40145"
},
{
"name": "CVE-2025-38387",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38387"
},
{
"name": "CVE-2025-68169",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68169"
},
{
"name": "CVE-2025-38362",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38362"
},
{
"name": "CVE-2025-40173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40173"
},
{
"name": "CVE-2025-68316",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68316"
},
{
"name": "CVE-2025-68321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68321"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2025-40004",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40004"
},
{
"name": "CVE-2025-38371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38371"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2025-37867",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37867"
},
{
"name": "CVE-2025-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23160"
},
{
"name": "CVE-2025-40311",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40311"
},
{
"name": "CVE-2025-38295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38295"
},
{
"name": "CVE-2025-38461",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38461"
},
{
"name": "CVE-2025-37857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37857"
},
{
"name": "CVE-2025-37842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37842"
},
{
"name": "CVE-2025-40237",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40237"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-38060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38060"
},
{
"name": "CVE-2025-40167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40167"
},
{
"name": "CVE-2025-38159",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38159"
},
{
"name": "CVE-2025-38066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38066"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-37744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37744"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-40194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40194"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-40333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40333"
},
{
"name": "CVE-2025-38305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38305"
},
{
"name": "CVE-2025-37884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37884"
},
{
"name": "CVE-2025-38067",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38067"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38699"
},
{
"name": "CVE-2025-37927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37927"
},
{
"name": "CVE-2025-38707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38707"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2025-37897",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37897"
},
{
"name": "CVE-2025-40256",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40256"
},
{
"name": "CVE-2025-37911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37911"
},
{
"name": "CVE-2025-40245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40245"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2025-37869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37869"
},
{
"name": "CVE-2025-39692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39692"
},
{
"name": "CVE-2025-40360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40360"
},
{
"name": "CVE-2025-40332",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40332"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-38068",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38068"
},
{
"name": "CVE-2025-38436",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38436"
},
{
"name": "CVE-2025-37930",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37930"
},
{
"name": "CVE-2025-40104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40104"
},
{
"name": "CVE-2025-38401",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38401"
},
{
"name": "CVE-2025-38677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38677"
},
{
"name": "CVE-2025-38097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38097"
},
{
"name": "CVE-2025-37810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37810"
},
{
"name": "CVE-2025-38253",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38253"
},
{
"name": "CVE-2025-40097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40097"
},
{
"name": "CVE-2025-38123",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38123"
},
{
"name": "CVE-2025-38338",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38338"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38239"
},
{
"name": "CVE-2025-40001",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40001"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38027",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38027"
},
{
"name": "CVE-2025-38102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38102"
},
{
"name": "CVE-2025-40035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40035"
},
{
"name": "CVE-2025-68187",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68187"
},
{
"name": "CVE-2025-38283",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38283"
},
{
"name": "CVE-2025-40322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40322"
},
{
"name": "CVE-2025-68209",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68209"
},
{
"name": "CVE-2025-40045",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40045"
},
{
"name": "CVE-2025-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23159"
},
{
"name": "CVE-2025-38455",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38455"
},
{
"name": "CVE-2025-40313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40313"
},
{
"name": "CVE-2025-40089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40089"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2025-38015",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38015"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-38449",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38449"
},
{
"name": "CVE-2025-40233",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40233"
},
{
"name": "CVE-2025-40172",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40172"
},
{
"name": "CVE-2025-37853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37853"
},
{
"name": "CVE-2025-38126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38126"
},
{
"name": "CVE-2025-38149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38149"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-38399",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38399"
},
{
"name": "CVE-2025-38065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38065"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-40188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40188"
},
{
"name": "CVE-2025-40271",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40271"
},
{
"name": "CVE-2025-40291",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40291"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-40359",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40359"
},
{
"name": "CVE-2025-38412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38412"
},
{
"name": "CVE-2025-38031",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38031"
},
{
"name": "CVE-2025-40186",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40186"
},
{
"name": "CVE-2025-38293",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38293"
},
{
"name": "CVE-2025-40073",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40073"
},
{
"name": "CVE-2025-38648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38648"
},
{
"name": "CVE-2025-38278",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38278"
},
{
"name": "CVE-2025-37764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37764"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2025-37741",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37741"
},
{
"name": "CVE-2025-38053",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38053"
},
{
"name": "CVE-2025-40242",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40242"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2025-37912",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37912"
},
{
"name": "CVE-2025-38482",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38482"
},
{
"name": "CVE-2025-37820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37820"
},
{
"name": "CVE-2025-68198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68198"
},
{
"name": "CVE-2025-37985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37985"
},
{
"name": "CVE-2025-68314",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68314"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-40212",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40212"
},
{
"name": "CVE-2025-37787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37787"
},
{
"name": "CVE-2025-38008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38008"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2025-68190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68190"
},
{
"name": "CVE-2025-38034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38034"
},
{
"name": "CVE-2025-40086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40086"
},
{
"name": "CVE-2025-68242",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68242"
},
{
"name": "CVE-2025-38135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38135"
},
{
"name": "CVE-2025-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38619"
},
{
"name": "CVE-2025-40169",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40169"
},
{
"name": "CVE-2025-38312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38312"
},
{
"name": "CVE-2025-38095",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38095"
},
{
"name": "CVE-2025-37878",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37878"
},
{
"name": "CVE-2025-39737",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39737"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2025-40049",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40049"
},
{
"name": "CVE-2025-68322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68322"
},
{
"name": "CVE-2025-38363",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38363"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38319",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38319"
},
{
"name": "CVE-2025-40238",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40238"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-68205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68205"
},
{
"name": "CVE-2025-40277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40277"
},
{
"name": "CVE-2025-40070",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40070"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2025-38457",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38457"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-37813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37813"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38212",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38212"
},
{
"name": "CVE-2025-40106",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40106"
},
{
"name": "CVE-2025-68174",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68174"
},
{
"name": "CVE-2025-38298",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38298"
},
{
"name": "CVE-2025-40272",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40272"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-38024",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38024"
},
{
"name": "CVE-2025-40047",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40047"
},
{
"name": "CVE-2025-38496",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38496"
},
{
"name": "CVE-2025-38078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38078"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-40136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40136"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-40344",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40344"
},
{
"name": "CVE-2025-40205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40205"
},
{
"name": "CVE-2025-40354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40354"
},
{
"name": "CVE-2025-38169",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38169"
},
{
"name": "CVE-2025-37931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37931"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38211"
},
{
"name": "CVE-2025-40033",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40033"
},
{
"name": "CVE-2025-38057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38057"
},
{
"name": "CVE-2025-40122",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40122"
},
{
"name": "CVE-2025-68188",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68188"
},
{
"name": "CVE-2025-40269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40269"
},
{
"name": "CVE-2025-37887",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37887"
},
{
"name": "CVE-2025-38077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38077"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-37861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37861"
},
{
"name": "CVE-2025-68319",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68319"
},
{
"name": "CVE-2025-40119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40119"
},
{
"name": "CVE-2025-38120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38120"
},
{
"name": "CVE-2025-38285",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38285"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-37938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37938"
},
{
"name": "CVE-2025-38005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38005"
},
{
"name": "CVE-2025-38368",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38368"
},
{
"name": "CVE-2025-40075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40075"
},
{
"name": "CVE-2025-38161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38161"
},
{
"name": "CVE-2025-38331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38331"
},
{
"name": "CVE-2025-38354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38354"
},
{
"name": "CVE-2025-40138",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40138"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2025-38696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38696"
},
{
"name": "CVE-2025-40143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40143"
},
{
"name": "CVE-2025-68189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68189"
},
{
"name": "CVE-2025-38274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38274"
},
{
"name": "CVE-2025-40076",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40076"
},
{
"name": "CVE-2025-68180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68180"
},
{
"name": "CVE-2025-37874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37874"
},
{
"name": "CVE-2025-38115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38115"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2025-37988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37988"
},
{
"name": "CVE-2025-23158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23158"
},
{
"name": "CVE-2025-21780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21780"
},
{
"name": "CVE-2025-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23144"
},
{
"name": "CVE-2025-38153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38153"
},
{
"name": "CVE-2025-37969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37969"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-37816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37816"
},
{
"name": "CVE-2025-37899",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37899"
},
{
"name": "CVE-2025-40362",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40362"
},
{
"name": "CVE-2025-37742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37742"
},
{
"name": "CVE-2025-68201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68201"
},
{
"name": "CVE-2025-40289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40289"
},
{
"name": "CVE-2025-37765",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37765"
},
{
"name": "CVE-2025-38395",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38395"
},
{
"name": "CVE-2025-37921",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37921"
},
{
"name": "CVE-2025-38507",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38507"
},
{
"name": "CVE-2025-40230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40230"
},
{
"name": "CVE-2025-39989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39989"
},
{
"name": "CVE-2025-38337",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38337"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38258"
},
{
"name": "CVE-2025-37828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37828"
},
{
"name": "CVE-2025-37769",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37769"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-40292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40292"
},
{
"name": "CVE-2025-38086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38086"
},
{
"name": "CVE-2025-68181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68181"
},
{
"name": "CVE-2025-37935",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37935"
},
{
"name": "CVE-2025-40032",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40032"
},
{
"name": "CVE-2025-38396",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38396"
},
{
"name": "CVE-2025-23161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23161"
},
{
"name": "CVE-2025-38407",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38407"
},
{
"name": "CVE-2025-38493",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38493"
},
{
"name": "CVE-2025-37803",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37803"
},
{
"name": "CVE-2025-40228",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40228"
},
{
"name": "CVE-2025-40150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40150"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-37824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37824"
},
{
"name": "CVE-2025-40274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40274"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2025-38003",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38003"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-40206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40206"
},
{
"name": "CVE-2025-40218",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40218"
},
{
"name": "CVE-2025-38007",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38007"
},
{
"name": "CVE-2025-37923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37923"
},
{
"name": "CVE-2025-40088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40088"
},
{
"name": "CVE-2025-40220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40220"
},
{
"name": "CVE-2025-38142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38142"
},
{
"name": "CVE-2025-37739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37739"
},
{
"name": "CVE-2025-38478",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38478"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-39788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39788"
},
{
"name": "CVE-2025-37831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37831"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-68312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68312"
},
{
"name": "CVE-2025-40062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40062"
},
{
"name": "CVE-2025-68194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68194"
},
{
"name": "CVE-2025-38269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38269"
},
{
"name": "CVE-2025-38079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38079"
},
{
"name": "CVE-2025-37940",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37940"
},
{
"name": "CVE-2025-40336",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40336"
},
{
"name": "CVE-2025-37945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37945"
},
{
"name": "CVE-2025-40067",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40067"
},
{
"name": "CVE-2025-40101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40101"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-68251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68251"
},
{
"name": "CVE-2025-38652",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38652"
},
{
"name": "CVE-2025-38110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38110"
},
{
"name": "CVE-2025-38422",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38422"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2025-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39698"
},
{
"name": "CVE-2025-40038",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40038"
},
{
"name": "CVE-2025-37915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37915"
},
{
"name": "CVE-2025-68183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68183"
},
{
"name": "CVE-2025-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23146"
},
{
"name": "CVE-2025-37903",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37903"
},
{
"name": "CVE-2025-40353",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40353"
},
{
"name": "CVE-2025-40222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40222"
},
{
"name": "CVE-2025-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23142"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-38303",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38303"
},
{
"name": "CVE-2025-38074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38074"
},
{
"name": "CVE-2025-40085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40085"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38232"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-40184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40184"
},
{
"name": "CVE-2025-68244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68244"
},
{
"name": "CVE-2025-40231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40231"
},
{
"name": "CVE-2025-38324",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38324"
},
{
"name": "CVE-2025-40278",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40278"
},
{
"name": "CVE-2025-38018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38018"
},
{
"name": "CVE-2025-40176",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40176"
},
{
"name": "CVE-2025-40342",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40342"
},
{
"name": "CVE-2025-37830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37830"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-37991",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37991"
},
{
"name": "CVE-2025-38425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38425"
},
{
"name": "CVE-2025-40210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40210"
},
{
"name": "CVE-2025-37978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37978"
},
{
"name": "CVE-2025-37781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37781"
},
{
"name": "CVE-2025-38210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38210"
},
{
"name": "CVE-2025-38542",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38542"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-38344",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38344"
},
{
"name": "CVE-2025-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23145"
},
{
"name": "CVE-2025-38322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38322"
},
{
"name": "CVE-2025-38088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38088"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2025-40193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40193"
},
{
"name": "CVE-2025-37823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37823"
},
{
"name": "CVE-2025-38332",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38332"
},
{
"name": "CVE-2025-40148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40148"
},
{
"name": "CVE-2025-40326",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40326"
},
{
"name": "CVE-2025-38386",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38386"
},
{
"name": "CVE-2025-40279",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40279"
},
{
"name": "CVE-2025-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38385"
},
{
"name": "CVE-2025-40201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40201"
},
{
"name": "CVE-2024-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53217"
},
{
"name": "CVE-2025-37952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37952"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-37793",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37793"
},
{
"name": "CVE-2025-40084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40084"
},
{
"name": "CVE-2025-68311",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68311"
},
{
"name": "CVE-2025-37740",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37740"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2025-38174",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38174"
},
{
"name": "CVE-2025-37826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37826"
},
{
"name": "CVE-2025-37986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37986"
},
{
"name": "CVE-2025-37829",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37829"
},
{
"name": "CVE-2025-68320",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68320"
},
{
"name": "CVE-2025-40341",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40341"
},
{
"name": "CVE-2025-38409",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38409"
},
{
"name": "CVE-2025-40199",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40199"
},
{
"name": "CVE-2025-40183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40183"
},
{
"name": "CVE-2025-38019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38019"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-68172",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68172"
},
{
"name": "CVE-2025-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23151"
},
{
"name": "CVE-2025-38037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38037"
},
{
"name": "CVE-2025-40338",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40338"
},
{
"name": "CVE-2025-40195",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40195"
},
{
"name": "CVE-2025-37796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37796"
},
{
"name": "CVE-2025-37962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37962"
},
{
"name": "CVE-2025-40134",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40134"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-37799",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37799"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2025-38342",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38342"
},
{
"name": "CVE-2025-39795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39795"
},
{
"name": "CVE-2025-37801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37801"
},
{
"name": "CVE-2025-38167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38167"
},
{
"name": "CVE-2025-37883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37883"
},
{
"name": "CVE-2025-40302",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40302"
},
{
"name": "CVE-2025-37863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37863"
},
{
"name": "CVE-2025-37901",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37901"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-40358",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40358"
},
{
"name": "CVE-2025-37811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37811"
},
{
"name": "CVE-2025-40165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40165"
},
{
"name": "CVE-2025-38257",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38257"
},
{
"name": "CVE-2025-68318",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68318"
},
{
"name": "CVE-2025-37864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37864"
},
{
"name": "CVE-2025-38307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38307"
},
{
"name": "CVE-2025-40161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40161"
},
{
"name": "CVE-2025-40357",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40357"
},
{
"name": "CVE-2025-40328",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40328"
},
{
"name": "CVE-2025-37916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37916"
},
{
"name": "CVE-2025-40340",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40340"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-37767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37767"
},
{
"name": "CVE-2025-40283",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40283"
},
{
"name": "CVE-2025-40324",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40324"
},
{
"name": "CVE-2025-37989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37989"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-40131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40131"
},
{
"name": "CVE-2025-40146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40146"
},
{
"name": "CVE-2025-38326",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38326"
},
{
"name": "CVE-2025-40177",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40177"
},
{
"name": "CVE-2025-38055",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38055"
},
{
"name": "CVE-2025-38129",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38129"
},
{
"name": "CVE-2025-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38384"
},
{
"name": "CVE-2025-38334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38334"
},
{
"name": "CVE-2025-38728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38728"
},
{
"name": "CVE-2025-38424",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38424"
},
{
"name": "CVE-2025-38430",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38430"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-39734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39734"
},
{
"name": "CVE-2025-38089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38089"
},
{
"name": "CVE-2025-40226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40226"
},
{
"name": "CVE-2025-40078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40078"
},
{
"name": "CVE-2025-38382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38382"
},
{
"name": "CVE-2025-40074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40074"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-40321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40321"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-40069",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40069"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-40116",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40116"
},
{
"name": "CVE-2025-68249",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68249"
},
{
"name": "CVE-2025-38124",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38124"
},
{
"name": "CVE-2025-37925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37925"
},
{
"name": "CVE-2025-40158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40158"
},
{
"name": "CVE-2025-39683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39683"
},
{
"name": "CVE-2025-38420",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38420"
},
{
"name": "CVE-2025-38071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38071"
},
{
"name": "CVE-2025-40327",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40327"
},
{
"name": "CVE-2025-40130",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40130"
},
{
"name": "CVE-2025-40179",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40179"
},
{
"name": "CVE-2025-37972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37972"
},
{
"name": "CVE-2025-38183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38183"
},
{
"name": "CVE-2025-40127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40127"
},
{
"name": "CVE-2025-37768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37768"
},
{
"name": "CVE-2025-40282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40282"
},
{
"name": "CVE-2025-39794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39794"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2025-37984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37984"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-40168",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40168"
},
{
"name": "CVE-2025-37856",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37856"
},
{
"name": "CVE-2025-38107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38107"
},
{
"name": "CVE-2025-38292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38292"
},
{
"name": "CVE-2025-40053",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40053"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2025-38222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38222"
},
{
"name": "CVE-2025-38010",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38010"
},
{
"name": "CVE-2025-38197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38197"
},
{
"name": "CVE-2025-38468",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38468"
},
{
"name": "CVE-2025-40120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40120"
},
{
"name": "CVE-2025-40185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40185"
},
{
"name": "CVE-2025-38688",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38688"
},
{
"name": "CVE-2025-38333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38333"
},
{
"name": "CVE-2025-40295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40295"
},
{
"name": "CVE-2025-68192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68192"
},
{
"name": "CVE-2025-37970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37970"
},
{
"name": "CVE-2025-21884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21884"
},
{
"name": "CVE-2025-37905",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37905"
},
{
"name": "CVE-2025-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38390"
},
{
"name": "CVE-2025-38013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38013"
},
{
"name": "CVE-2025-40098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40098"
},
{
"name": "CVE-2025-38059",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38059"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-37956",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37956"
},
{
"name": "CVE-2025-40243",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40243"
},
{
"name": "CVE-2025-40196",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40196"
},
{
"name": "CVE-2025-38148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38148"
},
{
"name": "CVE-2025-40129",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40129"
},
{
"name": "CVE-2025-38467",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38467"
},
{
"name": "CVE-2025-38117",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38117"
},
{
"name": "CVE-2025-38094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38094"
},
{
"name": "CVE-2025-68171",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68171"
},
{
"name": "CVE-2025-38072",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38072"
},
{
"name": "CVE-2025-37967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37967"
},
{
"name": "CVE-2025-40301",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40301"
},
{
"name": "CVE-2025-38300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38300"
},
{
"name": "CVE-2025-40040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40040"
},
{
"name": "CVE-2025-38289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38289"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-68207",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68207"
},
{
"name": "CVE-2025-40066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40066"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-37949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37949"
},
{
"name": "CVE-2025-68167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68167"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-40207",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40207"
},
{
"name": "CVE-2025-38373",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38373"
},
{
"name": "CVE-2025-38489",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38489"
},
{
"name": "CVE-2025-40095",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40095"
},
{
"name": "CVE-2025-37957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37957"
},
{
"name": "CVE-2025-38058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38058"
},
{
"name": "CVE-2025-38483",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38483"
},
{
"name": "CVE-2025-38369",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38369"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38122",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38122"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2025-40299",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40299"
},
{
"name": "CVE-2025-38173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38173"
},
{
"name": "CVE-2025-40286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40286"
},
{
"name": "CVE-2025-38143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38143"
},
{
"name": "CVE-2025-38098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38098"
},
{
"name": "CVE-2025-40091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40091"
},
{
"name": "CVE-2025-40318",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40318"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-68241",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68241"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-40118",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40118"
},
{
"name": "CVE-2025-38718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38718"
},
{
"name": "CVE-2025-38392",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38392"
},
{
"name": "CVE-2025-39673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39673"
},
{
"name": "CVE-2025-38259",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38259"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2025-40135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40135"
},
{
"name": "CVE-2025-38156",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38156"
},
{
"name": "CVE-2025-37951",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37951"
},
{
"name": "CVE-2025-37840",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37840"
},
{
"name": "CVE-2025-68253",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68253"
},
{
"name": "CVE-2025-68734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68734"
},
{
"name": "CVE-2025-37947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37947"
},
{
"name": "CVE-2025-38416",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38416"
},
{
"name": "CVE-2025-37846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37846"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-40044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40044"
},
{
"name": "CVE-2025-38343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38343"
},
{
"name": "CVE-2025-40105",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40105"
},
{
"name": "CVE-2025-38202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38202"
},
{
"name": "CVE-2025-40050",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40050"
},
{
"name": "CVE-2025-40072",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40072"
},
{
"name": "CVE-2025-40112",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40112"
},
{
"name": "CVE-2025-40079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40079"
},
{
"name": "CVE-2025-22101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22101"
},
{
"name": "CVE-2025-38374",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38374"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-38194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38194"
},
{
"name": "CVE-2025-68182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68182"
},
{
"name": "CVE-2025-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38549"
},
{
"name": "CVE-2025-40310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40310"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2025-38101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38101"
},
{
"name": "CVE-2025-37982",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37982"
},
{
"name": "CVE-2025-37992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37992"
},
{
"name": "CVE-2025-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38577"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2025-68317",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68317"
},
{
"name": "CVE-2025-38299",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38299"
},
{
"name": "CVE-2025-40154",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40154"
},
{
"name": "CVE-2025-40331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40331"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-38704",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38704"
},
{
"name": "CVE-2025-38348",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38348"
},
{
"name": "CVE-2025-40270",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40270"
},
{
"name": "CVE-2025-40191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40191"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-40189",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40189"
},
{
"name": "CVE-2025-40093",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40093"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-38040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38040"
},
{
"name": "CVE-2025-38265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38265"
},
{
"name": "CVE-2025-23149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23149"
},
{
"name": "CVE-2025-38403",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38403"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-40335",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40335"
},
{
"name": "CVE-2025-40149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40149"
},
{
"name": "CVE-2025-37914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37914"
},
{
"name": "CVE-2025-40164",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40164"
},
{
"name": "CVE-2025-37873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37873"
},
{
"name": "CVE-2025-37928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37928"
},
{
"name": "CVE-2025-40267",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40267"
},
{
"name": "CVE-2025-40235",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40235"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-37922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37922"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2025-68208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68208"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39687"
},
{
"name": "CVE-2025-37794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37794"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-38246",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38246"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-38220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38220"
},
{
"name": "CVE-2025-38405",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38405"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-40352",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40352"
},
{
"name": "CVE-2025-38090",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38090"
},
{
"name": "CVE-2025-38429",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38429"
},
{
"name": "CVE-2025-38225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38225"
},
{
"name": "CVE-2025-22037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22037"
},
{
"name": "CVE-2025-40280",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40280"
},
{
"name": "CVE-2025-38155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38155"
},
{
"name": "CVE-2025-40099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40099"
},
{
"name": "CVE-2025-37977",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37977"
},
{
"name": "CVE-2025-38365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38365"
},
{
"name": "CVE-2025-38415",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38415"
},
{
"name": "CVE-2025-40031",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40031"
},
{
"name": "CVE-2025-40180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40180"
},
{
"name": "CVE-2025-40293",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40293"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-37973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37973"
},
{
"name": "CVE-2025-40330",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40330"
},
{
"name": "CVE-2025-68750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68750"
},
{
"name": "CVE-2025-38260",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38260"
},
{
"name": "CVE-2025-37827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37827"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38244"
},
{
"name": "CVE-2025-38080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38080"
},
{
"name": "CVE-2025-40126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40126"
},
{
"name": "CVE-2025-37748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37748"
},
{
"name": "CVE-2025-38364",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38364"
},
{
"name": "CVE-2025-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38615"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-37836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37836"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-37944",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37944"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-40320",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40320"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38494",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38494"
},
{
"name": "CVE-2025-39753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39753"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-40203",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40203"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38193"
},
{
"name": "CVE-2025-38400",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38400"
},
{
"name": "CVE-2025-38136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38136"
},
{
"name": "CVE-2025-40192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40192"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-37771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37771"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-40200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40200"
},
{
"name": "CVE-2025-38236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38236"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-37975",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37975"
},
{
"name": "CVE-2025-40124",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40124"
},
{
"name": "CVE-2025-38347",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38347"
},
{
"name": "CVE-2025-39776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39776"
},
{
"name": "CVE-2025-37998",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37998"
},
{
"name": "CVE-2025-38198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38198"
},
{
"name": "CVE-2025-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23163"
},
{
"name": "CVE-2025-40094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40094"
},
{
"name": "CVE-2025-37968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37968"
},
{
"name": "CVE-2025-38376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38376"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2025-40102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40102"
},
{
"name": "CVE-2025-40170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40170"
},
{
"name": "CVE-2025-38437",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38437"
},
{
"name": "CVE-2025-40160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40160"
},
{
"name": "CVE-2025-40284",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40284"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-40209",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40209"
},
{
"name": "CVE-2025-40077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40077"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38048",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38048"
},
{
"name": "CVE-2025-40071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40071"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-40113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40113"
},
{
"name": "CVE-2025-39736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39736"
},
{
"name": "CVE-2025-40234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40234"
},
{
"name": "CVE-2025-37757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37757"
},
{
"name": "CVE-2025-68247",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68247"
},
{
"name": "CVE-2025-40305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40305"
},
{
"name": "CVE-2025-40080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40080"
},
{
"name": "CVE-2025-38009",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38009"
},
{
"name": "CVE-2025-40215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40215"
},
{
"name": "CVE-2025-40307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40307"
},
{
"name": "CVE-2025-40111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40111"
},
{
"name": "CVE-2025-38081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38081"
},
{
"name": "CVE-2025-37809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37809"
},
{
"name": "CVE-2024-36350",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36350"
},
{
"name": "CVE-2025-40211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40211"
},
{
"name": "CVE-2025-40068",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40068"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-38406",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38406"
},
{
"name": "CVE-2025-68315",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68315"
},
{
"name": "CVE-2025-40163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40163"
},
{
"name": "CVE-2025-40042",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40042"
},
{
"name": "CVE-2025-37817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37817"
},
{
"name": "CVE-2025-40155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40155"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-40217",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40217"
},
{
"name": "CVE-2025-22102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22102"
},
{
"name": "CVE-2025-37987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37987"
},
{
"name": "CVE-2025-37749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37749"
},
{
"name": "CVE-2024-36331",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36331"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2025-40133",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40133"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-37772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37772"
},
{
"name": "CVE-2025-38214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38214"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-37994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37994"
},
{
"name": "CVE-2025-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38551"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38218",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38218"
},
{
"name": "CVE-2025-40329",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40329"
},
{
"name": "CVE-2025-38349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38349"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-38393",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38393"
},
{
"name": "CVE-2025-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37891"
},
{
"name": "CVE-2025-38249",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38249"
},
{
"name": "CVE-2025-38716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38716"
},
{
"name": "CVE-2025-37858",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37858"
},
{
"name": "CVE-2025-38154",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38154"
},
{
"name": "CVE-2025-38469",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38469"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2025-40034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40034"
},
{
"name": "CVE-2025-40060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40060"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-38389",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38389"
},
{
"name": "CVE-2025-38448",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38448"
},
{
"name": "CVE-2025-37780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37780"
},
{
"name": "CVE-2025-37995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37995"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-37754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37754"
},
{
"name": "CVE-2025-40059",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40059"
},
{
"name": "CVE-2025-38497",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38497"
},
{
"name": "CVE-2025-68168",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68168"
},
{
"name": "CVE-2025-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23156"
},
{
"name": "CVE-2025-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23157"
},
{
"name": "CVE-2025-68206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68206"
},
{
"name": "CVE-2025-68309",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68309"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38165"
},
{
"name": "CVE-2025-40003",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40003"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-38495",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38495"
},
{
"name": "CVE-2025-37808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37808"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38052"
},
{
"name": "CVE-2025-38377",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38377"
},
{
"name": "CVE-2025-40175",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40175"
},
{
"name": "CVE-2025-68170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68170"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2025-68313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68313"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38462",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38462"
},
{
"name": "CVE-2025-38428",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38428"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-38262",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38262"
},
{
"name": "CVE-2025-38138",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38138"
},
{
"name": "CVE-2025-38035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38035"
},
{
"name": "CVE-2025-37759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37759"
},
{
"name": "CVE-2025-38414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38414"
},
{
"name": "CVE-2025-68197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68197"
},
{
"name": "CVE-2025-40123",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40123"
},
{
"name": "CVE-2025-37933",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37933"
},
{
"name": "CVE-2025-38310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38310"
},
{
"name": "CVE-2025-37886",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37886"
},
{
"name": "CVE-2025-37963",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37963"
},
{
"name": "CVE-2025-40297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40297"
},
{
"name": "CVE-2025-38226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38226"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-40178",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40178"
},
{
"name": "CVE-2025-40363",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40363"
},
{
"name": "CVE-2025-38443",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38443"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-37800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37800"
},
{
"name": "CVE-2025-40276",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40276"
},
{
"name": "CVE-2025-37900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37900"
},
{
"name": "CVE-2025-40224",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40224"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-37805",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37805"
},
{
"name": "CVE-2025-68245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68245"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-40317",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40317"
},
{
"name": "CVE-2025-40236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40236"
},
{
"name": "CVE-2025-37990",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37990"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-38180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38180"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2025-68202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68202"
},
{
"name": "CVE-2025-38145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38145"
},
{
"name": "CVE-2025-40174",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40174"
},
{
"name": "CVE-2025-37948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37948"
},
{
"name": "CVE-2025-38166",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38166"
},
{
"name": "CVE-2025-40227",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40227"
},
{
"name": "CVE-2025-37862",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37862"
},
{
"name": "CVE-2025-38321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38321"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-40316",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40316"
},
{
"name": "CVE-2025-37960",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37960"
},
{
"name": "CVE-2025-38045",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38045"
},
{
"name": "CVE-2025-38051",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38051"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-37763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37763"
},
{
"name": "CVE-2025-37954",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37954"
},
{
"name": "CVE-2025-22128",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22128"
},
{
"name": "CVE-2025-40065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40065"
},
{
"name": "CVE-2025-37839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37839"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-38277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38277"
},
{
"name": "CVE-2025-37913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37913"
},
{
"name": "CVE-2025-68177",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68177"
},
{
"name": "CVE-2025-39756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39756"
},
{
"name": "CVE-2025-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38539"
},
{
"name": "CVE-2025-40181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40181"
},
{
"name": "CVE-2025-68191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68191"
},
{
"name": "CVE-2025-38044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38044"
},
{
"name": "CVE-2025-68250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68250"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2025-40141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40141"
},
{
"name": "CVE-2025-38200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38200"
},
{
"name": "CVE-2025-38480",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38480"
},
{
"name": "CVE-2025-40132",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40132"
},
{
"name": "CVE-2025-38346",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38346"
},
{
"name": "CVE-2025-40152",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40152"
},
{
"name": "CVE-2025-37959",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37959"
},
{
"name": "CVE-2025-38191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38191"
},
{
"name": "CVE-2025-39946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39946"
},
{
"name": "CVE-2024-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50299"
},
{
"name": "CVE-2025-38062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38062"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-40288",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40288"
},
{
"name": "CVE-2025-68239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68239"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-40281",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40281"
},
{
"name": "CVE-2025-68185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68185"
},
{
"name": "CVE-2025-40304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40304"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-40110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40110"
},
{
"name": "CVE-2025-40162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40162"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38131"
},
{
"name": "CVE-2025-40268",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40268"
},
{
"name": "CVE-2025-37851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37851"
},
{
"name": "CVE-2025-38481",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38481"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2025-38320",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38320"
},
{
"name": "CVE-2025-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38625"
},
{
"name": "CVE-2025-38164",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38164"
},
{
"name": "CVE-2025-40303",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40303"
},
{
"name": "CVE-2025-68178",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68178"
},
{
"name": "CVE-2025-40337",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40337"
},
{
"name": "CVE-2025-40346",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40346"
},
{
"name": "CVE-2025-38264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38264"
},
{
"name": "CVE-2025-40036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40036"
},
{
"name": "CVE-2025-39676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39676"
},
{
"name": "CVE-2025-40241",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40241"
},
{
"name": "CVE-2025-37980",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37980"
},
{
"name": "CVE-2025-38280",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38280"
},
{
"name": "CVE-2025-37788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37788"
},
{
"name": "CVE-2025-38427",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38427"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2025-40046",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40046"
},
{
"name": "CVE-2025-37879",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37879"
},
{
"name": "CVE-2025-38217",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38217"
},
{
"name": "CVE-2025-40030",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40030"
},
{
"name": "CVE-2025-40244",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40244"
},
{
"name": "CVE-2025-37881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37881"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39715"
},
{
"name": "CVE-2025-40323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40323"
},
{
"name": "CVE-2025-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38569"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-40096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40096"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2025-37909",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37909"
},
{
"name": "CVE-2025-38700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38700"
},
{
"name": "CVE-2025-37849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37849"
},
{
"name": "CVE-2025-38162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38162"
},
{
"name": "CVE-2025-38532",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38532"
},
{
"name": "CVE-2025-39712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39712"
},
{
"name": "CVE-2025-37812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37812"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-40275",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40275"
},
{
"name": "CVE-2025-37875",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37875"
},
{
"name": "CVE-2025-38410",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38410"
},
{
"name": "CVE-2025-40182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40182"
},
{
"name": "CVE-2025-68211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68211"
},
{
"name": "CVE-2025-39781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39781"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-40339",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40339"
},
{
"name": "CVE-2025-40140",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40140"
},
{
"name": "CVE-2025-38020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38020"
},
{
"name": "CVE-2025-40223",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40223"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23140"
},
{
"name": "CVE-2025-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23150"
},
{
"name": "CVE-2025-38460",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38460"
},
{
"name": "CVE-2025-40061",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40061"
},
{
"name": "CVE-2025-38182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38182"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2025-38275",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38275"
},
{
"name": "CVE-2025-40213",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40213"
},
{
"name": "CVE-2025-38345",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38345"
},
{
"name": "CVE-2025-40334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40334"
},
{
"name": "CVE-2025-38170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38170"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-22115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22115"
},
{
"name": "CVE-2025-22120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22120"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2022-49267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49267"
},
{
"name": "CVE-2025-38231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38231"
},
{
"name": "CVE-2025-37854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37854"
},
{
"name": "CVE-2025-40142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40142"
},
{
"name": "CVE-2025-40159",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40159"
},
{
"name": "CVE-2025-40319",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40319"
},
{
"name": "CVE-2025-68193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68193"
},
{
"name": "CVE-2025-38473",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38473"
},
{
"name": "CVE-2025-38113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38113"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23148"
},
{
"name": "CVE-2025-38361",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38361"
},
{
"name": "CVE-2025-38470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38470"
},
{
"name": "CVE-2025-38181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38181"
},
{
"name": "CVE-2025-40051",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40051"
},
{
"name": "CVE-2025-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38391"
},
{
"name": "CVE-2025-38248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38248"
},
{
"name": "CVE-2025-40351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40351"
},
{
"name": "CVE-2025-40087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40087"
},
{
"name": "CVE-2025-40229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40229"
},
{
"name": "CVE-2025-23147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23147"
},
{
"name": "CVE-2025-39752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39752"
}
],
"initial_release_date": "2026-02-27T00:00:00",
"last_revision_date": "2026-02-27T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0227",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-02-27T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-02-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8060-1",
"url": "https://ubuntu.com/security/notices/USN-8060-1"
},
{
"published_at": "2026-02-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8059-2",
"url": "https://ubuntu.com/security/notices/USN-8059-2"
},
{
"published_at": "2026-02-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8028-8",
"url": "https://ubuntu.com/security/notices/USN-8028-8"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8060-4",
"url": "https://ubuntu.com/security/notices/USN-8060-4"
},
{
"published_at": "2026-02-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8052-2",
"url": "https://ubuntu.com/security/notices/USN-8052-2"
},
{
"published_at": "2026-02-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8060-2",
"url": "https://ubuntu.com/security/notices/USN-8060-2"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8059-4",
"url": "https://ubuntu.com/security/notices/USN-8059-4"
},
{
"published_at": "2026-02-26",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8059-6",
"url": "https://ubuntu.com/security/notices/USN-8059-6"
},
{
"published_at": "2026-02-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8061-1",
"url": "https://ubuntu.com/security/notices/USN-8061-1"
},
{
"published_at": "2026-02-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8060-3",
"url": "https://ubuntu.com/security/notices/USN-8060-3"
},
{
"published_at": "2026-02-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8059-1",
"url": "https://ubuntu.com/security/notices/USN-8059-1"
},
{
"published_at": "2026-02-24",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8029-3",
"url": "https://ubuntu.com/security/notices/USN-8029-3"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8059-5",
"url": "https://ubuntu.com/security/notices/USN-8059-5"
},
{
"published_at": "2026-02-25",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8059-3",
"url": "https://ubuntu.com/security/notices/USN-8059-3"
},
{
"published_at": "2026-02-20",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8015-5",
"url": "https://ubuntu.com/security/notices/USN-8015-5"
}
]
}
CERTFR-2026-AVI-0246
Vulnerability from certfr_avis - Published: 2026-03-06 - Updated: 2026-03-06
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 25.10",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2025-38490",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38490"
},
{
"name": "CVE-2025-37850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37850"
},
{
"name": "CVE-2025-38485",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38485"
},
{
"name": "CVE-2025-22026",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22026"
},
{
"name": "CVE-2025-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38579"
},
{
"name": "CVE-2025-37761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37761"
},
{
"name": "CVE-2025-37865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37865"
},
{
"name": "CVE-2025-38328",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38328"
},
{
"name": "CVE-2025-38711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38711"
},
{
"name": "CVE-2025-38487",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38487"
},
{
"name": "CVE-2025-37775",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37775"
},
{
"name": "CVE-2025-38335",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38335"
},
{
"name": "CVE-2025-38304",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38304"
},
{
"name": "CVE-2025-37892",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37892"
},
{
"name": "CVE-2025-38100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38100"
},
{
"name": "CVE-2025-37859",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37859"
},
{
"name": "CVE-2025-38043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38043"
},
{
"name": "CVE-2025-38471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38471"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-37792",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37792"
},
{
"name": "CVE-2025-38108",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38108"
},
{
"name": "CVE-2025-38230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38230"
},
{
"name": "CVE-2025-38229",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38229"
},
{
"name": "CVE-2025-38158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38158"
},
{
"name": "CVE-2025-37872",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37872"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2025-38279",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38279"
},
{
"name": "CVE-2025-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38561"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2025-22036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22036"
},
{
"name": "CVE-2025-38147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38147"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2025-38286",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38286"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-38501",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38501"
},
{
"name": "CVE-2025-38474",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38474"
},
{
"name": "CVE-2025-37979",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37979"
},
{
"name": "CVE-2025-37777",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37777"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-37936",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37936"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-37766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37766"
},
{
"name": "CVE-2025-38104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38104"
},
{
"name": "CVE-2025-37844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37844"
},
{
"name": "CVE-2025-21931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21931"
},
{
"name": "CVE-2025-37871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37871"
},
{
"name": "CVE-2025-37778",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37778"
},
{
"name": "CVE-2025-39716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39716"
},
{
"name": "CVE-2025-39702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39702"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-38163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38163"
},
{
"name": "CVE-2025-22126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22126"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38109",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38109"
},
{
"name": "CVE-2025-39779",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39779"
},
{
"name": "CVE-2025-37755",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37755"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2025-39720",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39720"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38388"
},
{
"name": "CVE-2025-38157",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38157"
},
{
"name": "CVE-2025-37790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37790"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2025-38323",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38323"
},
{
"name": "CVE-2025-40019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40019"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-38219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38219"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-38099",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38099"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-37758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37758"
},
{
"name": "CVE-2025-38087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38087"
},
{
"name": "CVE-2025-38039",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38039"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2024-56548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56548"
},
{
"name": "CVE-2025-38626",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38626"
},
{
"name": "CVE-2025-37852",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37852"
},
{
"name": "CVE-2025-37841",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37841"
},
{
"name": "CVE-2025-37918",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37918"
},
{
"name": "CVE-2025-37917",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37917"
},
{
"name": "CVE-2025-38290",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38290"
},
{
"name": "CVE-2025-38063",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38063"
},
{
"name": "CVE-2025-37770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37770"
},
{
"name": "CVE-2025-37773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37773"
},
{
"name": "CVE-2025-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38578"
},
{
"name": "CVE-2024-50047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50047"
},
{
"name": "CVE-2025-38675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38675"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38708",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38708"
},
{
"name": "CVE-2025-37961",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37961"
},
{
"name": "CVE-2025-38313",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38313"
},
{
"name": "CVE-2025-38336",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38336"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38061",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38061"
},
{
"name": "CVE-2025-37983",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37983"
},
{
"name": "CVE-2025-38127",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38127"
},
{
"name": "CVE-2025-38375",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38375"
},
{
"name": "CVE-2025-37784",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37784"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-37920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37920"
},
{
"name": "CVE-2025-37815",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37815"
},
{
"name": "CVE-2025-38686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38686"
},
{
"name": "CVE-2025-37819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37819"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2024-36357",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36357"
},
{
"name": "CVE-2025-38463",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38463"
},
{
"name": "CVE-2025-38112",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38112"
},
{
"name": "CVE-2025-38521",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38521"
},
{
"name": "CVE-2025-38023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38023"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-38282",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38282"
},
{
"name": "CVE-2025-39689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39689"
},
{
"name": "CVE-2025-38215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38215"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-37943",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37943"
},
{
"name": "CVE-2025-37745",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37745"
},
{
"name": "CVE-2025-39731",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39731"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38653"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-37789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37789"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38004",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38004"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-38387",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38387"
},
{
"name": "CVE-2025-38362",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38362"
},
{
"name": "CVE-2025-37924",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37924"
},
{
"name": "CVE-2025-38371",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38371"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2025-37867",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37867"
},
{
"name": "CVE-2025-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23160"
},
{
"name": "CVE-2025-38295",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38295"
},
{
"name": "CVE-2025-38461",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38461"
},
{
"name": "CVE-2025-37857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37857"
},
{
"name": "CVE-2025-37842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37842"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-38060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38060"
},
{
"name": "CVE-2025-38159",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38159"
},
{
"name": "CVE-2025-38066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38066"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-37744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37744"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38305",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38305"
},
{
"name": "CVE-2025-37884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37884"
},
{
"name": "CVE-2025-38067",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38067"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-38699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38699"
},
{
"name": "CVE-2025-37927",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37927"
},
{
"name": "CVE-2025-38707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38707"
},
{
"name": "CVE-2025-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38562"
},
{
"name": "CVE-2025-37897",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37897"
},
{
"name": "CVE-2025-37911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37911"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2025-37869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37869"
},
{
"name": "CVE-2025-39692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39692"
},
{
"name": "CVE-2025-38068",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38068"
},
{
"name": "CVE-2025-38436",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38436"
},
{
"name": "CVE-2025-37930",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37930"
},
{
"name": "CVE-2025-38401",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38401"
},
{
"name": "CVE-2025-38677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38677"
},
{
"name": "CVE-2025-38097",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38097"
},
{
"name": "CVE-2025-37810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37810"
},
{
"name": "CVE-2025-38253",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38253"
},
{
"name": "CVE-2025-38123",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38123"
},
{
"name": "CVE-2025-38338",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38338"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38239",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38239"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38027",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38027"
},
{
"name": "CVE-2025-38102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38102"
},
{
"name": "CVE-2025-38283",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38283"
},
{
"name": "CVE-2025-23159",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23159"
},
{
"name": "CVE-2025-38455",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38455"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2025-38015",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38015"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-38449",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38449"
},
{
"name": "CVE-2025-37853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37853"
},
{
"name": "CVE-2025-38126",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38126"
},
{
"name": "CVE-2025-38149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38149"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-38399",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38399"
},
{
"name": "CVE-2025-38065",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38065"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38412",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38412"
},
{
"name": "CVE-2025-38031",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38031"
},
{
"name": "CVE-2025-38293",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38293"
},
{
"name": "CVE-2025-38648",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38648"
},
{
"name": "CVE-2025-38278",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38278"
},
{
"name": "CVE-2025-37764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37764"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2025-37741",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37741"
},
{
"name": "CVE-2025-38053",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38053"
},
{
"name": "CVE-2025-37822",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37822"
},
{
"name": "CVE-2025-37912",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37912"
},
{
"name": "CVE-2025-38482",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38482"
},
{
"name": "CVE-2025-37820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37820"
},
{
"name": "CVE-2025-37985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37985"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-37787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37787"
},
{
"name": "CVE-2025-38008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38008"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2025-38034",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38034"
},
{
"name": "CVE-2025-38135",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38135"
},
{
"name": "CVE-2025-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38619"
},
{
"name": "CVE-2025-38312",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38312"
},
{
"name": "CVE-2025-38095",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38095"
},
{
"name": "CVE-2025-37878",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37878"
},
{
"name": "CVE-2025-39737",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39737"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2025-38363",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38363"
},
{
"name": "CVE-2025-21704",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21704"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38319",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38319"
},
{
"name": "CVE-2022-49698",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49698"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38250",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38250"
},
{
"name": "CVE-2025-38457",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38457"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-37813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37813"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38212",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38212"
},
{
"name": "CVE-2025-38298",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38298"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-38024",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38024"
},
{
"name": "CVE-2025-38496",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38496"
},
{
"name": "CVE-2025-38078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38078"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-38169",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38169"
},
{
"name": "CVE-2025-37931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37931"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38211",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38211"
},
{
"name": "CVE-2025-38057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38057"
},
{
"name": "CVE-2025-37887",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37887"
},
{
"name": "CVE-2025-38077",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38077"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-37861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37861"
},
{
"name": "CVE-2025-38120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38120"
},
{
"name": "CVE-2025-38285",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38285"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-37938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37938"
},
{
"name": "CVE-2025-38005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38005"
},
{
"name": "CVE-2025-38368",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38368"
},
{
"name": "CVE-2025-38161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38161"
},
{
"name": "CVE-2025-38331",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38331"
},
{
"name": "CVE-2025-38354",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38354"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2025-38696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38696"
},
{
"name": "CVE-2025-38274",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38274"
},
{
"name": "CVE-2025-37874",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37874"
},
{
"name": "CVE-2025-38115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38115"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2025-37988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37988"
},
{
"name": "CVE-2025-23158",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23158"
},
{
"name": "CVE-2025-21780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21780"
},
{
"name": "CVE-2025-23144",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23144"
},
{
"name": "CVE-2025-38153",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38153"
},
{
"name": "CVE-2025-37969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37969"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-37816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37816"
},
{
"name": "CVE-2025-37899",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37899"
},
{
"name": "CVE-2025-37742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37742"
},
{
"name": "CVE-2025-37765",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37765"
},
{
"name": "CVE-2025-38395",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38395"
},
{
"name": "CVE-2025-37921",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37921"
},
{
"name": "CVE-2025-38507",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38507"
},
{
"name": "CVE-2025-39989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39989"
},
{
"name": "CVE-2025-38337",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38337"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38258",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38258"
},
{
"name": "CVE-2025-37828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37828"
},
{
"name": "CVE-2025-37769",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37769"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-38086",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38086"
},
{
"name": "CVE-2025-37935",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37935"
},
{
"name": "CVE-2025-38396",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38396"
},
{
"name": "CVE-2025-23161",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23161"
},
{
"name": "CVE-2025-38407",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38407"
},
{
"name": "CVE-2025-38493",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38493"
},
{
"name": "CVE-2025-37803",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37803"
},
{
"name": "CVE-2022-48875",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48875"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-37824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37824"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2025-38003",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38003"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-38007",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38007"
},
{
"name": "CVE-2025-37923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37923"
},
{
"name": "CVE-2025-38142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38142"
},
{
"name": "CVE-2025-37739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37739"
},
{
"name": "CVE-2025-38478",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38478"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-39788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39788"
},
{
"name": "CVE-2025-37831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37831"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38269",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38269"
},
{
"name": "CVE-2025-38079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38079"
},
{
"name": "CVE-2025-37940",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37940"
},
{
"name": "CVE-2025-37945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37945"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38652",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38652"
},
{
"name": "CVE-2025-38110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38110"
},
{
"name": "CVE-2025-38422",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38422"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2025-39698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39698"
},
{
"name": "CVE-2025-37915",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37915"
},
{
"name": "CVE-2025-23146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23146"
},
{
"name": "CVE-2025-37903",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37903"
},
{
"name": "CVE-2025-23142",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23142"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-38303",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38303"
},
{
"name": "CVE-2025-38074",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38074"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38232"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38324",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38324"
},
{
"name": "CVE-2025-38018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38018"
},
{
"name": "CVE-2025-37830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37830"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-37991",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37991"
},
{
"name": "CVE-2025-38425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38425"
},
{
"name": "CVE-2025-37978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37978"
},
{
"name": "CVE-2025-37781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37781"
},
{
"name": "CVE-2025-38210",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38210"
},
{
"name": "CVE-2025-38542",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38542"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-38344",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38344"
},
{
"name": "CVE-2025-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23145"
},
{
"name": "CVE-2025-38322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38322"
},
{
"name": "CVE-2025-38088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38088"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2025-37823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37823"
},
{
"name": "CVE-2025-38332",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38332"
},
{
"name": "CVE-2025-38386",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38386"
},
{
"name": "CVE-2025-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38385"
},
{
"name": "CVE-2025-37952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37952"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-37793",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37793"
},
{
"name": "CVE-2025-37740",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37740"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2025-38174",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38174"
},
{
"name": "CVE-2025-37826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37826"
},
{
"name": "CVE-2025-37986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37986"
},
{
"name": "CVE-2025-37829",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37829"
},
{
"name": "CVE-2025-38409",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38409"
},
{
"name": "CVE-2025-38019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38019"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-23151",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23151"
},
{
"name": "CVE-2025-38037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38037"
},
{
"name": "CVE-2025-37796",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37796"
},
{
"name": "CVE-2025-37962",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37962"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-37799",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37799"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2025-38342",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38342"
},
{
"name": "CVE-2025-39795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39795"
},
{
"name": "CVE-2025-37801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37801"
},
{
"name": "CVE-2025-38167",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38167"
},
{
"name": "CVE-2025-37883",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37883"
},
{
"name": "CVE-2025-37863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37863"
},
{
"name": "CVE-2025-37901",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37901"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-37811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37811"
},
{
"name": "CVE-2025-38257",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38257"
},
{
"name": "CVE-2025-37864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37864"
},
{
"name": "CVE-2025-38307",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38307"
},
{
"name": "CVE-2025-37916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37916"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-37767",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37767"
},
{
"name": "CVE-2025-37989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37989"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-38326",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38326"
},
{
"name": "CVE-2025-38055",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38055"
},
{
"name": "CVE-2025-38129",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38129"
},
{
"name": "CVE-2025-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38384"
},
{
"name": "CVE-2025-38334",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38334"
},
{
"name": "CVE-2025-38728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38728"
},
{
"name": "CVE-2025-38424",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38424"
},
{
"name": "CVE-2025-38430",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38430"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-39734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39734"
},
{
"name": "CVE-2025-38089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38089"
},
{
"name": "CVE-2025-38382",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38382"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-38124",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38124"
},
{
"name": "CVE-2025-37925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37925"
},
{
"name": "CVE-2025-39683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39683"
},
{
"name": "CVE-2025-38420",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38420"
},
{
"name": "CVE-2025-38071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38071"
},
{
"name": "CVE-2025-37972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37972"
},
{
"name": "CVE-2025-38183",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38183"
},
{
"name": "CVE-2025-37768",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37768"
},
{
"name": "CVE-2025-39794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39794"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2025-37984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37984"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-37856",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37856"
},
{
"name": "CVE-2025-38107",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38107"
},
{
"name": "CVE-2025-38292",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38292"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2025-38222",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38222"
},
{
"name": "CVE-2025-38010",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38010"
},
{
"name": "CVE-2025-38197",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38197"
},
{
"name": "CVE-2025-38468",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38468"
},
{
"name": "CVE-2025-38688",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38688"
},
{
"name": "CVE-2025-38333",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38333"
},
{
"name": "CVE-2025-37970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37970"
},
{
"name": "CVE-2025-21884",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21884"
},
{
"name": "CVE-2025-37905",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37905"
},
{
"name": "CVE-2025-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38390"
},
{
"name": "CVE-2025-38013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38013"
},
{
"name": "CVE-2025-38059",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38059"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-37956",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37956"
},
{
"name": "CVE-2025-38148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38148"
},
{
"name": "CVE-2025-38467",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38467"
},
{
"name": "CVE-2025-38117",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38117"
},
{
"name": "CVE-2025-38094",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38094"
},
{
"name": "CVE-2025-40214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40214"
},
{
"name": "CVE-2025-38072",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38072"
},
{
"name": "CVE-2025-37967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37967"
},
{
"name": "CVE-2025-38300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38300"
},
{
"name": "CVE-2025-38289",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38289"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-37949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37949"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38373",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38373"
},
{
"name": "CVE-2025-38489",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38489"
},
{
"name": "CVE-2025-37957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37957"
},
{
"name": "CVE-2025-38058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38058"
},
{
"name": "CVE-2025-38483",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38483"
},
{
"name": "CVE-2025-38369",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38369"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38122",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38122"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2025-38173",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38173"
},
{
"name": "CVE-2025-38143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38143"
},
{
"name": "CVE-2025-38098",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38098"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-38718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38718"
},
{
"name": "CVE-2025-38392",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38392"
},
{
"name": "CVE-2025-39673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39673"
},
{
"name": "CVE-2025-38259",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38259"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2025-38156",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38156"
},
{
"name": "CVE-2025-37951",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37951"
},
{
"name": "CVE-2025-37840",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37840"
},
{
"name": "CVE-2025-37947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37947"
},
{
"name": "CVE-2025-38416",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38416"
},
{
"name": "CVE-2025-37846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37846"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-38192",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38192"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-38343",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38343"
},
{
"name": "CVE-2025-38202",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38202"
},
{
"name": "CVE-2025-22101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22101"
},
{
"name": "CVE-2025-38374",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38374"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-38194",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38194"
},
{
"name": "CVE-2025-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38549"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2025-38101",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38101"
},
{
"name": "CVE-2025-37982",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37982"
},
{
"name": "CVE-2025-37992",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37992"
},
{
"name": "CVE-2025-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38577"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2025-38299",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38299"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-38704",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38704"
},
{
"name": "CVE-2025-38348",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38348"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-38040",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38040"
},
{
"name": "CVE-2025-38265",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38265"
},
{
"name": "CVE-2025-23149",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23149"
},
{
"name": "CVE-2025-38403",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38403"
},
{
"name": "CVE-2025-21726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21726"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-37914",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37914"
},
{
"name": "CVE-2025-37873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37873"
},
{
"name": "CVE-2025-37928",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37928"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-37922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37922"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39687"
},
{
"name": "CVE-2025-37794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37794"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-38246",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38246"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-38220",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38220"
},
{
"name": "CVE-2025-38405",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38405"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-38090",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38090"
},
{
"name": "CVE-2025-38429",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38429"
},
{
"name": "CVE-2025-38225",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38225"
},
{
"name": "CVE-2025-22037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22037"
},
{
"name": "CVE-2025-38155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38155"
},
{
"name": "CVE-2025-37977",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37977"
},
{
"name": "CVE-2025-38365",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38365"
},
{
"name": "CVE-2025-38415",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38415"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-37973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37973"
},
{
"name": "CVE-2025-68750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-68750"
},
{
"name": "CVE-2025-38260",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38260"
},
{
"name": "CVE-2025-37827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37827"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38080"
},
{
"name": "CVE-2025-37748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37748"
},
{
"name": "CVE-2025-38364",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38364"
},
{
"name": "CVE-2025-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38615"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-37836",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37836"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-37944",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37944"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38494",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38494"
},
{
"name": "CVE-2025-39753",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39753"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38193",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38193"
},
{
"name": "CVE-2025-38400",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38400"
},
{
"name": "CVE-2025-38136",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38136"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-37771",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37771"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-38236",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38236"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-37975",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37975"
},
{
"name": "CVE-2025-38347",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38347"
},
{
"name": "CVE-2025-39776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39776"
},
{
"name": "CVE-2025-37998",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37998"
},
{
"name": "CVE-2025-38198",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38198"
},
{
"name": "CVE-2025-23163",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23163"
},
{
"name": "CVE-2025-37968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37968"
},
{
"name": "CVE-2025-38376",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38376"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2025-38437",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38437"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38048",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38048"
},
{
"name": "CVE-2025-39736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39736"
},
{
"name": "CVE-2025-37757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37757"
},
{
"name": "CVE-2025-38009",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38009"
},
{
"name": "CVE-2025-40215",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40215"
},
{
"name": "CVE-2025-38081",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38081"
},
{
"name": "CVE-2025-37809",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37809"
},
{
"name": "CVE-2024-36350",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36350"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-38406",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38406"
},
{
"name": "CVE-2025-37817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37817"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-22102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22102"
},
{
"name": "CVE-2025-37987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37987"
},
{
"name": "CVE-2025-37749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37749"
},
{
"name": "CVE-2024-36331",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36331"
},
{
"name": "CVE-2025-39748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39748"
},
{
"name": "CVE-2024-49927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49927"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-37772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37772"
},
{
"name": "CVE-2025-38214",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38214"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-37994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37994"
},
{
"name": "CVE-2025-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38551"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38218",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38218"
},
{
"name": "CVE-2025-38349",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38349"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-38393",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38393"
},
{
"name": "CVE-2024-47659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47659"
},
{
"name": "CVE-2025-37891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37891"
},
{
"name": "CVE-2025-38249",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38249"
},
{
"name": "CVE-2025-38716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38716"
},
{
"name": "CVE-2025-37858",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37858"
},
{
"name": "CVE-2025-38154",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38154"
},
{
"name": "CVE-2025-38469",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38469"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-38389",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38389"
},
{
"name": "CVE-2025-38448",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38448"
},
{
"name": "CVE-2025-37780",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37780"
},
{
"name": "CVE-2025-37995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37995"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-37754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37754"
},
{
"name": "CVE-2025-38497",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38497"
},
{
"name": "CVE-2025-23156",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23156"
},
{
"name": "CVE-2025-23157",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23157"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38165",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38165"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-38495",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38495"
},
{
"name": "CVE-2025-37808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37808"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38052"
},
{
"name": "CVE-2025-38377",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38377"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38462",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38462"
},
{
"name": "CVE-2025-38428",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38428"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-38262",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38262"
},
{
"name": "CVE-2025-38138",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38138"
},
{
"name": "CVE-2025-38035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38035"
},
{
"name": "CVE-2025-37759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37759"
},
{
"name": "CVE-2025-38414",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38414"
},
{
"name": "CVE-2025-37933",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37933"
},
{
"name": "CVE-2025-38310",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38310"
},
{
"name": "CVE-2025-37886",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37886"
},
{
"name": "CVE-2025-37963",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37963"
},
{
"name": "CVE-2025-40297",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40297"
},
{
"name": "CVE-2025-38226",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38226"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-38443",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38443"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-37800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37800"
},
{
"name": "CVE-2025-37900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37900"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-37805",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37805"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-37990",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37990"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-38180",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38180"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2025-38145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38145"
},
{
"name": "CVE-2025-37948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37948"
},
{
"name": "CVE-2025-38166",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38166"
},
{
"name": "CVE-2025-37862",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37862"
},
{
"name": "CVE-2025-38321",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38321"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-37960",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37960"
},
{
"name": "CVE-2025-38045",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38045"
},
{
"name": "CVE-2025-38051",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38051"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-37763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37763"
},
{
"name": "CVE-2025-22128",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22128"
},
{
"name": "CVE-2025-37839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37839"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-38277",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38277"
},
{
"name": "CVE-2025-37913",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37913"
},
{
"name": "CVE-2025-39756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39756"
},
{
"name": "CVE-2025-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38539"
},
{
"name": "CVE-2025-38044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38044"
},
{
"name": "CVE-2025-37786",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37786"
},
{
"name": "CVE-2025-38200",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38200"
},
{
"name": "CVE-2025-38480",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38480"
},
{
"name": "CVE-2025-38346",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38346"
},
{
"name": "CVE-2025-37959",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37959"
},
{
"name": "CVE-2025-38191",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38191"
},
{
"name": "CVE-2025-39946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39946"
},
{
"name": "CVE-2025-38062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38062"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2024-56593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56593"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38131",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38131"
},
{
"name": "CVE-2025-37851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37851"
},
{
"name": "CVE-2025-38481",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38481"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2025-38320",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38320"
},
{
"name": "CVE-2025-38625",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38625"
},
{
"name": "CVE-2025-38164",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38164"
},
{
"name": "CVE-2025-38264",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38264"
},
{
"name": "CVE-2025-39676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39676"
},
{
"name": "CVE-2025-37980",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37980"
},
{
"name": "CVE-2025-38280",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38280"
},
{
"name": "CVE-2025-37788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37788"
},
{
"name": "CVE-2025-38427",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38427"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2025-37879",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37879"
},
{
"name": "CVE-2025-38217",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38217"
},
{
"name": "CVE-2025-37881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37881"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39715"
},
{
"name": "CVE-2025-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38569"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2025-37909",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37909"
},
{
"name": "CVE-2025-38700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38700"
},
{
"name": "CVE-2025-37849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37849"
},
{
"name": "CVE-2025-38162",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38162"
},
{
"name": "CVE-2025-38532",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38532"
},
{
"name": "CVE-2025-39712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39712"
},
{
"name": "CVE-2025-37812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37812"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-37875",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37875"
},
{
"name": "CVE-2025-38410",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38410"
},
{
"name": "CVE-2025-39781",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39781"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38020"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-23140",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23140"
},
{
"name": "CVE-2025-23150",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23150"
},
{
"name": "CVE-2025-38460",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38460"
},
{
"name": "CVE-2025-38182",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38182"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2025-38275",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38275"
},
{
"name": "CVE-2025-38345",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38345"
},
{
"name": "CVE-2025-38170",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38170"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-22115",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22115"
},
{
"name": "CVE-2025-22120",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22120"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2022-49267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49267"
},
{
"name": "CVE-2025-38231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38231"
},
{
"name": "CVE-2025-37854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37854"
},
{
"name": "CVE-2025-38473",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38473"
},
{
"name": "CVE-2025-38113",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38113"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-23148",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23148"
},
{
"name": "CVE-2025-38361",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38361"
},
{
"name": "CVE-2025-38470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38470"
},
{
"name": "CVE-2025-38181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38181"
},
{
"name": "CVE-2025-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38391"
},
{
"name": "CVE-2025-38248",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38248"
},
{
"name": "CVE-2025-23147",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23147"
},
{
"name": "CVE-2025-39752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39752"
}
],
"initial_release_date": "2026-03-06T00:00:00",
"last_revision_date": "2026-03-06T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0246",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-03-06T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2026-03-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu LSN-0118-1",
"url": "https://ubuntu.com/security/notices/LSN-0118-1"
},
{
"published_at": "2026-03-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8070-1",
"url": "https://ubuntu.com/security/notices/USN-8070-1"
},
{
"published_at": "2026-03-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8059-7",
"url": "https://ubuntu.com/security/notices/USN-8059-7"
},
{
"published_at": "2026-03-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8060-5",
"url": "https://ubuntu.com/security/notices/USN-8060-5"
},
{
"published_at": "2026-03-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8074-1",
"url": "https://ubuntu.com/security/notices/USN-8074-1"
},
{
"published_at": "2026-03-03",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-7990-6",
"url": "https://ubuntu.com/security/notices/USN-7990-6"
},
{
"published_at": "2026-03-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8070-2",
"url": "https://ubuntu.com/security/notices/USN-8070-2"
},
{
"published_at": "2026-03-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8070-3",
"url": "https://ubuntu.com/security/notices/USN-8070-3"
},
{
"published_at": "2026-03-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8074-2",
"url": "https://ubuntu.com/security/notices/USN-8074-2"
},
{
"published_at": "2026-03-04",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-8060-6",
"url": "https://ubuntu.com/security/notices/USN-8060-6"
}
]
}
CERTFR-2026-AVI-0565
Vulnerability from certfr_avis - Published: 2026-05-12 - Updated: 2026-05-12
De multiples vulnérabilités ont été découvertes dans les produits Siemens. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| Siemens | N/A | SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE XR524-8C, 2x230V (6GK5524-8GS00-4AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W778-1 M12 (6GK5778-1GY00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE W774-1 RJ45 (6GK5774-1FX00-0AA6) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XR552-12M (2HR2) (6GK5552-0AA00-2HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W788-1 M12 (6GK5788-1GD00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC ET 200SP Open Controller CPU 1515SP PC2 (incl. SIPLUS variants) V3 CPUs toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SCALANCE XR524-8C, 1x230V (L3 int.) (6GK5524-8GR00-3AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X208PRO (6GK5208-0HA10-2AA6) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SIMATIC S7-300 CPU 319F-3 PN/DP (6ES7318-3FL01-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE W774-1 RJ45 (6GK5774-1FX00-0AC0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC S7-300 CPU 317F-2 PN/DP (6ES7317-2FK14-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC HMI MTP1000 Unified Comfort Panel (6AV2128-3KB06-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE X224 (6GK5224-0BA00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Comfort Pro for support arm (expandable, round tube) and extension unit (6AV2128-3XB27-0BX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE SC646-2C (6GK5646-2GS00-2AC2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-4M PoE TS (24V, ports on front) (6GK5324-4QG10-1CR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200S IM 151-8F PN/DP CPU (6ES7151-8FB01-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE X310 (6GK5310-0FA00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE WAB762-1 (6GK5762-1AJ00-6AA0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE WAM763-1 (US) (6GK5763-1AL00-7DB0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (24V, ports on rear) (6GK5324-4GG10-1JR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W1788-2 EEC M12 (6GK5788-2GY01-0TA0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on rear) (6GK5324-4GG00-3JR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP Open Controller CPU 1515SP PC2 (incl. SIPLUS variants) V2 CPUs toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SCALANCE XM408-4C (6GK5408-4GP00-2AM2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X302-7 EEC (2x 24V) (6GK5302-7GD00-2EA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE MUM856-1 (B1) (6GK5856-2EA10-3BA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1512SP-1 PN (6ES7512-1DK00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIMATIC S7-300 CPU 319-3 PN/DP (6ES7318-3EL01-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Comfort Pro neutral design for support arm (expandable, round tube) and extensio (6AV2128-3QB57-0BX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE X307-2 EEC (24V) (6GK5307-2FD00-1EA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W734-1 RJ45 (6GK5734-1FX00-0AA6) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE W722-1 RJ45 (6GK5722-1FC00-0AC0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE X308-2 (6GK5308-2FL00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR526-8C, 1x230V (6GK5526-8GS00-3AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Comfort Pro neutral design for support arm (expandable, round tube) and extensio (6AV2128-3XB57-0BX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP700 Unified Comfort Panel (6AV2128-3GB06-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on rear) (6GK5324-4GG10-3JR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-12M (24V, ports on rear) (6GK5324-0GG10-1HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR528-6M (6GK5528-0AA00-2AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP Open Controller CPU 1515SP PC3 V4 CPUs toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Comfort Pro for stand (expandable, flange at the bottom) (6AV2128-3QB27-1BX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Unified Comfort Panel (6AV2128-3QB06-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE M874-2 (6GK5874-2AA00-2AA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SIMATIC CFU PA (6ES7655-5PX11-0XX0) versions antérieures à 2.0.0 | ||
| Siemens | N/A | SCALANCE X307-2 EEC (230V) (6GK5307-2FD00-3EA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W734-1 RJ45 (6GK5734-1FX00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XR526-8C, 24V (6GK5526-8GS00-2AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W786-2 SFP (6GK5786-2FE00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE MUM856-1 (A1) (6GK5856-2EA10-3AA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Unified Comfort Panel neutral design (6AV2128-3QB36-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC CFU PA (6ES7655-5PX11-1XX0) versions antérieures à 2.0.0 | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Unified Comfort Panel hygienic (6AV2128-3QB40-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE W734-1 RJ45 (USA) (6GK5734-1FX00-0AB6) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE X212-2 (6GK5212-2BB00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIPROTEC 5 versions supérieures ou égales à7.80 pour la vulnérabilité CVE-2024-54017 | ||
| Siemens | N/A | SCALANCE W788-2 M12 (6GK5788-2GD00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XF204-2 (6GK5204-2BC00-2AF2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-12M TS (24V) (6GK5324-0GG00-1CR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7-400 CPU 416F-3 PN/DP V7 (6ES7416-3FS07-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR528-6M (2HR2, L3 int.) (6GK5528-0AR00-2HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7-300 CPU 317T-3 PN/DP (6ES7317-7TK10-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE X302-7 EEC (230V, coated) (6GK5302-7GD00-3GA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W1788-2IA M12 (6GK5788-2HY01-0AA0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE XR324-4M PoE (230V, ports on rear) (6GK5324-4QG10-3HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X310FE (6GK5310-0BA00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIPLUS S7-300 CPU 315F-2 PN/DP (6AG1315-2FJ14-2AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Unified Comfort Panel hygienic neutral design (6AV2128-3QB70-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Comfort Pro neutral design for support arm (not extendable, flange on top) (6AV2128-3MB57-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC ET 200pro IM 154-8F PN/DP CPU (6ES7154-8FB01-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR324-4M PoE (24V, ports on rear) (6GK5324-4QG10-1HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1514SPT-2 PN (6ES7514-2VN03-0AB0) toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIMATIC HMI MTP1000 Unified Comfort Panel hygienic neutral design (6AV2128-3KB70-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Comfort Pro for support arm (not extendable, flange on top) (6AV2128-3UB27-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE W721-1 RJ45 (6GK5721-1FC00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Comfort Pro for stand (expandable, flange at the bottom) (6AV2128-3XB27-1BX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC S7 PLCs Web Server versions antérieures à 2.9.9 | ||
| Siemens | N/A | SCALANCE XR324-12M (230V, ports on front) (6GK5324-0GG10-3AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-12M (230V, ports on front) (6GK5324-0GG00-3AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X204-2LD (6GK5204-2BC10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE XR552-12M (2HR2) (6GK5552-0AR00-2HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XF204 (6GK5204-0BA00-2AF2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X308-2M (6GK5308-2GG10-2AA2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7-1500 CPU 1516-3 PN/DP (6ES7516-3AN00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Comfort Pro neutral design for support arm (not extendable, flange on top) (6AV2128-3UB57-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (2x 24V, ports on rear) (6GK5324-4GG10-2JR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W788-1 RJ45 (6GK5788-1FC00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE W778-1 M12 EEC (USA) (6GK5778-1GY00-0TB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC S7-1500 CPU 1516F-3 PN/DP (6ES7516-3FN00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC S7-300 CPU 315F-2 PN/DP (6ES7315-2FJ14-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR552-12M (2HR2, L3 int.) (6GK5552-0AR00-2AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W788-2 RJ45 (6GK5788-2FC00-0AC0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1514SP-2 PN (6ES7514-2DN03-0AB0) toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIPROTEC 5 versions supérieures ou égales à7.80 et versions antérieures à 11.0 | ||
| Siemens | N/A | SCALANCE MUM853-1 (A1) (6GK5853-2EA10-2AA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE WAM766-1 EEC (US) (6GK5766-1GE00-7TB0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE XR524-8C, 2x230V (L3 int.) (6GK5524-8GR00-4AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X307-3 (6GK5307-3BL10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Unified Comfort Panel (6AV2128-3UB06-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE WAM766-1 (6GK5766-1GE00-7DA0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SIMATIC CN 4100 versions antérieures à 5.0 | ||
| Siemens | N/A | SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2) versions antérieures à 8.3 | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Comfort Pro neutral design for stand (expandable, flange at the bottom) (6AV2128-3QB57-1BX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC S7-400 CPU 414-3 PN/DP V7 (6ES7414-3EM07-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE M874-3 3G-Router (CN) (6GK5874-3AA00-2FA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE MUB852-1 (A1) (6GK5852-1EA10-1AA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE X308-2M (6GK5308-2GG00-2AA2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Unified Comfort Panel (6AV2128-3XB06-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on front) (6GK5324-4GG00-4ER2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE MUB852-1 (B1) (6GK5852-1EA10-1BA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE X204-2 (6GK5204-2BB10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X212-2LD (6GK5212-2BC00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE WAM766-1 EEC (ME) (6GK5766-1GE00-7TC0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Comfort Pro for support arm (expandable, round tube) and extension unit (6AV2128-3QB27-0BX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE W786-2 RJ45 (6GK5786-2FC00-0AC0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Comfort Pro neutral design for support arm (not extendable, flange on top) (6AV2128-3XB57-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1512SP F-1 PN (6ES7512-1SK01-0AB0) versions antérieures à 2.9.9 | ||
| Siemens | N/A | SCALANCE XR552-12M (6GK5552-0AA00-2AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR526-8C, 24V (L3 int.) (6GK5526-8GR00-2AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W774-1 RJ45 (6GK5774-1FX00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Unified Comfort Panel neutral design (6AV2128-3XB36-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Unified Comfort Panel hygienic (6AV2128-3UB40-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1510SP-1 PN (6ES7510-1DJ00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC S7-300 CPU 315T-3 PN/DP (6ES7315-7TJ10-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE WUM766-1 (USA) (6GK5766-1GE00-3DB0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Comfort Pro neutral design for support arm (not extendable, flange on top) (6AV2128-3QB57-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE W721-1 RJ45 (6GK5721-1FC00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC ET 200pro IM 154-8FX PN/DP CPU (6ES7154-8FX00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE W786-1 RJ45 (6GK5786-1FC00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE WUM766-1 (ME) (6GK5766-1GE00-3DC0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE W786-2IA RJ45 (6GK5786-2HC00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1512SP-1 PN (6ES7512-1DK00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR524-8C, 24V (L3 int.) (6GK5524-8GR00-2AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1512SP-1 PN (6ES7512-1DK01-0AB0) versions antérieures à 2.9.9 | ||
| Siemens | N/A | SIMATIC HMI MTP1000, Unified Comfort Panel neutral (6AV2128-3KB36-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE M876-4 (6GK5876-4AA10-2BA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE XR324-4M PoE TS (24V, ports on front) (6GK5324-4QG00-1CR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE WUM763-1 (6GK5763-1AL00-3AA0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SIMATIC S7-400 H V6 CPU family (incl. SIPLUS variants) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE X308-2LH (6GK5308-2FN10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W774-1 M12 EEC (6GK5774-1FY00-0TA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE WUM766-1 (6GK5766-1GE00-3DA0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Unified Comfort Panel hygienic neutral design (6AV2128-3UB70-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC S7 PLCs Web Server versions antérieures à 3.1.6 | ||
| Siemens | N/A | SCALANCE W738-1 M12 (6GK5738-1GY00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE X307-2 EEC (2x 230V) (6GK5307-2FD00-4EA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X307-2 EEC (24V, coated) (6GK5307-2FD00-1GA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1512SP F-1 PN (6ES7512-1SM03-0AB0) toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SCALANCE X307-3 (6GK5307-3BL00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7-1500 CPU 1513-1 PN (6ES7513-1AL00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1510SP F-1 PN (6ES7510-1SJ01-0AB0) versions antérieures à 2.9.9 | ||
| Siemens | N/A | SCALANCE XR324-12M (230V, ports on rear) (6GK5324-0GG10-3HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W748-1 RJ45 (6GK5748-1FC00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE X308-2M TS (6GK5308-2GG00-2CA2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W788-2 M12 (6GK5788-2GD00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE W788-2 M12 EEC (6GK5788-2GD00-0TB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE X204-2FM (6GK5204-2BB11-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIPLUS S7-300 CPU 317-2 PN/DP (6AG1317-2EK14-7AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC ET 200SP Open Controller CPU 1515SP PC (incl. SIPLUS variants) toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SCALANCE X304-2FE (6GK5304-2BD00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7-400 CPU 414F-3 PN/DP V7 (6ES7414-3FM07-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC S7-300 CPU 314C-2 PN/DP (6ES7314-6EH04-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE X308-2LH (6GK5308-2FN00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE MUM853-1 (B1) (6GK5853-2EA10-2BA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (24V, ports on rear) (6GK5324-4GG00-1JR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (2x 24V, ports on rear) (6GK5324-4GG00-2JR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7 PLCs Web Server toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIMATIC ET 200pro IM 154-8 PN/DP CPU (6ES7154-8AB01-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Unified Comfort Panel hygienic neutral design (6AV2128-3MB70-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE WAM763-1 (ME) (6GK5763-1AL00-7DC0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE X208 (6GK5208-0BA10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X302-7 EEC (2x 230V, coated) (6GK5302-7GD00-4GA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XM416-4C (6GK5416-4GS00-2AM2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE WUB762-1 (6GK5762-1AJ00-1AA0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE X302-7 EEC (24V, coated) (6GK5302-7GD00-1GA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X302-7 EEC (2x 24V, coated) (6GK5302-7GD00-2GA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W761-1 RJ45 (6GK5761-1FC00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE X308-2M TS (6GK5308-2GG10-2CA2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR528-6M (2HR2) (6GK5528-0AA00-2HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X206-1 (6GK5206-1BB10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Comfort Pro for support arm (expandable, round tube) and extension unit (6AV2128-3MB27-0BX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE M876-3 (6GK5876-3AA02-2BA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE XM416-4C (L3 int.) (6GK5416-4GR00-2AM2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X308-2LH+ (6GK5308-2FP10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W748-1 M12 (6GK5748-1GD00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC HMI MTP1500 Comfort Pro for support arm (not extendable, flange on top) (6AV2128-3QB27-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC S7-410 V8 CPU family (incl. SIPLUS variants) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE W774-1 RJ45 (USA) (6GK5774-1FX00-0AB6) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC Drive Controller CPU 1504D TF (6ES7615-4DF10-0AB0) versions antérieures à 3.1.6 | ||
| Siemens | N/A | SCALANCE X302-7 EEC (230V) (6GK5302-7GD00-3EA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Unified Comfort Hygienic neutral design (6AV2128-3XB70-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE X320-1-2LD FE (6GK5320-3BF00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE SC626-2C (6GK5626-2GS00-2AC2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W788-1 RJ45 (6GK5788-1FC00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Unified Comfort Panel neutral design (6AV2128-3UB36-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP700 Unified Comfort Panel hygienic neutral design (6AV2128-3GB40-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE X310 (6GK5310-0FA10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X307-2 EEC (2x 24V) (6GK5307-2FD00-2EA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (2x 24V, ports on front) (6GK5324-4GG00-2ER2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7-300 CPU 317-2 PN/DP (6ES7317-2EK14-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC HMI MTP700 Unified Comfort Panel hygienic neutral design (6AV2128-3GB70-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE W786-2 RJ45 (6GK5786-2FC00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1510SP F-1 PN (6ES7510-1SJ00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SCALANCE X307-2 EEC (230V, coated) (6GK5307-2FD00-3GA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Comfort Pro for stand (expandable, flange at the bottom) (6AV2128-3UB27-1BX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE W786-2 RJ45 (6GK5786-2FC00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XR526-8C, 1x230V (L3 int.) (6GK5526-8GR00-3AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE WAM763-1 (6GK5763-1AL00-7DA0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE X408-2 (6GK5408-2FD00-2AA2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIPROTEC 5 versions antérieures à 11.0 | ||
| Siemens | N/A | SCALANCE X308-2LD (6GK5308-2FM00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-12M (24V, ports on front) (6GK5324-0GG10-1AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE WUB762-1 iFeatures (6GK5762-1AJ00-2AA0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE XR528-6M (L3 int.) (6GK5528-0AR00-2AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X310FE (6GK5310-0BA10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Comfort Pro for support arm (not extendable, flange on top) (6AV2128-3MB27-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP700, Unified Comfort Panel neutral design (6AV2128-3GB36-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (2x 24V, ports on front) (6GK5324-4GG10-2ER2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W748-1 RJ45 (6GK5748-1FC00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XM408-8C (L3 int.) (6GK5408-8GR00-2AM2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on front) (6GK5324-4GG10-3ER2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7 PLCs Web Server toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIMATIC S7-400 CPU 412-2 PN V7 (6ES7412-2EK07-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE W786-2IA RJ45 (6GK5786-2HC00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC S7-1500 CPU 1511F-1 PN (6ES7511-1FK00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE X308-2LD (6GK5308-2FM10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X306-1LD FE (6GK5306-1BF00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-4M PoE (24V, ports on front) (6GK5324-4QG10-1AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W778-1 M12 EEC (6GK5778-1GY00-0TA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIPLUS S7-400 CPU 416-3 PN/DP V7 (6AG1416-3ES07-7AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1510SP F-1 PN (6ES7510-1SK03-0AB0) toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIPLUS S7-300 CPU 315-2 PN/DP (6AG1315-2EH14-7AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Comfort Pro neutral design for support arm (expandable, round tube) and extensio (6AV2128-3MB57-0BX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE WAM766-1 (US) (6GK5766-1GE00-7DB0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SIPLUS S7-300 CPU 314C-2 PN/DP (6AG1314-6EH04-7AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE M874-3 (6GK5874-3AA00-2AA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE XR324-12M TS (24V) (6GK5324-0GG10-1CR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1510SP F-1 PN (6ES7510-1SJ00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE W774-1 M12 EEC (6GK5774-1FY00-0TB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE MUM856-1 (CN) (6GK5856-2EA00-3FA1) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE W738-1 M12 (6GK5738-1GY00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XR324-4M PoE (230V, ports on rear) (6GK5324-4QG00-3HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE WAM766-1 (ME) (6GK5766-1GE00-7DC0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SIMATIC ET 200SP HA IM155-6 PN versions antérieures à 1.3 | ||
| Siemens | N/A | SCALANCE SC642-2C (6GK5642-2GS00-2AC2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W788-2 M12 EEC (6GK5788-2GD00-0TC0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE W788-1 M12 (6GK5788-1GD00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on rear) (6GK5324-4GG10-4JR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X308-2 RD (inkl. SIPLUS variants) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X307-3LD (6GK5307-3BM10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Comfort Pro for support arm (not extendable, flange on top) (6AV2128-3XB27-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE XR324-4M PoE (230V, ports on front) (6GK5324-4QG00-3AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Comfort Pro neutral design for stand (expandable, flange at the bottom) (6AV2128-3XB57-1BX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE X302-7 EEC (2x 230V) (6GK5302-7GD00-4EA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W786-1 RJ45 (6GK5786-1FC00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC S7-410 V10 CPU family (incl. SIPLUS variants) versions antérieures à 10.2 | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Comfort Pro neutral design for stand (expandable, flange at the bottom) (6AV2128-3UB57-1BX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1512SP F-1 PN (6ES7512-1SK00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIPLUS S7-300 CPU 317F-2 PN/DP (6AG1317-2FK14-2AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE WUM763-1 (US) (6GK5763-1AL00-3AB0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE XF206-1 (6GK5206-1BC00-2AF2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1510SP-1 PN (6ES7510-1DJ00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SCALANCE X308-2M PoE (6GK5308-2QG10-2AA2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC Drive Controller CPU 1507D TF (6ES7615-7DF10-0AB0) versions antérieures à 3.1.6 | ||
| Siemens | N/A | SCALANCE XR524-8C, 1x230V (6GK5524-8GS00-3AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE SC632-2C (6GK5632-2GS00-2AC2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7-1500 CPU 1515-2 PN (6ES7515-2AM00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR526-8C, 2x230V (6GK5526-8GS00-4AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X307-3LD (6GK5307-3BM00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X308-2M PoE (6GK5308-2QG00-2AA2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XM408-4C (L3 int.) (6GK5408-4GQ00-2AM2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7-300 CPU 317TF-3 PN/DP (6ES7317-7UL10-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR324-4M PoE (24V, ports on front) (6GK5324-4QG00-1AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1512SP F-1 PN (6ES7512-1SK00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC HMI MTP2200 Unified Comfort Hygienic (6AV2128-3XB40-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC ET 200S IM 151-8 PN/DP CPU (6ES7151-8AB01-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE X320-1 FE (6GK5320-1BD00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X216 (6GK5216-0BA00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1514SP F-2 PN (6ES7514-2SN03-0AB0) toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIMATIC S7-300 CPU 315-2 PN/DP (6ES7315-2EH14-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on front) (6GK5324-4GG10-4ER2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC CFU DIQ (6ES7655-5PX31-1XX0) versions antérieures à 2.0.0 | ||
| Siemens | N/A | SCALANCE W722-1 RJ45 (6GK5722-1FC00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on rear) (6GK5324-4GG00-4JR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W1748-1 M12 (6GK5748-1GY01-0TA0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Unified Comfort Panel (6AV2128-3MB06-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on front) (6GK5324-4GG00-3ER2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Unified Comfort Panel hygienic (6AV2128-3MB40-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE SC636-2C (6GK5636-2GS00-2AC2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1510SP-1 PN (6ES7510-1DJ01-0AB0) versions antérieures à 2.9.9 | ||
| Siemens | N/A | SCALANCE W774-1 RJ45 (6GK5774-1FX00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (24V, ports on front) (6GK5324-4GG10-1ER2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIPLUS S7-400 CPU 414-3 PN/DP V7 (6AG1414-3EM07-7AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE W734-1 RJ45 (6GK5734-1FX00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE W788-2 RJ45 (6GK5788-2FC00-0AB0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XR324-4M PoE (24V, ports on rear) (6GK5324-4QG00-1HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W788-2 M12 EEC (6GK5788-2GD00-0TA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC S7-1500 CPU 1515F-2 PN (6ES7515-2FM00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR324-12M (24V, ports on front) (6GK5324-0GG00-1AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-4M EEC (24V, ports on front) (6GK5324-4GG00-1ER2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W1788-2 M12 (6GK5788-2GY01-0AA0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SIMATIC HMI MTP1000 Unified Comfort Panel hygienic (6AV2128-3KB40-0AX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Comfort Pro for stand (expandable, flange at the bottom) (6AV2128-3MB27-1BX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE X206-1LD (6GK5206-1BC10-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W761-1 RJ45 (6GK5761-1FC00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE X302-7 EEC (24V) (6GK5302-7GD00-1EA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1510SP-1 PN (6ES7510-1DK03-0AB0) toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SCALANCE X308-2LH+ (6GK5308-2FP00-2AA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-4M PoE (230V, ports on front) (6GK5324-4QG10-3AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W786-2 SFP (6GK5786-2FE00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE W1748-1 M12 (6GK5748-1GY01-0AA0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XR524-8C, 24V (6GK5524-8GS00-2AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1514SPT F-2 PN (6ES7514-2WN03-0AB0) toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SCALANCE WUM763-1 (US) (6GK5763-1AL00-3DB0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE XR526-8C, 2x230V (L3 int.) (6GK5526-8GR00-4AR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W788-2 RJ45 (6GK5788-2FC00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE XR324-12M (24V, ports on rear) (6GK5324-0GG00-1HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE SC622-2C (6GK5622-2GS00-2AC2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC S7-1500 CPU 1511-1 PN (6ES7511-1AK00-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE XF208 (6GK5208-0BA00-2AF2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE XR324-12M (230V, ports on rear) (6GK5324-0GG00-3HR2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE WUM763-1 (6GK5763-1AL00-3DA0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Unified Comfort Panel neutral design (6AV2128-3MB36-0AX1) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE X307-2 EEC (2x 24V, coated) (6GK5307-2FD00-2GA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SIMATIC HMI MTP1200 Comfort Pro neutral design for stand (expandable, flange at the bottom) (6AV2128-3MB57-1BX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Comfort Pro for support arm (expandable, round tube) and extension unit (6AV2128-3UB27-0BX0) versions antérieures à 21 | ||
| Siemens | N/A | SIMATIC HMI MTP1900 Comfort Pro neutral design for support arm (expandable, round tube) and extensio (6AV2128-3UB57-0BX0) versions antérieures à 21 | ||
| Siemens | N/A | SCALANCE XM408-8C (6GK5408-8GS00-2AM2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE WAM766-1 EEC (6GK5766-1GE00-7TA0) versions antérieures à 3.2.0 | ||
| Siemens | N/A | SCALANCE W722-1 RJ45 (6GK5722-1FC00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE W748-1 M12 (6GK5748-1GD00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SIMATIC ET 200SP CPU 1512SP-1 PN (6ES7512-1DM03-0AB0) toutes versions pour les vulnérabilités CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789. | ||
| Siemens | N/A | SIMATIC S7-400 CPU 416-3 PN/DP V7 (6ES7416-3ES07-0AB0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE X204-2TS (6GK5204-2BB10-2CA2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE W778-1 M12 (6GK5778-1GY00-0AA0) versions antérieures à 6.6.0 | ||
| Siemens | N/A | SCALANCE W1788-1 M12 (6GK5788-1GY01-0AA0) toutes versions. L'éditeur indique que le produit ne bénéficiera pas de correctif de sécurité pour la vulnérabilité CVE-2025-40833. | ||
| Siemens | N/A | SCALANCE M804PB (6GK5804-0AP00-2AA2) versions antérieures à 8.3 | ||
| Siemens | N/A | SCALANCE X204-2LD TS (6GK5204-2BC10-2CA2) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE X307-2 EEC (2x 230V, coated) (6GK5307-2FD00-4GA3) toutes versions pour la vulnérabilité CVE-2025-40833 | ||
| Siemens | N/A | SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2) versions antérieures à 8.3 |
| Title | Publication Time | Tags | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SCALANCE S615 EEC LAN-Router (6GK5615-0AA01-2AA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR524-8C, 2x230V (6GK5524-8GS00-4AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W778-1 M12 (6GK5778-1GY00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W774-1 RJ45 (6GK5774-1FX00-0AA6) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR552-12M (2HR2) (6GK5552-0AA00-2HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-1 M12 (6GK5788-1GD00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP Open Controller CPU 1515SP PC2 (incl. SIPLUS variants) V3 CPUs toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR524-8C, 1x230V (L3 int.) (6GK5524-8GR00-3AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X208PRO (6GK5208-0HA10-2AA6) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUM853-1 (EU) (6GK5853-2EA00-2DA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 319F-3 PN/DP (6ES7318-3FL01-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W774-1 RJ45 (6GK5774-1FX00-0AC0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 317F-2 PN/DP (6ES7317-2FK14-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1000 Unified Comfort Panel (6AV2128-3KB06-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X224 (6GK5224-0BA00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Comfort Pro for support arm (expandable, round tube) and extension unit (6AV2128-3XB27-0BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE SC646-2C (6GK5646-2GS00-2AC2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE TS (24V, ports on front) (6GK5324-4QG10-1CR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200S IM 151-8F PN/DP CPU (6ES7151-8FB01-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X310 (6GK5310-0FA00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAB762-1 (6GK5762-1AJ00-6AA0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M812-1 ADSL-Router (6GK5812-1BA00-2AA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAM763-1 (US) (6GK5763-1AL00-7DB0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (24V, ports on rear) (6GK5324-4GG10-1JR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W1788-2 EEC M12 (6GK5788-2GY01-0TA0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on rear) (6GK5324-4GG00-3JR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP Open Controller CPU 1515SP PC2 (incl. SIPLUS variants) V2 CPUs toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XM408-4C (6GK5408-4GP00-2AM2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X302-7 EEC (2x 24V) (6GK5302-7GD00-2EA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUM856-1 (B1) (6GK5856-2EA10-3BA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1512SP-1 PN (6ES7512-1DK00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 319-3 PN/DP (6ES7318-3EL01-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M816-1 ADSL-Router (6GK5816-1AA00-2AA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Comfort Pro neutral design for support arm (expandable, round tube) and extensio (6AV2128-3QB57-0BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-2 EEC (24V) (6GK5307-2FD00-1EA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W734-1 RJ45 (6GK5734-1FX00-0AA6) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W722-1 RJ45 (6GK5722-1FC00-0AC0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2 (6GK5308-2FL00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR526-8C, 1x230V (6GK5526-8GS00-3AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Comfort Pro neutral design for support arm (expandable, round tube) and extensio (6AV2128-3XB57-0BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP700 Unified Comfort Panel (6AV2128-3GB06-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on rear) (6GK5324-4GG10-3JR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M (24V, ports on rear) (6GK5324-0GG10-1HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR528-6M (6GK5528-0AA00-2AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP Open Controller CPU 1515SP PC3 V4 CPUs toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Comfort Pro for stand (expandable, flange at the bottom) (6AV2128-3QB27-1BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Unified Comfort Panel (6AV2128-3QB06-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M874-2 (6GK5874-2AA00-2AA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC CFU PA (6ES7655-5PX11-0XX0) versions ant\u00e9rieures \u00e0 2.0.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-2 EEC (230V) (6GK5307-2FD00-3EA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W734-1 RJ45 (6GK5734-1FX00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR526-8C, 24V (6GK5526-8GS00-2AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W786-2 SFP (6GK5786-2FE00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUM856-1 (A1) (6GK5856-2EA10-3AA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Unified Comfort Panel neutral design (6AV2128-3QB36-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC CFU PA (6ES7655-5PX11-1XX0) versions ant\u00e9rieures \u00e0 2.0.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Unified Comfort Panel hygienic (6AV2128-3QB40-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W734-1 RJ45 (USA) (6GK5734-1FX00-0AB6) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X212-2 (6GK5212-2BB00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPROTEC 5 versions sup\u00e9rieures ou \u00e9gales \u00e07.80 pour la vuln\u00e9rabilit\u00e9 CVE-2024-54017",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-2 M12 (6GK5788-2GD00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XF204-2 (6GK5204-2BC00-2AF2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M TS (24V) (6GK5324-0GG00-1CR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-400 CPU 416F-3 PN/DP V7 (6ES7416-3FS07-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR528-6M (2HR2, L3 int.) (6GK5528-0AR00-2HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 317T-3 PN/DP (6ES7317-7TK10-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X302-7 EEC (230V, coated) (6GK5302-7GD00-3GA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W1788-2IA M12 (6GK5788-2HY01-0AA0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M876-4 (EU) (6GK5876-4AA00-2BA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE (230V, ports on rear) (6GK5324-4QG10-3HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X310FE (6GK5310-0BA00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPLUS S7-300 CPU 315F-2 PN/DP (6AG1315-2FJ14-2AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Unified Comfort Panel hygienic neutral design (6AV2128-3QB70-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Comfort Pro neutral design for support arm (not extendable, flange on top) (6AV2128-3MB57-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200pro IM 154-8F PN/DP CPU (6ES7154-8FB01-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE (24V, ports on rear) (6GK5324-4QG10-1HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1514SPT-2 PN (6ES7514-2VN03-0AB0) toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1000 Unified Comfort Panel hygienic neutral design (6AV2128-3KB70-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Comfort Pro for support arm (not extendable, flange on top) (6AV2128-3UB27-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W721-1 RJ45 (6GK5721-1FC00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Comfort Pro for stand (expandable, flange at the bottom) (6AV2128-3XB27-1BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 PLCs Web Server versions ant\u00e9rieures \u00e0 2.9.9",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M (230V, ports on front) (6GK5324-0GG10-3AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M (230V, ports on front) (6GK5324-0GG00-3AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X204-2LD (6GK5204-2BC10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M876-3 (ROK) (6GK5876-3AA02-2EA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR552-12M (2HR2) (6GK5552-0AR00-2HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XF204 (6GK5204-0BA00-2AF2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2M (6GK5308-2GG10-2AA2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 CPU 1516-3 PN/DP (6ES7516-3AN00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Comfort Pro neutral design for support arm (not extendable, flange on top) (6AV2128-3UB57-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (2x 24V, ports on rear) (6GK5324-4GG10-2JR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-1 RJ45 (6GK5788-1FC00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W778-1 M12 EEC (USA) (6GK5778-1GY00-0TB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 CPU 1516F-3 PN/DP (6ES7516-3FN00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 315F-2 PN/DP (6ES7315-2FJ14-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR552-12M (2HR2, L3 int.) (6GK5552-0AR00-2AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-2 RJ45 (6GK5788-2FC00-0AC0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1514SP-2 PN (6ES7514-2DN03-0AB0) toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPROTEC 5 versions sup\u00e9rieures ou \u00e9gales \u00e07.80 et versions ant\u00e9rieures \u00e0 11.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUM853-1 (A1) (6GK5853-2EA10-2AA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAM766-1 EEC (US) (6GK5766-1GE00-7TB0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M816-1 ADSL-Router (6GK5816-1BA00-2AA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR524-8C, 2x230V (L3 int.) (6GK5524-8GR00-4AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-3 (6GK5307-3BL10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Unified Comfort Panel (6AV2128-3UB06-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAM766-1 (6GK5766-1GE00-7DA0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC CN 4100 versions ant\u00e9rieures \u00e0 5.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M826-2 SHDSL-Router (6GK5826-2AB00-2AB2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Comfort Pro neutral design for stand (expandable, flange at the bottom) (6AV2128-3QB57-1BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-400 CPU 414-3 PN/DP V7 (6ES7414-3EM07-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M874-3 3G-Router (CN) (6GK5874-3AA00-2FA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUB852-1 (A1) (6GK5852-1EA10-1AA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2M (6GK5308-2GG00-2AA2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Unified Comfort Panel (6AV2128-3XB06-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on front) (6GK5324-4GG00-4ER2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUB852-1 (B1) (6GK5852-1EA10-1BA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X204-2 (6GK5204-2BB10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X212-2LD (6GK5212-2BC00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAM766-1 EEC (ME) (6GK5766-1GE00-7TC0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Comfort Pro for support arm (expandable, round tube) and extension unit (6AV2128-3QB27-0BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W786-2 RJ45 (6GK5786-2FC00-0AC0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Comfort Pro neutral design for support arm (not extendable, flange on top) (6AV2128-3XB57-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1512SP F-1 PN (6ES7512-1SK01-0AB0) versions ant\u00e9rieures \u00e0 2.9.9",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR552-12M (6GK5552-0AA00-2AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR526-8C, 24V (L3 int.) (6GK5526-8GR00-2AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W774-1 RJ45 (6GK5774-1FX00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Unified Comfort Panel neutral design (6AV2128-3XB36-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Unified Comfort Panel hygienic (6AV2128-3UB40-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1510SP-1 PN (6ES7510-1DJ00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 315T-3 PN/DP (6ES7315-7TJ10-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WUM766-1 (USA) (6GK5766-1GE00-3DB0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Comfort Pro neutral design for support arm (not extendable, flange on top) (6AV2128-3QB57-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W721-1 RJ45 (6GK5721-1FC00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200pro IM 154-8FX PN/DP CPU (6ES7154-8FX00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W786-1 RJ45 (6GK5786-1FC00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WUM766-1 (ME) (6GK5766-1GE00-3DC0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W786-2IA RJ45 (6GK5786-2HC00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1512SP-1 PN (6ES7512-1DK00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR524-8C, 24V (L3 int.) (6GK5524-8GR00-2AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1512SP-1 PN (6ES7512-1DK01-0AB0) versions ant\u00e9rieures \u00e0 2.9.9",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1000, Unified Comfort Panel neutral (6AV2128-3KB36-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M876-4 (6GK5876-4AA10-2BA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE TS (24V, ports on front) (6GK5324-4QG00-1CR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WUM763-1 (6GK5763-1AL00-3AA0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-400 H V6 CPU family (incl. SIPLUS variants) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUM856-1 (EU) (6GK5856-2EA00-3DA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2LH (6GK5308-2FN10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W774-1 M12 EEC (6GK5774-1FY00-0TA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WUM766-1 (6GK5766-1GE00-3DA0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Unified Comfort Panel hygienic neutral design (6AV2128-3UB70-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 PLCs Web Server versions ant\u00e9rieures \u00e0 3.1.6",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W738-1 M12 (6GK5738-1GY00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-2 EEC (2x 230V) (6GK5307-2FD00-4EA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-2 EEC (24V, coated) (6GK5307-2FD00-1GA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1512SP F-1 PN (6ES7512-1SM03-0AB0) toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-3 (6GK5307-3BL00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 CPU 1513-1 PN (6ES7513-1AL00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1510SP F-1 PN (6ES7510-1SJ01-0AB0) versions ant\u00e9rieures \u00e0 2.9.9",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M (230V, ports on rear) (6GK5324-0GG10-3HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W748-1 RJ45 (6GK5748-1FC00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2M TS (6GK5308-2GG00-2CA2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-2 M12 (6GK5788-2GD00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-2 M12 EEC (6GK5788-2GD00-0TB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X204-2FM (6GK5204-2BB11-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPLUS S7-300 CPU 317-2 PN/DP (6AG1317-2EK14-7AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP Open Controller CPU 1515SP PC (incl. SIPLUS variants) toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X304-2FE (6GK5304-2BD00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-400 CPU 414F-3 PN/DP V7 (6ES7414-3FM07-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 314C-2 PN/DP (6ES7314-6EH04-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2LH (6GK5308-2FN00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUM853-1 (B1) (6GK5853-2EA10-2BA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M812-1 ADSL-Router (6GK5812-1AA00-2AA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (24V, ports on rear) (6GK5324-4GG00-1JR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (2x 24V, ports on rear) (6GK5324-4GG00-2JR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 PLCs Web Server toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200pro IM 154-8 PN/DP CPU (6ES7154-8AB01-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Unified Comfort Panel hygienic neutral design (6AV2128-3MB70-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAM763-1 (ME) (6GK5763-1AL00-7DC0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X208 (6GK5208-0BA10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X302-7 EEC (2x 230V, coated) (6GK5302-7GD00-4GA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XM416-4C (6GK5416-4GS00-2AM2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WUB762-1 (6GK5762-1AJ00-1AA0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X302-7 EEC (24V, coated) (6GK5302-7GD00-1GA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X302-7 EEC (2x 24V, coated) (6GK5302-7GD00-2GA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W761-1 RJ45 (6GK5761-1FC00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2M TS (6GK5308-2GG10-2CA2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR528-6M (2HR2) (6GK5528-0AA00-2HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X206-1 (6GK5206-1BB10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Comfort Pro for support arm (expandable, round tube) and extension unit (6AV2128-3MB27-0BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M876-3 (6GK5876-3AA02-2BA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XM416-4C (L3 int.) (6GK5416-4GR00-2AM2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2LH+ (6GK5308-2FP10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W748-1 M12 (6GK5748-1GD00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1500 Comfort Pro for support arm (not extendable, flange on top) (6AV2128-3QB27-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-410 V8 CPU family (incl. SIPLUS variants) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W774-1 RJ45 (USA) (6GK5774-1FX00-0AB6) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Drive Controller CPU 1504D TF (6ES7615-4DF10-0AB0) versions ant\u00e9rieures \u00e0 3.1.6",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X302-7 EEC (230V) (6GK5302-7GD00-3EA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Unified Comfort Hygienic neutral design (6AV2128-3XB70-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X320-1-2LD FE (6GK5320-3BF00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE SC626-2C (6GK5626-2GS00-2AC2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-1 RJ45 (6GK5788-1FC00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Unified Comfort Panel neutral design (6AV2128-3UB36-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP700 Unified Comfort Panel hygienic neutral design (6AV2128-3GB40-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X310 (6GK5310-0FA10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-2 EEC (2x 24V) (6GK5307-2FD00-2EA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (2x 24V, ports on front) (6GK5324-4GG00-2ER2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 317-2 PN/DP (6ES7317-2EK14-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP700 Unified Comfort Panel hygienic neutral design (6AV2128-3GB70-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W786-2 RJ45 (6GK5786-2FC00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1510SP F-1 PN (6ES7510-1SJ00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-2 EEC (230V, coated) (6GK5307-2FD00-3GA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Comfort Pro for stand (expandable, flange at the bottom) (6AV2128-3UB27-1BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W786-2 RJ45 (6GK5786-2FC00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR526-8C, 1x230V (L3 int.) (6GK5526-8GR00-3AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAM763-1 (6GK5763-1AL00-7DA0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X408-2 (6GK5408-2FD00-2AA2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPROTEC 5 versions ant\u00e9rieures \u00e0 11.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2LD (6GK5308-2FM00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M (24V, ports on front) (6GK5324-0GG10-1AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WUB762-1 iFeatures (6GK5762-1AJ00-2AA0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR528-6M (L3 int.) (6GK5528-0AR00-2AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X310FE (6GK5310-0BA10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Comfort Pro for support arm (not extendable, flange on top) (6AV2128-3MB27-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP700, Unified Comfort Panel neutral design (6AV2128-3GB36-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (2x 24V, ports on front) (6GK5324-4GG10-2ER2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W748-1 RJ45 (6GK5748-1FC00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XM408-8C (L3 int.) (6GK5408-8GR00-2AM2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on front) (6GK5324-4GG10-3ER2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7 PLCs Web Server toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-400 CPU 412-2 PN V7 (6ES7412-2EK07-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W786-2IA RJ45 (6GK5786-2HC00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 CPU 1511F-1 PN (6ES7511-1FK00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2LD (6GK5308-2FM10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X306-1LD FE (6GK5306-1BF00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE (24V, ports on front) (6GK5324-4QG10-1AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W778-1 M12 EEC (6GK5778-1GY00-0TA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPLUS S7-400 CPU 416-3 PN/DP V7 (6AG1416-3ES07-7AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1510SP F-1 PN (6ES7510-1SK03-0AB0) toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPLUS S7-300 CPU 315-2 PN/DP (6AG1315-2EH14-7AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUM856-1 (RoW) (6GK5856-2EA00-3AA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Comfort Pro neutral design for support arm (expandable, round tube) and extensio (6AV2128-3MB57-0BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAM766-1 (US) (6GK5766-1GE00-7DB0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPLUS S7-300 CPU 314C-2 PN/DP (6AG1314-6EH04-7AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M874-3 (6GK5874-3AA00-2AA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M TS (24V) (6GK5324-0GG10-1CR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1510SP F-1 PN (6ES7510-1SJ00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W774-1 M12 EEC (6GK5774-1FY00-0TB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE MUM856-1 (CN) (6GK5856-2EA00-3FA1) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W738-1 M12 (6GK5738-1GY00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE (230V, ports on rear) (6GK5324-4QG00-3HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAM766-1 (ME) (6GK5766-1GE00-7DC0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP HA IM155-6 PN versions ant\u00e9rieures \u00e0 1.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE SC642-2C (6GK5642-2GS00-2AC2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-2 M12 EEC (6GK5788-2GD00-0TC0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-1 M12 (6GK5788-1GD00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on rear) (6GK5324-4GG10-4JR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2 RD (inkl. SIPLUS variants) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-3LD (6GK5307-3BM10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Comfort Pro for support arm (not extendable, flange on top) (6AV2128-3XB27-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE (230V, ports on front) (6GK5324-4QG00-3AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Comfort Pro neutral design for stand (expandable, flange at the bottom) (6AV2128-3XB57-1BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X302-7 EEC (2x 230V) (6GK5302-7GD00-4EA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W786-1 RJ45 (6GK5786-1FC00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-410 V10 CPU family (incl. SIPLUS variants) versions ant\u00e9rieures \u00e0 10.2",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Comfort Pro neutral design for stand (expandable, flange at the bottom) (6AV2128-3UB57-1BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1512SP F-1 PN (6ES7512-1SK00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPLUS S7-300 CPU 317F-2 PN/DP (6AG1317-2FK14-2AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WUM763-1 (US) (6GK5763-1AL00-3AB0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XF206-1 (6GK5206-1BC00-2AF2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1510SP-1 PN (6ES7510-1DJ00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2M PoE (6GK5308-2QG10-2AA2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC Drive Controller CPU 1507D TF (6ES7615-7DF10-0AB0) versions ant\u00e9rieures \u00e0 3.1.6",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR524-8C, 1x230V (6GK5524-8GS00-3AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE SC632-2C (6GK5632-2GS00-2AC2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 CPU 1515-2 PN (6ES7515-2AM00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR526-8C, 2x230V (6GK5526-8GS00-4AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-3LD (6GK5307-3BM00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2M PoE (6GK5308-2QG00-2AA2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XM408-4C (L3 int.) (6GK5408-4GQ00-2AM2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 317TF-3 PN/DP (6ES7317-7UL10-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE (24V, ports on front) (6GK5324-4QG00-1AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1512SP F-1 PN (6ES7512-1SK00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP2200 Unified Comfort Hygienic (6AV2128-3XB40-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200S IM 151-8 PN/DP CPU (6ES7151-8AB01-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X320-1 FE (6GK5320-1BD00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X216 (6GK5216-0BA00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1514SP F-2 PN (6ES7514-2SN03-0AB0) toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-300 CPU 315-2 PN/DP (6ES7315-2EH14-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on front) (6GK5324-4GG10-4ER2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC CFU DIQ (6ES7655-5PX31-1XX0) versions ant\u00e9rieures \u00e0 2.0.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W722-1 RJ45 (6GK5722-1FC00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (2x 100-240VAC/60-250VDC, ports on rear) (6GK5324-4GG00-4JR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W1748-1 M12 (6GK5748-1GY01-0TA0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Unified Comfort Panel (6AV2128-3MB06-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (100-240VAC/60-250VDC, ports on front) (6GK5324-4GG00-3ER2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Unified Comfort Panel hygienic (6AV2128-3MB40-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE SC636-2C (6GK5636-2GS00-2AC2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1510SP-1 PN (6ES7510-1DJ01-0AB0) versions ant\u00e9rieures \u00e0 2.9.9",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W774-1 RJ45 (6GK5774-1FX00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (24V, ports on front) (6GK5324-4GG10-1ER2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIPLUS S7-400 CPU 414-3 PN/DP V7 (6AG1414-3EM07-7AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W734-1 RJ45 (6GK5734-1FX00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-2 RJ45 (6GK5788-2FC00-0AB0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE (24V, ports on rear) (6GK5324-4QG00-1HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-2 M12 EEC (6GK5788-2GD00-0TA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 CPU 1515F-2 PN (6ES7515-2FM00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M (24V, ports on front) (6GK5324-0GG00-1AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M EEC (24V, ports on front) (6GK5324-4GG00-1ER2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W1788-2 M12 (6GK5788-2GY01-0AA0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE S615 LAN-Router (6GK5615-0AA00-2AA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1000 Unified Comfort Panel hygienic (6AV2128-3KB40-0AX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Comfort Pro for stand (expandable, flange at the bottom) (6AV2128-3MB27-1BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X206-1LD (6GK5206-1BC10-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W761-1 RJ45 (6GK5761-1FC00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X302-7 EEC (24V) (6GK5302-7GD00-1EA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1510SP-1 PN (6ES7510-1DK03-0AB0) toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X308-2LH+ (6GK5308-2FP00-2AA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-4M PoE (230V, ports on front) (6GK5324-4QG10-3AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W786-2 SFP (6GK5786-2FE00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W1748-1 M12 (6GK5748-1GY01-0AA0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR524-8C, 24V (6GK5524-8GS00-2AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1514SPT F-2 PN (6ES7514-2WN03-0AB0) toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WUM763-1 (US) (6GK5763-1AL00-3DB0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR526-8C, 2x230V (L3 int.) (6GK5526-8GR00-4AR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W788-2 RJ45 (6GK5788-2FC00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M (24V, ports on rear) (6GK5324-0GG00-1HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE SC622-2C (6GK5622-2GS00-2AC2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-1500 CPU 1511-1 PN (6ES7511-1AK00-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XF208 (6GK5208-0BA00-2AF2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XR324-12M (230V, ports on rear) (6GK5324-0GG00-3HR2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WUM763-1 (6GK5763-1AL00-3DA0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Unified Comfort Panel neutral design (6AV2128-3MB36-0AX1) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-2 EEC (2x 24V, coated) (6GK5307-2FD00-2GA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1200 Comfort Pro neutral design for stand (expandable, flange at the bottom) (6AV2128-3MB57-1BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Comfort Pro for support arm (expandable, round tube) and extension unit (6AV2128-3UB27-0BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC HMI MTP1900 Comfort Pro neutral design for support arm (expandable, round tube) and extensio (6AV2128-3UB57-0BX0) versions ant\u00e9rieures \u00e0 21",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE XM408-8C (6GK5408-8GS00-2AM2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE WAM766-1 EEC (6GK5766-1GE00-7TA0) versions ant\u00e9rieures \u00e0 3.2.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W722-1 RJ45 (6GK5722-1FC00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W748-1 M12 (6GK5748-1GD00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC ET 200SP CPU 1512SP-1 PN (6ES7512-1DM03-0AB0) toutes versions pour les vuln\u00e9rabilit\u00e9s CVE-2026-25786, CVE-2026-25787 et CVE-2026-25789.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SIMATIC S7-400 CPU 416-3 PN/DP V7 (6ES7416-3ES07-0AB0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X204-2TS (6GK5204-2BB10-2CA2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W778-1 M12 (6GK5778-1GY00-0AA0) versions ant\u00e9rieures \u00e0 6.6.0",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE W1788-1 M12 (6GK5788-1GY01-0AA0) toutes versions. L\u0027\u00e9diteur indique que le produit ne b\u00e9n\u00e9ficiera pas de correctif de s\u00e9curit\u00e9 pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833.",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M804PB (6GK5804-0AP00-2AA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X204-2LD TS (6GK5204-2BC10-2CA2) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE X307-2 EEC (2x 230V, coated) (6GK5307-2FD00-4GA3) toutes versions pour la vuln\u00e9rabilit\u00e9 CVE-2025-40833",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
},
{
"description": "SCALANCE M876-4 (NAM) (6GK5876-4AA00-2DA2) versions ant\u00e9rieures \u00e0 8.3",
"product": {
"name": "N/A",
"vendor": {
"name": "Siemens",
"scada": true
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2025-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-47219"
},
{
"name": "CVE-2025-39812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39812"
},
{
"name": "CVE-2026-21933",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21933"
},
{
"name": "CVE-2026-21932",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21932"
},
{
"name": "CVE-2025-38711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38711"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-9231",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9231"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39716",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39716"
},
{
"name": "CVE-2025-39702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39702"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-6052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6052"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38708",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38708"
},
{
"name": "CVE-2025-40833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40833"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2026-25787",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25787"
},
{
"name": "CVE-2026-22925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22925"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39689",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39689"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-55752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55752"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-39866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39866"
},
{
"name": "CVE-2025-39843",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39843"
},
{
"name": "CVE-2025-23160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23160"
},
{
"name": "CVE-2025-9820",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9820"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38699"
},
{
"name": "CVE-2025-38707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38707"
},
{
"name": "CVE-2025-39692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39692"
},
{
"name": "CVE-2025-38677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38677"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38502",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38502"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2026-21925",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21925"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39737",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39737"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-37931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37931"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2026-28389",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28389"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2025-38696",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38696"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-55754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-55754"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39788",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39788"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-7425",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-7425"
},
{
"name": "CVE-2025-43368",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-43368"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-23143",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23143"
},
{
"name": "CVE-2025-38322",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38322"
},
{
"name": "CVE-2025-9232",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9232"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-61795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61795"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2026-28387",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28387"
},
{
"name": "CVE-2025-39795",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39795"
},
{
"name": "CVE-2026-28388",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28388"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38728",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38728"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-48989",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-48989"
},
{
"name": "CVE-2025-39683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39683"
},
{
"name": "CVE-2025-39794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39794"
},
{
"name": "CVE-2025-39697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39697"
},
{
"name": "CVE-2026-25786",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25786"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39673"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-38723",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38723"
},
{
"name": "CVE-2024-57924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57924"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2026-28390",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-28390"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39687"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38347",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38347"
},
{
"name": "CVE-2025-39776",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39776"
},
{
"name": "CVE-2025-6021",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-6021"
},
{
"name": "CVE-2025-37968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37968"
},
{
"name": "CVE-2026-22924",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-22924"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2026-21945",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21945"
},
{
"name": "CVE-2025-39736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39736"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2026-31789",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31789"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-61748",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-61748"
},
{
"name": "CVE-2025-9230",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-9230"
},
{
"name": "CVE-2026-21947",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-21947"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-8916",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-8916"
},
{
"name": "CVE-2024-54017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-54017"
},
{
"name": "CVE-2025-39817",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39817"
},
{
"name": "CVE-2024-47704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47704"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2026-2673",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-2673"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2026-27662",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-27662"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2026-25789",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-25789"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-31257",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-31257"
},
{
"name": "CVE-2025-39756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39756"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53057"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2025-39676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39676"
},
{
"name": "CVE-2025-39813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39813"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39819",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39819"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39715"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-38700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38700"
},
{
"name": "CVE-2025-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-53066"
},
{
"name": "CVE-2025-39841",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39841"
},
{
"name": "CVE-2026-31790",
"url": "https://www.cve.org/CVERecord?id=CVE-2026-31790"
},
{
"name": "CVE-2025-14831",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-14831"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-39752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39752"
}
],
"initial_release_date": "2026-05-12T00:00:00",
"last_revision_date": "2026-05-12T00:00:00",
"links": [],
"reference": "CERTFR-2026-AVI-0565",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2026-05-12T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Injection de code indirecte \u00e0 distance (XSS)"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans les produits Siemens. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans les produits Siemens",
"vendor_advisories": [
{
"published_at": "2026-05-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-392349",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-392349.html"
},
{
"published_at": "2026-05-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-032379",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-032379.html"
},
{
"published_at": "2026-05-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-786884",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-786884.html"
},
{
"published_at": "2026-05-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-688146",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-688146.html"
},
{
"published_at": "2026-05-12",
"title": "Bulletin de s\u00e9curit\u00e9 Siemens SSA-387223",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-387223.html"
}
]
}
FKIE_CVE-2025-39738
Vulnerability from fkie_nvd - Published: 2025-09-11 17:15 - Updated: 2026-07-30 06:237.8 (High) - CVSS:3.1/
| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/125e94a4b76b7b75d194f85bedd628097d2121f0 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/39a93e1c9dbf7e11632efeb20fcf0fc1dcf64d51 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/4289b494ac553e74e86fed1c66b2bf9530bc1082 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/4e403bd8e127d40dc7c05f06ee969c1ba1537ec5 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/f83d4c81bda3b7d1813268ab77408f7a0ce691ff | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/fa086b1398cf7e5f7dee7241bd5f2855cb5df8dc | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/fcb1f77b8ed8795608ca7a1f6505e2b07236c1f3 | Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://lists.debian.org/debian-lts-announce/2025/10/msg00008.html | Mailing List, Third Party Advisory | |
| 0b142b55-0307-4c5a-b3c9-f314f3fb7c5e | https://cert-portal.siemens.com/productcert/html/ssa-032379.html |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 5.11 | |
| linux | linux_kernel | 5.11 | |
| linux | linux_kernel | 5.11 | |
| linux | linux_kernel | 5.11 | |
| linux | linux_kernel | 5.11 | |
| linux | linux_kernel | 5.11 | |
| linux | linux_kernel | 6.17 | |
| debian | debian_linux | 11.0 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"fs/btrfs/relocation.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "fa086b1398cf7e5f7dee7241bd5f2855cb5df8dc",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "fcb1f77b8ed8795608ca7a1f6505e2b07236c1f3",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "f83d4c81bda3b7d1813268ab77408f7a0ce691ff",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "39a93e1c9dbf7e11632efeb20fcf0fc1dcf64d51",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "125e94a4b76b7b75d194f85bedd628097d2121f0",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "4e403bd8e127d40dc7c05f06ee969c1ba1537ec5",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
},
{
"lessThan": "4289b494ac553e74e86fed1c66b2bf9530bc1082",
"status": "affected",
"version": "638331fa56caeaa8b4d31cc1dfbe0ce989bcff67",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"fs/btrfs/relocation.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.11"
},
{
"lessThan": "5.11",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.190",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.149",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.103",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.12.*",
"status": "unaffected",
"version": "6.12.43",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.15.*",
"status": "unaffected",
"version": "6.15.11",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.16.*",
"status": "unaffected",
"version": "6.16.2",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.17",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
},
{
"affectedData": [
{
"defaultStatus": "unknown",
"product": "SIMATIC CN 4100",
"vendor": "Siemens",
"versions": [
{
"lessThan": "V5.0",
"status": "affected",
"version": "0",
"versionType": "custom"
}
]
}
],
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "37696BCE-E60F-4750-AF90-704743E640AD",
"versionEndExcluding": "5.15.190",
"versionStartIncluding": "5.11.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FDBE8280-8983-4D2D-943D-2E6D0104E2D8",
"versionEndExcluding": "6.1.149",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "F2293654-7169-49B5-8D0D-EE51EF8B8E48",
"versionEndExcluding": "6.6.103",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "472C5F87-2BF3-4FAB-9B21-DA7513977363",
"versionEndExcluding": "6.12.43",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BC242347-F722-43AE-B910-BE0B22386977",
"versionEndExcluding": "6.15.11",
"versionStartIncluding": "6.13",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "BD7C087D-2415-4521-B624-30003352F899",
"versionEndExcluding": "6.16.2",
"versionStartIncluding": "6.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:-:*:*:*:*:*:*",
"matchCriteriaId": "7AD3510E-E8FA-47F3-9AD5-D8EA4A2719D1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc3:*:*:*:*:*:*",
"matchCriteriaId": "18C82C96-2853-4DFE-93AD-F6E59B4129CA",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc4:*:*:*:*:*:*",
"matchCriteriaId": "A330B043-47EA-4D06-82BF-153A1735FC11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc5:*:*:*:*:*:*",
"matchCriteriaId": "F0EE963C-B36C-4143-96A9-65BCA7D8F2EF",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc6:*:*:*:*:*:*",
"matchCriteriaId": "B511E2F6-2917-4797-8909-8F7EA4870C7B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:5.11:rc7:*:*:*:*:*:*",
"matchCriteriaId": "E9FA9D80-C790-41EA-8A21-DF7B170465E0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.17:rc1:*:*:*:*:*:*",
"matchCriteriaId": "327D22EF-390B-454C-BD31-2ED23C998A1C",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
},
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:debian:debian_linux:11.0:*:*:*:*:*:*:*",
"matchCriteriaId": "FA6FEEC2-9F11-4643-8827-749718254FED",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: do not allow relocation of partially dropped subvolumes\n\n[BUG]\nThere is an internal report that balance triggered transaction abort,\nwith the following call trace:\n\n item 85 key (594509824 169 0) itemoff 12599 itemsize 33\n extent refs 1 gen 197740 flags 2\n ref#0: tree block backref root 7\n item 86 key (594558976 169 0) itemoff 12566 itemsize 33\n extent refs 1 gen 197522 flags 2\n ref#0: tree block backref root 7\n ...\n BTRFS error (device loop0): extent item not found for insert, bytenr 594526208 num_bytes 16384 parent 449921024 root_objectid 934 owner 1 offset 0\n BTRFS error (device loop0): failed to run delayed ref for logical 594526208 num_bytes 16384 type 182 action 1 ref_mod 1: -117\n ------------[ cut here ]------------\n BTRFS: Transaction aborted (error -117)\n WARNING: CPU: 1 PID: 6963 at ../fs/btrfs/extent-tree.c:2168 btrfs_run_delayed_refs+0xfa/0x110 [btrfs]\n\nAnd btrfs check doesn\u0027t report anything wrong related to the extent\ntree.\n\n[CAUSE]\nThe cause is a little complex, firstly the extent tree indeed doesn\u0027t\nhave the backref for 594526208.\n\nThe extent tree only have the following two backrefs around that bytenr\non-disk:\n\n item 65 key (594509824 METADATA_ITEM 0) itemoff 13880 itemsize 33\n refs 1 gen 197740 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n item 66 key (594558976 METADATA_ITEM 0) itemoff 13847 itemsize 33\n refs 1 gen 197522 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n\nBut the such missing backref item is not an corruption on disk, as the\noffending delayed ref belongs to subvolume 934, and that subvolume is\nbeing dropped:\n\n item 0 key (934 ROOT_ITEM 198229) itemoff 15844 itemsize 439\n generation 198229 root_dirid 256 bytenr 10741039104 byte_limit 0 bytes_used 345571328\n last_snapshot 198229 flags 0x1000000000001(RDONLY) refs 0\n drop_progress key (206324 EXTENT_DATA 2711650304) drop_level 2\n level 2 generation_v2 198229\n\nAnd that offending tree block 594526208 is inside the dropped range of\nthat subvolume. That explains why there is no backref item for that\nbytenr and why btrfs check is not reporting anything wrong.\n\nBut this also shows another problem, as btrfs will do all the orphan\nsubvolume cleanup at a read-write mount.\n\nSo half-dropped subvolume should not exist after an RW mount, and\nbalance itself is also exclusive to subvolume cleanup, meaning we\nshouldn\u0027t hit a subvolume half-dropped during relocation.\n\nThe root cause is, there is no orphan item for this subvolume.\nIn fact there are 5 subvolumes from around 2021 that have the same\nproblem.\n\nIt looks like the original report has some older kernels running, and\ncaused those zombie subvolumes.\n\nThankfully upstream commit 8d488a8c7ba2 (\"btrfs: fix subvolume/snapshot\ndeletion not triggered on mount\") has long fixed the bug.\n\n[ENHANCEMENT]\nFor repairing such old fs, btrfs-progs will be enhanced.\n\nConsidering how delayed the problem will show up (at run delayed ref\ntime) and at that time we have to abort transaction already, it is too\nlate.\n\nInstead here we reject any half-dropped subvolume for reloc tree at the\nearliest time, preventing confusion and extra time wasted on debugging\nsimilar bugs."
}
],
"id": "CVE-2025-39738",
"lastModified": "2026-07-30T06:23:43.617",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.3,
"baseSeverity": "HIGH",
"confidentialityImpact": "LOW",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:L/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.5,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2025-09-11T17:15:35.443",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/125e94a4b76b7b75d194f85bedd628097d2121f0"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/39a93e1c9dbf7e11632efeb20fcf0fc1dcf64d51"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4289b494ac553e74e86fed1c66b2bf9530bc1082"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/4e403bd8e127d40dc7c05f06ee969c1ba1537ec5"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/f83d4c81bda3b7d1813268ab77408f7a0ce691ff"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/fa086b1398cf7e5f7dee7241bd5f2855cb5df8dc"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/fcb1f77b8ed8795608ca7a1f6505e2b07236c1f3"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Mailing List",
"Third Party Advisory"
],
"url": "https://lists.debian.org/debian-lts-announce/2025/10/msg00008.html"
},
{
"source": "0b142b55-0307-4c5a-b3c9-f314f3fb7c5e",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-032379.html"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "NVD-CWE-noinfo"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-8X83-VV5W-VMH3
Vulnerability from github – Published: 2025-09-11 18:35 – Updated: 2026-05-12 15:31In the Linux kernel, the following vulnerability has been resolved:
btrfs: do not allow relocation of partially dropped subvolumes
[BUG] There is an internal report that balance triggered transaction abort, with the following call trace:
item 85 key (594509824 169 0) itemoff 12599 itemsize 33 extent refs 1 gen 197740 flags 2 ref#0: tree block backref root 7 item 86 key (594558976 169 0) itemoff 12566 itemsize 33 extent refs 1 gen 197522 flags 2 ref#0: tree block backref root 7 ... BTRFS error (device loop0): extent item not found for insert, bytenr 594526208 num_bytes 16384 parent 449921024 root_objectid 934 owner 1 offset 0 BTRFS error (device loop0): failed to run delayed ref for logical 594526208 num_bytes 16384 type 182 action 1 ref_mod 1: -117 ------------[ cut here ]------------ BTRFS: Transaction aborted (error -117) WARNING: CPU: 1 PID: 6963 at ../fs/btrfs/extent-tree.c:2168 btrfs_run_delayed_refs+0xfa/0x110 [btrfs]
And btrfs check doesn't report anything wrong related to the extent tree.
[CAUSE] The cause is a little complex, firstly the extent tree indeed doesn't have the backref for 594526208.
The extent tree only have the following two backrefs around that bytenr on-disk:
item 65 key (594509824 METADATA_ITEM 0) itemoff 13880 itemsize 33
refs 1 gen 197740 flags TREE_BLOCK
tree block skinny level 0
(176 0x7) tree block backref root CSUM_TREE
item 66 key (594558976 METADATA_ITEM 0) itemoff 13847 itemsize 33
refs 1 gen 197522 flags TREE_BLOCK
tree block skinny level 0
(176 0x7) tree block backref root CSUM_TREE
But the such missing backref item is not an corruption on disk, as the offending delayed ref belongs to subvolume 934, and that subvolume is being dropped:
item 0 key (934 ROOT_ITEM 198229) itemoff 15844 itemsize 439
generation 198229 root_dirid 256 bytenr 10741039104 byte_limit 0 bytes_used 345571328
last_snapshot 198229 flags 0x1000000000001(RDONLY) refs 0
drop_progress key (206324 EXTENT_DATA 2711650304) drop_level 2
level 2 generation_v2 198229
And that offending tree block 594526208 is inside the dropped range of that subvolume. That explains why there is no backref item for that bytenr and why btrfs check is not reporting anything wrong.
But this also shows another problem, as btrfs will do all the orphan subvolume cleanup at a read-write mount.
So half-dropped subvolume should not exist after an RW mount, and balance itself is also exclusive to subvolume cleanup, meaning we shouldn't hit a subvolume half-dropped during relocation.
The root cause is, there is no orphan item for this subvolume. In fact there are 5 subvolumes from around 2021 that have the same problem.
It looks like the original report has some older kernels running, and caused those zombie subvolumes.
Thankfully upstream commit 8d488a8c7ba2 ("btrfs: fix subvolume/snapshot deletion not triggered on mount") has long fixed the bug.
[ENHANCEMENT] For repairing such old fs, btrfs-progs will be enhanced.
Considering how delayed the problem will show up (at run delayed ref time) and at that time we have to abort transaction already, it is too late.
Instead here we reject any half-dropped subvolume for reloc tree at the earliest time, preventing confusion and extra time wasted on debugging similar bugs.
{
"affected": [],
"aliases": [
"CVE-2025-39738"
],
"database_specific": {
"cwe_ids": [],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2025-09-11T17:15:35Z",
"severity": "HIGH"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: do not allow relocation of partially dropped subvolumes\n\n[BUG]\nThere is an internal report that balance triggered transaction abort,\nwith the following call trace:\n\n item 85 key (594509824 169 0) itemoff 12599 itemsize 33\n extent refs 1 gen 197740 flags 2\n ref#0: tree block backref root 7\n item 86 key (594558976 169 0) itemoff 12566 itemsize 33\n extent refs 1 gen 197522 flags 2\n ref#0: tree block backref root 7\n ...\n BTRFS error (device loop0): extent item not found for insert, bytenr 594526208 num_bytes 16384 parent 449921024 root_objectid 934 owner 1 offset 0\n BTRFS error (device loop0): failed to run delayed ref for logical 594526208 num_bytes 16384 type 182 action 1 ref_mod 1: -117\n ------------[ cut here ]------------\n BTRFS: Transaction aborted (error -117)\n WARNING: CPU: 1 PID: 6963 at ../fs/btrfs/extent-tree.c:2168 btrfs_run_delayed_refs+0xfa/0x110 [btrfs]\n\nAnd btrfs check doesn\u0027t report anything wrong related to the extent\ntree.\n\n[CAUSE]\nThe cause is a little complex, firstly the extent tree indeed doesn\u0027t\nhave the backref for 594526208.\n\nThe extent tree only have the following two backrefs around that bytenr\non-disk:\n\n item 65 key (594509824 METADATA_ITEM 0) itemoff 13880 itemsize 33\n refs 1 gen 197740 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n item 66 key (594558976 METADATA_ITEM 0) itemoff 13847 itemsize 33\n refs 1 gen 197522 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n\nBut the such missing backref item is not an corruption on disk, as the\noffending delayed ref belongs to subvolume 934, and that subvolume is\nbeing dropped:\n\n item 0 key (934 ROOT_ITEM 198229) itemoff 15844 itemsize 439\n generation 198229 root_dirid 256 bytenr 10741039104 byte_limit 0 bytes_used 345571328\n last_snapshot 198229 flags 0x1000000000001(RDONLY) refs 0\n drop_progress key (206324 EXTENT_DATA 2711650304) drop_level 2\n level 2 generation_v2 198229\n\nAnd that offending tree block 594526208 is inside the dropped range of\nthat subvolume. That explains why there is no backref item for that\nbytenr and why btrfs check is not reporting anything wrong.\n\nBut this also shows another problem, as btrfs will do all the orphan\nsubvolume cleanup at a read-write mount.\n\nSo half-dropped subvolume should not exist after an RW mount, and\nbalance itself is also exclusive to subvolume cleanup, meaning we\nshouldn\u0027t hit a subvolume half-dropped during relocation.\n\nThe root cause is, there is no orphan item for this subvolume.\nIn fact there are 5 subvolumes from around 2021 that have the same\nproblem.\n\nIt looks like the original report has some older kernels running, and\ncaused those zombie subvolumes.\n\nThankfully upstream commit 8d488a8c7ba2 (\"btrfs: fix subvolume/snapshot\ndeletion not triggered on mount\") has long fixed the bug.\n\n[ENHANCEMENT]\nFor repairing such old fs, btrfs-progs will be enhanced.\n\nConsidering how delayed the problem will show up (at run delayed ref\ntime) and at that time we have to abort transaction already, it is too\nlate.\n\nInstead here we reject any half-dropped subvolume for reloc tree at the\nearliest time, preventing confusion and extra time wasted on debugging\nsimilar bugs.",
"id": "GHSA-8x83-vv5w-vmh3",
"modified": "2026-05-12T15:31:05Z",
"published": "2025-09-11T18:35:50Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39738"
},
{
"type": "WEB",
"url": "https://cert-portal.siemens.com/productcert/html/ssa-032379.html"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/125e94a4b76b7b75d194f85bedd628097d2121f0"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/39a93e1c9dbf7e11632efeb20fcf0fc1dcf64d51"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/4289b494ac553e74e86fed1c66b2bf9530bc1082"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/4e403bd8e127d40dc7c05f06ee969c1ba1537ec5"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/f83d4c81bda3b7d1813268ab77408f7a0ce691ff"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/fa086b1398cf7e5f7dee7241bd5f2855cb5df8dc"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/fcb1f77b8ed8795608ca7a1f6505e2b07236c1f3"
},
{
"type": "WEB",
"url": "https://lists.debian.org/debian-lts-announce/2025/10/msg00008.html"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
]
}
ICSA-26-134-10
Vulnerability from csaf_cisa - Published: 2026-05-12 00:00 - Updated: 2026-05-14 06:00MSRC_CVE-2025-39738
Vulnerability from csaf_microsoft - Published: 2025-09-02 00:00 - Updated: 2026-02-24 14:38NCSC-2026-0147
Vulnerability from csaf_ncscnl - Published: 2026-05-13 06:33 - Updated: 2026-05-13 06:33Multiple security vulnerabilities affecting the Linux kernel, including btrfs subvolume relocation, CPU cache initialization, AMD processor data leakage, and the VMSCAPE branch predictor isolation flaw, were fixed across various SUSE Linux Enterprise and Micro kernel versions.
OESA-2026-2579 (CVE-2025-38263)
Vulnerability from osv_openeuler – Published: 2026-06-05 11:11 – Updated: 2026-08-06 11:11 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
bcache: fix NULL pointer in cache_set_flush()
- LINE#1794 - LINE#1887 is some codes about function of bch_cache_set_alloc().
- LINE#2078 - LINE#2142 is some codes about function of register_cache_set().
- register_cache_set() will call bch_cache_set_alloc() in LINE#2098.
1794 struct cache_set bch_cache_set_alloc(struct cache_sb sb) 1795 { ... 1860 if (!(c->devices = kcalloc(c->nr_uuids, sizeof(void ), GFP_KERNEL)) || 1861 mempool_init_slab_pool(&c->search, 32, bch_search_cache) || 1862 mempool_init_kmalloc_pool(&c->bio_meta, 2, 1863 sizeof(struct bbio) + sizeof(struct bio_vec) * 1864 bucket_pages(c)) || 1865 mempool_init_kmalloc_pool(&c->fill_iter, 1, iter_size) || 1866 bioset_init(&c->bio_split, 4, offsetof(struct bbio, bio), 1867 BIOSET_NEED_BVECS|BIOSET_NEED_RESCUER) || 1868 !(c->uuids = alloc_bucket_pages(GFP_KERNEL, c)) || 1869 !(c->moving_gc_wq = alloc_workqueue("bcache_gc", 1870 WQ_MEM_RECLAIM, 0)) || 1871 bch_journal_alloc(c) || 1872 bch_btree_cache_alloc(c) || 1873 bch_open_buckets_alloc(c) || 1874 bch_bset_sort_state_init(&c->sort, ilog2(c->btree_pages))) 1875 goto err; ^^^^^^^^ 1876 ... 1883 return c; 1884 err: 1885 bch_cache_set_unregister(c); ^^^^^^^^^^^^^^^^^^^^^^^^^^^ 1886 return NULL; 1887 } ... 2078 static const char register_cache_set(struct cache *ca) 2079 { ... 2098 c = bch_cache_set_alloc(&ca->sb); 2099 if (!c) 2100 return err; ^^^^^^^^^^ ... 2128 ca->set = c; 2129 ca->set->cache[ca->sb.nr_this_dev] = ca; ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ ... 2138 return NULL; 2139 err: 2140 bch_cache_set_unregister(c); 2141 return err; 2142 }
(1) If LINE#1860 - LINE#1874 is true, then do 'goto err'(LINE#1875) and call bch_cache_set_unregister()(LINE#1885). (2) As (1) return NULL(LINE#1886), LINE#2098 - LINE#2100 would return. (3) As (2) has returned, LINE#2128 - LINE#2129 would do not give the value to c->cache[], it means that c->cache[] is NULL.
LINE#1624 - LINE#1665 is some codes about function of cache_set_flush(). As (1), in LINE#1885 call bch_cache_set_unregister() ---> bch_cache_set_stop() ---> closure_queue() -.-> cache_set_flush() (as below LINE#1624)
1624 static void cache_set_flush(struct closure *cl) 1625 { ... 1654 for_each_cache(ca, c, i) 1655 if (ca->alloc_thread) ^^ 1656 kthread_stop(ca->alloc_thread); ... 1665 }
(4) In LINE#1655 ca is NULL(see (3)) in cache_set_flush() then the kernel crash occurred as below: [ 846.712887] bcache: register_cache() error drbd6: cannot allocate memory [ 846.713242] bcache: register_bcache() error : failed to register device [ 846.713336] bcache: cache_set_free() Cache set 2f84bdc1-498a-4f2f-98a7-01946bf54287 unregistered [ 846.713768] BUG: unable to handle kernel NULL pointer dereference at 00000000000009f8 [ 846.714790] PGD 0 P4D 0 [ 846.715129] Oops: 0000 [#1] SMP PTI [ 846.715472] CPU: 19 PID: 5057 Comm: kworker/19:16 Kdump: loaded Tainted: G OE --------- - - 4.18.0-147.5.1.el8_1.5es.3.x86_64 #1 [ 846.716082] Hardware name: ESPAN GI-25212/X11DPL-i, BIOS 2.1 06/15/2018 [ 846.716451] Workqueue: events cache_set_flush [bcache] [ 846.716808] RIP: 0010:cache_set_flush+0xc9/0x1b0 [bcache] [ 846.717155] Code: 00 4c 89 a5 b0 03 00 00 48 8b 85 68 f6 ff ff a8 08 0f 84 88 00 00 00 31 db 66 83 bd 3c f7 ff ff 00 48 8b 85 48 ff ff ff 74 28 <48> 8b b8 f8 09 00 0 ---truncated---(CVE-2025-38263)
In the Linux kernel, the following vulnerability has been resolved:
vsock/vmci: Clear the vmci transport packet properly when initializing it
In vmci_transport_packet_init memset the vmci_transport_packet before populating the fields to avoid any uninitialised data being left in the structure.(CVE-2025-38403)
In the Linux kernel, the following vulnerability has been resolved:
atm: clip: Fix infinite recursive call of clip_push().
syzbot reported the splat below. [0]
This happens if we call ioctl(ATMARP_MKIP) more than once.
During the first call, clip_mkip() sets clip_push() to vcc->push(), and the second call copies it to clip_vcc->old_push().
Later, when the socket is close()d, vcc_destroy_socket() passes NULL skb to clip_push(), which calls clip_vcc->old_push(), triggering the infinite recursion.
Let's prevent the second ioctl(ATMARP_MKIP) by checking vcc->user_back, which is allocated by the first call as clip_vcc.
Note also that we use lock_sock() to prevent racy calls.
[0]: BUG: TASK stack guard page was hit at ffffc9000d66fff8 (stack is ffffc9000d670000..ffffc9000d678000) Oops: stack guard page: 0000 [#1] SMP KASAN NOPTI CPU: 0 UID: 0 PID: 5322 Comm: syz.0.0 Not tainted 6.16.0-rc4-syzkaller #0 PREEMPT(full) Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014 RIP: 0010:clip_push+0x5/0x720 net/atm/clip.c:191 Code: e0 8f aa 8c e8 1c ad 5b fa eb ae 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 55 <41> 57 41 56 41 55 41 54 53 48 83 ec 20 48 89 f3 49 89 fd 48 bd 00 RSP: 0018:ffffc9000d670000 EFLAGS: 00010246 RAX: 1ffff1100235a4a5 RBX: ffff888011ad2508 RCX: ffff8880003c0000 RDX: 0000000000000000 RSI: 0000000000000000 RDI: ffff888037f01000 RBP: dffffc0000000000 R08: ffffffff8fa104f7 R09: 1ffffffff1f4209e R10: dffffc0000000000 R11: ffffffff8a99b300 R12: ffffffff8a99b300 R13: ffff888037f01000 R14: ffff888011ad2500 R15: ffff888037f01578 FS: 000055557ab6d500(0000) GS:ffff88808d250000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: ffffc9000d66fff8 CR3: 0000000043172000 CR4: 0000000000352ef0 Call Trace: <TASK> clip_push+0x6dc/0x720 net/atm/clip.c:200 clip_push+0x6dc/0x720 net/atm/clip.c:200 clip_push+0x6dc/0x720 net/atm/clip.c:200 ... clip_push+0x6dc/0x720 net/atm/clip.c:200 clip_push+0x6dc/0x720 net/atm/clip.c:200 clip_push+0x6dc/0x720 net/atm/clip.c:200 vcc_destroy_socket net/atm/common.c:183 [inline] vcc_release+0x157/0x460 net/atm/common.c:205 __sock_release net/socket.c:647 [inline] sock_close+0xc0/0x240 net/socket.c:1391 __fput+0x449/0xa70 fs/file_table.c:465 task_work_run+0x1d1/0x260 kernel/task_work.c:227 resume_user_mode_work include/linux/resume_user_mode.h:50 [inline] exit_to_user_mode_loop+0xec/0x110 kernel/entry/common.c:114 exit_to_user_mode_prepare include/linux/entry-common.h:330 [inline] syscall_exit_to_user_mode_work include/linux/entry-common.h:414 [inline] syscall_exit_to_user_mode include/linux/entry-common.h:449 [inline] do_syscall_64+0x2bd/0x3b0 arch/x86/entry/syscall_64.c:100 entry_SYSCALL_64_after_hwframe+0x77/0x7f RIP: 0033:0x7ff31c98e929 Code: ff ff c3 66 2e 0f 1f 84 00 00 00 00 00 0f 1f 40 00 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 a8 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007fffb5aa1f78 EFLAGS: 00000246 ORIG_RAX: 00000000000001b4 RAX: 0000000000000000 RBX: 0000000000012747 RCX: 00007ff31c98e929 RDX: 0000000000000000 RSI: 000000000000001e RDI: 0000000000000003 RBP: 00007ff31cbb7ba0 R08: 0000000000000001 R09: 0000000db5aa226f R10: 00007ff31c7ff030 R11: 0000000000000246 R12: 00007ff31cbb608c R13: 00007ff31cbb6080 R14: ffffffffffffffff R15: 00007fffb5aa2090 </TASK> Modules linked in:(CVE-2025-38459)
In the Linux kernel, the following vulnerability has been resolved:
iwlwifi: Add missing check for alloc_ordered_workqueue
Add check for the return value of alloc_ordered_workqueue since it may return NULL pointer.(CVE-2025-38602)
In the Linux kernel, the following vulnerability has been resolved:
wifi: mac80211: reject TDLS operations when station is not associated
syzbot triggered a WARN in ieee80211_tdls_oper() by sending NL80211_TDLS_ENABLE_LINK immediately after NL80211_CMD_CONNECT, before association completed and without prior TDLS setup.
This left internal state like sdata->u.mgd.tdls_peer uninitialized, leading to a WARN_ON() in code paths that assumed it was valid.
Reject the operation early if not in station mode or not associated.(CVE-2025-38644)
In the Linux kernel, the following vulnerability has been resolved:
btrfs: do not allow relocation of partially dropped subvolumes
[BUG] There is an internal report that balance triggered transaction abort, with the following call trace:
item 85 key (594509824 169 0) itemoff 12599 itemsize 33 extent refs 1 gen 197740 flags 2 ref#0: tree block backref root 7 item 86 key (594558976 169 0) itemoff 12566 itemsize 33 extent refs 1 gen 197522 flags 2 ref#0: tree block backref root 7 ... BTRFS error (device loop0): extent item not found for insert, bytenr 594526208 num_bytes 16384 parent 449921024 root_objectid 934 owner 1 offset 0 BTRFS error (device loop0): failed to run delayed ref for logical 594526208 num_bytes 16384 type 182 action 1 ref_mod 1: -117 ------------[ cut here ]------------ BTRFS: Transaction aborted (error -117) WARNING: CPU: 1 PID: 6963 at ../fs/btrfs/extent-tree.c:2168 btrfs_run_delayed_refs+0xfa/0x110 [btrfs]
And btrfs check doesn't report anything wrong related to the extent tree.
[CAUSE] The cause is a little complex, firstly the extent tree indeed doesn't have the backref for 594526208.
The extent tree only have the following two backrefs around that bytenr on-disk:
item 65 key (594509824 METADATA_ITEM 0) itemoff 13880 itemsize 33
refs 1 gen 197740 flags TREE_BLOCK
tree block skinny level 0
(176 0x7) tree block backref root CSUM_TREE
item 66 key (594558976 METADATA_ITEM 0) itemoff 13847 itemsize 33
refs 1 gen 197522 flags TREE_BLOCK
tree block skinny level 0
(176 0x7) tree block backref root CSUM_TREE
But the such missing backref item is not an corruption on disk, as the offending delayed ref belongs to subvolume 934, and that subvolume is being dropped:
item 0 key (934 ROOT_ITEM 198229) itemoff 15844 itemsize 439
generation 198229 root_dirid 256 bytenr 10741039104 byte_limit 0 bytes_used 345571328
last_snapshot 198229 flags 0x1000000000001(RDONLY) refs 0
drop_progress key (206324 EXTENT_DATA 2711650304) drop_level 2
level 2 generation_v2 198229
And that offending tree block 594526208 is inside the dropped range of that subvolume. That explains why there is no backref item for that bytenr and why btrfs check is not reporting anything wrong.
But this also shows another problem, as btrfs will do all the orphan subvolume cleanup at a read-write mount.
So half-dropped subvolume should not exist after an RW mount, and balance itself is also exclusive to subvolume cleanup, meaning we shouldn't hit a subvolume half-dropped during relocation.
The root cause is, there is no orphan item for this subvolume. In fact there are 5 subvolumes from around 2021 that have the same problem.
It looks like the original report has some older kernels running, and caused those zombie subvolumes.
Thankfully upstream commit 8d488a8c7ba2 ("btrfs: fix subvolume/snapshot deletion not triggered on mount") has long fixed the bug.
[ENHANCEMENT] For repairing such old fs, btrfs-progs will be enhanced.
Considering how delayed the problem will show up (at run delayed ref time) and at that time we have to abort transaction already, it is too late.
Instead here we reject any half-dropped subvolume for reloc tree at the earliest time, preventing confusion and extra time wasted on debugging similar bugs.(CVE-2025-39738)
In the Linux kernel, the following vulnerability has been resolved:
can: peak_usb: fix shift-out-of-bounds issue
Explicitly uses a 64-bit constant when the number of bits used for its shifting is 32 (which is the case for PC CAN FD interfaces supported by this driver).
mkl: update subject, apply manually
In the Linux kernel, the following vulnerability has been resolved:
team: Move team device type change at the end of team_port_add
Attempting to add a port device that is already up will expectedly fail, but not before modifying the team device header_ops.
In the case of the syzbot reproducer the gre0 device is already in state UP when it attempts to add it as a port device of team0, this fails but before that header_ops->create of team0 is changed from eth_header to ipgre_header in the call to team_dev_type_check_change.
Later when we end up in ipgre_header() struct ip_tunnel* points to nonsense as the private data of the device still holds a struct team.
Example sequence of iproute2 commands to reproduce the hang/BUG(): ip link add dev team0 type team ip link add dev gre0 type gre ip link set dev gre0 up ip link set dev gre0 master team0 ip link set dev team0 up ping -I team0 1.1.1.1
Move team_dev_type_check_change down where all other checks have passed as it changes the dev type with no way to restore it in case one of the checks that follow it fail.
Also make sure to preserve the origial mtu assignment: - If port_dev is not the same type as dev, dev takes mtu from port_dev - If port_dev is the same type as dev, port_dev takes mtu from dev
This is done by adding a conditional before the call to dev_set_mtu to prevent it from assigning port_dev->mtu = dev->mtu and instead letting team_dev_type_check_change assign dev->mtu = port_dev->mtu. The conditional is needed because the patch moves the call to team_dev_type_check_change past dev_set_mtu.
Testing: - team device driver in-tree selftests - Add/remove various devices as slaves of team device - syzbot(CVE-2025-68340)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/umad: Reject negative data_len in ib_umad_write
ib_umad_write computes data_len from user-controlled count and the MAD header sizes. With a mismatched user MAD header size and RMPP header length, data_len can become negative and reach ib_create_send_mad(). This can make the padding calculation exceed the segment size and trigger an out-of-bounds memset in alloc_send_rmpp_list().
Add an explicit check to reject negative data_len before creating the send buffer.
KASAN splat: [ 211.363464] BUG: KASAN: slab-out-of-bounds in ib_create_send_mad+0xa01/0x11b0 [ 211.364077] Write of size 220 at addr ffff88800c3fa1f8 by task spray_thread/102 [ 211.365867] ib_create_send_mad+0xa01/0x11b0 [ 211.365887] ib_umad_write+0x853/0x1c80(CVE-2026-23243)
In the Linux kernel, the following vulnerability has been resolved:
macvlan: observe an RCU grace period in macvlan_common_newlink() error path
valis reported that a race condition still happens after my prior patch.
macvlan_common_newlink() might have made @dev visible before detecting an error, and its caller will directly call free_netdev(dev).
We must respect an RCU period, either in macvlan or the core networking stack.
After adding a temporary mdelay(1000) in macvlan_forward_source_one() to open the race window, valis repro was:
ip link add p1 type veth peer p2 ip link set address 00:00:00:00:00:20 dev p1 ip link set up dev p1 ip link set up dev p2 ip link add mv0 link p2 type macvlan mode source
(ip link add invalid% link p2 type macvlan mode source macaddr add 00:00:00:00:00:20 &) ; sleep 0.5 ; ping -c1 -I p1 1.2.3.4 PING 1.2.3.4 (1.2.3.4): 56 data bytes RTNETLINK answers: Invalid argument
BUG: KASAN: slab-use-after-free in macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444) Read of size 8 at addr ffff888016bb89c0 by task e/175
CPU: 1 UID: 1000 PID: 175 Comm: e Not tainted 6.19.0-rc8+ #33 NONE Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.14.0-2 04/01/2014 Call Trace: <IRQ> dump_stack_lvl (lib/dump_stack.c:123) print_report (mm/kasan/report.c:379 mm/kasan/report.c:482) ? macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444) kasan_report (mm/kasan/report.c:597) ? macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444) macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444) ? tasklet_init (kernel/softirq.c:983) macvlan_handle_frame (drivers/net/macvlan.c:501)
Allocated by task 169: kasan_save_stack (mm/kasan/common.c:58) kasan_save_track (./arch/x86/include/asm/current.h:25 mm/kasan/common.c:70 mm/kasan/common.c:79) __kasan_kmalloc (mm/kasan/common.c:419) __kvmalloc_node_noprof (./include/linux/kasan.h:263 mm/slub.c:5657 mm/slub.c:7140) alloc_netdev_mqs (net/core/dev.c:12012) rtnl_create_link (net/core/rtnetlink.c:3648) rtnl_newlink (net/core/rtnetlink.c:3830 net/core/rtnetlink.c:3957 net/core/rtnetlink.c:4072) rtnetlink_rcv_msg (net/core/rtnetlink.c:6958) netlink_rcv_skb (net/netlink/af_netlink.c:2550) netlink_unicast (net/netlink/af_netlink.c:1319 net/netlink/af_netlink.c:1344) netlink_sendmsg (net/netlink/af_netlink.c:1894) __sys_sendto (net/socket.c:727 net/socket.c:742 net/socket.c:2206) __x64_sys_sendto (net/socket.c:2209) do_syscall_64 (arch/x86/entry/syscall_64.c:63 arch/x86/entry/syscall_64.c:94) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:131)
Freed by task 169: kasan_save_stack (mm/kasan/common.c:58) kasan_save_track (./arch/x86/include/asm/current.h:25 mm/kasan/common.c:70 mm/kasan/common.c:79) kasan_save_free_info (mm/kasan/generic.c:587) __kasan_slab_free (mm/kasan/common.c:287) kfree (mm/slub.c:6674 mm/slub.c:6882) rtnl_newlink (net/core/rtnetlink.c:3845 net/core/rtnetlink.c:3957 net/core/rtnetlink.c:4072) rtnetlink_rcv_msg (net/core/rtnetlink.c:6958) netlink_rcv_skb (net/netlink/af_netlink.c:2550) netlink_unicast (net/netlink/af_netlink.c:1319 net/netlink/af_netlink.c:1344) netlink_sendmsg (net/netlink/af_netlink.c:1894) __sys_sendto (net/socket.c:727 net/socket.c:742 net/socket.c:2206) __x64_sys_sendto (net/socket.c:2209) do_syscall_64 (arch/x86/entry/syscall_64.c:63 arch/x86/entry/syscall_64.c:94) entry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:131)(CVE-2026-23273)
In the Linux kernel, the following vulnerability has been resolved:
mm: blk-cgroup: fix use-after-free in cgwb_release_workfn()
cgwb_release_workfn() calls css_put(wb->blkcg_css) and then later accesses wb->blkcg_css again via blkcg_unpin_online(). If css_put() drops the last reference, the blkcg can be freed asynchronously (css_free_rwork_fn -> blkcg_css_free -> kfree) before blkcg_unpin_online() dereferences the pointer to access blkcg->online_pin, resulting in a use-after-free:
BUG: KASAN: slab-use-after-free in blkcg_unpin_online (./include/linux/instrumented.h:112 ./include/linux/atomic/atomic-instrumented.h:400 ./include/linux/refcount.h:389 ./include/linux/refcount.h:432 ./include/linux/refcount.h:450 block/blk-cgroup.c:1367) Write of size 4 at addr ff11000117aa6160 by task kworker/71:1/531 Workqueue: cgwb_release cgwb_release_workfn Call Trace: <TASK> blkcg_unpin_online (./include/linux/instrumented.h:112 ./include/linux/atomic/atomic-instrumented.h:400 ./include/linux/refcount.h:389 ./include/linux/refcount.h:432 ./include/linux/refcount.h:450 block/blk-cgroup.c:1367) cgwb_release_workfn (mm/backing-dev.c:629) process_scheduled_works (kernel/workqueue.c:3278 kernel/workqueue.c:3385)
Freed by task 1016: kfree (./include/linux/kasan.h:235 mm/slub.c:2689 mm/slub.c:6246 mm/slub.c:6561) css_free_rwork_fn (kernel/cgroup/cgroup.c:5542) process_scheduled_works (kernel/workqueue.c:3302 kernel/workqueue.c:3385)
** Stack based on commit 66672af7a095 ("Add linux-next specific files for 20260410")
I am seeing this crash sporadically in Meta fleet across multiple kernel versions. A full reproducer is available at: https://github.com/leitao/debug/blob/main/reproducers/repro_blkcg_uaf.sh
(The race window is narrow. To make it easily reproducible, inject a msleep(100) between css_put() and blkcg_unpin_online() in cgwb_release_workfn(). With that delay and a KASAN-enabled kernel, the reproducer triggers the splat reliably in less than a second.)
Fix this by moving blkcg_unpin_online() before css_put(), so the cgwb's CSS reference keeps the blkcg alive while blkcg_unpin_online() accesses it.(CVE-2026-31586)
In the Linux kernel, the following vulnerability has been resolved:
KVM: x86: Use scratch field in MMIO fragment to hold small write values
When exiting to userspace to service an emulated MMIO write, copy the to-be-written value to a scratch field in the MMIO fragment if the size of the data payload is 8 bytes or less, i.e. can fit in a single chunk, instead of pointing the fragment directly at the source value.
This fixes a class of use-after-free bugs that occur when the emulator initiates a write using an on-stack, local variable as the source, the write splits a page boundary, and both pages are MMIO pages. Because KVM's ABI only allows for physically contiguous MMIO requests, accesses that split MMIO pages are separated into two fragments, and are sent to userspace one at a time. When KVM attempts to complete userspace MMIO in response to KVM_RUN after the first fragment, KVM will detect the second fragment and generate a second userspace exit, and reference the on-stack variable.
The issue is most visible if the second KVM_RUN is performed by a separate task, in which case the stack of the initiating task can show up as truly freed data.
================================================================== BUG: KASAN: use-after-free in complete_emulated_mmio+0x305/0x420 Read of size 1 at addr ffff888009c378d1 by task syz-executor417/984
CPU: 1 PID: 984 Comm: syz-executor417 Not tainted 5.10.0-182.0.0.95.h2627.eulerosv2r13.x86_64 #3 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.15.0-0-g2dd4b9b3f840-prebuilt.qemu.org 04/01/2014 Call Trace: dump_stack+0xbe/0xfd print_address_description.constprop.0+0x19/0x170 __kasan_report.cold+0x6c/0x84 kasan_report+0x3a/0x50 check_memory_region+0xfd/0x1f0 memcpy+0x20/0x60 complete_emulated_mmio+0x305/0x420 kvm_arch_vcpu_ioctl_run+0x63f/0x6d0 kvm_vcpu_ioctl+0x413/0xb20 __se_sys_ioctl+0x111/0x160 do_syscall_64+0x30/0x40 entry_SYSCALL_64_after_hwframe+0x67/0xd1 RIP: 0033:0x42477d Code: <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007faa8e6890e8 EFLAGS: 00000246 ORIG_RAX: 0000000000000010 RAX: ffffffffffffffda RBX: 00000000004d7338 RCX: 000000000042477d RDX: 0000000000000000 RSI: 000000000000ae80 RDI: 0000000000000005 RBP: 00000000004d7330 R08: 00007fff28d546df R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000246 R12: 00000000004d733c R13: 0000000000000000 R14: 000000000040a200 R15: 00007fff28d54720
The buggy address belongs to the page: page:0000000029f6a428 refcount:0 mapcount:0 mapping:0000000000000000 index:0x0 pfn:0x9c37 flags: 0xfffffc0000000(node=0|zone=1|lastcpupid=0x1fffff) raw: 000fffffc0000000 0000000000000000 ffffea0000270dc8 0000000000000000 raw: 0000000000000000 0000000000000000 00000000ffffffff 0000000000000000 page dumped because: kasan: bad access detected
Memory state around the buggy address: ffff888009c37780: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ffff888009c37800: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff >ffff888009c37880: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ^ ffff888009c37900: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ffff888009c37980: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ==================================================================
The bug can also be reproduced with a targeted KVM-Unit-Test by hacking KVM to fill a large on-stack variable in complete_emulated_mmio(), i.e. by overwrite the data value with garbage.
Limit the use of the scratch fields to 8-byte or smaller accesses, and to just writes, as larger accesses and reads are not affected thanks to implementation details in the emulator, but add a sanity check to ensure those details don't change in the future. Specifically, KVM never uses on-stack variables for accesses larger that 8 bytes, e.g. uses an operand in the emulator context, and *al ---truncated---(CVE-2026-31588)
In the Linux kernel, the following vulnerability has been resolved:
openvswitch: defer tunnel netdev_put to RCU release
ovs_netdev_tunnel_destroy() may run after NETDEV_UNREGISTER already detached the device. Dropping the netdev reference in destroy can race with concurrent readers that still observe vport->dev.
Do not release vport->dev in ovs_netdev_tunnel_destroy(). Instead, let vport_netdev_free() drop the reference from the RCU callback, matching the non-tunnel destroy path and avoiding additional synchronization under RTNL.(CVE-2026-31678)
In the Linux kernel, the following vulnerability has been resolved:
usb: ulpi: fix double free in ulpi_register_interface() error path
When device_register() fails, ulpi_register() calls put_device() on ulpi->dev.
The device release callback ulpi_dev_release() drops the OF node reference and frees ulpi, but the current error path in ulpi_register_interface() then calls kfree(ulpi) again, causing a double free.
Let put_device() handle the cleanup through ulpi_dev_release() and avoid freeing ulpi again in ulpi_register_interface().(CVE-2026-31759)
In the Linux kernel, the following vulnerability has been resolved:
drm/ioc32: stop speculation on the drm_compat_ioctl path
The drm compat ioctl path takes a user controlled pointer, and then dereferences it into a table of function pointers, the signature method of spectre problems. Fix this up by calling array_index_nospec() on the index to the function pointer list.(CVE-2026-31781)
In the Linux kernel, the following vulnerability has been resolved:
ip6_tunnel: clear skb2->cb[] in ip4ip6_err()
Oskar Kjos reported the following problem.
ip4ip6_err() calls icmp_send() on a cloned skb whose cb[] was written by the IPv6 receive path as struct inet6_skb_parm. icmp_send() passes IPCB(skb2) to __ip_options_echo(), which interprets that cb[] region as struct inet_skb_parm (IPv4). The layouts differ: inet6_skb_parm.nhoff at offset 14 overlaps inet_skb_parm.opt.rr, producing a non-zero rr value. __ip_options_echo() then reads optlen from attacker-controlled packet data at sptr[rr+1] and copies that many bytes into dopt->__data, a fixed 40-byte stack buffer (IP_OPTIONS_DATA_FIXED_SIZE).
To fix this we clear skb2->cb[], as suggested by Oskar Kjos.
Also add minimal IPv4 header validation (version == 4, ihl >= 5).(CVE-2026-43037)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: icmp: clear skb2->cb[] in ip6_err_gen_icmpv6_unreach()
Sashiko AI-review observed:
In ip6_err_gen_icmpv6_unreach(), the skb is an outer IPv4 ICMP error packet where its cb contains an IPv4 inet_skb_parm. When skb is cloned into skb2 and passed to icmp6_send(), it uses IP6CB(skb2).
IP6CB interprets the IPv4 inet_skb_parm as an inet6_skb_parm. The cipso offset in inet_skb_parm.opt directly overlaps with dsthao in inet6_skb_parm at offset 18.
If an attacker sends a forged ICMPv4 error with a CIPSO IP option, dsthao would be a non-zero offset. Inside icmp6_send(), mip6_addr_swap() is called and uses ipv6_find_tlv(skb, opt->dsthao, IPV6_TLV_HAO).
This would scan the inner, attacker-controlled IPv6 packet starting at that offset, potentially returning a fake TLV without checking if the remaining packet length can hold the full 18-byte struct ipv6_destopt_hao.
Could mip6_addr_swap() then perform a 16-byte swap that extends past the end of the packet data into skb_shared_info?
Should the cb array also be cleared in ip6_err_gen_icmpv6_unreach() and ip6ip6_err() to prevent this?
This patch implements the first suggestion.
I am not sure if ip6ip6_err() needs to be changed. A separate patch would be better anyway.(CVE-2026-43038)
In the Linux kernel, the following vulnerability has been resolved:
xfrm6: fix uninitialized saddr in xfrm6_get_saddr()
xfrm6_get_saddr() does not check the return value of ipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable source address (returns -EADDRNOTAVAIL), saddr->in6 is left uninitialized, but xfrm6_get_saddr() still returns 0 (success).
This causes the caller xfrm_tmpl_resolve_one() to use the uninitialized address in xfrm_state_find(), triggering KMSAN warning:
===================================================== BUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940 xfrm_state_find+0x2424/0xa940 xfrm_resolve_and_create_bundle+0x906/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 xfrm_lookup_route+0x63/0x2b0 ip_route_output_flow+0x1ce/0x270 udp_sendmsg+0x2ce1/0x3400 inet_sendmsg+0x1ef/0x2a0 __sock_sendmsg+0x278/0x3d0 __sys_sendto+0x593/0x720 __x64_sys_sendto+0x130/0x200 x64_sys_call+0x332b/0x3e70 do_syscall_64+0xd3/0xf80 entry_SYSCALL_64_after_hwframe+0x77/0x7f
Local variable tmp.i.i created at: xfrm_resolve_and_create_bundle+0x3e3/0x5a20 xfrm_lookup_with_ifid+0xcc0/0x3770 =====================================================
Fix by checking the return value of ipv6_dev_get_saddr() and propagating the error.(CVE-2026-43139)
In the Linux kernel, the following vulnerability has been resolved:
xfs: fix freemap adjustments when adding xattrs to leaf blocks
xfs/592 and xfs/794 both trip this assertion in the leaf block freemap adjustment code after ~20 minutes of running on my test VMs:
ASSERT(ichdr->firstused >= ichdr->count * sizeof(xfs_attr_leaf_entry_t) + xfs_attr3_leaf_hdr_size(leaf));
Upon enabling quite a lot more debugging code, I narrowed this down to fsstress trying to set a local extended attribute with namelen=3 and valuelen=71. This results in an entry size of 80 bytes.
At the start of xfs_attr3_leaf_add_work, the freemap looks like this:
i 0 base 448 size 0 rhs 448 count 46 i 1 base 388 size 132 rhs 448 count 46 i 2 base 2120 size 4 rhs 448 count 46 firstused = 520
where "rhs" is the first byte past the end of the leaf entry array. This is inconsistent -- the entries array ends at byte 448, but freemap[1] says there's free space starting at byte 388!
By the end of the function, the freemap is in worse shape:
i 0 base 456 size 0 rhs 456 count 47 i 1 base 388 size 52 rhs 456 count 47 i 2 base 2120 size 4 rhs 456 count 47 firstused = 440
Important note: 388 is not aligned with the entries array element size of 8 bytes.
Based on the incorrect freemap, the name area starts at byte 440, which is below the end of the entries array! That's why the assertion triggers and the filesystem shuts down.
How did we end up here? First, recall from the previous patch that the freemap array in an xattr leaf block is not intended to be a comprehensive map of all free space in the leaf block. In other words, it's perfectly legal to have a leaf block with:
- 376 bytes in use by the entries array
- freemap[0] has [base = 376, size = 8]
- freemap[1] has [base = 388, size = 1500]
- the space between 376 and 388 is free, but the freemap stopped tracking that some time ago
If we add one xattr, the entries array grows to 384 bytes, and freemap[0] becomes [base = 384, size = 0]. So far, so good. But if we add a second xattr, the entries array grows to 392 bytes, and freemap[0] gets pushed up to [base = 392, size = 0]. This is bad, because freemap[1] hasn't been updated, and now the entries array and the free space claim the same space.
The fix here is to adjust all freemap entries so that none of them collide with the entries array. Note that this fix relies on commit 2a2b5932db6758 ("xfs: fix attr leaf header freemap.size underflow") and the previous patch that resets zero length freemap entries to have base = 0.(CVE-2026-43158)
In the Linux kernel, the following vulnerability has been resolved:
net: usb: kaweth: remove TX queue manipulation in kaweth_set_rx_mode
kaweth_set_rx_mode(), the ndo_set_rx_mode callback, calls netif_stop_queue() and netif_wake_queue(). These are TX queue flow control functions unrelated to RX multicast configuration.
The premature netif_wake_queue() can re-enable TX while tx_urb is still in-flight, leading to a double usb_submit_urb() on the same URB:
kaweth_start_xmit() { netif_stop_queue(); usb_submit_urb(kaweth->tx_urb); }
kaweth_set_rx_mode() { netif_stop_queue(); netif_wake_queue(); // wakes TX queue before URB is done }
kaweth_start_xmit() { netif_stop_queue(); usb_submit_urb(kaweth->tx_urb); // URB submitted while active }
This triggers the WARN in usb_submit_urb():
"URB submitted while active"
This is a similar class of bug fixed in rtl8150 by
- commit 958baf5eaee3 ("net: usb: Remove disruptive netif_wake_queue in rtl8150_set_multicast").
Also kaweth_set_rx_mode() is already functionally broken, the real set_rx_mode action is performed by kaweth_async_set_rx_mode(), which in turn is not a no-op only at ndo_open() time.(CVE-2026-43180)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: xt_tcpmss: check remaining length before reading optlen
Quoting reporter: In net/netfilter/xt_tcpmss.c (lines 53-68), the TCP option parser reads op[i+1] directly without validating the remaining option length.
If the last byte of the option field is not EOL/NOP (0/1), the code attempts to index op[i+1]. In the case where i + 1 == optlen, this causes an out-of-bounds read, accessing memory past the optlen boundary (either reading beyond the stack buffer _opt or the following payload).(CVE-2026-43190)
In the Linux kernel, the following vulnerability has been resolved:
netfilter: nf_conntrack_h323: fix OOB read in decode_choice()
In decode_choice(), the boundary check before get_len() uses the
variable len, which is still 0 from its initialization at the top of
the function:
unsigned int type, ext, len = 0;
...
if (ext || (son->attr & OPEN)) {
BYTE_ALIGN(bs);
if (nf_h323_error_boundary(bs, len, 0)) /* len is 0 here */
return H323_ERROR_BOUND;
len = get_len(bs); /* OOB read */
When the bitstream is exactly consumed (bs->cur == bs->end), the check nf_h323_error_boundary(bs, 0, 0) evaluates to (bs->cur + 0 > bs->end), which is false. The subsequent get_len() call then dereferences *bs->cur++, reading 1 byte past the end of the buffer. If that byte has bit 7 set, get_len() reads a second byte as well.
This can be triggered remotely by sending a crafted Q.931 SETUP message with a User-User Information Element containing exactly 2 bytes of PER-encoded data ({0x08, 0x00}) to port 1720 through a firewall with the nf_conntrack_h323 helper active. The decoder fully consumes the PER buffer before reaching this code path, resulting in a 1-2 byte heap-buffer-overflow read confirmed by AddressSanitizer.
Fix this by checking for 2 bytes (the maximum that get_len() may read)
instead of the uninitialized len. This matches the pattern used at
every other get_len() call site in the same file, where the caller
checks for 2 bytes of available data before calling get_len().(CVE-2026-43233)
In the Linux kernel, the following vulnerability has been resolved:
mailbox: Prevent out-of-bounds access in fw_mbox_index_xlate()
Although it is guided that #mbox-cells must be at least 1, there are
many instances of #mbox-cells = <0>; in the device tree. If that is
the case and the corresponding mailbox controller does not provide
fw_xlate and of_xlatefunction pointers,fw_mbox_index_xlate()` will
be used by default and out-of-bounds accesses could occur due to lack of
bounds check in that function.(CVE-2026-43281)
In the Linux kernel, there is a double free vulnerability in the error handling path of cpufreq_dbs_governor_init() function. When kobject_init_and_add() fails, cpufreq_dbs_governor_init() calls kobject_put(&dbs_data->attr_set.kobj). The kobject release callback cpufreq_dbs_data_release() calls gov->exit(dbs_data) and kfree(dbs_data), but the current error path then calls gov->exit(dbs_data) and kfree(dbs_data) again, causing a double free. Keep the direct kfree(dbs_data) for the gov->init() failure path, but after kobject_init_and_add() has been called, let kobject_put() handle the cleanup through cpufreq_dbs_data_release().(CVE-2026-43328)
In the Linux kernel, the following vulnerability has been resolved:
lib/crypto: chacha: Zeroize permuted_state before it leaves scope
Since the ChaCha permutation is invertible, the local variable 'permuted_state' is sufficient to compute the original 'state', and thus the key, even after the permutation has been done.
While the kernel is quite inconsistent about zeroizing secrets on the stack (and some prominent userspace crypto libraries don't bother at all since it's not guaranteed to work anyway), the kernel does try to do it as a best practice, especially in cases involving the RNG.
Thus, explicitly zeroize 'permuted_state' before it goes out of scope.(CVE-2026-43336)
In the Linux kernel, the following vulnerability has been resolved:
usb: class: cdc-wdm: fix reordering issue in read code path
Quoting the bug report:
Due to compiler optimization or CPU out-of-order execution, the desc->length update can be reordered before the memmove. If this happens, wdm_read() can see the new length and call copy_to_user() on uninitialized memory. This also violates LKMM data race rules [1].
Fix it by using WRITE_ONCE and memory barriers.(CVE-2026-43427)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5e: Fix DMA FIFO desync on error CQE SQ recovery
In case of a TX error CQE, a recovery flow is triggered, mlx5e_reset_txqsq_cc_pc() resets dma_fifo_cc to 0 but not dma_fifo_pc, desyncing the DMA FIFO producer and consumer.
After recovery, the producer pushes new DMA entries at the old dma_fifo_pc, while the consumer reads from position 0. This causes us to unmap stale DMA addresses from before the recovery.
The DMA FIFO is a purely software construct with no HW counterpart. At the point of reset, all WQEs have been flushed so dma_fifo_cc is already equal to dma_fifo_pc. There is no need to reset either counter, similar to how skb_fifo pc/cc are untouched.
Remove the 'dma_fifo_cc = 0' reset.
This fixes the following WARNING: WARNING: CPU: 0 PID: 0 at drivers/iommu/dma-iommu.c:1240 iommu_dma_unmap_page+0x79/0x90 Modules linked in: mlx5_vdpa vringh vdpa bonding mlx5_ib mlx5_vfio_pci ipip mlx5_fwctl tunnel4 mlx5_core ib_ipoib geneve ip6_gre ip_gre gre nf_tables ip6_tunnel rdma_ucm ib_uverbs ib_umad vfio_pci vfio_pci_core act_mirred act_skbedit act_vlan vhost_net vhost tap ip6table_mangle ip6table_nat ip6table_filter ip6_tables iptable_mangle cls_matchall nfnetlink_cttimeout act_gact cls_flower sch_ingress vhost_iotlb iptable_raw tunnel6 vfio_iommu_type1 vfio openvswitch nsh rpcsec_gss_krb5 auth_rpcgss oid_registry xt_conntrack xt_MASQUERADE nf_conntrack_netlink nfnetlink iptable_nat nf_nat xt_addrtype br_netfilter overlay zram zsmalloc rpcrdma ib_iser libiscsi scsi_transport_iscsi rdma_cm iw_cm ib_cm ib_core fuse [last unloaded: nf_tables] CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.13.0-rc5_for_upstream_min_debug_2024_12_30_21_33 #1 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014 RIP: 0010:iommu_dma_unmap_page+0x79/0x90 Code: 2b 4d 3b 21 72 26 4d 3b 61 08 73 20 49 89 d8 44 89 f9 5b 4c 89 f2 4c 89 e6 48 89 ef 5d 41 5c 41 5d 41 5e 41 5f e9 c7 ae 9e ff <0f> 0b 5b 5d 41 5c 41 5d 41 5e 41 5f c3 66 2e 0f 1f 84 00 00 00 00 Call Trace: <IRQ> ? __warn+0x7d/0x110 ? iommu_dma_unmap_page+0x79/0x90 ? report_bug+0x16d/0x180 ? handle_bug+0x4f/0x90 ? exc_invalid_op+0x14/0x70 ? asm_exc_invalid_op+0x16/0x20 ? iommu_dma_unmap_page+0x79/0x90 ? iommu_dma_unmap_page+0x2e/0x90 dma_unmap_page_attrs+0x10d/0x1b0 mlx5e_tx_wi_dma_unmap+0xbe/0x120 [mlx5_core] mlx5e_poll_tx_cq+0x16d/0x690 [mlx5_core] mlx5e_napi_poll+0x8b/0xac0 [mlx5_core] __napi_poll+0x24/0x190 net_rx_action+0x32a/0x3b0 ? mlx5_eq_comp_int+0x7e/0x270 [mlx5_core] ? notifier_call_chain+0x35/0xa0 handle_softirqs+0xc9/0x270 irq_exit_rcu+0x71/0xd0 common_interrupt+0x7f/0xa0 </IRQ> <TASK> asm_common_interrupt+0x22/0x40(CVE-2026-43466)
In the Linux kernel's openvswitch module, the vport netlink reply helpers allocate a fixed-size skb with nlmsg_new(NLMSG_DEFAULT_SIZE, ...) but serialize the full upcall PID array via ovs_vport_get_upcall_portids(). Since ovs_vport_set_upcall_portids() accepts any non-zero multiple of sizeof(u32) with no upper bound, a CAP_NET_ADMIN user can install a PID array large enough to overflow the reply buffer, causing nla_put() to fail with -EMSGSIZE and hitting BUG_ON(err < 0), leading to a kernel panic. On systems with unprivileged user namespaces enabled (e.g., Ubuntu default), this is reachable via unshare -Urn.(CVE-2026-45840)
In the Linux kernel, the following vulnerability has been resolved: drm/nouveau: fix u32 overflow in pushbuf reloc bounds check nouveau_gem_pushbuf_reloc_apply() validates each relocation with if (r->reloc_bo_offset + 4 > nvbo->bo.base.size) but reloc_bo_offset is __u32 (uapi/drm/nouveau_drm.h) and the integer literal 4 promotes to unsigned int, so the addition is performed in 32 bits and wraps before the comparison against the size_t bo size. Cast to u64 so the addition happens in 64-bit arithmetic. [ Add Fixes: tag. - Danilo ] The Linux kernel CVE team has assigned CVE-2026-46006 to this issue.(CVE-2026-46006)
In the Linux kernel, the following vulnerability has been resolved:
thermal: core: Fix thermal zone governor cleanup issues
If thermal_zone_device_register_with_trips() fails after adding a thermal governor to the thermal zone being registered, the governor is not removed from it as appropriate which may lead to a memory leak.
In turn, thermal_zone_device_unregister() calls thermal_set_governor() without acquiring the thermal zone lock beforehand which may race with a governor update via sysfs and may lead to a use-after-free in that case.
Address these issues by adding two thermal_set_governor() calls, one to thermal_release() to remove the governor from the given thermal zone, and one to the thermal zone registration error path to cover failures preceding the thermal zone device registration.(CVE-2026-46021)
In the Linux kernel, the following vulnerability has been resolved: dm mirror: fix integer overflow in create_dirty_log() The argument count calculation in create_dirty_log() performs *args_used = 2 + param_count before validating against argc. When a user provides a param_count close to UINT_MAX via the device mapper table string, this unsigned addition wraps around to a small value, causing the subsequent argc < *args_used check to be bypassed. The overflowed param_count is then passed as argc to dm_dirty_log_create(), where it can cause out-of-bounds reads on the argv array. Fix by comparing param_count against argc - 2 before performing the addition, following the same pattern used by parse_features() in the same file. Since argc >= 2 is already guaranteed, the subtraction is safe. The Linux kernel CVE team has assigned CVE-2026-46023 to this issue.(CVE-2026-46023)
In the Linux kernel, the following vulnerability has been resolved: crypto: authencesn - reject short ahash digests during instance creation authencesn requires either a zero authsize or an authsize of at least 4 bytes because the ESN encrypt/decrypt paths always move 4 bytes of high-order sequence number data at the end of the authenticated data. While crypto_authenc_esn_setauthsize() already rejects explicit non-zero authsizes in the range 1..3, crypto_authenc_esn_create() still copied auth->digestsize into inst->alg.maxauthsize without validating it. The AEAD core then initialized the tfm's default authsize from that value. As a result, selecting an ahash with digest size 1..3, such as cbcmac(cipher_null), exposed authencesn instances whose default authsize was invalid even though setauthsize() would have rejected the same value. AF_ALG could then trigger the ESN tail handling with a too-short tag and hit an out-of-bounds access. Reject authencesn instances whose ahash digest size is in the invalid non-zero range 1..3 so that no tfm can inherit an unsupported default authsize. The Linux kernel CVE team has assigned CVE-2026-46033 to this issue.(CVE-2026-46033)
In the Linux kernel, the following vulnerability has been resolved:
ceph: only d_add() negative dentries when they are unhashed
Ceph can call d_add(dentry, NULL) on a negative dentry that is already present in the primary dcache hash.
In the current VFS that is not safe. d_add() goes through __d_add() to __d_rehash(), which unconditionally reinserts dentry->d_hash into the hlist_bl bucket. If the dentry is already hashed, reinserting the same node can corrupt the bucket, including creating a self-loop. Once that happens, __d_lookup() can spin forever in the hlist_bl walk, typically looping only on the d_name.hash mismatch check and eventually triggering RCU stall reports like this one:
rcu: INFO: rcu_sched self-detected stall on CPU rcu: 87-....: (2100 ticks this GP) idle=3a4c/1/0x4000000000000000 softirq=25003319/25003319 fqs=829 rcu: (t=2101 jiffies g=79058445 q=698988 ncpus=192) CPU: 87 UID: 2952868916 PID: 3933303 Comm: php-cgi8.3 Not tainted 6.18.17-i1-amd #950 NONE Hardware name: Dell Inc. PowerEdge R7615/0G9DHV, BIOS 1.6.6 09/22/2023 RIP: 0010:__d_lookup+0x46/0xb0 Code: c1 e8 07 48 8d 04 c2 48 8b 00 49 89 fc 49 89 f5 48 89 c3 48 83 e3 fe 48 83 f8 01 77 0f eb 2d 0f 1f 44 00 00 48 8b 1b 48 85 db <74> 20 39 6b 18 75 f3 48 8d 7b 78 e8 ba 85 d0 00 4c 39 63 10 74 1f RSP: 0018:ff745a70c8253898 EFLAGS: 00000282 RAX: ff26e470054cb208 RBX: ff26e470054cb208 RCX: 000000006e958966 RDX: ff26e48267340000 RSI: ff745a70c82539b0 RDI: ff26e458f74655c0 RBP: 000000006e958966 R08: 0000000000000180 R09: 9cd08d909b919a89 R10: ff26e458f74655c0 R11: 0000000000000000 R12: ff26e458f74655c0 R13: ff745a70c82539b0 R14: d0d0d0d0d0d0d0d0 R15: 2f2f2f2f2f2f2f2f FS: 00007f5770896980(0000) GS:ff26e482c5d88000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 00007f5764de50c0 CR3: 000000a72abb5001 CR4: 0000000000771ef0 PKRU: 55555554 Call Trace: <TASK> lookup_fast+0x9f/0x100 walk_component+0x1f/0x150 link_path_walk+0x20e/0x3d0 path_lookupat+0x68/0x180 filename_lookup+0xdc/0x1e0 vfs_statx+0x6c/0x140 vfs_fstatat+0x67/0xa0 __do_sys_newfstatat+0x24/0x60 do_syscall_64+0x6a/0x230 entry_SYSCALL_64_after_hwframe+0x76/0x7e
This is reachable with reused cached negative dentries. A Ceph lookup or atomic_open can be handed a negative dentry that is already hashed, and fs/ceph/dir.c then hits one of two paths that incorrectly assume "negative" also means "unhashed":
-
ceph_finish_lookup(): MDS reply is -ENOENT with no trace -> d_add(dentry, NULL)
-
ceph_lookup(): local ENOENT fast path for a complete directory with shared caps -> d_add(dentry, NULL)
Both paths can therefore re-add an already-hashed negative dentry.
Ceph already uses the correct pattern elsewhere: ceph_fill_trace() only calls d_add(dn, NULL) for a negative null-dentry reply when d_unhashed(dn) is true.
Fix both fs/ceph/dir.c sites the same way: only call d_add() for a negative dentry when it is actually unhashed. If the negative dentry is already hashed, leave it in place and reuse it as-is.
This preserves the existing behavior for unhashed dentries while avoiding d_hash list corruption for reused hashed negatives.(CVE-2026-46052)
In the Linux kernel, the following vulnerability has been resolved: sctp: revalidate list cursor after sctp_sendmsg_to_asoc() in SCTP_SENDALL. The SCTP_SENDALL path in sctp_sendmsg() iterates ep->asocs with list_for_each_entry_safe(), which caches the next entry in @tmp before the loop body runs. The body calls sctp_sendmsg_to_asoc(), which may drop the socket lock inside sctp_wait_for_sndbuf(). While the lock is dropped, another thread can SCTP_SOCKOPT_PEELOFF the association cached in @tmp, migrating it to a new endpoint via sctp_sock_migrate() (list_del_init() + list_add_tail() to newep->asocs), and optionally close the new socket which frees the association via kfree_rcu(). The cached @tmp can also be freed by a network ABORT for that association, processed in softirq while the lock is dropped. sctp_wait_for_sndbuf() revalidates @asoc (the current entry) on re-lock via the "sk != asoc->base.sk" and "asoc->base.dead" checks, but nothing revalidates @tmp. After a successful return, the iterator advances to the stale @tmp, yielding either a use-after-free (if the peeled socket was closed) or a list-walk onto the new endpoint's list head (type confusion of &newep->asocs as a struct sctp_association *). Both are reachable from CapEff=0; the type-confusion path gives controlled indirect call via the outqueue.sched->init_sid pointer. Fix by re-deriving @tmp from @asoc after sctp_sendmsg_to_asoc() returns. @asoc is known to still be on ep->asocs at that point: the only callers that list_del an association from ep->asocs are sctp_association_free() (which sets asoc->base.dead) and sctp_assoc_migrate() (which changes asoc->base.sk), and sctp_wait_for_sndbuf() checks both under the lock before any successful return; a tripped check propagates as err < 0 and the loop bails before the re-derive. The SCTP_ABORT path in sctp_sendmsg_check_sflags() returns 0 and the loop hits 'continue' before sctp_sendmsg_to_asoc() is ever called, so the @tmp cached by list_for_each_entry_safe() still covers the lock-held free that ba59fb027307 ("sctp: walk the list of asocs safely") was added for.(CVE-2026-46227)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2606.1.0.0375.oe2003sp4.src.rpm"
],
"x86_64": [
"bpftool-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2606.1.0.0375.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2606.1.0.0375.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "Critical"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbcache: fix NULL pointer in cache_set_flush()\n\n1. LINE#1794 - LINE#1887 is some codes about function of\n bch_cache_set_alloc().\n2. LINE#2078 - LINE#2142 is some codes about function of\n register_cache_set().\n3. register_cache_set() will call bch_cache_set_alloc() in LINE#2098.\n\n 1794 struct cache_set *bch_cache_set_alloc(struct cache_sb *sb)\n 1795 {\n ...\n 1860 if (!(c-\u0026gt;devices = kcalloc(c-\u0026gt;nr_uuids, sizeof(void *), GFP_KERNEL)) ||\n 1861 mempool_init_slab_pool(\u0026amp;c-\u0026gt;search, 32, bch_search_cache) ||\n 1862 mempool_init_kmalloc_pool(\u0026amp;c-\u0026gt;bio_meta, 2,\n 1863 sizeof(struct bbio) + sizeof(struct bio_vec) *\n 1864 bucket_pages(c)) ||\n 1865 mempool_init_kmalloc_pool(\u0026amp;c-\u0026gt;fill_iter, 1, iter_size) ||\n 1866 bioset_init(\u0026amp;c-\u0026gt;bio_split, 4, offsetof(struct bbio, bio),\n 1867 BIOSET_NEED_BVECS|BIOSET_NEED_RESCUER) ||\n 1868 !(c-\u0026gt;uuids = alloc_bucket_pages(GFP_KERNEL, c)) ||\n 1869 !(c-\u0026gt;moving_gc_wq = alloc_workqueue(\u0026quot;bcache_gc\u0026quot;,\n 1870 WQ_MEM_RECLAIM, 0)) ||\n 1871 bch_journal_alloc(c) ||\n 1872 bch_btree_cache_alloc(c) ||\n 1873 bch_open_buckets_alloc(c) ||\n 1874 bch_bset_sort_state_init(\u0026amp;c-\u0026gt;sort, ilog2(c-\u0026gt;btree_pages)))\n 1875 goto err;\n ^^^^^^^^\n 1876\n ...\n 1883 return c;\n 1884 err:\n 1885 bch_cache_set_unregister(c);\n ^^^^^^^^^^^^^^^^^^^^^^^^^^^\n 1886 return NULL;\n 1887 }\n ...\n 2078 static const char *register_cache_set(struct cache *ca)\n 2079 {\n ...\n 2098 c = bch_cache_set_alloc(\u0026amp;ca-\u0026gt;sb);\n 2099 if (!c)\n 2100 return err;\n ^^^^^^^^^^\n ...\n 2128 ca-\u0026gt;set = c;\n 2129 ca-\u0026gt;set-\u0026gt;cache[ca-\u0026gt;sb.nr_this_dev] = ca;\n ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^\n ...\n 2138 return NULL;\n 2139 err:\n 2140 bch_cache_set_unregister(c);\n 2141 return err;\n 2142 }\n\n(1) If LINE#1860 - LINE#1874 is true, then do \u0026apos;goto err\u0026apos;(LINE#1875) and\n call bch_cache_set_unregister()(LINE#1885).\n(2) As (1) return NULL(LINE#1886), LINE#2098 - LINE#2100 would return.\n(3) As (2) has returned, LINE#2128 - LINE#2129 would do *not* give the\n value to c-\u0026gt;cache[], it means that c-\u0026gt;cache[] is NULL.\n\nLINE#1624 - LINE#1665 is some codes about function of cache_set_flush().\nAs (1), in LINE#1885 call\nbch_cache_set_unregister()\n---\u0026gt; bch_cache_set_stop()\n ---\u0026gt; closure_queue()\n -.-\u0026gt; cache_set_flush() (as below LINE#1624)\n\n 1624 static void cache_set_flush(struct closure *cl)\n 1625 {\n ...\n 1654 for_each_cache(ca, c, i)\n 1655 if (ca-\u0026gt;alloc_thread)\n ^^\n 1656 kthread_stop(ca-\u0026gt;alloc_thread);\n ...\n 1665 }\n\n(4) In LINE#1655 ca is NULL(see (3)) in cache_set_flush() then the\n kernel crash occurred as below:\n[ 846.712887] bcache: register_cache() error drbd6: cannot allocate memory\n[ 846.713242] bcache: register_bcache() error : failed to register device\n[ 846.713336] bcache: cache_set_free() Cache set 2f84bdc1-498a-4f2f-98a7-01946bf54287 unregistered\n[ 846.713768] BUG: unable to handle kernel NULL pointer dereference at 00000000000009f8\n[ 846.714790] PGD 0 P4D 0\n[ 846.715129] Oops: 0000 [#1] SMP PTI\n[ 846.715472] CPU: 19 PID: 5057 Comm: kworker/19:16 Kdump: loaded Tainted: G OE --------- - - 4.18.0-147.5.1.el8_1.5es.3.x86_64 #1\n[ 846.716082] Hardware name: ESPAN GI-25212/X11DPL-i, BIOS 2.1 06/15/2018\n[ 846.716451] Workqueue: events cache_set_flush [bcache]\n[ 846.716808] RIP: 0010:cache_set_flush+0xc9/0x1b0 [bcache]\n[ 846.717155] Code: 00 4c 89 a5 b0 03 00 00 48 8b 85 68 f6 ff ff a8 08 0f 84 88 00 00 00 31 db 66 83 bd 3c f7 ff ff 00 48 8b 85 48 ff ff ff 74 28 \u0026lt;48\u0026gt; 8b b8 f8 09 00 0\n---truncated---(CVE-2025-38263)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nvsock/vmci: Clear the vmci transport packet properly when initializing it\n\nIn vmci_transport_packet_init memset the vmci_transport_packet before\npopulating the fields to avoid any uninitialised data being left in the\nstructure.(CVE-2025-38403)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\natm: clip: Fix infinite recursive call of clip_push().\n\nsyzbot reported the splat below. [0]\n\nThis happens if we call ioctl(ATMARP_MKIP) more than once.\n\nDuring the first call, clip_mkip() sets clip_push() to vcc-\u0026gt;push(),\nand the second call copies it to clip_vcc-\u0026gt;old_push().\n\nLater, when the socket is close()d, vcc_destroy_socket() passes\nNULL skb to clip_push(), which calls clip_vcc-\u0026gt;old_push(),\ntriggering the infinite recursion.\n\nLet\u0026apos;s prevent the second ioctl(ATMARP_MKIP) by checking\nvcc-\u0026gt;user_back, which is allocated by the first call as clip_vcc.\n\nNote also that we use lock_sock() to prevent racy calls.\n\n[0]:\nBUG: TASK stack guard page was hit at ffffc9000d66fff8 (stack is ffffc9000d670000..ffffc9000d678000)\nOops: stack guard page: 0000 [#1] SMP KASAN NOPTI\nCPU: 0 UID: 0 PID: 5322 Comm: syz.0.0 Not tainted 6.16.0-rc4-syzkaller #0 PREEMPT(full)\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014\nRIP: 0010:clip_push+0x5/0x720 net/atm/clip.c:191\nCode: e0 8f aa 8c e8 1c ad 5b fa eb ae 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 55 \u0026lt;41\u0026gt; 57 41 56 41 55 41 54 53 48 83 ec 20 48 89 f3 49 89 fd 48 bd 00\nRSP: 0018:ffffc9000d670000 EFLAGS: 00010246\nRAX: 1ffff1100235a4a5 RBX: ffff888011ad2508 RCX: ffff8880003c0000\nRDX: 0000000000000000 RSI: 0000000000000000 RDI: ffff888037f01000\nRBP: dffffc0000000000 R08: ffffffff8fa104f7 R09: 1ffffffff1f4209e\nR10: dffffc0000000000 R11: ffffffff8a99b300 R12: ffffffff8a99b300\nR13: ffff888037f01000 R14: ffff888011ad2500 R15: ffff888037f01578\nFS: 000055557ab6d500(0000) GS:ffff88808d250000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: ffffc9000d66fff8 CR3: 0000000043172000 CR4: 0000000000352ef0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n...\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n clip_push+0x6dc/0x720 net/atm/clip.c:200\n vcc_destroy_socket net/atm/common.c:183 [inline]\n vcc_release+0x157/0x460 net/atm/common.c:205\n __sock_release net/socket.c:647 [inline]\n sock_close+0xc0/0x240 net/socket.c:1391\n __fput+0x449/0xa70 fs/file_table.c:465\n task_work_run+0x1d1/0x260 kernel/task_work.c:227\n resume_user_mode_work include/linux/resume_user_mode.h:50 [inline]\n exit_to_user_mode_loop+0xec/0x110 kernel/entry/common.c:114\n exit_to_user_mode_prepare include/linux/entry-common.h:330 [inline]\n syscall_exit_to_user_mode_work include/linux/entry-common.h:414 [inline]\n syscall_exit_to_user_mode include/linux/entry-common.h:449 [inline]\n do_syscall_64+0x2bd/0x3b0 arch/x86/entry/syscall_64.c:100\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\nRIP: 0033:0x7ff31c98e929\nCode: ff ff c3 66 2e 0f 1f 84 00 00 00 00 00 0f 1f 40 00 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 a8 ff ff ff f7 d8 64 89 01 48\nRSP: 002b:00007fffb5aa1f78 EFLAGS: 00000246 ORIG_RAX: 00000000000001b4\nRAX: 0000000000000000 RBX: 0000000000012747 RCX: 00007ff31c98e929\nRDX: 0000000000000000 RSI: 000000000000001e RDI: 0000000000000003\nRBP: 00007ff31cbb7ba0 R08: 0000000000000001 R09: 0000000db5aa226f\nR10: 00007ff31c7ff030 R11: 0000000000000246 R12: 00007ff31cbb608c\nR13: 00007ff31cbb6080 R14: ffffffffffffffff R15: 00007fffb5aa2090\n \u0026lt;/TASK\u0026gt;\nModules linked in:(CVE-2025-38459)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niwlwifi: Add missing check for alloc_ordered_workqueue\n\nAdd check for the return value of alloc_ordered_workqueue since it may\nreturn NULL pointer.(CVE-2025-38602)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: mac80211: reject TDLS operations when station is not associated\n\nsyzbot triggered a WARN in ieee80211_tdls_oper() by sending\nNL80211_TDLS_ENABLE_LINK immediately after NL80211_CMD_CONNECT,\nbefore association completed and without prior TDLS setup.\n\nThis left internal state like sdata-\u0026gt;u.mgd.tdls_peer uninitialized,\nleading to a WARN_ON() in code paths that assumed it was valid.\n\nReject the operation early if not in station mode or not associated.(CVE-2025-38644)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nbtrfs: do not allow relocation of partially dropped subvolumes\n\n[BUG]\nThere is an internal report that balance triggered transaction abort,\nwith the following call trace:\n\n item 85 key (594509824 169 0) itemoff 12599 itemsize 33\n extent refs 1 gen 197740 flags 2\n ref#0: tree block backref root 7\n item 86 key (594558976 169 0) itemoff 12566 itemsize 33\n extent refs 1 gen 197522 flags 2\n ref#0: tree block backref root 7\n ...\n BTRFS error (device loop0): extent item not found for insert, bytenr 594526208 num_bytes 16384 parent 449921024 root_objectid 934 owner 1 offset 0\n BTRFS error (device loop0): failed to run delayed ref for logical 594526208 num_bytes 16384 type 182 action 1 ref_mod 1: -117\n ------------[ cut here ]------------\n BTRFS: Transaction aborted (error -117)\n WARNING: CPU: 1 PID: 6963 at ../fs/btrfs/extent-tree.c:2168 btrfs_run_delayed_refs+0xfa/0x110 [btrfs]\n\nAnd btrfs check doesn\u0026apos;t report anything wrong related to the extent\ntree.\n\n[CAUSE]\nThe cause is a little complex, firstly the extent tree indeed doesn\u0026apos;t\nhave the backref for 594526208.\n\nThe extent tree only have the following two backrefs around that bytenr\non-disk:\n\n item 65 key (594509824 METADATA_ITEM 0) itemoff 13880 itemsize 33\n refs 1 gen 197740 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n item 66 key (594558976 METADATA_ITEM 0) itemoff 13847 itemsize 33\n refs 1 gen 197522 flags TREE_BLOCK\n tree block skinny level 0\n (176 0x7) tree block backref root CSUM_TREE\n\nBut the such missing backref item is not an corruption on disk, as the\noffending delayed ref belongs to subvolume 934, and that subvolume is\nbeing dropped:\n\n item 0 key (934 ROOT_ITEM 198229) itemoff 15844 itemsize 439\n generation 198229 root_dirid 256 bytenr 10741039104 byte_limit 0 bytes_used 345571328\n last_snapshot 198229 flags 0x1000000000001(RDONLY) refs 0\n drop_progress key (206324 EXTENT_DATA 2711650304) drop_level 2\n level 2 generation_v2 198229\n\nAnd that offending tree block 594526208 is inside the dropped range of\nthat subvolume. That explains why there is no backref item for that\nbytenr and why btrfs check is not reporting anything wrong.\n\nBut this also shows another problem, as btrfs will do all the orphan\nsubvolume cleanup at a read-write mount.\n\nSo half-dropped subvolume should not exist after an RW mount, and\nbalance itself is also exclusive to subvolume cleanup, meaning we\nshouldn\u0026apos;t hit a subvolume half-dropped during relocation.\n\nThe root cause is, there is no orphan item for this subvolume.\nIn fact there are 5 subvolumes from around 2021 that have the same\nproblem.\n\nIt looks like the original report has some older kernels running, and\ncaused those zombie subvolumes.\n\nThankfully upstream commit 8d488a8c7ba2 (\u0026quot;btrfs: fix subvolume/snapshot\ndeletion not triggered on mount\u0026quot;) has long fixed the bug.\n\n[ENHANCEMENT]\nFor repairing such old fs, btrfs-progs will be enhanced.\n\nConsidering how delayed the problem will show up (at run delayed ref\ntime) and at that time we have to abort transaction already, it is too\nlate.\n\nInstead here we reject any half-dropped subvolume for reloc tree at the\nearliest time, preventing confusion and extra time wasted on debugging\nsimilar bugs.(CVE-2025-39738)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncan: peak_usb: fix shift-out-of-bounds issue\n\nExplicitly uses a 64-bit constant when the number of bits used for its\nshifting is 32 (which is the case for PC CAN FD interfaces supported by\nthis driver).\n\n[mkl: update subject, apply manually](CVE-2025-40020)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nteam: Move team device type change at the end of team_port_add\n\nAttempting to add a port device that is already up will expectedly fail,\nbut not before modifying the team device header_ops.\n\nIn the case of the syzbot reproducer the gre0 device is\nalready in state UP when it attempts to add it as a\nport device of team0, this fails but before that\nheader_ops-\u0026gt;create of team0 is changed from eth_header to ipgre_header\nin the call to team_dev_type_check_change.\n\nLater when we end up in ipgre_header() struct ip_tunnel* points to nonsense\nas the private data of the device still holds a struct team.\n\nExample sequence of iproute2 commands to reproduce the hang/BUG():\nip link add dev team0 type team\nip link add dev gre0 type gre\nip link set dev gre0 up\nip link set dev gre0 master team0\nip link set dev team0 up\nping -I team0 1.1.1.1\n\nMove team_dev_type_check_change down where all other checks have passed\nas it changes the dev type with no way to restore it in case\none of the checks that follow it fail.\n\nAlso make sure to preserve the origial mtu assignment:\n - If port_dev is not the same type as dev, dev takes mtu from port_dev\n - If port_dev is the same type as dev, port_dev takes mtu from dev\n\nThis is done by adding a conditional before the call to dev_set_mtu\nto prevent it from assigning port_dev-\u0026gt;mtu = dev-\u0026gt;mtu and instead\nletting team_dev_type_check_change assign dev-\u0026gt;mtu = port_dev-\u0026gt;mtu.\nThe conditional is needed because the patch moves the call to\nteam_dev_type_check_change past dev_set_mtu.\n\nTesting:\n - team device driver in-tree selftests\n - Add/remove various devices as slaves of team device\n - syzbot(CVE-2025-68340)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nRDMA/umad: Reject negative data_len in ib_umad_write\n\nib_umad_write computes data_len from user-controlled count and the\nMAD header sizes. With a mismatched user MAD header size and RMPP\nheader length, data_len can become negative and reach ib_create_send_mad().\nThis can make the padding calculation exceed the segment size and trigger\nan out-of-bounds memset in alloc_send_rmpp_list().\n\nAdd an explicit check to reject negative data_len before creating the\nsend buffer.\n\nKASAN splat:\n[ 211.363464] BUG: KASAN: slab-out-of-bounds in ib_create_send_mad+0xa01/0x11b0\n[ 211.364077] Write of size 220 at addr ffff88800c3fa1f8 by task spray_thread/102\n[ 211.365867] ib_create_send_mad+0xa01/0x11b0\n[ 211.365887] ib_umad_write+0x853/0x1c80(CVE-2026-23243)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmacvlan: observe an RCU grace period in macvlan_common_newlink() error path\n\nvalis reported that a race condition still happens after my prior patch.\n\nmacvlan_common_newlink() might have made @dev visible before\ndetecting an error, and its caller will directly call free_netdev(dev).\n\nWe must respect an RCU period, either in macvlan or the core networking\nstack.\n\nAfter adding a temporary mdelay(1000) in macvlan_forward_source_one()\nto open the race window, valis repro was:\n\nip link add p1 type veth peer p2\nip link set address 00:00:00:00:00:20 dev p1\nip link set up dev p1\nip link set up dev p2\nip link add mv0 link p2 type macvlan mode source\n\n(ip link add invalid% link p2 type macvlan mode source macaddr add\n00:00:00:00:00:20 \u0026amp;) ; sleep 0.5 ; ping -c1 -I p1 1.2.3.4\nPING 1.2.3.4 (1.2.3.4): 56 data bytes\nRTNETLINK answers: Invalid argument\n\nBUG: KASAN: slab-use-after-free in macvlan_forward_source\n(drivers/net/macvlan.c:408 drivers/net/macvlan.c:444)\nRead of size 8 at addr ffff888016bb89c0 by task e/175\n\nCPU: 1 UID: 1000 PID: 175 Comm: e Not tainted 6.19.0-rc8+ #33 NONE\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.14.0-2 04/01/2014\nCall Trace:\n\u0026lt;IRQ\u0026gt;\ndump_stack_lvl (lib/dump_stack.c:123)\nprint_report (mm/kasan/report.c:379 mm/kasan/report.c:482)\n? macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444)\nkasan_report (mm/kasan/report.c:597)\n? macvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444)\nmacvlan_forward_source (drivers/net/macvlan.c:408 drivers/net/macvlan.c:444)\n? tasklet_init (kernel/softirq.c:983)\nmacvlan_handle_frame (drivers/net/macvlan.c:501)\n\nAllocated by task 169:\nkasan_save_stack (mm/kasan/common.c:58)\nkasan_save_track (./arch/x86/include/asm/current.h:25\nmm/kasan/common.c:70 mm/kasan/common.c:79)\n__kasan_kmalloc (mm/kasan/common.c:419)\n__kvmalloc_node_noprof (./include/linux/kasan.h:263 mm/slub.c:5657\nmm/slub.c:7140)\nalloc_netdev_mqs (net/core/dev.c:12012)\nrtnl_create_link (net/core/rtnetlink.c:3648)\nrtnl_newlink (net/core/rtnetlink.c:3830 net/core/rtnetlink.c:3957\nnet/core/rtnetlink.c:4072)\nrtnetlink_rcv_msg (net/core/rtnetlink.c:6958)\nnetlink_rcv_skb (net/netlink/af_netlink.c:2550)\nnetlink_unicast (net/netlink/af_netlink.c:1319 net/netlink/af_netlink.c:1344)\nnetlink_sendmsg (net/netlink/af_netlink.c:1894)\n__sys_sendto (net/socket.c:727 net/socket.c:742 net/socket.c:2206)\n__x64_sys_sendto (net/socket.c:2209)\ndo_syscall_64 (arch/x86/entry/syscall_64.c:63 arch/x86/entry/syscall_64.c:94)\nentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:131)\n\nFreed by task 169:\nkasan_save_stack (mm/kasan/common.c:58)\nkasan_save_track (./arch/x86/include/asm/current.h:25\nmm/kasan/common.c:70 mm/kasan/common.c:79)\nkasan_save_free_info (mm/kasan/generic.c:587)\n__kasan_slab_free (mm/kasan/common.c:287)\nkfree (mm/slub.c:6674 mm/slub.c:6882)\nrtnl_newlink (net/core/rtnetlink.c:3845 net/core/rtnetlink.c:3957\nnet/core/rtnetlink.c:4072)\nrtnetlink_rcv_msg (net/core/rtnetlink.c:6958)\nnetlink_rcv_skb (net/netlink/af_netlink.c:2550)\nnetlink_unicast (net/netlink/af_netlink.c:1319 net/netlink/af_netlink.c:1344)\nnetlink_sendmsg (net/netlink/af_netlink.c:1894)\n__sys_sendto (net/socket.c:727 net/socket.c:742 net/socket.c:2206)\n__x64_sys_sendto (net/socket.c:2209)\ndo_syscall_64 (arch/x86/entry/syscall_64.c:63 arch/x86/entry/syscall_64.c:94)\nentry_SYSCALL_64_after_hwframe (arch/x86/entry/entry_64.S:131)(CVE-2026-23273)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmm: blk-cgroup: fix use-after-free in cgwb_release_workfn()\n\ncgwb_release_workfn() calls css_put(wb-\u0026gt;blkcg_css) and then later accesses\nwb-\u0026gt;blkcg_css again via blkcg_unpin_online(). If css_put() drops the last\nreference, the blkcg can be freed asynchronously (css_free_rwork_fn -\u0026gt;\nblkcg_css_free -\u0026gt; kfree) before blkcg_unpin_online() dereferences the\npointer to access blkcg-\u0026gt;online_pin, resulting in a use-after-free:\n\n BUG: KASAN: slab-use-after-free in blkcg_unpin_online (./include/linux/instrumented.h:112 ./include/linux/atomic/atomic-instrumented.h:400 ./include/linux/refcount.h:389 ./include/linux/refcount.h:432 ./include/linux/refcount.h:450 block/blk-cgroup.c:1367)\n Write of size 4 at addr ff11000117aa6160 by task kworker/71:1/531\n Workqueue: cgwb_release cgwb_release_workfn\n Call Trace:\n \u0026lt;TASK\u0026gt;\n blkcg_unpin_online (./include/linux/instrumented.h:112 ./include/linux/atomic/atomic-instrumented.h:400 ./include/linux/refcount.h:389 ./include/linux/refcount.h:432 ./include/linux/refcount.h:450 block/blk-cgroup.c:1367)\n cgwb_release_workfn (mm/backing-dev.c:629)\n process_scheduled_works (kernel/workqueue.c:3278 kernel/workqueue.c:3385)\n\n Freed by task 1016:\n kfree (./include/linux/kasan.h:235 mm/slub.c:2689 mm/slub.c:6246 mm/slub.c:6561)\n css_free_rwork_fn (kernel/cgroup/cgroup.c:5542)\n process_scheduled_works (kernel/workqueue.c:3302 kernel/workqueue.c:3385)\n\n** Stack based on commit 66672af7a095 (\u0026quot;Add linux-next specific files\nfor 20260410\u0026quot;)\n\nI am seeing this crash sporadically in Meta fleet across multiple kernel\nversions. A full reproducer is available at:\nhttps://github.com/leitao/debug/blob/main/reproducers/repro_blkcg_uaf.sh\n\n(The race window is narrow. To make it easily reproducible, inject a\nmsleep(100) between css_put() and blkcg_unpin_online() in\ncgwb_release_workfn(). With that delay and a KASAN-enabled kernel, the\nreproducer triggers the splat reliably in less than a second.)\n\nFix this by moving blkcg_unpin_online() before css_put(), so the\ncgwb\u0026apos;s CSS reference keeps the blkcg alive while blkcg_unpin_online()\naccesses it.(CVE-2026-31586)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nKVM: x86: Use scratch field in MMIO fragment to hold small write values\n\nWhen exiting to userspace to service an emulated MMIO write, copy the\nto-be-written value to a scratch field in the MMIO fragment if the size\nof the data payload is 8 bytes or less, i.e. can fit in a single chunk,\ninstead of pointing the fragment directly at the source value.\n\nThis fixes a class of use-after-free bugs that occur when the emulator\ninitiates a write using an on-stack, local variable as the source, the\nwrite splits a page boundary, *and* both pages are MMIO pages. Because\nKVM\u0026apos;s ABI only allows for physically contiguous MMIO requests, accesses\nthat split MMIO pages are separated into two fragments, and are sent to\nuserspace one at a time. When KVM attempts to complete userspace MMIO in\nresponse to KVM_RUN after the first fragment, KVM will detect the second\nfragment and generate a second userspace exit, and reference the on-stack\nvariable.\n\nThe issue is most visible if the second KVM_RUN is performed by a separate\ntask, in which case the stack of the initiating task can show up as truly\nfreed data.\n\n ==================================================================\n BUG: KASAN: use-after-free in complete_emulated_mmio+0x305/0x420\n Read of size 1 at addr ffff888009c378d1 by task syz-executor417/984\n\n CPU: 1 PID: 984 Comm: syz-executor417 Not tainted 5.10.0-182.0.0.95.h2627.eulerosv2r13.x86_64 #3\n Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.15.0-0-g2dd4b9b3f840-prebuilt.qemu.org 04/01/2014 Call Trace:\n dump_stack+0xbe/0xfd\n print_address_description.constprop.0+0x19/0x170\n __kasan_report.cold+0x6c/0x84\n kasan_report+0x3a/0x50\n check_memory_region+0xfd/0x1f0\n memcpy+0x20/0x60\n complete_emulated_mmio+0x305/0x420\n kvm_arch_vcpu_ioctl_run+0x63f/0x6d0\n kvm_vcpu_ioctl+0x413/0xb20\n __se_sys_ioctl+0x111/0x160\n do_syscall_64+0x30/0x40\n entry_SYSCALL_64_after_hwframe+0x67/0xd1\n RIP: 0033:0x42477d\n Code: \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48\n RSP: 002b:00007faa8e6890e8 EFLAGS: 00000246 ORIG_RAX: 0000000000000010\n RAX: ffffffffffffffda RBX: 00000000004d7338 RCX: 000000000042477d\n RDX: 0000000000000000 RSI: 000000000000ae80 RDI: 0000000000000005\n RBP: 00000000004d7330 R08: 00007fff28d546df R09: 0000000000000000\n R10: 0000000000000000 R11: 0000000000000246 R12: 00000000004d733c\n R13: 0000000000000000 R14: 000000000040a200 R15: 00007fff28d54720\n\n The buggy address belongs to the page:\n page:0000000029f6a428 refcount:0 mapcount:0 mapping:0000000000000000 index:0x0 pfn:0x9c37\n flags: 0xfffffc0000000(node=0|zone=1|lastcpupid=0x1fffff)\n raw: 000fffffc0000000 0000000000000000 ffffea0000270dc8 0000000000000000\n raw: 0000000000000000 0000000000000000 00000000ffffffff 0000000000000000 page dumped because: kasan: bad access detected\n\n Memory state around the buggy address:\n ffff888009c37780: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n ffff888009c37800: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n \u0026gt;ffff888009c37880: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n ^\n ffff888009c37900: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n ffff888009c37980: ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff\n ==================================================================\n\nThe bug can also be reproduced with a targeted KVM-Unit-Test by hacking\nKVM to fill a large on-stack variable in complete_emulated_mmio(), i.e. by\noverwrite the data value with garbage.\n\nLimit the use of the scratch fields to 8-byte or smaller accesses, and to\njust writes, as larger accesses and reads are not affected thanks to\nimplementation details in the emulator, but add a sanity check to ensure\nthose details don\u0026apos;t change in the future. Specifically, KVM never uses\non-stack variables for accesses larger that 8 bytes, e.g. uses an operand\nin the emulator context, and *al\n---truncated---(CVE-2026-31588)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nopenvswitch: defer tunnel netdev_put to RCU release\n\novs_netdev_tunnel_destroy() may run after NETDEV_UNREGISTER already\ndetached the device. Dropping the netdev reference in destroy can race\nwith concurrent readers that still observe vport-\u0026gt;dev.\n\nDo not release vport-\u0026gt;dev in ovs_netdev_tunnel_destroy(). Instead, let\nvport_netdev_free() drop the reference from the RCU callback, matching\nthe non-tunnel destroy path and avoiding additional synchronization\nunder RTNL.(CVE-2026-31678)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: ulpi: fix double free in ulpi_register_interface() error path\n\nWhen device_register() fails, ulpi_register() calls put_device() on\nulpi-\u0026gt;dev.\n\nThe device release callback ulpi_dev_release() drops the OF node\nreference and frees ulpi, but the current error path in\nulpi_register_interface() then calls kfree(ulpi) again, causing a\ndouble free.\n\nLet put_device() handle the cleanup through ulpi_dev_release() and\navoid freeing ulpi again in ulpi_register_interface().(CVE-2026-31759)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/ioc32: stop speculation on the drm_compat_ioctl path\n\nThe drm compat ioctl path takes a user controlled pointer, and then\ndereferences it into a table of function pointers, the signature method\nof spectre problems. Fix this up by calling array_index_nospec() on the\nindex to the function pointer list.(CVE-2026-31781)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nip6_tunnel: clear skb2-\u0026gt;cb[] in ip4ip6_err()\n\nOskar Kjos reported the following problem.\n\nip4ip6_err() calls icmp_send() on a cloned skb whose cb[] was written\nby the IPv6 receive path as struct inet6_skb_parm. icmp_send() passes\nIPCB(skb2) to __ip_options_echo(), which interprets that cb[] region\nas struct inet_skb_parm (IPv4). The layouts differ: inet6_skb_parm.nhoff\nat offset 14 overlaps inet_skb_parm.opt.rr, producing a non-zero rr\nvalue. __ip_options_echo() then reads optlen from attacker-controlled\npacket data at sptr[rr+1] and copies that many bytes into dopt-\u0026gt;__data,\na fixed 40-byte stack buffer (IP_OPTIONS_DATA_FIXED_SIZE).\n\nTo fix this we clear skb2-\u0026gt;cb[], as suggested by Oskar Kjos.\n\nAlso add minimal IPv4 header validation (version == 4, ihl \u0026gt;= 5).(CVE-2026-43037)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nipv6: icmp: clear skb2-\u0026gt;cb[] in ip6_err_gen_icmpv6_unreach()\n\nSashiko AI-review observed:\n\n In ip6_err_gen_icmpv6_unreach(), the skb is an outer IPv4 ICMP error packet\n where its cb contains an IPv4 inet_skb_parm. When skb is cloned into skb2\n and passed to icmp6_send(), it uses IP6CB(skb2).\n\n IP6CB interprets the IPv4 inet_skb_parm as an inet6_skb_parm. The cipso\n offset in inet_skb_parm.opt directly overlaps with dsthao in inet6_skb_parm\n at offset 18.\n\n If an attacker sends a forged ICMPv4 error with a CIPSO IP option, dsthao\n would be a non-zero offset. Inside icmp6_send(), mip6_addr_swap() is called\n and uses ipv6_find_tlv(skb, opt-\u0026gt;dsthao, IPV6_TLV_HAO).\n\n This would scan the inner, attacker-controlled IPv6 packet starting at that\n offset, potentially returning a fake TLV without checking if the remaining\n packet length can hold the full 18-byte struct ipv6_destopt_hao.\n\n Could mip6_addr_swap() then perform a 16-byte swap that extends past the end\n of the packet data into skb_shared_info?\n\n Should the cb array also be cleared in ip6_err_gen_icmpv6_unreach() and\n ip6ip6_err() to prevent this?\n\nThis patch implements the first suggestion.\n\nI am not sure if ip6ip6_err() needs to be changed.\nA separate patch would be better anyway.(CVE-2026-43038)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm6: fix uninitialized saddr in xfrm6_get_saddr()\n\nxfrm6_get_saddr() does not check the return value of\nipv6_dev_get_saddr(). When ipv6_dev_get_saddr() fails to find a suitable\nsource address (returns -EADDRNOTAVAIL), saddr-\u0026gt;in6 is left\nuninitialized, but xfrm6_get_saddr() still returns 0 (success).\n\nThis causes the caller xfrm_tmpl_resolve_one() to use the uninitialized\naddress in xfrm_state_find(), triggering KMSAN warning:\n\n=====================================================\nBUG: KMSAN: uninit-value in xfrm_state_find+0x2424/0xa940\n xfrm_state_find+0x2424/0xa940\n xfrm_resolve_and_create_bundle+0x906/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n xfrm_lookup_route+0x63/0x2b0\n ip_route_output_flow+0x1ce/0x270\n udp_sendmsg+0x2ce1/0x3400\n inet_sendmsg+0x1ef/0x2a0\n __sock_sendmsg+0x278/0x3d0\n __sys_sendto+0x593/0x720\n __x64_sys_sendto+0x130/0x200\n x64_sys_call+0x332b/0x3e70\n do_syscall_64+0xd3/0xf80\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n\nLocal variable tmp.i.i created at:\n xfrm_resolve_and_create_bundle+0x3e3/0x5a20\n xfrm_lookup_with_ifid+0xcc0/0x3770\n=====================================================\n\nFix by checking the return value of ipv6_dev_get_saddr() and propagating\nthe error.(CVE-2026-43139)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfs: fix freemap adjustments when adding xattrs to leaf blocks\n\nxfs/592 and xfs/794 both trip this assertion in the leaf block freemap\nadjustment code after ~20 minutes of running on my test VMs:\n\n ASSERT(ichdr-\u0026gt;firstused \u0026gt;= ichdr-\u0026gt;count * sizeof(xfs_attr_leaf_entry_t)\n\t\t\t\t\t+ xfs_attr3_leaf_hdr_size(leaf));\n\nUpon enabling quite a lot more debugging code, I narrowed this down to\nfsstress trying to set a local extended attribute with namelen=3 and\nvaluelen=71. This results in an entry size of 80 bytes.\n\nAt the start of xfs_attr3_leaf_add_work, the freemap looks like this:\n\ni 0 base 448 size 0 rhs 448 count 46\ni 1 base 388 size 132 rhs 448 count 46\ni 2 base 2120 size 4 rhs 448 count 46\nfirstused = 520\n\nwhere \u0026quot;rhs\u0026quot; is the first byte past the end of the leaf entry array.\nThis is inconsistent -- the entries array ends at byte 448, but\nfreemap[1] says there\u0026apos;s free space starting at byte 388!\n\nBy the end of the function, the freemap is in worse shape:\n\ni 0 base 456 size 0 rhs 456 count 47\ni 1 base 388 size 52 rhs 456 count 47\ni 2 base 2120 size 4 rhs 456 count 47\nfirstused = 440\n\nImportant note: 388 is not aligned with the entries array element size\nof 8 bytes.\n\nBased on the incorrect freemap, the name area starts at byte 440, which\nis below the end of the entries array! That\u0026apos;s why the assertion\ntriggers and the filesystem shuts down.\n\nHow did we end up here? First, recall from the previous patch that the\nfreemap array in an xattr leaf block is not intended to be a\ncomprehensive map of all free space in the leaf block. In other words,\nit\u0026apos;s perfectly legal to have a leaf block with:\n\n * 376 bytes in use by the entries array\n * freemap[0] has [base = 376, size = 8]\n * freemap[1] has [base = 388, size = 1500]\n * the space between 376 and 388 is free, but the freemap stopped\n tracking that some time ago\n\nIf we add one xattr, the entries array grows to 384 bytes, and\nfreemap[0] becomes [base = 384, size = 0]. So far, so good. But if we\nadd a second xattr, the entries array grows to 392 bytes, and freemap[0]\ngets pushed up to [base = 392, size = 0]. This is bad, because\nfreemap[1] hasn\u0026apos;t been updated, and now the entries array and the free\nspace claim the same space.\n\nThe fix here is to adjust all freemap entries so that none of them\ncollide with the entries array. Note that this fix relies on commit\n2a2b5932db6758 (\u0026quot;xfs: fix attr leaf header freemap.size underflow\u0026quot;) and\nthe previous patch that resets zero length freemap entries to have\nbase = 0.(CVE-2026-43158)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: usb: kaweth: remove TX queue manipulation in kaweth_set_rx_mode\n\nkaweth_set_rx_mode(), the ndo_set_rx_mode callback, calls\nnetif_stop_queue() and netif_wake_queue(). These are TX queue flow\ncontrol functions unrelated to RX multicast configuration.\n\nThe premature netif_wake_queue() can re-enable TX while tx_urb is still\nin-flight, leading to a double usb_submit_urb() on the same URB:\n\nkaweth_start_xmit() {\n netif_stop_queue();\n usb_submit_urb(kaweth-\u0026gt;tx_urb);\n}\n\nkaweth_set_rx_mode() {\n netif_stop_queue();\n netif_wake_queue(); // wakes TX queue before URB is done\n}\n\nkaweth_start_xmit() {\n netif_stop_queue();\n usb_submit_urb(kaweth-\u0026gt;tx_urb); // URB submitted while active\n}\n\nThis triggers the WARN in usb_submit_urb():\n\n \u0026quot;URB submitted while active\u0026quot;\n\nThis is a similar class of bug fixed in rtl8150 by\n\n- commit 958baf5eaee3 (\u0026quot;net: usb: Remove disruptive netif_wake_queue in rtl8150_set_multicast\u0026quot;).\n\nAlso kaweth_set_rx_mode() is already functionally broken, the\nreal set_rx_mode action is performed by kaweth_async_set_rx_mode(),\nwhich in turn is not a no-op only at ndo_open() time.(CVE-2026-43180)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: xt_tcpmss: check remaining length before reading optlen\n\nQuoting reporter:\n In net/netfilter/xt_tcpmss.c (lines 53-68), the TCP option parser reads\n op[i+1] directly without validating the remaining option length.\n\n If the last byte of the option field is not EOL/NOP (0/1), the code attempts\n to index op[i+1]. In the case where i + 1 == optlen, this causes an\n out-of-bounds read, accessing memory past the optlen boundary\n (either reading beyond the stack buffer _opt or the\n following payload).(CVE-2026-43190)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnetfilter: nf_conntrack_h323: fix OOB read in decode_choice()\n\nIn decode_choice(), the boundary check before get_len() uses the\nvariable `len`, which is still 0 from its initialization at the top of\nthe function:\n\n unsigned int type, ext, len = 0;\n ...\n if (ext || (son-\u0026gt;attr \u0026amp; OPEN)) {\n BYTE_ALIGN(bs);\n if (nf_h323_error_boundary(bs, len, 0)) /* len is 0 here */\n return H323_ERROR_BOUND;\n len = get_len(bs); /* OOB read */\n\nWhen the bitstream is exactly consumed (bs-\u0026gt;cur == bs-\u0026gt;end), the check\nnf_h323_error_boundary(bs, 0, 0) evaluates to (bs-\u0026gt;cur + 0 \u0026gt; bs-\u0026gt;end),\nwhich is false. The subsequent get_len() call then dereferences\n*bs-\u0026gt;cur++, reading 1 byte past the end of the buffer. If that byte\nhas bit 7 set, get_len() reads a second byte as well.\n\nThis can be triggered remotely by sending a crafted Q.931 SETUP message\nwith a User-User Information Element containing exactly 2 bytes of\nPER-encoded data ({0x08, 0x00}) to port 1720 through a firewall with\nthe nf_conntrack_h323 helper active. The decoder fully consumes the\nPER buffer before reaching this code path, resulting in a 1-2 byte\nheap-buffer-overflow read confirmed by AddressSanitizer.\n\nFix this by checking for 2 bytes (the maximum that get_len() may read)\ninstead of the uninitialized `len`. This matches the pattern used at\nevery other get_len() call site in the same file, where the caller\nchecks for 2 bytes of available data before calling get_len().(CVE-2026-43233)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmailbox: Prevent out-of-bounds access in fw_mbox_index_xlate()\n\nAlthough it is guided that `#mbox-cells` must be at least 1, there are\nmany instances of `#mbox-cells = \u0026lt;0\u0026gt;;` in the device tree. If that is\nthe case and the corresponding mailbox controller does not provide\n`fw_xlate` and of_xlate` function pointers, `fw_mbox_index_xlate()` will\nbe used by default and out-of-bounds accesses could occur due to lack of\nbounds check in that function.(CVE-2026-43281)\n\nIn the Linux kernel, there is a double free vulnerability in the error handling path of cpufreq_dbs_governor_init() function. When kobject_init_and_add() fails, cpufreq_dbs_governor_init() calls kobject_put(\u0026amp;dbs_data-\u0026gt;attr_set.kobj). The kobject release callback cpufreq_dbs_data_release() calls gov-\u0026gt;exit(dbs_data) and kfree(dbs_data), but the current error path then calls gov-\u0026gt;exit(dbs_data) and kfree(dbs_data) again, causing a double free. Keep the direct kfree(dbs_data) for the gov-\u0026gt;init() failure path, but after kobject_init_and_add() has been called, let kobject_put() handle the cleanup through cpufreq_dbs_data_release().(CVE-2026-43328)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nlib/crypto: chacha: Zeroize permuted_state before it leaves scope\n\nSince the ChaCha permutation is invertible, the local variable\n\u0026apos;permuted_state\u0026apos; is sufficient to compute the original \u0026apos;state\u0026apos;, and thus\nthe key, even after the permutation has been done.\n\nWhile the kernel is quite inconsistent about zeroizing secrets on the\nstack (and some prominent userspace crypto libraries don\u0026apos;t bother at all\nsince it\u0026apos;s not guaranteed to work anyway), the kernel does try to do it\nas a best practice, especially in cases involving the RNG.\n\nThus, explicitly zeroize \u0026apos;permuted_state\u0026apos; before it goes out of scope.(CVE-2026-43336)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nusb: class: cdc-wdm: fix reordering issue in read code path\n\nQuoting the bug report:\n\nDue to compiler optimization or CPU out-of-order execution, the\ndesc-\u0026gt;length update can be reordered before the memmove. If this\nhappens, wdm_read() can see the new length and call copy_to_user() on\nuninitialized memory. This also violates LKMM data race rules [1].\n\nFix it by using WRITE_ONCE and memory barriers.(CVE-2026-43427)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/mlx5e: Fix DMA FIFO desync on error CQE SQ recovery\n\nIn case of a TX error CQE, a recovery flow is triggered,\nmlx5e_reset_txqsq_cc_pc() resets dma_fifo_cc to 0 but not dma_fifo_pc,\ndesyncing the DMA FIFO producer and consumer.\n\nAfter recovery, the producer pushes new DMA entries at the old\ndma_fifo_pc, while the consumer reads from position 0.\nThis causes us to unmap stale DMA addresses from before the recovery.\n\nThe DMA FIFO is a purely software construct with no HW counterpart.\nAt the point of reset, all WQEs have been flushed so dma_fifo_cc is\nalready equal to dma_fifo_pc. There is no need to reset either counter,\nsimilar to how skb_fifo pc/cc are untouched.\n\nRemove the \u0026apos;dma_fifo_cc = 0\u0026apos; reset.\n\nThis fixes the following WARNING:\n WARNING: CPU: 0 PID: 0 at drivers/iommu/dma-iommu.c:1240 iommu_dma_unmap_page+0x79/0x90\n Modules linked in: mlx5_vdpa vringh vdpa bonding mlx5_ib mlx5_vfio_pci ipip mlx5_fwctl tunnel4 mlx5_core ib_ipoib geneve ip6_gre ip_gre gre nf_tables ip6_tunnel rdma_ucm ib_uverbs ib_umad vfio_pci vfio_pci_core act_mirred act_skbedit act_vlan vhost_net vhost tap ip6table_mangle ip6table_nat ip6table_filter ip6_tables iptable_mangle cls_matchall nfnetlink_cttimeout act_gact cls_flower sch_ingress vhost_iotlb iptable_raw tunnel6 vfio_iommu_type1 vfio openvswitch nsh rpcsec_gss_krb5 auth_rpcgss oid_registry xt_conntrack xt_MASQUERADE nf_conntrack_netlink nfnetlink iptable_nat nf_nat xt_addrtype br_netfilter overlay zram zsmalloc rpcrdma ib_iser libiscsi scsi_transport_iscsi rdma_cm iw_cm ib_cm ib_core fuse [last unloaded: nf_tables]\n CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.13.0-rc5_for_upstream_min_debug_2024_12_30_21_33 #1\n Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.13.0-0-gf21b5a4aeb02-prebuilt.qemu.org 04/01/2014\n RIP: 0010:iommu_dma_unmap_page+0x79/0x90\n Code: 2b 4d 3b 21 72 26 4d 3b 61 08 73 20 49 89 d8 44 89 f9 5b 4c 89 f2 4c 89 e6 48 89 ef 5d 41 5c 41 5d 41 5e 41 5f e9 c7 ae 9e ff \u0026lt;0f\u0026gt; 0b 5b 5d 41 5c 41 5d 41 5e 41 5f c3 66 2e 0f 1f 84 00 00 00 00\n Call Trace:\n \u0026lt;IRQ\u0026gt;\n ? __warn+0x7d/0x110\n ? iommu_dma_unmap_page+0x79/0x90\n ? report_bug+0x16d/0x180\n ? handle_bug+0x4f/0x90\n ? exc_invalid_op+0x14/0x70\n ? asm_exc_invalid_op+0x16/0x20\n ? iommu_dma_unmap_page+0x79/0x90\n ? iommu_dma_unmap_page+0x2e/0x90\n dma_unmap_page_attrs+0x10d/0x1b0\n mlx5e_tx_wi_dma_unmap+0xbe/0x120 [mlx5_core]\n mlx5e_poll_tx_cq+0x16d/0x690 [mlx5_core]\n mlx5e_napi_poll+0x8b/0xac0 [mlx5_core]\n __napi_poll+0x24/0x190\n net_rx_action+0x32a/0x3b0\n ? mlx5_eq_comp_int+0x7e/0x270 [mlx5_core]\n ? notifier_call_chain+0x35/0xa0\n handle_softirqs+0xc9/0x270\n irq_exit_rcu+0x71/0xd0\n common_interrupt+0x7f/0xa0\n \u0026lt;/IRQ\u0026gt;\n \u0026lt;TASK\u0026gt;\n asm_common_interrupt+0x22/0x40(CVE-2026-43466)\n\nIn the Linux kernel\u0026apos;s openvswitch module, the vport netlink reply helpers allocate a fixed-size skb with nlmsg_new(NLMSG_DEFAULT_SIZE, ...) but serialize the full upcall PID array via ovs_vport_get_upcall_portids(). Since ovs_vport_set_upcall_portids() accepts any non-zero multiple of sizeof(u32) with no upper bound, a CAP_NET_ADMIN user can install a PID array large enough to overflow the reply buffer, causing nla_put() to fail with -EMSGSIZE and hitting BUG_ON(err \u0026lt; 0), leading to a kernel panic. On systems with unprivileged user namespaces enabled (e.g., Ubuntu default), this is reachable via unshare -Urn.(CVE-2026-45840)\n\nIn the Linux kernel, the following vulnerability has been resolved: drm/nouveau: fix u32 overflow in pushbuf reloc bounds check nouveau_gem_pushbuf_reloc_apply() validates each relocation with if (r-\u0026gt;reloc_bo_offset + 4 \u0026gt; nvbo-\u0026gt;bo.base.size) but reloc_bo_offset is __u32 (uapi/drm/nouveau_drm.h) and the integer literal 4 promotes to unsigned int, so the addition is performed in 32 bits and wraps before the comparison against the size_t bo size. Cast to u64 so the addition happens in 64-bit arithmetic. [ Add Fixes: tag. - Danilo ] The Linux kernel CVE team has assigned CVE-2026-46006 to this issue.(CVE-2026-46006)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nthermal: core: Fix thermal zone governor cleanup issues\n\nIf thermal_zone_device_register_with_trips() fails after adding\na thermal governor to the thermal zone being registered, the\ngovernor is not removed from it as appropriate which may lead to\na memory leak.\n\nIn turn, thermal_zone_device_unregister() calls thermal_set_governor()\nwithout acquiring the thermal zone lock beforehand which may race with\na governor update via sysfs and may lead to a use-after-free in that\ncase.\n\nAddress these issues by adding two thermal_set_governor() calls, one to\nthermal_release() to remove the governor from the given thermal zone,\nand one to the thermal zone registration error path to cover failures\npreceding the thermal zone device registration.(CVE-2026-46021)\n\nIn the Linux kernel, the following vulnerability has been resolved: dm mirror: fix integer overflow in create_dirty_log() The argument count calculation in create_dirty_log() performs `*args_used = 2 + param_count` before validating against argc. When a user provides a param_count close to UINT_MAX via the device mapper table string, this unsigned addition wraps around to a small value, causing the subsequent `argc \u0026lt; *args_used` check to be bypassed. The overflowed param_count is then passed as argc to dm_dirty_log_create(), where it can cause out-of-bounds reads on the argv array. Fix by comparing param_count against argc - 2 before performing the addition, following the same pattern used by parse_features() in the same file. Since argc \u0026gt;= 2 is already guaranteed, the subtraction is safe. The Linux kernel CVE team has assigned CVE-2026-46023 to this issue.(CVE-2026-46023)\n\nIn the Linux kernel, the following vulnerability has been resolved: crypto: authencesn - reject short ahash digests during instance creation authencesn requires either a zero authsize or an authsize of at least 4 bytes because the ESN encrypt/decrypt paths always move 4 bytes of high-order sequence number data at the end of the authenticated data. While crypto_authenc_esn_setauthsize() already rejects explicit non-zero authsizes in the range 1..3, crypto_authenc_esn_create() still copied auth-\u0026gt;digestsize into inst-\u0026gt;alg.maxauthsize without validating it. The AEAD core then initialized the tfm\u0026apos;s default authsize from that value. As a result, selecting an ahash with digest size 1..3, such as cbcmac(cipher_null), exposed authencesn instances whose default authsize was invalid even though setauthsize() would have rejected the same value. AF_ALG could then trigger the ESN tail handling with a too-short tag and hit an out-of-bounds access. Reject authencesn instances whose ahash digest size is in the invalid non-zero range 1..3 so that no tfm can inherit an unsupported default authsize. The Linux kernel CVE team has assigned CVE-2026-46033 to this issue.(CVE-2026-46033)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nceph: only d_add() negative dentries when they are unhashed\n\nCeph can call d_add(dentry, NULL) on a negative dentry that is already\npresent in the primary dcache hash.\n\nIn the current VFS that is not safe. d_add() goes through __d_add()\nto __d_rehash(), which unconditionally reinserts dentry-\u0026gt;d_hash into\nthe hlist_bl bucket. If the dentry is already hashed, reinserting the\nsame node can corrupt the bucket, including creating a self-loop.\nOnce that happens, __d_lookup() can spin forever in the hlist_bl walk,\ntypically looping only on the d_name.hash mismatch check and\neventually triggering RCU stall reports like this one:\n\n rcu: INFO: rcu_sched self-detected stall on CPU\n rcu: 87-....: (2100 ticks this GP) idle=3a4c/1/0x4000000000000000 softirq=25003319/25003319 fqs=829\n rcu: (t=2101 jiffies g=79058445 q=698988 ncpus=192)\n CPU: 87 UID: 2952868916 PID: 3933303 Comm: php-cgi8.3 Not tainted 6.18.17-i1-amd #950 NONE\n Hardware name: Dell Inc. PowerEdge R7615/0G9DHV, BIOS 1.6.6 09/22/2023\n RIP: 0010:__d_lookup+0x46/0xb0\n Code: c1 e8 07 48 8d 04 c2 48 8b 00 49 89 fc 49 89 f5 48 89 c3 48 83 e3 fe 48 83 f8 01 77 0f eb 2d 0f 1f 44 00 00 48 8b 1b 48 85 db \u0026lt;74\u0026gt; 20 39 6b 18 75 f3 48 8d 7b 78 e8 ba 85 d0 00 4c 39 63 10 74 1f\n RSP: 0018:ff745a70c8253898 EFLAGS: 00000282\n RAX: ff26e470054cb208 RBX: ff26e470054cb208 RCX: 000000006e958966\n RDX: ff26e48267340000 RSI: ff745a70c82539b0 RDI: ff26e458f74655c0\n RBP: 000000006e958966 R08: 0000000000000180 R09: 9cd08d909b919a89\n R10: ff26e458f74655c0 R11: 0000000000000000 R12: ff26e458f74655c0\n R13: ff745a70c82539b0 R14: d0d0d0d0d0d0d0d0 R15: 2f2f2f2f2f2f2f2f\n FS: 00007f5770896980(0000) GS:ff26e482c5d88000(0000) knlGS:0000000000000000\n CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n CR2: 00007f5764de50c0 CR3: 000000a72abb5001 CR4: 0000000000771ef0\n PKRU: 55555554\n Call Trace:\n \u0026lt;TASK\u0026gt;\n lookup_fast+0x9f/0x100\n walk_component+0x1f/0x150\n link_path_walk+0x20e/0x3d0\n path_lookupat+0x68/0x180\n filename_lookup+0xdc/0x1e0\n vfs_statx+0x6c/0x140\n vfs_fstatat+0x67/0xa0\n __do_sys_newfstatat+0x24/0x60\n do_syscall_64+0x6a/0x230\n entry_SYSCALL_64_after_hwframe+0x76/0x7e\n\nThis is reachable with reused cached negative dentries. A Ceph lookup\nor atomic_open can be handed a negative dentry that is already hashed,\nand fs/ceph/dir.c then hits one of two paths that incorrectly assume\n\u0026quot;negative\u0026quot; also means \u0026quot;unhashed\u0026quot;:\n\n - ceph_finish_lookup():\n MDS reply is -ENOENT with no trace\n -\u0026gt; d_add(dentry, NULL)\n\n - ceph_lookup():\n local ENOENT fast path for a complete directory with shared caps\n -\u0026gt; d_add(dentry, NULL)\n\nBoth paths can therefore re-add an already-hashed negative dentry.\n\nCeph already uses the correct pattern elsewhere: ceph_fill_trace() only\ncalls d_add(dn, NULL) for a negative null-dentry reply when d_unhashed(dn)\nis true.\n\nFix both fs/ceph/dir.c sites the same way: only call d_add() for a\nnegative dentry when it is actually unhashed. If the negative dentry\nis already hashed, leave it in place and reuse it as-is.\n\nThis preserves the existing behavior for unhashed dentries while\navoiding d_hash list corruption for reused hashed negatives.(CVE-2026-46052)\n\nIn the Linux kernel, the following vulnerability has been resolved: sctp: revalidate list cursor after sctp_sendmsg_to_asoc() in SCTP_SENDALL. The SCTP_SENDALL path in sctp_sendmsg() iterates ep-\u0026gt;asocs with list_for_each_entry_safe(), which caches the next entry in @tmp before the loop body runs. The body calls sctp_sendmsg_to_asoc(), which may drop the socket lock inside sctp_wait_for_sndbuf(). While the lock is dropped, another thread can SCTP_SOCKOPT_PEELOFF the association cached in @tmp, migrating it to a new endpoint via sctp_sock_migrate() (list_del_init() + list_add_tail() to newep-\u0026gt;asocs), and optionally close the new socket which frees the association via kfree_rcu(). The cached @tmp can also be freed by a network ABORT for that association, processed in softirq while the lock is dropped. sctp_wait_for_sndbuf() revalidates @asoc (the current entry) on re-lock via the \u0026quot;sk != asoc-\u0026gt;base.sk\u0026quot; and \u0026quot;asoc-\u0026gt;base.dead\u0026quot; checks, but nothing revalidates @tmp. After a successful return, the iterator advances to the stale @tmp, yielding either a use-after-free (if the peeled socket was closed) or a list-walk onto the new endpoint\u0026apos;s list head (type confusion of \u0026amp;newep-\u0026gt;asocs as a struct sctp_association *). Both are reachable from CapEff=0; the type-confusion path gives controlled indirect call via the outqueue.sched-\u0026gt;init_sid pointer. Fix by re-deriving @tmp from @asoc after sctp_sendmsg_to_asoc() returns. @asoc is known to still be on ep-\u0026gt;asocs at that point: the only callers that list_del an association from ep-\u0026gt;asocs are sctp_association_free() (which sets asoc-\u0026gt;base.dead) and sctp_assoc_migrate() (which changes asoc-\u0026gt;base.sk), and sctp_wait_for_sndbuf() checks both under the lock before any successful return; a tripped check propagates as err \u0026lt; 0 and the loop bails before the re-derive. The SCTP_ABORT path in sctp_sendmsg_check_sflags() returns 0 and the loop hits \u0026apos;continue\u0026apos; before sctp_sendmsg_to_asoc() is ever called, so the @tmp cached by list_for_each_entry_safe() still covers the lock-held free that ba59fb027307 (\u0026quot;sctp: walk the list of asocs safely\u0026quot;) was added for.(CVE-2026-46227)",
"id": "OESA-2026-2579",
"modified": "2026-08-06T11:11:31Z",
"published": "2026-06-05T11:11:31Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2026-2579"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38263"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38403"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38459"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38602"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38644"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39738"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-40020"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-68340"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-23243"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-23273"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31586"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31588"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31678"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31759"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-31781"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43037"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43038"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43139"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43158"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43180"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43190"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43233"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43281"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43328"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43336"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43427"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-43466"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-45840"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46006"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46021"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46023"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46033"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2026-46227"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2025-38263",
"CVE-2025-38403",
"CVE-2025-38459",
"CVE-2025-38602",
"CVE-2025-38644",
"CVE-2025-39738",
"CVE-2025-40020",
"CVE-2025-68340",
"CVE-2026-23243",
"CVE-2026-23273",
"CVE-2026-31586",
"CVE-2026-31588",
"CVE-2026-31678",
"CVE-2026-31759",
"CVE-2026-31781",
"CVE-2026-43037",
"CVE-2026-43038",
"CVE-2026-43139",
"CVE-2026-43158",
"CVE-2026-43180",
"CVE-2026-43190",
"CVE-2026-43233",
"CVE-2026-43281",
"CVE-2026-43328",
"CVE-2026-43336",
"CVE-2026-43427",
"CVE-2026-43466",
"CVE-2026-45840",
"CVE-2026-46006",
"CVE-2026-46021",
"CVE-2026-46023",
"CVE-2026-46033",
"CVE-2026-46052",
"CVE-2026-46227"
]
}
Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.