Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2024-38569 (GCVE-0-2024-38569)
Vulnerability from cvelistv5 – Published: 2024-06-19 13:35 – Updated: 2026-08-05 11:32| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
8404b0fbc7fbd42e5c5d28cdedd450e70829c77a , < 3d1face00ebb7996842aee4214d7d0fb0c77b1e9
(git)
Affected: 8404b0fbc7fbd42e5c5d28cdedd450e70829c77a , < 8e9aab2492178f25372f1820bfd9289fbd74efd0 (git) Affected: 8404b0fbc7fbd42e5c5d28cdedd450e70829c77a , < 567d34626c22b36579ec0abfdf5eda2949044220 (git) Affected: 8404b0fbc7fbd42e5c5d28cdedd450e70829c77a , < ff48247144d13a3a0817127703724256008efa78 (git) Affected: 8404b0fbc7fbd42e5c5d28cdedd450e70829c77a , < 77fce82678ea5fd51442e62febec2004f79e041b (git) |
guessed | |
| Linux | Linux |
Affected:
5.17
Unaffected: 0 , < 5.17 (semver) Unaffected: 6.1.93 , ≤ 6.1.* (semver) Unaffected: 6.6.33 , ≤ 6.6.* (semver) Unaffected: 6.8.12 , ≤ 6.8.* (semver) Unaffected: 6.9.3 , ≤ 6.9.* (semver) Unaffected: 6.10 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-38569",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-24T18:24:22.058209Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-24T18:24:28.077Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
},
{
"providerMetadata": {
"dateUpdated": "2024-08-02T04:12:26.114Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/perf/hisilicon/hisi_pcie_pmu.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "3d1face00ebb7996842aee4214d7d0fb0c77b1e9",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "8e9aab2492178f25372f1820bfd9289fbd74efd0",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "567d34626c22b36579ec0abfdf5eda2949044220",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "ff48247144d13a3a0817127703724256008efa78",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "77fce82678ea5fd51442e62febec2004f79e041b",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/perf/hisilicon/hisi_pcie_pmu.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.17"
},
{
"lessThan": "5.17",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.10",
"versionStartIncluding": "5.17",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrivers/perf: hisi_pcie: Fix out-of-bound access when valid event group\n\nThe perf tool allows users to create event groups through following\ncmd [1], but the driver does not check whether the array index is out of\nbounds when writing data to the event_group array. If the number of events\nin an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write\noverflow of event_group array occurs.\n\nAdd array index check to fix the possible array out of bounds violation,\nand return directly when write new events are written to array bounds.\n\nThere are 9 different events in an event_group.\n[1] perf stat -e \u0027{pmu/event1/, ... ,pmu/event9/}\u0027"
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The bug is reached only through the local `perf_event_open(2)` syscall against a HiSilicon PCIe PMU device; no network or remote-peer data is involved.\nAC:L - Triggering is fully deterministic \u2014 open a group leader plus 7 distinct hisi_pcie events, then open a 9th distinct event \u2014 with no race, timing window, or memory-layout condition outside the attacker\u0027s control.\nPR:L - On the profiling/HPC/Kunpeng-server deployments where this PMU driver is actually used, `kernel.perf_event_paranoid` is commonly set to 0 or -1, which makes `perf_allow_cpu()` pass for any unprivileged local user; only that (not real root) is needed to build the oversized event group.\nUI:N - The attacker performs the entire nine-syscall sequence itself; no victim action or cooperation is required.\nS:U - The out-of-bounds write corrupts the kernel\u0027s own stack within the same security authority; no VM, IOMMU, or sandbox boundary is crossed.\nC:H - The overflow is stack memory corruption adjacent to saved registers and spilled pointers, which per kernel scoring practice can be leveraged toward disclosure of kernel memory and defeats stack-layout confidentiality assumptions.\nI:H - This is an out-of-bounds stack write that places an attacker-groomed kernel heap pointer over the canary/saved-register slot above the array, i.e. corruption of control-flow-relevant stack state.\nA:H - On stack-protector-enabled arm64 builds the OOB write clobbers the canary and reliably triggers `__stack_chk_fail()` \u2192 kernel panic, and it can be repeated at will from userspace."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T11:32:50.420Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9"
},
{
"url": "https://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0"
},
{
"url": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220"
},
{
"url": "https://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78"
},
{
"url": "https://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b"
}
],
"title": "drivers/perf: hisi_pcie: Fix out-of-bound access when valid event group",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-38569",
"datePublished": "2024-06-19T13:35:35.588Z",
"dateReserved": "2024-06-18T19:36:34.923Z",
"dateUpdated": "2026-08-05T11:32:50.420Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2024-38569",
"date": "2026-09-18",
"epss": "0.00234",
"percentile": "0.14647"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/perf/hisilicon/hisi_pcie_pmu.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "3d1face00ebb7996842aee4214d7d0fb0c77b1e9",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "8e9aab2492178f25372f1820bfd9289fbd74efd0",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "567d34626c22b36579ec0abfdf5eda2949044220",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "ff48247144d13a3a0817127703724256008efa78",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "77fce82678ea5fd51442e62febec2004f79e041b",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/perf/hisilicon/hisi_pcie_pmu.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.17"
},
{
"lessThan": "5.17",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "899D7A4F-A23D-4FA2-84B4-4BAA03F98BBC",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FCE796DF-3B50-4DC6-BAE5-95271068FC9E",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "80550309-67AB-4FD1-AC07-3DED5C4F01B2",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E07124C1-19E8-4D21-828D-9932A01D3011",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "6.9",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrivers/perf: hisi_pcie: Fix out-of-bound access when valid event group\n\nThe perf tool allows users to create event groups through following\ncmd [1], but the driver does not check whether the array index is out of\nbounds when writing data to the event_group array. If the number of events\nin an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write\noverflow of event_group array occurs.\n\nAdd array index check to fix the possible array out of bounds violation,\nand return directly when write new events are written to array bounds.\n\nThere are 9 different events in an event_group.\n[1] perf stat -e \u0027{pmu/event1/, ... ,pmu/event9/}\u0027"
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: drivers/perf: hisi_pcie: corrige el acceso fuera de los l\u00edmites cuando el grupo de eventos es v\u00e1lido. La herramienta perf permite a los usuarios crear grupos de eventos mediante el siguiente cmd [1], pero el controlador no compruebe si el \u00edndice de la matriz est\u00e1 fuera de los l\u00edmites al escribir datos en la matriz event_group. Si el n\u00famero de eventos en un event_group es mayor que HISI_PCIE_MAX_COUNTERS, se produce un desbordamiento de escritura en la memoria de la matriz event_group. Agregue la verificaci\u00f3n del \u00edndice de la matriz para corregir la posible infracci\u00f3n de la matriz fuera de los l\u00edmites y regrese directamente cuando se escriban nuevos eventos en los l\u00edmites de la matriz. Hay 9 eventos diferentes en un grupo de eventos. [1] estad\u00edstica de rendimiento -e \u0027{pmu/event1/, ...,pmu/event9/}\u0027"
}
],
"id": "CVE-2024-38569",
"lastModified": "2026-08-04T11:18:45.183",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-38569",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-24T18:24:22.058209Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-06-19T14:15:17.060",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-129"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2026-08-04T22:45:29+00:00",
"cve": "CVE-2024-38569",
"id": "CVE-2024-38569",
"initial_release_date": "2024-06-19T00:00:00+00:00",
"product_status:known_not_affected": "198",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: drivers/perf: hisi_pcie: Fix out-of-bound access when valid event group",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2024/cve-2024-38569.json",
"version": "3"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T04:12:26.114Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78"
},
{
"tags": [
"x_transferred"
],
"url": "https://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"other": {
"content": {
"id": "CVE-2024-38569",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-24T18:24:22.058209Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2024-06-24T18:24:25.520Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/perf/hisilicon/hisi_pcie_pmu.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "3d1face00ebb7996842aee4214d7d0fb0c77b1e9",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "8e9aab2492178f25372f1820bfd9289fbd74efd0",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "567d34626c22b36579ec0abfdf5eda2949044220",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "ff48247144d13a3a0817127703724256008efa78",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "77fce82678ea5fd51442e62febec2004f79e041b",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/perf/hisilicon/hisi_pcie_pmu.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.17"
},
{
"lessThan": "5.17",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.10",
"versionStartIncluding": "5.17",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrivers/perf: hisi_pcie: Fix out-of-bound access when valid event group\n\nThe perf tool allows users to create event groups through following\ncmd [1], but the driver does not check whether the array index is out of\nbounds when writing data to the event_group array. If the number of events\nin an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write\noverflow of event_group array occurs.\n\nAdd array index check to fix the possible array out of bounds violation,\nand return directly when write new events are written to array bounds.\n\nThere are 9 different events in an event_group.\n[1] perf stat -e \u0027{pmu/event1/, ... ,pmu/event9/}\u0027"
}
],
"metrics": [
{
"cvssV3_1": {
"baseScore": 7.8,
"baseSeverity": "HIGH",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"scenarios": [
{
"lang": "en",
"value": "AV:L - The bug is reached only through the local `perf_event_open(2)` syscall against a HiSilicon PCIe PMU device; no network or remote-peer data is involved.\nAC:L - Triggering is fully deterministic \u2014 open a group leader plus 7 distinct hisi_pcie events, then open a 9th distinct event \u2014 with no race, timing window, or memory-layout condition outside the attacker\u0027s control.\nPR:L - On the profiling/HPC/Kunpeng-server deployments where this PMU driver is actually used, `kernel.perf_event_paranoid` is commonly set to 0 or -1, which makes `perf_allow_cpu()` pass for any unprivileged local user; only that (not real root) is needed to build the oversized event group.\nUI:N - The attacker performs the entire nine-syscall sequence itself; no victim action or cooperation is required.\nS:U - The out-of-bounds write corrupts the kernel\u0027s own stack within the same security authority; no VM, IOMMU, or sandbox boundary is crossed.\nC:H - The overflow is stack memory corruption adjacent to saved registers and spilled pointers, which per kernel scoring practice can be leveraged toward disclosure of kernel memory and defeats stack-layout confidentiality assumptions.\nI:H - This is an out-of-bounds stack write that places an attacker-groomed kernel heap pointer over the canary/saved-register slot above the array, i.e. corruption of control-flow-relevant stack state.\nA:H - On stack-protector-enabled arm64 builds the OOB write clobbers the canary and reliably triggers `__stack_chk_fail()` \u2192 kernel panic, and it can be repeated at will from userspace."
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-08-05T11:32:50.420Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9"
},
{
"url": "https://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0"
},
{
"url": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220"
},
{
"url": "https://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78"
},
{
"url": "https://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b"
}
],
"title": "drivers/perf: hisi_pcie: Fix out-of-bound access when valid event group",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2024-38569",
"datePublished": "2024-06-19T13:35:35.588Z",
"dateReserved": "2024-06-18T19:36:34.923Z",
"dateUpdated": "2026-08-05T11:32:50.420Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
BDU:2024-08321 (CVE-2024-38569)
Vulnerability from fstec – Published: 2024-10-23 – Updated: 2025-05-06 – View on bdu.fstec.ru Fixed- CWE-129 - Непроверенное индексирование массива
{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:C/I:C/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "\u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f, \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb, \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb, \u0410\u041e \u00ab\u041d\u041f\u041f\u041a\u0422\u00bb",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "12 (Debian GNU/Linux), 7.3 (\u0420\u0415\u0414 \u041e\u0421), 1.7 (Astra Linux Special Edition), 4.7 (Astra Linux Special Edition), \u043e\u0442 6.9.0 \u0434\u043e 6.9.2 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 6.2 \u0434\u043e 6.6.32 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 6.7 \u0434\u043e 6.8.11 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u0434\u043e 2.11 (\u041e\u0421\u041e\u041d \u041e\u0421\u043d\u043e\u0432\u0430 \u041enyx), 1.8 (Astra Linux Special Edition), \u043e\u0442 5.17 \u0434\u043e 6.1.92 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0414\u043b\u044f Linux:\nhttps://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220\nhttps://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0\nhttps://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9\nhttps://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78\nhttps://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.1.93\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.6.33\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.8.12\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.9.3\n\n\u0414\u043b\u044f Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2024-38569\n\n\u0414\u043b\u044f \u0420\u0435\u0434\u041e\u0421: \nhttp://repo.red-soft.ru/redos/7.3c/x86_64/updates/\n\n\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f linux \u0434\u043e \u0432\u0435\u0440\u0441\u0438\u0438 6.6.36-0.osnova233\n\n\u0414\u043b\u044f \u041e\u0421 Astra Linux:\n\u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.1 \u0434\u043e 6.1.124-1.astra1+ci7 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se17-bulletin-2025-0319SE17\n\n\u0414\u043b\u044f \u041e\u0421 Astra Linux:\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.1 \u0434\u043e 6.1.124-1.astra1+ci29 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se18-bulletin-2025-0411SE18\n- \u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.6 \u0434\u043e 6.12.11-1.astra1+ci18 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se18-bulletin-2025-0411SE18\n\n\u0414\u043b\u044f \u041e\u0421 Astra Linux:\n\u043e\u0431\u043d\u043e\u0432\u0438\u0442\u044c \u043f\u0430\u043a\u0435\u0442 linux-6.1 \u0434\u043e 6.1.124-1.astra2+ci4 \u0438\u043b\u0438 \u0431\u043e\u043b\u0435\u0435 \u0432\u044b\u0441\u043e\u043a\u043e\u0439 \u0432\u0435\u0440\u0441\u0438\u0438, \u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0438 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f: https://wiki.astralinux.ru/astra-linux-se47-bulletin-2025-0422SE47",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "28.04.2024",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "06.05.2025",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "23.10.2024",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2024-08321",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2024-38569",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Debian GNU/Linux, \u0420\u0415\u0414 \u041e\u0421 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), Astra Linux Special Edition (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), Linux, \u041e\u0421\u041e\u041d \u041e\u0421\u043d\u043e\u0432\u0430 \u041enyx (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21165913)",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "\u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 12 , \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb \u0420\u0415\u0414 \u041e\u0421 7.3 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb Astra Linux Special Edition 1.7 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb Astra Linux Special Edition 4.7 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.9.0 \u0434\u043e 6.9.2 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.2 \u0434\u043e 6.6.32 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.7 \u0434\u043e 6.8.11 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0410\u041e \u00ab\u041d\u041f\u041f\u041a\u0422\u00bb \u041e\u0421\u041e\u041d \u041e\u0421\u043d\u043e\u0432\u0430 \u041enyx \u0434\u043e 2.11 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21165913), \u041e\u041e\u041e \u00ab\u0420\u0443\u0441\u0411\u0418\u0422\u0435\u0445-\u0410\u0441\u0442\u0440\u0430\u00bb Astra Linux Special Edition 1.8 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u2116369), \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.17 \u0434\u043e 6.1.92 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 hisi_pcie_pmu_validate_event_group() \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u043e\u043a\u0430\u0437\u0430\u0442\u044c \u0432\u043e\u0437\u0434\u0435\u0439\u0441\u0442\u0432\u0438\u0435 \u043d\u0430 \u043a\u043e\u043d\u0444\u0438\u0434\u0435\u043d\u0446\u0438\u0430\u043b\u044c\u043d\u043e\u0441\u0442\u044c, \u0446\u0435\u043b\u043e\u0441\u0442\u043d\u043e\u0441\u0442\u044c \u0438 \u0434\u043e\u0441\u0442\u0443\u043f\u043d\u043e\u0441\u0442\u044c \u0437\u0430\u0449\u0438\u0449\u0430\u0435\u043c\u043e\u0439 \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u041d\u0435\u043f\u0440\u043e\u0432\u0435\u0440\u0435\u043d\u043d\u043e\u0435 \u0438\u043d\u0434\u0435\u043a\u0441\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u043c\u0430\u0441\u0441\u0438\u0432\u0430 (CWE-129)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 hisi_pcie_pmu_validate_event_group() \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0432\u044b\u0437\u0432\u0430\u043d\u0430 \u043f\u0435\u0440\u0435\u043f\u043e\u043b\u043d\u0435\u043d\u0438\u0435\u043c \u0431\u0443\u0444\u0435\u0440\u0430. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u043e\u043a\u0430\u0437\u0430\u0442\u044c \u0432\u043e\u0437\u0434\u0435\u0439\u0441\u0442\u0432\u0438\u0435 \u043d\u0430 \u043a\u043e\u043d\u0444\u0438\u0434\u0435\u043d\u0446\u0438\u0430\u043b\u044c\u043d\u043e\u0441\u0442\u044c, \u0446\u0435\u043b\u043e\u0441\u0442\u043d\u043e\u0441\u0442\u044c \u0438 \u0434\u043e\u0441\u0442\u0443\u043f\u043d\u043e\u0441\u0442\u044c \u0437\u0430\u0449\u0438\u0449\u0430\u0435\u043c\u043e\u0439 \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0441\u0442\u0440\u0443\u043a\u0442\u0443\u0440\u0430\u043c\u0438 \u0434\u0430\u043d\u043d\u044b\u0445",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220\nhttps://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0\nhttps://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9\nhttps://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78\nhttps://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b\nhttps://www.cve.org/CVERecord?id=CVE-2024-38569\nhttps://lore.kernel.org/linux-cve-announce/2024061956-CVE-2024-38569-2a26@gregkh/\nhttps://git.kernel.org/linus/77fce82678ea5fd51442e62febec2004f79e041b\nhttps://ubuntu.com/security/notices/USN-6949-1\nhttps://ubuntu.com/security/notices/USN-6952-1\nhttps://ubuntu.com/security/notices/USN-6955-1\nhttps://ubuntu.com/security/notices/USN-6949-2\nhttps://ubuntu.com/security/notices/USN-6952-2\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.1.93\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.6.33\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.8.12\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.9.3\nhttps://security-tracker.debian.org/tracker/CVE-2024-38569\nhttp://repo.red-soft.ru/redos/7.3c/x86_64/updates/\nhttps://\u043f\u043e\u0434\u0434\u0435\u0440\u0436\u043a\u0430.\u043d\u043f\u043f\u043a\u0442.\u0440\u0444/bin/view/\u041e\u0421\u043d\u043e\u0432\u0430/\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f/2.11/\nhttps://wiki.astralinux.ru/astra-linux-se17-bulletin-2025-0319SE17\nhttps://wiki.astralinux.ru/astra-linux-se18-bulletin-2025-0411SE18\nhttps://wiki.astralinux.ru/astra-linux-se47-bulletin-2025-0422SE47",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-129",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 6,8)\n\u0412\u044b\u0441\u043e\u043a\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 7,8)"
}
CERTFR-2024-AVI-0632
Vulnerability from certfr_avis - Published: 2024-07-26 - Updated: 2024-07-26
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, un contournement de la politique de sécurité et un déni de service.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | N/A | Basesystem Module 15-SP6 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | Legacy Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | Development Tools Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 |
| Title | Publication Time | Tags | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-0090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0090"
},
{
"name": "CVE-2024-0091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0091"
},
{
"name": "CVE-2024-0092",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0092"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26482"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
}
],
"initial_release_date": "2024-07-26T00:00:00",
"last_revision_date": "2024-07-26T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-0632",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-07-26T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, un contournement de la politique de s\u00e9curit\u00e9 et un d\u00e9ni de service.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2575-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242575-1"
},
{
"published_at": "2024-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2585-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242585-1"
},
{
"published_at": "2024-07-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2571-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242571-1"
}
]
}
CERTFR-2024-AVI-0667
Vulnerability from certfr_avis - Published: 2024-08-09 - Updated: 2024-08-09
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 18.04 ESM",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 14.04 ESM",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-46343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46343"
},
{
"name": "CVE-2024-25744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25744"
},
{
"name": "CVE-2024-26600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26600"
},
{
"name": "CVE-2023-52436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52436"
},
{
"name": "CVE-2023-52443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52443"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2023-52449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52449"
},
{
"name": "CVE-2023-52444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52444"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26602"
},
{
"name": "CVE-2024-26603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26603"
},
{
"name": "CVE-2024-1151",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-1151"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2024-26593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26593"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2024-26667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26667"
},
{
"name": "CVE-2024-0841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0841"
},
{
"name": "CVE-2024-26695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26695"
},
{
"name": "CVE-2024-26717",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26717"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2023-52637",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52637"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-25742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25742"
},
{
"name": "CVE-2024-26664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26664"
},
{
"name": "CVE-2024-23307",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23307"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26707"
},
{
"name": "CVE-2024-26697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26697"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2024-26689",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26689"
},
{
"name": "CVE-2024-26748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26748"
},
{
"name": "CVE-2023-52638",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52638"
},
{
"name": "CVE-2024-26606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26606"
},
{
"name": "CVE-2024-26718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26718"
},
{
"name": "CVE-2024-26702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26702"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26710"
},
{
"name": "CVE-2024-26803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26803"
},
{
"name": "CVE-2024-26798",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26798"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26675"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26712"
},
{
"name": "CVE-2024-24858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24858"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26723"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2024-26660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26660"
},
{
"name": "CVE-2024-26789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26789"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26688"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26722",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26722"
},
{
"name": "CVE-2024-26681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26681"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2023-52620",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52620"
},
{
"name": "CVE-2024-26700",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26700"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26696"
},
{
"name": "CVE-2024-26698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26698"
},
{
"name": "CVE-2024-26790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26790"
},
{
"name": "CVE-2024-26715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26715"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26792",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26792"
},
{
"name": "CVE-2024-26680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26680"
},
{
"name": "CVE-2024-26736",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26736"
},
{
"name": "CVE-2024-26782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26782"
},
{
"name": "CVE-2024-26980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26980"
},
{
"name": "CVE-2024-26917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26917"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2024-26910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26910"
},
{
"name": "CVE-2024-26907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26907"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26820",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26820"
},
{
"name": "CVE-2024-26936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26936"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-26898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26898"
},
{
"name": "CVE-2023-52642",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52642"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-26825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26825"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-26926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26926"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26916"
},
{
"name": "CVE-2023-52643",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52643"
},
{
"name": "CVE-2024-26829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26829"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2021-47131",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47131"
},
{
"name": "CVE-2023-52585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52585"
},
{
"name": "CVE-2022-48655",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48655"
},
{
"name": "CVE-2024-26828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26828"
},
{
"name": "CVE-2024-26693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26693"
},
{
"name": "CVE-2024-26694",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26694"
},
{
"name": "CVE-2024-26919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26919"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26838"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35983"
},
{
"name": "CVE-2024-35988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35988"
},
{
"name": "CVE-2024-35996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35996"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-26890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26890"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-24859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24859"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26662"
},
{
"name": "CVE-2024-26666",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26666"
},
{
"name": "CVE-2024-26677",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26677"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26703"
},
{
"name": "CVE-2024-26708",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26708"
},
{
"name": "CVE-2024-26711",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26711"
},
{
"name": "CVE-2024-26716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26716"
},
{
"name": "CVE-2024-26719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26719"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-26818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26818"
},
{
"name": "CVE-2024-26824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26824"
},
{
"name": "CVE-2024-26831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26831"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38593"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2022-48674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48674"
},
{
"name": "CVE-2024-27394",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27394"
},
{
"name": "CVE-2024-35846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35846"
},
{
"name": "CVE-2024-35856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35856"
},
{
"name": "CVE-2024-35858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35858"
},
{
"name": "CVE-2024-35859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35859"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-35987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35987"
},
{
"name": "CVE-2024-35993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35993"
},
{
"name": "CVE-2024-35994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35994"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36001"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36028"
},
{
"name": "CVE-2024-36033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36033"
},
{
"name": "CVE-2024-36881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36881"
},
{
"name": "CVE-2024-36884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36884"
},
{
"name": "CVE-2024-36888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36888"
},
{
"name": "CVE-2024-36892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36892"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36908"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36925"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-36932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36932"
},
{
"name": "CVE-2024-36943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36943"
},
{
"name": "CVE-2024-36948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36948"
},
{
"name": "CVE-2024-36956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36956"
},
{
"name": "CVE-2024-36958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36958"
},
{
"name": "CVE-2024-36961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36961"
},
{
"name": "CVE-2024-36963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36963"
},
{
"name": "CVE-2024-36966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36966"
},
{
"name": "CVE-2024-36968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36968"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2024-38542",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38542"
},
{
"name": "CVE-2024-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38561"
},
{
"name": "CVE-2024-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38563"
},
{
"name": "CVE-2024-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38574"
},
{
"name": "CVE-2024-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38576"
},
{
"name": "CVE-2024-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38577"
},
{
"name": "CVE-2024-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38584"
},
{
"name": "CVE-2024-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38585"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-38606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38606"
},
{
"name": "CVE-2024-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38614"
},
{
"name": "CVE-2024-38620",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38620"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2024-42134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42134"
}
],
"initial_release_date": "2024-08-09T00:00:00",
"last_revision_date": "2024-08-09T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-0667",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-09T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-08-02",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6895-4",
"url": "https://ubuntu.com/security/notices/USN-6895-4"
},
{
"published_at": "2024-08-08",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6951-1",
"url": "https://ubuntu.com/security/notices/USN-6951-1"
},
{
"published_at": "2024-08-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6926-2",
"url": "https://ubuntu.com/security/notices/USN-6926-2"
},
{
"published_at": "2024-08-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6952-1",
"url": "https://ubuntu.com/security/notices/USN-6952-1"
},
{
"published_at": "2024-08-08",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6949-1",
"url": "https://ubuntu.com/security/notices/USN-6949-1"
},
{
"published_at": "2024-08-01",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6922-2",
"url": "https://ubuntu.com/security/notices/USN-6922-2"
},
{
"published_at": "2024-08-08",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6950-1",
"url": "https://ubuntu.com/security/notices/USN-6950-1"
},
{
"published_at": "2024-08-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6953-1",
"url": "https://ubuntu.com/security/notices/USN-6953-1"
}
]
}
CERTFR-2024-AVI-0693
Vulnerability from certfr_avis - Published: 2024-08-16 - Updated: 2024-08-16
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une élévation de privilèges et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
None| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | openSUSE Leap Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 11 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4 LTSS EXTREME CORE 11-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 11 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": null,
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-26558",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26558"
},
{
"name": "CVE-2021-0129",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0129"
},
{
"name": "CVE-2021-43389",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-43389"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2022-0854",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-0854"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2023-37453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37453"
},
{
"name": "CVE-2023-4244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4244"
},
{
"name": "CVE-2023-24023",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-24023"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2023-52507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52507"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26720"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2023-52580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52580"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-26880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26880"
},
{
"name": "CVE-2024-26644",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26644"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26623"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2021-47201",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47201"
},
{
"name": "CVE-2021-47194",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47194"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-47275",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47275"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47498",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47498"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2021-47538",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47538"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47555",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47555"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35869",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35869"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27064"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2021-4439",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4439"
},
{
"name": "CVE-2021-47089",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47089"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47515",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47515"
},
{
"name": "CVE-2021-47539",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47539"
},
{
"name": "CVE-2021-47566",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47566"
},
{
"name": "CVE-2021-47571",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47571"
},
{
"name": "CVE-2021-47572",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47572"
},
{
"name": "CVE-2021-47576",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47576"
},
{
"name": "CVE-2021-47577",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47577"
},
{
"name": "CVE-2021-47578",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47578"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47583",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47583"
},
{
"name": "CVE-2021-47584",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47584"
},
{
"name": "CVE-2021-47585",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47585"
},
{
"name": "CVE-2021-47586",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47586"
},
{
"name": "CVE-2021-47587",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47587"
},
{
"name": "CVE-2021-47589",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47589"
},
{
"name": "CVE-2021-47592",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47592"
},
{
"name": "CVE-2021-47595",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47595"
},
{
"name": "CVE-2021-47596",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47596"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47601",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47601"
},
{
"name": "CVE-2021-47602",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47602"
},
{
"name": "CVE-2021-47603",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47603"
},
{
"name": "CVE-2021-47604",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47604"
},
{
"name": "CVE-2021-47605",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47605"
},
{
"name": "CVE-2021-47607",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47607"
},
{
"name": "CVE-2021-47608",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47608"
},
{
"name": "CVE-2021-47609",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47609"
},
{
"name": "CVE-2021-47610",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47610"
},
{
"name": "CVE-2021-47611",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47611"
},
{
"name": "CVE-2021-47612",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47612"
},
{
"name": "CVE-2021-47614",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47614"
},
{
"name": "CVE-2021-47615",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47615"
},
{
"name": "CVE-2021-47616",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47616"
},
{
"name": "CVE-2021-47617",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47617"
},
{
"name": "CVE-2021-47618",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47618"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2021-47620",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47620"
},
{
"name": "CVE-2022-48711",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48711"
},
{
"name": "CVE-2022-48712",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48712"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48714",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48714"
},
{
"name": "CVE-2022-48715",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48715"
},
{
"name": "CVE-2022-48716",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48716"
},
{
"name": "CVE-2022-48717",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48717"
},
{
"name": "CVE-2022-48718",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48718"
},
{
"name": "CVE-2022-48720",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48720"
},
{
"name": "CVE-2022-48721",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48721"
},
{
"name": "CVE-2022-48722",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48722"
},
{
"name": "CVE-2022-48723",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48723"
},
{
"name": "CVE-2022-48724",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48724"
},
{
"name": "CVE-2022-48725",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48725"
},
{
"name": "CVE-2022-48726",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48726"
},
{
"name": "CVE-2022-48727",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48727"
},
{
"name": "CVE-2022-48728",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48728"
},
{
"name": "CVE-2022-48729",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48729"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48733",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48733"
},
{
"name": "CVE-2022-48734",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48734"
},
{
"name": "CVE-2022-48735",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48735"
},
{
"name": "CVE-2022-48736",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48736"
},
{
"name": "CVE-2022-48737",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48737"
},
{
"name": "CVE-2022-48738",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48738"
},
{
"name": "CVE-2022-48739",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48739"
},
{
"name": "CVE-2022-48740",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48740"
},
{
"name": "CVE-2022-48743",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48743"
},
{
"name": "CVE-2022-48744",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48744"
},
{
"name": "CVE-2022-48745",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48745"
},
{
"name": "CVE-2022-48746",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48746"
},
{
"name": "CVE-2022-48747",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48747"
},
{
"name": "CVE-2022-48748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48748"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48751",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48751"
},
{
"name": "CVE-2022-48752",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48752"
},
{
"name": "CVE-2022-48753",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48753"
},
{
"name": "CVE-2022-48754",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48754"
},
{
"name": "CVE-2022-48755",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48755"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48758",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48758"
},
{
"name": "CVE-2022-48759",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48759"
},
{
"name": "CVE-2022-48760",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48760"
},
{
"name": "CVE-2022-48761",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48761"
},
{
"name": "CVE-2022-48763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48763"
},
{
"name": "CVE-2022-48765",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48765"
},
{
"name": "CVE-2022-48766",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48766"
},
{
"name": "CVE-2022-48767",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48767"
},
{
"name": "CVE-2022-48768",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48768"
},
{
"name": "CVE-2022-48769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48769"
},
{
"name": "CVE-2022-48770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48770"
},
{
"name": "CVE-2022-48771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48771"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52737",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52737"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52846",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52846"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47145",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47145"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2024-26785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26785"
},
{
"name": "CVE-2024-27402",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27402"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2016-20022",
"url": "https://www.cve.org/CVERecord?id=CVE-2016-20022"
},
{
"name": "CVE-2021-47086",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47086"
},
{
"name": "CVE-2021-47126",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47126"
},
{
"name": "CVE-2021-47186",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47186"
},
{
"name": "CVE-2021-47291",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47291"
},
{
"name": "CVE-2021-47295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47295"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2021-47588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47588"
},
{
"name": "CVE-2021-47590",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47590"
},
{
"name": "CVE-2021-47591",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47591"
},
{
"name": "CVE-2021-47593",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47593"
},
{
"name": "CVE-2021-47598",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47598"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2021-47606",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47606"
},
{
"name": "CVE-2021-47622",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47622"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48774"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48776"
},
{
"name": "CVE-2022-48777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48777"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48792"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48794"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48803"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48807"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48814",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48814"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48820"
},
{
"name": "CVE-2022-48821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48821"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48826"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48841"
},
{
"name": "CVE-2022-48842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48842"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48844",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48844"
},
{
"name": "CVE-2022-48846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48846"
},
{
"name": "CVE-2022-48847",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48847"
},
{
"name": "CVE-2022-48849",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48849"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48852",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48852"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48855",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48855"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48859",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48859"
},
{
"name": "CVE-2022-48860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48860"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48862"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-31315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31315"
},
{
"name": "CVE-2023-52573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52573"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
}
],
"initial_release_date": "2024-08-16T00:00:00",
"last_revision_date": "2024-08-16T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-0693",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-16T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une \u00e9l\u00e9vation de privil\u00e8ges et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2911-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242911-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2894-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242894-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2892-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242892-1"
},
{
"published_at": "2024-08-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2923-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242923-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2939-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242939-1"
},
{
"published_at": "2024-08-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2929-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242929-1"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2902-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242902-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2895-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242895-1"
},
{
"published_at": "2024-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2874-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242874-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2896-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242896-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2893-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242893-1"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2901-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242901-1"
}
]
}
CERTFR-2024-AVI-0694
Vulnerability from certfr_avis - Published: 2024-08-16 - Updated: 2024-08-16
De multiples vulnérabilités ont été découvertes dans le noyau Linux d'Ubuntu. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Title | Publication Time | Tags | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Ubuntu 16.04 ESM",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 24.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 20.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
},
{
"description": "Ubuntu 22.04 LTS",
"product": {
"name": "Ubuntu",
"vendor": {
"name": "Ubuntu",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2023-46343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-46343"
},
{
"name": "CVE-2024-25744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25744"
},
{
"name": "CVE-2023-52436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52436"
},
{
"name": "CVE-2023-52443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52443"
},
{
"name": "CVE-2023-52469",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52469"
},
{
"name": "CVE-2023-52449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52449"
},
{
"name": "CVE-2023-52444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52444"
},
{
"name": "CVE-2023-52434",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52434"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-25742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25742"
},
{
"name": "CVE-2024-24858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24858"
},
{
"name": "CVE-2024-24857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24857"
},
{
"name": "CVE-2023-52620",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52620"
},
{
"name": "CVE-2024-26980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26980"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26840"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26936"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2023-52585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52585"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27398",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27398"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36929"
},
{
"name": "CVE-2024-36933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36933"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2024-31076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-31076"
},
{
"name": "CVE-2024-33621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33621"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35983"
},
{
"name": "CVE-2024-35988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35988"
},
{
"name": "CVE-2024-35996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35996"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36286",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36286"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-37356",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37356"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38596"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38612"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38637",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38637"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-39292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39292"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-26952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26952"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52752",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52752"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38545",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38545"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-24859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24859"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-36270",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36270"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38593"
},
{
"name": "CVE-2024-38607",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38607"
},
{
"name": "CVE-2024-38613",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38613"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39467",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39467"
},
{
"name": "CVE-2024-39480",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39480"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39489",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39489"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2022-48674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48674"
},
{
"name": "CVE-2024-27394",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27394"
},
{
"name": "CVE-2024-35846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35846"
},
{
"name": "CVE-2024-35856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35856"
},
{
"name": "CVE-2024-35858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35858"
},
{
"name": "CVE-2024-35859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35859"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-35987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35987"
},
{
"name": "CVE-2024-35993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35993"
},
{
"name": "CVE-2024-35994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35994"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36001"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36028"
},
{
"name": "CVE-2024-36033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36033"
},
{
"name": "CVE-2024-36881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36881"
},
{
"name": "CVE-2024-36884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36884"
},
{
"name": "CVE-2024-36888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36888"
},
{
"name": "CVE-2024-36892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36892"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36908"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36925"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-36932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36932"
},
{
"name": "CVE-2024-36943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36943"
},
{
"name": "CVE-2024-36948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36948"
},
{
"name": "CVE-2024-36956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36956"
},
{
"name": "CVE-2024-36958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36958"
},
{
"name": "CVE-2024-36961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36961"
},
{
"name": "CVE-2024-36963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36963"
},
{
"name": "CVE-2024-36966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36966"
},
{
"name": "CVE-2024-36968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36968"
},
{
"name": "CVE-2024-36979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36979"
},
{
"name": "CVE-2024-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38538"
},
{
"name": "CVE-2024-38542",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38542"
},
{
"name": "CVE-2024-38561",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38561"
},
{
"name": "CVE-2024-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38563"
},
{
"name": "CVE-2024-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38574"
},
{
"name": "CVE-2024-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38576"
},
{
"name": "CVE-2024-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38577"
},
{
"name": "CVE-2024-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38584"
},
{
"name": "CVE-2024-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38585"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-38606",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38606"
},
{
"name": "CVE-2024-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38614"
},
{
"name": "CVE-2024-38620",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38620"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2024-42134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42134"
}
],
"initial_release_date": "2024-08-16T00:00:00",
"last_revision_date": "2024-08-16T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-0694",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-16T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux d\u0027Ubuntu. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux d\u0027Ubuntu",
"vendor_advisories": [
{
"published_at": "2024-08-09",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6926-3",
"url": "https://ubuntu.com/security/notices/USN-6926-3"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6950-2",
"url": "https://ubuntu.com/security/notices/USN-6950-2"
},
{
"published_at": "2024-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6955-1",
"url": "https://ubuntu.com/security/notices/USN-6955-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6949-2",
"url": "https://ubuntu.com/security/notices/USN-6949-2"
},
{
"published_at": "2024-08-12",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6956-1",
"url": "https://ubuntu.com/security/notices/USN-6956-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6957-1",
"url": "https://ubuntu.com/security/notices/USN-6957-1"
},
{
"published_at": "2024-08-13",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6950-3",
"url": "https://ubuntu.com/security/notices/USN-6950-3"
},
{
"published_at": "2024-08-14",
"title": "Bulletin de s\u00e9curit\u00e9 Ubuntu USN-6951-2",
"url": "https://ubuntu.com/security/notices/USN-6951-2"
}
]
}
CERTFR-2024-AVI-0717
Vulnerability from certfr_avis - Published: 2024-08-23 - Updated: 2024-08-23
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et un déni de service à distance.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 12 12-SP5 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Software Development Kit 12 SP5 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 |
| Title | Publication Time | Tags | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 12 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Software Development Kit 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2020-26558",
"url": "https://www.cve.org/CVERecord?id=CVE-2020-26558"
},
{
"name": "CVE-2021-0129",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-0129"
},
{
"name": "CVE-2022-20368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-20368"
},
{
"name": "CVE-2022-2964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2964"
},
{
"name": "CVE-2022-28748",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-28748"
},
{
"name": "CVE-2023-1582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1582"
},
{
"name": "CVE-2023-37453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-37453"
},
{
"name": "CVE-2023-0160",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-0160"
},
{
"name": "CVE-2023-51780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-51780"
},
{
"name": "CVE-2023-52458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52458"
},
{
"name": "CVE-2024-26625",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26625"
},
{
"name": "CVE-2023-52594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52594"
},
{
"name": "CVE-2024-26601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26601"
},
{
"name": "CVE-2024-26585",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26585"
},
{
"name": "CVE-2024-26633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26633"
},
{
"name": "CVE-2023-52435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52435"
},
{
"name": "CVE-2023-52612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52612"
},
{
"name": "CVE-2023-52591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52591"
},
{
"name": "CVE-2024-26642",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26642"
},
{
"name": "CVE-2024-26654",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26654"
},
{
"name": "CVE-2023-52615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52615"
},
{
"name": "CVE-2024-26659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26659"
},
{
"name": "CVE-2024-26614",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26614"
},
{
"name": "CVE-2024-25739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25739"
},
{
"name": "CVE-2024-22099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-22099"
},
{
"name": "CVE-2023-52623",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52623"
},
{
"name": "CVE-2023-52619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52619"
},
{
"name": "CVE-2023-7042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7042"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26800"
},
{
"name": "CVE-2024-26769",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26769"
},
{
"name": "CVE-2024-26775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26775"
},
{
"name": "CVE-2024-26704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26704"
},
{
"name": "CVE-2023-52622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52622"
},
{
"name": "CVE-2024-26671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26671"
},
{
"name": "CVE-2024-26814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26814"
},
{
"name": "CVE-2024-26685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26685"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-26737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26737"
},
{
"name": "CVE-2024-26663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26663"
},
{
"name": "CVE-2024-26805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26805"
},
{
"name": "CVE-2024-26773",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26773"
},
{
"name": "CVE-2023-52618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52618"
},
{
"name": "CVE-2023-52631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52631"
},
{
"name": "CVE-2024-26793",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26793"
},
{
"name": "CVE-2023-52616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52616"
},
{
"name": "CVE-2024-26750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26750"
},
{
"name": "CVE-2024-26813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26813"
},
{
"name": "CVE-2024-26764",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26764"
},
{
"name": "CVE-2024-27437",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27437"
},
{
"name": "CVE-2024-26735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26735"
},
{
"name": "CVE-2024-26684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26684"
},
{
"name": "CVE-2024-26679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26679"
},
{
"name": "CVE-2024-26816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26816"
},
{
"name": "CVE-2024-26726",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26726"
},
{
"name": "CVE-2023-52640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52640"
},
{
"name": "CVE-2024-26676",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26676"
},
{
"name": "CVE-2024-26802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26802"
},
{
"name": "CVE-2024-26760",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26760"
},
{
"name": "CVE-2024-26733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26733"
},
{
"name": "CVE-2024-26815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26815"
},
{
"name": "CVE-2023-52641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52641"
},
{
"name": "CVE-2024-26772",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26772"
},
{
"name": "CVE-2024-26791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26791"
},
{
"name": "CVE-2023-52635",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52635"
},
{
"name": "CVE-2024-26774",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26774"
},
{
"name": "CVE-2024-26643",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26643"
},
{
"name": "CVE-2024-26665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26665"
},
{
"name": "CVE-2024-26714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26714"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26673"
},
{
"name": "CVE-2024-26780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26780"
},
{
"name": "CVE-2024-26731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26731"
},
{
"name": "CVE-2024-26742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26742"
},
{
"name": "CVE-2024-26641",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26641"
},
{
"name": "CVE-2024-0639",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-0639"
},
{
"name": "CVE-2024-26807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26807"
},
{
"name": "CVE-2023-52503",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52503"
},
{
"name": "CVE-2023-52580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52580"
},
{
"name": "CVE-2024-27393",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27393"
},
{
"name": "CVE-2024-26870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26870"
},
{
"name": "CVE-2024-26863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26863"
},
{
"name": "CVE-2024-27025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27025"
},
{
"name": "CVE-2024-26845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26845"
},
{
"name": "CVE-2024-27028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27028"
},
{
"name": "CVE-2024-26861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26861"
},
{
"name": "CVE-2024-26961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26961"
},
{
"name": "CVE-2024-26978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26978"
},
{
"name": "CVE-2024-27013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27013"
},
{
"name": "CVE-2024-26989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26989"
},
{
"name": "CVE-2024-26615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26615"
},
{
"name": "CVE-2024-26846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26846"
},
{
"name": "CVE-2024-26958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26958"
},
{
"name": "CVE-2024-27008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27008"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-26925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26925"
},
{
"name": "CVE-2024-26934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26934"
},
{
"name": "CVE-2024-26957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26957"
},
{
"name": "CVE-2024-26981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26981"
},
{
"name": "CVE-2024-26889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26889"
},
{
"name": "CVE-2024-27000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27000"
},
{
"name": "CVE-2024-27388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27388"
},
{
"name": "CVE-2024-27003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27003"
},
{
"name": "CVE-2024-26883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26883"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26882"
},
{
"name": "CVE-2024-27015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27015"
},
{
"name": "CVE-2024-26984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26984"
},
{
"name": "CVE-2024-27020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27020"
},
{
"name": "CVE-2024-26973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26973"
},
{
"name": "CVE-2024-26960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26960"
},
{
"name": "CVE-2024-26996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26996"
},
{
"name": "CVE-2024-26635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26635"
},
{
"name": "CVE-2024-26950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26950"
},
{
"name": "CVE-2024-26999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26999"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-24861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-24861"
},
{
"name": "CVE-2024-27004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27004"
},
{
"name": "CVE-2024-27002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27002"
},
{
"name": "CVE-2024-26920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26920"
},
{
"name": "CVE-2024-27016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27016"
},
{
"name": "CVE-2024-26857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26857"
},
{
"name": "CVE-2024-27001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27001"
},
{
"name": "CVE-2024-26885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26885"
},
{
"name": "CVE-2024-26878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26878"
},
{
"name": "CVE-2024-26976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26976"
},
{
"name": "CVE-2024-26983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26983"
},
{
"name": "CVE-2024-26994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26994"
},
{
"name": "CVE-2024-26636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26636"
},
{
"name": "CVE-2024-26937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26937"
},
{
"name": "CVE-2024-27030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27030"
},
{
"name": "CVE-2024-27065",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27065"
},
{
"name": "CVE-2024-26997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26997"
},
{
"name": "CVE-2024-26922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26922"
},
{
"name": "CVE-2024-26884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26884"
},
{
"name": "CVE-2024-27014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27014"
},
{
"name": "CVE-2024-26862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26862"
},
{
"name": "CVE-2024-26901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26901"
},
{
"name": "CVE-2024-26992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26992"
},
{
"name": "CVE-2024-27046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27046"
},
{
"name": "CVE-2024-26903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26903"
},
{
"name": "CVE-2024-26993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26993"
},
{
"name": "CVE-2024-26951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26951"
},
{
"name": "CVE-2024-26855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26855"
},
{
"name": "CVE-2024-27019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27019"
},
{
"name": "CVE-2024-26923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26923"
},
{
"name": "CVE-2024-27022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27022"
},
{
"name": "CVE-2024-26988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26988"
},
{
"name": "CVE-2024-26650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26650"
},
{
"name": "CVE-2024-26638",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26638"
},
{
"name": "CVE-2024-26826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26826"
},
{
"name": "CVE-2024-26623",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26623"
},
{
"name": "CVE-2024-26632",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26632"
},
{
"name": "CVE-2023-52472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52472"
},
{
"name": "CVE-2023-38417",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-38417"
},
{
"name": "CVE-2023-47210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-47210"
},
{
"name": "CVE-2024-21823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-21823"
},
{
"name": "CVE-2024-27062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27062"
},
{
"name": "CVE-2021-47219",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47219"
},
{
"name": "CVE-2024-26866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26866"
},
{
"name": "CVE-2021-47197",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47197"
},
{
"name": "CVE-2024-26856",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26856"
},
{
"name": "CVE-2024-26881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26881"
},
{
"name": "CVE-2023-52652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52652"
},
{
"name": "CVE-2024-27389",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27389"
},
{
"name": "CVE-2024-26982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26982"
},
{
"name": "CVE-2024-26972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26972"
},
{
"name": "CVE-2024-26830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26830"
},
{
"name": "CVE-2024-27056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27056"
},
{
"name": "CVE-2023-52645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52645"
},
{
"name": "CVE-2024-26836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26836"
},
{
"name": "CVE-2024-26933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26933"
},
{
"name": "CVE-2023-52653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52653"
},
{
"name": "CVE-2024-26739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26739"
},
{
"name": "CVE-2024-23848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-23848"
},
{
"name": "CVE-2024-26783",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26783"
},
{
"name": "CVE-2024-26948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26948"
},
{
"name": "CVE-2024-26853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26853"
},
{
"name": "CVE-2021-47194",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47194"
},
{
"name": "CVE-2021-47191",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47191"
},
{
"name": "CVE-2024-26656",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26656"
},
{
"name": "CVE-2024-26964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26964"
},
{
"name": "CVE-2023-52882",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52882"
},
{
"name": "CVE-2024-26900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26900"
},
{
"name": "CVE-2024-27399",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27399"
},
{
"name": "CVE-2024-27401",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27401"
},
{
"name": "CVE-2024-35848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35848"
},
{
"name": "CVE-2024-35947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35947"
},
{
"name": "CVE-2024-36017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36017"
},
{
"name": "CVE-2024-36889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36889"
},
{
"name": "CVE-2024-36902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36902"
},
{
"name": "CVE-2024-36904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36904"
},
{
"name": "CVE-2024-36916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36916"
},
{
"name": "CVE-2024-36919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36919"
},
{
"name": "CVE-2024-36934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36934"
},
{
"name": "CVE-2024-36939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36939"
},
{
"name": "CVE-2024-36940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36940"
},
{
"name": "CVE-2024-36941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36941"
},
{
"name": "CVE-2024-36946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36946"
},
{
"name": "CVE-2024-36950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36950"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2024-36959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36959"
},
{
"name": "CVE-2021-47388",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47388"
},
{
"name": "CVE-2021-47395",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47395"
},
{
"name": "CVE-2021-47399",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47399"
},
{
"name": "CVE-2021-47402",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47402"
},
{
"name": "CVE-2021-47403",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47403"
},
{
"name": "CVE-2021-47405",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47405"
},
{
"name": "CVE-2021-47438",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47438"
},
{
"name": "CVE-2021-47441",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47441"
},
{
"name": "CVE-2021-47468",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47468"
},
{
"name": "CVE-2021-47501",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47501"
},
{
"name": "CVE-2021-47506",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47506"
},
{
"name": "CVE-2021-47516",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47516"
},
{
"name": "CVE-2021-47520",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47520"
},
{
"name": "CVE-2021-47542",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47542"
},
{
"name": "CVE-2021-47559",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47559"
},
{
"name": "CVE-2023-52656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52656"
},
{
"name": "CVE-2023-52657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52657"
},
{
"name": "CVE-2023-52659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52659"
},
{
"name": "CVE-2023-52660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52660"
},
{
"name": "CVE-2023-52661",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52661"
},
{
"name": "CVE-2023-52662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52662"
},
{
"name": "CVE-2023-52664",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52664"
},
{
"name": "CVE-2023-52669",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52669"
},
{
"name": "CVE-2023-52671",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52671"
},
{
"name": "CVE-2023-52674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52674"
},
{
"name": "CVE-2023-52676",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52676"
},
{
"name": "CVE-2023-52678",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52678"
},
{
"name": "CVE-2023-52679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52679"
},
{
"name": "CVE-2023-52680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52680"
},
{
"name": "CVE-2023-52683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52683"
},
{
"name": "CVE-2023-52685",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52685"
},
{
"name": "CVE-2023-52686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52686"
},
{
"name": "CVE-2023-52690",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52690"
},
{
"name": "CVE-2023-52691",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52691"
},
{
"name": "CVE-2023-52692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52692"
},
{
"name": "CVE-2023-52693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52693"
},
{
"name": "CVE-2023-52694",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52694"
},
{
"name": "CVE-2023-52696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52696"
},
{
"name": "CVE-2023-52698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52698"
},
{
"name": "CVE-2023-52699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52699"
},
{
"name": "CVE-2023-52743",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52743"
},
{
"name": "CVE-2023-52753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52753"
},
{
"name": "CVE-2023-52754",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52754"
},
{
"name": "CVE-2023-52757",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52757"
},
{
"name": "CVE-2023-52759",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52759"
},
{
"name": "CVE-2023-52763",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52763"
},
{
"name": "CVE-2023-52764",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52764"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52773",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52773"
},
{
"name": "CVE-2023-52774",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52774"
},
{
"name": "CVE-2023-52777",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52777"
},
{
"name": "CVE-2023-52781",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52781"
},
{
"name": "CVE-2023-52788",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52788"
},
{
"name": "CVE-2023-52789",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52789"
},
{
"name": "CVE-2023-52791",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52791"
},
{
"name": "CVE-2023-52795",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52795"
},
{
"name": "CVE-2023-52796",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52796"
},
{
"name": "CVE-2023-52798",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52798"
},
{
"name": "CVE-2023-52799",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52799"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2023-52803",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52803"
},
{
"name": "CVE-2023-52804",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52804"
},
{
"name": "CVE-2023-52805",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52805"
},
{
"name": "CVE-2023-52806",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52806"
},
{
"name": "CVE-2023-52807",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52807"
},
{
"name": "CVE-2023-52808",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52808"
},
{
"name": "CVE-2023-52809",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52809"
},
{
"name": "CVE-2023-52810",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52810"
},
{
"name": "CVE-2023-52811",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52811"
},
{
"name": "CVE-2023-52814",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52814"
},
{
"name": "CVE-2023-52815",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52815"
},
{
"name": "CVE-2023-52816",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52816"
},
{
"name": "CVE-2023-52817",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52817"
},
{
"name": "CVE-2023-52818",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52818"
},
{
"name": "CVE-2023-52819",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52819"
},
{
"name": "CVE-2023-52821",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52821"
},
{
"name": "CVE-2023-52825",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52825"
},
{
"name": "CVE-2023-52826",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52826"
},
{
"name": "CVE-2023-52832",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52832"
},
{
"name": "CVE-2023-52833",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52833"
},
{
"name": "CVE-2023-52834",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52834"
},
{
"name": "CVE-2023-52838",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52838"
},
{
"name": "CVE-2023-52840",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52840"
},
{
"name": "CVE-2023-52841",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52841"
},
{
"name": "CVE-2023-52844",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52844"
},
{
"name": "CVE-2023-52847",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52847"
},
{
"name": "CVE-2023-52851",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52851"
},
{
"name": "CVE-2023-52853",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52853"
},
{
"name": "CVE-2023-52854",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52854"
},
{
"name": "CVE-2023-52855",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52855"
},
{
"name": "CVE-2023-52856",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52856"
},
{
"name": "CVE-2023-52858",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52858"
},
{
"name": "CVE-2023-52860",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52860"
},
{
"name": "CVE-2023-52861",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52861"
},
{
"name": "CVE-2023-52864",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52864"
},
{
"name": "CVE-2023-52865",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52865"
},
{
"name": "CVE-2023-52867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52867"
},
{
"name": "CVE-2023-52868",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52868"
},
{
"name": "CVE-2023-52870",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52870"
},
{
"name": "CVE-2023-52871",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52871"
},
{
"name": "CVE-2023-52872",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52872"
},
{
"name": "CVE-2023-52873",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52873"
},
{
"name": "CVE-2023-52875",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52875"
},
{
"name": "CVE-2023-52876",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52876"
},
{
"name": "CVE-2023-52877",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52877"
},
{
"name": "CVE-2023-52878",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52878"
},
{
"name": "CVE-2023-52880",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52880"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26822"
},
{
"name": "CVE-2024-26921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26921"
},
{
"name": "CVE-2024-26928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26928"
},
{
"name": "CVE-2024-269355",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-269355"
},
{
"name": "CVE-2024-26938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26938"
},
{
"name": "CVE-2024-26940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26940"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-27395",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27395"
},
{
"name": "CVE-2024-27396",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27396"
},
{
"name": "CVE-2024-27400",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27400"
},
{
"name": "CVE-2024-27405",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27405"
},
{
"name": "CVE-2024-27410",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27410"
},
{
"name": "CVE-2024-27412",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27412"
},
{
"name": "CVE-2024-27413",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27413"
},
{
"name": "CVE-2024-27416",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27416"
},
{
"name": "CVE-2024-27417",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27417"
},
{
"name": "CVE-2024-27419",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27419"
},
{
"name": "CVE-2024-27431",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27431"
},
{
"name": "CVE-2024-27435",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27435"
},
{
"name": "CVE-2024-27436",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27436"
},
{
"name": "CVE-2024-35789",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35789"
},
{
"name": "CVE-2024-35791",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35791"
},
{
"name": "CVE-2024-35796",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35796"
},
{
"name": "CVE-2024-35799",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35799"
},
{
"name": "CVE-2024-35801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35801"
},
{
"name": "CVE-2024-35804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35804"
},
{
"name": "CVE-2024-35806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35806"
},
{
"name": "CVE-2024-35809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35809"
},
{
"name": "CVE-2024-35811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35811"
},
{
"name": "CVE-2024-35812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35812"
},
{
"name": "CVE-2024-35813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35813"
},
{
"name": "CVE-2024-35815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35815"
},
{
"name": "CVE-2024-35817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35817"
},
{
"name": "CVE-2024-35821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35821"
},
{
"name": "CVE-2024-35822",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35822"
},
{
"name": "CVE-2024-35823",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35823"
},
{
"name": "CVE-2024-35825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35825"
},
{
"name": "CVE-2024-35828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35828"
},
{
"name": "CVE-2024-35829",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35829"
},
{
"name": "CVE-2024-35830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35830"
},
{
"name": "CVE-2024-35833",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35833"
},
{
"name": "CVE-2024-35845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35845"
},
{
"name": "CVE-2024-35847",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35847"
},
{
"name": "CVE-2024-35849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35849"
},
{
"name": "CVE-2024-35851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35851"
},
{
"name": "CVE-2024-35852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35852"
},
{
"name": "CVE-2024-35854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35854"
},
{
"name": "CVE-2024-35860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35860"
},
{
"name": "CVE-2024-35861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35861"
},
{
"name": "CVE-2024-35862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35862"
},
{
"name": "CVE-2024-35863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35863"
},
{
"name": "CVE-2024-35864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35864"
},
{
"name": "CVE-2024-35865",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35865"
},
{
"name": "CVE-2024-35866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35866"
},
{
"name": "CVE-2024-35867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35867"
},
{
"name": "CVE-2024-35868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35868"
},
{
"name": "CVE-2024-35872",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35872"
},
{
"name": "CVE-2024-35875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35875"
},
{
"name": "CVE-2024-35877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35877"
},
{
"name": "CVE-2024-35878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35878"
},
{
"name": "CVE-2024-35879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35879"
},
{
"name": "CVE-2024-35885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35885"
},
{
"name": "CVE-2024-35887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35887"
},
{
"name": "CVE-2024-35895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35895"
},
{
"name": "CVE-2024-35901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35901"
},
{
"name": "CVE-2024-35904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35904"
},
{
"name": "CVE-2024-35905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35905"
},
{
"name": "CVE-2024-35907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35907"
},
{
"name": "CVE-2024-35912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35912"
},
{
"name": "CVE-2024-35914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35914"
},
{
"name": "CVE-2024-35915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35915"
},
{
"name": "CVE-2024-35922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35922"
},
{
"name": "CVE-2024-35924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35924"
},
{
"name": "CVE-2024-35930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35930"
},
{
"name": "CVE-2024-35932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35932"
},
{
"name": "CVE-2024-35933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35933"
},
{
"name": "CVE-2024-35935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35935"
},
{
"name": "CVE-2024-35936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35936"
},
{
"name": "CVE-2024-35938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35938"
},
{
"name": "CVE-2024-35940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35940"
},
{
"name": "CVE-2024-35943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35943"
},
{
"name": "CVE-2024-35944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35944"
},
{
"name": "CVE-2024-35950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35950"
},
{
"name": "CVE-2024-35951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35951"
},
{
"name": "CVE-2024-35952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35952"
},
{
"name": "CVE-2024-35955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35955"
},
{
"name": "CVE-2024-35959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35959"
},
{
"name": "CVE-2024-35963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35963"
},
{
"name": "CVE-2024-35964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35964"
},
{
"name": "CVE-2024-35965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35965"
},
{
"name": "CVE-2024-35966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35966"
},
{
"name": "CVE-2024-35967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35967"
},
{
"name": "CVE-2024-35969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35969"
},
{
"name": "CVE-2024-35973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35973"
},
{
"name": "CVE-2024-35976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35976"
},
{
"name": "CVE-2024-35978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35978"
},
{
"name": "CVE-2024-35982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35982"
},
{
"name": "CVE-2024-35984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35984"
},
{
"name": "CVE-2024-35989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35989"
},
{
"name": "CVE-2024-35990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35990"
},
{
"name": "CVE-2024-35998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35998"
},
{
"name": "CVE-2024-35999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35999"
},
{
"name": "CVE-2024-36006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36006"
},
{
"name": "CVE-2024-36007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36007"
},
{
"name": "CVE-2024-36012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36012"
},
{
"name": "CVE-2024-36014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36014"
},
{
"name": "CVE-2024-36015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36015"
},
{
"name": "CVE-2024-36016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36016"
},
{
"name": "CVE-2024-36026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36026"
},
{
"name": "CVE-2024-36029",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36029"
},
{
"name": "CVE-2024-36032",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36032"
},
{
"name": "CVE-2024-36880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36880"
},
{
"name": "CVE-2024-36893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36893"
},
{
"name": "CVE-2024-36896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36896"
},
{
"name": "CVE-2024-36897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36897"
},
{
"name": "CVE-2024-36906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36906"
},
{
"name": "CVE-2024-36918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36918"
},
{
"name": "CVE-2024-36924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36924"
},
{
"name": "CVE-2024-36926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36926"
},
{
"name": "CVE-2024-36928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36928"
},
{
"name": "CVE-2024-36931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36931"
},
{
"name": "CVE-2024-36938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36938"
},
{
"name": "CVE-2024-36942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36942"
},
{
"name": "CVE-2024-36944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36944"
},
{
"name": "CVE-2024-36947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36947"
},
{
"name": "CVE-2024-36952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36952"
},
{
"name": "CVE-2024-36955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36955"
},
{
"name": "CVE-2023-52667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52667"
},
{
"name": "CVE-2023-52658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52658"
},
{
"name": "CVE-2023-52663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52663"
},
{
"name": "CVE-2023-52670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52670"
},
{
"name": "CVE-2023-52673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52673"
},
{
"name": "CVE-2023-52675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52675"
},
{
"name": "CVE-2023-52681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52681"
},
{
"name": "CVE-2023-52687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52687"
},
{
"name": "CVE-2023-52695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52695"
},
{
"name": "CVE-2023-52697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52697"
},
{
"name": "CVE-2023-52771",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52771"
},
{
"name": "CVE-2023-52772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52772"
},
{
"name": "CVE-2023-6238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6238"
},
{
"name": "CVE-2024-26611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26611"
},
{
"name": "CVE-2024-26652",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26652"
},
{
"name": "CVE-2024-26657",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26657"
},
{
"name": "CVE-2024-26674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26674"
},
{
"name": "CVE-2024-26740",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26740"
},
{
"name": "CVE-2024-26756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26756"
},
{
"name": "CVE-2024-26786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26786"
},
{
"name": "CVE-2024-26794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26794"
},
{
"name": "CVE-2024-26832",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26832"
},
{
"name": "CVE-2024-26844",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26844"
},
{
"name": "CVE-2024-26854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26854"
},
{
"name": "CVE-2024-26858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26858"
},
{
"name": "CVE-2024-26860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26860"
},
{
"name": "CVE-2024-26868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26868"
},
{
"name": "CVE-2024-26899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26899"
},
{
"name": "CVE-2024-26909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26909"
},
{
"name": "CVE-2024-26932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26932"
},
{
"name": "CVE-2024-26945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26945"
},
{
"name": "CVE-2024-26946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26946"
},
{
"name": "CVE-2024-26949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26949"
},
{
"name": "CVE-2024-26962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26962"
},
{
"name": "CVE-2024-26963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26963"
},
{
"name": "CVE-2024-26986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26986"
},
{
"name": "CVE-2024-26990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26990"
},
{
"name": "CVE-2024-26991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26991"
},
{
"name": "CVE-2024-26995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26995"
},
{
"name": "CVE-2024-27027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27027"
},
{
"name": "CVE-2024-27031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27031"
},
{
"name": "CVE-2024-27057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27057"
},
{
"name": "CVE-2024-27067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27067"
},
{
"name": "CVE-2024-27080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27080"
},
{
"name": "CVE-2024-27408",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27408"
},
{
"name": "CVE-2024-27411",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27411"
},
{
"name": "CVE-2024-27418",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27418"
},
{
"name": "CVE-2024-27432",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27432"
},
{
"name": "CVE-2024-27434",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27434"
},
{
"name": "CVE-2024-35784",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35784"
},
{
"name": "CVE-2024-35786",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35786"
},
{
"name": "CVE-2024-35788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35788"
},
{
"name": "CVE-2024-35790",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35790"
},
{
"name": "CVE-2024-35794",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35794"
},
{
"name": "CVE-2024-35795",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35795"
},
{
"name": "CVE-2024-35800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35800"
},
{
"name": "CVE-2024-35803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35803"
},
{
"name": "CVE-2024-35808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35808"
},
{
"name": "CVE-2024-35810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35810"
},
{
"name": "CVE-2024-35814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35814"
},
{
"name": "CVE-2024-35819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35819"
},
{
"name": "CVE-2024-35824",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35824"
},
{
"name": "CVE-2024-35834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35834"
},
{
"name": "CVE-2024-35835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35835"
},
{
"name": "CVE-2024-35836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35836"
},
{
"name": "CVE-2024-35837",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35837"
},
{
"name": "CVE-2024-35838",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35838"
},
{
"name": "CVE-2024-35841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35841"
},
{
"name": "CVE-2024-35842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35842"
},
{
"name": "CVE-2024-35850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35850"
},
{
"name": "CVE-2024-35883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35883"
},
{
"name": "CVE-2024-35889",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35889"
},
{
"name": "CVE-2024-35891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35891"
},
{
"name": "CVE-2024-35903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35903"
},
{
"name": "CVE-2024-35909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35909"
},
{
"name": "CVE-2024-35911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35911"
},
{
"name": "CVE-2024-35916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35916"
},
{
"name": "CVE-2024-35917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35917"
},
{
"name": "CVE-2024-35921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35921"
},
{
"name": "CVE-2024-35927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35927"
},
{
"name": "CVE-2024-35928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35928"
},
{
"name": "CVE-2024-35931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35931"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35945"
},
{
"name": "CVE-2024-35946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35946"
},
{
"name": "CVE-2024-35953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35953"
},
{
"name": "CVE-2024-35954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35954"
},
{
"name": "CVE-2024-35956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35956"
},
{
"name": "CVE-2024-35958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35958"
},
{
"name": "CVE-2024-35960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35960"
},
{
"name": "CVE-2024-35961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35961"
},
{
"name": "CVE-2024-35971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35971"
},
{
"name": "CVE-2024-35972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35972"
},
{
"name": "CVE-2024-35974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35974"
},
{
"name": "CVE-2024-35975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35975"
},
{
"name": "CVE-2024-35977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35977"
},
{
"name": "CVE-2024-35981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35981"
},
{
"name": "CVE-2024-35986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35986"
},
{
"name": "CVE-2024-35991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35991"
},
{
"name": "CVE-2024-35992",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35992"
},
{
"name": "CVE-2024-35995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35995"
},
{
"name": "CVE-2024-35997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35997"
},
{
"name": "CVE-2024-36002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36002"
},
{
"name": "CVE-2024-36009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36009"
},
{
"name": "CVE-2024-36011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36011"
},
{
"name": "CVE-2024-36013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36013"
},
{
"name": "CVE-2024-36018",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36018"
},
{
"name": "CVE-2024-36019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36019"
},
{
"name": "CVE-2024-36020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36020"
},
{
"name": "CVE-2024-36021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36021"
},
{
"name": "CVE-2024-36025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36025"
},
{
"name": "CVE-2024-36030",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36030"
},
{
"name": "CVE-2024-36885",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36885"
},
{
"name": "CVE-2024-36890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36890"
},
{
"name": "CVE-2024-36891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36891"
},
{
"name": "CVE-2024-36894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36894"
},
{
"name": "CVE-2024-36895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36895"
},
{
"name": "CVE-2024-36898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36898"
},
{
"name": "CVE-2024-36921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36921"
},
{
"name": "CVE-2024-36922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36922"
},
{
"name": "CVE-2024-36930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36930"
},
{
"name": "CVE-2024-36936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36936"
},
{
"name": "CVE-2024-36949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36949"
},
{
"name": "CVE-2024-36951",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36951"
},
{
"name": "CVE-2023-52672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52672"
},
{
"name": "CVE-2024-27414",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27414"
},
{
"name": "CVE-2024-35805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35805"
},
{
"name": "CVE-2024-35807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35807"
},
{
"name": "CVE-2024-35853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35853"
},
{
"name": "CVE-2024-35855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35855"
},
{
"name": "CVE-2024-35884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35884"
},
{
"name": "CVE-2024-35886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35886"
},
{
"name": "CVE-2024-35893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35893"
},
{
"name": "CVE-2024-35896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35896"
},
{
"name": "CVE-2024-35898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35898"
},
{
"name": "CVE-2024-35899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35899"
},
{
"name": "CVE-2024-35900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35900"
},
{
"name": "CVE-2024-35925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35925"
},
{
"name": "CVE-2024-35934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35934"
},
{
"name": "CVE-2024-35962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35962"
},
{
"name": "CVE-2024-36004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36004"
},
{
"name": "CVE-2024-36005",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36005"
},
{
"name": "CVE-2024-36008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36008"
},
{
"name": "CVE-2024-36288",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36288"
},
{
"name": "CVE-2024-36960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36960"
},
{
"name": "CVE-2024-36964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36964"
},
{
"name": "CVE-2024-36971",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36971"
},
{
"name": "CVE-2024-37353",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37353"
},
{
"name": "CVE-2024-38381",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38381"
},
{
"name": "CVE-2024-38549",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38549"
},
{
"name": "CVE-2024-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38552"
},
{
"name": "CVE-2024-38558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38558"
},
{
"name": "CVE-2024-38559",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38559"
},
{
"name": "CVE-2024-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38560"
},
{
"name": "CVE-2024-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38565"
},
{
"name": "CVE-2024-38567",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38567"
},
{
"name": "CVE-2024-38578",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38578"
},
{
"name": "CVE-2024-38579",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38579"
},
{
"name": "CVE-2024-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38582"
},
{
"name": "CVE-2024-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38583"
},
{
"name": "CVE-2024-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38587"
},
{
"name": "CVE-2024-38598",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38598"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38601"
},
{
"name": "CVE-2024-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38618"
},
{
"name": "CVE-2024-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38621"
},
{
"name": "CVE-2024-38627",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38627"
},
{
"name": "CVE-2024-38633",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38633"
},
{
"name": "CVE-2024-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38634"
},
{
"name": "CVE-2024-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38659"
},
{
"name": "CVE-2024-38780",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38780"
},
{
"name": "CVE-2024-26944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26944"
},
{
"name": "CVE-2024-27064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27064"
},
{
"name": "CVE-2024-35827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35827"
},
{
"name": "CVE-2024-35831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35831"
},
{
"name": "CVE-2024-35843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35843"
},
{
"name": "CVE-2023-52813",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52813"
},
{
"name": "CVE-2023-52835",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52835"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-35890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35890"
},
{
"name": "CVE-2021-47103",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47103"
},
{
"name": "CVE-2021-47432",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47432"
},
{
"name": "CVE-2021-47580",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47580"
},
{
"name": "CVE-2021-47582",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47582"
},
{
"name": "CVE-2021-47597",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47597"
},
{
"name": "CVE-2021-47600",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47600"
},
{
"name": "CVE-2021-47619",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47619"
},
{
"name": "CVE-2022-48713",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48713"
},
{
"name": "CVE-2022-48730",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48730"
},
{
"name": "CVE-2022-48732",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48732"
},
{
"name": "CVE-2022-48749",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48749"
},
{
"name": "CVE-2022-48756",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48756"
},
{
"name": "CVE-2022-48772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48772"
},
{
"name": "CVE-2023-52735",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52735"
},
{
"name": "CVE-2023-52762",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52762"
},
{
"name": "CVE-2023-52784",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52784"
},
{
"name": "CVE-2023-52787",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52787"
},
{
"name": "CVE-2023-52837",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52837"
},
{
"name": "CVE-2023-52843",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52843"
},
{
"name": "CVE-2023-52845",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52845"
},
{
"name": "CVE-2023-52869",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52869"
},
{
"name": "CVE-2023-52884",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52884"
},
{
"name": "CVE-2024-26842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26842"
},
{
"name": "CVE-2024-33619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-33619"
},
{
"name": "CVE-2024-35247",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35247"
},
{
"name": "CVE-2024-35857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35857"
},
{
"name": "CVE-2024-35979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35979"
},
{
"name": "CVE-2024-36477",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36477"
},
{
"name": "CVE-2024-36478",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36478"
},
{
"name": "CVE-2024-36479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36479"
},
{
"name": "CVE-2024-36592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36592"
},
{
"name": "CVE-2024-36899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36899"
},
{
"name": "CVE-2024-36900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36900"
},
{
"name": "CVE-2024-36915",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36915"
},
{
"name": "CVE-2024-36917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36917"
},
{
"name": "CVE-2024-36923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36923"
},
{
"name": "CVE-2024-36937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36937"
},
{
"name": "CVE-2024-36945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36945"
},
{
"name": "CVE-2024-36965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36965"
},
{
"name": "CVE-2024-36967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36967"
},
{
"name": "CVE-2024-36969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36969"
},
{
"name": "CVE-2024-36975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36975"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2024-37021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37021"
},
{
"name": "CVE-2024-37078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37078"
},
{
"name": "CVE-2024-37354",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-37354"
},
{
"name": "CVE-2024-38388",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38388"
},
{
"name": "CVE-2024-38390",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38390"
},
{
"name": "CVE-2024-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38540"
},
{
"name": "CVE-2024-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38541"
},
{
"name": "CVE-2024-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38544"
},
{
"name": "CVE-2024-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38546"
},
{
"name": "CVE-2024-38547",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38547"
},
{
"name": "CVE-2024-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38548"
},
{
"name": "CVE-2024-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38550"
},
{
"name": "CVE-2024-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38553"
},
{
"name": "CVE-2024-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38555"
},
{
"name": "CVE-2024-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38556"
},
{
"name": "CVE-2024-38557",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38557"
},
{
"name": "CVE-2024-38564",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38564"
},
{
"name": "CVE-2024-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38568"
},
{
"name": "CVE-2024-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38571"
},
{
"name": "CVE-2024-38573",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38573"
},
{
"name": "CVE-2024-38580",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38580"
},
{
"name": "CVE-2024-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38581"
},
{
"name": "CVE-2024-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38590"
},
{
"name": "CVE-2024-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38591"
},
{
"name": "CVE-2024-38594",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38594"
},
{
"name": "CVE-2024-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38597"
},
{
"name": "CVE-2024-38600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38600"
},
{
"name": "CVE-2024-38603",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38603"
},
{
"name": "CVE-2024-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38605"
},
{
"name": "CVE-2024-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38608"
},
{
"name": "CVE-2024-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38616"
},
{
"name": "CVE-2024-38619",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38619"
},
{
"name": "CVE-2024-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38630"
},
{
"name": "CVE-2024-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38635"
},
{
"name": "CVE-2024-38661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38661"
},
{
"name": "CVE-2024-39301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39301"
},
{
"name": "CVE-2024-39468",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39468"
},
{
"name": "CVE-2024-39469",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39469"
},
{
"name": "CVE-2024-39471",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39471"
},
{
"name": "CVE-2021-47547",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47547"
},
{
"name": "CVE-2024-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38610"
},
{
"name": "CVE-2024-39475",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39475"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2024-26691",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26691"
},
{
"name": "CVE-2024-26734",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26734"
},
{
"name": "CVE-2024-27012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27012"
},
{
"name": "CVE-2024-35880",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35880"
},
{
"name": "CVE-2024-35892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35892"
},
{
"name": "CVE-2024-35908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35908"
},
{
"name": "CVE-2024-35926",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35926"
},
{
"name": "CVE-2024-35942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35942"
},
{
"name": "CVE-2024-35957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35957"
},
{
"name": "CVE-2024-35970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35970"
},
{
"name": "CVE-2024-36024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36024"
},
{
"name": "CVE-2024-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38543"
},
{
"name": "CVE-2024-38586",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38586"
},
{
"name": "CVE-2024-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38663"
},
{
"name": "CVE-2024-25741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-25741"
},
{
"name": "CVE-2024-36973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36973"
},
{
"name": "CVE-2024-36974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36974"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39276"
},
{
"name": "CVE-2024-39371",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39371"
},
{
"name": "CVE-2024-39474",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39474"
},
{
"name": "CVE-2024-39482",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39482"
},
{
"name": "CVE-2024-39487",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39487"
},
{
"name": "CVE-2024-39488",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39488"
},
{
"name": "CVE-2024-39493",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39493"
},
{
"name": "CVE-2024-39494",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39494"
},
{
"name": "CVE-2024-39496",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39496"
},
{
"name": "CVE-2024-39499",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39499"
},
{
"name": "CVE-2024-39500",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39500"
},
{
"name": "CVE-2024-39501",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39501"
},
{
"name": "CVE-2024-39502",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39502"
},
{
"name": "CVE-2024-39505",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39505"
},
{
"name": "CVE-2024-39506",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39506"
},
{
"name": "CVE-2024-39507",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39507"
},
{
"name": "CVE-2024-39509",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39509"
},
{
"name": "CVE-2024-40900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40900"
},
{
"name": "CVE-2024-40901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40901"
},
{
"name": "CVE-2024-40902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40902"
},
{
"name": "CVE-2024-40903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40903"
},
{
"name": "CVE-2024-40904",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40904"
},
{
"name": "CVE-2024-40906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40906"
},
{
"name": "CVE-2024-40908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40908"
},
{
"name": "CVE-2024-40911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40911"
},
{
"name": "CVE-2024-40912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40912"
},
{
"name": "CVE-2024-40916",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40916"
},
{
"name": "CVE-2024-40919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40919"
},
{
"name": "CVE-2024-40924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40924"
},
{
"name": "CVE-2024-40927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40927"
},
{
"name": "CVE-2024-40929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40929"
},
{
"name": "CVE-2024-40931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40931"
},
{
"name": "CVE-2024-40932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40932"
},
{
"name": "CVE-2024-40934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40934"
},
{
"name": "CVE-2024-40935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40935"
},
{
"name": "CVE-2024-40937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40937"
},
{
"name": "CVE-2024-40940",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40940"
},
{
"name": "CVE-2024-40941",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40941"
},
{
"name": "CVE-2024-40942",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40942"
},
{
"name": "CVE-2024-40943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40943"
},
{
"name": "CVE-2024-40945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40945"
},
{
"name": "CVE-2024-40947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40947"
},
{
"name": "CVE-2024-40948",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40948"
},
{
"name": "CVE-2024-40953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40953"
},
{
"name": "CVE-2024-40954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40954"
},
{
"name": "CVE-2024-40956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40956"
},
{
"name": "CVE-2024-40958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40958"
},
{
"name": "CVE-2024-40959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40959"
},
{
"name": "CVE-2024-40960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40960"
},
{
"name": "CVE-2024-40961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40961"
},
{
"name": "CVE-2024-40966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40966"
},
{
"name": "CVE-2024-40967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40967"
},
{
"name": "CVE-2024-40970",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40970"
},
{
"name": "CVE-2024-40976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40976"
},
{
"name": "CVE-2024-40977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40977"
},
{
"name": "CVE-2024-40978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40978"
},
{
"name": "CVE-2024-40981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40981"
},
{
"name": "CVE-2024-40984",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40984"
},
{
"name": "CVE-2024-40987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40987"
},
{
"name": "CVE-2024-40988",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40988"
},
{
"name": "CVE-2024-40989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40989"
},
{
"name": "CVE-2024-40990",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40990"
},
{
"name": "CVE-2024-40994",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40994"
},
{
"name": "CVE-2024-40995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40995"
},
{
"name": "CVE-2024-41002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41002"
},
{
"name": "CVE-2024-41004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41004"
},
{
"name": "CVE-2024-41006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41006"
},
{
"name": "CVE-2023-52749",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52749"
},
{
"name": "CVE-2023-52750",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52750"
},
{
"name": "CVE-2023-52765",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52765"
},
{
"name": "CVE-2023-52767",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52767"
},
{
"name": "CVE-2023-52768",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52768"
},
{
"name": "CVE-2023-52769",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52769"
},
{
"name": "CVE-2023-52776",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52776"
},
{
"name": "CVE-2023-52780",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52780"
},
{
"name": "CVE-2023-52782",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52782"
},
{
"name": "CVE-2023-52783",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52783"
},
{
"name": "CVE-2023-52786",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52786"
},
{
"name": "CVE-2023-52792",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52792"
},
{
"name": "CVE-2023-52794",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52794"
},
{
"name": "CVE-2023-52801",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52801"
},
{
"name": "CVE-2023-52812",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52812"
},
{
"name": "CVE-2023-52827",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52827"
},
{
"name": "CVE-2023-52829",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52829"
},
{
"name": "CVE-2023-52836",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52836"
},
{
"name": "CVE-2023-52842",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52842"
},
{
"name": "CVE-2023-52849",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52849"
},
{
"name": "CVE-2023-52850",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52850"
},
{
"name": "CVE-2023-52857",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52857"
},
{
"name": "CVE-2023-52862",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52862"
},
{
"name": "CVE-2023-52863",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52863"
},
{
"name": "CVE-2023-52866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52866"
},
{
"name": "CVE-2023-52874",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52874"
},
{
"name": "CVE-2023-52879",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52879"
},
{
"name": "CVE-2023-52883",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52883"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2024-34777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-34777"
},
{
"name": "CVE-2024-36010",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36010"
},
{
"name": "CVE-2024-36281",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36281"
},
{
"name": "CVE-2024-36882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36882"
},
{
"name": "CVE-2024-36887",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36887"
},
{
"name": "CVE-2024-36903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36903"
},
{
"name": "CVE-2024-36935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36935"
},
{
"name": "CVE-2024-36962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36962"
},
{
"name": "CVE-2024-36972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36972"
},
{
"name": "CVE-2024-36977",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36977"
},
{
"name": "CVE-2024-38384",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38384"
},
{
"name": "CVE-2024-38385",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38385"
},
{
"name": "CVE-2024-38391",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38391"
},
{
"name": "CVE-2024-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38539"
},
{
"name": "CVE-2024-38551",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38551"
},
{
"name": "CVE-2024-38554",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38554"
},
{
"name": "CVE-2024-38562",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38562"
},
{
"name": "CVE-2024-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38566"
},
{
"name": "CVE-2024-38569",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38569"
},
{
"name": "CVE-2024-38570",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38570"
},
{
"name": "CVE-2024-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38572"
},
{
"name": "CVE-2024-38575",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38575"
},
{
"name": "CVE-2024-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38588"
},
{
"name": "CVE-2024-38592",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38592"
},
{
"name": "CVE-2024-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38595"
},
{
"name": "CVE-2024-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38602"
},
{
"name": "CVE-2024-38611",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38611"
},
{
"name": "CVE-2024-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38617"
},
{
"name": "CVE-2024-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38622"
},
{
"name": "CVE-2024-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38628"
},
{
"name": "CVE-2024-38629",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38629"
},
{
"name": "CVE-2024-38636",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38636"
},
{
"name": "CVE-2024-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38664"
},
{
"name": "CVE-2024-39277",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39277"
},
{
"name": "CVE-2024-39291",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39291"
},
{
"name": "CVE-2024-39296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39296"
},
{
"name": "CVE-2024-39362",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39362"
},
{
"name": "CVE-2024-39463",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39463"
},
{
"name": "CVE-2024-39466",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39466"
},
{
"name": "CVE-2024-35949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35949"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36003"
},
{
"name": "CVE-2024-36901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36901"
},
{
"name": "CVE-2024-36909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36909"
},
{
"name": "CVE-2024-36910",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36910"
},
{
"name": "CVE-2024-36911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36911"
},
{
"name": "CVE-2024-36912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36912"
},
{
"name": "CVE-2024-36913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36913"
},
{
"name": "CVE-2024-36914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36914"
},
{
"name": "CVE-2024-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38604"
},
{
"name": "CVE-2024-41011",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41011"
},
{
"name": "CVE-2021-47624",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47624"
},
{
"name": "CVE-2023-52775",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52775"
},
{
"name": "CVE-2023-52885",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52885"
},
{
"name": "CVE-2024-39472",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39472"
},
{
"name": "CVE-2023-52751",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52751"
},
{
"name": "CVE-2024-26785",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26785"
},
{
"name": "CVE-2024-27402",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27402"
},
{
"name": "CVE-2024-27404",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27404"
},
{
"name": "CVE-2024-39473",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39473"
},
{
"name": "CVE-2024-39479",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39479"
},
{
"name": "CVE-2024-39481",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39481"
},
{
"name": "CVE-2024-39490",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39490"
},
{
"name": "CVE-2024-39498",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39498"
},
{
"name": "CVE-2024-39504",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39504"
},
{
"name": "CVE-2024-40923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40923"
},
{
"name": "CVE-2024-40925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40925"
},
{
"name": "CVE-2024-40928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40928"
},
{
"name": "CVE-2024-40972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40972"
},
{
"name": "CVE-2024-40975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40975"
},
{
"name": "CVE-2024-40979",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40979"
},
{
"name": "CVE-2024-40998",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40998"
},
{
"name": "CVE-2024-40999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40999"
},
{
"name": "CVE-2024-41013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41013"
},
{
"name": "CVE-2024-41014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41014"
},
{
"name": "CVE-2024-41017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41017"
},
{
"name": "CVE-2024-41090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41090"
},
{
"name": "CVE-2024-41091",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41091"
},
{
"name": "CVE-2021-47086",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47086"
},
{
"name": "CVE-2021-47126",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47126"
},
{
"name": "CVE-2021-47186",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47186"
},
{
"name": "CVE-2021-47291",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47291"
},
{
"name": "CVE-2021-47295",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47295"
},
{
"name": "CVE-2021-47546",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47546"
},
{
"name": "CVE-2021-47588",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47588"
},
{
"name": "CVE-2021-47590",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47590"
},
{
"name": "CVE-2021-47591",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47591"
},
{
"name": "CVE-2021-47593",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47593"
},
{
"name": "CVE-2021-47598",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47598"
},
{
"name": "CVE-2021-47599",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47599"
},
{
"name": "CVE-2021-47606",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47606"
},
{
"name": "CVE-2021-47622",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47622"
},
{
"name": "CVE-2021-47623",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47623"
},
{
"name": "CVE-2022-48773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48773"
},
{
"name": "CVE-2022-48774",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48774"
},
{
"name": "CVE-2022-48775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48775"
},
{
"name": "CVE-2022-48776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48776"
},
{
"name": "CVE-2022-48777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48777"
},
{
"name": "CVE-2022-48778",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48778"
},
{
"name": "CVE-2022-48780",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48780"
},
{
"name": "CVE-2022-48783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48783"
},
{
"name": "CVE-2022-48784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48784"
},
{
"name": "CVE-2022-48785",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48785"
},
{
"name": "CVE-2022-48786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48786"
},
{
"name": "CVE-2022-48787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48787"
},
{
"name": "CVE-2022-48788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48788"
},
{
"name": "CVE-2022-48789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48789"
},
{
"name": "CVE-2022-48790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48790"
},
{
"name": "CVE-2022-48791",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48791"
},
{
"name": "CVE-2022-48792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48792"
},
{
"name": "CVE-2022-48793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48793"
},
{
"name": "CVE-2022-48794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48794"
},
{
"name": "CVE-2022-48796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48796"
},
{
"name": "CVE-2022-48797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48797"
},
{
"name": "CVE-2022-48798",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48798"
},
{
"name": "CVE-2022-48799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48799"
},
{
"name": "CVE-2022-48800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48800"
},
{
"name": "CVE-2022-48801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48801"
},
{
"name": "CVE-2022-48802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48802"
},
{
"name": "CVE-2022-48803",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48803"
},
{
"name": "CVE-2022-48804",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48804"
},
{
"name": "CVE-2022-48805",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48805"
},
{
"name": "CVE-2022-48806",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48806"
},
{
"name": "CVE-2022-48807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48807"
},
{
"name": "CVE-2022-48809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48809"
},
{
"name": "CVE-2022-48810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48810"
},
{
"name": "CVE-2022-48811",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48811"
},
{
"name": "CVE-2022-48812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48812"
},
{
"name": "CVE-2022-48813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48813"
},
{
"name": "CVE-2022-48814",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48814"
},
{
"name": "CVE-2022-48815",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48815"
},
{
"name": "CVE-2022-48816",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48816"
},
{
"name": "CVE-2022-48817",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48817"
},
{
"name": "CVE-2022-48818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48818"
},
{
"name": "CVE-2022-48820",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48820"
},
{
"name": "CVE-2022-48821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48821"
},
{
"name": "CVE-2022-48822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48822"
},
{
"name": "CVE-2022-48823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48823"
},
{
"name": "CVE-2022-48824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48824"
},
{
"name": "CVE-2022-48825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48825"
},
{
"name": "CVE-2022-48826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48826"
},
{
"name": "CVE-2022-48827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48827"
},
{
"name": "CVE-2022-48828",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48828"
},
{
"name": "CVE-2022-48829",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48829"
},
{
"name": "CVE-2022-48830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48830"
},
{
"name": "CVE-2022-48831",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48831"
},
{
"name": "CVE-2022-48834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48834"
},
{
"name": "CVE-2022-48835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48835"
},
{
"name": "CVE-2022-48836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48836"
},
{
"name": "CVE-2022-48837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48837"
},
{
"name": "CVE-2022-48838",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48838"
},
{
"name": "CVE-2022-48839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48839"
},
{
"name": "CVE-2022-48840",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48840"
},
{
"name": "CVE-2022-48841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48841"
},
{
"name": "CVE-2022-48842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48842"
},
{
"name": "CVE-2022-48843",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48843"
},
{
"name": "CVE-2022-48844",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48844"
},
{
"name": "CVE-2022-48846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48846"
},
{
"name": "CVE-2022-48847",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48847"
},
{
"name": "CVE-2022-48849",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48849"
},
{
"name": "CVE-2022-48850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48850"
},
{
"name": "CVE-2022-48851",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48851"
},
{
"name": "CVE-2022-48852",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48852"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2022-48855",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48855"
},
{
"name": "CVE-2022-48856",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48856"
},
{
"name": "CVE-2022-48857",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48857"
},
{
"name": "CVE-2022-48858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48858"
},
{
"name": "CVE-2022-48859",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48859"
},
{
"name": "CVE-2022-48860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48860"
},
{
"name": "CVE-2022-48861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48861"
},
{
"name": "CVE-2022-48862",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48862"
},
{
"name": "CVE-2022-48863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48863"
},
{
"name": "CVE-2022-48864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48864"
},
{
"name": "CVE-2022-48866",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48866"
},
{
"name": "CVE-2023-31315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31315"
},
{
"name": "CVE-2023-52573",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52573"
},
{
"name": "CVE-2023-52886",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52886"
},
{
"name": "CVE-2024-39497",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39497"
},
{
"name": "CVE-2024-39508",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39508"
},
{
"name": "CVE-2024-40909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40909"
},
{
"name": "CVE-2024-40982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40982"
},
{
"name": "CVE-2024-41009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41009"
},
{
"name": "CVE-2024-41012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41012"
},
{
"name": "CVE-2024-41015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41015"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-41040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41040"
},
{
"name": "CVE-2024-41041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41041"
},
{
"name": "CVE-2024-41044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41044"
},
{
"name": "CVE-2024-41048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41048"
},
{
"name": "CVE-2024-41057",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41057"
},
{
"name": "CVE-2024-41058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41058"
},
{
"name": "CVE-2024-41059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41059"
},
{
"name": "CVE-2024-41060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41060"
},
{
"name": "CVE-2024-41063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41063"
},
{
"name": "CVE-2024-41064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41064"
},
{
"name": "CVE-2024-41066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41066"
},
{
"name": "CVE-2024-41069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41069"
},
{
"name": "CVE-2024-41070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41070"
},
{
"name": "CVE-2024-41071",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41071"
},
{
"name": "CVE-2024-41072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41072"
},
{
"name": "CVE-2024-41076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41076"
},
{
"name": "CVE-2024-41078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41078"
},
{
"name": "CVE-2024-41081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41081"
},
{
"name": "CVE-2024-41087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41087"
},
{
"name": "CVE-2024-41089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41089"
},
{
"name": "CVE-2024-41095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41095"
},
{
"name": "CVE-2024-42070",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42070"
},
{
"name": "CVE-2024-42079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42079"
},
{
"name": "CVE-2024-42093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42093"
},
{
"name": "CVE-2024-42096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42096"
},
{
"name": "CVE-2024-42105",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42105"
},
{
"name": "CVE-2024-42119",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42119"
},
{
"name": "CVE-2024-42120",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42120"
},
{
"name": "CVE-2024-42122",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42122"
},
{
"name": "CVE-2024-42124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42124"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-42161",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42161"
},
{
"name": "CVE-2024-42223",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42223"
},
{
"name": "CVE-2024-42224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42224"
},
{
"name": "CVE-2024-42230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42230"
}
],
"initial_release_date": "2024-08-23T00:00:00",
"last_revision_date": "2024-08-23T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-0717",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-08-23T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et un d\u00e9ni de service \u00e0 distance.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2980-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242980-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2940-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242940-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2944-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242944-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2943-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242943-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2948-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242948-1"
},
{
"published_at": "2024-08-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2973-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242973-1"
},
{
"published_at": "2024-08-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:2947-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20242947-1"
}
]
}
FKIE_CVE-2024-38569
Vulnerability from fkie_nvd - Published: 2024-06-19 14:15 - Updated: 2026-08-04 11:187.8 (High) - CVSS:3.1/
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/perf/hisilicon/hisi_pcie_pmu.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "3d1face00ebb7996842aee4214d7d0fb0c77b1e9",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "8e9aab2492178f25372f1820bfd9289fbd74efd0",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "567d34626c22b36579ec0abfdf5eda2949044220",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "ff48247144d13a3a0817127703724256008efa78",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
},
{
"lessThan": "77fce82678ea5fd51442e62febec2004f79e041b",
"status": "affected",
"version": "8404b0fbc7fbd42e5c5d28cdedd450e70829c77a",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/perf/hisilicon/hisi_pcie_pmu.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "5.17"
},
{
"lessThan": "5.17",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.93",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.6.*",
"status": "unaffected",
"version": "6.6.33",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.8.*",
"status": "unaffected",
"version": "6.8.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.9.*",
"status": "unaffected",
"version": "6.9.3",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.10",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "899D7A4F-A23D-4FA2-84B4-4BAA03F98BBC",
"versionEndExcluding": "6.1.93",
"versionStartIncluding": "5.17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "FCE796DF-3B50-4DC6-BAE5-95271068FC9E",
"versionEndExcluding": "6.6.33",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "80550309-67AB-4FD1-AC07-3DED5C4F01B2",
"versionEndExcluding": "6.8.12",
"versionStartIncluding": "6.7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "E07124C1-19E8-4D21-828D-9932A01D3011",
"versionEndExcluding": "6.9.3",
"versionStartIncluding": "6.9",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrivers/perf: hisi_pcie: Fix out-of-bound access when valid event group\n\nThe perf tool allows users to create event groups through following\ncmd [1], but the driver does not check whether the array index is out of\nbounds when writing data to the event_group array. If the number of events\nin an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write\noverflow of event_group array occurs.\n\nAdd array index check to fix the possible array out of bounds violation,\nand return directly when write new events are written to array bounds.\n\nThere are 9 different events in an event_group.\n[1] perf stat -e \u0027{pmu/event1/, ... ,pmu/event9/}\u0027"
},
{
"lang": "es",
"value": "En el kernel de Linux, se ha resuelto la siguiente vulnerabilidad: drivers/perf: hisi_pcie: corrige el acceso fuera de los l\u00edmites cuando el grupo de eventos es v\u00e1lido. La herramienta perf permite a los usuarios crear grupos de eventos mediante el siguiente cmd [1], pero el controlador no compruebe si el \u00edndice de la matriz est\u00e1 fuera de los l\u00edmites al escribir datos en la matriz event_group. Si el n\u00famero de eventos en un event_group es mayor que HISI_PCIE_MAX_COUNTERS, se produce un desbordamiento de escritura en la memoria de la matriz event_group. Agregue la verificaci\u00f3n del \u00edndice de la matriz para corregir la posible infracci\u00f3n de la matriz fuera de los l\u00edmites y regrese directamente cuando se escriban nuevos eventos en los l\u00edmites de la matriz. Hay 9 eventos diferentes en un grupo de eventos. [1] estad\u00edstica de rendimiento -e \u0027{pmu/event1/, ...,pmu/event9/}\u0027"
}
],
"id": "CVE-2024-38569",
"lastModified": "2026-08-04T11:18:45.183",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"type": "Secondary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2024-38569",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2024-06-24T18:24:22.058209Z",
"version": "2.0.3"
}
}
]
},
"published": "2024-06-19T14:15:17.060",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-129"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-FR6H-WC99-8M37
Vulnerability from github – Published: 2024-06-19 15:30 – Updated: 2024-09-19 15:30In the Linux kernel, the following vulnerability has been resolved:
drivers/perf: hisi_pcie: Fix out-of-bound access when valid event group
The perf tool allows users to create event groups through following cmd [1], but the driver does not check whether the array index is out of bounds when writing data to the event_group array. If the number of events in an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write overflow of event_group array occurs.
Add array index check to fix the possible array out of bounds violation, and return directly when write new events are written to array bounds.
There are 9 different events in an event_group. [1] perf stat -e '{pmu/event1/, ... ,pmu/event9/}'
{
"affected": [],
"aliases": [
"CVE-2024-38569"
],
"database_specific": {
"cwe_ids": [
"CWE-129"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2024-06-19T14:15:17Z",
"severity": "HIGH"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\ndrivers/perf: hisi_pcie: Fix out-of-bound access when valid event group\n\nThe perf tool allows users to create event groups through following\ncmd [1], but the driver does not check whether the array index is out of\nbounds when writing data to the event_group array. If the number of events\nin an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write\noverflow of event_group array occurs.\n\nAdd array index check to fix the possible array out of bounds violation,\nand return directly when write new events are written to array bounds.\n\nThere are 9 different events in an event_group.\n[1] perf stat -e \u0027{pmu/event1/, ... ,pmu/event9/}\u0027",
"id": "GHSA-fr6h-wc99-8m37",
"modified": "2024-09-19T15:30:48Z",
"published": "2024-06-19T15:30:53Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38569"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3d1face00ebb7996842aee4214d7d0fb0c77b1e9"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/567d34626c22b36579ec0abfdf5eda2949044220"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/77fce82678ea5fd51442e62febec2004f79e041b"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/8e9aab2492178f25372f1820bfd9289fbd74efd0"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/ff48247144d13a3a0817127703724256008efa78"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2024-1768 (CVE-2021-47381)
Vulnerability from osv_openeuler – Published: 2024-06-28 11:07 – Updated: 2026-08-06 11:07 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
ASoC: SOF: Fix DSP oops stack dump output contents
Fix @buf arg given to hex_dump_to_buffer() and stack address used in dump error output.(CVE-2021-47381)
In the Linux kernel, the following vulnerability has been resolved:
scsi: iscsi: Fix iscsi_task use after free
Commit d39df158518c ("scsi: iscsi: Have abort handler get ref to conn") added iscsi_get_conn()/iscsi_put_conn() calls during abort handling but then also changed the handling of the case where we detect an already completed task where we now end up doing a goto to the common put/cleanup code. This results in a iscsi_task use after free, because the common cleanup code will do a put on the iscsi_task.
This reverts the goto and moves the iscsi_get_conn() to after we've checked if the iscsi_task is valid.(CVE-2021-47427)
In the Linux kernel, the following vulnerability has been resolved:
spi: Fix deadlock when adding SPI controllers on SPI buses
Currently we have a global spi_add_lock which we take when adding new devices so that we can check that we're not trying to reuse a chip select that's already controlled. This means that if the SPI device is itself a SPI controller and triggers the instantiation of further SPI devices we trigger a deadlock as we try to register and instantiate those devices while in the process of doing so for the parent controller and hence already holding the global spi_add_lock. Since we only care about concurrency within a single SPI bus move the lock to be per controller, avoiding the deadlock.
This can be easily triggered in the case of spi-mux.(CVE-2021-47469)
(CVE-2023-39180)
In the Linux kernel, the following vulnerability has been resolved:
powerpc/powernv: Add a null pointer check in opal_powercap_init()
kasprintf() returns a pointer to dynamically allocated memory which can be NULL upon failure.(CVE-2023-52696)
In the Linux kernel, the following vulnerability has been resolved:
i2c: core: Run atomic i2c xfer when !preemptible
Since bae1d3a05a8b, i2c transfers are non-atomic if preemption is disabled. However, non-atomic i2c transfers require preemption (e.g. in wait_for_completion() while waiting for the DMA).
panic() calls preempt_disable_notrace() before calling emergency_restart(). Therefore, if an i2c device is used for the restart, the xfer should be atomic. This avoids warnings like:
[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0 [ 12.676926] Voluntary context switch within RCU read-side critical section! ... [ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114 [ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70 ... [ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58 [ 13.001050] machine_restart from panic+0x2a8/0x32c
Use !preemptible() instead, which is basically the same check as pre-v5.2.(CVE-2023-52791)
In the Linux kernel, the following vulnerability has been resolved:
hid: cp2112: Fix duplicate workqueue initialization
Previously the cp2112 driver called INIT_DELAYED_WORK within cp2112_gpio_irq_startup, resulting in duplicate initilizations of the workqueue on subsequent IRQ startups following an initial request. This resulted in a warning in set_work_data in workqueue.c, as well as a rare NULL dereference within process_one_work in workqueue.c.
Initialize the workqueue within _probe instead.(CVE-2023-52853)
In the Linux kernel, the following vulnerability has been resolved:
ksmbd: fix UAF issue in ksmbd_tcp_new_connection()
The race is between the handling of a new TCP connection and
its disconnection. It leads to UAF on struct tcp_transport in
ksmbd_tcp_new_connection() function.(CVE-2024-26592)
In the Linux kernel, the following vulnerability has been resolved:
net/ipv6: avoid possible UAF in ip6_route_mpath_notify()
syzbot found another use-after-free in ip6_route_mpath_notify() [1]
Commit f7225172f25a ("net/ipv6: prevent use after free in ip6_route_mpath_notify") was not able to fix the root cause.
We need to defer the fib6_info_release() calls after ip6_route_mpath_notify(), in the cleanup phase.
[1] BUG: KASAN: slab-use-after-free in rt6_fill_node+0x1460/0x1ac0 Read of size 4 at addr ffff88809a07fc64 by task syz-executor.2/23037
CPU: 0 PID: 23037 Comm: syz-executor.2 Not tainted 6.8.0-rc4-syzkaller-01035-gea7f3cfaa588 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/25/2024 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x1e7/0x2e0 lib/dump_stack.c:106 print_address_description mm/kasan/report.c:377 [inline] print_report+0x167/0x540 mm/kasan/report.c:488 kasan_report+0x142/0x180 mm/kasan/report.c:601 rt6_fill_node+0x1460/0x1ac0 inet6_rt_notify+0x13b/0x290 net/ipv6/route.c:6184 ip6_route_mpath_notify net/ipv6/route.c:5198 [inline] ip6_route_multipath_add net/ipv6/route.c:5404 [inline] inet6_rtm_newroute+0x1d0f/0x2300 net/ipv6/route.c:5517 rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597 netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543 netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline] netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367 netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x221/0x270 net/socket.c:745 _syssendmsg+0x525/0x7d0 net/socket.c:2584 _sys_sendmsg net/socket.c:2638 [inline] __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667 do_syscall_64+0xf9/0x240 entry_SYSCALL_64_after_hwframe+0x6f/0x77 RIP: 0033:0x7f73dd87dda9 Code: 28 00 00 00 75 05 48 83 c4 28 c3 e8 e1 20 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 <48> 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48 RSP: 002b:00007f73de6550c8 EFLAGS: 00000246 ORIG_RAX: 000000000000002e RAX: ffffffffffffffda RBX: 00007f73dd9ac050 RCX: 00007f73dd87dda9 RDX: 0000000000000000 RSI: 0000000020000140 RDI: 0000000000000005 RBP: 00007f73dd8ca47a R08: 0000000000000000 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000 R13: 000000000000006e R14: 00007f73dd9ac050 R15: 00007ffdbdeb7858 </TASK>
Allocated by task 23037: kasan_save_stack mm/kasan/common.c:47 [inline] kasan_save_track+0x3f/0x80 mm/kasan/common.c:68 poison_kmalloc_redzone mm/kasan/common.c:372 [inline] __kasan_kmalloc+0x98/0xb0 mm/kasan/common.c:389 kasan_kmalloc include/linux/kasan.h:211 [inline] __do_kmalloc_node mm/slub.c:3981 [inline] __kmalloc+0x22e/0x490 mm/slub.c:3994 kmalloc include/linux/slab.h:594 [inline] kzalloc include/linux/slab.h:711 [inline] fib6_info_alloc+0x2e/0xf0 net/ipv6/ip6_fib.c:155 ip6_route_info_create+0x445/0x12b0 net/ipv6/route.c:3758 ip6_route_multipath_add net/ipv6/route.c:5298 [inline] inet6_rtm_newroute+0x744/0x2300 net/ipv6/route.c:5517 rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597 netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543 netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline] netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367 netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908 sock_sendmsg_nosec net/socket.c:730 [inline] __sock_sendmsg+0x221/0x270 net/socket.c:745 _syssendmsg+0x525/0x7d0 net/socket.c:2584 _sys_sendmsg net/socket.c:2638 [inline] __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667 do_syscall_64+0xf9/0x240 entry_SYSCALL_64_after_hwframe+0x6f/0x77
Freed by task 16: kasan_save_stack mm/kasan/common.c:47 [inline] kasan_save_track+0x3f/0x80 mm/kasan/common.c:68 kasan_save_free_info+0x4e/0x60 mm/kasan/generic.c:640 poison_slab_object+0xa6/0xe0 m ---truncated---(CVE-2024-26852)
In the Linux kernel, the following vulnerability has been resolved:
inet: inet_defrag: prevent sk release while still in use
ip_local_out() and other functions can pass skb->sk as function argument.
If the skb is a fragment and reassembly happens before such function call returns, the sk must not be released.
This affects skb fragments reassembled via netfilter or similar modules, e.g. openvswitch or ct_act.c, when run as part of tx pipeline.
Eric Dumazet made an initial analysis of this bug. Quoting Eric: Calling ip_defrag() in output path is also implying skb_orphan(), which is buggy because output path relies on sk not disappearing.
A relevant old patch about the issue was : 8282f27449bf ("inet: frag: Always orphan skbs inside ip_defrag()")
[..]
net/ipv4/ip_output.c depends on skb->sk being set, and probably to an inet socket, not an arbitrary one.
If we orphan the packet in ipvlan, then downstream things like FQ packet scheduler will not work properly.
We need to change ip_defrag() to only use skb_orphan() when really needed, ie whenever frag_list is going to be used.
Eric suggested to stash sk in fragment queue and made an initial patch. However there is a problem with this:
If skb is refragmented again right after, ip_do_fragment() will copy head->sk to the new fragments, and sets up destructor to sock_wfree. IOW, we have no choice but to fix up sk_wmem accouting to reflect the fully reassembled skb, else wmem will underflow.
This change moves the orphan down into the core, to last possible moment. As ip_defrag_offset is aliased with sk_buff->sk member, we must move the offset into the FRAG_CB, else skb->sk gets clobbered.
This allows to delay the orphaning long enough to learn if the skb has to be queued or if the skb is completing the reasm queue.
In the former case, things work as before, skb is orphaned. This is safe because skb gets queued/stolen and won't continue past reasm engine.
In the latter case, we will steal the skb->sk reference, reattach it to the head skb, and fix up wmem accouting when inet_frag inflates truesize.(CVE-2024-26921)
In the Linux kernel, the following vulnerability has been resolved:
scsi: core: Fix unremoved procfs host directory regression
Commit fc663711b944 ("scsi: core: Remove the /proc/scsi/${proc_name} directory earlier") fixed a bug related to modules loading/unloading, by adding a call to scsi_proc_hostdir_rm() on scsi_remove_host(). But that led to a potential duplicate call to the hostdir_rm() routine, since it's also called from scsi_host_dev_release(). That triggered a regression report, which was then fixed by commit be03df3d4bfe ("scsi: core: Fix a procfs host directory removal regression"). The fix just dropped the hostdir_rm() call from dev_release().
But it happens that this proc directory is created on scsi_host_alloc(), and that function "pairs" with scsi_host_dev_release(), while scsi_remove_host() pairs with scsi_add_host(). In other words, it seems the reason for removing the proc directory on dev_release() was meant to cover cases in which a SCSI host structure was allocated, but the call to scsi_add_host() didn't happen. And that pattern happens to exist in some error paths, for example.
Syzkaller causes that by using USB raw gadget device, error'ing on usb-storage driver, at usb_stor_probe2(). By checking that path, we can see that the BadDevice label leads to a scsi_host_put() after a SCSI host allocation, but there's no call to scsi_add_host() in such path. That leads to messages like this in dmesg (and a leak of the SCSI host proc structure):
usb-storage 4-1:87.51: USB Mass Storage device detected proc_dir_entry 'scsi/usb-storage' already registered WARNING: CPU: 1 PID: 3519 at fs/proc/generic.c:377 proc_register+0x347/0x4e0 fs/proc/generic.c:376
The proper fix seems to still call scsi_proc_hostdir_rm() on dev_release(), but guard that with the state check for SHOST_CREATED; there is even a comment in scsi_host_dev_release() detailing that: such conditional is meant for cases where the SCSI host was allocated but there was no calls to {add,remove}_host(), like the usb-storage case.
This is what we propose here and with that, the error path of usb-storage does not trigger the warning anymore.(CVE-2024-26935)
In the Linux kernel, the following vulnerability has been resolved:
init/main.c: Fix potential static_command_line memory overflow
We allocate memory of size 'xlen + strlen(boot_command_line) + 1' for static_command_line, but the strings copied into static_command_line are extra_command_line and command_line, rather than extra_command_line and boot_command_line.
When strlen(command_line) > strlen(boot_command_line), static_command_line will overflow.
This patch just recovers strlen(command_line) which was miss-consolidated with strlen(boot_command_line) in the commit f5c7310ac73e ("init/main: add checks for the return value of memblock_alloc*()")(CVE-2024-26988)
In the Linux kernel, the following vulnerability has been resolved:
f2fs: fix to avoid potential panic during recovery
During recovery, if FAULT_BLOCK is on, it is possible that f2fs_reserve_new_block() will return -ENOSPC during recovery, then it may trigger panic.
Also, if fault injection rate is 1 and only FAULT_BLOCK fault type is on, it may encounter deadloop in loop of block reservation.
Let's change as below to fix these issues: - remove bug_on() to avoid panic. - limit the loop count of block reservation to avoid potential deadloop.(CVE-2024-27032)
In the Linux kernel, the following vulnerability has been resolved:
clk: Fix clk_core_get NULL dereference
It is possible for clk_core_get to dereference a NULL in the following sequence:
clk_core_get() of_clk_get_hw_from_clkspec() __of_clk_get_hw_from_provider() __clk_get_hw()
__clk_get_hw() can return NULL which is dereferenced by clk_core_get() at hw->core.
Prior to commit dde4eff47c82 ("clk: Look for parents with clkdev based clk_lookups") the check IS_ERR_OR_NULL() was performed which would have caught the NULL.
Reading the description of this function it talks about returning NULL but that cannot be so at the moment.
Update the function to check for hw before dereferencing it and return NULL if hw is NULL.(CVE-2024-27038)
In the Linux kernel, the following vulnerability has been resolved:
net: phy: fix phy_get_internal_delay accessing an empty array
The phy_get_internal_delay function could try to access to an empty array in the case that the driver is calling phy_get_internal_delay without defining delay_values and rx-internal-delay-ps or tx-internal-delay-ps is defined to 0 in the device-tree. This will lead to "unable to handle kernel NULL pointer dereference at virtual address 0". To avoid this kernel oops, the test should be delay >= 0. As there is already delay < 0 test just before, the test could only be size == 0.(CVE-2024-27047)
In the Linux kernel, the following vulnerability has been resolved:
wifi: rtl8xxxu: add cancel_work_sync() for c2hcmd_work
The workqueue might still be running, when the driver is stopped. To avoid a use-after-free, call cancel_work_sync() in rtl8xxxu_stop().(CVE-2024-27052)
In the Linux kernel, the following vulnerability has been resolved:
wifi: wilc1000: fix RCU usage in connect path
With lockdep enabled, calls to the connect function from cfg802.11 layer lead to the following warning:
============================= WARNING: suspicious RCU usage 6.7.0-rc1-wt+ #333 Not tainted
drivers/net/wireless/microchip/wilc1000/hif.c:386 suspicious rcu_dereference_check() usage! [...] stack backtrace: CPU: 0 PID: 100 Comm: wpa_supplicant Not tainted 6.7.0-rc1-wt+ #333 Hardware name: Atmel SAMA5 unwind_backtrace from show_stack+0x18/0x1c show_stack from dump_stack_lvl+0x34/0x48 dump_stack_lvl from wilc_parse_join_bss_param+0x7dc/0x7f4 wilc_parse_join_bss_param from connect+0x2c4/0x648 connect from cfg80211_connect+0x30c/0xb74 cfg80211_connect from nl80211_connect+0x860/0xa94 nl80211_connect from genl_rcv_msg+0x3fc/0x59c genl_rcv_msg from netlink_rcv_skb+0xd0/0x1f8 netlink_rcv_skb from genl_rcv+0x2c/0x3c genl_rcv from netlink_unicast+0x3b0/0x550 netlink_unicast from netlink_sendmsg+0x368/0x688 netlink_sendmsg from _syssendmsg+0x190/0x430 __sys_sendmsg from syssendmsg+0x110/0x158 _sys_sendmsg from sys_sendmsg+0xe8/0x150 sys_sendmsg from ret_fast_syscall+0x0/0x1c
This warning is emitted because in the connect path, when trying to parse target BSS parameters, we dereference a RCU pointer whithout being in RCU critical section. Fix RCU dereference usage by moving it to a RCU read critical section. To avoid wrapping the whole wilc_parse_join_bss_param under the critical section, just use the critical section to copy ies data(CVE-2024-27053)
In the Linux kernel, the following vulnerability has been resolved:
ipv6: fix potential "struct net" leak in inet6_rtm_getaddr()
It seems that if userspace provides a correct IFA_TARGET_NETNSID value but no IFA_ADDRESS and IFA_LOCAL attributes, inet6_rtm_getaddr() returns -EINVAL with an elevated "struct net" refcount.(CVE-2024-27417)
In the Linux kernel, the following vulnerability has been resolved:
genirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline
The absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of interrupt affinity reconfiguration via procfs. Instead, the change is deferred until the next instance of the interrupt being triggered on the original CPU.
When the interrupt next triggers on the original CPU, the new affinity is enforced within __irq_move_irq(). A vector is allocated from the new CPU, but the old vector on the original CPU remains and is not immediately reclaimed. Instead, apicd->move_in_progress is flagged, and the reclaiming process is delayed until the next trigger of the interrupt on the new CPU.
Upon the subsequent triggering of the interrupt on the new CPU, irq_complete_move() adds a task to the old CPU's vector_cleanup list if it remains online. Subsequently, the timer on the old CPU iterates over its vector_cleanup list, reclaiming old vectors.
However, a rare scenario arises if the old CPU is outgoing before the interrupt triggers again on the new CPU.
In that case irq_force_complete_move() is not invoked on the outgoing CPU to reclaim the old apicd->prev_vector because the interrupt isn't currently affine to the outgoing CPU, and irq_needs_fixup() returns false. Even though __vector_schedule_cleanup() is later called on the new CPU, it doesn't reclaim apicd->prev_vector; instead, it simply resets both apicd->move_in_progress and apicd->prev_vector to 0.
As a result, the vector remains unreclaimed in vector_matrix, leading to a CPU vector leak.
To address this issue, move the invocation of irq_force_complete_move() before the irq_needs_fixup() call to reclaim apicd->prev_vector, if the interrupt is currently or used to be affine to the outgoing CPU.
Additionally, reclaim the vector in __vector_schedule_cleanup() as well, following a warning message, although theoretically it should never see apicd->move_in_progress with apicd->prev_cpu pointing to an offline CPU.(CVE-2024-31076)
In the Linux kernel, the following vulnerability has been resolved:
wifi: brcmfmac: Fix use-after-free bug in brcmf_cfg80211_detach
This is the candidate patch of CVE-2023-47233 : https://nvd.nist.gov/vuln/detail/CVE-2023-47233
In brcm80211 driver,it starts with the following invoking chain to start init a timeout worker:
->brcmf_usb_probe ->brcmf_usb_probe_cb ->brcmf_attach ->brcmf_bus_started ->brcmf_cfg80211_attach ->wl_init_priv ->brcmf_init_escan ->INIT_WORK(&cfg->escan_timeout_work, brcmf_cfg80211_escan_timeout_worker);
If we disconnect the USB by hotplug, it will call brcmf_usb_disconnect to make cleanup. The invoking chain is :
brcmf_usb_disconnect ->brcmf_usb_disconnect_cb ->brcmf_detach ->brcmf_cfg80211_detach ->kfree(cfg);
While the timeout woker may still be running. This will cause a use-after-free bug on cfg in brcmf_cfg80211_escan_timeout_worker.
Fix it by deleting the timer and canceling the worker in brcmf_cfg80211_detach.
arend.vanspriel@broadcom.com: keep timer delete as is and cancel work just before free
In the Linux kernel, the following vulnerability has been resolved:
drm/amdgpu: amdgpu_ttm_gart_bind set gtt bound flag
Otherwise after the GTT bo is released, the GTT and gart space is freed but amdgpu_ttm_backend_unbind will not clear the gart page table entry and leave valid mapping entry pointing to the stale system page. Then if GPU access the gart address mistakely, it will read undefined value instead page fault, harder to debug and reproduce the real issue.(CVE-2024-35817)
In the Linux kernel, the following vulnerability has been resolved:
media: tc358743: register v4l2 async device only after successful setup
Ensure the device has been setup correctly before registering the v4l2 async device, thus allowing userspace to access.(CVE-2024-35830)
In the Linux kernel, the following vulnerability has been resolved:
dyndbg: fix old BUG_ON in >control parser
Fix a BUG_ON from 2009. Even if it looks "unreachable" (I didn't really look), lets make sure by removing it, doing pr_err and return -EINVAL instead.(CVE-2024-35947)
In the Linux kernel, the following vulnerability has been resolved:
drm/amd/display: Fix division by zero in setup_dsc_config
When slice_height is 0, the division by slice_height in the calculation of the number of slices will cause a division by zero driver crash. This leaves the kernel in a state that requires a reboot. This patch adds a check to avoid the division by zero.
The stack trace below is for the 6.8.4 Kernel. I reproduced the issue on a Z16 Gen 2 Lenovo Thinkpad with a Apple Studio Display monitor connected via Thunderbolt. The amdgpu driver crashed with this exception when I rebooted the system with the monitor connected.
kernel: ? die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434 arch/x86/kernel/dumpstack.c:447) kernel: ? do_trap (arch/x86/kernel/traps.c:113 arch/x86/kernel/traps.c:154) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? do_error_trap (./arch/x86/include/asm/traps.h:58 arch/x86/kernel/traps.c:175) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? exc_divide_error (arch/x86/kernel/traps.c:194 (discriminator 2)) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: ? asm_exc_divide_error (./arch/x86/include/asm/idtentry.h:548) kernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu kernel: dc_dsc_compute_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1109) amdgpu
After applying this patch, the driver no longer crashes when the monitor is connected and the system is rebooted. I believe this is the same issue reported for 3113.(CVE-2024-36969)
In the Linux kernel, the following vulnerability has been resolved:
net: sched: sch_multiq: fix possible OOB write in multiq_tune()
q->bands will be assigned to qopt->bands to execute subsequent code logic after kmalloc. So the old q->bands should not be used in kmalloc. Otherwise, an out-of-bounds write will occur.(CVE-2024-36978)
In the Linux kernel, the following vulnerability has been resolved:
net: bridge: xmit: make sure we have at least eth header len bytes
syzbot triggered an uninit value[1] error in bridge device's xmit path by sending a short (less than ETH_HLEN bytes) skb. To fix it check if we can actually pull that amount instead of assuming.
Tested with dropwatch: drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3) origin: software timestamp: Mon May 13 11:31:53 2024 778214037 nsec protocol: 0x88a8 length: 2 original length: 2 drop reason: PKT_TOO_SMALL
[1] BUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65 __netdev_start_xmit include/linux/netdevice.h:4903 [inline] netdev_start_xmit include/linux/netdevice.h:4917 [inline] xmit_one net/core/dev.c:3531 [inline] dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547 __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341 dev_queue_xmit include/linux/netdevice.h:3091 [inline] __bpf_tx_skb net/core/filter.c:2136 [inline] __bpf_redirect_common net/core/filter.c:2180 [inline] __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187 _bpfclone_redirect net/core/filter.c:2460 [inline] bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432 _bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997 __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238 bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline] __bpf_prog_run include/linux/filter.h:657 [inline] bpf_prog_run include/linux/filter.h:664 [inline] bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425 bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058 bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269 __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678 __do_sys_bpf kernel/bpf/syscall.c:5767 [inline] __se_sys_bpf kernel/bpf/syscall.c:5765 [inline] __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765 x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Fix UAF for cq async event
The refcount of CQ is not protected by locks. When CQ asynchronous events and CQ destruction are concurrent, CQ may have been released, which will cause UAF.
Use the xa_lock() to protect the CQ refcount.(CVE-2024-38545)
In the Linux kernel, the following vulnerability has been resolved:
drm/mediatek: Add 0 size check to mtk_drm_gem_obj
Add a check to mtk_drm_gem_init if we attempt to allocate a GEM object of 0 bytes. Currently, no such check exists and the kernel will panic if a userspace application attempts to allocate a 0x0 GBM buffer.
Tested by attempting to allocate a 0x0 GBM buffer on an MT8188 and verifying that we now return EINVAL.(CVE-2024-38549)
In the Linux kernel, the following vulnerability has been resolved:
net/mlx5: Discard command completions in internal error
Fix use after free when FW completion arrives while device is in internal error state. Avoid calling completion handler in this case, since the device will flush the command interface and trigger all completions manually.
Kernel log: ------------[ cut here ]------------ refcount_t: underflow; use-after-free. ... RIP: 0010:refcount_warn_saturate+0xd8/0xe0 ... Call Trace: <IRQ> ? __warn+0x79/0x120 ? refcount_warn_saturate+0xd8/0xe0 ? report_bug+0x17c/0x190 ? handle_bug+0x3c/0x60 ? exc_invalid_op+0x14/0x70 ? asm_exc_invalid_op+0x16/0x20 ? refcount_warn_saturate+0xd8/0xe0 cmd_ent_put+0x13b/0x160 [mlx5_core] mlx5_cmd_comp_handler+0x5f9/0x670 [mlx5_core] cmd_comp_notifier+0x1f/0x30 [mlx5_core] notifier_call_chain+0x35/0xb0 atomic_notifier_call_chain+0x16/0x20 mlx5_eq_async_int+0xf6/0x290 [mlx5_core] notifier_call_chain+0x35/0xb0 atomic_notifier_call_chain+0x16/0x20 irq_int_handler+0x19/0x30 [mlx5_core] __handle_irq_event_percpu+0x4b/0x160 handle_irq_event+0x2e/0x80 handle_edge_irq+0x98/0x230 __common_interrupt+0x3b/0xa0 common_interrupt+0x7b/0xa0 </IRQ> <TASK> asm_common_interrupt+0x22/0x40(CVE-2024-38555)
In the Linux kernel, the following vulnerability has been resolved:
drivers/perf: hisi_pcie: Fix out-of-bound access when valid event group
The perf tool allows users to create event groups through following cmd [1], but the driver does not check whether the array index is out of bounds when writing data to the event_group array. If the number of events in an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write overflow of event_group array occurs.
Add array index check to fix the possible array out of bounds violation, and return directly when write new events are written to array bounds.
There are 9 different events in an event_group. [1] perf stat -e '{pmu/event1/, ... ,pmu/event9/}'(CVE-2024-38569)
In the Linux kernel, the following vulnerability has been resolved:
RDMA/hns: Fix deadlock on SRQ async events.
xa_lock for SRQ table may be required in AEQ. Use xa_store_irq()/ xa_erase_irq() to avoid deadlock.(CVE-2024-38591)
In the Linux kernel, the following vulnerability has been resolved:
ring-buffer: Fix a race between readers and resize checks
The reader code in rb_get_reader_page() swaps a new reader page into the ring buffer by doing cmpxchg on old->list.prev->next to point it to the new page. Following that, if the operation is successful, old->list.next->prev gets updated too. This means the underlying doubly-linked list is temporarily inconsistent, page->prev->next or page->next->prev might not be equal back to page for some page in the ring buffer.
The resize operation in ring_buffer_resize() can be invoked in parallel. It calls rb_check_pages() which can detect the described inconsistency and stop further tracing:
[ 190.271762] ------------[ cut here ]------------ [ 190.271771] WARNING: CPU: 1 PID: 6186 at kernel/trace/ring_buffer.c:1467 rb_check_pages.isra.0+0x6a/0xa0 [ 190.271789] Modules linked in: [...] [ 190.271991] Unloaded tainted modules: intel_uncore_frequency(E):1 skx_edac(E):1 [ 190.272002] CPU: 1 PID: 6186 Comm: cmd.sh Kdump: loaded Tainted: G E 6.9.0-rc6-default #5 158d3e1e6d0b091c34c3b96bfd99a1c58306d79f [ 190.272011] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.16.0-0-gd239552c-rebuilt.opensuse.org 04/01/2014 [ 190.272015] RIP: 0010:rb_check_pages.isra.0+0x6a/0xa0 [ 190.272023] Code: [...] [ 190.272028] RSP: 0018:ffff9c37463abb70 EFLAGS: 00010206 [ 190.272034] RAX: ffff8eba04b6cb80 RBX: 0000000000000007 RCX: ffff8eba01f13d80 [ 190.272038] RDX: ffff8eba01f130c0 RSI: ffff8eba04b6cd00 RDI: ffff8eba0004c700 [ 190.272042] RBP: ffff8eba0004c700 R08: 0000000000010002 R09: 0000000000000000 [ 190.272045] R10: 00000000ffff7f52 R11: ffff8eba7f600000 R12: ffff8eba0004c720 [ 190.272049] R13: ffff8eba00223a00 R14: 0000000000000008 R15: ffff8eba067a8000 [ 190.272053] FS: 00007f1bd64752c0(0000) GS:ffff8eba7f680000(0000) knlGS:0000000000000000 [ 190.272057] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 [ 190.272061] CR2: 00007f1bd6662590 CR3: 000000010291e001 CR4: 0000000000370ef0 [ 190.272070] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000 [ 190.272073] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400 [ 190.272077] Call Trace: [ 190.272098] <TASK> [ 190.272189] ring_buffer_resize+0x2ab/0x460 [ 190.272199] __tracing_resize_ring_buffer.part.0+0x23/0xa0 [ 190.272206] tracing_resize_ring_buffer+0x65/0x90 [ 190.272216] tracing_entries_write+0x74/0xc0 [ 190.272225] vfs_write+0xf5/0x420 [ 190.272248] ksys_write+0x67/0xe0 [ 190.272256] do_syscall_64+0x82/0x170 [ 190.272363] entry_SYSCALL_64_after_hwframe+0x76/0x7e [ 190.272373] RIP: 0033:0x7f1bd657d263 [ 190.272381] Code: [...] [ 190.272385] RSP: 002b:00007ffe72b643f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000001 [ 190.272391] RAX: ffffffffffffffda RBX: 0000000000000002 RCX: 00007f1bd657d263 [ 190.272395] RDX: 0000000000000002 RSI: 0000555a6eb538e0 RDI: 0000000000000001 [ 190.272398] RBP: 0000555a6eb538e0 R08: 000000000000000a R09: 0000000000000000 [ 190.272401] R10: 0000555a6eb55190 R11: 0000000000000246 R12: 00007f1bd6662500 [ 190.272404] R13: 0000000000000002 R14: 00007f1bd6667c00 R15: 0000000000000002 [ 190.272412] </TASK> [ 190.272414] ---[ end trace 0000000000000000 ]---
Note that ring_buffer_resize() calls rb_check_pages() only if the parent trace_buffer has recording disabled. Recent commit d78ab792705c ("tracing: Stop current tracer when resizing buffer") causes that it is now always the case which makes it more likely to experience this issue.
The window to hit this race is nonetheless very small. To help reproducing it, one can add a delay loop in rb_get_reader_page():
ret = rb_head_page_replace(reader, cpu_buffer->reader_page); if (!ret) goto spin; for (unsigned i = 0; i < 1U << 26; i++) / inserted delay loop / asm volatile ("" : : : "memory"); rb_list_head(reader->list.next)->prev = &cpu_buffer->reader_page->list;
.. ---truncated---(CVE-2024-38601)
In the Linux kernel, the following vulnerability has been resolved:
serial: max3100: Lock port->lock when calling uart_handle_cts_change()
uart_handle_cts_change() has to be called with port lock taken, Since we run it in a separate work, the lock may not be taken at the time of running. Make sure that it's taken by explicitly doing that. Without it we got a splat:
WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0 ... Workqueue: max3100-0 max3100_work [max3100] RIP: 0010:uart_handle_cts_change+0xa6/0xb0 ... max3100_handlerx+0xc5/0x110 [max3100] max3100_work+0x12a/0x340 max3100
In the Linux kernel, the following vulnerability has been resolved:
bpf: Allow delete from sockmap/sockhash only if update is allowed
We have seen an influx of syzkaller reports where a BPF program attached to a tracepoint triggers a locking rule violation by performing a map_delete on a sockmap/sockhash.
We don't intend to support this artificial use scenario. Extend the existing verifier allowed-program-type check for updating sockmap/sockhash to also cover deleting from a map.
From now on only BPF programs which were previously allowed to update sockmap/sockhash can delete from these map types.(CVE-2024-38662)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-tools-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-tools-devel-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"python3-perf-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-source-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.82.0.163.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.82.0.163.oe2203sp1.src.rpm"
],
"x86_64": [
"kernel-tools-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-debugsource-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.82.0.163.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.82.0.163.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nASoC: SOF: Fix DSP oops stack dump output contents\r\n\r\nFix @buf arg given to hex_dump_to_buffer() and stack address used\nin dump error output.(CVE-2021-47381)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: iscsi: Fix iscsi_task use after free\r\n\r\nCommit d39df158518c (\u0026quot;scsi: iscsi: Have abort handler get ref to conn\u0026quot;)\nadded iscsi_get_conn()/iscsi_put_conn() calls during abort handling but\nthen also changed the handling of the case where we detect an already\ncompleted task where we now end up doing a goto to the common put/cleanup\ncode. This results in a iscsi_task use after free, because the common\ncleanup code will do a put on the iscsi_task.\r\n\r\nThis reverts the goto and moves the iscsi_get_conn() to after we\u0026apos;ve checked\nif the iscsi_task is valid.(CVE-2021-47427)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nspi: Fix deadlock when adding SPI controllers on SPI buses\r\n\r\nCurrently we have a global spi_add_lock which we take when adding new\ndevices so that we can check that we\u0026apos;re not trying to reuse a chip\nselect that\u0026apos;s already controlled. This means that if the SPI device is\nitself a SPI controller and triggers the instantiation of further SPI\ndevices we trigger a deadlock as we try to register and instantiate\nthose devices while in the process of doing so for the parent controller\nand hence already holding the global spi_add_lock. Since we only care\nabout concurrency within a single SPI bus move the lock to be per\ncontroller, avoiding the deadlock.\r\n\r\nThis can be easily triggered in the case of spi-mux.(CVE-2021-47469)\r\n\r\n(CVE-2023-39180)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\npowerpc/powernv: Add a null pointer check in opal_powercap_init()\r\n\r\nkasprintf() returns a pointer to dynamically allocated memory\nwhich can be NULL upon failure.(CVE-2023-52696)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ni2c: core: Run atomic i2c xfer when !preemptible\r\n\r\nSince bae1d3a05a8b, i2c transfers are non-atomic if preemption is\ndisabled. However, non-atomic i2c transfers require preemption (e.g. in\nwait_for_completion() while waiting for the DMA).\r\n\r\npanic() calls preempt_disable_notrace() before calling\nemergency_restart(). Therefore, if an i2c device is used for the\nrestart, the xfer should be atomic. This avoids warnings like:\r\n\r\n[ 12.667612] WARNING: CPU: 1 PID: 1 at kernel/rcu/tree_plugin.h:318 rcu_note_context_switch+0x33c/0x6b0\n[ 12.676926] Voluntary context switch within RCU read-side critical section!\n...\n[ 12.742376] schedule_timeout from wait_for_completion_timeout+0x90/0x114\n[ 12.749179] wait_for_completion_timeout from tegra_i2c_wait_completion+0x40/0x70\n...\n[ 12.994527] atomic_notifier_call_chain from machine_restart+0x34/0x58\n[ 13.001050] machine_restart from panic+0x2a8/0x32c\r\n\r\nUse !preemptible() instead, which is basically the same check as\npre-v5.2.(CVE-2023-52791)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nhid: cp2112: Fix duplicate workqueue initialization\r\n\r\nPreviously the cp2112 driver called INIT_DELAYED_WORK within\ncp2112_gpio_irq_startup, resulting in duplicate initilizations of the\nworkqueue on subsequent IRQ startups following an initial request. This\nresulted in a warning in set_work_data in workqueue.c, as well as a rare\nNULL dereference within process_one_work in workqueue.c.\r\n\r\nInitialize the workqueue within _probe instead.(CVE-2023-52853)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nksmbd: fix UAF issue in ksmbd_tcp_new_connection()\r\n\r\nThe race is between the handling of a new TCP connection and\nits disconnection. It leads to UAF on `struct tcp_transport` in\nksmbd_tcp_new_connection() function.(CVE-2024-26592)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/ipv6: avoid possible UAF in ip6_route_mpath_notify()\r\n\r\nsyzbot found another use-after-free in ip6_route_mpath_notify() [1]\r\n\r\nCommit f7225172f25a (\u0026quot;net/ipv6: prevent use after free in\nip6_route_mpath_notify\u0026quot;) was not able to fix the root cause.\r\n\r\nWe need to defer the fib6_info_release() calls after\nip6_route_mpath_notify(), in the cleanup phase.\r\n\r\n[1]\nBUG: KASAN: slab-use-after-free in rt6_fill_node+0x1460/0x1ac0\nRead of size 4 at addr ffff88809a07fc64 by task syz-executor.2/23037\r\n\r\nCPU: 0 PID: 23037 Comm: syz-executor.2 Not tainted 6.8.0-rc4-syzkaller-01035-gea7f3cfaa588 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/25/2024\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x1e7/0x2e0 lib/dump_stack.c:106\n print_address_description mm/kasan/report.c:377 [inline]\n print_report+0x167/0x540 mm/kasan/report.c:488\n kasan_report+0x142/0x180 mm/kasan/report.c:601\n rt6_fill_node+0x1460/0x1ac0\n inet6_rt_notify+0x13b/0x290 net/ipv6/route.c:6184\n ip6_route_mpath_notify net/ipv6/route.c:5198 [inline]\n ip6_route_multipath_add net/ipv6/route.c:5404 [inline]\n inet6_rtm_newroute+0x1d0f/0x2300 net/ipv6/route.c:5517\n rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597\n netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543\n netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline]\n netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367\n netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x221/0x270 net/socket.c:745\n ____sys_sendmsg+0x525/0x7d0 net/socket.c:2584\n ___sys_sendmsg net/socket.c:2638 [inline]\n __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667\n do_syscall_64+0xf9/0x240\n entry_SYSCALL_64_after_hwframe+0x6f/0x77\nRIP: 0033:0x7f73dd87dda9\nCode: 28 00 00 00 75 05 48 83 c4 28 c3 e8 e1 20 00 00 90 48 89 f8 48 89 f7 48 89 d6 48 89 ca 4d 89 c2 4d 89 c8 4c 8b 4c 24 08 0f 05 \u0026lt;48\u0026gt; 3d 01 f0 ff ff 73 01 c3 48 c7 c1 b0 ff ff ff f7 d8 64 89 01 48\nRSP: 002b:00007f73de6550c8 EFLAGS: 00000246 ORIG_RAX: 000000000000002e\nRAX: ffffffffffffffda RBX: 00007f73dd9ac050 RCX: 00007f73dd87dda9\nRDX: 0000000000000000 RSI: 0000000020000140 RDI: 0000000000000005\nRBP: 00007f73dd8ca47a R08: 0000000000000000 R09: 0000000000000000\nR10: 0000000000000000 R11: 0000000000000246 R12: 0000000000000000\nR13: 000000000000006e R14: 00007f73dd9ac050 R15: 00007ffdbdeb7858\n \u0026lt;/TASK\u0026gt;\r\n\r\nAllocated by task 23037:\n kasan_save_stack mm/kasan/common.c:47 [inline]\n kasan_save_track+0x3f/0x80 mm/kasan/common.c:68\n poison_kmalloc_redzone mm/kasan/common.c:372 [inline]\n __kasan_kmalloc+0x98/0xb0 mm/kasan/common.c:389\n kasan_kmalloc include/linux/kasan.h:211 [inline]\n __do_kmalloc_node mm/slub.c:3981 [inline]\n __kmalloc+0x22e/0x490 mm/slub.c:3994\n kmalloc include/linux/slab.h:594 [inline]\n kzalloc include/linux/slab.h:711 [inline]\n fib6_info_alloc+0x2e/0xf0 net/ipv6/ip6_fib.c:155\n ip6_route_info_create+0x445/0x12b0 net/ipv6/route.c:3758\n ip6_route_multipath_add net/ipv6/route.c:5298 [inline]\n inet6_rtm_newroute+0x744/0x2300 net/ipv6/route.c:5517\n rtnetlink_rcv_msg+0x885/0x1040 net/core/rtnetlink.c:6597\n netlink_rcv_skb+0x1e3/0x430 net/netlink/af_netlink.c:2543\n netlink_unicast_kernel net/netlink/af_netlink.c:1341 [inline]\n netlink_unicast+0x7ea/0x980 net/netlink/af_netlink.c:1367\n netlink_sendmsg+0xa3b/0xd70 net/netlink/af_netlink.c:1908\n sock_sendmsg_nosec net/socket.c:730 [inline]\n __sock_sendmsg+0x221/0x270 net/socket.c:745\n ____sys_sendmsg+0x525/0x7d0 net/socket.c:2584\n ___sys_sendmsg net/socket.c:2638 [inline]\n __sys_sendmsg+0x2b0/0x3a0 net/socket.c:2667\n do_syscall_64+0xf9/0x240\n entry_SYSCALL_64_after_hwframe+0x6f/0x77\r\n\r\nFreed by task 16:\n kasan_save_stack mm/kasan/common.c:47 [inline]\n kasan_save_track+0x3f/0x80 mm/kasan/common.c:68\n kasan_save_free_info+0x4e/0x60 mm/kasan/generic.c:640\n poison_slab_object+0xa6/0xe0 m\n---truncated---(CVE-2024-26852)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninet: inet_defrag: prevent sk release while still in use\r\n\r\nip_local_out() and other functions can pass skb-\u0026gt;sk as function argument.\r\n\r\nIf the skb is a fragment and reassembly happens before such function call\nreturns, the sk must not be released.\r\n\r\nThis affects skb fragments reassembled via netfilter or similar\nmodules, e.g. openvswitch or ct_act.c, when run as part of tx pipeline.\r\n\r\nEric Dumazet made an initial analysis of this bug. Quoting Eric:\n Calling ip_defrag() in output path is also implying skb_orphan(),\n which is buggy because output path relies on sk not disappearing.\r\n\r\n A relevant old patch about the issue was :\n 8282f27449bf (\u0026quot;inet: frag: Always orphan skbs inside ip_defrag()\u0026quot;)\r\n\r\n [..]\r\n\r\n net/ipv4/ip_output.c depends on skb-\u0026gt;sk being set, and probably to an\n inet socket, not an arbitrary one.\r\n\r\n If we orphan the packet in ipvlan, then downstream things like FQ\n packet scheduler will not work properly.\r\n\r\n We need to change ip_defrag() to only use skb_orphan() when really\n needed, ie whenever frag_list is going to be used.\r\n\r\nEric suggested to stash sk in fragment queue and made an initial patch.\nHowever there is a problem with this:\r\n\r\nIf skb is refragmented again right after, ip_do_fragment() will copy\nhead-\u0026gt;sk to the new fragments, and sets up destructor to sock_wfree.\nIOW, we have no choice but to fix up sk_wmem accouting to reflect the\nfully reassembled skb, else wmem will underflow.\r\n\r\nThis change moves the orphan down into the core, to last possible moment.\nAs ip_defrag_offset is aliased with sk_buff-\u0026gt;sk member, we must move the\noffset into the FRAG_CB, else skb-\u0026gt;sk gets clobbered.\r\n\r\nThis allows to delay the orphaning long enough to learn if the skb has\nto be queued or if the skb is completing the reasm queue.\r\n\r\nIn the former case, things work as before, skb is orphaned. This is\nsafe because skb gets queued/stolen and won\u0026apos;t continue past reasm engine.\r\n\r\nIn the latter case, we will steal the skb-\u0026gt;sk reference, reattach it to\nthe head skb, and fix up wmem accouting when inet_frag inflates truesize.(CVE-2024-26921)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nscsi: core: Fix unremoved procfs host directory regression\r\n\r\nCommit fc663711b944 (\u0026quot;scsi: core: Remove the /proc/scsi/${proc_name}\ndirectory earlier\u0026quot;) fixed a bug related to modules loading/unloading, by\nadding a call to scsi_proc_hostdir_rm() on scsi_remove_host(). But that led\nto a potential duplicate call to the hostdir_rm() routine, since it\u0026apos;s also\ncalled from scsi_host_dev_release(). That triggered a regression report,\nwhich was then fixed by commit be03df3d4bfe (\u0026quot;scsi: core: Fix a procfs host\ndirectory removal regression\u0026quot;). The fix just dropped the hostdir_rm() call\nfrom dev_release().\r\n\r\nBut it happens that this proc directory is created on scsi_host_alloc(),\nand that function \u0026quot;pairs\u0026quot; with scsi_host_dev_release(), while\nscsi_remove_host() pairs with scsi_add_host(). In other words, it seems the\nreason for removing the proc directory on dev_release() was meant to cover\ncases in which a SCSI host structure was allocated, but the call to\nscsi_add_host() didn\u0026apos;t happen. And that pattern happens to exist in some\nerror paths, for example.\r\n\r\nSyzkaller causes that by using USB raw gadget device, error\u0026apos;ing on\nusb-storage driver, at usb_stor_probe2(). By checking that path, we can see\nthat the BadDevice label leads to a scsi_host_put() after a SCSI host\nallocation, but there\u0026apos;s no call to scsi_add_host() in such path. That leads\nto messages like this in dmesg (and a leak of the SCSI host proc\nstructure):\r\n\r\nusb-storage 4-1:87.51: USB Mass Storage device detected\nproc_dir_entry \u0026apos;scsi/usb-storage\u0026apos; already registered\nWARNING: CPU: 1 PID: 3519 at fs/proc/generic.c:377 proc_register+0x347/0x4e0 fs/proc/generic.c:376\r\n\r\nThe proper fix seems to still call scsi_proc_hostdir_rm() on dev_release(),\nbut guard that with the state check for SHOST_CREATED; there is even a\ncomment in scsi_host_dev_release() detailing that: such conditional is\nmeant for cases where the SCSI host was allocated but there was no calls to\n{add,remove}_host(), like the usb-storage case.\r\n\r\nThis is what we propose here and with that, the error path of usb-storage\ndoes not trigger the warning anymore.(CVE-2024-26935)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ninit/main.c: Fix potential static_command_line memory overflow\r\n\r\nWe allocate memory of size \u0026apos;xlen + strlen(boot_command_line) + 1\u0026apos; for\nstatic_command_line, but the strings copied into static_command_line are\nextra_command_line and command_line, rather than extra_command_line and\nboot_command_line.\r\n\r\nWhen strlen(command_line) \u0026gt; strlen(boot_command_line), static_command_line\nwill overflow.\r\n\r\nThis patch just recovers strlen(command_line) which was miss-consolidated\nwith strlen(boot_command_line) in the commit f5c7310ac73e (\u0026quot;init/main: add\nchecks for the return value of memblock_alloc*()\u0026quot;)(CVE-2024-26988)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nf2fs: fix to avoid potential panic during recovery\r\n\r\nDuring recovery, if FAULT_BLOCK is on, it is possible that\nf2fs_reserve_new_block() will return -ENOSPC during recovery,\nthen it may trigger panic.\r\n\r\nAlso, if fault injection rate is 1 and only FAULT_BLOCK fault\ntype is on, it may encounter deadloop in loop of block reservation.\r\n\r\nLet\u0026apos;s change as below to fix these issues:\n- remove bug_on() to avoid panic.\n- limit the loop count of block reservation to avoid potential\ndeadloop.(CVE-2024-27032)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nclk: Fix clk_core_get NULL dereference\r\n\r\nIt is possible for clk_core_get to dereference a NULL in the following\nsequence:\r\n\r\nclk_core_get()\n of_clk_get_hw_from_clkspec()\n __of_clk_get_hw_from_provider()\n __clk_get_hw()\r\n\r\n__clk_get_hw() can return NULL which is dereferenced by clk_core_get() at\nhw-\u0026gt;core.\r\n\r\nPrior to commit dde4eff47c82 (\u0026quot;clk: Look for parents with clkdev based\nclk_lookups\u0026quot;) the check IS_ERR_OR_NULL() was performed which would have\ncaught the NULL.\r\n\r\nReading the description of this function it talks about returning NULL but\nthat cannot be so at the moment.\r\n\r\nUpdate the function to check for hw before dereferencing it and return NULL\nif hw is NULL.(CVE-2024-27038)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: phy: fix phy_get_internal_delay accessing an empty array\r\n\r\nThe phy_get_internal_delay function could try to access to an empty\narray in the case that the driver is calling phy_get_internal_delay\nwithout defining delay_values and rx-internal-delay-ps or\ntx-internal-delay-ps is defined to 0 in the device-tree.\nThis will lead to \u0026quot;unable to handle kernel NULL pointer dereference at\nvirtual address 0\u0026quot;. To avoid this kernel oops, the test should be delay\n\u0026gt;= 0. As there is already delay \u0026lt; 0 test just before, the test could\nonly be size == 0.(CVE-2024-27047)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: rtl8xxxu: add cancel_work_sync() for c2hcmd_work\r\n\r\nThe workqueue might still be running, when the driver is stopped. To\navoid a use-after-free, call cancel_work_sync() in rtl8xxxu_stop().(CVE-2024-27052)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: wilc1000: fix RCU usage in connect path\r\n\r\nWith lockdep enabled, calls to the connect function from cfg802.11 layer\nlead to the following warning:\r\n\r\n=============================\nWARNING: suspicious RCU usage\n6.7.0-rc1-wt+ #333 Not tainted\n-----------------------------\ndrivers/net/wireless/microchip/wilc1000/hif.c:386\nsuspicious rcu_dereference_check() usage!\n[...]\nstack backtrace:\nCPU: 0 PID: 100 Comm: wpa_supplicant Not tainted 6.7.0-rc1-wt+ #333\nHardware name: Atmel SAMA5\n unwind_backtrace from show_stack+0x18/0x1c\n show_stack from dump_stack_lvl+0x34/0x48\n dump_stack_lvl from wilc_parse_join_bss_param+0x7dc/0x7f4\n wilc_parse_join_bss_param from connect+0x2c4/0x648\n connect from cfg80211_connect+0x30c/0xb74\n cfg80211_connect from nl80211_connect+0x860/0xa94\n nl80211_connect from genl_rcv_msg+0x3fc/0x59c\n genl_rcv_msg from netlink_rcv_skb+0xd0/0x1f8\n netlink_rcv_skb from genl_rcv+0x2c/0x3c\n genl_rcv from netlink_unicast+0x3b0/0x550\n netlink_unicast from netlink_sendmsg+0x368/0x688\n netlink_sendmsg from ____sys_sendmsg+0x190/0x430\n ____sys_sendmsg from ___sys_sendmsg+0x110/0x158\n ___sys_sendmsg from sys_sendmsg+0xe8/0x150\n sys_sendmsg from ret_fast_syscall+0x0/0x1c\r\n\r\nThis warning is emitted because in the connect path, when trying to parse\ntarget BSS parameters, we dereference a RCU pointer whithout being in RCU\ncritical section.\nFix RCU dereference usage by moving it to a RCU read critical section. To\navoid wrapping the whole wilc_parse_join_bss_param under the critical\nsection, just use the critical section to copy ies data(CVE-2024-27053)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nipv6: fix potential \u0026quot;struct net\u0026quot; leak in inet6_rtm_getaddr()\r\n\r\nIt seems that if userspace provides a correct IFA_TARGET_NETNSID value\nbut no IFA_ADDRESS and IFA_LOCAL attributes, inet6_rtm_getaddr()\nreturns -EINVAL with an elevated \u0026quot;struct net\u0026quot; refcount.(CVE-2024-27417)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ngenirq/cpuhotplug, x86/vector: Prevent vector leak during CPU offline\r\n\r\nThe absence of IRQD_MOVE_PCNTXT prevents immediate effectiveness of\ninterrupt affinity reconfiguration via procfs. Instead, the change is\ndeferred until the next instance of the interrupt being triggered on the\noriginal CPU.\r\n\r\nWhen the interrupt next triggers on the original CPU, the new affinity is\nenforced within __irq_move_irq(). A vector is allocated from the new CPU,\nbut the old vector on the original CPU remains and is not immediately\nreclaimed. Instead, apicd-\u0026gt;move_in_progress is flagged, and the reclaiming\nprocess is delayed until the next trigger of the interrupt on the new CPU.\r\n\r\nUpon the subsequent triggering of the interrupt on the new CPU,\nirq_complete_move() adds a task to the old CPU\u0026apos;s vector_cleanup list if it\nremains online. Subsequently, the timer on the old CPU iterates over its\nvector_cleanup list, reclaiming old vectors.\r\n\r\nHowever, a rare scenario arises if the old CPU is outgoing before the\ninterrupt triggers again on the new CPU.\r\n\r\nIn that case irq_force_complete_move() is not invoked on the outgoing CPU\nto reclaim the old apicd-\u0026gt;prev_vector because the interrupt isn\u0026apos;t currently\naffine to the outgoing CPU, and irq_needs_fixup() returns false. Even\nthough __vector_schedule_cleanup() is later called on the new CPU, it\ndoesn\u0026apos;t reclaim apicd-\u0026gt;prev_vector; instead, it simply resets both\napicd-\u0026gt;move_in_progress and apicd-\u0026gt;prev_vector to 0.\r\n\r\nAs a result, the vector remains unreclaimed in vector_matrix, leading to a\nCPU vector leak.\r\n\r\nTo address this issue, move the invocation of irq_force_complete_move()\nbefore the irq_needs_fixup() call to reclaim apicd-\u0026gt;prev_vector, if the\ninterrupt is currently or used to be affine to the outgoing CPU.\r\n\r\nAdditionally, reclaim the vector in __vector_schedule_cleanup() as well,\nfollowing a warning message, although theoretically it should never see\napicd-\u0026gt;move_in_progress with apicd-\u0026gt;prev_cpu pointing to an offline CPU.(CVE-2024-31076)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nwifi: brcmfmac: Fix use-after-free bug in brcmf_cfg80211_detach\r\n\r\nThis is the candidate patch of CVE-2023-47233 :\nhttps://nvd.nist.gov/vuln/detail/CVE-2023-47233\r\n\r\nIn brcm80211 driver,it starts with the following invoking chain\nto start init a timeout worker:\r\n\r\n-\u0026gt;brcmf_usb_probe\n -\u0026gt;brcmf_usb_probe_cb\n -\u0026gt;brcmf_attach\n -\u0026gt;brcmf_bus_started\n -\u0026gt;brcmf_cfg80211_attach\n -\u0026gt;wl_init_priv\n -\u0026gt;brcmf_init_escan\n -\u0026gt;INIT_WORK(\u0026amp;cfg-\u0026gt;escan_timeout_work,\n\t\t brcmf_cfg80211_escan_timeout_worker);\r\n\r\nIf we disconnect the USB by hotplug, it will call\nbrcmf_usb_disconnect to make cleanup. The invoking chain is :\r\n\r\nbrcmf_usb_disconnect\n -\u0026gt;brcmf_usb_disconnect_cb\n -\u0026gt;brcmf_detach\n -\u0026gt;brcmf_cfg80211_detach\n -\u0026gt;kfree(cfg);\r\n\r\nWhile the timeout woker may still be running. This will cause\na use-after-free bug on cfg in brcmf_cfg80211_escan_timeout_worker.\r\n\r\nFix it by deleting the timer and canceling the worker in\nbrcmf_cfg80211_detach.\r\n\r\n[arend.vanspriel@broadcom.com: keep timer delete as is and cancel work just before free](CVE-2024-35811)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amdgpu: amdgpu_ttm_gart_bind set gtt bound flag\r\n\r\nOtherwise after the GTT bo is released, the GTT and gart space is freed\nbut amdgpu_ttm_backend_unbind will not clear the gart page table entry\nand leave valid mapping entry pointing to the stale system page. Then\nif GPU access the gart address mistakely, it will read undefined value\ninstead page fault, harder to debug and reproduce the real issue.(CVE-2024-35817)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nmedia: tc358743: register v4l2 async device only after successful setup\r\n\r\nEnsure the device has been setup correctly before registering the v4l2\nasync device, thus allowing userspace to access.(CVE-2024-35830)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndyndbg: fix old BUG_ON in \u0026gt;control parser\r\n\r\nFix a BUG_ON from 2009. Even if it looks \u0026quot;unreachable\u0026quot; (I didn\u0026apos;t\nreally look), lets make sure by removing it, doing pr_err and return\n-EINVAL instead.(CVE-2024-35947)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/amd/display: Fix division by zero in setup_dsc_config\r\n\r\nWhen slice_height is 0, the division by slice_height in the calculation\nof the number of slices will cause a division by zero driver crash. This\nleaves the kernel in a state that requires a reboot. This patch adds a\ncheck to avoid the division by zero.\r\n\r\nThe stack trace below is for the 6.8.4 Kernel. I reproduced the issue on\na Z16 Gen 2 Lenovo Thinkpad with a Apple Studio Display monitor\nconnected via Thunderbolt. The amdgpu driver crashed with this exception\nwhen I rebooted the system with the monitor connected.\r\n\r\nkernel: ? die (arch/x86/kernel/dumpstack.c:421 arch/x86/kernel/dumpstack.c:434 arch/x86/kernel/dumpstack.c:447)\nkernel: ? do_trap (arch/x86/kernel/traps.c:113 arch/x86/kernel/traps.c:154)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? do_error_trap (./arch/x86/include/asm/traps.h:58 arch/x86/kernel/traps.c:175)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? exc_divide_error (arch/x86/kernel/traps.c:194 (discriminator 2))\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: ? asm_exc_divide_error (./arch/x86/include/asm/idtentry.h:548)\nkernel: ? setup_dsc_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1053) amdgpu\nkernel: dc_dsc_compute_config (drivers/gpu/drm/amd/amdgpu/../display/dc/dsc/dc_dsc.c:1109) amdgpu\r\n\r\nAfter applying this patch, the driver no longer crashes when the monitor\nis connected and the system is rebooted. I believe this is the same\nissue reported for 3113.(CVE-2024-36969)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: sched: sch_multiq: fix possible OOB write in multiq_tune()\r\n\r\nq-\u0026gt;bands will be assigned to qopt-\u0026gt;bands to execute subsequent code logic\nafter kmalloc. So the old q-\u0026gt;bands should not be used in kmalloc.\nOtherwise, an out-of-bounds write will occur.(CVE-2024-36978)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet: bridge: xmit: make sure we have at least eth header len bytes\r\n\r\nsyzbot triggered an uninit value[1] error in bridge device\u0026apos;s xmit path\nby sending a short (less than ETH_HLEN bytes) skb. To fix it check if\nwe can actually pull that amount instead of assuming.\r\n\r\nTested with dropwatch:\n drop at: br_dev_xmit+0xb93/0x12d0 [bridge] (0xffffffffc06739b3)\n origin: software\n timestamp: Mon May 13 11:31:53 2024 778214037 nsec\n protocol: 0x88a8\n length: 2\n original length: 2\n drop reason: PKT_TOO_SMALL\r\n\r\n[1]\nBUG: KMSAN: uninit-value in br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n br_dev_xmit+0x61d/0x1cb0 net/bridge/br_device.c:65\n __netdev_start_xmit include/linux/netdevice.h:4903 [inline]\n netdev_start_xmit include/linux/netdevice.h:4917 [inline]\n xmit_one net/core/dev.c:3531 [inline]\n dev_hard_start_xmit+0x247/0xa20 net/core/dev.c:3547\n __dev_queue_xmit+0x34db/0x5350 net/core/dev.c:4341\n dev_queue_xmit include/linux/netdevice.h:3091 [inline]\n __bpf_tx_skb net/core/filter.c:2136 [inline]\n __bpf_redirect_common net/core/filter.c:2180 [inline]\n __bpf_redirect+0x14a6/0x1620 net/core/filter.c:2187\n ____bpf_clone_redirect net/core/filter.c:2460 [inline]\n bpf_clone_redirect+0x328/0x470 net/core/filter.c:2432\n ___bpf_prog_run+0x13fe/0xe0f0 kernel/bpf/core.c:1997\n __bpf_prog_run512+0xb5/0xe0 kernel/bpf/core.c:2238\n bpf_dispatcher_nop_func include/linux/bpf.h:1234 [inline]\n __bpf_prog_run include/linux/filter.h:657 [inline]\n bpf_prog_run include/linux/filter.h:664 [inline]\n bpf_test_run+0x499/0xc30 net/bpf/test_run.c:425\n bpf_prog_test_run_skb+0x14ea/0x1f20 net/bpf/test_run.c:1058\n bpf_prog_test_run+0x6b7/0xad0 kernel/bpf/syscall.c:4269\n __sys_bpf+0x6aa/0xd90 kernel/bpf/syscall.c:5678\n __do_sys_bpf kernel/bpf/syscall.c:5767 [inline]\n __se_sys_bpf kernel/bpf/syscall.c:5765 [inline]\n __x64_sys_bpf+0xa0/0xe0 kernel/bpf/syscall.c:5765\n x64_sys_call+0x96b/0x3b50 arch/x86/include/generated/asm/syscalls_64.h:322\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xcf/0x1e0 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f(CVE-2024-38538)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Fix UAF for cq async event\r\n\r\nThe refcount of CQ is not protected by locks. When CQ asynchronous\nevents and CQ destruction are concurrent, CQ may have been released,\nwhich will cause UAF.\r\n\r\nUse the xa_lock() to protect the CQ refcount.(CVE-2024-38545)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrm/mediatek: Add 0 size check to mtk_drm_gem_obj\r\n\r\nAdd a check to mtk_drm_gem_init if we attempt to allocate a GEM object\nof 0 bytes. Currently, no such check exists and the kernel will panic if\na userspace application attempts to allocate a 0x0 GBM buffer.\r\n\r\nTested by attempting to allocate a 0x0 GBM buffer on an MT8188 and\nverifying that we now return EINVAL.(CVE-2024-38549)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nnet/mlx5: Discard command completions in internal error\r\n\r\nFix use after free when FW completion arrives while device is in\ninternal error state. Avoid calling completion handler in this case,\nsince the device will flush the command interface and trigger all\ncompletions manually.\r\n\r\nKernel log:\n------------[ cut here ]------------\nrefcount_t: underflow; use-after-free.\n...\nRIP: 0010:refcount_warn_saturate+0xd8/0xe0\n...\nCall Trace:\n\u0026lt;IRQ\u0026gt;\n? __warn+0x79/0x120\n? refcount_warn_saturate+0xd8/0xe0\n? report_bug+0x17c/0x190\n? handle_bug+0x3c/0x60\n? exc_invalid_op+0x14/0x70\n? asm_exc_invalid_op+0x16/0x20\n? refcount_warn_saturate+0xd8/0xe0\ncmd_ent_put+0x13b/0x160 [mlx5_core]\nmlx5_cmd_comp_handler+0x5f9/0x670 [mlx5_core]\ncmd_comp_notifier+0x1f/0x30 [mlx5_core]\nnotifier_call_chain+0x35/0xb0\natomic_notifier_call_chain+0x16/0x20\nmlx5_eq_async_int+0xf6/0x290 [mlx5_core]\nnotifier_call_chain+0x35/0xb0\natomic_notifier_call_chain+0x16/0x20\nirq_int_handler+0x19/0x30 [mlx5_core]\n__handle_irq_event_percpu+0x4b/0x160\nhandle_irq_event+0x2e/0x80\nhandle_edge_irq+0x98/0x230\n__common_interrupt+0x3b/0xa0\ncommon_interrupt+0x7b/0xa0\n\u0026lt;/IRQ\u0026gt;\n\u0026lt;TASK\u0026gt;\nasm_common_interrupt+0x22/0x40(CVE-2024-38555)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\ndrivers/perf: hisi_pcie: Fix out-of-bound access when valid event group\r\n\r\nThe perf tool allows users to create event groups through following\ncmd [1], but the driver does not check whether the array index is out of\nbounds when writing data to the event_group array. If the number of events\nin an event_group is greater than HISI_PCIE_MAX_COUNTERS, the memory write\noverflow of event_group array occurs.\r\n\r\nAdd array index check to fix the possible array out of bounds violation,\nand return directly when write new events are written to array bounds.\r\n\r\nThere are 9 different events in an event_group.\n[1] perf stat -e \u0026apos;{pmu/event1/, ... ,pmu/event9/}\u0026apos;(CVE-2024-38569)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nRDMA/hns: Fix deadlock on SRQ async events.\r\n\r\nxa_lock for SRQ table may be required in AEQ. Use xa_store_irq()/\nxa_erase_irq() to avoid deadlock.(CVE-2024-38591)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nring-buffer: Fix a race between readers and resize checks\r\n\r\nThe reader code in rb_get_reader_page() swaps a new reader page into the\nring buffer by doing cmpxchg on old-\u0026gt;list.prev-\u0026gt;next to point it to the\nnew page. Following that, if the operation is successful,\nold-\u0026gt;list.next-\u0026gt;prev gets updated too. This means the underlying\ndoubly-linked list is temporarily inconsistent, page-\u0026gt;prev-\u0026gt;next or\npage-\u0026gt;next-\u0026gt;prev might not be equal back to page for some page in the\nring buffer.\r\n\r\nThe resize operation in ring_buffer_resize() can be invoked in parallel.\nIt calls rb_check_pages() which can detect the described inconsistency\nand stop further tracing:\r\n\r\n[ 190.271762] ------------[ cut here ]------------\n[ 190.271771] WARNING: CPU: 1 PID: 6186 at kernel/trace/ring_buffer.c:1467 rb_check_pages.isra.0+0x6a/0xa0\n[ 190.271789] Modules linked in: [...]\n[ 190.271991] Unloaded tainted modules: intel_uncore_frequency(E):1 skx_edac(E):1\n[ 190.272002] CPU: 1 PID: 6186 Comm: cmd.sh Kdump: loaded Tainted: G E 6.9.0-rc6-default #5 158d3e1e6d0b091c34c3b96bfd99a1c58306d79f\n[ 190.272011] Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS rel-1.16.0-0-gd239552c-rebuilt.opensuse.org 04/01/2014\n[ 190.272015] RIP: 0010:rb_check_pages.isra.0+0x6a/0xa0\n[ 190.272023] Code: [...]\n[ 190.272028] RSP: 0018:ffff9c37463abb70 EFLAGS: 00010206\n[ 190.272034] RAX: ffff8eba04b6cb80 RBX: 0000000000000007 RCX: ffff8eba01f13d80\n[ 190.272038] RDX: ffff8eba01f130c0 RSI: ffff8eba04b6cd00 RDI: ffff8eba0004c700\n[ 190.272042] RBP: ffff8eba0004c700 R08: 0000000000010002 R09: 0000000000000000\n[ 190.272045] R10: 00000000ffff7f52 R11: ffff8eba7f600000 R12: ffff8eba0004c720\n[ 190.272049] R13: ffff8eba00223a00 R14: 0000000000000008 R15: ffff8eba067a8000\n[ 190.272053] FS: 00007f1bd64752c0(0000) GS:ffff8eba7f680000(0000) knlGS:0000000000000000\n[ 190.272057] CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\n[ 190.272061] CR2: 00007f1bd6662590 CR3: 000000010291e001 CR4: 0000000000370ef0\n[ 190.272070] DR0: 0000000000000000 DR1: 0000000000000000 DR2: 0000000000000000\n[ 190.272073] DR3: 0000000000000000 DR6: 00000000fffe0ff0 DR7: 0000000000000400\n[ 190.272077] Call Trace:\n[ 190.272098] \u0026lt;TASK\u0026gt;\n[ 190.272189] ring_buffer_resize+0x2ab/0x460\n[ 190.272199] __tracing_resize_ring_buffer.part.0+0x23/0xa0\n[ 190.272206] tracing_resize_ring_buffer+0x65/0x90\n[ 190.272216] tracing_entries_write+0x74/0xc0\n[ 190.272225] vfs_write+0xf5/0x420\n[ 190.272248] ksys_write+0x67/0xe0\n[ 190.272256] do_syscall_64+0x82/0x170\n[ 190.272363] entry_SYSCALL_64_after_hwframe+0x76/0x7e\n[ 190.272373] RIP: 0033:0x7f1bd657d263\n[ 190.272381] Code: [...]\n[ 190.272385] RSP: 002b:00007ffe72b643f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000001\n[ 190.272391] RAX: ffffffffffffffda RBX: 0000000000000002 RCX: 00007f1bd657d263\n[ 190.272395] RDX: 0000000000000002 RSI: 0000555a6eb538e0 RDI: 0000000000000001\n[ 190.272398] RBP: 0000555a6eb538e0 R08: 000000000000000a R09: 0000000000000000\n[ 190.272401] R10: 0000555a6eb55190 R11: 0000000000000246 R12: 00007f1bd6662500\n[ 190.272404] R13: 0000000000000002 R14: 00007f1bd6667c00 R15: 0000000000000002\n[ 190.272412] \u0026lt;/TASK\u0026gt;\n[ 190.272414] ---[ end trace 0000000000000000 ]---\r\n\r\nNote that ring_buffer_resize() calls rb_check_pages() only if the parent\ntrace_buffer has recording disabled. Recent commit d78ab792705c\n(\u0026quot;tracing: Stop current tracer when resizing buffer\u0026quot;) causes that it is\nnow always the case which makes it more likely to experience this issue.\r\n\r\nThe window to hit this race is nonetheless very small. To help\nreproducing it, one can add a delay loop in rb_get_reader_page():\r\n\r\n ret = rb_head_page_replace(reader, cpu_buffer-\u0026gt;reader_page);\n if (!ret)\n \tgoto spin;\n for (unsigned i = 0; i \u0026lt; 1U \u0026lt;\u0026lt; 26; i++) /* inserted delay loop */\n \t__asm__ __volatile__ (\u0026quot;\u0026quot; : : : \u0026quot;memory\u0026quot;);\n rb_list_head(reader-\u0026gt;list.next)-\u0026gt;prev = \u0026amp;cpu_buffer-\u0026gt;reader_page-\u0026gt;list;\r\n\r\n.. \n---truncated---(CVE-2024-38601)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nserial: max3100: Lock port-\u0026gt;lock when calling uart_handle_cts_change()\r\n\r\nuart_handle_cts_change() has to be called with port lock taken,\nSince we run it in a separate work, the lock may not be taken at\nthe time of running. Make sure that it\u0026apos;s taken by explicitly doing\nthat. Without it we got a splat:\r\n\r\n WARNING: CPU: 0 PID: 10 at drivers/tty/serial/serial_core.c:3491 uart_handle_cts_change+0xa6/0xb0\n ...\n Workqueue: max3100-0 max3100_work [max3100]\n RIP: 0010:uart_handle_cts_change+0xa6/0xb0\n ...\n max3100_handlerx+0xc5/0x110 [max3100]\n max3100_work+0x12a/0x340 [max3100](CVE-2024-38634)\r\n\r\nIn the Linux kernel, the following vulnerability has been resolved:\r\n\r\nbpf: Allow delete from sockmap/sockhash only if update is allowed\r\n\r\nWe have seen an influx of syzkaller reports where a BPF program attached to\na tracepoint triggers a locking rule violation by performing a map_delete\non a sockmap/sockhash.\r\n\r\nWe don\u0026apos;t intend to support this artificial use scenario. Extend the\nexisting verifier allowed-program-type check for updating sockmap/sockhash\nto also cover deleting from a map.\r\n\r\nFrom now on only BPF programs which were previously allowed to update\nsockmap/sockhash can delete from these map types.(CVE-2024-38662)",
"id": "OESA-2024-1768",
"modified": "2026-08-06T11:07:14Z",
"published": "2024-06-28T11:07:14Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2024-1768"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47381"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47427"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2021-47469"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-39180"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52696"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52791"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-52853"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26592"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26852"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26921"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26935"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-26988"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27032"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27038"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27047"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27052"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27053"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-27417"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-31076"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35811"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35817"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35830"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-35947"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36969"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-36978"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38538"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38545"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38549"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38555"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38569"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38591"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38601"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38634"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-38662"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2021-47381",
"CVE-2021-47427",
"CVE-2021-47469",
"CVE-2023-39180",
"CVE-2023-52696",
"CVE-2023-52791",
"CVE-2023-52853",
"CVE-2024-26592",
"CVE-2024-26852",
"CVE-2024-26921",
"CVE-2024-26935",
"CVE-2024-26988",
"CVE-2024-27032",
"CVE-2024-27038",
"CVE-2024-27047",
"CVE-2024-27052",
"CVE-2024-27053",
"CVE-2024-27417",
"CVE-2024-31076",
"CVE-2024-35811",
"CVE-2024-35817",
"CVE-2024-35830",
"CVE-2024-35947",
"CVE-2024-36969",
"CVE-2024-36978",
"CVE-2024-38538",
"CVE-2024-38545",
"CVE-2024-38549",
"CVE-2024-38555",
"CVE-2024-38569",
"CVE-2024-38591",
"CVE-2024-38601",
"CVE-2024-38634",
"CVE-2024-38662"
]
}
SUSE-SU-2024:2571-1
Vulnerability from csaf_suse - Published: 2024-07-22 10:34 - Updated: 2024-07-22 10:34Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.