Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2023-53515 (GCVE-0-2023-53515)
Vulnerability from cvelistv5 – Published: 2025-10-01 11:46 – Updated: 2026-05-11 19:46| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5 , < 97a2d55ead76358245b446efd87818e919196d7a
(git)
Affected: 7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5 , < b788ad3b2468512339c05f23692e36860264e674 (git) Affected: 7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5 , < 3ff54d904fafabd0912796785e53cce4e69ca123 (git) Affected: 7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5 , < 5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e (git) Affected: 7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5 , < af5818c35173e096085c6ae2e3aac605d3d15e41 (git) Affected: 7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5 , < 2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e (git) Affected: 7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5 , < 55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a (git) |
guessed | |
| Linux | Linux |
Affected:
4.15
Unaffected: 0 , < 4.15 (semver) Unaffected: 4.19.293 , ≤ 4.19.* (semver) Unaffected: 5.4.255 , ≤ 5.4.* (semver) Unaffected: 5.10.192 , ≤ 5.10.* (semver) Unaffected: 5.15.128 , ≤ 5.15.* (semver) Unaffected: 6.1.47 , ≤ 6.1.* (semver) Unaffected: 6.4.12 , ≤ 6.4.* (semver) Unaffected: 6.5 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/virtio/virtio_mmio.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "97a2d55ead76358245b446efd87818e919196d7a",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "b788ad3b2468512339c05f23692e36860264e674",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "3ff54d904fafabd0912796785e53cce4e69ca123",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "af5818c35173e096085c6ae2e3aac605d3d15e41",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/virtio/virtio_mmio.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.15"
},
{
"lessThan": "4.15",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.293",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.255",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.192",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.128",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.47",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.4.*",
"status": "unaffected",
"version": "6.4.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.5",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.293",
"versionStartIncluding": "4.15",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.255",
"versionStartIncluding": "4.15",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.192",
"versionStartIncluding": "4.15",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.128",
"versionStartIncluding": "4.15",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.47",
"versionStartIncluding": "4.15",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.4.12",
"versionStartIncluding": "4.15",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.5",
"versionStartIncluding": "4.15",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nvirtio-mmio: don\u0027t break lifecycle of vm_dev\n\nvm_dev has a separate lifecycle because it has a \u0027struct device\u0027\nembedded. Thus, having a release callback for it is correct.\n\nAllocating the vm_dev struct with devres totally breaks this protection,\nthough. Instead of waiting for the vm_dev release callback, the memory\nis freed when the platform_device is removed. Resulting in a\nuse-after-free when finally the callback is to be called.\n\nTo easily see the problem, compile the kernel with\nCONFIG_DEBUG_KOBJECT_RELEASE and unbind with sysfs.\n\nThe fix is easy, don\u0027t use devres in this case.\n\nFound during my research about object lifetime problems."
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T19:46:28.049Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/97a2d55ead76358245b446efd87818e919196d7a"
},
{
"url": "https://git.kernel.org/stable/c/b788ad3b2468512339c05f23692e36860264e674"
},
{
"url": "https://git.kernel.org/stable/c/3ff54d904fafabd0912796785e53cce4e69ca123"
},
{
"url": "https://git.kernel.org/stable/c/5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e"
},
{
"url": "https://git.kernel.org/stable/c/af5818c35173e096085c6ae2e3aac605d3d15e41"
},
{
"url": "https://git.kernel.org/stable/c/2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e"
},
{
"url": "https://git.kernel.org/stable/c/55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a"
}
],
"title": "virtio-mmio: don\u0027t break lifecycle of vm_dev",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-53515",
"datePublished": "2025-10-01T11:46:03.192Z",
"dateReserved": "2025-10-01T11:39:39.406Z",
"dateUpdated": "2026-05-11T19:46:28.049Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2023-53515",
"date": "2026-09-29",
"epss": "0.00149",
"percentile": "0.03446"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/virtio/virtio_mmio.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "97a2d55ead76358245b446efd87818e919196d7a",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "b788ad3b2468512339c05f23692e36860264e674",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "3ff54d904fafabd0912796785e53cce4e69ca123",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "af5818c35173e096085c6ae2e3aac605d3d15e41",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/virtio/virtio_mmio.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.15"
},
{
"lessThan": "4.15",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.293",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.255",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.192",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.128",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.47",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.4.*",
"status": "unaffected",
"version": "6.4.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.5",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "ED6316DD-6C72-425B-A7D4-EA2D57F6124C",
"versionEndExcluding": "4.19.293",
"versionStartIncluding": "4.15.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1379E40A-2AC3-484E-929A-7F46B6C3B521",
"versionEndExcluding": "5.4.255",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9396FFDC-6A0D-44B7-9368-21B456F6D4AE",
"versionEndExcluding": "5.10.192",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1415629F-F97B-4880-BA1E-AF3DBB8EF305",
"versionEndExcluding": "5.15.128",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "2EEA01B0-0151-4E0F-B140-1A441EEDD717",
"versionEndExcluding": "6.1.47",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CF8ECF64-40AE-49AB-8315-4D83F9F56ECF",
"versionEndExcluding": "6.4.12",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:-:*:*:*:*:*:*",
"matchCriteriaId": "3B4D39AF-668B-442B-8085-639A6D4FA5AC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc3:*:*:*:*:*:*",
"matchCriteriaId": "14E8986E-B317-40EA-B0B5-5D2922D2AF5B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc4:*:*:*:*:*:*",
"matchCriteriaId": "EBC4657A-0239-47DF-B582-87D8DFA69439",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc5:*:*:*:*:*:*",
"matchCriteriaId": "0E1F48A9-9185-4554-9265-22CEC01D18FD",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc6:*:*:*:*:*:*",
"matchCriteriaId": "639D2465-65E0-40E2-B7A8-BEA9E221DE54",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc7:*:*:*:*:*:*",
"matchCriteriaId": "A282AD0B-2D63-4F05-8F89-109A0975B423",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc8:*:*:*:*:*:*",
"matchCriteriaId": "30358221-183C-4699-994E-AF51F5D534FC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc9:*:*:*:*:*:*",
"matchCriteriaId": "A5ED80A8-E656-4AE9-921B-C22402C94A4C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc1:*:*:*:*:*:*",
"matchCriteriaId": "0B3E6E4D-E24E-4630-B00C-8C9901C597B0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc2:*:*:*:*:*:*",
"matchCriteriaId": "E4A01A71-0F09-4DB2-A02F-7EFFBE27C98D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc3:*:*:*:*:*:*",
"matchCriteriaId": "F5608371-157A-4318-8A2E-4104C3467EA1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc4:*:*:*:*:*:*",
"matchCriteriaId": "2226A776-DF8C-49E0-A030-0A7853BB018A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc5:*:*:*:*:*:*",
"matchCriteriaId": "6F15C659-DF06-455A-9765-0E6DE920F29A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc6:*:*:*:*:*:*",
"matchCriteriaId": "5B1C14ED-ABC4-41D3-8D9C-D38C6A65B4DE",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nvirtio-mmio: don\u0027t break lifecycle of vm_dev\n\nvm_dev has a separate lifecycle because it has a \u0027struct device\u0027\nembedded. Thus, having a release callback for it is correct.\n\nAllocating the vm_dev struct with devres totally breaks this protection,\nthough. Instead of waiting for the vm_dev release callback, the memory\nis freed when the platform_device is removed. Resulting in a\nuse-after-free when finally the callback is to be called.\n\nTo easily see the problem, compile the kernel with\nCONFIG_DEBUG_KOBJECT_RELEASE and unbind with sysfs.\n\nThe fix is easy, don\u0027t use devres in this case.\n\nFound during my research about object lifetime problems."
}
],
"id": "CVE-2023-53515",
"lastModified": "2026-06-17T06:45:30.660",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2025-10-01T12:15:55.583",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3ff54d904fafabd0912796785e53cce4e69ca123"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/97a2d55ead76358245b446efd87818e919196d7a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/af5818c35173e096085c6ae2e3aac605d3d15e41"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b788ad3b2468512339c05f23692e36860264e674"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-416"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2026-06-29T22:24:53+00:00",
"cve": "CVE-2023-53515",
"id": "CVE-2023-53515",
"initial_release_date": "2023-01-01T00:00:00+00:00",
"product_status:known_affected": "156",
"product_status:known_not_affected": "118",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: virtio-mmio: don\u0027t break lifecycle of vm_dev",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2023/cve-2023-53515.json",
"version": "3"
}
}
}
BDU:2025-12787 (CVE-2023-53515)
Vulnerability from fstec – Published: 2025-10-13 – Updated: 2026-09-01 – View on bdu.fstec.ru Fixed{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:C/I:C/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "Red Hat, Inc., \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f, \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb, \u0410\u041e \u00ab\u0421\u0431\u0435\u0440\u0422\u0435\u0445\u00bb",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "8 (Red Hat Enterprise Linux), 11 (Debian GNU/Linux), 12 (Debian GNU/Linux), 7.3 (\u0420\u0415\u0414 \u041e\u0421), 9 (Red Hat Enterprise Linux), \u043e\u0442 6.2 \u0434\u043e 6.4.11 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.16 \u0434\u043e 6.1.46 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 4.15 \u0434\u043e 4.19.292 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 4.20 \u0434\u043e 5.4.254 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.5 \u0434\u043e 5.10.191 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.11 \u0434\u043e 5.15.127 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), 9.2.0-fstec (Platform V SberLinux OS Server)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\n\u0414\u043b\u044f Linux:\nhttps://lore.kernel.org/linux-cve-announce/2025100131-CVE-2023-53515-abe8@gregkh/\nhttps://git.kernel.org/stable/c/2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e\t\nhttps://git.kernel.org/stable/c/3ff54d904fafabd0912796785e53cce4e69ca123\t\nhttps://git.kernel.org/stable/c/55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a\t\nhttps://git.kernel.org/stable/c/5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e\t\nhttps://git.kernel.org/stable/c/97a2d55ead76358245b446efd87818e919196d7a\t\nhttps://git.kernel.org/stable/c/af5818c35173e096085c6ae2e3aac605d3d15e41\t\nhttps://git.kernel.org/stable/c/b788ad3b2468512339c05f23692e36860264e674\n\n\u0414\u043b\u044f Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2023-53515\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u044b\u0445 \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Red Hat Inc.:\nhttps://access.redhat.com/security/cve/cve-2023-53515\n\n\n\n\u0414\u043b\u044f \u0420\u0435\u0434 \u041e\u0421: http://repo.red-soft.ru/redos/7.3c/x86_64/updates/",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "10.08.2023",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "01.09.2026",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "13.10.2025",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2025-12787",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2023-53515",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Red Hat Enterprise Linux, Debian GNU/Linux, \u0420\u0415\u0414 \u041e\u0421 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), Linux, Platform V SberLinux OS Server (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u211618785)",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "Red Hat, Inc. Red Hat Enterprise Linux 8 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 11 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 12 , \u041e\u041e\u041e \u00ab\u0420\u0435\u0434 \u0421\u043e\u0444\u0442\u00bb \u0420\u0415\u0414 \u041e\u0421 7.3 (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u21163751), Red Hat, Inc. Red Hat Enterprise Linux 9 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.4 \u0434\u043e 6.4.12 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u0434\u043e 6.5 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 4.15 \u0434\u043e 4.19.293 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.4 \u0434\u043e 5.4.255 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.10 \u0434\u043e 5.10.192 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.15 \u0434\u043e 5.15.128 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.1 \u0434\u043e 6.1.47 , \u0410\u041e \u00ab\u0421\u0431\u0435\u0440\u0422\u0435\u0445\u00bb Platform V SberLinux OS Server 9.2.0-fstec (\u0437\u0430\u043f\u0438\u0441\u044c \u0432 \u0435\u0434\u0438\u043d\u043e\u043c \u0440\u0435\u0435\u0441\u0442\u0440\u0435 \u0440\u043e\u0441\u0441\u0438\u0439\u0441\u043a\u0438\u0445 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c \u211618785)",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0439 virtio_mmio_release_dev() \u0438 virtio_mmio_probe() \u0432 \u043c\u043e\u0434\u0443\u043b\u0435 drivers/virtio/virtio_mmio.c \u043f\u043e\u0434\u0434\u0435\u0440\u0436\u043a\u0438 \u0448\u0438\u043d\u044b virtio \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u043e\u043a\u0430\u0437\u0430\u0442\u044c \u0432\u043e\u0437\u0434\u0435\u0439\u0441\u0442\u0432\u0438\u0435 \u043d\u0430 \u043a\u043e\u043d\u0444\u0438\u0434\u0435\u043d\u0446\u0438\u0430\u043b\u044c\u043d\u043e\u0441\u0442\u044c, \u0446\u0435\u043b\u043e\u0441\u0442\u043d\u043e\u0441\u0442\u044c \u0438 \u0434\u043e\u0441\u0442\u0443\u043f\u043d\u043e\u0441\u0442\u044c \u0437\u0430\u0449\u0438\u0449\u0430\u0435\u043c\u043e\u0439 \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u043f\u043e\u0441\u043b\u0435 \u043e\u0441\u0432\u043e\u0431\u043e\u0436\u0434\u0435\u043d\u0438\u044f (CWE-416), \u041e\u043f\u0435\u0440\u0430\u0446\u0438\u044f \u0441 \u0440\u0435\u0441\u0443\u0440\u0441\u043e\u043c \u043f\u043e\u0441\u043b\u0435 \u0438\u0441\u0442\u0435\u0447\u0435\u043d\u0438\u044f \u0441\u0440\u043e\u043a\u0430 \u0435\u0433\u043e \u0434\u0435\u0439\u0441\u0442\u0432\u0438\u044f \u0438\u043b\u0438 \u043e\u0441\u0432\u043e\u0431\u043e\u0436\u0434\u0435\u043d\u0438\u044f (CWE-672)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0439 virtio_mmio_release_dev() \u0438 virtio_mmio_probe() \u0432 \u043c\u043e\u0434\u0443\u043b\u0435 drivers/virtio/virtio_mmio.c \u043f\u043e\u0434\u0434\u0435\u0440\u0436\u043a\u0438 \u0448\u0438\u043d\u044b virtio \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u044f\u043c\u0438 \u0441 \u0440\u0435\u0441\u0443\u0440\u0441\u043e\u043c \u043f\u043e\u0441\u043b\u0435 \u0438\u0441\u0442\u0435\u0447\u0435\u043d\u0438\u044f \u0435\u0433\u043e \u0441\u0440\u043e\u043a\u0430 \u0434\u0435\u0439\u0441\u0442\u0432\u0438\u044f. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u043e\u043a\u0430\u0437\u0430\u0442\u044c \u0432\u043e\u0437\u0434\u0435\u0439\u0441\u0442\u0432\u0438\u0435 \u043d\u0430 \u043a\u043e\u043d\u0444\u0438\u0434\u0435\u043d\u0446\u0438\u0430\u043b\u044c\u043d\u043e\u0441\u0442\u044c, \u0446\u0435\u043b\u043e\u0441\u0442\u043d\u043e\u0441\u0442\u044c \u0438 \u0434\u043e\u0441\u0442\u0443\u043f\u043d\u043e\u0441\u0442\u044c \u0437\u0430\u0449\u0438\u0449\u0430\u0435\u043c\u043e\u0439 \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0441\u0442\u0440\u0443\u043a\u0442\u0443\u0440\u0430\u043c\u0438 \u0434\u0430\u043d\u043d\u044b\u0445, \u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u0441\u0443\u0440\u0441\u0430\u043c\u0438",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://access.redhat.com/security/cve/cve-2023-53515\nhttps://git.kernel.org/linus/55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a\nhttps://git.kernel.org/stable/c/2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e\nhttps://git.kernel.org/stable/c/3ff54d904fafabd0912796785e53cce4e69ca123\nhttps://git.kernel.org/stable/c/55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a\nhttps://git.kernel.org/stable/c/5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e\nhttps://git.kernel.org/stable/c/97a2d55ead76358245b446efd87818e919196d7a\nhttps://git.kernel.org/stable/c/af5818c35173e096085c6ae2e3aac605d3d15e41\nhttps://git.kernel.org/stable/c/b788ad3b2468512339c05f23692e36860264e674\nhttps://lore.kernel.org/linux-cve-announce/2025100131-CVE-2023-53515-abe8@gregkh/\nhttps://security-tracker.debian.org/tracker/CVE-2023-53515\nhttps://www.cve.org/CVERecord?id=CVE-2023-53515\n\nhttps://redos.red-soft.ru/support/secure/",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-416, CWE-672",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 6,8)\n\u0412\u044b\u0441\u043e\u043a\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.1 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 7,8)\n\u041d\u0435\u0442 \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u043e\u0446\u0435\u043d\u043a\u0430 CVSS 4.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 0)"
}
CERTFR-2025-AVI-0895
Vulnerability from certfr_avis - Published: 2025-10-17 - Updated: 2025-10-17
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, une atteinte à l'intégrité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 LTSS | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | Confidential Computing Module | Confidential Computing Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.2 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.2 | ||
| SUSE | Legacy Module | Legacy Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Enterprise Storage | SUSE Enterprise Storage 7.1 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | Legacy Module | Legacy Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Confidential Computing Module 15-SP6",
"product": {
"name": "Confidential Computing Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "SUSE Enterprise Storage",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2021-4460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4460"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2022-50242",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50242"
},
{
"name": "CVE-2022-50244",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50244"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2022-50253",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50253"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2022-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50265"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2022-50285",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50285"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50287"
},
{
"name": "CVE-2022-50288",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50288"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50291",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50291"
},
{
"name": "CVE-2022-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50292"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50303"
},
{
"name": "CVE-2022-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50304"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2022-50311",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50311"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2022-50323",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50323"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2022-50325",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50325"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2022-50339",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50339"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50352",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50352"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2022-50354",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50354"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2022-50356",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50356"
},
{
"name": "CVE-2022-50357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50357"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2022-50360",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50360"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2022-50365",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50365"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2022-50378",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50378"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2022-50390",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50390"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2022-50393",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50393"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2022-50396",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50396"
},
{
"name": "CVE-2022-50398",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50398"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2022-50405",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50405"
},
{
"name": "CVE-2022-50406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50406"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50412",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50412"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2022-50418",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50418"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2022-50433",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50433"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2022-50441",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50441"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2022-50447",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50447"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2022-50452",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50452"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2022-50464",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50464"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53168"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53193",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53193"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53232"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53237"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53254"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2023-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53284"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53308"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53320"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53332"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53340"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53347"
},
{
"name": "CVE-2023-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53348"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53378"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53383"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53398",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53398"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53466"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53482",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53482"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53489",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53489"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53511",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53511"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2023-53532",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53532"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2025-21692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21692"
},
{
"name": "CVE-2025-21791",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21791"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2025-21969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21969"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2025-22023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22023"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2025-38089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38089"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38477",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38477"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2022-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49975"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
}
],
"initial_release_date": "2025-10-17T00:00:00",
"last_revision_date": "2025-10-17T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0895",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-17T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03615-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503615-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03553-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503553-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03557-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503557-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03539-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503539-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03543-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503543-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03580-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503580-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03613-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503613-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03600-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503600-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03602-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503602-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03561-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503561-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03614-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503614-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03567-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503567-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03554-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503554-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03576-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503576-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03626-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503626-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03548-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503548-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03551-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503551-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03601-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503601-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03578-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503578-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03575-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503575-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03562-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503562-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03572-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503572-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03550-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503550-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03568-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503568-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03569-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503569-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03563-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503563-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03566-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503566-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03555-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503555-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03529-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503529-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03538-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503538-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03571-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503571-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03559-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503559-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03528-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503528-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03583-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503583-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03552-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503552-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03577-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503577-1"
}
]
}
CERTFR-2025-AVI-0921
Vulnerability from certfr_avis - Published: 2025-10-24 - Updated: 2025-10-24
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | Public Cloud Module | Public Cloud Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3 LTS",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3 LTS",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3 LTS",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38521",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38521"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2023-53513",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53513"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2025-21971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21971"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38110"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2025-38206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38206"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2025-38396",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38396"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-38440",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38440"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-38470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38470"
},
{
"name": "CVE-2025-38471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38471"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-38490",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38490"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
}
],
"initial_release_date": "2025-10-24T00:00:00",
"last_revision_date": "2025-10-24T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0921",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-24T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03650-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503650-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03636-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503636-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03648-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503648-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03652-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503652-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253761-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253761-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3736-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253736-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3772-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253772-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03663-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503663-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03634-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503634-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3703-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253703-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03643-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503643-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03646-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503646-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3720-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253720-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3712-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253712-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3734-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253734-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03672-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503672-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3748-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253748-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3770-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253770-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3751-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253751-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03638-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503638-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03628-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503628-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3679-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253679-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3704-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253704-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3684-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253684-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3733-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253733-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03671-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503671-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3675-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253675-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03664-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503664-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03633-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503633-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3755-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253755-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3683-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253683-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3716-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253716-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03653-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503653-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03666-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503666-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3725-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253725-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3771-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253771-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03656-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503656-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03662-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503662-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3705-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253705-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3764-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253764-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3721-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253721-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3768-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253768-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3717-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253717-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3769-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253769-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3740-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253740-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253762-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253762-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3741-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253741-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3742-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253742-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3731-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253731-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3765-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253765-1"
}
]
}
CERTFR-2025-AVI-1009
Vulnerability from certfr_avis - Published: 2025-11-14 - Updated: 2025-11-14
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Elles permettent à un attaquant de provoquer un problème de sécurité non spécifié par l'éditeur.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.1 | ||
| SUSE | Legacy Module | Legacy Module 15-SP7 | ||
| SUSE | SUSE Linux Micro | SUSE Linux Micro 6.0 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.1",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Micro 6.0",
"product": {
"name": "SUSE Linux Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-2586",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2586"
},
{
"name": "CVE-2022-3640",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3640"
},
{
"name": "CVE-2022-3619",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3619"
},
{
"name": "CVE-2022-1679",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-1679"
},
{
"name": "CVE-2022-2905",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2905"
},
{
"name": "CVE-2022-3564",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3564"
},
{
"name": "CVE-2022-4095",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4095"
},
{
"name": "CVE-2022-3903",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3903"
},
{
"name": "CVE-2022-2585",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2585"
},
{
"name": "CVE-2022-4662",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-4662"
},
{
"name": "CVE-2023-28866",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28866"
},
{
"name": "CVE-2023-1990",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1990"
},
{
"name": "CVE-2023-3111",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3111"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26804"
},
{
"name": "CVE-2024-26935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26935"
},
{
"name": "CVE-2024-26924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26924"
},
{
"name": "CVE-2024-26808",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26808"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38699"
},
{
"name": "CVE-2025-38700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38700"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39673"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39676"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39683"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39697"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39702"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39756"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39794"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39812"
},
{
"name": "CVE-2025-39813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39813"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39841",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39841"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39851"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39866"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38718"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2021-47557",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47557"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2024-27397",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27397"
},
{
"name": "CVE-2025-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38539"
},
{
"name": "CVE-2025-38653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38653"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39876"
},
{
"name": "CVE-2025-39881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39881"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39898",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39898"
},
{
"name": "CVE-2025-39902",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39902"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39911"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2021-47595",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47595"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2024-36978",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36978"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-39931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39931"
},
{
"name": "CVE-2025-39934",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39934"
},
{
"name": "CVE-2025-39937",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39937"
},
{
"name": "CVE-2025-39938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39938"
},
{
"name": "CVE-2025-39945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39945"
},
{
"name": "CVE-2025-39946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39946"
},
{
"name": "CVE-2025-39947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39947"
},
{
"name": "CVE-2025-39949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39949"
},
{
"name": "CVE-2025-39955",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39955"
},
{
"name": "CVE-2025-39957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39957"
},
{
"name": "CVE-2025-39965",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39965"
},
{
"name": "CVE-2025-39967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39967"
},
{
"name": "CVE-2025-39968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39968"
},
{
"name": "CVE-2025-39969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39969"
},
{
"name": "CVE-2025-39970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39970"
},
{
"name": "CVE-2025-39971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39971"
},
{
"name": "CVE-2025-39972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39972"
},
{
"name": "CVE-2025-39973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39973"
},
{
"name": "CVE-2025-39981",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39981"
},
{
"name": "CVE-2025-39982",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39982"
},
{
"name": "CVE-2025-39985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39985"
},
{
"name": "CVE-2025-39987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39987"
},
{
"name": "CVE-2025-39994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39994"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2025-40018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40018"
},
{
"name": "CVE-2025-40019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40019"
},
{
"name": "CVE-2025-40020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40020"
},
{
"name": "CVE-2025-40029",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40029"
},
{
"name": "CVE-2025-40032",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40032"
},
{
"name": "CVE-2025-40035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40035"
},
{
"name": "CVE-2025-40036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40036"
},
{
"name": "CVE-2025-40043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40043"
},
{
"name": "CVE-2025-40044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40044"
},
{
"name": "CVE-2025-40049",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40049"
},
{
"name": "CVE-2025-40051",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40051"
},
{
"name": "CVE-2025-40052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40052"
},
{
"name": "CVE-2025-40056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40056"
},
{
"name": "CVE-2025-40060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40060"
},
{
"name": "CVE-2025-40061",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40061"
},
{
"name": "CVE-2025-40071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40071"
},
{
"name": "CVE-2025-40078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40078"
},
{
"name": "CVE-2025-40085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40085"
},
{
"name": "CVE-2025-40087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40087"
},
{
"name": "CVE-2025-40088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40088"
},
{
"name": "CVE-2025-40096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40096"
},
{
"name": "CVE-2025-40100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40100"
},
{
"name": "CVE-2025-40104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40104"
},
{
"name": "CVE-2023-53538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53538"
},
{
"name": "CVE-2023-53539",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53539"
},
{
"name": "CVE-2023-53540",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53540"
},
{
"name": "CVE-2023-53541",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53541"
},
{
"name": "CVE-2023-53543",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53543"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2023-53546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53546"
},
{
"name": "CVE-2023-53548",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53548"
},
{
"name": "CVE-2023-53550",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53550"
},
{
"name": "CVE-2023-53552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53552"
},
{
"name": "CVE-2023-53553",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53553"
},
{
"name": "CVE-2023-53554",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53554"
},
{
"name": "CVE-2023-53555",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53555"
},
{
"name": "CVE-2023-53556",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53556"
},
{
"name": "CVE-2023-53557",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53557"
},
{
"name": "CVE-2023-53558",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53558"
},
{
"name": "CVE-2023-53559",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53559"
},
{
"name": "CVE-2023-53560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53560"
},
{
"name": "CVE-2023-53563",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53563"
},
{
"name": "CVE-2023-53568",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53568"
},
{
"name": "CVE-2023-53570",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53570"
},
{
"name": "CVE-2023-53572",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53572"
},
{
"name": "CVE-2023-53574",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53574"
},
{
"name": "CVE-2023-53575",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53575"
},
{
"name": "CVE-2023-53577",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53577"
},
{
"name": "CVE-2023-53579",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53579"
},
{
"name": "CVE-2023-53580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53580"
},
{
"name": "CVE-2023-53581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53581"
},
{
"name": "CVE-2023-53583",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53583"
},
{
"name": "CVE-2023-53585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53585"
},
{
"name": "CVE-2023-53588",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53588"
},
{
"name": "CVE-2023-53593",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53593"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2023-53597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53597"
},
{
"name": "CVE-2023-53599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53599"
},
{
"name": "CVE-2023-53600",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53600"
},
{
"name": "CVE-2023-53601",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53601"
},
{
"name": "CVE-2023-53602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53602"
},
{
"name": "CVE-2023-53603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53603"
},
{
"name": "CVE-2023-53611",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53611"
},
{
"name": "CVE-2023-53613",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53613"
},
{
"name": "CVE-2023-53615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53615"
},
{
"name": "CVE-2023-53616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53616"
},
{
"name": "CVE-2023-53617",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53617"
},
{
"name": "CVE-2023-53618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53618"
},
{
"name": "CVE-2023-53619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53619"
},
{
"name": "CVE-2023-53621",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53621"
},
{
"name": "CVE-2023-53622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53622"
},
{
"name": "CVE-2023-53631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53631"
},
{
"name": "CVE-2023-53632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53632"
},
{
"name": "CVE-2023-53633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53633"
},
{
"name": "CVE-2023-53638",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53638"
},
{
"name": "CVE-2023-53645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53645"
},
{
"name": "CVE-2023-53646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53646"
},
{
"name": "CVE-2023-53647",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53647"
},
{
"name": "CVE-2023-53648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53648"
},
{
"name": "CVE-2023-53649",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53649"
},
{
"name": "CVE-2023-53650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53650"
},
{
"name": "CVE-2023-53652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53652"
},
{
"name": "CVE-2023-53653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53653"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2023-53654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53654"
},
{
"name": "CVE-2023-53656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53656"
},
{
"name": "CVE-2023-53657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53657"
},
{
"name": "CVE-2023-53658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53658"
},
{
"name": "CVE-2023-53659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53659"
},
{
"name": "CVE-2023-53660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53660"
},
{
"name": "CVE-2023-53662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53662"
},
{
"name": "CVE-2023-53663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53663"
},
{
"name": "CVE-2023-53665",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53665"
},
{
"name": "CVE-2023-53666",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53666"
},
{
"name": "CVE-2023-53668",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53668"
},
{
"name": "CVE-2023-53670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53670"
},
{
"name": "CVE-2023-53672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53672"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2023-53674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53674"
},
{
"name": "CVE-2023-53681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53681"
},
{
"name": "CVE-2023-53686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53686"
},
{
"name": "CVE-2023-53687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53687"
},
{
"name": "CVE-2023-53693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53693"
},
{
"name": "CVE-2023-53697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53697"
},
{
"name": "CVE-2023-53698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53698"
},
{
"name": "CVE-2023-53699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53699"
},
{
"name": "CVE-2023-53703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53703"
},
{
"name": "CVE-2023-53704",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53704"
},
{
"name": "CVE-2023-53707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53707"
},
{
"name": "CVE-2023-53708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53708"
},
{
"name": "CVE-2023-53711",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53711"
},
{
"name": "CVE-2023-53713",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53713"
},
{
"name": "CVE-2023-53718",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53718"
},
{
"name": "CVE-2023-53721",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53721"
},
{
"name": "CVE-2023-53722",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53722"
},
{
"name": "CVE-2023-53725",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53725"
},
{
"name": "CVE-2023-53726",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53726"
},
{
"name": "CVE-2023-53727",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53727"
},
{
"name": "CVE-2023-53728",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53728"
},
{
"name": "CVE-2023-53729",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53729"
},
{
"name": "CVE-2023-53730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53730"
},
{
"name": "CVE-2023-53731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53731"
},
{
"name": "CVE-2023-53733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53733"
},
{
"name": "CVE-2025-39895",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39895"
},
{
"name": "CVE-2025-39900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39900"
},
{
"name": "CVE-2025-39948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39948"
},
{
"name": "CVE-2025-39952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39952"
},
{
"name": "CVE-2025-39978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39978"
},
{
"name": "CVE-2025-39984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39984"
},
{
"name": "CVE-2025-39986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39986"
},
{
"name": "CVE-2025-39988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39988"
},
{
"name": "CVE-2025-39991",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39991"
},
{
"name": "CVE-2025-39993",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39993"
},
{
"name": "CVE-2025-39995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39995"
},
{
"name": "CVE-2025-39996",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39996"
},
{
"name": "CVE-2025-39997",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39997"
},
{
"name": "CVE-2025-40000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40000"
},
{
"name": "CVE-2025-40010",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40010"
},
{
"name": "CVE-2025-40011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40011"
},
{
"name": "CVE-2025-40012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40012"
},
{
"name": "CVE-2025-40013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40013"
},
{
"name": "CVE-2025-40037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40037"
},
{
"name": "CVE-2025-40058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40058"
},
{
"name": "CVE-2025-40062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40062"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-40091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40091"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2024-53141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53141"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2024-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53197"
},
{
"name": "CVE-2024-56558",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56558"
},
{
"name": "CVE-2024-53164",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53164"
},
{
"name": "CVE-2023-52924",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52924"
},
{
"name": "CVE-2023-52925",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52925"
},
{
"name": "CVE-2025-21700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21700"
},
{
"name": "CVE-2024-56770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56770"
},
{
"name": "CVE-2025-21703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21703"
},
{
"name": "CVE-2024-57999",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57999"
},
{
"name": "CVE-2025-21756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21756"
},
{
"name": "CVE-2025-21702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21702"
},
{
"name": "CVE-2025-21999",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21999"
},
{
"name": "CVE-2025-22056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22056"
},
{
"name": "CVE-2025-37785",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37785"
},
{
"name": "CVE-2024-28956",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-28956"
},
{
"name": "CVE-2024-35840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35840"
},
{
"name": "CVE-2025-23145",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23145"
},
{
"name": "CVE-2025-37798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37798"
},
{
"name": "CVE-2025-23141",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23141"
},
{
"name": "CVE-2025-37752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37752"
},
{
"name": "CVE-2025-37789",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37789"
},
{
"name": "CVE-2025-37823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37823"
},
{
"name": "CVE-2025-37890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37890"
},
{
"name": "CVE-2025-37932",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37932"
},
{
"name": "CVE-2025-37948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37948"
},
{
"name": "CVE-2025-37953",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37953"
},
{
"name": "CVE-2025-37963",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37963"
},
{
"name": "CVE-2022-49769",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49769"
},
{
"name": "CVE-2022-49770",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49770"
},
{
"name": "CVE-2022-49771",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49771"
},
{
"name": "CVE-2022-49772",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49772"
},
{
"name": "CVE-2022-49775",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49775"
},
{
"name": "CVE-2022-49776",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49776"
},
{
"name": "CVE-2022-49777",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49777"
},
{
"name": "CVE-2022-49779",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49779"
},
{
"name": "CVE-2022-49783",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49783"
},
{
"name": "CVE-2022-49787",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49787"
},
{
"name": "CVE-2022-49788",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49788"
},
{
"name": "CVE-2022-49789",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49789"
},
{
"name": "CVE-2022-49790",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49790"
},
{
"name": "CVE-2022-49792",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49792"
},
{
"name": "CVE-2022-49793",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49793"
},
{
"name": "CVE-2022-49794",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49794"
},
{
"name": "CVE-2022-49796",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49796"
},
{
"name": "CVE-2022-49797",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49797"
},
{
"name": "CVE-2022-49799",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49799"
},
{
"name": "CVE-2022-49800",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49800"
},
{
"name": "CVE-2022-49801",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49801"
},
{
"name": "CVE-2022-49802",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49802"
},
{
"name": "CVE-2022-49807",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49807"
},
{
"name": "CVE-2022-49809",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49809"
},
{
"name": "CVE-2022-49810",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49810"
},
{
"name": "CVE-2022-49812",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49812"
},
{
"name": "CVE-2022-49813",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49813"
},
{
"name": "CVE-2022-49818",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49818"
},
{
"name": "CVE-2022-49821",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49821"
},
{
"name": "CVE-2022-49822",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49822"
},
{
"name": "CVE-2022-49823",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49823"
},
{
"name": "CVE-2022-49824",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49824"
},
{
"name": "CVE-2022-49825",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49825"
},
{
"name": "CVE-2022-49826",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49826"
},
{
"name": "CVE-2022-49827",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49827"
},
{
"name": "CVE-2022-49830",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49830"
},
{
"name": "CVE-2022-49832",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49832"
},
{
"name": "CVE-2022-49834",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49834"
},
{
"name": "CVE-2022-49835",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49835"
},
{
"name": "CVE-2022-49836",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49836"
},
{
"name": "CVE-2022-49839",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49839"
},
{
"name": "CVE-2022-49841",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49841"
},
{
"name": "CVE-2022-49842",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49842"
},
{
"name": "CVE-2022-49845",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49845"
},
{
"name": "CVE-2022-49846",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49846"
},
{
"name": "CVE-2022-49850",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49850"
},
{
"name": "CVE-2022-49853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49853"
},
{
"name": "CVE-2022-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49858"
},
{
"name": "CVE-2022-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49860"
},
{
"name": "CVE-2022-49861",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49861"
},
{
"name": "CVE-2022-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49863"
},
{
"name": "CVE-2022-49864",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49864"
},
{
"name": "CVE-2022-49865",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49865"
},
{
"name": "CVE-2022-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49868"
},
{
"name": "CVE-2022-49869",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49869"
},
{
"name": "CVE-2022-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49870"
},
{
"name": "CVE-2022-49871",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49871"
},
{
"name": "CVE-2022-49874",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49874"
},
{
"name": "CVE-2022-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49879"
},
{
"name": "CVE-2022-49880",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49880"
},
{
"name": "CVE-2022-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49881"
},
{
"name": "CVE-2022-49885",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49885"
},
{
"name": "CVE-2022-49887",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49887"
},
{
"name": "CVE-2022-49888",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49888"
},
{
"name": "CVE-2022-49889",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49889"
},
{
"name": "CVE-2022-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49890"
},
{
"name": "CVE-2022-49891",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49891"
},
{
"name": "CVE-2022-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49892"
},
{
"name": "CVE-2022-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49900"
},
{
"name": "CVE-2022-49905",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49905"
},
{
"name": "CVE-2022-49906",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49906"
},
{
"name": "CVE-2022-49908",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49908"
},
{
"name": "CVE-2022-49909",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49909"
},
{
"name": "CVE-2022-49910",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49910"
},
{
"name": "CVE-2022-49915",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49915"
},
{
"name": "CVE-2022-49916",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49916"
},
{
"name": "CVE-2022-49922",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49922"
},
{
"name": "CVE-2022-49923",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49923"
},
{
"name": "CVE-2022-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49924"
},
{
"name": "CVE-2022-49925",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49925"
},
{
"name": "CVE-2022-49927",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49927"
},
{
"name": "CVE-2022-49928",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49928"
},
{
"name": "CVE-2022-49931",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49931"
},
{
"name": "CVE-2023-53035",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53035"
},
{
"name": "CVE-2023-53038",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53038"
},
{
"name": "CVE-2023-53039",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53039"
},
{
"name": "CVE-2023-53040",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53040"
},
{
"name": "CVE-2023-53041",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53041"
},
{
"name": "CVE-2023-53044",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53044"
},
{
"name": "CVE-2023-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53045"
},
{
"name": "CVE-2023-53049",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53049"
},
{
"name": "CVE-2023-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53052"
},
{
"name": "CVE-2023-53054",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53054"
},
{
"name": "CVE-2023-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53056"
},
{
"name": "CVE-2023-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53058"
},
{
"name": "CVE-2023-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53059"
},
{
"name": "CVE-2023-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53060"
},
{
"name": "CVE-2023-53062",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53062"
},
{
"name": "CVE-2023-53064",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53064"
},
{
"name": "CVE-2023-53065",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53065"
},
{
"name": "CVE-2023-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53066"
},
{
"name": "CVE-2023-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53068"
},
{
"name": "CVE-2023-53075",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53075"
},
{
"name": "CVE-2023-53077",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53077"
},
{
"name": "CVE-2023-53078",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53078"
},
{
"name": "CVE-2023-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53079"
},
{
"name": "CVE-2023-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53081"
},
{
"name": "CVE-2023-53084",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53084"
},
{
"name": "CVE-2023-53087",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53087"
},
{
"name": "CVE-2023-53089",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53089"
},
{
"name": "CVE-2023-53090",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53090"
},
{
"name": "CVE-2023-53091",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53091"
},
{
"name": "CVE-2023-53092",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53092"
},
{
"name": "CVE-2023-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53093"
},
{
"name": "CVE-2023-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53096"
},
{
"name": "CVE-2023-53098",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53098"
},
{
"name": "CVE-2023-53099",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53099"
},
{
"name": "CVE-2023-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53100"
},
{
"name": "CVE-2023-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53101"
},
{
"name": "CVE-2023-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53106"
},
{
"name": "CVE-2023-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53108"
},
{
"name": "CVE-2023-53111",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53111"
},
{
"name": "CVE-2023-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53114"
},
{
"name": "CVE-2023-53116",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53116"
},
{
"name": "CVE-2023-53118",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53118"
},
{
"name": "CVE-2023-53119",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53119"
},
{
"name": "CVE-2023-53123",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53123"
},
{
"name": "CVE-2023-53124",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53124"
},
{
"name": "CVE-2023-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53125"
},
{
"name": "CVE-2023-53131",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53131"
},
{
"name": "CVE-2023-53134",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53134"
},
{
"name": "CVE-2023-53137",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53137"
},
{
"name": "CVE-2023-53139",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53139"
},
{
"name": "CVE-2023-53140",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53140"
},
{
"name": "CVE-2023-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53142"
},
{
"name": "CVE-2023-53143",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53143"
},
{
"name": "CVE-2023-53145",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53145"
},
{
"name": "CVE-2022-49762",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49762"
},
{
"name": "CVE-2022-49763",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49763"
},
{
"name": "CVE-2022-49773",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49773"
},
{
"name": "CVE-2022-49781",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49781"
},
{
"name": "CVE-2022-49784",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49784"
},
{
"name": "CVE-2022-49786",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49786"
},
{
"name": "CVE-2022-49795",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49795"
},
{
"name": "CVE-2022-49837",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49837"
},
{
"name": "CVE-2022-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49886"
},
{
"name": "CVE-2022-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49901"
},
{
"name": "CVE-2022-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49902"
},
{
"name": "CVE-2022-49917",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49917"
},
{
"name": "CVE-2022-49918",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49918"
},
{
"name": "CVE-2022-49921",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49921"
},
{
"name": "CVE-2022-49929",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49929"
},
{
"name": "CVE-2023-53036",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53036"
},
{
"name": "CVE-2023-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53042"
},
{
"name": "CVE-2023-53057",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53057"
},
{
"name": "CVE-2023-53070",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53070"
},
{
"name": "CVE-2023-53071",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53071"
},
{
"name": "CVE-2023-53073",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53073"
},
{
"name": "CVE-2023-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53074"
},
{
"name": "CVE-2023-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53082"
},
{
"name": "CVE-2023-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53095"
},
{
"name": "CVE-2023-53102",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53102"
},
{
"name": "CVE-2023-53105",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53105"
},
{
"name": "CVE-2023-53109",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53109"
},
{
"name": "CVE-2023-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53112"
},
{
"name": "CVE-2023-53128",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53128"
},
{
"name": "CVE-2025-37997",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37997"
},
{
"name": "CVE-2025-38000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38000"
},
{
"name": "CVE-2025-38001",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38001"
},
{
"name": "CVE-2022-49934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49934"
},
{
"name": "CVE-2022-49935",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49935"
},
{
"name": "CVE-2022-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49936"
},
{
"name": "CVE-2022-49937",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49937"
},
{
"name": "CVE-2022-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49938"
},
{
"name": "CVE-2022-49940",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49940"
},
{
"name": "CVE-2022-49942",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49942"
},
{
"name": "CVE-2022-49943",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49943"
},
{
"name": "CVE-2022-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49944"
},
{
"name": "CVE-2022-49945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49945"
},
{
"name": "CVE-2022-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49946"
},
{
"name": "CVE-2022-49948",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49948"
},
{
"name": "CVE-2022-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49949"
},
{
"name": "CVE-2022-49950",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49950"
},
{
"name": "CVE-2022-49951",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49951"
},
{
"name": "CVE-2022-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49952"
},
{
"name": "CVE-2022-49954",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49954"
},
{
"name": "CVE-2022-49956",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49956"
},
{
"name": "CVE-2022-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49957"
},
{
"name": "CVE-2022-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49958"
},
{
"name": "CVE-2022-49960",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49960"
},
{
"name": "CVE-2022-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49962"
},
{
"name": "CVE-2022-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49963"
},
{
"name": "CVE-2022-49964",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49964"
},
{
"name": "CVE-2022-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49965"
},
{
"name": "CVE-2022-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49966"
},
{
"name": "CVE-2022-49968",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49968"
},
{
"name": "CVE-2022-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49969"
},
{
"name": "CVE-2022-49971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49971"
},
{
"name": "CVE-2022-49972",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49972"
},
{
"name": "CVE-2022-49977",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49977"
},
{
"name": "CVE-2022-49978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49978"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2022-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49981"
},
{
"name": "CVE-2022-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49982"
},
{
"name": "CVE-2022-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49983"
},
{
"name": "CVE-2022-49984",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49984"
},
{
"name": "CVE-2022-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49985"
},
{
"name": "CVE-2022-49986",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49986"
},
{
"name": "CVE-2022-49987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49987"
},
{
"name": "CVE-2022-49989",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49989"
},
{
"name": "CVE-2022-49990",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49990"
},
{
"name": "CVE-2022-49993",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49993"
},
{
"name": "CVE-2022-49995",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49995"
},
{
"name": "CVE-2022-49999",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49999"
},
{
"name": "CVE-2022-50002",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50002"
},
{
"name": "CVE-2022-50003",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50003"
},
{
"name": "CVE-2022-50005",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50005"
},
{
"name": "CVE-2022-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50006"
},
{
"name": "CVE-2022-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50008"
},
{
"name": "CVE-2022-50010",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50010"
},
{
"name": "CVE-2022-50011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50011"
},
{
"name": "CVE-2022-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50012"
},
{
"name": "CVE-2022-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50015"
},
{
"name": "CVE-2022-50016",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50016"
},
{
"name": "CVE-2022-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50019"
},
{
"name": "CVE-2022-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50020"
},
{
"name": "CVE-2022-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50021"
},
{
"name": "CVE-2022-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50022"
},
{
"name": "CVE-2022-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50023"
},
{
"name": "CVE-2022-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50024"
},
{
"name": "CVE-2022-50026",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50026"
},
{
"name": "CVE-2022-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50027"
},
{
"name": "CVE-2022-50028",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50028"
},
{
"name": "CVE-2022-50029",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50029"
},
{
"name": "CVE-2022-50030",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50030"
},
{
"name": "CVE-2022-50031",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50031"
},
{
"name": "CVE-2022-50032",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50032"
},
{
"name": "CVE-2022-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50033"
},
{
"name": "CVE-2022-50034",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50034"
},
{
"name": "CVE-2022-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50035"
},
{
"name": "CVE-2022-50036",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50036"
},
{
"name": "CVE-2022-50037",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50037"
},
{
"name": "CVE-2022-50038",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50038"
},
{
"name": "CVE-2022-50039",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50039"
},
{
"name": "CVE-2022-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50040"
},
{
"name": "CVE-2022-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50041"
},
{
"name": "CVE-2022-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50044"
},
{
"name": "CVE-2022-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50045"
},
{
"name": "CVE-2022-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50046"
},
{
"name": "CVE-2022-50047",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50047"
},
{
"name": "CVE-2022-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50049"
},
{
"name": "CVE-2022-50050",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50050"
},
{
"name": "CVE-2022-50051",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50051"
},
{
"name": "CVE-2022-50052",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50052"
},
{
"name": "CVE-2022-50053",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50053"
},
{
"name": "CVE-2022-50054",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50054"
},
{
"name": "CVE-2022-50055",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50055"
},
{
"name": "CVE-2022-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50059"
},
{
"name": "CVE-2022-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50060"
},
{
"name": "CVE-2022-50061",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50061"
},
{
"name": "CVE-2022-50062",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50062"
},
{
"name": "CVE-2022-50065",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50065"
},
{
"name": "CVE-2022-50066",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50066"
},
{
"name": "CVE-2022-50067",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50067"
},
{
"name": "CVE-2022-50068",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50068"
},
{
"name": "CVE-2022-50072",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50072"
},
{
"name": "CVE-2022-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50073"
},
{
"name": "CVE-2022-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50074"
},
{
"name": "CVE-2022-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50076"
},
{
"name": "CVE-2022-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50077"
},
{
"name": "CVE-2022-50079",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50079"
},
{
"name": "CVE-2022-50083",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50083"
},
{
"name": "CVE-2022-50084",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50084"
},
{
"name": "CVE-2022-50085",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50085"
},
{
"name": "CVE-2022-50086",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50086"
},
{
"name": "CVE-2022-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50087"
},
{
"name": "CVE-2022-50092",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50092"
},
{
"name": "CVE-2022-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50093"
},
{
"name": "CVE-2022-50094",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50094"
},
{
"name": "CVE-2022-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50095"
},
{
"name": "CVE-2022-50097",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50097"
},
{
"name": "CVE-2022-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50098"
},
{
"name": "CVE-2022-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50099"
},
{
"name": "CVE-2022-50100",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50100"
},
{
"name": "CVE-2022-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50101"
},
{
"name": "CVE-2022-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50102"
},
{
"name": "CVE-2022-50103",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50103"
},
{
"name": "CVE-2022-50104",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50104"
},
{
"name": "CVE-2022-50108",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50108"
},
{
"name": "CVE-2022-50109",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50109"
},
{
"name": "CVE-2022-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50110"
},
{
"name": "CVE-2022-50111",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50111"
},
{
"name": "CVE-2022-50112",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50112"
},
{
"name": "CVE-2022-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50115"
},
{
"name": "CVE-2022-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50116"
},
{
"name": "CVE-2022-50117",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50117"
},
{
"name": "CVE-2022-50118",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50118"
},
{
"name": "CVE-2022-50120",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50120"
},
{
"name": "CVE-2022-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50121"
},
{
"name": "CVE-2022-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50124"
},
{
"name": "CVE-2022-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50125"
},
{
"name": "CVE-2022-50126",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50126"
},
{
"name": "CVE-2022-50127",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50127"
},
{
"name": "CVE-2022-50129",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50129"
},
{
"name": "CVE-2022-50131",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50131"
},
{
"name": "CVE-2022-50132",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50132"
},
{
"name": "CVE-2022-50133",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50133"
},
{
"name": "CVE-2022-50134",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50134"
},
{
"name": "CVE-2022-50135",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50135"
},
{
"name": "CVE-2022-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50136"
},
{
"name": "CVE-2022-50137",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50137"
},
{
"name": "CVE-2022-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50138"
},
{
"name": "CVE-2022-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50139"
},
{
"name": "CVE-2022-50140",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50140"
},
{
"name": "CVE-2022-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50141"
},
{
"name": "CVE-2022-50142",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50142"
},
{
"name": "CVE-2022-50143",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50143"
},
{
"name": "CVE-2022-50144",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50144"
},
{
"name": "CVE-2022-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50145"
},
{
"name": "CVE-2022-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50146"
},
{
"name": "CVE-2022-50149",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50149"
},
{
"name": "CVE-2022-50151",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50151"
},
{
"name": "CVE-2022-50152",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50152"
},
{
"name": "CVE-2022-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50153"
},
{
"name": "CVE-2022-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50154"
},
{
"name": "CVE-2022-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50155"
},
{
"name": "CVE-2022-50156",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50156"
},
{
"name": "CVE-2022-50157",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50157"
},
{
"name": "CVE-2022-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50158"
},
{
"name": "CVE-2022-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50160"
},
{
"name": "CVE-2022-50161",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50161"
},
{
"name": "CVE-2022-50162",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50162"
},
{
"name": "CVE-2022-50164",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50164"
},
{
"name": "CVE-2022-50165",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50165"
},
{
"name": "CVE-2022-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50166"
},
{
"name": "CVE-2022-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50169"
},
{
"name": "CVE-2022-50171",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50171"
},
{
"name": "CVE-2022-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50172"
},
{
"name": "CVE-2022-50173",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50173"
},
{
"name": "CVE-2022-50175",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50175"
},
{
"name": "CVE-2022-50176",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50176"
},
{
"name": "CVE-2022-50178",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50178"
},
{
"name": "CVE-2022-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50179"
},
{
"name": "CVE-2022-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50181"
},
{
"name": "CVE-2022-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50183"
},
{
"name": "CVE-2022-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50184"
},
{
"name": "CVE-2022-50185",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50185"
},
{
"name": "CVE-2022-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50186"
},
{
"name": "CVE-2022-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50187"
},
{
"name": "CVE-2022-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50188"
},
{
"name": "CVE-2022-50190",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50190"
},
{
"name": "CVE-2022-50191",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50191"
},
{
"name": "CVE-2022-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50192"
},
{
"name": "CVE-2022-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50194"
},
{
"name": "CVE-2022-50196",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50196"
},
{
"name": "CVE-2022-50197",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50197"
},
{
"name": "CVE-2022-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50198"
},
{
"name": "CVE-2022-50199",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50199"
},
{
"name": "CVE-2022-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50200"
},
{
"name": "CVE-2022-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50201"
},
{
"name": "CVE-2022-50202",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50202"
},
{
"name": "CVE-2022-50203",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50203"
},
{
"name": "CVE-2022-50204",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50204"
},
{
"name": "CVE-2022-50206",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50206"
},
{
"name": "CVE-2022-50207",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50207"
},
{
"name": "CVE-2022-50208",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50208"
},
{
"name": "CVE-2022-50209",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50209"
},
{
"name": "CVE-2022-50211",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50211"
},
{
"name": "CVE-2022-50212",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50212"
},
{
"name": "CVE-2022-50213",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50213"
},
{
"name": "CVE-2022-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50215"
},
{
"name": "CVE-2022-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50218"
},
{
"name": "CVE-2022-50220",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50220"
},
{
"name": "CVE-2022-50221",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50221"
},
{
"name": "CVE-2022-50222",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50222"
},
{
"name": "CVE-2022-50226",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50226"
},
{
"name": "CVE-2022-50228",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50228"
},
{
"name": "CVE-2022-50229",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50229"
},
{
"name": "CVE-2022-50231",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50231"
},
{
"name": "CVE-2023-53046",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53046"
},
{
"name": "CVE-2023-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53048"
},
{
"name": "CVE-2023-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53076"
},
{
"name": "CVE-2023-53097",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53097"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38060"
},
{
"name": "CVE-2025-38083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38083"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38008"
},
{
"name": "CVE-2025-38453",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38453"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
}
],
"initial_release_date": "2025-11-14T00:00:00",
"last_revision_date": "2025-11-14T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-1009",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-11-14T00:00:00.000000"
}
],
"risks": [
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Elles permettent \u00e0 un attaquant de provoquer un probl\u00e8me de s\u00e9curit\u00e9 non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-11-06",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20959-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520959-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4059-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254059-1"
},
{
"published_at": "2025-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3987-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253987-1"
},
{
"published_at": "2025-11-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4064-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254064-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20989-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520989-1"
},
{
"published_at": "2025-11-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4001-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254001-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4046-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254046-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4040-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254040-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4043-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254043-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4062-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254062-1"
},
{
"published_at": "2025-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3995-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253995-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20958-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520958-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4057-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254057-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4050-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254050-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:2264-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20252264-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20990-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520990-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4036-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254036-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:2173-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20252173-1"
},
{
"published_at": "2025-11-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4003-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254003-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4056-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254056-1"
},
{
"published_at": "2025-11-09",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4004-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254004-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20980-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520980-1"
},
{
"published_at": "2025-11-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4058-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254058-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4016-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254016-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4031-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254031-1"
},
{
"published_at": "2025-11-06",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20991-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520991-1"
},
{
"published_at": "2025-11-05",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20981-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520981-1"
},
{
"published_at": "2025-11-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4078-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254078-1"
},
{
"published_at": "2025-11-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4063-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254063-1"
},
{
"published_at": "2025-11-06",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:20960-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202520960-1"
},
{
"published_at": "2025-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4000-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254000-1"
},
{
"published_at": "2025-11-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4024-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254024-1"
},
{
"published_at": "2025-11-07",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3998-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253998-1"
}
]
}
CERTFR-2025-AVI-1032
Vulnerability from certfr_avis - Published: 2025-11-21 - Updated: 2025-11-21
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire à distance, une élévation de privilèges et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | N/A | Public Cloud Module 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | Basesystem Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | Legacy Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 LTS | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Manager Server 4.3 LTS | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 LTS | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | Development Tools Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP7 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3 LTS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38552",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38552"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38699",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38699"
},
{
"name": "CVE-2025-38700",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38700"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39673",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39673"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39676"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39683"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39697"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39702"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39756",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39756"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39794",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39794"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39812",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39812"
},
{
"name": "CVE-2025-39813",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39813"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39841",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39841"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39851",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39851"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39866",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39866"
},
{
"name": "CVE-2025-38718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38718"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2022-50327",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50327"
},
{
"name": "CVE-2025-38539",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38539"
},
{
"name": "CVE-2025-38653",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38653"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39876",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39876"
},
{
"name": "CVE-2025-39881",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39881"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39902",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39902"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39911",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39911"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2025-39931",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39931"
},
{
"name": "CVE-2025-39934",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39934"
},
{
"name": "CVE-2025-39937",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39937"
},
{
"name": "CVE-2025-39938",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39938"
},
{
"name": "CVE-2025-39945",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39945"
},
{
"name": "CVE-2025-39946",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39946"
},
{
"name": "CVE-2025-39947",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39947"
},
{
"name": "CVE-2025-39949",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39949"
},
{
"name": "CVE-2025-39955",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39955"
},
{
"name": "CVE-2025-39957",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39957"
},
{
"name": "CVE-2025-39965",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39965"
},
{
"name": "CVE-2025-39967",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39967"
},
{
"name": "CVE-2025-39968",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39968"
},
{
"name": "CVE-2025-39969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39969"
},
{
"name": "CVE-2025-39970",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39970"
},
{
"name": "CVE-2025-39971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39971"
},
{
"name": "CVE-2025-39972",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39972"
},
{
"name": "CVE-2025-39973",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39973"
},
{
"name": "CVE-2025-39981",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39981"
},
{
"name": "CVE-2025-39982",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39982"
},
{
"name": "CVE-2025-39985",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39985"
},
{
"name": "CVE-2025-39987",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39987"
},
{
"name": "CVE-2025-39994",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39994"
},
{
"name": "CVE-2025-40005",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40005"
},
{
"name": "CVE-2025-40016",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40016"
},
{
"name": "CVE-2025-40018",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40018"
},
{
"name": "CVE-2025-40019",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40019"
},
{
"name": "CVE-2025-40020",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40020"
},
{
"name": "CVE-2025-40029",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40029"
},
{
"name": "CVE-2025-40032",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40032"
},
{
"name": "CVE-2025-40035",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40035"
},
{
"name": "CVE-2025-40036",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40036"
},
{
"name": "CVE-2025-40043",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40043"
},
{
"name": "CVE-2025-40044",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40044"
},
{
"name": "CVE-2025-40049",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40049"
},
{
"name": "CVE-2025-40051",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40051"
},
{
"name": "CVE-2025-40052",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40052"
},
{
"name": "CVE-2025-40056",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40056"
},
{
"name": "CVE-2025-40060",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40060"
},
{
"name": "CVE-2025-40061",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40061"
},
{
"name": "CVE-2025-40071",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40071"
},
{
"name": "CVE-2025-40078",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40078"
},
{
"name": "CVE-2025-40080",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40080"
},
{
"name": "CVE-2025-40085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40085"
},
{
"name": "CVE-2025-40087",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40087"
},
{
"name": "CVE-2025-40088",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40088"
},
{
"name": "CVE-2025-40096",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40096"
},
{
"name": "CVE-2025-40100",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40100"
},
{
"name": "CVE-2025-40102",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40102"
},
{
"name": "CVE-2025-40104",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40104"
},
{
"name": "CVE-2023-53538",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53538"
},
{
"name": "CVE-2023-53539",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53539"
},
{
"name": "CVE-2023-53540",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53540"
},
{
"name": "CVE-2023-53541",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53541"
},
{
"name": "CVE-2023-53543",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53543"
},
{
"name": "CVE-2023-53545",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53545"
},
{
"name": "CVE-2023-53546",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53546"
},
{
"name": "CVE-2023-53548",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53548"
},
{
"name": "CVE-2023-53550",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53550"
},
{
"name": "CVE-2023-53552",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53552"
},
{
"name": "CVE-2023-53553",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53553"
},
{
"name": "CVE-2023-53554",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53554"
},
{
"name": "CVE-2023-53555",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53555"
},
{
"name": "CVE-2023-53556",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53556"
},
{
"name": "CVE-2023-53557",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53557"
},
{
"name": "CVE-2023-53558",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53558"
},
{
"name": "CVE-2023-53559",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53559"
},
{
"name": "CVE-2023-53560",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53560"
},
{
"name": "CVE-2023-53563",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53563"
},
{
"name": "CVE-2023-53568",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53568"
},
{
"name": "CVE-2023-53570",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53570"
},
{
"name": "CVE-2023-53572",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53572"
},
{
"name": "CVE-2023-53574",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53574"
},
{
"name": "CVE-2023-53575",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53575"
},
{
"name": "CVE-2023-53577",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53577"
},
{
"name": "CVE-2023-53579",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53579"
},
{
"name": "CVE-2023-53580",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53580"
},
{
"name": "CVE-2023-53581",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53581"
},
{
"name": "CVE-2023-53583",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53583"
},
{
"name": "CVE-2023-53585",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53585"
},
{
"name": "CVE-2023-53588",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53588"
},
{
"name": "CVE-2023-53593",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53593"
},
{
"name": "CVE-2023-53596",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53596"
},
{
"name": "CVE-2023-53597",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53597"
},
{
"name": "CVE-2023-53599",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53599"
},
{
"name": "CVE-2023-53600",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53600"
},
{
"name": "CVE-2023-53601",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53601"
},
{
"name": "CVE-2023-53602",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53602"
},
{
"name": "CVE-2023-53603",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53603"
},
{
"name": "CVE-2023-53611",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53611"
},
{
"name": "CVE-2023-53613",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53613"
},
{
"name": "CVE-2023-53615",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53615"
},
{
"name": "CVE-2023-53616",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53616"
},
{
"name": "CVE-2023-53617",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53617"
},
{
"name": "CVE-2023-53618",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53618"
},
{
"name": "CVE-2023-53619",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53619"
},
{
"name": "CVE-2023-53621",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53621"
},
{
"name": "CVE-2023-53622",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53622"
},
{
"name": "CVE-2023-53631",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53631"
},
{
"name": "CVE-2023-53632",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53632"
},
{
"name": "CVE-2023-53633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53633"
},
{
"name": "CVE-2023-53638",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53638"
},
{
"name": "CVE-2023-53645",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53645"
},
{
"name": "CVE-2023-53646",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53646"
},
{
"name": "CVE-2023-53647",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53647"
},
{
"name": "CVE-2023-53648",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53648"
},
{
"name": "CVE-2023-53649",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53649"
},
{
"name": "CVE-2023-53650",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53650"
},
{
"name": "CVE-2023-53652",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53652"
},
{
"name": "CVE-2023-53653",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53653"
},
{
"name": "CVE-2023-53637",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53637"
},
{
"name": "CVE-2024-45016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45016"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2023-53654",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53654"
},
{
"name": "CVE-2023-53656",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53656"
},
{
"name": "CVE-2023-53657",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53657"
},
{
"name": "CVE-2023-53658",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53658"
},
{
"name": "CVE-2023-53659",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53659"
},
{
"name": "CVE-2023-53660",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53660"
},
{
"name": "CVE-2023-53662",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53662"
},
{
"name": "CVE-2023-53663",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53663"
},
{
"name": "CVE-2023-53665",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53665"
},
{
"name": "CVE-2023-53666",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53666"
},
{
"name": "CVE-2023-53668",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53668"
},
{
"name": "CVE-2023-53670",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53670"
},
{
"name": "CVE-2023-53672",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53672"
},
{
"name": "CVE-2023-53673",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53673"
},
{
"name": "CVE-2023-53674",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53674"
},
{
"name": "CVE-2023-53681",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53681"
},
{
"name": "CVE-2023-53686",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53686"
},
{
"name": "CVE-2023-53687",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53687"
},
{
"name": "CVE-2023-53693",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53693"
},
{
"name": "CVE-2023-53697",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53697"
},
{
"name": "CVE-2023-53698",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53698"
},
{
"name": "CVE-2023-53699",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53699"
},
{
"name": "CVE-2023-53703",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53703"
},
{
"name": "CVE-2023-53704",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53704"
},
{
"name": "CVE-2023-53707",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53707"
},
{
"name": "CVE-2023-53708",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53708"
},
{
"name": "CVE-2023-53711",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53711"
},
{
"name": "CVE-2023-53713",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53713"
},
{
"name": "CVE-2023-53718",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53718"
},
{
"name": "CVE-2023-53721",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53721"
},
{
"name": "CVE-2023-53722",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53722"
},
{
"name": "CVE-2023-53725",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53725"
},
{
"name": "CVE-2023-53726",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53726"
},
{
"name": "CVE-2023-53727",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53727"
},
{
"name": "CVE-2023-53728",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53728"
},
{
"name": "CVE-2023-53729",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53729"
},
{
"name": "CVE-2023-53730",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53730"
},
{
"name": "CVE-2023-53731",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53731"
},
{
"name": "CVE-2023-53733",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53733"
},
{
"name": "CVE-2025-39895",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39895"
},
{
"name": "CVE-2025-39900",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39900"
},
{
"name": "CVE-2025-39948",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39948"
},
{
"name": "CVE-2025-39952",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39952"
},
{
"name": "CVE-2025-39978",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39978"
},
{
"name": "CVE-2025-39984",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39984"
},
{
"name": "CVE-2025-39986",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39986"
},
{
"name": "CVE-2025-39988",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39988"
},
{
"name": "CVE-2025-39991",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39991"
},
{
"name": "CVE-2025-39993",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39993"
},
{
"name": "CVE-2025-39995",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39995"
},
{
"name": "CVE-2025-39996",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39996"
},
{
"name": "CVE-2025-39997",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39997"
},
{
"name": "CVE-2025-40000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40000"
},
{
"name": "CVE-2025-40010",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40010"
},
{
"name": "CVE-2025-40011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40011"
},
{
"name": "CVE-2025-40012",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40012"
},
{
"name": "CVE-2025-40013",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40013"
},
{
"name": "CVE-2025-40037",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40037"
},
{
"name": "CVE-2025-40058",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40058"
},
{
"name": "CVE-2025-40062",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40062"
},
{
"name": "CVE-2025-40082",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40082"
},
{
"name": "CVE-2025-40091",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40091"
},
{
"name": "CVE-2022-50334",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50334"
},
{
"name": "CVE-2022-50470",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50470"
},
{
"name": "CVE-2022-50471",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50471"
},
{
"name": "CVE-2022-50472",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50472"
},
{
"name": "CVE-2022-50475",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50475"
},
{
"name": "CVE-2022-50478",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50478"
},
{
"name": "CVE-2022-50479",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50479"
},
{
"name": "CVE-2022-50480",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50480"
},
{
"name": "CVE-2022-50482",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50482"
},
{
"name": "CVE-2022-50484",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50484"
},
{
"name": "CVE-2022-50485",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50485"
},
{
"name": "CVE-2022-50487",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50487"
},
{
"name": "CVE-2022-50488",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50488"
},
{
"name": "CVE-2022-50489",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50489"
},
{
"name": "CVE-2022-50490",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50490"
},
{
"name": "CVE-2022-50492",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50492"
},
{
"name": "CVE-2022-50493",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50493"
},
{
"name": "CVE-2022-50494",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50494"
},
{
"name": "CVE-2022-50496",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50496"
},
{
"name": "CVE-2022-50497",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50497"
},
{
"name": "CVE-2022-50498",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50498"
},
{
"name": "CVE-2022-50499",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50499"
},
{
"name": "CVE-2022-50501",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50501"
},
{
"name": "CVE-2022-50503",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50503"
},
{
"name": "CVE-2022-50504",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50504"
},
{
"name": "CVE-2022-50505",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50505"
},
{
"name": "CVE-2022-50509",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50509"
},
{
"name": "CVE-2022-50511",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50511"
},
{
"name": "CVE-2022-50512",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50512"
},
{
"name": "CVE-2022-50513",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50513"
},
{
"name": "CVE-2022-50514",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50514"
},
{
"name": "CVE-2022-50515",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50515"
},
{
"name": "CVE-2022-50516",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50516"
},
{
"name": "CVE-2022-50519",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50519"
},
{
"name": "CVE-2022-50520",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50520"
},
{
"name": "CVE-2022-50521",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50521"
},
{
"name": "CVE-2022-50523",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50523"
},
{
"name": "CVE-2022-50524",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50524"
},
{
"name": "CVE-2022-50525",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50525"
},
{
"name": "CVE-2022-50526",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50526"
},
{
"name": "CVE-2022-50527",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50527"
},
{
"name": "CVE-2022-50528",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50528"
},
{
"name": "CVE-2022-50529",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50529"
},
{
"name": "CVE-2022-50530",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50530"
},
{
"name": "CVE-2022-50532",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50532"
},
{
"name": "CVE-2022-50534",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50534"
},
{
"name": "CVE-2022-50535",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50535"
},
{
"name": "CVE-2022-50537",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50537"
},
{
"name": "CVE-2022-50541",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50541"
},
{
"name": "CVE-2022-50542",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50542"
},
{
"name": "CVE-2022-50543",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50543"
},
{
"name": "CVE-2022-50544",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50544"
},
{
"name": "CVE-2022-50545",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50545"
},
{
"name": "CVE-2022-50546",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50546"
},
{
"name": "CVE-2022-50549",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50549"
},
{
"name": "CVE-2022-50551",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50551"
},
{
"name": "CVE-2022-50553",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50553"
},
{
"name": "CVE-2022-50556",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50556"
},
{
"name": "CVE-2022-50559",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50559"
},
{
"name": "CVE-2022-50560",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50560"
},
{
"name": "CVE-2022-50561",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50561"
},
{
"name": "CVE-2022-50562",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50562"
},
{
"name": "CVE-2022-50563",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50563"
},
{
"name": "CVE-2022-50564",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50564"
},
{
"name": "CVE-2022-50566",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50566"
},
{
"name": "CVE-2022-50567",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50567"
},
{
"name": "CVE-2022-50568",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50568"
},
{
"name": "CVE-2022-50570",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50570"
},
{
"name": "CVE-2022-50572",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50572"
},
{
"name": "CVE-2022-50574",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50574"
},
{
"name": "CVE-2022-50575",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50575"
},
{
"name": "CVE-2022-50576",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50576"
},
{
"name": "CVE-2022-50577",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50577"
},
{
"name": "CVE-2022-50578",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50578"
},
{
"name": "CVE-2022-50579",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50579"
},
{
"name": "CVE-2022-50580",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50580"
},
{
"name": "CVE-2022-50581",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50581"
},
{
"name": "CVE-2022-50582",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50582"
},
{
"name": "CVE-2023-53533",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53533"
},
{
"name": "CVE-2023-53534",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53534"
},
{
"name": "CVE-2023-53542",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53542"
},
{
"name": "CVE-2023-53547",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53547"
},
{
"name": "CVE-2023-53551",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53551"
},
{
"name": "CVE-2023-53562",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53562"
},
{
"name": "CVE-2023-53564",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53564"
},
{
"name": "CVE-2023-53566",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53566"
},
{
"name": "CVE-2023-53567",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53567"
},
{
"name": "CVE-2023-53571",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53571"
},
{
"name": "CVE-2023-53576",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53576"
},
{
"name": "CVE-2023-53578",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53578"
},
{
"name": "CVE-2023-53582",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53582"
},
{
"name": "CVE-2023-53587",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53587"
},
{
"name": "CVE-2023-53589",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53589"
},
{
"name": "CVE-2023-53591",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53591"
},
{
"name": "CVE-2023-53592",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53592"
},
{
"name": "CVE-2023-53594",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53594"
},
{
"name": "CVE-2023-53598",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53598"
},
{
"name": "CVE-2023-53604",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53604"
},
{
"name": "CVE-2023-53605",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53605"
},
{
"name": "CVE-2023-53607",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53607"
},
{
"name": "CVE-2023-53608",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53608"
},
{
"name": "CVE-2023-53612",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53612"
},
{
"name": "CVE-2023-53625",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53625"
},
{
"name": "CVE-2023-53626",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53626"
},
{
"name": "CVE-2023-53639",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53639"
},
{
"name": "CVE-2023-53640",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53640"
},
{
"name": "CVE-2023-53641",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53641"
},
{
"name": "CVE-2023-53644",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53644"
},
{
"name": "CVE-2023-53651",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53651"
},
{
"name": "CVE-2023-53667",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53667"
},
{
"name": "CVE-2023-53675",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53675"
},
{
"name": "CVE-2023-53679",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53679"
},
{
"name": "CVE-2023-53680",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53680"
},
{
"name": "CVE-2023-53683",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53683"
},
{
"name": "CVE-2023-53692",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53692"
},
{
"name": "CVE-2023-53695",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53695"
},
{
"name": "CVE-2023-53696",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53696"
},
{
"name": "CVE-2023-53700",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53700"
},
{
"name": "CVE-2023-53705",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53705"
},
{
"name": "CVE-2023-53709",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53709"
},
{
"name": "CVE-2023-53715",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53715"
},
{
"name": "CVE-2023-53716",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53716"
},
{
"name": "CVE-2023-53717",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53717"
},
{
"name": "CVE-2023-53719",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53719"
},
{
"name": "CVE-2023-53723",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53723"
},
{
"name": "CVE-2023-53724",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53724"
},
{
"name": "CVE-2023-7324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-7324"
},
{
"name": "CVE-2022-48956",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48956"
},
{
"name": "CVE-2022-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49014"
},
{
"name": "CVE-2024-47674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47674"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50115"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-8805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-8805"
},
{
"name": "CVE-2024-53146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53146"
},
{
"name": "CVE-2024-53156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53156"
},
{
"name": "CVE-2024-53173",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53173"
},
{
"name": "CVE-2024-53214",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53214"
},
{
"name": "CVE-2024-56605",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56605"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2024-56664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56664"
},
{
"name": "CVE-2024-57893",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57893"
},
{
"name": "CVE-2024-56600",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56600"
},
{
"name": "CVE-2024-56601",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56601"
},
{
"name": "CVE-2024-56650",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-56650"
},
{
"name": "CVE-2022-49080",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49080"
},
{
"name": "CVE-2022-49179",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49179"
},
{
"name": "CVE-2022-49545",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49545"
},
{
"name": "CVE-2022-49563",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49563"
},
{
"name": "CVE-2022-49564",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49564"
},
{
"name": "CVE-2024-57996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-57996"
},
{
"name": "CVE-2025-21772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21772"
},
{
"name": "CVE-2025-21791",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21791"
},
{
"name": "CVE-2022-49053",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49053"
},
{
"name": "CVE-2022-49465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49465"
},
{
"name": "CVE-2025-21702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21702"
},
{
"name": "CVE-2025-21971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21971"
},
{
"name": "CVE-2025-37752",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37752"
},
{
"name": "CVE-2025-37797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37797"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-38000",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38000"
},
{
"name": "CVE-2025-38079",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38079"
},
{
"name": "CVE-2025-38083",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38083"
},
{
"name": "CVE-2025-38177",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38177"
},
{
"name": "CVE-2025-38181",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38181"
},
{
"name": "CVE-2025-38212",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38212"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2025-38477",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38477"
},
{
"name": "CVE-2025-38494",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38494"
},
{
"name": "CVE-2025-38495",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38495"
},
{
"name": "CVE-2025-38498",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38498"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38008",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38008"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
}
],
"initial_release_date": "2025-11-21T00:00:00",
"last_revision_date": "2025-11-21T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-1032",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-11-21T00:00:00.000000"
}
],
"risks": [
{
"description": "Ex\u00e9cution de code arbitraire \u00e0 distance"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire \u00e0 distance, une \u00e9l\u00e9vation de privil\u00e8ges et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-11-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4128-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254128-1"
},
{
"published_at": "2025-11-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4123-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254123-1"
},
{
"published_at": "2025-11-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4140-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254140-1"
},
{
"published_at": "2025-11-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4141-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254141-1"
},
{
"published_at": "2025-11-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4139-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254139-1"
},
{
"published_at": "2025-11-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4135-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254135-1"
},
{
"published_at": "2025-11-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4111-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254111-1"
},
{
"published_at": "2025-11-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4149-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254149-1"
},
{
"published_at": "2025-11-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:4132-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20254132-1"
}
]
}
FKIE_CVE-2023-53515
Vulnerability from fkie_nvd - Published: 2025-10-01 12:15 - Updated: 2026-06-17 06:45| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/3ff54d904fafabd0912796785e53cce4e69ca123 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/97a2d55ead76358245b446efd87818e919196d7a | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/af5818c35173e096085c6ae2e3aac605d3d15e41 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/b788ad3b2468512339c05f23692e36860264e674 | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 4.15 | |
| linux | linux_kernel | 4.15 | |
| linux | linux_kernel | 4.15 | |
| linux | linux_kernel | 4.15 | |
| linux | linux_kernel | 4.15 | |
| linux | linux_kernel | 4.15 | |
| linux | linux_kernel | 4.15 | |
| linux | linux_kernel | 4.15 | |
| linux | linux_kernel | 6.5 | |
| linux | linux_kernel | 6.5 | |
| linux | linux_kernel | 6.5 | |
| linux | linux_kernel | 6.5 | |
| linux | linux_kernel | 6.5 | |
| linux | linux_kernel | 6.5 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"drivers/virtio/virtio_mmio.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "97a2d55ead76358245b446efd87818e919196d7a",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "b788ad3b2468512339c05f23692e36860264e674",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "3ff54d904fafabd0912796785e53cce4e69ca123",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "af5818c35173e096085c6ae2e3aac605d3d15e41",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
},
{
"lessThan": "55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a",
"status": "affected",
"version": "7eb781b1bbb7136fe78fb8c28c1c223c61fa32b5",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"drivers/virtio/virtio_mmio.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.15"
},
{
"lessThan": "4.15",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.293",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.255",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.192",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.128",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.47",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.4.*",
"status": "unaffected",
"version": "6.4.12",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.5",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "ED6316DD-6C72-425B-A7D4-EA2D57F6124C",
"versionEndExcluding": "4.19.293",
"versionStartIncluding": "4.15.1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1379E40A-2AC3-484E-929A-7F46B6C3B521",
"versionEndExcluding": "5.4.255",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9396FFDC-6A0D-44B7-9368-21B456F6D4AE",
"versionEndExcluding": "5.10.192",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "1415629F-F97B-4880-BA1E-AF3DBB8EF305",
"versionEndExcluding": "5.15.128",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "2EEA01B0-0151-4E0F-B140-1A441EEDD717",
"versionEndExcluding": "6.1.47",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "CF8ECF64-40AE-49AB-8315-4D83F9F56ECF",
"versionEndExcluding": "6.4.12",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:-:*:*:*:*:*:*",
"matchCriteriaId": "3B4D39AF-668B-442B-8085-639A6D4FA5AC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc3:*:*:*:*:*:*",
"matchCriteriaId": "14E8986E-B317-40EA-B0B5-5D2922D2AF5B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc4:*:*:*:*:*:*",
"matchCriteriaId": "EBC4657A-0239-47DF-B582-87D8DFA69439",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc5:*:*:*:*:*:*",
"matchCriteriaId": "0E1F48A9-9185-4554-9265-22CEC01D18FD",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc6:*:*:*:*:*:*",
"matchCriteriaId": "639D2465-65E0-40E2-B7A8-BEA9E221DE54",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc7:*:*:*:*:*:*",
"matchCriteriaId": "A282AD0B-2D63-4F05-8F89-109A0975B423",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc8:*:*:*:*:*:*",
"matchCriteriaId": "30358221-183C-4699-994E-AF51F5D534FC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:4.15:rc9:*:*:*:*:*:*",
"matchCriteriaId": "A5ED80A8-E656-4AE9-921B-C22402C94A4C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc1:*:*:*:*:*:*",
"matchCriteriaId": "0B3E6E4D-E24E-4630-B00C-8C9901C597B0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc2:*:*:*:*:*:*",
"matchCriteriaId": "E4A01A71-0F09-4DB2-A02F-7EFFBE27C98D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc3:*:*:*:*:*:*",
"matchCriteriaId": "F5608371-157A-4318-8A2E-4104C3467EA1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc4:*:*:*:*:*:*",
"matchCriteriaId": "2226A776-DF8C-49E0-A030-0A7853BB018A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc5:*:*:*:*:*:*",
"matchCriteriaId": "6F15C659-DF06-455A-9765-0E6DE920F29A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.5:rc6:*:*:*:*:*:*",
"matchCriteriaId": "5B1C14ED-ABC4-41D3-8D9C-D38C6A65B4DE",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\nvirtio-mmio: don\u0027t break lifecycle of vm_dev\n\nvm_dev has a separate lifecycle because it has a \u0027struct device\u0027\nembedded. Thus, having a release callback for it is correct.\n\nAllocating the vm_dev struct with devres totally breaks this protection,\nthough. Instead of waiting for the vm_dev release callback, the memory\nis freed when the platform_device is removed. Resulting in a\nuse-after-free when finally the callback is to be called.\n\nTo easily see the problem, compile the kernel with\nCONFIG_DEBUG_KOBJECT_RELEASE and unbind with sysfs.\n\nThe fix is easy, don\u0027t use devres in this case.\n\nFound during my research about object lifetime problems."
}
],
"id": "CVE-2023-53515",
"lastModified": "2026-06-17T06:45:30.660",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 5.9,
"source": "nvd@nist.gov",
"type": "Primary"
}
]
},
"published": "2025-10-01T12:15:55.583",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3ff54d904fafabd0912796785e53cce4e69ca123"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/97a2d55ead76358245b446efd87818e919196d7a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/af5818c35173e096085c6ae2e3aac605d3d15e41"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/b788ad3b2468512339c05f23692e36860264e674"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Analyzed",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-416"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-H7XX-83RF-FCJ5
Vulnerability from github – Published: 2025-10-01 12:30 – Updated: 2026-01-26 21:30In the Linux kernel, the following vulnerability has been resolved:
virtio-mmio: don't break lifecycle of vm_dev
vm_dev has a separate lifecycle because it has a 'struct device' embedded. Thus, having a release callback for it is correct.
Allocating the vm_dev struct with devres totally breaks this protection, though. Instead of waiting for the vm_dev release callback, the memory is freed when the platform_device is removed. Resulting in a use-after-free when finally the callback is to be called.
To easily see the problem, compile the kernel with CONFIG_DEBUG_KOBJECT_RELEASE and unbind with sysfs.
The fix is easy, don't use devres in this case.
Found during my research about object lifetime problems.
{
"affected": [],
"aliases": [
"CVE-2023-53515"
],
"database_specific": {
"cwe_ids": [
"CWE-416"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2025-10-01T12:15:55Z",
"severity": "HIGH"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\nvirtio-mmio: don\u0027t break lifecycle of vm_dev\n\nvm_dev has a separate lifecycle because it has a \u0027struct device\u0027\nembedded. Thus, having a release callback for it is correct.\n\nAllocating the vm_dev struct with devres totally breaks this protection,\nthough. Instead of waiting for the vm_dev release callback, the memory\nis freed when the platform_device is removed. Resulting in a\nuse-after-free when finally the callback is to be called.\n\nTo easily see the problem, compile the kernel with\nCONFIG_DEBUG_KOBJECT_RELEASE and unbind with sysfs.\n\nThe fix is easy, don\u0027t use devres in this case.\n\nFound during my research about object lifetime problems.",
"id": "GHSA-h7xx-83rf-fcj5",
"modified": "2026-01-26T21:30:30Z",
"published": "2025-10-01T12:30:31Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53515"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2dcb368fe5a8eee498ca75c93a18ce2f3b0d6a8e"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3ff54d904fafabd0912796785e53cce4e69ca123"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/55c91fedd03d7b9cf0c5199b2eb12b9b8e95281a"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/5b7d5c2dd664eb8b9a06ecbc06e28d39359c422e"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/97a2d55ead76358245b446efd87818e919196d7a"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/af5818c35173e096085c6ae2e3aac605d3d15e41"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/b788ad3b2468512339c05f23692e36860264e674"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2025-2469 (CVE-2022-50410)
Vulnerability from osv_openeuler – Published: 2025-10-17 11:09 – Updated: 2026-08-06 11:09 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
NFSD: Protect against send buffer overflow in NFSv2 READ
Since before the git era, NFSD has conserved the number of pages held by each nfsd thread by combining the RPC receive and send buffers into a single array of pages. This works because there are no cases where an operation needs a large RPC Call message and a large RPC Reply at the same time.
Once an RPC Call has been received, svc_process() updates svc_rqst::rq_res to describe the part of rq_pages that can be used for constructing the Reply. This means that the send buffer (rq_res) shrinks when the received RPC record containing the RPC Call is large.
A client can force this shrinkage on TCP by sending a correctly- formed RPC Call header contained in an RPC record that is excessively large. The full maximum payload size cannot be constructed in that case.(CVE-2022-50410)
In the Linux kernel, the following vulnerability has been resolved:
media: az6007: Fix null-ptr-deref in az6007_i2c_xfer()
In az6007_i2c_xfer, msg is controlled by user. When msg[i].buf is null and msg[i].len is zero, former checks on msg[i].buf would be passed. Malicious data finally reach az6007_i2c_xfer. If accessing msg[i].buf[0] without sanity check, null ptr deref would happen. We add check on msg[i].len to prevent crash.
Similar commit: commit 0ed554fd769a ("media: dvb-usb: az6027: fix null-ptr-deref in az6027_i2c_xfer()")(CVE-2023-53220)
In the Linux kernel, the following vulnerability has been resolved:
kobject: Add sanity check for kset->kobj.ktype in kset_register()
When I register a kset in the following way: static struct kset my_kset; kobject_set_name(&my_kset.kobj, "my_kset"); ret = kset_register(&my_kset);
A null pointer dereference exception is occurred: [ 4453.568337] Unable to handle kernel NULL pointer dereference at \ virtual address 0000000000000028 ... ... [ 4453.810361] Call trace: [ 4453.813062] kobject_get_ownership+0xc/0x34 [ 4453.817493] kobject_add_internal+0x98/0x274 [ 4453.822005] kset_register+0x5c/0xb4 [ 4453.825820] my_kobj_init+0x44/0x1000 [my_kset] ... ...
Because I didn't initialize my_kset.kobj.ktype.
According to the description in Documentation/core-api/kobject.rst: - A ktype is the type of object that embeds a kobject. Every structure that embeds a kobject needs a corresponding ktype.
So add sanity check to make sure kset->kobj.ktype is not NULL.(CVE-2023-53480)
In the Linux kernel, the following vulnerability has been resolved:
virtio-mmio: don't break lifecycle of vm_dev
vm_dev has a separate lifecycle because it has a 'struct device' embedded. Thus, having a release callback for it is correct.
Allocating the vm_dev struct with devres totally breaks this protection, though. Instead of waiting for the vm_dev release callback, the memory is freed when the platform_device is removed. Resulting in a use-after-free when finally the callback is to be called.
To easily see the problem, compile the kernel with CONFIG_DEBUG_KOBJECT_RELEASE and unbind with sysfs.
The fix is easy, don't use devres in this case.
Found during my research about object lifetime problems.(CVE-2023-53515)
In the Linux kernel, the following vulnerability has been resolved:
net: usbnet: Fix WARNING in usbnet_start_xmit/usb_submit_urb
The syzbot fuzzer identified a problem in the usbnet driver:
usb 1-1: BOGUS urb xfer, pipe 3 != type 1 WARNING: CPU: 0 PID: 754 at drivers/usb/core/urb.c:504 usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504 Modules linked in: CPU: 0 PID: 754 Comm: kworker/0:2 Not tainted 6.4.0-rc7-syzkaller-00014-g692b7dc87ca6 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 05/27/2023 Workqueue: mld mld_ifc_work RIP: 0010:usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504 Code: 7c 24 18 e8 2c b4 5b fb 48 8b 7c 24 18 e8 42 07 f0 fe 41 89 d8 44 89 e1 4c 89 ea 48 89 c6 48 c7 c7 a0 c9 fc 8a e8 5a 6f 23 fb <0f> 0b e9 58 f8 ff ff e8 fe b3 5b fb 48 81 c5 c0 05 00 00 e9 84 f7 RSP: 0018:ffffc9000463f568 EFLAGS: 00010086 RAX: 0000000000000000 RBX: 0000000000000001 RCX: 0000000000000000 RDX: ffff88801eb28000 RSI: ffffffff814c03b7 RDI: 0000000000000001 RBP: ffff8881443b7190 R08: 0000000000000001 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000001 R12: 0000000000000003 R13: ffff88802a77cb18 R14: 0000000000000003 R15: ffff888018262500 FS: 0000000000000000(0000) GS:ffff8880b9800000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000556a99c15a18 CR3: 0000000028c71000 CR4: 0000000000350ef0 Call Trace: <TASK> usbnet_start_xmit+0xfe5/0x2190 drivers/net/usb/usbnet.c:1453 __netdev_start_xmit include/linux/netdevice.h:4918 [inline] netdev_start_xmit include/linux/netdevice.h:4932 [inline] xmit_one net/core/dev.c:3578 [inline] dev_hard_start_xmit+0x187/0x700 net/core/dev.c:3594 ...
This bug is caused by the fact that usbnet trusts the bulk endpoint addresses its probe routine receives in the driver_info structure, and it does not check to see that these endpoints actually exist and have the expected type and directions.
The fix is simply to add such a check.(CVE-2023-53548)
In the Linux kernel, the following vulnerability has been resolved:
tracing: Limit access to parser->buffer when trace_get_user failed
When the length of the string written to set_ftrace_filter exceeds FTRACE_BUFF_MAX, the following KASAN alarm will be triggered:
BUG: KASAN: slab-out-of-bounds in strsep+0x18c/0x1b0 Read of size 1 at addr ffff0000d00bd5ba by task ash/165
CPU: 1 UID: 0 PID: 165 Comm: ash Not tainted 6.16.0-g6bcdbd62bd56-dirty Hardware name: linux,dummy-virt (DT) Call trace: show_stack+0x34/0x50 (C) dump_stack_lvl+0xa0/0x158 print_address_description.constprop.0+0x88/0x398 print_report+0xb0/0x280 kasan_report+0xa4/0xf0 __asan_report_load1_noabort+0x20/0x30 strsep+0x18c/0x1b0 ftrace_process_regex.isra.0+0x100/0x2d8 ftrace_regex_release+0x484/0x618 __fput+0x364/0xa58 ____fput+0x28/0x40 task_work_run+0x154/0x278 do_notify_resume+0x1f0/0x220 el0_svc+0xec/0xf0 el0t_64_sync_handler+0xa0/0xe8 el0t_64_sync+0x1ac/0x1b0
The reason is that trace_get_user will fail when processing a string longer than FTRACE_BUFF_MAX, but not set the end of parser->buffer to 0. Then an OOB access will be triggered in ftrace_regex_release-> ftrace_process_regex->strsep->strpbrk. We can solve this problem by limiting access to parser->buffer when trace_get_user failed.(CVE-2025-39683)
In the Linux kernel, the following vulnerability has been resolved:
vxlan: Fix NPD in {arp,neigh}_reduce() when using nexthop objects
When the "proxy" option is enabled on a VXLAN device, the device will suppress ARP requests and IPv6 Neighbor Solicitation messages if it is able to reply on behalf of the remote host. That is, if a matching and valid neighbor entry is configured on the VXLAN device whose MAC address is not behind the "any" remote (0.0.0.0 / ::).
The code currently assumes that the FDB entry for the neighbor's MAC address points to a valid remote destination, but this is incorrect if the entry is associated with an FDB nexthop group. This can result in a NPD [1][3] which can be reproduced using [2][4].
Fix by checking that the remote destination exists before dereferencing it.
[1] BUG: kernel NULL pointer dereference, address: 0000000000000000 [...] CPU: 4 UID: 0 PID: 365 Comm: arping Not tainted 6.17.0-rc2-virtme-g2a89cb21162c #2 PREEMPT(voluntary) Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.17.0-4.fc41 04/01/2014 RIP: 0010:vxlan_xmit+0xb58/0x15f0 [...] Call Trace: <TASK> dev_hard_start_xmit+0x5d/0x1c0 __dev_queue_xmit+0x246/0xfd0 packet_sendmsg+0x113a/0x1850 __sock_sendmsg+0x38/0x70 __sys_sendto+0x126/0x180 __x64_sys_sendto+0x24/0x30 do_syscall_64+0xa4/0x260 entry_SYSCALL_64_after_hwframe+0x4b/0x53
[2] #!/bin/bash
ip address add 192.0.2.1/32 dev lo
ip nexthop add id 1 via 192.0.2.2 fdb ip nexthop add id 10 group 1 fdb
ip link add name vx0 up type vxlan id 10010 local 192.0.2.1 dstport 4789 proxy
ip neigh add 192.0.2.3 lladdr 00:11:22:33:44:55 nud perm dev vx0
bridge fdb add 00:11:22:33:44:55 dev vx0 self static nhid 10
arping -b -c 1 -s 192.0.2.1 -I vx0 192.0.2.3
[3] BUG: kernel NULL pointer dereference, address: 0000000000000000 [...] CPU: 13 UID: 0 PID: 372 Comm: ndisc6 Not tainted 6.17.0-rc2-virtmne-g6ee90cb26014 #3 PREEMPT(voluntary) Hardware name: QEMU Standard PC (i440FX + PIIX, 1v996), BIOS 1.17.0-4.fc41 04/01/2x014 RIP: 0010:vxlan_xmit+0x803/0x1600 [...] Call Trace: <TASK> dev_hard_start_xmit+0x5d/0x1c0 __dev_queue_xmit+0x246/0xfd0 ip6_finish_output2+0x210/0x6c0 ip6_finish_output+0x1af/0x2b0 ip6_mr_output+0x92/0x3e0 ip6_send_skb+0x30/0x90 rawv6_sendmsg+0xe6e/0x12e0 __sock_sendmsg+0x38/0x70 __sys_sendto+0x126/0x180 __x64_sys_sendto+0x24/0x30 do_syscall_64+0xa4/0x260 entry_SYSCALL_64_after_hwframe+0x4b/0x53 RIP: 0033:0x7f383422ec77
[4] #!/bin/bash
ip address add 2001:db8:1::1/128 dev lo
ip nexthop add id 1 via 2001:db8:1::1 fdb ip nexthop add id 10 group 1 fdb
ip link add name vx0 up type vxlan id 10010 local 2001:db8:1::1 dstport 4789 proxy
ip neigh add 2001:db8:1::3 lladdr 00:11:22:33:44:55 nud perm dev vx0
bridge fdb add 00:11:22:33:44:55 dev vx0 self static nhid 10
ndisc6 -r 1 -s 2001:db8:1::1 -w 1 2001:db8:1::3 vx0(CVE-2025-39850)
| URL | Type | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"kernel-debuginfo-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"kernel-debugsource-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"kernel-devel-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"kernel-headers-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"kernel-source-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"kernel-tools-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"kernel-tools-devel-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"perf-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"perf-debuginfo-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"python3-perf-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-285.0.0.187.oe2203sp3.aarch64.rpm"
],
"src": [
"kernel-5.10.0-285.0.0.187.oe2203sp3.src.rpm"
],
"x86_64": [
"kernel-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"kernel-debuginfo-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"kernel-debugsource-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"kernel-devel-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"kernel-headers-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"kernel-source-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"kernel-tools-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"kernel-tools-devel-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"perf-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"perf-debuginfo-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"python3-perf-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-285.0.0.187.oe2203sp3.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP3",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP3"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-285.0.0.187.oe2203sp3"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nNFSD: Protect against send buffer overflow in NFSv2 READ\n\nSince before the git era, NFSD has conserved the number of pages\nheld by each nfsd thread by combining the RPC receive and send\nbuffers into a single array of pages. This works because there are\nno cases where an operation needs a large RPC Call message and a\nlarge RPC Reply at the same time.\n\nOnce an RPC Call has been received, svc_process() updates\nsvc_rqst::rq_res to describe the part of rq_pages that can be\nused for constructing the Reply. This means that the send buffer\n(rq_res) shrinks when the received RPC record containing the RPC\nCall is large.\n\nA client can force this shrinkage on TCP by sending a correctly-\nformed RPC Call header contained in an RPC record that is\nexcessively large. The full maximum payload size cannot be\nconstructed in that case.(CVE-2022-50410)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmedia: az6007: Fix null-ptr-deref in az6007_i2c_xfer()\n\nIn az6007_i2c_xfer, msg is controlled by user. When msg[i].buf\nis null and msg[i].len is zero, former checks on msg[i].buf would be\npassed. Malicious data finally reach az6007_i2c_xfer. If accessing\nmsg[i].buf[0] without sanity check, null ptr deref would happen.\nWe add check on msg[i].len to prevent crash.\n\nSimilar commit:\ncommit 0ed554fd769a\n(\u0026quot;media: dvb-usb: az6027: fix null-ptr-deref in az6027_i2c_xfer()\u0026quot;)(CVE-2023-53220)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nkobject: Add sanity check for kset-\u0026gt;kobj.ktype in kset_register()\n\nWhen I register a kset in the following way:\n\tstatic struct kset my_kset;\n\tkobject_set_name(\u0026amp;my_kset.kobj, \u0026quot;my_kset\u0026quot;);\n ret = kset_register(\u0026amp;my_kset);\n\nA null pointer dereference exception is occurred:\n[ 4453.568337] Unable to handle kernel NULL pointer dereference at \\\nvirtual address 0000000000000028\n... ...\n[ 4453.810361] Call trace:\n[ 4453.813062] kobject_get_ownership+0xc/0x34\n[ 4453.817493] kobject_add_internal+0x98/0x274\n[ 4453.822005] kset_register+0x5c/0xb4\n[ 4453.825820] my_kobj_init+0x44/0x1000 [my_kset]\n... ...\n\nBecause I didn\u0026apos;t initialize my_kset.kobj.ktype.\n\nAccording to the description in Documentation/core-api/kobject.rst:\n - A ktype is the type of object that embeds a kobject. Every structure\n that embeds a kobject needs a corresponding ktype.\n\nSo add sanity check to make sure kset-\u0026gt;kobj.ktype is not NULL.(CVE-2023-53480)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nvirtio-mmio: don\u0026apos;t break lifecycle of vm_dev\n\nvm_dev has a separate lifecycle because it has a \u0026apos;struct device\u0026apos;\nembedded. Thus, having a release callback for it is correct.\n\nAllocating the vm_dev struct with devres totally breaks this protection,\nthough. Instead of waiting for the vm_dev release callback, the memory\nis freed when the platform_device is removed. Resulting in a\nuse-after-free when finally the callback is to be called.\n\nTo easily see the problem, compile the kernel with\nCONFIG_DEBUG_KOBJECT_RELEASE and unbind with sysfs.\n\nThe fix is easy, don\u0026apos;t use devres in this case.\n\nFound during my research about object lifetime problems.(CVE-2023-53515)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: usbnet: Fix WARNING in usbnet_start_xmit/usb_submit_urb\n\nThe syzbot fuzzer identified a problem in the usbnet driver:\n\nusb 1-1: BOGUS urb xfer, pipe 3 != type 1\nWARNING: CPU: 0 PID: 754 at drivers/usb/core/urb.c:504 usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504\nModules linked in:\nCPU: 0 PID: 754 Comm: kworker/0:2 Not tainted 6.4.0-rc7-syzkaller-00014-g692b7dc87ca6 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 05/27/2023\nWorkqueue: mld mld_ifc_work\nRIP: 0010:usb_submit_urb+0xed6/0x1880 drivers/usb/core/urb.c:504\nCode: 7c 24 18 e8 2c b4 5b fb 48 8b 7c 24 18 e8 42 07 f0 fe 41 89 d8 44 89 e1 4c 89 ea 48 89 c6 48 c7 c7 a0 c9 fc 8a e8 5a 6f 23 fb \u0026lt;0f\u0026gt; 0b e9 58 f8 ff ff e8 fe b3 5b fb 48 81 c5 c0 05 00 00 e9 84 f7\nRSP: 0018:ffffc9000463f568 EFLAGS: 00010086\nRAX: 0000000000000000 RBX: 0000000000000001 RCX: 0000000000000000\nRDX: ffff88801eb28000 RSI: ffffffff814c03b7 RDI: 0000000000000001\nRBP: ffff8881443b7190 R08: 0000000000000001 R09: 0000000000000000\nR10: 0000000000000000 R11: 0000000000000001 R12: 0000000000000003\nR13: ffff88802a77cb18 R14: 0000000000000003 R15: ffff888018262500\nFS: 0000000000000000(0000) GS:ffff8880b9800000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000556a99c15a18 CR3: 0000000028c71000 CR4: 0000000000350ef0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n usbnet_start_xmit+0xfe5/0x2190 drivers/net/usb/usbnet.c:1453\n __netdev_start_xmit include/linux/netdevice.h:4918 [inline]\n netdev_start_xmit include/linux/netdevice.h:4932 [inline]\n xmit_one net/core/dev.c:3578 [inline]\n dev_hard_start_xmit+0x187/0x700 net/core/dev.c:3594\n...\n\nThis bug is caused by the fact that usbnet trusts the bulk endpoint\naddresses its probe routine receives in the driver_info structure, and\nit does not check to see that these endpoints actually exist and have\nthe expected type and directions.\n\nThe fix is simply to add such a check.(CVE-2023-53548)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntracing: Limit access to parser-\u0026gt;buffer when trace_get_user failed\n\nWhen the length of the string written to set_ftrace_filter exceeds\nFTRACE_BUFF_MAX, the following KASAN alarm will be triggered:\n\nBUG: KASAN: slab-out-of-bounds in strsep+0x18c/0x1b0\nRead of size 1 at addr ffff0000d00bd5ba by task ash/165\n\nCPU: 1 UID: 0 PID: 165 Comm: ash Not tainted 6.16.0-g6bcdbd62bd56-dirty\nHardware name: linux,dummy-virt (DT)\nCall trace:\n show_stack+0x34/0x50 (C)\n dump_stack_lvl+0xa0/0x158\n print_address_description.constprop.0+0x88/0x398\n print_report+0xb0/0x280\n kasan_report+0xa4/0xf0\n __asan_report_load1_noabort+0x20/0x30\n strsep+0x18c/0x1b0\n ftrace_process_regex.isra.0+0x100/0x2d8\n ftrace_regex_release+0x484/0x618\n __fput+0x364/0xa58\n ____fput+0x28/0x40\n task_work_run+0x154/0x278\n do_notify_resume+0x1f0/0x220\n el0_svc+0xec/0xf0\n el0t_64_sync_handler+0xa0/0xe8\n el0t_64_sync+0x1ac/0x1b0\n\nThe reason is that trace_get_user will fail when processing a string\nlonger than FTRACE_BUFF_MAX, but not set the end of parser-\u0026gt;buffer to 0.\nThen an OOB access will be triggered in ftrace_regex_release-\u0026gt;\nftrace_process_regex-\u0026gt;strsep-\u0026gt;strpbrk. We can solve this problem by\nlimiting access to parser-\u0026gt;buffer when trace_get_user failed.(CVE-2025-39683)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nvxlan: Fix NPD in {arp,neigh}_reduce() when using nexthop objects\n\nWhen the \u0026quot;proxy\u0026quot; option is enabled on a VXLAN device, the device will\nsuppress ARP requests and IPv6 Neighbor Solicitation messages if it is\nable to reply on behalf of the remote host. That is, if a matching and\nvalid neighbor entry is configured on the VXLAN device whose MAC address\nis not behind the \u0026quot;any\u0026quot; remote (0.0.0.0 / ::).\n\nThe code currently assumes that the FDB entry for the neighbor\u0026apos;s MAC\naddress points to a valid remote destination, but this is incorrect if\nthe entry is associated with an FDB nexthop group. This can result in a\nNPD [1][3] which can be reproduced using [2][4].\n\nFix by checking that the remote destination exists before dereferencing\nit.\n\n[1]\nBUG: kernel NULL pointer dereference, address: 0000000000000000\n[...]\nCPU: 4 UID: 0 PID: 365 Comm: arping Not tainted 6.17.0-rc2-virtme-g2a89cb21162c #2 PREEMPT(voluntary)\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.17.0-4.fc41 04/01/2014\nRIP: 0010:vxlan_xmit+0xb58/0x15f0\n[...]\nCall Trace:\n \u0026lt;TASK\u0026gt;\n dev_hard_start_xmit+0x5d/0x1c0\n __dev_queue_xmit+0x246/0xfd0\n packet_sendmsg+0x113a/0x1850\n __sock_sendmsg+0x38/0x70\n __sys_sendto+0x126/0x180\n __x64_sys_sendto+0x24/0x30\n do_syscall_64+0xa4/0x260\n entry_SYSCALL_64_after_hwframe+0x4b/0x53\n\n[2]\n #!/bin/bash\n\n ip address add 192.0.2.1/32 dev lo\n\n ip nexthop add id 1 via 192.0.2.2 fdb\n ip nexthop add id 10 group 1 fdb\n\n ip link add name vx0 up type vxlan id 10010 local 192.0.2.1 dstport 4789 proxy\n\n ip neigh add 192.0.2.3 lladdr 00:11:22:33:44:55 nud perm dev vx0\n\n bridge fdb add 00:11:22:33:44:55 dev vx0 self static nhid 10\n\n arping -b -c 1 -s 192.0.2.1 -I vx0 192.0.2.3\n\n[3]\nBUG: kernel NULL pointer dereference, address: 0000000000000000\n[...]\nCPU: 13 UID: 0 PID: 372 Comm: ndisc6 Not tainted 6.17.0-rc2-virtmne-g6ee90cb26014 #3 PREEMPT(voluntary)\nHardware name: QEMU Standard PC (i440FX + PIIX, 1v996), BIOS 1.17.0-4.fc41 04/01/2x014\nRIP: 0010:vxlan_xmit+0x803/0x1600\n[...]\nCall Trace:\n \u0026lt;TASK\u0026gt;\n dev_hard_start_xmit+0x5d/0x1c0\n __dev_queue_xmit+0x246/0xfd0\n ip6_finish_output2+0x210/0x6c0\n ip6_finish_output+0x1af/0x2b0\n ip6_mr_output+0x92/0x3e0\n ip6_send_skb+0x30/0x90\n rawv6_sendmsg+0xe6e/0x12e0\n __sock_sendmsg+0x38/0x70\n __sys_sendto+0x126/0x180\n __x64_sys_sendto+0x24/0x30\n do_syscall_64+0xa4/0x260\n entry_SYSCALL_64_after_hwframe+0x4b/0x53\nRIP: 0033:0x7f383422ec77\n\n[4]\n #!/bin/bash\n\n ip address add 2001:db8:1::1/128 dev lo\n\n ip nexthop add id 1 via 2001:db8:1::1 fdb\n ip nexthop add id 10 group 1 fdb\n\n ip link add name vx0 up type vxlan id 10010 local 2001:db8:1::1 dstport 4789 proxy\n\n ip neigh add 2001:db8:1::3 lladdr 00:11:22:33:44:55 nud perm dev vx0\n\n bridge fdb add 00:11:22:33:44:55 dev vx0 self static nhid 10\n\n ndisc6 -r 1 -s 2001:db8:1::1 -w 1 2001:db8:1::3 vx0(CVE-2025-39850)",
"id": "OESA-2025-2469",
"modified": "2026-08-06T11:09:33Z",
"published": "2025-10-17T11:09:33Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-2469"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50410"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53220"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53480"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53515"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53548"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39683"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39850"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:H/PR:L/UI:N/S:U/C:L/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-50410",
"CVE-2023-53220",
"CVE-2023-53480",
"CVE-2023-53515",
"CVE-2023-53548",
"CVE-2025-39683",
"CVE-2025-39850"
]
}
OESA-2025-2553 (CVE-2022-50405)
Vulnerability from osv_openeuler – Published: 2025-10-31 11:09 – Updated: 2026-08-06 11:09 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
net/tunnel: wait until all sk_user_data reader finish before releasing the sock
There is a race condition in vxlan that when deleting a vxlan device during receiving packets, there is a possibility that the sock is released after getting vxlan_sock vs from sk_user_data. Then in later vxlan_ecn_decapsulate(), vxlan_get_sk_family() we will got NULL pointer dereference. e.g.
#0 [ffffa25ec6978a38] machine_kexec at ffffffff8c669757 #1 [ffffa25ec6978a90] __crash_kexec at ffffffff8c7c0a4d #2 [ffffa25ec6978b58] crash_kexec at ffffffff8c7c1c48 #3 [ffffa25ec6978b60] oops_end at ffffffff8c627f2b #4 [ffffa25ec6978b80] page_fault_oops at ffffffff8c678fcb #5 [ffffa25ec6978bd8] exc_page_fault at ffffffff8d109542 #6 [ffffa25ec6978c00] asm_exc_page_fault at ffffffff8d200b62 [exception RIP: vxlan_ecn_decapsulate+0x3b] RIP: ffffffffc1014e7b RSP: ffffa25ec6978cb0 RFLAGS: 00010246 RAX: 0000000000000008 RBX: ffff8aa000888000 RCX: 0000000000000000 RDX: 000000000000000e RSI: ffff8a9fc7ab803e RDI: ffff8a9fd1168700 RBP: ffff8a9fc7ab803e R8: 0000000000700000 R9: 00000000000010ae R10: ffff8a9fcb748980 R11: 0000000000000000 R12: ffff8a9fd1168700 R13: ffff8aa000888000 R14: 00000000002a0000 R15: 00000000000010ae ORIG_RAX: ffffffffffffffff CS: 0010 SS: 0018 #7 [ffffa25ec6978ce8] vxlan_rcv at ffffffffc10189cd [vxlan] #8 [ffffa25ec6978d90] udp_queue_rcv_one_skb at ffffffff8cfb6507 #9 [ffffa25ec6978dc0] udp_unicast_rcv_skb at ffffffff8cfb6e45 #10 [ffffa25ec6978dc8] __udp4_lib_rcv at ffffffff8cfb8807 #11 [ffffa25ec6978e20] ip_protocol_deliver_rcu at ffffffff8cf76951 #12 [ffffa25ec6978e48] ip_local_deliver at ffffffff8cf76bde #13 [ffffa25ec6978ea0] __netif_receive_skb_one_core at ffffffff8cecde9b #14 [ffffa25ec6978ec8] process_backlog at ffffffff8cece139 #15 [ffffa25ec6978f00] __napi_poll at ffffffff8ceced1a #16 [ffffa25ec6978f28] net_rx_action at ffffffff8cecf1f3 #17 [ffffa25ec6978fa0] __softirqentry_text_start at ffffffff8d4000ca #18 [ffffa25ec6978ff0] do_softirq at ffffffff8c6fbdc3
Reproducer: https://github.com/Mellanox/ovs-tests/blob/master/test-ovs-vxlan-remove-tunnel-during-traffic.sh
Fix this by waiting for all sk_user_data reader to finish before releasing the sock.(CVE-2022-50405)
In the Linux kernel, there is a vulnerability in the USB host controller interface (xHCI). When the xHC host is dying or being removed, endpoints are not properly cleaned up, remaining in the bandwidth list when freeing the virtual device. This causes a list_del corruption kernel crash when unbinding xhci-pci, as xhci_mem_cleanup() later attempts to delete already freed endpoints from the bandwidth list. This vulnerability only affects hosts that use software bandwidth checking, which currently is only the xHC in Intel Panther Point PCH (Ivy Bridge).(CVE-2022-50470)
In the Linux kernel, the following vulnerability has been resolved:thermal: intel_powerclamp: Use get_cpu() instead of smp_processor_id() to avoid crashWhen CPU 0 is offline and intel_powerclamp is used to injectidle, it generates kernel BUG:BUG: using smp_processor_id() in preemptible [00000000] code: bash/15687caller is debug_smp_processor_id+0x17/0x20CPU: 4 PID: 15687 Comm: bash Not tainted 5.19.0-rc7+ #57Call Trace:<TASK>dump_stack_lvl+0x49/0x63dump_stack+0x10/0x16check_preemption_disabled+0xdd/0xe0debug_smp_processor_id+0x17/0x20powerclamp_set_cur_state+0x7f/0xf9 [intel_powerclamp]......Here CPU 0 is the control CPU by default and changed to the current CPU,if CPU 0 offlined. This check has to be performed under cpus_read_lock(),hence the above warning.Use get_cpu() instead of smp_processor_id() to avoid this BUG. rjw: Subject edits
In the Linux kernel, the following vulnerability has been resolved:iommu/amd: Fix pci device refcount leak in ppr_notifier()As comment of pci_get_domain_bus_and_slot() says, it returnsa pci device with refcount increment, when finish using it,the caller must decrement the reference count by callingpci_dev_put(). So call it before returning from ppr_notifier()to avoid refcount leak.(CVE-2022-50505)
In the Linux kernel, the following vulnerability has been resolved:usb: host: xhci: Fix potential memory leak in xhci_alloc_stream_info()xhci_alloc_stream_info() allocates stream context array for stream_info->stream_ctx_array with xhci_alloc_stream_ctx(). When some error occurs,stream_info->stream_ctx_array is not released, which will lead to amemory leak.We can fix it by releasing the stream_info->stream_ctx_array withxhci_free_stream_ctx() on the error path to avoid the potential memoryleak.(CVE-2022-50544)
In the Linux kernel, the following vulnerability has been resolved:mtd: Fix device name leak when register device failed in add_mtd_device()There is a kmemleak when register device failed: unreferenced object 0xffff888101aab550 (size 8): comm insmod , pid 3922, jiffies 4295277753 (age 925.408s) hex dump (first 8 bytes): 6d 74 64 30 00 88 ff ff mtd0.... backtrace: [<00000000bde26724>] __kmalloc_node_track_caller+0x4e/0x150 [<000000003c32b416>] kvasprintf+0xb0/0x130 [<000000001f7a8f15>] kobject_set_name_vargs+0x2f/0xb0 [<000000006e781163>] dev_set_name+0xab/0xe0 [<00000000e30d0c78>] add_mtd_device+0x4bb/0x700 [<00000000f3d34de7>] mtd_device_parse_register+0x2ac/0x3f0 [<00000000c0d88488>] 0xffffffffa0238457 [<00000000b40d0922>] 0xffffffffa02a008f [<0000000023d17b9d>] do_one_initcall+0x87/0x2a0 [<00000000770f6ca6>] do_init_module+0xdf/0x320 [<000000007b6768fe>] load_module+0x2f98/0x3330 [<00000000346bed5a>] __do_sys_finit_module+0x113/0x1b0 [<00000000674c2290>] do_syscall_64+0x35/0x80 [<000000004c6a8d97>] entry_SYSCALL_64_after_hwframe+0x46/0xb0If register device failed, should call put_device() to give up thereference.(CVE-2022-50566)
In the Linux kernel, the following vulnerability has been resolved:
ubi: ensure that VID header offset + VID header size <= alloc, size
Ensure that the VID header offset + VID header size does not exceed the allocated area to avoid slab OOB.
BUG: KASAN: slab-out-of-bounds in crc32_body lib/crc32.c:111 [inline] BUG: KASAN: slab-out-of-bounds in crc32_le_generic lib/crc32.c:179 [inline] BUG: KASAN: slab-out-of-bounds in crc32_le_base+0x58c/0x626 lib/crc32.c:197 Read of size 4 at addr ffff88802bb36f00 by task syz-executor136/1555
CPU: 2 PID: 1555 Comm: syz-executor136 Tainted: G W 6.0.0-1868 #1 Hardware name: Red Hat KVM, BIOS 1.13.0-2.module+el8.3.0+7860+a7792d29 04/01/2014 Call Trace: <TASK> __dump_stack lib/dump_stack.c:88 [inline] dump_stack_lvl+0x85/0xad lib/dump_stack.c:106 print_address_description mm/kasan/report.c:317 [inline] print_report.cold.13+0xb6/0x6bb mm/kasan/report.c:433 kasan_report+0xa7/0x11b mm/kasan/report.c:495 crc32_body lib/crc32.c:111 [inline] crc32_le_generic lib/crc32.c:179 [inline] crc32_le_base+0x58c/0x626 lib/crc32.c:197 ubi_io_write_vid_hdr+0x1b7/0x472 drivers/mtd/ubi/io.c:1067 create_vtbl+0x4d5/0x9c4 drivers/mtd/ubi/vtbl.c:317 create_empty_lvol drivers/mtd/ubi/vtbl.c:500 [inline] ubi_read_volume_table+0x67b/0x288a drivers/mtd/ubi/vtbl.c:812 ubi_attach+0xf34/0x1603 drivers/mtd/ubi/attach.c:1601 ubi_attach_mtd_dev+0x6f3/0x185e drivers/mtd/ubi/build.c:965 ctrl_cdev_ioctl+0x2db/0x347 drivers/mtd/ubi/cdev.c:1043 vfs_ioctl fs/ioctl.c:51 [inline] __do_sys_ioctl fs/ioctl.c:870 [inline] __se_sys_ioctl fs/ioctl.c:856 [inline] __x64_sys_ioctl+0x193/0x213 fs/ioctl.c:856 do_syscall_x64 arch/x86/entry/common.c:50 [inline] do_syscall_64+0x3e/0x86 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0x0 RIP: 0033:0x7f96d5cf753d Code: RSP: 002b:00007fffd72206f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000010 RAX: ffffffffffffffda RBX: 0000000000000000 RCX: 00007f96d5cf753d RDX: 0000000020000080 RSI: 0000000040186f40 RDI: 0000000000000003 RBP: 0000000000400cd0 R08: 0000000000000000 R09: 0000000000000000 R10: 0000000000000000 R11: 0000000000000246 R12: 0000000000400be0 R13: 00007fffd72207e0 R14: 0000000000000000 R15: 0000000000000000 </TASK>
Allocated by task 1555: kasan_save_stack+0x20/0x3d mm/kasan/common.c:38 kasan_set_track mm/kasan/common.c:45 [inline] set_alloc_info mm/kasan/common.c:437 [inline] _kasankmalloc mm/kasan/common.c:516 [inline] kasan_kmalloc+0x88/0xa3 mm/kasan/common.c:525 kasan_kmalloc include/linux/kasan.h:234 [inline] __kmalloc+0x138/0x257 mm/slub.c:4429 kmalloc include/linux/slab.h:605 [inline] ubi_alloc_vid_buf drivers/mtd/ubi/ubi.h:1093 [inline] create_vtbl+0xcc/0x9c4 drivers/mtd/ubi/vtbl.c:295 create_empty_lvol drivers/mtd/ubi/vtbl.c:500 [inline] ubi_read_volume_table+0x67b/0x288a drivers/mtd/ubi/vtbl.c:812 ubi_attach+0xf34/0x1603 drivers/mtd/ubi/attach.c:1601 ubi_attach_mtd_dev+0x6f3/0x185e drivers/mtd/ubi/build.c:965 ctrl_cdev_ioctl+0x2db/0x347 drivers/mtd/ubi/cdev.c:1043 vfs_ioctl fs/ioctl.c:51 [inline] __do_sys_ioctl fs/ioctl.c:870 [inline] __se_sys_ioctl fs/ioctl.c:856 [inline] __x64_sys_ioctl+0x193/0x213 fs/ioctl.c:856 do_syscall_x64 arch/x86/entry/common.c:50 [inline] do_syscall_64+0x3e/0x86 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0x0
The buggy address belongs to the object at ffff88802bb36e00 which belongs to the cache kmalloc-256 of size 256 The buggy address is located 0 bytes to the right of 256-byte region [ffff88802bb36e00, ffff88802bb36f00)
The buggy address belongs to the physical page: page:00000000ea4d1263 refcount:1 mapcount:0 mapping:0000000000000000 index:0x0 pfn:0x2bb36 head:00000000ea4d1263 order:1 compound_mapcount:0 compound_pincount:0 flags: 0xfffffc0010200(slab|head|node=0|zone=1|lastcpupid=0x1fffff) raw: 000fffffc0010200 ffffea000066c300 dead000000000003 ffff888100042b40 raw: 0000000000000000 00000000001 ---truncated---(CVE-2023-53265)
In the Linux kernel, the following vulnerability has been resolved:
ubi: Fix unreferenced object reported by kmemleak in ubi_resize_volume()
There is a memory leaks problem reported by kmemleak:
unreferenced object 0xffff888102007a00 (size 128): comm "ubirsvol", pid 32090, jiffies 4298464136 (age 2361.231s) hex dump (first 32 bytes): ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ................ ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ................ backtrace: [<ffffffff8176cecd>] __kmalloc+0x4d/0x150 [<ffffffffa02a9a36>] ubi_eba_create_table+0x76/0x170 [ubi] [<ffffffffa029764e>] ubi_resize_volume+0x1be/0xbc0 [ubi] [<ffffffffa02a3321>] ubi_cdev_ioctl+0x701/0x1850 [ubi] [<ffffffff81975d2d>] __x64_sys_ioctl+0x11d/0x170 [<ffffffff83c142a5>] do_syscall_64+0x35/0x80 [<ffffffff83e0006a>] entry_SYSCALL_64_after_hwframe+0x46/0xb0
This is due to a mismatch between create and destroy interfaces, and in detail that "new_eba_tbl" created by ubi_eba_create_table() but destroyed by kfree(), while will causing "new_eba_tbl->entries" not freed.
Fix it by replacing kfree(new_eba_tbl) with ubi_eba_destroy_table(new_eba_tbl)(CVE-2023-53271)
In the Linux kernel, the following vulnerability has been resolved:
sctp: check send stream number after wait_for_sndbuf
This patch fixes a corner case where the asoc out stream count may change after wait_for_sndbuf.
When the main thread in the client starts a connection, if its out stream count is set to N while the in stream count in the server is set to N - 2, another thread in the client keeps sending the msgs with stream number N - 1, and waits for sndbuf before processing INIT_ACK.
However, after processing INIT_ACK, the out stream count in the client is shrunk to N - 2, the same to the in stream count in the server. The crash occurs when the thread waiting for sndbuf is awake and sends the msg in a non-existing stream(N - 1), the call trace is as below:
KASAN: null-ptr-deref in range [0x0000000000000038-0x000000000000003f] Call Trace: <TASK> sctp_cmd_send_msg net/sctp/sm_sideeffect.c:1114 [inline] sctp_cmd_interpreter net/sctp/sm_sideeffect.c:1777 [inline] sctp_side_effects net/sctp/sm_sideeffect.c:1199 [inline] sctp_do_sm+0x197d/0x5310 net/sctp/sm_sideeffect.c:1170 sctp_primitive_SEND+0x9f/0xc0 net/sctp/primitive.c:163 sctp_sendmsg_to_asoc+0x10eb/0x1a30 net/sctp/socket.c:1868 sctp_sendmsg+0x8d4/0x1d90 net/sctp/socket.c:2026 inet_sendmsg+0x9d/0xe0 net/ipv4/af_inet.c:825 sock_sendmsg_nosec net/socket.c:722 [inline] sock_sendmsg+0xde/0x190 net/socket.c:745
The fix is to add an unlikely check for the send stream number after the thread wakes up from the wait_for_sndbuf.(CVE-2023-53296)
In the Linux kernel, the following vulnerability has been resolved:
sctp: fix a potential overflow in sctp_ifwdtsn_skip
Currently, when traversing ifwdtsn skips with _sctp_walk_ifwdtsn, it only checks the pos against the end of the chunk. However, the data left for the last pos may be < sizeof(struct sctp_ifwdtsn_skip), and dereference it as struct sctp_ifwdtsn_skip may cause coverflow.
This patch fixes it by checking the pos against "the end of the chunk - sizeof(struct sctp_ifwdtsn_skip)" in sctp_ifwdtsn_skip, similar to sctp_fwdtsn_skip.(CVE-2023-53372)
In the Linux kernel, the following vulnerability has been resolved:
wifi: mwifiex: avoid possible NULL skb pointer dereference
In 'mwifiex_handle_uap_rx_forward()', always check the value returned by 'skb_copy()' to avoid potential NULL pointer dereference in 'mwifiex_uap_queue_bridged_pkt()', and drop original skb in case of copying failure.
Found by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2023-53384)
In the Linux kernel, the following vulnerability has been resolved:
drm/radeon: free iio for atombios when driver shutdown
Fix below kmemleak when unload radeon driver:
unreferenced object 0xffff9f8608ede200 (size 512): comm "systemd-udevd", pid 326, jiffies 4294682822 (age 716.338s) hex dump (first 32 bytes): 00 00 00 00 c4 aa ec aa 14 ab 00 00 00 00 00 00 ................ 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................ backtrace: [<0000000062fadebe>] kmem_cache_alloc_trace+0x2f1/0x500 [<00000000b6883cea>] atom_parse+0x117/0x230 [radeon] [<00000000158c23fd>] radeon_atombios_init+0xab/0x170 [radeon] [<00000000683f672e>] si_init+0x57/0x750 [radeon] [<00000000566cc31f>] radeon_device_init+0x559/0x9c0 [radeon] [<0000000046efabb3>] radeon_driver_load_kms+0xc1/0x1a0 [radeon] [<00000000b5155064>] drm_dev_register+0xdd/0x1d0 [<0000000045fec835>] radeon_pci_probe+0xbd/0x100 [radeon] [<00000000e69ecca3>] pci_device_probe+0xe1/0x160 [<0000000019484b76>] really_probe.part.0+0xc1/0x2c0 [<000000003f2649da>] __driver_probe_device+0x96/0x130 [<00000000231c5bb1>] driver_probe_device+0x24/0xf0 [<0000000000a42377>] __driver_attach+0x77/0x190 [<00000000d7574da6>] bus_for_each_dev+0x7f/0xd0 [<00000000633166d2>] driver_attach+0x1e/0x30 [<00000000313b05b8>] bus_add_driver+0x12c/0x1e0
iio was allocated in atom_index_iio() called by atom_parse(), but it doesn't got released when the dirver is shutdown. Fix this kmemleak by free it in radeon_atombios_fini().(CVE-2023-53453)
In the Linux kernel, the following vulnerability has been resolved:
ubi: ubi_wl_put_peb: Fix infinite loop when wear-leveling work failed
Following process will trigger an infinite loop in ubi_wl_put_peb():
ubifs_bgt ubi_bgt
ubifs_leb_unmap ubi_leb_unmap ubi_eba_unmap_leb ubi_wl_put_peb wear_leveling_worker e1 = rb_entry(rb_first(&ubi->used) e2 = get_peb_for_wl(ubi) ubi_io_read_vid_hdr // return err (flash fault) out_error: ubi->move_from = ubi->move_to = NULL wl_entry_destroy(ubi, e1) ubi->lookuptbl[e->pnum] = NULL retry: e = ubi->lookuptbl[pnum]; // return NULL if (e == ubi->move_from) { // NULL == NULL gets true goto retry; // infinite loop !!!
$ top PID USER PR NI VIRT RES SHR S %CPU %MEM COMMAND 7676 root 20 0 0 0 0 R 100.0 0.0 ubifs_bgt0_0
Fix it by: 1) Letting ubi_wl_put_peb() returns directly if wearl leveling entry has been removed from 'ubi->lookuptbl'. 2) Using 'ubi->wl_lock' protecting wl entry deletion to preventing an use-after-free problem for wl entry in ubi_wl_put_peb().
Fetch a reproducer in [Link].(CVE-2023-53481)
In the Linux kernel, the following vulnerability has been resolved:
virtio-mmio: don't break lifecycle of vm_dev
vm_dev has a separate lifecycle because it has a 'struct device' embedded. Thus, having a release callback for it is correct.
Allocating the vm_dev struct with devres totally breaks this protection, though. Instead of waiting for the vm_dev release callback, the memory is freed when the platform_device is removed. Resulting in a use-after-free when finally the callback is to be called.
To easily see the problem, compile the kernel with CONFIG_DEBUG_KOBJECT_RELEASE and unbind with sysfs.
The fix is easy, don't use devres in this case.
Found during my research about object lifetime problems.(CVE-2023-53515)
In the Linux kernel, the following vulnerability has been resolved:spi: qup: Don t skip cleanup in remove s error pathReturning early in a platform driver s remove callback is wrong. In thiscase the dma resources are not released in the error path. this is neverretried later and so this is a permanent leak. To fix this, only skiphardware disabling if waking the device fails.(CVE-2023-53567)
In the Linux kernel, the following vulnerability has been resolved:dm integrity: call kmem_cache_destroy() in dm_integrity_init() error pathOtherwise the journal_io_cache will leak if dm_register_target() fails.(CVE-2023-53604)
In the Linux kernel, the following vulnerability has been resolved:ALSA: ac97: Fix possible NULL dereference in snd_ac97_mixersmatch error:sound/pci/ac97/ac97_codec.c:2354 snd_ac97_mixer() error:we previously assumed rac97 could be null (see line 2072)remove redundant assignment, return error if rac97 is NULL.(CVE-2023-53648)
In the Linux kernel, the following vulnerability has been resolved:bcache: Fix __bch_btree_node_alloc to make the failure behavior consistentIn some specific situations, the return value of __bch_btree_node_allocmay be NULL. This may lead to a potential NULL pointer dereference incaller function like a calling chain :btree_split->bch_btree_node_alloc->__bch_btree_node_alloc.Fix it by initializing the return value in __bch_btree_node_alloc.(CVE-2023-53681)
In the Linux kernel, the following vulnerability has been resolved:serial: arc_uart: fix of_iomap leak in arc_serial_probeSmatch reports:drivers/tty/serial/arc_uart.c:631 arc_serial_probe() warn: port->membase from of_iomap() not released on lines: 631.In arc_serial_probe(), if uart_add_one_port() fails,port->membase is not released, which would cause a resource leak.To fix this, I replace of_iomap with devm_platform_ioremap_resource.(CVE-2023-53719)
In the Linux kernel, the following vulnerability has been resolved:posix-timers: Ensure timer ID search-loop limit is validposix_timer_add() tries to allocate a posix timer ID by starting from thecached ID which was stored by the last successful allocation.This is done in a loop searching the ID space for a free slot one byone. The loop has to terminate when the search wrapped around to thestarting point.But that s racy vs. establishing the starting point. That is read outlockless, which leads to the following problem:CPU0 CPU1posix_timer_add() start = sig->posix_timer_id; lock(hash_lock); ... posix_timer_add() if (++sig->posix_timer_id < 0) start = sig->posix_timer_id; sig->posix_timer_id = 0;So CPU1 can observe a negative start value, i.e. -1, and the loop breaknever happens because the condition can never be true: if (sig->posix_timer_id == start) break;While this is unlikely to ever turn into an endless loop as the ID space ishuge (INT_MAX), the racy read of the start value caught the attention ofKCSAN and Dmitry unearthed that incorrectness.Rewrite it so that all id operations are under the hash lock.(CVE-2023-53728)
In the Linux kernel, the following vulnerability has been resolved:sunrpc: fix one UAF issue caused by sunrpc kernel tcp socketBUG: KASAN: slab-use-after-free in tcp_write_timer_handler+0x156/0x3e0Read of size 1 at addr ffff888111f322cd by task swapper/0/0CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.12.0-rc4-dirty #7Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1Call Trace: <IRQ> dump_stack_lvl+0x68/0xa0 print_address_description.constprop.0+0x2c/0x3d0 print_report+0xb4/0x270 kasan_report+0xbd/0xf0 tcp_write_timer_handler+0x156/0x3e0 tcp_write_timer+0x66/0x170 call_timer_fn+0xfb/0x1d0 __run_timers+0x3f8/0x480 run_timer_softirq+0x9b/0x100 handle_softirqs+0x153/0x390 __irq_exit_rcu+0x103/0x120 irq_exit_rcu+0xe/0x20 sysvec_apic_timer_interrupt+0x76/0x90 </IRQ> <TASK> asm_sysvec_apic_timer_interrupt+0x1a/0x20RIP: 0010:default_idle+0xf/0x20Code: 4c 01 c7 4c 29 c2 e9 72 ff ff ff 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 66 90 0f 00 2d 33 f8 25 00 fb f4 <fa> c3 cc cc cc cc 66 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90RSP: 0018:ffffffffa2007e28 EFLAGS: 00000242RAX: 00000000000f3b31 RBX: 1ffffffff4400fc7 RCX: ffffffffa09c3196RDX: 0000000000000000 RSI: 0000000000000000 RDI: ffffffff9f00590fRBP: 0000000000000000 R08: 0000000000000001 R09: ffffed102360835dR10: ffff88811b041aeb R11: 0000000000000001 R12: 0000000000000000R13: ffffffffa202d7c0 R14: 0000000000000000 R15: 00000000000147d0 default_idle_call+0x6b/0xa0 cpuidle_idle_call+0x1af/0x1f0 do_idle+0xbc/0x130 cpu_startup_entry+0x33/0x40 rest_init+0x11f/0x210 start_kernel+0x39a/0x420 x86_64_start_reservations+0x18/0x30 x86_64_start_kernel+0x97/0xa0 common_startup_64+0x13e/0x141 </TASK>Allocated by task 595: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 __kasan_slab_alloc+0x87/0x90 kmem_cache_alloc_noprof+0x12b/0x3f0 copy_net_ns+0x94/0x380 create_new_namespaces+0x24c/0x500 unshare_nsproxy_namespaces+0x75/0xf0 ksys_unshare+0x24e/0x4f0 __x64_sys_unshare+0x1f/0x30 do_syscall_64+0x70/0x180 entry_SYSCALL_64_after_hwframe+0x76/0x7eFreed by task 100: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 kasan_save_free_info+0x3b/0x60 __kasan_slab_free+0x54/0x70 kmem_cache_free+0x156/0x5d0 cleanup_net+0x5d3/0x670 process_one_work+0x776/0xa90 worker_thread+0x2e2/0x560 kthread+0x1a8/0x1f0 ret_from_fork+0x34/0x60 ret_from_fork_asm+0x1a/0x30Reproduction script:mkdir -p /mnt/nfssharemkdir -p /mnt/nfs/netns_1mkfs.ext4 /dev/sdbmount /dev/sdb /mnt/nfssharesystemctl restart nfs-serverchmod 777 /mnt/nfsshareexportfs -i -o rw,no_root_squash *:/mnt/nfsshareip netns add netns_1ip link add name veth_1_peer type veth peer veth_1ifconfig veth_1_peer 11.11.0.254 upip link set veth_1 netns netns_1ip netns exec netns_1 ifconfig veth_1 11.11.0.1ip netns exec netns_1 /root/iptables -A OUTPUT -d 11.11.0.254 -p tcp --tcp-flags FIN FIN -j DROP(note: In my environment, a DESTROY_CLIENTID operation is always sent immediately, breaking the nfs tcp connection.)ip netns exec netns_1 timeout -s 9 300 mount -t nfs -o proto=tcp,vers=4.1 11.11.0.254:/mnt/nfsshare /mnt/nfs/netns_1ip netns del netns_1The reason here is that the tcp socket in netns_1 (nfs side) has beenshutdown and closed (done in xs_destroy), but the FIN message (with ack)is discarded, and the nfsd side keeps sending retransmission messages.As a result, when the tcp sock in netns_1 processes the received message,it sends the message (FIN message) in the sending queue, and the tcp timeris re-established. When the network namespace is deleted, the net structureaccessed by tcp s timer handler function causes problems.To fix this problem, let s hold netns refcnt for the tcp kernel socket asdone in other modules. This is an ugly hack which can easily be backportedto earlier kernels. A proper fix which cleans up the interfaces willfollow, but may not be so easy to backport.(CVE-2024-53168)
In the Linux kernel, the following vulnerability has been resolved:
net: atm: fix /proc/net/atm/lec handling
/proc/net/atm/lec must ensure safety against dev_lec[] changes.
It appears it had dev_put() calls without prior dev_hold(), leading to imbalance and UAF.(CVE-2025-38180)
In the Linux kernel, a race condition vulnerability exists in the posix-cpu-timers component. When a non-autoreaping exiting task has passed exit_notify() and calls handle_posix_cpu_timers() from IRQ, it can be reaped by its parent or debugger immediately after unlock_task_sighand(). If a concurrent posix_cpu_timer_del() runs at that moment, it will fail to detect timer->it.cpu.firing != 0 because cpu_timer_task_rcu() and/or lock_task_sighand() will fail. The fix adds a tsk->exit_state check to run_posix_cpu_timers().(CVE-2025-38352)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: Validate UAC3 power domain descriptors, too
UAC3 power domain descriptors need to be verified with its variable bLength for avoiding the unexpected OOB accesses by malicious firmware, too.(CVE-2025-38729)
In the Linux kernel, the following vulnerability has been resolved:
scsi: qla4xxx: Prevent a potential error pointer dereference
The qla4xxx_get_ep_fwdb() function is supposed to return NULL on error, but qla4xxx_ep_connect() returns error pointers. Propagating the error pointers will lead to an Oops in the caller, so change the error pointers to NULL.(CVE-2025-39676)
A buffer overflow vulnerability was found in the efivarfs component of the Linux kernel. When dentry->d_name.len < EFI_VARIABLE_GUID_LEN, 'guid' may become negative, causing out-of-bounds reads. This vulnerability can be triggered by parallel search using invalid file names, causing kernel memory to be accessed out of bounds.(CVE-2025-39817)
| URL | Type | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2510.4.0.0349.oe2003sp4.src.rpm"
],
"x86_64": [
"bpftool-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2510.4.0.0349.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2510.4.0.0349.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet/tunnel: wait until all sk_user_data reader finish before releasing the sock\n\nThere is a race condition in vxlan that when deleting a vxlan device\nduring receiving packets, there is a possibility that the sock is\nreleased after getting vxlan_sock vs from sk_user_data. Then in\nlater vxlan_ecn_decapsulate(), vxlan_get_sk_family() we will got\nNULL pointer dereference. e.g.\n\n #0 [ffffa25ec6978a38] machine_kexec at ffffffff8c669757\n #1 [ffffa25ec6978a90] __crash_kexec at ffffffff8c7c0a4d\n #2 [ffffa25ec6978b58] crash_kexec at ffffffff8c7c1c48\n #3 [ffffa25ec6978b60] oops_end at ffffffff8c627f2b\n #4 [ffffa25ec6978b80] page_fault_oops at ffffffff8c678fcb\n #5 [ffffa25ec6978bd8] exc_page_fault at ffffffff8d109542\n #6 [ffffa25ec6978c00] asm_exc_page_fault at ffffffff8d200b62\n [exception RIP: vxlan_ecn_decapsulate+0x3b]\n RIP: ffffffffc1014e7b RSP: ffffa25ec6978cb0 RFLAGS: 00010246\n RAX: 0000000000000008 RBX: ffff8aa000888000 RCX: 0000000000000000\n RDX: 000000000000000e RSI: ffff8a9fc7ab803e RDI: ffff8a9fd1168700\n RBP: ffff8a9fc7ab803e R8: 0000000000700000 R9: 00000000000010ae\n R10: ffff8a9fcb748980 R11: 0000000000000000 R12: ffff8a9fd1168700\n R13: ffff8aa000888000 R14: 00000000002a0000 R15: 00000000000010ae\n ORIG_RAX: ffffffffffffffff CS: 0010 SS: 0018\n #7 [ffffa25ec6978ce8] vxlan_rcv at ffffffffc10189cd [vxlan]\n #8 [ffffa25ec6978d90] udp_queue_rcv_one_skb at ffffffff8cfb6507\n #9 [ffffa25ec6978dc0] udp_unicast_rcv_skb at ffffffff8cfb6e45\n #10 [ffffa25ec6978dc8] __udp4_lib_rcv at ffffffff8cfb8807\n #11 [ffffa25ec6978e20] ip_protocol_deliver_rcu at ffffffff8cf76951\n #12 [ffffa25ec6978e48] ip_local_deliver at ffffffff8cf76bde\n #13 [ffffa25ec6978ea0] __netif_receive_skb_one_core at ffffffff8cecde9b\n #14 [ffffa25ec6978ec8] process_backlog at ffffffff8cece139\n #15 [ffffa25ec6978f00] __napi_poll at ffffffff8ceced1a\n #16 [ffffa25ec6978f28] net_rx_action at ffffffff8cecf1f3\n #17 [ffffa25ec6978fa0] __softirqentry_text_start at ffffffff8d4000ca\n #18 [ffffa25ec6978ff0] do_softirq at ffffffff8c6fbdc3\n\nReproducer: https://github.com/Mellanox/ovs-tests/blob/master/test-ovs-vxlan-remove-tunnel-during-traffic.sh\n\nFix this by waiting for all sk_user_data reader to finish before\nreleasing the sock.(CVE-2022-50405)\n\nIn the Linux kernel, there is a vulnerability in the USB host controller interface (xHCI). When the xHC host is dying or being removed, endpoints are not properly cleaned up, remaining in the bandwidth list when freeing the virtual device. This causes a list_del corruption kernel crash when unbinding xhci-pci, as xhci_mem_cleanup() later attempts to delete already freed endpoints from the bandwidth list. This vulnerability only affects hosts that use software bandwidth checking, which currently is only the xHC in Intel Panther Point PCH (Ivy Bridge).(CVE-2022-50470)\n\nIn the Linux kernel, the following vulnerability has been resolved:thermal: intel_powerclamp: Use get_cpu() instead of smp_processor_id() to avoid crashWhen CPU 0 is offline and intel_powerclamp is used to injectidle, it generates kernel BUG:BUG: using smp_processor_id() in preemptible [00000000] code: bash/15687caller is debug_smp_processor_id+0x17/0x20CPU: 4 PID: 15687 Comm: bash Not tainted 5.19.0-rc7+ #57Call Trace:\u0026lt;TASK\u0026gt;dump_stack_lvl+0x49/0x63dump_stack+0x10/0x16check_preemption_disabled+0xdd/0xe0debug_smp_processor_id+0x17/0x20powerclamp_set_cur_state+0x7f/0xf9 [intel_powerclamp]......Here CPU 0 is the control CPU by default and changed to the current CPU,if CPU 0 offlined. This check has to be performed under cpus_read_lock(),hence the above warning.Use get_cpu() instead of smp_processor_id() to avoid this BUG.[ rjw: Subject edits ](CVE-2022-50494)\n\nIn the Linux kernel, the following vulnerability has been resolved:iommu/amd: Fix pci device refcount leak in ppr_notifier()As comment of pci_get_domain_bus_and_slot() says, it returnsa pci device with refcount increment, when finish using it,the caller must decrement the reference count by callingpci_dev_put(). So call it before returning from ppr_notifier()to avoid refcount leak.(CVE-2022-50505)\n\nIn the Linux kernel, the following vulnerability has been resolved:usb: host: xhci: Fix potential memory leak in xhci_alloc_stream_info()xhci_alloc_stream_info() allocates stream context array for stream_info-\u0026gt;stream_ctx_array with xhci_alloc_stream_ctx(). When some error occurs,stream_info-\u0026gt;stream_ctx_array is not released, which will lead to amemory leak.We can fix it by releasing the stream_info-\u0026gt;stream_ctx_array withxhci_free_stream_ctx() on the error path to avoid the potential memoryleak.(CVE-2022-50544)\n\nIn the Linux kernel, the following vulnerability has been resolved:mtd: Fix device name leak when register device failed in add_mtd_device()There is a kmemleak when register device failed: unreferenced object 0xffff888101aab550 (size 8): comm insmod , pid 3922, jiffies 4295277753 (age 925.408s) hex dump (first 8 bytes): 6d 74 64 30 00 88 ff ff mtd0.... backtrace: [\u0026lt;00000000bde26724\u0026gt;] __kmalloc_node_track_caller+0x4e/0x150 [\u0026lt;000000003c32b416\u0026gt;] kvasprintf+0xb0/0x130 [\u0026lt;000000001f7a8f15\u0026gt;] kobject_set_name_vargs+0x2f/0xb0 [\u0026lt;000000006e781163\u0026gt;] dev_set_name+0xab/0xe0 [\u0026lt;00000000e30d0c78\u0026gt;] add_mtd_device+0x4bb/0x700 [\u0026lt;00000000f3d34de7\u0026gt;] mtd_device_parse_register+0x2ac/0x3f0 [\u0026lt;00000000c0d88488\u0026gt;] 0xffffffffa0238457 [\u0026lt;00000000b40d0922\u0026gt;] 0xffffffffa02a008f [\u0026lt;0000000023d17b9d\u0026gt;] do_one_initcall+0x87/0x2a0 [\u0026lt;00000000770f6ca6\u0026gt;] do_init_module+0xdf/0x320 [\u0026lt;000000007b6768fe\u0026gt;] load_module+0x2f98/0x3330 [\u0026lt;00000000346bed5a\u0026gt;] __do_sys_finit_module+0x113/0x1b0 [\u0026lt;00000000674c2290\u0026gt;] do_syscall_64+0x35/0x80 [\u0026lt;000000004c6a8d97\u0026gt;] entry_SYSCALL_64_after_hwframe+0x46/0xb0If register device failed, should call put_device() to give up thereference.(CVE-2022-50566)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nubi: ensure that VID header offset + VID header size \u0026lt;= alloc, size\n\nEnsure that the VID header offset + VID header size does not exceed\nthe allocated area to avoid slab OOB.\n\nBUG: KASAN: slab-out-of-bounds in crc32_body lib/crc32.c:111 [inline]\nBUG: KASAN: slab-out-of-bounds in crc32_le_generic lib/crc32.c:179 [inline]\nBUG: KASAN: slab-out-of-bounds in crc32_le_base+0x58c/0x626 lib/crc32.c:197\nRead of size 4 at addr ffff88802bb36f00 by task syz-executor136/1555\n\nCPU: 2 PID: 1555 Comm: syz-executor136 Tainted: G W\n6.0.0-1868 #1\nHardware name: Red Hat KVM, BIOS 1.13.0-2.module+el8.3.0+7860+a7792d29\n04/01/2014\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:88 [inline]\n dump_stack_lvl+0x85/0xad lib/dump_stack.c:106\n print_address_description mm/kasan/report.c:317 [inline]\n print_report.cold.13+0xb6/0x6bb mm/kasan/report.c:433\n kasan_report+0xa7/0x11b mm/kasan/report.c:495\n crc32_body lib/crc32.c:111 [inline]\n crc32_le_generic lib/crc32.c:179 [inline]\n crc32_le_base+0x58c/0x626 lib/crc32.c:197\n ubi_io_write_vid_hdr+0x1b7/0x472 drivers/mtd/ubi/io.c:1067\n create_vtbl+0x4d5/0x9c4 drivers/mtd/ubi/vtbl.c:317\n create_empty_lvol drivers/mtd/ubi/vtbl.c:500 [inline]\n ubi_read_volume_table+0x67b/0x288a drivers/mtd/ubi/vtbl.c:812\n ubi_attach+0xf34/0x1603 drivers/mtd/ubi/attach.c:1601\n ubi_attach_mtd_dev+0x6f3/0x185e drivers/mtd/ubi/build.c:965\n ctrl_cdev_ioctl+0x2db/0x347 drivers/mtd/ubi/cdev.c:1043\n vfs_ioctl fs/ioctl.c:51 [inline]\n __do_sys_ioctl fs/ioctl.c:870 [inline]\n __se_sys_ioctl fs/ioctl.c:856 [inline]\n __x64_sys_ioctl+0x193/0x213 fs/ioctl.c:856\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3e/0x86 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0x0\nRIP: 0033:0x7f96d5cf753d\nCode:\nRSP: 002b:00007fffd72206f8 EFLAGS: 00000246 ORIG_RAX: 0000000000000010\nRAX: ffffffffffffffda RBX: 0000000000000000 RCX: 00007f96d5cf753d\nRDX: 0000000020000080 RSI: 0000000040186f40 RDI: 0000000000000003\nRBP: 0000000000400cd0 R08: 0000000000000000 R09: 0000000000000000\nR10: 0000000000000000 R11: 0000000000000246 R12: 0000000000400be0\nR13: 00007fffd72207e0 R14: 0000000000000000 R15: 0000000000000000\n \u0026lt;/TASK\u0026gt;\n\nAllocated by task 1555:\n kasan_save_stack+0x20/0x3d mm/kasan/common.c:38\n kasan_set_track mm/kasan/common.c:45 [inline]\n set_alloc_info mm/kasan/common.c:437 [inline]\n ____kasan_kmalloc mm/kasan/common.c:516 [inline]\n __kasan_kmalloc+0x88/0xa3 mm/kasan/common.c:525\n kasan_kmalloc include/linux/kasan.h:234 [inline]\n __kmalloc+0x138/0x257 mm/slub.c:4429\n kmalloc include/linux/slab.h:605 [inline]\n ubi_alloc_vid_buf drivers/mtd/ubi/ubi.h:1093 [inline]\n create_vtbl+0xcc/0x9c4 drivers/mtd/ubi/vtbl.c:295\n create_empty_lvol drivers/mtd/ubi/vtbl.c:500 [inline]\n ubi_read_volume_table+0x67b/0x288a drivers/mtd/ubi/vtbl.c:812\n ubi_attach+0xf34/0x1603 drivers/mtd/ubi/attach.c:1601\n ubi_attach_mtd_dev+0x6f3/0x185e drivers/mtd/ubi/build.c:965\n ctrl_cdev_ioctl+0x2db/0x347 drivers/mtd/ubi/cdev.c:1043\n vfs_ioctl fs/ioctl.c:51 [inline]\n __do_sys_ioctl fs/ioctl.c:870 [inline]\n __se_sys_ioctl fs/ioctl.c:856 [inline]\n __x64_sys_ioctl+0x193/0x213 fs/ioctl.c:856\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3e/0x86 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0x0\n\nThe buggy address belongs to the object at ffff88802bb36e00\n which belongs to the cache kmalloc-256 of size 256\nThe buggy address is located 0 bytes to the right of\n 256-byte region [ffff88802bb36e00, ffff88802bb36f00)\n\nThe buggy address belongs to the physical page:\npage:00000000ea4d1263 refcount:1 mapcount:0 mapping:0000000000000000\nindex:0x0 pfn:0x2bb36\nhead:00000000ea4d1263 order:1 compound_mapcount:0 compound_pincount:0\nflags: 0xfffffc0010200(slab|head|node=0|zone=1|lastcpupid=0x1fffff)\nraw: 000fffffc0010200 ffffea000066c300 dead000000000003 ffff888100042b40\nraw: 0000000000000000 00000000001\n---truncated---(CVE-2023-53265)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nubi: Fix unreferenced object reported by kmemleak in ubi_resize_volume()\n\nThere is a memory leaks problem reported by kmemleak:\n\nunreferenced object 0xffff888102007a00 (size 128):\n comm \u0026quot;ubirsvol\u0026quot;, pid 32090, jiffies 4298464136 (age 2361.231s)\n hex dump (first 32 bytes):\nff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ................\nff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ff ................\n backtrace:\n[\u0026lt;ffffffff8176cecd\u0026gt;] __kmalloc+0x4d/0x150\n[\u0026lt;ffffffffa02a9a36\u0026gt;] ubi_eba_create_table+0x76/0x170 [ubi]\n[\u0026lt;ffffffffa029764e\u0026gt;] ubi_resize_volume+0x1be/0xbc0 [ubi]\n[\u0026lt;ffffffffa02a3321\u0026gt;] ubi_cdev_ioctl+0x701/0x1850 [ubi]\n[\u0026lt;ffffffff81975d2d\u0026gt;] __x64_sys_ioctl+0x11d/0x170\n[\u0026lt;ffffffff83c142a5\u0026gt;] do_syscall_64+0x35/0x80\n[\u0026lt;ffffffff83e0006a\u0026gt;] entry_SYSCALL_64_after_hwframe+0x46/0xb0\n\nThis is due to a mismatch between create and destroy interfaces, and\nin detail that \u0026quot;new_eba_tbl\u0026quot; created by ubi_eba_create_table() but\ndestroyed by kfree(), while will causing \u0026quot;new_eba_tbl-\u0026gt;entries\u0026quot; not\nfreed.\n\nFix it by replacing kfree(new_eba_tbl) with\nubi_eba_destroy_table(new_eba_tbl)(CVE-2023-53271)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: check send stream number after wait_for_sndbuf\n\nThis patch fixes a corner case where the asoc out stream count may change\nafter wait_for_sndbuf.\n\nWhen the main thread in the client starts a connection, if its out stream\ncount is set to N while the in stream count in the server is set to N - 2,\nanother thread in the client keeps sending the msgs with stream number\nN - 1, and waits for sndbuf before processing INIT_ACK.\n\nHowever, after processing INIT_ACK, the out stream count in the client is\nshrunk to N - 2, the same to the in stream count in the server. The crash\noccurs when the thread waiting for sndbuf is awake and sends the msg in a\nnon-existing stream(N - 1), the call trace is as below:\n\n KASAN: null-ptr-deref in range [0x0000000000000038-0x000000000000003f]\n Call Trace:\n \u0026lt;TASK\u0026gt;\n sctp_cmd_send_msg net/sctp/sm_sideeffect.c:1114 [inline]\n sctp_cmd_interpreter net/sctp/sm_sideeffect.c:1777 [inline]\n sctp_side_effects net/sctp/sm_sideeffect.c:1199 [inline]\n sctp_do_sm+0x197d/0x5310 net/sctp/sm_sideeffect.c:1170\n sctp_primitive_SEND+0x9f/0xc0 net/sctp/primitive.c:163\n sctp_sendmsg_to_asoc+0x10eb/0x1a30 net/sctp/socket.c:1868\n sctp_sendmsg+0x8d4/0x1d90 net/sctp/socket.c:2026\n inet_sendmsg+0x9d/0xe0 net/ipv4/af_inet.c:825\n sock_sendmsg_nosec net/socket.c:722 [inline]\n sock_sendmsg+0xde/0x190 net/socket.c:745\n\nThe fix is to add an unlikely check for the send stream number after the\nthread wakes up from the wait_for_sndbuf.(CVE-2023-53296)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nsctp: fix a potential overflow in sctp_ifwdtsn_skip\n\nCurrently, when traversing ifwdtsn skips with _sctp_walk_ifwdtsn, it only\nchecks the pos against the end of the chunk. However, the data left for\nthe last pos may be \u0026lt; sizeof(struct sctp_ifwdtsn_skip), and dereference\nit as struct sctp_ifwdtsn_skip may cause coverflow.\n\nThis patch fixes it by checking the pos against \u0026quot;the end of the chunk -\nsizeof(struct sctp_ifwdtsn_skip)\u0026quot; in sctp_ifwdtsn_skip, similar to\nsctp_fwdtsn_skip.(CVE-2023-53372)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: mwifiex: avoid possible NULL skb pointer dereference\n\nIn \u0026apos;mwifiex_handle_uap_rx_forward()\u0026apos;, always check the value\nreturned by \u0026apos;skb_copy()\u0026apos; to avoid potential NULL pointer\ndereference in \u0026apos;mwifiex_uap_queue_bridged_pkt()\u0026apos;, and drop\noriginal skb in case of copying failure.\n\nFound by Linux Verification Center (linuxtesting.org) with SVACE.(CVE-2023-53384)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/radeon: free iio for atombios when driver shutdown\n\nFix below kmemleak when unload radeon driver:\n\nunreferenced object 0xffff9f8608ede200 (size 512):\n comm \u0026quot;systemd-udevd\u0026quot;, pid 326, jiffies 4294682822 (age 716.338s)\n hex dump (first 32 bytes):\n 00 00 00 00 c4 aa ec aa 14 ab 00 00 00 00 00 00 ................\n 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................\n backtrace:\n [\u0026lt;0000000062fadebe\u0026gt;] kmem_cache_alloc_trace+0x2f1/0x500\n [\u0026lt;00000000b6883cea\u0026gt;] atom_parse+0x117/0x230 [radeon]\n [\u0026lt;00000000158c23fd\u0026gt;] radeon_atombios_init+0xab/0x170 [radeon]\n [\u0026lt;00000000683f672e\u0026gt;] si_init+0x57/0x750 [radeon]\n [\u0026lt;00000000566cc31f\u0026gt;] radeon_device_init+0x559/0x9c0 [radeon]\n [\u0026lt;0000000046efabb3\u0026gt;] radeon_driver_load_kms+0xc1/0x1a0 [radeon]\n [\u0026lt;00000000b5155064\u0026gt;] drm_dev_register+0xdd/0x1d0\n [\u0026lt;0000000045fec835\u0026gt;] radeon_pci_probe+0xbd/0x100 [radeon]\n [\u0026lt;00000000e69ecca3\u0026gt;] pci_device_probe+0xe1/0x160\n [\u0026lt;0000000019484b76\u0026gt;] really_probe.part.0+0xc1/0x2c0\n [\u0026lt;000000003f2649da\u0026gt;] __driver_probe_device+0x96/0x130\n [\u0026lt;00000000231c5bb1\u0026gt;] driver_probe_device+0x24/0xf0\n [\u0026lt;0000000000a42377\u0026gt;] __driver_attach+0x77/0x190\n [\u0026lt;00000000d7574da6\u0026gt;] bus_for_each_dev+0x7f/0xd0\n [\u0026lt;00000000633166d2\u0026gt;] driver_attach+0x1e/0x30\n [\u0026lt;00000000313b05b8\u0026gt;] bus_add_driver+0x12c/0x1e0\n\niio was allocated in atom_index_iio() called by atom_parse(),\nbut it doesn\u0026apos;t got released when the dirver is shutdown.\nFix this kmemleak by free it in radeon_atombios_fini().(CVE-2023-53453)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nubi: ubi_wl_put_peb: Fix infinite loop when wear-leveling work failed\n\nFollowing process will trigger an infinite loop in ubi_wl_put_peb():\n\n\tubifs_bgt\t\tubi_bgt\nubifs_leb_unmap\n ubi_leb_unmap\n ubi_eba_unmap_leb\n ubi_wl_put_peb\twear_leveling_worker\n e1 = rb_entry(rb_first(\u0026amp;ubi-\u0026gt;used)\n\t\t\t e2 = get_peb_for_wl(ubi)\n\t\t\t ubi_io_read_vid_hdr // return err (flash fault)\n\t\t\t out_error:\n\t\t\t ubi-\u0026gt;move_from = ubi-\u0026gt;move_to = NULL\n\t\t\t wl_entry_destroy(ubi, e1)\n\t\t\t ubi-\u0026gt;lookuptbl[e-\u0026gt;pnum] = NULL\n retry:\n e = ubi-\u0026gt;lookuptbl[pnum];\t// return NULL\n\tif (e == ubi-\u0026gt;move_from) {\t// NULL == NULL gets true\n\t goto retry;\t\t\t// infinite loop !!!\n\n$ top\n PID USER PR NI VIRT RES SHR S %CPU %MEM COMMAND\n 7676 root 20 0 0 0 0 R 100.0 0.0 ubifs_bgt0_0\n\nFix it by:\n 1) Letting ubi_wl_put_peb() returns directly if wearl leveling entry has\n been removed from \u0026apos;ubi-\u0026gt;lookuptbl\u0026apos;.\n 2) Using \u0026apos;ubi-\u0026gt;wl_lock\u0026apos; protecting wl entry deletion to preventing an\n use-after-free problem for wl entry in ubi_wl_put_peb().\n\nFetch a reproducer in [Link].(CVE-2023-53481)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nvirtio-mmio: don\u0026apos;t break lifecycle of vm_dev\n\nvm_dev has a separate lifecycle because it has a \u0026apos;struct device\u0026apos;\nembedded. Thus, having a release callback for it is correct.\n\nAllocating the vm_dev struct with devres totally breaks this protection,\nthough. Instead of waiting for the vm_dev release callback, the memory\nis freed when the platform_device is removed. Resulting in a\nuse-after-free when finally the callback is to be called.\n\nTo easily see the problem, compile the kernel with\nCONFIG_DEBUG_KOBJECT_RELEASE and unbind with sysfs.\n\nThe fix is easy, don\u0026apos;t use devres in this case.\n\nFound during my research about object lifetime problems.(CVE-2023-53515)\n\nIn the Linux kernel, the following vulnerability has been resolved:spi: qup: Don t skip cleanup in remove s error pathReturning early in a platform driver s remove callback is wrong. In thiscase the dma resources are not released in the error path. this is neverretried later and so this is a permanent leak. To fix this, only skiphardware disabling if waking the device fails.(CVE-2023-53567)\n\nIn the Linux kernel, the following vulnerability has been resolved:dm integrity: call kmem_cache_destroy() in dm_integrity_init() error pathOtherwise the journal_io_cache will leak if dm_register_target() fails.(CVE-2023-53604)\n\nIn the Linux kernel, the following vulnerability has been resolved:ALSA: ac97: Fix possible NULL dereference in snd_ac97_mixersmatch error:sound/pci/ac97/ac97_codec.c:2354 snd_ac97_mixer() error:we previously assumed rac97 could be null (see line 2072)remove redundant assignment, return error if rac97 is NULL.(CVE-2023-53648)\n\nIn the Linux kernel, the following vulnerability has been resolved:bcache: Fix __bch_btree_node_alloc to make the failure behavior consistentIn some specific situations, the return value of __bch_btree_node_allocmay be NULL. This may lead to a potential NULL pointer dereference incaller function like a calling chain :btree_split-\u0026gt;bch_btree_node_alloc-\u0026gt;__bch_btree_node_alloc.Fix it by initializing the return value in __bch_btree_node_alloc.(CVE-2023-53681)\n\nIn the Linux kernel, the following vulnerability has been resolved:serial: arc_uart: fix of_iomap leak in `arc_serial_probe`Smatch reports:drivers/tty/serial/arc_uart.c:631 arc_serial_probe() warn: port-\u0026gt;membase from of_iomap() not released on lines: 631.In arc_serial_probe(), if uart_add_one_port() fails,port-\u0026gt;membase is not released, which would cause a resource leak.To fix this, I replace of_iomap with devm_platform_ioremap_resource.(CVE-2023-53719)\n\nIn the Linux kernel, the following vulnerability has been resolved:posix-timers: Ensure timer ID search-loop limit is validposix_timer_add() tries to allocate a posix timer ID by starting from thecached ID which was stored by the last successful allocation.This is done in a loop searching the ID space for a free slot one byone. The loop has to terminate when the search wrapped around to thestarting point.But that s racy vs. establishing the starting point. That is read outlockless, which leads to the following problem:CPU0 CPU1posix_timer_add() start = sig-\u0026gt;posix_timer_id; lock(hash_lock); ... posix_timer_add() if (++sig-\u0026gt;posix_timer_id \u0026lt; 0) start = sig-\u0026gt;posix_timer_id; sig-\u0026gt;posix_timer_id = 0;So CPU1 can observe a negative start value, i.e. -1, and the loop breaknever happens because the condition can never be true: if (sig-\u0026gt;posix_timer_id == start) break;While this is unlikely to ever turn into an endless loop as the ID space ishuge (INT_MAX), the racy read of the start value caught the attention ofKCSAN and Dmitry unearthed that incorrectness.Rewrite it so that all id operations are under the hash lock.(CVE-2023-53728)\n\nIn the Linux kernel, the following vulnerability has been resolved:sunrpc: fix one UAF issue caused by sunrpc kernel tcp socketBUG: KASAN: slab-use-after-free in tcp_write_timer_handler+0x156/0x3e0Read of size 1 at addr ffff888111f322cd by task swapper/0/0CPU: 0 UID: 0 PID: 0 Comm: swapper/0 Not tainted 6.12.0-rc4-dirty #7Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.15.0-1Call Trace: \u0026lt;IRQ\u0026gt; dump_stack_lvl+0x68/0xa0 print_address_description.constprop.0+0x2c/0x3d0 print_report+0xb4/0x270 kasan_report+0xbd/0xf0 tcp_write_timer_handler+0x156/0x3e0 tcp_write_timer+0x66/0x170 call_timer_fn+0xfb/0x1d0 __run_timers+0x3f8/0x480 run_timer_softirq+0x9b/0x100 handle_softirqs+0x153/0x390 __irq_exit_rcu+0x103/0x120 irq_exit_rcu+0xe/0x20 sysvec_apic_timer_interrupt+0x76/0x90 \u0026lt;/IRQ\u0026gt; \u0026lt;TASK\u0026gt; asm_sysvec_apic_timer_interrupt+0x1a/0x20RIP: 0010:default_idle+0xf/0x20Code: 4c 01 c7 4c 29 c2 e9 72 ff ff ff 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 90 f3 0f 1e fa 66 90 0f 00 2d 33 f8 25 00 fb f4 \u0026lt;fa\u0026gt; c3 cc cc cc cc 66 66 2e 0f 1f 84 00 00 00 00 00 90 90 90 90 90RSP: 0018:ffffffffa2007e28 EFLAGS: 00000242RAX: 00000000000f3b31 RBX: 1ffffffff4400fc7 RCX: ffffffffa09c3196RDX: 0000000000000000 RSI: 0000000000000000 RDI: ffffffff9f00590fRBP: 0000000000000000 R08: 0000000000000001 R09: ffffed102360835dR10: ffff88811b041aeb R11: 0000000000000001 R12: 0000000000000000R13: ffffffffa202d7c0 R14: 0000000000000000 R15: 00000000000147d0 default_idle_call+0x6b/0xa0 cpuidle_idle_call+0x1af/0x1f0 do_idle+0xbc/0x130 cpu_startup_entry+0x33/0x40 rest_init+0x11f/0x210 start_kernel+0x39a/0x420 x86_64_start_reservations+0x18/0x30 x86_64_start_kernel+0x97/0xa0 common_startup_64+0x13e/0x141 \u0026lt;/TASK\u0026gt;Allocated by task 595: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 __kasan_slab_alloc+0x87/0x90 kmem_cache_alloc_noprof+0x12b/0x3f0 copy_net_ns+0x94/0x380 create_new_namespaces+0x24c/0x500 unshare_nsproxy_namespaces+0x75/0xf0 ksys_unshare+0x24e/0x4f0 __x64_sys_unshare+0x1f/0x30 do_syscall_64+0x70/0x180 entry_SYSCALL_64_after_hwframe+0x76/0x7eFreed by task 100: kasan_save_stack+0x24/0x50 kasan_save_track+0x14/0x30 kasan_save_free_info+0x3b/0x60 __kasan_slab_free+0x54/0x70 kmem_cache_free+0x156/0x5d0 cleanup_net+0x5d3/0x670 process_one_work+0x776/0xa90 worker_thread+0x2e2/0x560 kthread+0x1a8/0x1f0 ret_from_fork+0x34/0x60 ret_from_fork_asm+0x1a/0x30Reproduction script:mkdir -p /mnt/nfssharemkdir -p /mnt/nfs/netns_1mkfs.ext4 /dev/sdbmount /dev/sdb /mnt/nfssharesystemctl restart nfs-serverchmod 777 /mnt/nfsshareexportfs -i -o rw,no_root_squash *:/mnt/nfsshareip netns add netns_1ip link add name veth_1_peer type veth peer veth_1ifconfig veth_1_peer 11.11.0.254 upip link set veth_1 netns netns_1ip netns exec netns_1 ifconfig veth_1 11.11.0.1ip netns exec netns_1 /root/iptables -A OUTPUT -d 11.11.0.254 -p tcp --tcp-flags FIN FIN -j DROP(note: In my environment, a DESTROY_CLIENTID operation is always sent immediately, breaking the nfs tcp connection.)ip netns exec netns_1 timeout -s 9 300 mount -t nfs -o proto=tcp,vers=4.1 11.11.0.254:/mnt/nfsshare /mnt/nfs/netns_1ip netns del netns_1The reason here is that the tcp socket in netns_1 (nfs side) has beenshutdown and closed (done in xs_destroy), but the FIN message (with ack)is discarded, and the nfsd side keeps sending retransmission messages.As a result, when the tcp sock in netns_1 processes the received message,it sends the message (FIN message) in the sending queue, and the tcp timeris re-established. When the network namespace is deleted, the net structureaccessed by tcp s timer handler function causes problems.To fix this problem, let s hold netns refcnt for the tcp kernel socket asdone in other modules. This is an ugly hack which can easily be backportedto earlier kernels. A proper fix which cleans up the interfaces willfollow, but may not be so easy to backport.(CVE-2024-53168)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: atm: fix /proc/net/atm/lec handling\n\n/proc/net/atm/lec must ensure safety against dev_lec[] changes.\n\nIt appears it had dev_put() calls without prior dev_hold(),\nleading to imbalance and UAF.(CVE-2025-38180)\n\nIn the Linux kernel, a race condition vulnerability exists in the posix-cpu-timers component. When a non-autoreaping exiting task has passed exit_notify() and calls handle_posix_cpu_timers() from IRQ, it can be reaped by its parent or debugger immediately after unlock_task_sighand(). If a concurrent posix_cpu_timer_del() runs at that moment, it will fail to detect timer-\u0026gt;it.cpu.firing != 0 because cpu_timer_task_rcu() and/or lock_task_sighand() will fail. The fix adds a tsk-\u0026gt;exit_state check to run_posix_cpu_timers().(CVE-2025-38352)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: usb-audio: Validate UAC3 power domain descriptors, too\n\nUAC3 power domain descriptors need to be verified with its variable\nbLength for avoiding the unexpected OOB accesses by malicious\nfirmware, too.(CVE-2025-38729)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: qla4xxx: Prevent a potential error pointer dereference\n\nThe qla4xxx_get_ep_fwdb() function is supposed to return NULL on error,\nbut qla4xxx_ep_connect() returns error pointers. Propagating the error\npointers will lead to an Oops in the caller, so change the error pointers\nto NULL.(CVE-2025-39676)\n\nA buffer overflow vulnerability was found in the efivarfs component of the Linux kernel. When dentry-\u0026gt;d_name.len \u0026lt; EFI_VARIABLE_GUID_LEN, \u0026amp;#39;guid\u0026amp;#39; may become negative, causing out-of-bounds reads. This vulnerability can be triggered by parallel search using invalid file names, causing kernel memory to be accessed out of bounds.(CVE-2025-39817)",
"id": "OESA-2025-2553",
"modified": "2026-08-06T11:09:38Z",
"published": "2025-10-31T11:09:38Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-2553"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50405"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50470"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50494"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50505"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50544"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50566"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53265"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53271"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53296"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53372"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53384"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53453"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53481"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53515"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53567"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53604"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53648"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53681"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53719"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53728"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2024-53168"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38180"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38352"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-38729"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39676"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39817"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-50405",
"CVE-2022-50470",
"CVE-2022-50494",
"CVE-2022-50505",
"CVE-2022-50544",
"CVE-2022-50566",
"CVE-2023-53265",
"CVE-2023-53271",
"CVE-2023-53296",
"CVE-2023-53372",
"CVE-2023-53384",
"CVE-2023-53453",
"CVE-2023-53481",
"CVE-2023-53515",
"CVE-2023-53567",
"CVE-2023-53604",
"CVE-2023-53648",
"CVE-2023-53681",
"CVE-2023-53719",
"CVE-2023-53728",
"CVE-2024-53168",
"CVE-2025-38180",
"CVE-2025-38352",
"CVE-2025-38729",
"CVE-2025-39676",
"CVE-2025-39817"
]
}
SUSE-SU-2025:03600-1
Vulnerability from csaf_suse - Published: 2025-10-15 12:54 - Updated: 2026-09-20 17:51Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.