Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2023-53344 (GCVE-0-2023-53344)
Vulnerability from cvelistv5 – Published: 2025-09-17 14:56 – Updated: 2026-05-11 19:43- CWE-908 - Use of Uninitialized Resource
| Vendor | Product | Version | CPE status | |
|---|---|---|---|---|
| Linux | Linux |
Affected:
6f3b911d5f29b98752e5da86a295210c0c4f4e14 , < 3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be
(git)
Affected: 6f3b911d5f29b98752e5da86a295210c0c4f4e14 , < 618b15d09fed6126356101543451d49860db4388 (git) Affected: 6f3b911d5f29b98752e5da86a295210c0c4f4e14 , < 78bc7f0ab99458221224d3ab97199c0f8e6861f1 (git) Affected: 6f3b911d5f29b98752e5da86a295210c0c4f4e14 , < ab2a55907823f0bca56b6d03ea05e4071ba8535f (git) Affected: 6f3b911d5f29b98752e5da86a295210c0c4f4e14 , < bf70e0eab64c625da84d9fdf4e84466b79418920 (git) Affected: 6f3b911d5f29b98752e5da86a295210c0c4f4e14 , < c11dbc7705b3739974ac31a13f4ab81e61a5fb07 (git) Affected: 6f3b911d5f29b98752e5da86a295210c0c4f4e14 , < 2e6ad51c709fa794e0ce26003c9c9cd944e3383a (git) Affected: 6f3b911d5f29b98752e5da86a295210c0c4f4e14 , < 2b4c99f7d9a57ecd644eda9b1fb0a1072414959f (git) |
guessed | |
| Linux | Linux |
Affected:
4.8
Unaffected: 0 , < 4.8 (semver) Unaffected: 4.14.312 , ≤ 4.14.* (semver) Unaffected: 4.19.280 , ≤ 4.19.* (semver) Unaffected: 5.4.240 , ≤ 5.4.* (semver) Unaffected: 5.10.177 , ≤ 5.10.* (semver) Unaffected: 5.15.106 , ≤ 5.15.* (semver) Unaffected: 6.1.23 , ≤ 6.1.* (semver) Unaffected: 6.2.10 , ≤ 6.2.* (semver) Unaffected: 6.3 , ≤ * (original_commit_for_fix) |
guessed |
{
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2023-53344",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T18:39:34.603082Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-908",
"description": "CWE-908 Use of Uninitialized Resource",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-01-14T18:43:02.515Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/can/bcm.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "618b15d09fed6126356101543451d49860db4388",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "78bc7f0ab99458221224d3ab97199c0f8e6861f1",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "ab2a55907823f0bca56b6d03ea05e4071ba8535f",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "bf70e0eab64c625da84d9fdf4e84466b79418920",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "c11dbc7705b3739974ac31a13f4ab81e61a5fb07",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "2e6ad51c709fa794e0ce26003c9c9cd944e3383a",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "2b4c99f7d9a57ecd644eda9b1fb0a1072414959f",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/can/bcm.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.8"
},
{
"lessThan": "4.8",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.14.*",
"status": "unaffected",
"version": "4.14.312",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.280",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.240",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.177",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.106",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.23",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.2.*",
"status": "unaffected",
"version": "6.2.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.3",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.14.312",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.280",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.240",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.177",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.106",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.23",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.2.10",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.3",
"versionStartIncluding": "4.8",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncan: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write\n\nSyzkaller reported the following issue:\n\n=====================================================\nBUG: KMSAN: uninit-value in aio_rw_done fs/aio.c:1520 [inline]\nBUG: KMSAN: uninit-value in aio_write+0x899/0x950 fs/aio.c:1600\n aio_rw_done fs/aio.c:1520 [inline]\n aio_write+0x899/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:766 [inline]\n slab_alloc_node mm/slub.c:3452 [inline]\n __kmem_cache_alloc_node+0x71f/0xce0 mm/slub.c:3491\n __do_kmalloc_node mm/slab_common.c:967 [inline]\n __kmalloc+0x11d/0x3b0 mm/slab_common.c:981\n kmalloc_array include/linux/slab.h:636 [inline]\n bcm_tx_setup+0x80e/0x29d0 net/can/bcm.c:930\n bcm_sendmsg+0x3a2/0xce0 net/can/bcm.c:1351\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n sock_write_iter+0x495/0x5e0 net/socket.c:1108\n call_write_iter include/linux/fs.h:2189 [inline]\n aio_write+0x63a/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nCPU: 1 PID: 5034 Comm: syz-executor350 Not tainted 6.2.0-rc6-syzkaller-80422-geda666ff2276 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/12/2023\n=====================================================\n\nWe can follow the call chain and find that \u0027bcm_tx_setup\u0027 function\ncalls \u0027memcpy_from_msg\u0027 to copy some content to the newly allocated\nframe of \u0027op-\u003eframes\u0027. After that the \u0027len\u0027 field of copied structure\nbeing compared with some constant value (64 or 8). However, if\n\u0027memcpy_from_msg\u0027 returns an error, we will compare some uninitialized\nmemory. This triggers \u0027uninit-value\u0027 issue.\n\nThis patch will add \u0027memcpy_from_msg\u0027 possible errors processing to\navoid uninit-value issue.\n\nTested via syzkaller"
}
],
"providerMetadata": {
"dateUpdated": "2026-05-11T19:43:07.980Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be"
},
{
"url": "https://git.kernel.org/stable/c/618b15d09fed6126356101543451d49860db4388"
},
{
"url": "https://git.kernel.org/stable/c/78bc7f0ab99458221224d3ab97199c0f8e6861f1"
},
{
"url": "https://git.kernel.org/stable/c/ab2a55907823f0bca56b6d03ea05e4071ba8535f"
},
{
"url": "https://git.kernel.org/stable/c/bf70e0eab64c625da84d9fdf4e84466b79418920"
},
{
"url": "https://git.kernel.org/stable/c/c11dbc7705b3739974ac31a13f4ab81e61a5fb07"
},
{
"url": "https://git.kernel.org/stable/c/2e6ad51c709fa794e0ce26003c9c9cd944e3383a"
},
{
"url": "https://git.kernel.org/stable/c/2b4c99f7d9a57ecd644eda9b1fb0a1072414959f"
}
],
"title": "can: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-53344",
"datePublished": "2025-09-17T14:56:37.024Z",
"dateReserved": "2025-09-16T16:08:59.566Z",
"dateUpdated": "2026-05-11T19:43:07.980Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2023-53344",
"date": "2026-09-19",
"epss": "0.00198",
"percentile": "0.09931"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/can/bcm.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "618b15d09fed6126356101543451d49860db4388",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "78bc7f0ab99458221224d3ab97199c0f8e6861f1",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "ab2a55907823f0bca56b6d03ea05e4071ba8535f",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "bf70e0eab64c625da84d9fdf4e84466b79418920",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "c11dbc7705b3739974ac31a13f4ab81e61a5fb07",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "2e6ad51c709fa794e0ce26003c9c9cd944e3383a",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "2b4c99f7d9a57ecd644eda9b1fb0a1072414959f",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/can/bcm.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.8"
},
{
"lessThan": "4.8",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.14.*",
"status": "unaffected",
"version": "4.14.312",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.280",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.240",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.177",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.106",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.23",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.2.*",
"status": "unaffected",
"version": "6.2.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.3",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B3D02741-96A1-4D83-8B57-F48AD85FD045",
"versionEndExcluding": "4.14.312",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B8449DA5-0637-406C-99C3-84AF4CB5F3EB",
"versionEndExcluding": "4.19.280",
"versionStartIncluding": "4.15",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "2C5F51A3-AEBF-4E51-AA58-D8C8B4554A86",
"versionEndExcluding": "5.4.240",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9FED8369-E7A1-48C6-9700-6ADEDEC371F7",
"versionEndExcluding": "5.10.177",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "46A62903-B927-42D9-88F8-7F39EC9BC23B",
"versionEndExcluding": "5.15.106",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "C6396026-EF6B-4933-AF27-B3AFE6E5506D",
"versionEndExcluding": "6.1.23",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "5178A008-E2D6-4093-BCD4-8A80523EE39E",
"versionEndExcluding": "6.2.10",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.3:rc1:*:*:*:*:*:*",
"matchCriteriaId": "B8E3B0E8-FA27-4305-87BB-AF6C25B160CB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.3:rc2:*:*:*:*:*:*",
"matchCriteriaId": "A47F0FC3-CE52-4BA1-BA51-22F783938431",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.3:rc3:*:*:*:*:*:*",
"matchCriteriaId": "3583026A-27EC-4A4C-850A-83F2AF970673",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.3:rc4:*:*:*:*:*:*",
"matchCriteriaId": "DC271202-7570-4505-89A4-D602D47BFD00",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncan: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write\n\nSyzkaller reported the following issue:\n\n=====================================================\nBUG: KMSAN: uninit-value in aio_rw_done fs/aio.c:1520 [inline]\nBUG: KMSAN: uninit-value in aio_write+0x899/0x950 fs/aio.c:1600\n aio_rw_done fs/aio.c:1520 [inline]\n aio_write+0x899/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:766 [inline]\n slab_alloc_node mm/slub.c:3452 [inline]\n __kmem_cache_alloc_node+0x71f/0xce0 mm/slub.c:3491\n __do_kmalloc_node mm/slab_common.c:967 [inline]\n __kmalloc+0x11d/0x3b0 mm/slab_common.c:981\n kmalloc_array include/linux/slab.h:636 [inline]\n bcm_tx_setup+0x80e/0x29d0 net/can/bcm.c:930\n bcm_sendmsg+0x3a2/0xce0 net/can/bcm.c:1351\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n sock_write_iter+0x495/0x5e0 net/socket.c:1108\n call_write_iter include/linux/fs.h:2189 [inline]\n aio_write+0x63a/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nCPU: 1 PID: 5034 Comm: syz-executor350 Not tainted 6.2.0-rc6-syzkaller-80422-geda666ff2276 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/12/2023\n=====================================================\n\nWe can follow the call chain and find that \u0027bcm_tx_setup\u0027 function\ncalls \u0027memcpy_from_msg\u0027 to copy some content to the newly allocated\nframe of \u0027op-\u003eframes\u0027. After that the \u0027len\u0027 field of copied structure\nbeing compared with some constant value (64 or 8). However, if\n\u0027memcpy_from_msg\u0027 returns an error, we will compare some uninitialized\nmemory. This triggers \u0027uninit-value\u0027 issue.\n\nThis patch will add \u0027memcpy_from_msg\u0027 possible errors processing to\navoid uninit-value issue.\n\nTested via syzkaller"
}
],
"id": "CVE-2023-53344",
"lastModified": "2026-06-17T06:44:57.197",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-53344",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T18:39:34.603082Z",
"version": "2.0.3"
}
}
]
},
"published": "2025-09-17T15:15:38.237",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2b4c99f7d9a57ecd644eda9b1fb0a1072414959f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2e6ad51c709fa794e0ce26003c9c9cd944e3383a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/618b15d09fed6126356101543451d49860db4388"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/78bc7f0ab99458221224d3ab97199c0f8e6861f1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ab2a55907823f0bca56b6d03ea05e4071ba8535f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bf70e0eab64c625da84d9fdf4e84466b79418920"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c11dbc7705b3739974ac31a13f4ab81e61a5fb07"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-908"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-908"
}
],
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Low",
"current_release_date": "2026-06-30T10:31:04+00:00",
"cve": "CVE-2023-53344",
"id": "CVE-2023-53344",
"initial_release_date": "2023-01-01T00:00:00+00:00",
"product_status:known_affected": "170",
"product_status:known_not_affected": "104",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: Linux Kernel: Denial of Service in CAN BCM due to uninitialized memory read",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2023/cve-2023-53344.json",
"version": "3"
},
"vulnrichment": {
"containers": {
"adp": [
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2023-53344",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T18:39:34.603082Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-908",
"description": "CWE-908 Use of Uninitialized Resource",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2026-01-14T18:39:30.554Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/can/bcm.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "618b15d09fed6126356101543451d49860db4388",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "78bc7f0ab99458221224d3ab97199c0f8e6861f1",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "ab2a55907823f0bca56b6d03ea05e4071ba8535f",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "bf70e0eab64c625da84d9fdf4e84466b79418920",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "c11dbc7705b3739974ac31a13f4ab81e61a5fb07",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "2e6ad51c709fa794e0ce26003c9c9cd944e3383a",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "2b4c99f7d9a57ecd644eda9b1fb0a1072414959f",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/can/bcm.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.8"
},
{
"lessThan": "4.8",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.14.*",
"status": "unaffected",
"version": "4.14.312",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.280",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.240",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.177",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.106",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.23",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.2.*",
"status": "unaffected",
"version": "6.2.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.3",
"versionType": "original_commit_for_fix"
}
]
}
],
"cpeApplicability": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.14.312",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "4.19.280",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.4.240",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.10.177",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "5.15.106",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.1.23",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.2.10",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"versionEndExcluding": "6.3",
"versionStartIncluding": "4.8",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncan: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write\n\nSyzkaller reported the following issue:\n\n=====================================================\nBUG: KMSAN: uninit-value in aio_rw_done fs/aio.c:1520 [inline]\nBUG: KMSAN: uninit-value in aio_write+0x899/0x950 fs/aio.c:1600\n aio_rw_done fs/aio.c:1520 [inline]\n aio_write+0x899/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:766 [inline]\n slab_alloc_node mm/slub.c:3452 [inline]\n __kmem_cache_alloc_node+0x71f/0xce0 mm/slub.c:3491\n __do_kmalloc_node mm/slab_common.c:967 [inline]\n __kmalloc+0x11d/0x3b0 mm/slab_common.c:981\n kmalloc_array include/linux/slab.h:636 [inline]\n bcm_tx_setup+0x80e/0x29d0 net/can/bcm.c:930\n bcm_sendmsg+0x3a2/0xce0 net/can/bcm.c:1351\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n sock_write_iter+0x495/0x5e0 net/socket.c:1108\n call_write_iter include/linux/fs.h:2189 [inline]\n aio_write+0x63a/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nCPU: 1 PID: 5034 Comm: syz-executor350 Not tainted 6.2.0-rc6-syzkaller-80422-geda666ff2276 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/12/2023\n=====================================================\n\nWe can follow the call chain and find that \u0027bcm_tx_setup\u0027 function\ncalls \u0027memcpy_from_msg\u0027 to copy some content to the newly allocated\nframe of \u0027op-\u003eframes\u0027. After that the \u0027len\u0027 field of copied structure\nbeing compared with some constant value (64 or 8). However, if\n\u0027memcpy_from_msg\u0027 returns an error, we will compare some uninitialized\nmemory. This triggers \u0027uninit-value\u0027 issue.\n\nThis patch will add \u0027memcpy_from_msg\u0027 possible errors processing to\navoid uninit-value issue.\n\nTested via syzkaller"
}
],
"providerMetadata": {
"dateUpdated": "2025-09-17T14:56:37.024Z",
"orgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"shortName": "Linux"
},
"references": [
{
"url": "https://git.kernel.org/stable/c/3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be"
},
{
"url": "https://git.kernel.org/stable/c/618b15d09fed6126356101543451d49860db4388"
},
{
"url": "https://git.kernel.org/stable/c/78bc7f0ab99458221224d3ab97199c0f8e6861f1"
},
{
"url": "https://git.kernel.org/stable/c/ab2a55907823f0bca56b6d03ea05e4071ba8535f"
},
{
"url": "https://git.kernel.org/stable/c/bf70e0eab64c625da84d9fdf4e84466b79418920"
},
{
"url": "https://git.kernel.org/stable/c/c11dbc7705b3739974ac31a13f4ab81e61a5fb07"
},
{
"url": "https://git.kernel.org/stable/c/2e6ad51c709fa794e0ce26003c9c9cd944e3383a"
},
{
"url": "https://git.kernel.org/stable/c/2b4c99f7d9a57ecd644eda9b1fb0a1072414959f"
}
],
"title": "can: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write",
"x_generator": {
"engine": "bippy-1.2.0"
}
}
},
"cveMetadata": {
"assignerOrgId": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"assignerShortName": "Linux",
"cveId": "CVE-2023-53344",
"datePublished": "2025-09-17T14:56:37.024Z",
"dateReserved": "2025-09-16T16:08:59.566Z",
"dateUpdated": "2026-01-14T18:43:02.515Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.2"
}
}
}
BDU:2026-03643 (CVE-2023-53344)
Vulnerability from fstec – Published: 2026-03-25 – Updated: 2026-03-25 – View on bdu.fstec.ru Fixed- CWE-824 - Доступ неинициализированного указателя
{
"CVSS 2.0": "AV:L/AC:L/Au:S/C:N/I:N/A:C",
"CVSS 3.0": "AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"CVSS 4.0": null,
"remediation_\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": null,
"remediation_\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435": null,
"\u0412\u0435\u043d\u0434\u043e\u0440 \u041f\u041e": "Canonical Ltd., Red Hat, Inc., \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0412\u0435\u0440\u0441\u0438\u044f \u041f\u041e": "16.04 LTS (Ubuntu), 18.04 LTS (Ubuntu), 8 (Red Hat Enterprise Linux), 20.04 LTS (Ubuntu), 11 (Debian GNU/Linux), 22.04 LTS (Ubuntu), 9 (Red Hat Enterprise Linux), \u043e\u0442 4.15 \u0434\u043e 4.19.279 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 4.20 \u0434\u043e 5.4.239 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.5 \u0434\u043e 5.10.176 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.11 \u0434\u043e 5.15.105 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 5.16 \u0434\u043e 6.1.22 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 6.2 \u0434\u043e 6.2.9 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux), \u043e\u0442 4.8 \u0434\u043e 4.14.311 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e (Linux)",
"\u0412\u043e\u0437\u043c\u043e\u0436\u043d\u044b\u0435 \u043c\u0435\u0440\u044b \u043f\u043e \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044e": "\u0412 \u0443\u0441\u043b\u043e\u0432\u0438\u044f\u0445 \u043e\u0442\u0441\u0443\u0442\u0441\u0442\u0432\u0438\u044f \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0439 \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u043e\u0442 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u044f \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0443\u0435\u0442\u0441\u044f \u043f\u0440\u0438\u0434\u0435\u0440\u0436\u0438\u0432\u0430\u0442\u044c\u0441\u044f \"\u0420\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439 \u043f\u043e \u0431\u0435\u0437\u043e\u043f\u0430\u0441\u043d\u043e\u0439 \u043d\u0430\u0441\u0442\u0440\u043e\u0439\u043a\u0435 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u044b\u0445 \u0441\u0438\u0441\u0442\u0435\u043c LINUX\", \u0438\u0437\u043b\u043e\u0436\u0435\u043d\u043d\u044b\u0445 \u0432 \u043c\u0435\u0442\u043e\u0434\u0438\u0447\u0435\u0441\u043a\u043e\u043c \u0434\u043e\u043a\u0443\u043c\u0435\u043d\u0442\u0435 \u0424\u0421\u0422\u042d\u041a \u0420\u043e\u0441\u0441\u0438\u0438, \u0443\u0442\u0432\u0435\u0440\u0436\u0434\u0451\u043d\u043d\u043e\u043c 25 \u0434\u0435\u043a\u0430\u0431\u0440\u044f 2022 \u0433\u043e\u0434\u0430.\n\n\u0418\u0441\u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u043d\u0438\u0435 \u0440\u0435\u043a\u043e\u043c\u0435\u043d\u0434\u0430\u0446\u0438\u0439:\n\u0414\u043b\u044f Linux:\nhttps://git.kernel.org/stable/c/3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be\nhttps://git.kernel.org/stable/c/618b15d09fed6126356101543451d49860db4388\nhttps://git.kernel.org/stable/c/78bc7f0ab99458221224d3ab97199c0f8e6861f1\nhttps://git.kernel.org/stable/c/ab2a55907823f0bca56b6d03ea05e4071ba8535f\nhttps://git.kernel.org/stable/c/bf70e0eab64c625da84d9fdf4e84466b79418920\nhttps://git.kernel.org/stable/c/c11dbc7705b3739974ac31a13f4ab81e61a5fb07\nhttps://git.kernel.org/stable/c/2e6ad51c709fa794e0ce26003c9c9cd944e3383a\nhttps://git.kernel.org/linus/2b4c99f7d9a57ecd644eda9b1fb0a1072414959f\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u044b\u0445 \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Red Hat Inc.:\nhttps://access.redhat.com/security/cve/cve-2023-53344\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u044b\u0445 \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Debian GNU/Linux:\nhttps://security-tracker.debian.org/tracker/CVE-2023-53344\n\n\u0414\u043b\u044f \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u044b\u0445 \u043f\u0440\u043e\u0434\u0443\u043a\u0442\u043e\u0432 Ubuntu:\nhttps://ubuntu.com/security/CVE-2023-53344\n\n\u041a\u043e\u043c\u043f\u0435\u043d\u0441\u0438\u0440\u0443\u044e\u0449\u0438\u0435 \u043c\u0435\u0440\u044b:\n- \u043c\u0438\u043d\u0438\u043c\u0438\u0437\u0430\u0446\u0438\u044f \u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u0442\u0435\u043b\u044c\u0441\u043a\u0438\u0445 \u043f\u0440\u0438\u0432\u0438\u043b\u0435\u0433\u0438\u0439;\n- \u043e\u0442\u043a\u043b\u044e\u0447\u0435\u043d\u0438\u0435/\u0443\u0434\u0430\u043b\u0435\u043d\u0438\u0435 \u043d\u0435\u0438\u0441\u043f\u043e\u043b\u044c\u0437\u0443\u0435\u043c\u044b\u0445 \u0443\u0447\u0451\u0442\u043d\u044b\u0445 \u0437\u0430\u043f\u0438\u0441\u0435\u0439 \u043f\u043e\u043b\u044c\u0437\u043e\u0432\u0430\u0442\u0435\u043b\u0435\u0439;\n- \u043a\u043e\u043d\u0442\u0440\u043e\u043b\u044c \u0436\u0443\u0440\u043d\u0430\u043b\u043e\u0432 \u0430\u0443\u0434\u0438\u0442\u0430 \u043a\u043b\u0430\u0441\u0442\u0435\u0440\u0430 \u0434\u043b\u044f \u043e\u0442\u0441\u043b\u0435\u0436\u0438\u0432\u0430\u043d\u0438\u044f \u043f\u043e\u043f\u044b\u0442\u043e\u043a \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438.",
"\u0414\u0430\u0442\u0430 \u0432\u044b\u044f\u0432\u043b\u0435\u043d\u0438\u044f": "27.03.2023",
"\u0414\u0430\u0442\u0430 \u043f\u043e\u0441\u043b\u0435\u0434\u043d\u0435\u0433\u043e \u043e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u044f": "25.03.2026",
"\u0414\u0430\u0442\u0430 \u043f\u0443\u0431\u043b\u0438\u043a\u0430\u0446\u0438\u0438": "25.03.2026",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440": "BDU:2026-03643",
"\u0418\u0434\u0435\u043d\u0442\u0438\u0444\u0438\u043a\u0430\u0442\u043e\u0440\u044b \u0434\u0440\u0443\u0433\u0438\u0445 \u0441\u0438\u0441\u0442\u0435\u043c \u043e\u043f\u0438\u0441\u0430\u043d\u0438\u0439 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "CVE-2023-53344",
"\u0418\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f \u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0430",
"\u041a\u043b\u0430\u0441\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u043a\u043e\u0434\u0430",
"\u041d\u0430\u0437\u0432\u0430\u043d\u0438\u0435 \u041f\u041e": "Ubuntu, Red Hat Enterprise Linux, Debian GNU/Linux, Linux",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u041e\u0421 \u0438 \u0442\u0438\u043f \u0430\u043f\u043f\u0430\u0440\u0430\u0442\u043d\u043e\u0439 \u043f\u043b\u0430\u0442\u0444\u043e\u0440\u043c\u044b": "Canonical Ltd. Ubuntu 16.04 LTS , Canonical Ltd. Ubuntu 18.04 LTS , Red Hat, Inc. Red Hat Enterprise Linux 8 , Canonical Ltd. Ubuntu 20.04 LTS , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Debian GNU/Linux 11 , Canonical Ltd. Ubuntu 22.04 LTS , Red Hat, Inc. Red Hat Enterprise Linux 9 , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 4.15 \u0434\u043e 4.19.279 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 4.20 \u0434\u043e 5.4.239 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.5 \u0434\u043e 5.10.176 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.11 \u0434\u043e 5.15.105 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 5.16 \u0434\u043e 6.1.22 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 6.2 \u0434\u043e 6.2.9 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e , \u0421\u043e\u043e\u0431\u0449\u0435\u0441\u0442\u0432\u043e \u0441\u0432\u043e\u0431\u043e\u0434\u043d\u043e\u0433\u043e \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f Linux \u043e\u0442 4.8 \u0434\u043e 4.14.311 \u0432\u043a\u043b\u044e\u0447\u0438\u0442\u0435\u043b\u044c\u043d\u043e ",
"\u041d\u0430\u0438\u043c\u0435\u043d\u043e\u0432\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 bcm_tx_setup() \u043c\u043e\u0434\u0443\u043b\u044f net/can/bcm.c \u043f\u043e\u0434\u0441\u0438\u0441\u0442\u0435\u043c\u044b \u0448\u0438\u043d\u044b CAN \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux, \u043f\u043e\u0437\u0432\u043e\u043b\u044f\u044e\u0449\u0430\u044f \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041d\u0430\u043b\u0438\u0447\u0438\u0435 \u044d\u043a\u0441\u043f\u043b\u043e\u0439\u0442\u0430": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "\u0414\u043e\u0441\u0442\u0443\u043f \u043d\u0435\u0438\u043d\u0438\u0446\u0438\u0430\u043b\u0438\u0437\u0438\u0440\u043e\u0432\u0430\u043d\u043d\u043e\u0433\u043e \u0443\u043a\u0430\u0437\u0430\u0442\u0435\u043b\u044f (CWE-824)",
"\u041e\u043f\u0438\u0441\u0430\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0423\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u044c \u0444\u0443\u043d\u043a\u0446\u0438\u0438 bcm_tx_setup() \u043c\u043e\u0434\u0443\u043b\u044f net/can/bcm.c \u043f\u043e\u0434\u0441\u0438\u0441\u0442\u0435\u043c\u044b \u0448\u0438\u043d\u044b CAN \u044f\u0434\u0440\u0430 \u043e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u043e\u0439 \u0441\u0438\u0441\u0442\u0435\u043c\u044b Linux \u0441\u0432\u044f\u0437\u0430\u043d\u0430 \u0441 \u0434\u043e\u0441\u0442\u0443\u043f\u043e\u043c \u043a \u043d\u0435\u0438\u043d\u0438\u0446\u0438\u0430\u043b\u0438\u0437\u0438\u0440\u043e\u0432\u0430\u043d\u043d\u043e\u043c\u0443 \u0443\u043a\u0430\u0437\u0430\u0442\u0435\u043b\u044e. \u042d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u044f \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438 \u043c\u043e\u0436\u0435\u0442 \u043f\u043e\u0437\u0432\u043e\u043b\u0438\u0442\u044c \u043d\u0430\u0440\u0443\u0448\u0438\u0442\u0435\u043b\u044e \u0432\u044b\u0437\u0432\u0430\u0442\u044c \u043e\u0442\u043a\u0430\u0437 \u0432 \u043e\u0431\u0441\u043b\u0443\u0436\u0438\u0432\u0430\u043d\u0438\u0438",
"\u041f\u043e\u0441\u043b\u0435\u0434\u0441\u0442\u0432\u0438\u044f \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": null,
"\u041f\u0440\u043e\u0447\u0430\u044f \u0438\u043d\u0444\u043e\u0440\u043c\u0430\u0446\u0438\u044f": null,
"\u0421\u0432\u044f\u0437\u044c \u0441 \u0438\u043d\u0446\u0438\u0434\u0435\u043d\u0442\u0430\u043c\u0438 \u0418\u0411": "\u0414\u0430\u043d\u043d\u044b\u0435 \u0443\u0442\u043e\u0447\u043d\u044f\u044e\u0442\u0441\u044f",
"\u0421\u043e\u0441\u0442\u043e\u044f\u043d\u0438\u0435 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041e\u043f\u0443\u0431\u043b\u0438\u043a\u043e\u0432\u0430\u043d\u0430",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u0443\u0441\u0442\u0440\u0430\u043d\u0435\u043d\u0438\u044f": "\u041e\u0431\u043d\u043e\u0432\u043b\u0435\u043d\u0438\u0435 \u043f\u0440\u043e\u0433\u0440\u0430\u043c\u043c\u043d\u043e\u0433\u043e \u043e\u0431\u0435\u0441\u043f\u0435\u0447\u0435\u043d\u0438\u044f",
"\u0421\u043f\u043e\u0441\u043e\u0431 \u044d\u043a\u0441\u043f\u043b\u0443\u0430\u0442\u0430\u0446\u0438\u0438": "\u041c\u0430\u043d\u0438\u043f\u0443\u043b\u0438\u0440\u043e\u0432\u0430\u043d\u0438\u0435 \u0441\u0442\u0440\u0443\u043a\u0442\u0443\u0440\u0430\u043c\u0438 \u0434\u0430\u043d\u043d\u044b\u0445",
"\u0421\u0441\u044b\u043b\u043a\u0438 \u043d\u0430 \u0438\u0441\u0442\u043e\u0447\u043d\u0438\u043a\u0438": "https://www.cve.org/CVERecord?id=CVE-2023-53344\nhttps://git.kernel.org/stable/c/3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be\nhttps://git.kernel.org/stable/c/618b15d09fed6126356101543451d49860db4388\nhttps://git.kernel.org/stable/c/78bc7f0ab99458221224d3ab97199c0f8e6861f1\nhttps://git.kernel.org/stable/c/ab2a55907823f0bca56b6d03ea05e4071ba8535f\nhttps://git.kernel.org/stable/c/bf70e0eab64c625da84d9fdf4e84466b79418920\nhttps://git.kernel.org/stable/c/c11dbc7705b3739974ac31a13f4ab81e61a5fb07\nhttps://git.kernel.org/stable/c/2e6ad51c709fa794e0ce26003c9c9cd944e3383a\nhttps://git.kernel.org/linus/2b4c99f7d9a57ecd644eda9b1fb0a1072414959f\nhttps://kernel.org/pub/linux/kernel/v4.x/ChangeLog-4.14.312\nhttps://kernel.org/pub/linux/kernel/v4.x/ChangeLog-4.19.280\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.4.240\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.10.177\nhttps://kernel.org/pub/linux/kernel/v5.x/ChangeLog-5.15.106\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.1.23\nhttps://kernel.org/pub/linux/kernel/v6.x/ChangeLog-6.2.10\nhttps://access.redhat.com/security/cve/cve-2023-53344\nhttps://security-tracker.debian.org/tracker/CVE-2023-53344\nhttps://ubuntu.com/security/CVE-2023-53344",
"\u0421\u0442\u0430\u0442\u0443\u0441 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u041f\u043e\u0434\u0442\u0432\u0435\u0440\u0436\u0434\u0435\u043d\u0430 \u043f\u0440\u043e\u0438\u0437\u0432\u043e\u0434\u0438\u0442\u0435\u043b\u0435\u043c",
"\u0422\u0438\u043f \u041f\u041e": "\u041e\u043f\u0435\u0440\u0430\u0446\u0438\u043e\u043d\u043d\u0430\u044f \u0441\u0438\u0441\u0442\u0435\u043c\u0430",
"\u0422\u0438\u043f \u043e\u0448\u0438\u0431\u043a\u0438 CWE": "CWE-824",
"\u0423\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 \u0443\u044f\u0437\u0432\u0438\u043c\u043e\u0441\u0442\u0438": "\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 2.0 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 4,6)\n\u0421\u0440\u0435\u0434\u043d\u0438\u0439 \u0443\u0440\u043e\u0432\u0435\u043d\u044c \u043e\u043f\u0430\u0441\u043d\u043e\u0441\u0442\u0438 (\u0431\u0430\u0437\u043e\u0432\u0430\u044f \u043e\u0446\u0435\u043d\u043a\u0430 CVSS 3.1 \u0441\u043e\u0441\u0442\u0430\u0432\u043b\u044f\u0435\u0442 5,5)"
}
CERTFR-2025-AVI-0895
Vulnerability from certfr_avis - Published: 2025-10-17 - Updated: 2025-10-17
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une atteinte à la confidentialité des données, une atteinte à l'intégrité des données et un contournement de la politique de sécurité.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 LTSS | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | Confidential Computing Module | Confidential Computing Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.2 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.2 | ||
| SUSE | Legacy Module | Legacy Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Enterprise Storage | SUSE Enterprise Storage 7.1 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | Basesystem Module | Basesystem Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Desktop | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | Legacy Module | Legacy Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 LTSS | ||
| SUSE | SUSE Linux Enterprise Workstation Extension | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | Development Tools Module | Development Tools Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Confidential Computing Module 15-SP6",
"product": {
"name": "Confidential Computing Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "SUSE Enterprise Storage",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP7",
"product": {
"name": "Basesystem Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP7",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Desktop",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP7",
"product": {
"name": "Legacy Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Workstation Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP7",
"product": {
"name": "Development Tools Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2021-4460",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-4460"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2022-50242",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50242"
},
{
"name": "CVE-2022-50244",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50244"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2022-50253",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50253"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2022-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50265"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2022-50285",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50285"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50287"
},
{
"name": "CVE-2022-50288",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50288"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50291",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50291"
},
{
"name": "CVE-2022-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50292"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50303",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50303"
},
{
"name": "CVE-2022-50304",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50304"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2022-50311",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50311"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2022-50323",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50323"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2022-50325",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50325"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2022-50339",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50339"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50352",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50352"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2022-50354",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50354"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2022-50356",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50356"
},
{
"name": "CVE-2022-50357",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50357"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2022-50360",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50360"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2022-50365",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50365"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2022-50378",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50378"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2022-50390",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50390"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2022-50393",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50393"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2022-50396",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50396"
},
{
"name": "CVE-2022-50398",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50398"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2022-50405",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50405"
},
{
"name": "CVE-2022-50406",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50406"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50412",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50412"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2022-50418",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50418"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2022-50433",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50433"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2022-50441",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50441"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2022-50447",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50447"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2022-50452",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50452"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2022-50464",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50464"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53168"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53193",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53193"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53232",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53232"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53237",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53237"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53254",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53254"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2023-53284",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53284"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53308",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53308"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53320",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53320"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53332",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53332"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53340",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53340"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53347",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53347"
},
{
"name": "CVE-2023-53348",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53348"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53378",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53378"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53383",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53383"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53398",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53398"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53466",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53466"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53482",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53482"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53489",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53489"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53511",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53511"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2023-53532",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53532"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2024-53168",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53168"
},
{
"name": "CVE-2024-53194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53194"
},
{
"name": "CVE-2025-21692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21692"
},
{
"name": "CVE-2025-21791",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21791"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2025-21969",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21969"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2025-22023",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22023"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2025-38011",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38011"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2025-38089",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38089"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38477",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38477"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2022-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49975"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
}
],
"initial_release_date": "2025-10-17T00:00:00",
"last_revision_date": "2025-10-17T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0895",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-17T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
},
{
"description": "\u00c9l\u00e9vation de privil\u00e8ges"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es, une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es et un contournement de la politique de s\u00e9curit\u00e9.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03615-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503615-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03553-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503553-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03557-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503557-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03539-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503539-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03543-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503543-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03580-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503580-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03613-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503613-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03600-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503600-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03602-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503602-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03561-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503561-1"
},
{
"published_at": "2025-10-16",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03614-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503614-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03567-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503567-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03554-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503554-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03576-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503576-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03626-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503626-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03548-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503548-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03551-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503551-1"
},
{
"published_at": "2025-10-15",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03601-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503601-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03578-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503578-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03575-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503575-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03562-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503562-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03572-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503572-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03550-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503550-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03568-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503568-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03569-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503569-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03563-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503563-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03566-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503566-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03555-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503555-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03529-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503529-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03538-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503538-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03571-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503571-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03559-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503559-1"
},
{
"published_at": "2025-10-10",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03528-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503528-1"
},
{
"published_at": "2025-10-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03583-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503583-1"
},
{
"published_at": "2025-10-11",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03552-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503552-1"
},
{
"published_at": "2025-10-12",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03577-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503577-1"
}
]
}
CERTFR-2025-AVI-0921
Vulnerability from certfr_avis - Published: 2025-10-24 - Updated: 2025-10-24
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, un déni de service à distance et une atteinte à la confidentialité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | Public Cloud Module | Public Cloud Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | SUSE Linux Enterprise High Availability Extension | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP7 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.4 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP7 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | Public Cloud Module | Public Cloud Module 15-SP6 | ||
| SUSE | openSUSE Leap | openSUSE Leap 15.6 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | SUSE Manager Proxy | SUSE Manager Proxy 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP6 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | SUSE Linux Enterprise High Performance Computing | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.5 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | SUSE Linux Enterprise Real Time | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | SUSE Manager Retail Branch Server | SUSE Manager Retail Branch Server 4.3 LTS | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP7 | ||
| SUSE | SUSE Manager Server | SUSE Manager Server 4.3 | ||
| SUSE | SUSE Real Time Module | SUSE Real Time Module 15-SP7 | ||
| SUSE | SUSE Linux Enterprise Server | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | SUSE Linux Enterprise Micro | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | SUSE Linux Enterprise Live Patching | SUSE Linux Enterprise Live Patching 15-SP4 |
| Title | Publication Time | Tags | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "Public Cloud Module 15-SP7",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Availability Extension",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3 LTS",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP7",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "Public Cloud Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "openSUSE Leap",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3 LTS",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "SUSE Manager Proxy",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "SUSE Linux Enterprise High Performance Computing",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "SUSE Linux Enterprise Real Time",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3 LTS",
"product": {
"name": "SUSE Manager Retail Branch Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP7",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "SUSE Manager Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP7",
"product": {
"name": "SUSE Real Time Module",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "SUSE Linux Enterprise Server",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "SUSE Linux Enterprise Micro",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "SUSE Linux Enterprise Live Patching",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-2978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2978"
},
{
"name": "CVE-2022-2602",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-2602"
},
{
"name": "CVE-2022-43945",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-43945"
},
{
"name": "CVE-2022-36280",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-36280"
},
{
"name": "CVE-2023-28328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28328"
},
{
"name": "CVE-2023-1380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-1380"
},
{
"name": "CVE-2023-31248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-31248"
},
{
"name": "CVE-2023-3772",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3772"
},
{
"name": "CVE-2023-42753",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-42753"
},
{
"name": "CVE-2023-3867",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-3867"
},
{
"name": "CVE-2023-5633",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-5633"
},
{
"name": "CVE-2023-39197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-39197"
},
{
"name": "CVE-2024-26584",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26584"
},
{
"name": "CVE-2024-26583",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26583"
},
{
"name": "CVE-2024-58240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58240"
},
{
"name": "CVE-2025-38614",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38614"
},
{
"name": "CVE-2025-38676",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38676"
},
{
"name": "CVE-2025-38679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38679"
},
{
"name": "CVE-2025-38680",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38680"
},
{
"name": "CVE-2025-38681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38681"
},
{
"name": "CVE-2025-38683",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38683"
},
{
"name": "CVE-2025-38684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38684"
},
{
"name": "CVE-2025-38685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38685"
},
{
"name": "CVE-2025-38687",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38687"
},
{
"name": "CVE-2025-38691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38691"
},
{
"name": "CVE-2025-38693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38693"
},
{
"name": "CVE-2025-38694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38694"
},
{
"name": "CVE-2025-38695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38695"
},
{
"name": "CVE-2025-38697",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38697"
},
{
"name": "CVE-2025-38698",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38698"
},
{
"name": "CVE-2025-38701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38701"
},
{
"name": "CVE-2025-38702",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38702"
},
{
"name": "CVE-2025-38706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38706"
},
{
"name": "CVE-2025-38712",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38712"
},
{
"name": "CVE-2025-38713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38713"
},
{
"name": "CVE-2025-38714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38714"
},
{
"name": "CVE-2025-38715",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38715"
},
{
"name": "CVE-2025-38721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38721"
},
{
"name": "CVE-2025-38724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38724"
},
{
"name": "CVE-2025-38725",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38725"
},
{
"name": "CVE-2025-38727",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38727"
},
{
"name": "CVE-2025-38729",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38729"
},
{
"name": "CVE-2025-38730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38730"
},
{
"name": "CVE-2025-38732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38732"
},
{
"name": "CVE-2025-38734",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38734"
},
{
"name": "CVE-2025-38735",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38735"
},
{
"name": "CVE-2025-38736",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38736"
},
{
"name": "CVE-2025-39675",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39675"
},
{
"name": "CVE-2025-39679",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39679"
},
{
"name": "CVE-2025-39681",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39681"
},
{
"name": "CVE-2025-39682",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39682"
},
{
"name": "CVE-2025-39684",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39684"
},
{
"name": "CVE-2025-39685",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39685"
},
{
"name": "CVE-2025-39686",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39686"
},
{
"name": "CVE-2025-39691",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39691"
},
{
"name": "CVE-2025-39693",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39693"
},
{
"name": "CVE-2025-39694",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39694"
},
{
"name": "CVE-2025-39695",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39695"
},
{
"name": "CVE-2025-39701",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39701"
},
{
"name": "CVE-2025-39703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39703"
},
{
"name": "CVE-2025-39705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39705"
},
{
"name": "CVE-2025-39706",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39706"
},
{
"name": "CVE-2025-39707",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39707"
},
{
"name": "CVE-2025-39709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39709"
},
{
"name": "CVE-2025-39710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39710"
},
{
"name": "CVE-2025-39711",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39711"
},
{
"name": "CVE-2025-39713",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39713"
},
{
"name": "CVE-2025-39714",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39714"
},
{
"name": "CVE-2025-39718",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39718"
},
{
"name": "CVE-2025-39719",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39719"
},
{
"name": "CVE-2025-39721",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39721"
},
{
"name": "CVE-2025-39724",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39724"
},
{
"name": "CVE-2025-39738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39738"
},
{
"name": "CVE-2025-39742",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39742"
},
{
"name": "CVE-2025-39743",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39743"
},
{
"name": "CVE-2025-39749",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39749"
},
{
"name": "CVE-2025-39751",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39751"
},
{
"name": "CVE-2025-39757",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39757"
},
{
"name": "CVE-2025-39759",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39759"
},
{
"name": "CVE-2025-39760",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39760"
},
{
"name": "CVE-2025-39766",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39766"
},
{
"name": "CVE-2025-39770",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39770"
},
{
"name": "CVE-2025-39772",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39772"
},
{
"name": "CVE-2025-39773",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39773"
},
{
"name": "CVE-2025-39782",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39782"
},
{
"name": "CVE-2025-39783",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39783"
},
{
"name": "CVE-2025-39787",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39787"
},
{
"name": "CVE-2025-39790",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39790"
},
{
"name": "CVE-2025-39798",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39798"
},
{
"name": "CVE-2025-39800",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39800"
},
{
"name": "CVE-2025-39801",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39801"
},
{
"name": "CVE-2025-39806",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39806"
},
{
"name": "CVE-2025-39807",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39807"
},
{
"name": "CVE-2025-39808",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39808"
},
{
"name": "CVE-2025-39810",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39810"
},
{
"name": "CVE-2025-39811",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39811"
},
{
"name": "CVE-2025-39823",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39823"
},
{
"name": "CVE-2025-39824",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39824"
},
{
"name": "CVE-2025-39825",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39825"
},
{
"name": "CVE-2025-39826",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39826"
},
{
"name": "CVE-2025-39827",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39827"
},
{
"name": "CVE-2025-39828",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39828"
},
{
"name": "CVE-2025-39832",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39832"
},
{
"name": "CVE-2025-39835",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39835"
},
{
"name": "CVE-2025-39838",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39838"
},
{
"name": "CVE-2025-39839",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39839"
},
{
"name": "CVE-2025-39842",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39842"
},
{
"name": "CVE-2025-39844",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39844"
},
{
"name": "CVE-2025-39845",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39845"
},
{
"name": "CVE-2025-39846",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39846"
},
{
"name": "CVE-2025-39847",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39847"
},
{
"name": "CVE-2025-39848",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39848"
},
{
"name": "CVE-2025-39849",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39849"
},
{
"name": "CVE-2025-39850",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39850"
},
{
"name": "CVE-2025-39853",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39853"
},
{
"name": "CVE-2025-39854",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39854"
},
{
"name": "CVE-2025-39857",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39857"
},
{
"name": "CVE-2025-39860",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39860"
},
{
"name": "CVE-2025-39861",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39861"
},
{
"name": "CVE-2025-39863",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39863"
},
{
"name": "CVE-2025-39864",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39864"
},
{
"name": "CVE-2025-39865",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39865"
},
{
"name": "CVE-2025-40300",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-40300"
},
{
"name": "CVE-2025-38514",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38514"
},
{
"name": "CVE-2025-39890",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39890"
},
{
"name": "CVE-2025-38511",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38511"
},
{
"name": "CVE-2025-38521",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38521"
},
{
"name": "CVE-2025-38605",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38605"
},
{
"name": "CVE-2025-38668",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38668"
},
{
"name": "CVE-2025-38527",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38527"
},
{
"name": "CVE-2025-39730",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39730"
},
{
"name": "CVE-2025-39761",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39761"
},
{
"name": "CVE-2023-53305",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53305"
},
{
"name": "CVE-2023-53373",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53373"
},
{
"name": "CVE-2023-53259",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53259"
},
{
"name": "CVE-2025-38574",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38574"
},
{
"name": "CVE-2025-38622",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38622"
},
{
"name": "CVE-2025-38623",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38623"
},
{
"name": "CVE-2025-38639",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38639"
},
{
"name": "CVE-2025-38645",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38645"
},
{
"name": "CVE-2025-38664",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38664"
},
{
"name": "CVE-2025-39869",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39869"
},
{
"name": "CVE-2025-39870",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39870"
},
{
"name": "CVE-2025-39873",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39873"
},
{
"name": "CVE-2025-39885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39885"
},
{
"name": "CVE-2025-39891",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39891"
},
{
"name": "CVE-2025-39907",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39907"
},
{
"name": "CVE-2025-39920",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39920"
},
{
"name": "CVE-2025-39923",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39923"
},
{
"name": "CVE-2022-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50233"
},
{
"name": "CVE-2022-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50234"
},
{
"name": "CVE-2022-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50235"
},
{
"name": "CVE-2022-50239",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50239"
},
{
"name": "CVE-2022-50241",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50241"
},
{
"name": "CVE-2022-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50246"
},
{
"name": "CVE-2022-50247",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50247"
},
{
"name": "CVE-2022-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50248"
},
{
"name": "CVE-2022-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50249"
},
{
"name": "CVE-2022-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50250"
},
{
"name": "CVE-2022-50251",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50251"
},
{
"name": "CVE-2022-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50252"
},
{
"name": "CVE-2022-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50255"
},
{
"name": "CVE-2022-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50257"
},
{
"name": "CVE-2022-50258",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50258"
},
{
"name": "CVE-2022-50260",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50260"
},
{
"name": "CVE-2022-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50261"
},
{
"name": "CVE-2022-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50264"
},
{
"name": "CVE-2022-50266",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50266"
},
{
"name": "CVE-2022-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50267"
},
{
"name": "CVE-2022-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50268"
},
{
"name": "CVE-2022-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50269"
},
{
"name": "CVE-2022-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50271"
},
{
"name": "CVE-2022-50272",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50272"
},
{
"name": "CVE-2022-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50275"
},
{
"name": "CVE-2022-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50276"
},
{
"name": "CVE-2022-50277",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50277"
},
{
"name": "CVE-2022-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50278"
},
{
"name": "CVE-2022-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50279"
},
{
"name": "CVE-2022-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50282"
},
{
"name": "CVE-2022-50286",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50286"
},
{
"name": "CVE-2022-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50289"
},
{
"name": "CVE-2022-50294",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50294"
},
{
"name": "CVE-2022-50297",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50297"
},
{
"name": "CVE-2022-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50298"
},
{
"name": "CVE-2022-50299",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50299"
},
{
"name": "CVE-2022-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50301"
},
{
"name": "CVE-2022-50308",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50308"
},
{
"name": "CVE-2022-50309",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50309"
},
{
"name": "CVE-2022-50312",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50312"
},
{
"name": "CVE-2022-50317",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50317"
},
{
"name": "CVE-2022-50318",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50318"
},
{
"name": "CVE-2022-50320",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50320"
},
{
"name": "CVE-2022-50321",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50321"
},
{
"name": "CVE-2022-50324",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50324"
},
{
"name": "CVE-2022-50328",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50328"
},
{
"name": "CVE-2022-50329",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50329"
},
{
"name": "CVE-2022-50330",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50330"
},
{
"name": "CVE-2022-50331",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50331"
},
{
"name": "CVE-2022-50333",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50333"
},
{
"name": "CVE-2022-50340",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50340"
},
{
"name": "CVE-2022-50342",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50342"
},
{
"name": "CVE-2022-50344",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50344"
},
{
"name": "CVE-2022-50346",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50346"
},
{
"name": "CVE-2022-50347",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50347"
},
{
"name": "CVE-2022-50348",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50348"
},
{
"name": "CVE-2022-50349",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50349"
},
{
"name": "CVE-2022-50351",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50351"
},
{
"name": "CVE-2022-50353",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50353"
},
{
"name": "CVE-2022-50355",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50355"
},
{
"name": "CVE-2022-50358",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50358"
},
{
"name": "CVE-2022-50359",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50359"
},
{
"name": "CVE-2022-50362",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50362"
},
{
"name": "CVE-2022-50364",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50364"
},
{
"name": "CVE-2022-50367",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50367"
},
{
"name": "CVE-2022-50368",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50368"
},
{
"name": "CVE-2022-50369",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50369"
},
{
"name": "CVE-2022-50370",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50370"
},
{
"name": "CVE-2022-50372",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50372"
},
{
"name": "CVE-2022-50373",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50373"
},
{
"name": "CVE-2022-50374",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50374"
},
{
"name": "CVE-2022-50375",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50375"
},
{
"name": "CVE-2022-50376",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50376"
},
{
"name": "CVE-2022-50379",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50379"
},
{
"name": "CVE-2022-50381",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50381"
},
{
"name": "CVE-2022-50385",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50385"
},
{
"name": "CVE-2022-50386",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50386"
},
{
"name": "CVE-2022-50388",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50388"
},
{
"name": "CVE-2022-50389",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50389"
},
{
"name": "CVE-2022-50391",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50391"
},
{
"name": "CVE-2022-50392",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50392"
},
{
"name": "CVE-2022-50394",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50394"
},
{
"name": "CVE-2022-50395",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50395"
},
{
"name": "CVE-2022-50399",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50399"
},
{
"name": "CVE-2022-50401",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50401"
},
{
"name": "CVE-2022-50402",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50402"
},
{
"name": "CVE-2022-50404",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50404"
},
{
"name": "CVE-2022-50408",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50408"
},
{
"name": "CVE-2022-50409",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50409"
},
{
"name": "CVE-2022-50410",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50410"
},
{
"name": "CVE-2022-50411",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50411"
},
{
"name": "CVE-2022-50414",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50414"
},
{
"name": "CVE-2022-50417",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50417"
},
{
"name": "CVE-2022-50419",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50419"
},
{
"name": "CVE-2022-50422",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50422"
},
{
"name": "CVE-2022-50423",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50423"
},
{
"name": "CVE-2022-50425",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50425"
},
{
"name": "CVE-2022-50427",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50427"
},
{
"name": "CVE-2022-50428",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50428"
},
{
"name": "CVE-2022-50429",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50429"
},
{
"name": "CVE-2022-50430",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50430"
},
{
"name": "CVE-2022-50431",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50431"
},
{
"name": "CVE-2022-50432",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50432"
},
{
"name": "CVE-2022-50434",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50434"
},
{
"name": "CVE-2022-50435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50435"
},
{
"name": "CVE-2022-50436",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50436"
},
{
"name": "CVE-2022-50437",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50437"
},
{
"name": "CVE-2022-50439",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50439"
},
{
"name": "CVE-2022-50440",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50440"
},
{
"name": "CVE-2022-50443",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50443"
},
{
"name": "CVE-2022-50444",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50444"
},
{
"name": "CVE-2022-50449",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50449"
},
{
"name": "CVE-2022-50453",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50453"
},
{
"name": "CVE-2022-50454",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50454"
},
{
"name": "CVE-2022-50456",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50456"
},
{
"name": "CVE-2022-50458",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50458"
},
{
"name": "CVE-2022-50459",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50459"
},
{
"name": "CVE-2022-50460",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50460"
},
{
"name": "CVE-2022-50465",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50465"
},
{
"name": "CVE-2022-50466",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50466"
},
{
"name": "CVE-2022-50467",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50467"
},
{
"name": "CVE-2022-50468",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50468"
},
{
"name": "CVE-2022-50469",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-50469"
},
{
"name": "CVE-2023-53147",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53147"
},
{
"name": "CVE-2023-53148",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53148"
},
{
"name": "CVE-2023-53149",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53149"
},
{
"name": "CVE-2023-53150",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53150"
},
{
"name": "CVE-2023-53151",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53151"
},
{
"name": "CVE-2023-53152",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53152"
},
{
"name": "CVE-2023-53153",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53153"
},
{
"name": "CVE-2023-53165",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53165"
},
{
"name": "CVE-2023-53167",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53167"
},
{
"name": "CVE-2023-53170",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53170"
},
{
"name": "CVE-2023-53171",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53171"
},
{
"name": "CVE-2023-53174",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53174"
},
{
"name": "CVE-2023-53175",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53175"
},
{
"name": "CVE-2023-53176",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53176"
},
{
"name": "CVE-2023-53177",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53177"
},
{
"name": "CVE-2023-53178",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53178"
},
{
"name": "CVE-2023-53179",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53179"
},
{
"name": "CVE-2023-53180",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53180"
},
{
"name": "CVE-2023-53181",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53181"
},
{
"name": "CVE-2023-53182",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53182"
},
{
"name": "CVE-2023-53183",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53183"
},
{
"name": "CVE-2023-53184",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53184"
},
{
"name": "CVE-2023-53185",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53185"
},
{
"name": "CVE-2023-53187",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53187"
},
{
"name": "CVE-2023-53189",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53189"
},
{
"name": "CVE-2023-53192",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53192"
},
{
"name": "CVE-2023-53195",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53195"
},
{
"name": "CVE-2023-53196",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53196"
},
{
"name": "CVE-2023-53197",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53197"
},
{
"name": "CVE-2023-53199",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53199"
},
{
"name": "CVE-2023-53201",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53201"
},
{
"name": "CVE-2023-53204",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53204"
},
{
"name": "CVE-2023-53205",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53205"
},
{
"name": "CVE-2023-53206",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53206"
},
{
"name": "CVE-2023-53207",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53207"
},
{
"name": "CVE-2023-53208",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53208"
},
{
"name": "CVE-2023-53209",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53209"
},
{
"name": "CVE-2023-53210",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53210"
},
{
"name": "CVE-2023-53213",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53213"
},
{
"name": "CVE-2023-53215",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53215"
},
{
"name": "CVE-2023-53216",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53216"
},
{
"name": "CVE-2023-53217",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53217"
},
{
"name": "CVE-2023-53219",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53219"
},
{
"name": "CVE-2023-53220",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53220"
},
{
"name": "CVE-2023-53221",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53221"
},
{
"name": "CVE-2023-53222",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53222"
},
{
"name": "CVE-2023-53223",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53223"
},
{
"name": "CVE-2023-53226",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53226"
},
{
"name": "CVE-2023-53229",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53229"
},
{
"name": "CVE-2023-53230",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53230"
},
{
"name": "CVE-2023-53231",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53231"
},
{
"name": "CVE-2023-53234",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53234"
},
{
"name": "CVE-2023-53235",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53235"
},
{
"name": "CVE-2023-53238",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53238"
},
{
"name": "CVE-2023-53239",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53239"
},
{
"name": "CVE-2023-53241",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53241"
},
{
"name": "CVE-2023-53242",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53242"
},
{
"name": "CVE-2023-53243",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53243"
},
{
"name": "CVE-2023-53244",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53244"
},
{
"name": "CVE-2023-53245",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53245"
},
{
"name": "CVE-2023-53246",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53246"
},
{
"name": "CVE-2023-53247",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53247"
},
{
"name": "CVE-2023-53248",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53248"
},
{
"name": "CVE-2023-53249",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53249"
},
{
"name": "CVE-2023-53250",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53250"
},
{
"name": "CVE-2023-53251",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53251"
},
{
"name": "CVE-2023-53252",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53252"
},
{
"name": "CVE-2023-53255",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53255"
},
{
"name": "CVE-2023-53257",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53257"
},
{
"name": "CVE-2023-53258",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53258"
},
{
"name": "CVE-2023-53260",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53260"
},
{
"name": "CVE-2023-53261",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53261"
},
{
"name": "CVE-2023-53263",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53263"
},
{
"name": "CVE-2023-53264",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53264"
},
{
"name": "CVE-2023-53265",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53265"
},
{
"name": "CVE-2023-53268",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53268"
},
{
"name": "CVE-2023-53270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53270"
},
{
"name": "CVE-2023-53272",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53272"
},
{
"name": "CVE-2023-53273",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53273"
},
{
"name": "CVE-2023-53274",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53274"
},
{
"name": "CVE-2023-53275",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53275"
},
{
"name": "CVE-2023-53276",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53276"
},
{
"name": "CVE-2023-53277",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53277"
},
{
"name": "CVE-2023-53280",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53280"
},
{
"name": "CVE-2023-53281",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53281"
},
{
"name": "CVE-2023-53282",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53282"
},
{
"name": "CVE-2023-53286",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53286"
},
{
"name": "CVE-2023-53287",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53287"
},
{
"name": "CVE-2023-53288",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53288"
},
{
"name": "CVE-2023-53291",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53291"
},
{
"name": "CVE-2023-53292",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53292"
},
{
"name": "CVE-2023-53295",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53295"
},
{
"name": "CVE-2023-53297",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53297"
},
{
"name": "CVE-2023-53298",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53298"
},
{
"name": "CVE-2023-53299",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53299"
},
{
"name": "CVE-2023-53302",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53302"
},
{
"name": "CVE-2023-53303",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53303"
},
{
"name": "CVE-2023-53304",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53304"
},
{
"name": "CVE-2023-53307",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53307"
},
{
"name": "CVE-2023-53309",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53309"
},
{
"name": "CVE-2023-53311",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53311"
},
{
"name": "CVE-2023-53312",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53312"
},
{
"name": "CVE-2023-53313",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53313"
},
{
"name": "CVE-2023-53314",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53314"
},
{
"name": "CVE-2023-53315",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53315"
},
{
"name": "CVE-2023-53316",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53316"
},
{
"name": "CVE-2023-53317",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53317"
},
{
"name": "CVE-2023-53319",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53319"
},
{
"name": "CVE-2023-53321",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53321"
},
{
"name": "CVE-2023-53322",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53322"
},
{
"name": "CVE-2023-53323",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53323"
},
{
"name": "CVE-2023-53324",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53324"
},
{
"name": "CVE-2023-53325",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53325"
},
{
"name": "CVE-2023-53326",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53326"
},
{
"name": "CVE-2023-53328",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53328"
},
{
"name": "CVE-2023-53330",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53330"
},
{
"name": "CVE-2023-53331",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53331"
},
{
"name": "CVE-2023-53333",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53333"
},
{
"name": "CVE-2023-53334",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53334"
},
{
"name": "CVE-2023-53335",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53335"
},
{
"name": "CVE-2023-53336",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53336"
},
{
"name": "CVE-2023-53337",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53337"
},
{
"name": "CVE-2023-53338",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53338"
},
{
"name": "CVE-2023-53339",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53339"
},
{
"name": "CVE-2023-53342",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53342"
},
{
"name": "CVE-2023-53343",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53343"
},
{
"name": "CVE-2023-53344",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53344"
},
{
"name": "CVE-2023-53349",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53349"
},
{
"name": "CVE-2023-53350",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53350"
},
{
"name": "CVE-2023-53352",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53352"
},
{
"name": "CVE-2023-53354",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53354"
},
{
"name": "CVE-2023-53356",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53356"
},
{
"name": "CVE-2023-53357",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53357"
},
{
"name": "CVE-2023-53359",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53359"
},
{
"name": "CVE-2023-53360",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53360"
},
{
"name": "CVE-2023-53362",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53362"
},
{
"name": "CVE-2023-53364",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53364"
},
{
"name": "CVE-2023-53365",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53365"
},
{
"name": "CVE-2023-53367",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53367"
},
{
"name": "CVE-2023-53368",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53368"
},
{
"name": "CVE-2023-53369",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53369"
},
{
"name": "CVE-2023-53370",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53370"
},
{
"name": "CVE-2023-53371",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53371"
},
{
"name": "CVE-2023-53374",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53374"
},
{
"name": "CVE-2023-53375",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53375"
},
{
"name": "CVE-2023-53377",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53377"
},
{
"name": "CVE-2023-53379",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53379"
},
{
"name": "CVE-2023-53380",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53380"
},
{
"name": "CVE-2023-53381",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53381"
},
{
"name": "CVE-2023-53384",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53384"
},
{
"name": "CVE-2023-53385",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53385"
},
{
"name": "CVE-2023-53386",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53386"
},
{
"name": "CVE-2023-53388",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53388"
},
{
"name": "CVE-2023-53390",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53390"
},
{
"name": "CVE-2023-53391",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53391"
},
{
"name": "CVE-2023-53393",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53393"
},
{
"name": "CVE-2023-53394",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53394"
},
{
"name": "CVE-2023-53395",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53395"
},
{
"name": "CVE-2023-53396",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53396"
},
{
"name": "CVE-2023-53397",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53397"
},
{
"name": "CVE-2023-53400",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53400"
},
{
"name": "CVE-2023-53401",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53401"
},
{
"name": "CVE-2023-53404",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53404"
},
{
"name": "CVE-2023-53405",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53405"
},
{
"name": "CVE-2023-53406",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53406"
},
{
"name": "CVE-2023-53409",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53409"
},
{
"name": "CVE-2023-53413",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53413"
},
{
"name": "CVE-2023-53414",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53414"
},
{
"name": "CVE-2023-53415",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53415"
},
{
"name": "CVE-2023-53416",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53416"
},
{
"name": "CVE-2023-53420",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53420"
},
{
"name": "CVE-2023-53421",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53421"
},
{
"name": "CVE-2023-53422",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53422"
},
{
"name": "CVE-2023-53424",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53424"
},
{
"name": "CVE-2023-53425",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53425"
},
{
"name": "CVE-2023-53426",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53426"
},
{
"name": "CVE-2023-53427",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53427"
},
{
"name": "CVE-2023-53428",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53428"
},
{
"name": "CVE-2023-53429",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53429"
},
{
"name": "CVE-2023-53431",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53431"
},
{
"name": "CVE-2023-53432",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53432"
},
{
"name": "CVE-2023-53435",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53435"
},
{
"name": "CVE-2023-53436",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53436"
},
{
"name": "CVE-2023-53437",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53437"
},
{
"name": "CVE-2023-53438",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53438"
},
{
"name": "CVE-2023-53440",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53440"
},
{
"name": "CVE-2023-53441",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53441"
},
{
"name": "CVE-2023-53442",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53442"
},
{
"name": "CVE-2023-53443",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53443"
},
{
"name": "CVE-2023-53444",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53444"
},
{
"name": "CVE-2023-53446",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53446"
},
{
"name": "CVE-2023-53447",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53447"
},
{
"name": "CVE-2023-53448",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53448"
},
{
"name": "CVE-2023-53449",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53449"
},
{
"name": "CVE-2023-53451",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53451"
},
{
"name": "CVE-2023-53452",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53452"
},
{
"name": "CVE-2023-53453",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53453"
},
{
"name": "CVE-2023-53454",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53454"
},
{
"name": "CVE-2023-53456",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53456"
},
{
"name": "CVE-2023-53457",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53457"
},
{
"name": "CVE-2023-53458",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53458"
},
{
"name": "CVE-2023-53461",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53461"
},
{
"name": "CVE-2023-53462",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53462"
},
{
"name": "CVE-2023-53463",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53463"
},
{
"name": "CVE-2023-53464",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53464"
},
{
"name": "CVE-2023-53465",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53465"
},
{
"name": "CVE-2023-53468",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53468"
},
{
"name": "CVE-2023-53471",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53471"
},
{
"name": "CVE-2023-53472",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53472"
},
{
"name": "CVE-2023-53473",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53473"
},
{
"name": "CVE-2023-53474",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53474"
},
{
"name": "CVE-2023-53475",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53475"
},
{
"name": "CVE-2023-53476",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53476"
},
{
"name": "CVE-2023-53479",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53479"
},
{
"name": "CVE-2023-53480",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53480"
},
{
"name": "CVE-2023-53485",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53485"
},
{
"name": "CVE-2023-53487",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53487"
},
{
"name": "CVE-2023-53488",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53488"
},
{
"name": "CVE-2023-53490",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53490"
},
{
"name": "CVE-2023-53491",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53491"
},
{
"name": "CVE-2023-53492",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53492"
},
{
"name": "CVE-2023-53493",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53493"
},
{
"name": "CVE-2023-53494",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53494"
},
{
"name": "CVE-2023-53495",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53495"
},
{
"name": "CVE-2023-53496",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53496"
},
{
"name": "CVE-2023-53498",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53498"
},
{
"name": "CVE-2023-53499",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53499"
},
{
"name": "CVE-2023-53500",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53500"
},
{
"name": "CVE-2023-53501",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53501"
},
{
"name": "CVE-2023-53504",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53504"
},
{
"name": "CVE-2023-53505",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53505"
},
{
"name": "CVE-2023-53506",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53506"
},
{
"name": "CVE-2023-53507",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53507"
},
{
"name": "CVE-2023-53508",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53508"
},
{
"name": "CVE-2023-53509",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53509"
},
{
"name": "CVE-2023-53510",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53510"
},
{
"name": "CVE-2023-53512",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53512"
},
{
"name": "CVE-2023-53515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53515"
},
{
"name": "CVE-2023-53516",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53516"
},
{
"name": "CVE-2023-53518",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53518"
},
{
"name": "CVE-2023-53519",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53519"
},
{
"name": "CVE-2023-53520",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53520"
},
{
"name": "CVE-2023-53521",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53521"
},
{
"name": "CVE-2023-53523",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53523"
},
{
"name": "CVE-2023-53524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53524"
},
{
"name": "CVE-2023-53525",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53525"
},
{
"name": "CVE-2023-53526",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53526"
},
{
"name": "CVE-2023-53527",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53527"
},
{
"name": "CVE-2023-53528",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53528"
},
{
"name": "CVE-2023-53530",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53530"
},
{
"name": "CVE-2023-53531",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53531"
},
{
"name": "CVE-2025-38234",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38234"
},
{
"name": "CVE-2025-38255",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38255"
},
{
"name": "CVE-2025-38402",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38402"
},
{
"name": "CVE-2025-38408",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38408"
},
{
"name": "CVE-2025-38526",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38526"
},
{
"name": "CVE-2025-38533",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38533"
},
{
"name": "CVE-2025-38544",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38544"
},
{
"name": "CVE-2025-38584",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38584"
},
{
"name": "CVE-2024-26661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26661"
},
{
"name": "CVE-2025-38590",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38590"
},
{
"name": "CVE-2025-38593",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38593"
},
{
"name": "CVE-2025-38595",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38595"
},
{
"name": "CVE-2025-38597",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38597"
},
{
"name": "CVE-2025-38616",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38616"
},
{
"name": "CVE-2025-38628",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38628"
},
{
"name": "CVE-2025-38640",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38640"
},
{
"name": "CVE-2025-38643",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38643"
},
{
"name": "CVE-2025-38659",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38659"
},
{
"name": "CVE-2025-38660",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38660"
},
{
"name": "CVE-2025-38678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38678"
},
{
"name": "CVE-2025-38692",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38692"
},
{
"name": "CVE-2025-38703",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38703"
},
{
"name": "CVE-2025-38705",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38705"
},
{
"name": "CVE-2025-38709",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38709"
},
{
"name": "CVE-2025-38710",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38710"
},
{
"name": "CVE-2025-38722",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38722"
},
{
"name": "CVE-2025-39677",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39677"
},
{
"name": "CVE-2025-39678",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39678"
},
{
"name": "CVE-2025-39726",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39726"
},
{
"name": "CVE-2025-39732",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39732"
},
{
"name": "CVE-2025-39739",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39739"
},
{
"name": "CVE-2025-39744",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39744"
},
{
"name": "CVE-2025-39746",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39746"
},
{
"name": "CVE-2025-39747",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39747"
},
{
"name": "CVE-2025-39750",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39750"
},
{
"name": "CVE-2025-39754",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39754"
},
{
"name": "CVE-2025-39758",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39758"
},
{
"name": "CVE-2025-39763",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39763"
},
{
"name": "CVE-2025-39764",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39764"
},
{
"name": "CVE-2025-39797",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39797"
},
{
"name": "CVE-2025-39816",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39816"
},
{
"name": "CVE-2025-39830",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39830"
},
{
"name": "CVE-2025-39833",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39833"
},
{
"name": "CVE-2025-39834",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39834"
},
{
"name": "CVE-2025-39871",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39871"
},
{
"name": "CVE-2025-39882",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39882"
},
{
"name": "CVE-2025-39889",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39889"
},
{
"name": "CVE-2025-39922",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39922"
},
{
"name": "CVE-2025-39925",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-39925"
},
{
"name": "CVE-2023-53513",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-53513"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-46733",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46733"
},
{
"name": "CVE-2024-53125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53125"
},
{
"name": "CVE-2023-52923",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52923"
},
{
"name": "CVE-2022-49138",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49138"
},
{
"name": "CVE-2024-58090",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58090"
},
{
"name": "CVE-2025-21971",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-21971"
},
{
"name": "CVE-2025-37738",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37738"
},
{
"name": "CVE-2025-37885",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37885"
},
{
"name": "CVE-2025-37958",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-37958"
},
{
"name": "CVE-2025-23155",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-23155"
},
{
"name": "CVE-2025-22022",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-22022"
},
{
"name": "CVE-2022-49980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49980"
},
{
"name": "CVE-2025-38014",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38014"
},
{
"name": "CVE-2025-38110",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38110"
},
{
"name": "CVE-2025-38216",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38216"
},
{
"name": "CVE-2025-38206",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38206"
},
{
"name": "CVE-2025-38075",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38075"
},
{
"name": "CVE-2025-38084",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38084"
},
{
"name": "CVE-2025-38085",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38085"
},
{
"name": "CVE-2025-38103",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38103"
},
{
"name": "CVE-2025-38111",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38111"
},
{
"name": "CVE-2025-38119",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38119"
},
{
"name": "CVE-2025-38146",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38146"
},
{
"name": "CVE-2025-38160",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38160"
},
{
"name": "CVE-2025-38184",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38184"
},
{
"name": "CVE-2025-38185",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38185"
},
{
"name": "CVE-2025-38190",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38190"
},
{
"name": "CVE-2025-38245",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38245"
},
{
"name": "CVE-2025-38251",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38251"
},
{
"name": "CVE-2025-38263",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38263"
},
{
"name": "CVE-2025-38351",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38351"
},
{
"name": "CVE-2025-38380",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38380"
},
{
"name": "CVE-2025-38396",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38396"
},
{
"name": "CVE-2025-38418",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38418"
},
{
"name": "CVE-2025-38419",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38419"
},
{
"name": "CVE-2025-38439",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38439"
},
{
"name": "CVE-2025-38440",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38440"
},
{
"name": "CVE-2025-38441",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38441"
},
{
"name": "CVE-2025-38444",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38444"
},
{
"name": "CVE-2025-38445",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38445"
},
{
"name": "CVE-2025-38456",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38456"
},
{
"name": "CVE-2025-38458",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38458"
},
{
"name": "CVE-2025-38459",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38459"
},
{
"name": "CVE-2025-38464",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38464"
},
{
"name": "CVE-2025-38465",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38465"
},
{
"name": "CVE-2025-38466",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38466"
},
{
"name": "CVE-2025-38470",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38470"
},
{
"name": "CVE-2025-38471",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38471"
},
{
"name": "CVE-2025-38472",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38472"
},
{
"name": "CVE-2025-38476",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38476"
},
{
"name": "CVE-2025-38488",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38488"
},
{
"name": "CVE-2025-38490",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38490"
},
{
"name": "CVE-2025-38491",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38491"
},
{
"name": "CVE-2025-38499",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38499"
},
{
"name": "CVE-2025-38500",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38500"
},
{
"name": "CVE-2025-38006",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38006"
},
{
"name": "CVE-2023-4130",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4130"
},
{
"name": "CVE-2023-4515",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-4515"
},
{
"name": "CVE-2024-58238",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58238"
},
{
"name": "CVE-2024-58239",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-58239"
},
{
"name": "CVE-2025-38125",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38125"
},
{
"name": "CVE-2025-38201",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38201"
},
{
"name": "CVE-2025-38205",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38205"
},
{
"name": "CVE-2025-38208",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38208"
},
{
"name": "CVE-2025-38360",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38360"
},
{
"name": "CVE-2025-38503",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38503"
},
{
"name": "CVE-2025-38506",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38506"
},
{
"name": "CVE-2025-38510",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38510"
},
{
"name": "CVE-2025-38512",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38512"
},
{
"name": "CVE-2025-38513",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38513"
},
{
"name": "CVE-2025-38515",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38515"
},
{
"name": "CVE-2025-38516",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38516"
},
{
"name": "CVE-2025-38520",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38520"
},
{
"name": "CVE-2025-38524",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38524"
},
{
"name": "CVE-2025-38528",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38528"
},
{
"name": "CVE-2025-38529",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38529"
},
{
"name": "CVE-2025-38530",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38530"
},
{
"name": "CVE-2025-38531",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38531"
},
{
"name": "CVE-2025-38535",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38535"
},
{
"name": "CVE-2025-38537",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38537"
},
{
"name": "CVE-2025-38538",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38538"
},
{
"name": "CVE-2025-38540",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38540"
},
{
"name": "CVE-2025-38541",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38541"
},
{
"name": "CVE-2025-38543",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38543"
},
{
"name": "CVE-2025-38546",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38546"
},
{
"name": "CVE-2025-38548",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38548"
},
{
"name": "CVE-2025-38550",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38550"
},
{
"name": "CVE-2025-38553",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38553"
},
{
"name": "CVE-2025-38555",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38555"
},
{
"name": "CVE-2025-38560",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38560"
},
{
"name": "CVE-2025-38563",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38563"
},
{
"name": "CVE-2025-38565",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38565"
},
{
"name": "CVE-2025-38566",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38566"
},
{
"name": "CVE-2025-38568",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38568"
},
{
"name": "CVE-2025-38571",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38571"
},
{
"name": "CVE-2025-38572",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38572"
},
{
"name": "CVE-2025-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38576"
},
{
"name": "CVE-2025-38581",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38581"
},
{
"name": "CVE-2025-38582",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38582"
},
{
"name": "CVE-2025-38583",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38583"
},
{
"name": "CVE-2025-38585",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38585"
},
{
"name": "CVE-2025-38587",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38587"
},
{
"name": "CVE-2025-38588",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38588"
},
{
"name": "CVE-2025-38591",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38591"
},
{
"name": "CVE-2025-38601",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38601"
},
{
"name": "CVE-2025-38602",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38602"
},
{
"name": "CVE-2025-38604",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38604"
},
{
"name": "CVE-2025-38608",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38608"
},
{
"name": "CVE-2025-38609",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38609"
},
{
"name": "CVE-2025-38610",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38610"
},
{
"name": "CVE-2025-38612",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38612"
},
{
"name": "CVE-2025-38617",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38617"
},
{
"name": "CVE-2025-38618",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38618"
},
{
"name": "CVE-2025-38621",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38621"
},
{
"name": "CVE-2025-38624",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38624"
},
{
"name": "CVE-2025-38630",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38630"
},
{
"name": "CVE-2025-38632",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38632"
},
{
"name": "CVE-2025-38634",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38634"
},
{
"name": "CVE-2025-38635",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38635"
},
{
"name": "CVE-2025-38644",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38644"
},
{
"name": "CVE-2025-38646",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38646"
},
{
"name": "CVE-2025-38650",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38650"
},
{
"name": "CVE-2025-38656",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38656"
},
{
"name": "CVE-2025-38663",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38663"
},
{
"name": "CVE-2025-38665",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38665"
},
{
"name": "CVE-2025-38670",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38670"
},
{
"name": "CVE-2025-38671",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38671"
},
{
"name": "CVE-2025-38556",
"url": "https://www.cve.org/CVERecord?id=CVE-2025-38556"
}
],
"initial_release_date": "2025-10-24T00:00:00",
"last_revision_date": "2025-10-24T00:00:00",
"links": [],
"reference": "CERTFR-2025-AVI-0921",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2025-10-24T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, un d\u00e9ni de service \u00e0 distance et une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03650-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503650-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03636-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503636-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03648-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503648-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03652-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503652-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253761-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253761-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3736-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253736-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3772-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253772-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03663-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503663-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03634-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503634-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3703-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253703-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03643-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503643-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03646-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503646-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3720-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253720-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3712-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253712-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3734-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253734-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03672-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503672-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3748-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253748-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3770-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253770-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3751-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253751-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03638-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503638-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03628-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503628-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3679-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253679-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3704-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253704-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3684-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253684-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3733-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253733-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03671-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503671-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3675-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253675-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03664-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503664-1"
},
{
"published_at": "2025-10-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03633-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503633-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3755-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253755-1"
},
{
"published_at": "2025-10-20",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3683-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253683-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3716-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253716-1"
},
{
"published_at": "2025-10-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03653-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503653-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03666-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503666-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3725-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253725-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3771-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253771-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03656-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503656-1"
},
{
"published_at": "2025-10-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:03662-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-202503662-1"
},
{
"published_at": "2025-10-21",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3705-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253705-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3764-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253764-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3721-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253721-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3768-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253768-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3717-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253717-1"
},
{
"published_at": "2025-10-24",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3769-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253769-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3740-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253740-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE suse-su-20253762-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253762-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3741-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253741-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3742-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253742-1"
},
{
"published_at": "2025-10-22",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3731-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253731-1"
},
{
"published_at": "2025-10-23",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2025:3765-1",
"url": "https://www.suse.com/support/update/announcement/2025/suse-su-20253765-1"
}
]
}
FKIE_CVE-2023-53344
Vulnerability from fkie_nvd - Published: 2025-09-17 15:15 - Updated: 2026-06-17 06:445.5 (Medium) - CVSS:3.1/
| URL | Tags | ||
|---|---|---|---|
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/2b4c99f7d9a57ecd644eda9b1fb0a1072414959f | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/2e6ad51c709fa794e0ce26003c9c9cd944e3383a | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/618b15d09fed6126356101543451d49860db4388 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/78bc7f0ab99458221224d3ab97199c0f8e6861f1 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/ab2a55907823f0bca56b6d03ea05e4071ba8535f | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/bf70e0eab64c625da84d9fdf4e84466b79418920 | Patch | |
| 416baaa9-dc9f-4396-8d5f-8c081fb06d67 | https://git.kernel.org/stable/c/c11dbc7705b3739974ac31a13f4ab81e61a5fb07 | Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | * | |
| linux | linux_kernel | 6.3 | |
| linux | linux_kernel | 6.3 | |
| linux | linux_kernel | 6.3 | |
| linux | linux_kernel | 6.3 |
{
"affected": [
{
"affectedData": [
{
"defaultStatus": "unaffected",
"product": "Linux",
"programFiles": [
"net/can/bcm.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"lessThan": "3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "618b15d09fed6126356101543451d49860db4388",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "78bc7f0ab99458221224d3ab97199c0f8e6861f1",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "ab2a55907823f0bca56b6d03ea05e4071ba8535f",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "bf70e0eab64c625da84d9fdf4e84466b79418920",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "c11dbc7705b3739974ac31a13f4ab81e61a5fb07",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "2e6ad51c709fa794e0ce26003c9c9cd944e3383a",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
},
{
"lessThan": "2b4c99f7d9a57ecd644eda9b1fb0a1072414959f",
"status": "affected",
"version": "6f3b911d5f29b98752e5da86a295210c0c4f4e14",
"versionType": "git"
}
]
},
{
"defaultStatus": "affected",
"product": "Linux",
"programFiles": [
"net/can/bcm.c"
],
"repo": "https://git.kernel.org/pub/scm/linux/kernel/git/stable/linux.git",
"vendor": "Linux",
"versions": [
{
"status": "affected",
"version": "4.8"
},
{
"lessThan": "4.8",
"status": "unaffected",
"version": "0",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.14.*",
"status": "unaffected",
"version": "4.14.312",
"versionType": "semver"
},
{
"lessThanOrEqual": "4.19.*",
"status": "unaffected",
"version": "4.19.280",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.4.*",
"status": "unaffected",
"version": "5.4.240",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.10.*",
"status": "unaffected",
"version": "5.10.177",
"versionType": "semver"
},
{
"lessThanOrEqual": "5.15.*",
"status": "unaffected",
"version": "5.15.106",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.1.*",
"status": "unaffected",
"version": "6.1.23",
"versionType": "semver"
},
{
"lessThanOrEqual": "6.2.*",
"status": "unaffected",
"version": "6.2.10",
"versionType": "semver"
},
{
"lessThanOrEqual": "*",
"status": "unaffected",
"version": "6.3",
"versionType": "original_commit_for_fix"
}
]
}
],
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B3D02741-96A1-4D83-8B57-F48AD85FD045",
"versionEndExcluding": "4.14.312",
"versionStartIncluding": "4.8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "B8449DA5-0637-406C-99C3-84AF4CB5F3EB",
"versionEndExcluding": "4.19.280",
"versionStartIncluding": "4.15",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "2C5F51A3-AEBF-4E51-AA58-D8C8B4554A86",
"versionEndExcluding": "5.4.240",
"versionStartIncluding": "4.20",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "9FED8369-E7A1-48C6-9700-6ADEDEC371F7",
"versionEndExcluding": "5.10.177",
"versionStartIncluding": "5.5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "46A62903-B927-42D9-88F8-7F39EC9BC23B",
"versionEndExcluding": "5.15.106",
"versionStartIncluding": "5.11",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "C6396026-EF6B-4933-AF27-B3AFE6E5506D",
"versionEndExcluding": "6.1.23",
"versionStartIncluding": "5.16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "5178A008-E2D6-4093-BCD4-8A80523EE39E",
"versionEndExcluding": "6.2.10",
"versionStartIncluding": "6.2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.3:rc1:*:*:*:*:*:*",
"matchCriteriaId": "B8E3B0E8-FA27-4305-87BB-AF6C25B160CB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.3:rc2:*:*:*:*:*:*",
"matchCriteriaId": "A47F0FC3-CE52-4BA1-BA51-22F783938431",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.3:rc3:*:*:*:*:*:*",
"matchCriteriaId": "3583026A-27EC-4A4C-850A-83F2AF970673",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:linux:linux_kernel:6.3:rc4:*:*:*:*:*:*",
"matchCriteriaId": "DC271202-7570-4505-89A4-D602D47BFD00",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "In the Linux kernel, the following vulnerability has been resolved:\n\ncan: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write\n\nSyzkaller reported the following issue:\n\n=====================================================\nBUG: KMSAN: uninit-value in aio_rw_done fs/aio.c:1520 [inline]\nBUG: KMSAN: uninit-value in aio_write+0x899/0x950 fs/aio.c:1600\n aio_rw_done fs/aio.c:1520 [inline]\n aio_write+0x899/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:766 [inline]\n slab_alloc_node mm/slub.c:3452 [inline]\n __kmem_cache_alloc_node+0x71f/0xce0 mm/slub.c:3491\n __do_kmalloc_node mm/slab_common.c:967 [inline]\n __kmalloc+0x11d/0x3b0 mm/slab_common.c:981\n kmalloc_array include/linux/slab.h:636 [inline]\n bcm_tx_setup+0x80e/0x29d0 net/can/bcm.c:930\n bcm_sendmsg+0x3a2/0xce0 net/can/bcm.c:1351\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n sock_write_iter+0x495/0x5e0 net/socket.c:1108\n call_write_iter include/linux/fs.h:2189 [inline]\n aio_write+0x63a/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nCPU: 1 PID: 5034 Comm: syz-executor350 Not tainted 6.2.0-rc6-syzkaller-80422-geda666ff2276 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/12/2023\n=====================================================\n\nWe can follow the call chain and find that \u0027bcm_tx_setup\u0027 function\ncalls \u0027memcpy_from_msg\u0027 to copy some content to the newly allocated\nframe of \u0027op-\u003eframes\u0027. After that the \u0027len\u0027 field of copied structure\nbeing compared with some constant value (64 or 8). However, if\n\u0027memcpy_from_msg\u0027 returns an error, we will compare some uninitialized\nmemory. This triggers \u0027uninit-value\u0027 issue.\n\nThis patch will add \u0027memcpy_from_msg\u0027 possible errors processing to\navoid uninit-value issue.\n\nTested via syzkaller"
}
],
"id": "CVE-2023-53344",
"lastModified": "2026-06-17T06:44:57.197",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-53344",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2026-01-14T18:39:34.603082Z",
"version": "2.0.3"
}
}
]
},
"published": "2025-09-17T15:15:38.237",
"references": [
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2b4c99f7d9a57ecd644eda9b1fb0a1072414959f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/2e6ad51c709fa794e0ce26003c9c9cd944e3383a"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/618b15d09fed6126356101543451d49860db4388"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/78bc7f0ab99458221224d3ab97199c0f8e6861f1"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/ab2a55907823f0bca56b6d03ea05e4071ba8535f"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/bf70e0eab64c625da84d9fdf4e84466b79418920"
},
{
"source": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"tags": [
"Patch"
],
"url": "https://git.kernel.org/stable/c/c11dbc7705b3739974ac31a13f4ab81e61a5fb07"
}
],
"sourceIdentifier": "416baaa9-dc9f-4396-8d5f-8c081fb06d67",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-908"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-908"
}
],
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
]
}
GHSA-7QP3-GX4R-G85J
Vulnerability from github – Published: 2025-09-17 15:30 – Updated: 2025-12-11 15:30In the Linux kernel, the following vulnerability has been resolved:
can: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write
Syzkaller reported the following issue:
===================================================== BUG: KMSAN: uninit-value in aio_rw_done fs/aio.c:1520 [inline] BUG: KMSAN: uninit-value in aio_write+0x899/0x950 fs/aio.c:1600 aio_rw_done fs/aio.c:1520 [inline] aio_write+0x899/0x950 fs/aio.c:1600 io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019 __do_sys_io_submit fs/aio.c:2078 [inline] __se_sys_io_submit+0x293/0x770 fs/aio.c:2048 __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048 do_syscall_x64 arch/x86/entry/common.c:50 [inline] do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0xcd
Uninit was created at: slab_post_alloc_hook mm/slab.h:766 [inline] slab_alloc_node mm/slub.c:3452 [inline] __kmem_cache_alloc_node+0x71f/0xce0 mm/slub.c:3491 __do_kmalloc_node mm/slab_common.c:967 [inline] __kmalloc+0x11d/0x3b0 mm/slab_common.c:981 kmalloc_array include/linux/slab.h:636 [inline] bcm_tx_setup+0x80e/0x29d0 net/can/bcm.c:930 bcm_sendmsg+0x3a2/0xce0 net/can/bcm.c:1351 sock_sendmsg_nosec net/socket.c:714 [inline] sock_sendmsg net/socket.c:734 [inline] sock_write_iter+0x495/0x5e0 net/socket.c:1108 call_write_iter include/linux/fs.h:2189 [inline] aio_write+0x63a/0x950 fs/aio.c:1600 io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019 __do_sys_io_submit fs/aio.c:2078 [inline] __se_sys_io_submit+0x293/0x770 fs/aio.c:2048 __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048 do_syscall_x64 arch/x86/entry/common.c:50 [inline] do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0xcd
CPU: 1 PID: 5034 Comm: syz-executor350 Not tainted 6.2.0-rc6-syzkaller-80422-geda666ff2276 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/12/2023 =====================================================
We can follow the call chain and find that 'bcm_tx_setup' function calls 'memcpy_from_msg' to copy some content to the newly allocated frame of 'op->frames'. After that the 'len' field of copied structure being compared with some constant value (64 or 8). However, if 'memcpy_from_msg' returns an error, we will compare some uninitialized memory. This triggers 'uninit-value' issue.
This patch will add 'memcpy_from_msg' possible errors processing to avoid uninit-value issue.
Tested via syzkaller
{
"affected": [],
"aliases": [
"CVE-2023-53344"
],
"database_specific": {
"cwe_ids": [
"CWE-908"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2025-09-17T15:15:38Z",
"severity": "MODERATE"
},
"details": "In the Linux kernel, the following vulnerability has been resolved:\n\ncan: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write\n\nSyzkaller reported the following issue:\n\n=====================================================\nBUG: KMSAN: uninit-value in aio_rw_done fs/aio.c:1520 [inline]\nBUG: KMSAN: uninit-value in aio_write+0x899/0x950 fs/aio.c:1600\n aio_rw_done fs/aio.c:1520 [inline]\n aio_write+0x899/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:766 [inline]\n slab_alloc_node mm/slub.c:3452 [inline]\n __kmem_cache_alloc_node+0x71f/0xce0 mm/slub.c:3491\n __do_kmalloc_node mm/slab_common.c:967 [inline]\n __kmalloc+0x11d/0x3b0 mm/slab_common.c:981\n kmalloc_array include/linux/slab.h:636 [inline]\n bcm_tx_setup+0x80e/0x29d0 net/can/bcm.c:930\n bcm_sendmsg+0x3a2/0xce0 net/can/bcm.c:1351\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n sock_write_iter+0x495/0x5e0 net/socket.c:1108\n call_write_iter include/linux/fs.h:2189 [inline]\n aio_write+0x63a/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nCPU: 1 PID: 5034 Comm: syz-executor350 Not tainted 6.2.0-rc6-syzkaller-80422-geda666ff2276 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/12/2023\n=====================================================\n\nWe can follow the call chain and find that \u0027bcm_tx_setup\u0027 function\ncalls \u0027memcpy_from_msg\u0027 to copy some content to the newly allocated\nframe of \u0027op-\u003eframes\u0027. After that the \u0027len\u0027 field of copied structure\nbeing compared with some constant value (64 or 8). However, if\n\u0027memcpy_from_msg\u0027 returns an error, we will compare some uninitialized\nmemory. This triggers \u0027uninit-value\u0027 issue.\n\nThis patch will add \u0027memcpy_from_msg\u0027 possible errors processing to\navoid uninit-value issue.\n\nTested via syzkaller",
"id": "GHSA-7qp3-gx4r-g85j",
"modified": "2025-12-11T15:30:29Z",
"published": "2025-09-17T15:30:38Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53344"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2b4c99f7d9a57ecd644eda9b1fb0a1072414959f"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/2e6ad51c709fa794e0ce26003c9c9cd944e3383a"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/3fa0f1e0e31b1b73cdf59d4c36c7242e6ef821be"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/618b15d09fed6126356101543451d49860db4388"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/78bc7f0ab99458221224d3ab97199c0f8e6861f1"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/ab2a55907823f0bca56b6d03ea05e4071ba8535f"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/bf70e0eab64c625da84d9fdf4e84466b79418920"
},
{
"type": "WEB",
"url": "https://git.kernel.org/stable/c/c11dbc7705b3739974ac31a13f4ab81e61a5fb07"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
OESA-2025-2659 (CVE-2022-50349)
Vulnerability from osv_openeuler – Published: 2025-11-14 11:09 – Updated: 2026-08-06 11:09 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel, the following vulnerability has been resolved:
misc: tifm: fix possible memory leak in tifm_7xx1_switch_media()
If device_register() returns error in tifm_7xx1_switch_media(), name of kobject which is allocated in dev_set_name() called in device_add() is leaked.
Never directly free @dev after calling device_register(), even if it returned an error! Always use put_device() to give up the reference initialized.(CVE-2022-50349)
In the Linux kernel, the following vulnerability has been resolved:
net: hns: fix possible memory leak in hnae_ae_register()
Inject fault while probing module, if device_register() fails, but the refcount of kobject is not decreased to 0, the name allocated in dev_set_name() is leaked. Fix this by calling put_device(), so that name can be freed in callback function kobject_cleanup().
unreferenced object 0xffff00c01aba2100 (size 128): comm "systemd-udevd", pid 1259, jiffies 4294903284 (age 294.152s) hex dump (first 32 bytes): 68 6e 61 65 30 00 00 00 18 21 ba 1a c0 00 ff ff hnae0....!...... 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................ backtrace: [<0000000034783f26>] slab_post_alloc_hook+0xa0/0x3e0 [<00000000748188f2>] __kmem_cache_alloc_node+0x164/0x2b0 [<00000000ab0743e8>] __kmalloc_node_track_caller+0x6c/0x390 [<000000006c0ffb13>] kvasprintf+0x8c/0x118 [<00000000fa27bfe1>] kvasprintf_const+0x60/0xc8 [<0000000083e10ed7>] kobject_set_name_vargs+0x3c/0xc0 [<000000000b87affc>] dev_set_name+0x7c/0xa0 [<000000003fd8fe26>] hnae_ae_register+0xcc/0x190 [hnae] [<00000000fe97edc9>] hns_dsaf_ae_init+0x9c/0x108 [hns_dsaf] [<00000000c36ff1eb>] hns_dsaf_probe+0x548/0x748 hns_dsaf
In the Linux kernel, the following vulnerability has been resolved:
ext4: avoid crash when inline data creation follows DIO write
When inode is created and written to using direct IO, there is nothing to clear the EXT4_STATE_MAY_INLINE_DATA flag. Thus when inode gets truncated later to say 1 byte and written using normal write, we will try to store the data as inline data. This confuses the code later because the inode now has both normal block and inline data allocated and the confusion manifests for example as:
kernel BUG at fs/ext4/inode.c:2721! invalid opcode: 0000 [#1] PREEMPT SMP KASAN CPU: 0 PID: 359 Comm: repro Not tainted 5.19.0-rc8-00001-g31ba1e3b8305-dirty #15 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.0-1.fc36 04/01/2014 RIP: 0010:ext4_writepages+0x363d/0x3660 RSP: 0018:ffffc90000ccf260 EFLAGS: 00010293 RAX: ffffffff81e1abcd RBX: 0000008000000000 RCX: ffff88810842a180 RDX: 0000000000000000 RSI: 0000008000000000 RDI: 0000000000000000 RBP: ffffc90000ccf650 R08: ffffffff81e17d58 R09: ffffed10222c680b R10: dfffe910222c680c R11: 1ffff110222c680a R12: ffff888111634128 R13: ffffc90000ccf880 R14: 0000008410000000 R15: 0000000000000001 FS: 00007f72635d2640(0000) GS:ffff88811b000000(0000) knlGS:0000000000000000 CS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033 CR2: 0000565243379180 CR3: 000000010aa74000 CR4: 0000000000150eb0 Call Trace: <TASK> do_writepages+0x397/0x640 filemap_fdatawrite_wbc+0x151/0x1b0 file_write_and_wait_range+0x1c9/0x2b0 ext4_sync_file+0x19e/0xa00 vfs_fsync_range+0x17b/0x190 ext4_buffered_write_iter+0x488/0x530 ext4_file_write_iter+0x449/0x1b90 vfs_write+0xbcd/0xf40 ksys_write+0x198/0x2c0 __x64_sys_write+0x7b/0x90 do_syscall_64+0x3d/0x90 entry_SYSCALL_64_after_hwframe+0x63/0xcd </TASK>
Fix the problem by clearing EXT4_STATE_MAY_INLINE_DATA when we are doing direct IO write to a file.(CVE-2022-50435)
In the Linux kernel, the following vulnerability has been resolved:
iommu/vt-d: Clean up si_domain in the init_dmars() error path
A splat from kmem_cache_destroy() was seen with a kernel prior to commit ee2653bbe89d ("iommu/vt-d: Remove domain and devinfo mempool") when there was a failure in init_dmars(), because the iommu_domain cache still had objects. While the mempool code is now gone, there still is a leak of the si_domain memory if init_dmars() fails. So clean up si_domain in the init_dmars() error path.(CVE-2022-50482)
In the Linux kernel, the following vulnerability has been resolved:
ALSA: usb-audio: Fix potential memory leaks
When the driver hits -ENOMEM at allocating a URB or a buffer, it aborts and goes to the error path that releases the all previously allocated resources. However, when -ENOMEM hits at the middle of the sync EP URB allocation loop, the partially allocated URBs might be left without released, because ep->nurbs is still zero at that point.
Fix it by setting ep->nurbs at first, so that the error handler loops over the full URB list.(CVE-2022-50484)
In the Linux kernel, the following vulnerability has been resolved:
drm/mipi-dsi: Detach devices when removing the host
Whenever the MIPI-DSI host is unregistered, the code of mipi_dsi_host_unregister() loops over every device currently found on that bus and will unregister it.
However, it doesn't detach it from the bus first, which leads to all kind of resource leaks if the host wants to perform some clean up whenever a device is detached.(CVE-2022-50489)
In the Linux kernel, the following vulnerability has been resolved:
drm/radeon: Fix PCI device refcount leak in radeon_atrm_get_bios()
As comment of pci_get_class() says, it returns a pci_device with its refcount increased and decreased the refcount for the input parameter @from if it is not NULL.
If we break the loop in radeon_atrm_get_bios() with 'pdev' not NULL, we need to call pci_dev_put() to decrease the refcount. Add the missing pci_dev_put() to avoid refcount leak.(CVE-2022-50520)
In the Linux kernel, the following vulnerability has been resolved:
tipc: fix an information leak in tipc_topsrv_kern_subscr
Use a 8-byte write to initialize sub.usr_handle in tipc_topsrv_kern_subscr(), otherwise four bytes remain uninitialized when issuing setsockopt(..., SOL_TIPC, ...). This resulted in an infoleak reported by KMSAN when the packet was received:
===================================================== BUG: KMSAN: kernel-infoleak in copyout+0xbc/0x100 lib/iov_iter.c:169 instrument_copy_to_user ./include/linux/instrumented.h:121 copyout+0xbc/0x100 lib/iov_iter.c:169 _copy_to_iter+0x5c0/0x20a0 lib/iov_iter.c:527 copy_to_iter ./include/linux/uio.h:176 simple_copy_to_iter+0x64/0xa0 net/core/datagram.c:513 __skb_datagram_iter+0x123/0xdc0 net/core/datagram.c:419 skb_copy_datagram_iter+0x58/0x200 net/core/datagram.c:527 skb_copy_datagram_msg ./include/linux/skbuff.h:3903 packet_recvmsg+0x521/0x1e70 net/packet/af_packet.c:3469 _sysrecvmsg+0x2c4/0x810 net/socket.c:? _sys_recvmsg+0x217/0x840 net/socket.c:2743 __sys_recvmsg net/socket.c:2773 __do_sys_recvmsg net/socket.c:2783 __se_sys_recvmsg net/socket.c:2780 __x64_sys_recvmsg+0x364/0x540 net/socket.c:2780 do_syscall_x64 arch/x86/entry/common.c:50 do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0xcd arch/x86/entry/entry_64.S:120
...
Uninit was stored to memory at: tipc_sub_subscribe+0x42d/0xb50 net/tipc/subscr.c:156 tipc_conn_rcv_sub+0x246/0x620 net/tipc/topsrv.c:375 tipc_topsrv_kern_subscr+0x2e8/0x400 net/tipc/topsrv.c:579 tipc_group_create+0x4e7/0x7d0 net/tipc/group.c:190 tipc_sk_join+0x2a8/0x770 net/tipc/socket.c:3084 tipc_setsockopt+0xae5/0xe40 net/tipc/socket.c:3201 __sys_setsockopt+0x87f/0xdc0 net/socket.c:2252 __do_sys_setsockopt net/socket.c:2263 __se_sys_setsockopt net/socket.c:2260 __x64_sys_setsockopt+0xe0/0x160 net/socket.c:2260 do_syscall_x64 arch/x86/entry/common.c:50 do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0xcd arch/x86/entry/entry_64.S:120
Local variable sub created at: tipc_topsrv_kern_subscr+0x57/0x400 net/tipc/topsrv.c:562 tipc_group_create+0x4e7/0x7d0 net/tipc/group.c:190
Bytes 84-87 of 88 are uninitialized Memory access of size 88 starts at ffff88801ed57cd0 Data copied to user address 0000000020000400 ... =====================================================(CVE-2022-50531)
In the Linux kernel, the following vulnerability has been resolved:
wifi: brcmfmac: Fix potential shift-out-of-bounds in brcmf_fw_alloc_request()
This patch fixes a shift-out-of-bounds in brcmfmac that occurs in BIT(chiprev) when a 'chiprev' provided by the device is too large. It should also not be equal to or greater than BITS_PER_TYPE(u32) as we do bitwise AND with a u32 variable and BIT(chiprev). The patch adds a check that makes the function return NULL if that is the case. Note that the NULL case is later handled by the bus-specific caller, brcmf_usb_probe_cb() or brcmf_usb_reset_resume(), for example.
Found by a modified version of syzkaller.
UBSAN: shift-out-of-bounds in drivers/net/wireless/broadcom/brcm80211/brcmfmac/firmware.c shift exponent 151055786 is too large for 64-bit type 'long unsigned int' CPU: 0 PID: 1885 Comm: kworker/0:2 Tainted: G O 5.14.0+ #132 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.12.1-0-ga5cab58e9a3f-prebuilt.qemu.org 04/01/2014 Workqueue: usb_hub_wq hub_event Call Trace: dump_stack_lvl+0x57/0x7d ubsan_epilogue+0x5/0x40 __ubsan_handle_shift_out_of_bounds.cold+0x53/0xdb ? lock_chain_count+0x20/0x20 brcmf_fw_alloc_request.cold+0x19/0x3ea ? brcmf_fw_get_firmwares+0x250/0x250 ? brcmf_usb_ioctl_resp_wait+0x1a7/0x1f0 brcmf_usb_get_fwname+0x114/0x1a0 ? brcmf_usb_reset_resume+0x120/0x120 ? number+0x6c4/0x9a0 brcmf_c_process_clm_blob+0x168/0x590 ? put_dec+0x90/0x90 ? enable_ptr_key_workfn+0x20/0x20 ? brcmf_common_pd_remove+0x50/0x50 ? rcu_read_lock_sched_held+0xa1/0xd0 brcmf_c_preinit_dcmds+0x673/0xc40 ? brcmf_c_set_joinpref_default+0x100/0x100 ? rcu_read_lock_sched_held+0xa1/0xd0 ? rcu_read_lock_bh_held+0xb0/0xb0 ? lock_acquire+0x19d/0x4e0 ? find_held_lock+0x2d/0x110 ? brcmf_usb_deq+0x1cc/0x260 ? mark_held_locks+0x9f/0xe0 ? lockdep_hardirqs_on_prepare+0x273/0x3e0 ? _raw_spin_unlock_irqrestore+0x47/0x50 ? trace_hardirqs_on+0x1c/0x120 ? brcmf_usb_deq+0x1a7/0x260 ? brcmf_usb_rx_fill_all+0x5a/0xf0 brcmf_attach+0x246/0xd40 ? wiphy_new_nm+0x1476/0x1d50 ? kmemdup+0x30/0x40 brcmf_usb_probe+0x12de/0x1690 ? brcmf_usbdev_qinit.constprop.0+0x470/0x470 usb_probe_interface+0x25f/0x710 really_probe+0x1be/0xa90 __driver_probe_device+0x2ab/0x460 ? usb_match_id.part.0+0x88/0xc0 driver_probe_device+0x49/0x120 __device_attach_driver+0x18a/0x250 ? driver_allows_async_probing+0x120/0x120 bus_for_each_drv+0x123/0x1a0 ? bus_rescan_devices+0x20/0x20 ? lockdep_hardirqs_on_prepare+0x273/0x3e0 ? trace_hardirqs_on+0x1c/0x120 __device_attach+0x207/0x330 ? device_bind_driver+0xb0/0xb0 ? kobject_uevent_env+0x230/0x12c0 bus_probe_device+0x1a2/0x260 device_add+0xa61/0x1ce0 ? __mutex_unlock_slowpath+0xe7/0x660 ? __fw_devlink_link_to_suppliers+0x550/0x550 usb_set_configuration+0x984/0x1770 ? kernfs_create_link+0x175/0x230 usb_generic_driver_probe+0x69/0x90 usb_probe_device+0x9c/0x220 really_probe+0x1be/0xa90 __driver_probe_device+0x2ab/0x460 driver_probe_device+0x49/0x120 __device_attach_driver+0x18a/0x250 ? driver_allows_async_probing+0x120/0x120 bus_for_each_drv+0x123/0x1a0 ? bus_rescan_devices+0x20/0x20 ? lockdep_hardirqs_on_prepare+0x273/0x3e0 ? trace_hardirqs_on+0x1c/0x120 __device_attach+0x207/0x330 ? device_bind_driver+0xb0/0xb0 ? kobject_uevent_env+0x230/0x12c0 bus_probe_device+0x1a2/0x260 device_add+0xa61/0x1ce0 ? __fw_devlink_link_to_suppliers+0x550/0x550 usb_new_device.cold+0x463/0xf66 ? hub_disconnect+0x400/0x400 ? _raw_spin_unlock_irq+0x24/0x30 hub_event+0x10d5/0x3330 ? hub_port_debounce+0x280/0x280 ? __lock_acquire+0x1671/0x5790 ? wq_calc_node_cpumask+0x170/0x2a0 ? lock_release+0x640/0x640 ? rcu_read_lock_sched_held+0xa1/0xd0 ? rcu_read_lock_bh_held+0xb0/0xb0 ? lockdep_hardirqs_on_prepare+0x273/0x3e0 process_one_work+0x873/0x13e0 ? lock_release+0x640/0x640 ? pwq_dec_nr_in_flight+0x320/0x320 ? rwlock_bug.part.0+0x90/0x90 worker_thread+0x8b/0xd10 ? __kthread_parkme+0xd9/0x1d0 ? pr ---truncated---(CVE-2022-50551)
In the Linux kernel, the following vulnerability has been resolved:
blk-mq: use quiesced elevator switch when reinitializing queues
The hctx's run_work may be racing with the elevator switch when reinitializing hardware queues. The queue is merely frozen in this context, but that only prevents requests from allocating and doesn't stop the hctx work from running. The work may get an elevator pointer that's being torn down, and can result in use-after-free errors and kernel panics (example below). Use the quiesced elevator switch instead, and make the previous one static since it is now only used locally.
nvme nvme0: resetting controller nvme nvme0: 32/0/0 default/read/poll queues BUG: kernel NULL pointer dereference, address: 0000000000000008 #PF: supervisor read access in kernel mode #PF: error_code(0x0000) - not-present page PGD 80000020c8861067 P4D 80000020c8861067 PUD 250f8c8067 PMD 0 Oops: 0000 [#1] SMP PTI Workqueue: kblockd blk_mq_run_work_fn RIP: 0010:kyber_has_work+0x29/0x70
...
Call Trace: __blk_mq_do_dispatch_sched+0x83/0x2b0 __blk_mq_sched_dispatch_requests+0x12e/0x170 blk_mq_sched_dispatch_requests+0x30/0x60 __blk_mq_run_hw_queue+0x2b/0x50 process_one_work+0x1ef/0x380 worker_thread+0x2d/0x3e0(CVE-2022-50552)
In the Linux kernel, the following vulnerability has been resolved:
wifi: ath9k: don't allow to overwrite ENDPOINT0 attributes
A bad USB device is able to construct a service connection response message with target endpoint being ENDPOINT0 which is reserved for HTC_CTRL_RSVD_SVC and should not be modified to be used for any other services.
Reject such service connection responses.
Found by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2023-53185)
In the Linux kernel, the following vulnerability has been resolved:
wifi: ath9k: hif_usb: clean up skbs if ath9k_hif_usb_rx_stream() fails
Syzkaller detected a memory leak of skbs in ath9k_hif_usb_rx_stream(). While processing skbs in ath9k_hif_usb_rx_stream(), the already allocated skbs in skb_pool are not freed if ath9k_hif_usb_rx_stream() fails. If we have an incorrect pkt_len or pkt_tag, the input skb is considered invalid and dropped. All the associated packets already in skb_pool should be dropped and freed. Added a comment describing this issue.
The patch also makes remain_skb NULL after being processed so that it cannot be referenced after potential free. The initialization of hif_dev fields which are associated with remain_skb (rx_remain_len, rx_transfer_len and rx_pad_len) is moved after a new remain_skb is allocated.
Found by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2023-53199)
In the Linux kernel, the following vulnerability has been resolved:
can: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write
Syzkaller reported the following issue:
===================================================== BUG: KMSAN: uninit-value in aio_rw_done fs/aio.c:1520 [inline] BUG: KMSAN: uninit-value in aio_write+0x899/0x950 fs/aio.c:1600 aio_rw_done fs/aio.c:1520 [inline] aio_write+0x899/0x950 fs/aio.c:1600 io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019 __do_sys_io_submit fs/aio.c:2078 [inline] __se_sys_io_submit+0x293/0x770 fs/aio.c:2048 __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048 do_syscall_x64 arch/x86/entry/common.c:50 [inline] do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0xcd
Uninit was created at: slab_post_alloc_hook mm/slab.h:766 [inline] slab_alloc_node mm/slub.c:3452 [inline] __kmem_cache_alloc_node+0x71f/0xce0 mm/slub.c:3491 __do_kmalloc_node mm/slab_common.c:967 [inline] __kmalloc+0x11d/0x3b0 mm/slab_common.c:981 kmalloc_array include/linux/slab.h:636 [inline] bcm_tx_setup+0x80e/0x29d0 net/can/bcm.c:930 bcm_sendmsg+0x3a2/0xce0 net/can/bcm.c:1351 sock_sendmsg_nosec net/socket.c:714 [inline] sock_sendmsg net/socket.c:734 [inline] sock_write_iter+0x495/0x5e0 net/socket.c:1108 call_write_iter include/linux/fs.h:2189 [inline] aio_write+0x63a/0x950 fs/aio.c:1600 io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019 __do_sys_io_submit fs/aio.c:2078 [inline] __se_sys_io_submit+0x293/0x770 fs/aio.c:2048 __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048 do_syscall_x64 arch/x86/entry/common.c:50 [inline] do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80 entry_SYSCALL_64_after_hwframe+0x63/0xcd
CPU: 1 PID: 5034 Comm: syz-executor350 Not tainted 6.2.0-rc6-syzkaller-80422-geda666ff2276 #0 Hardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/12/2023 =====================================================
We can follow the call chain and find that 'bcm_tx_setup' function calls 'memcpy_from_msg' to copy some content to the newly allocated frame of 'op->frames'. After that the 'len' field of copied structure being compared with some constant value (64 or 8). However, if 'memcpy_from_msg' returns an error, we will compare some uninitialized memory. This triggers 'uninit-value' issue.
This patch will add 'memcpy_from_msg' possible errors processing to avoid uninit-value issue.
Tested via syzkaller(CVE-2023-53344)
In the Linux kernel, the following vulnerability has been resolved:
cifs: Fix warning and UAF when destroy the MR list
If the MR allocate failed, the MR recovery work not initialized and list not cleared. Then will be warning and UAF when release the MR:
WARNING: CPU: 4 PID: 824 at kernel/workqueue.c:3066 __flush_work.isra.0+0xf7/0x110 CPU: 4 PID: 824 Comm: mount.cifs Not tainted 6.1.0-rc5+ #82 RIP: 0010:__flush_work.isra.0+0xf7/0x110 Call Trace: <TASK> __cancel_work_timer+0x2ba/0x2e0 smbd_destroy+0x4e1/0x990 _smbd_get_connection+0x1cbd/0x2110 smbd_get_connection+0x21/0x40 cifs_get_tcp_session+0x8ef/0xda0 mount_get_conns+0x60/0x750 cifs_mount+0x103/0xd00 cifs_smb3_do_mount+0x1dd/0xcb0 smb3_get_tree+0x1d5/0x300 vfs_get_tree+0x41/0xf0 path_mount+0x9b3/0xdd0 __x64_sys_mount+0x190/0x1d0 do_syscall_64+0x35/0x80 entry_SYSCALL_64_after_hwframe+0x46/0xb0
BUG: KASAN: use-after-free in smbd_destroy+0x4fc/0x990 Read of size 8 at addr ffff88810b156a08 by task mount.cifs/824 CPU: 4 PID: 824 Comm: mount.cifs Tainted: G W 6.1.0-rc5+ #82 Call Trace: dump_stack_lvl+0x34/0x44 print_report+0x171/0x472 kasan_report+0xad/0x130 smbd_destroy+0x4fc/0x990 _smbd_get_connection+0x1cbd/0x2110 smbd_get_connection+0x21/0x40 cifs_get_tcp_session+0x8ef/0xda0 mount_get_conns+0x60/0x750 cifs_mount+0x103/0xd00 cifs_smb3_do_mount+0x1dd/0xcb0 smb3_get_tree+0x1d5/0x300 vfs_get_tree+0x41/0xf0 path_mount+0x9b3/0xdd0 __x64_sys_mount+0x190/0x1d0 do_syscall_64+0x35/0x80 entry_SYSCALL_64_after_hwframe+0x46/0xb0
Allocated by task 824: kasan_save_stack+0x1e/0x40 kasan_set_track+0x21/0x30 __kasan_kmalloc+0x7a/0x90 _smbd_get_connection+0x1b6f/0x2110 smbd_get_connection+0x21/0x40 cifs_get_tcp_session+0x8ef/0xda0 mount_get_conns+0x60/0x750 cifs_mount+0x103/0xd00 cifs_smb3_do_mount+0x1dd/0xcb0 smb3_get_tree+0x1d5/0x300 vfs_get_tree+0x41/0xf0 path_mount+0x9b3/0xdd0 __x64_sys_mount+0x190/0x1d0 do_syscall_64+0x35/0x80 entry_SYSCALL_64_after_hwframe+0x46/0xb0
Freed by task 824: kasan_save_stack+0x1e/0x40 kasan_set_track+0x21/0x30 kasan_save_free_info+0x2a/0x40 _kasanslab_free+0x143/0x1b0 kmem_cache_free+0xc8/0x330 _smbd_get_connection+0x1c6a/0x2110 smbd_get_connection+0x21/0x40 cifs_get_tcp_session+0x8ef/0xda0 mount_get_conns+0x60/0x750 cifs_mount+0x103/0xd00 cifs_smb3_do_mount+0x1dd/0xcb0 smb3_get_tree+0x1d5/0x300 vfs_get_tree+0x41/0xf0 path_mount+0x9b3/0xdd0 __x64_sys_mount+0x190/0x1d0 do_syscall_64+0x35/0x80 entry_SYSCALL_64_after_hwframe+0x46/0xb0
Let's initialize the MR recovery work before MR allocate to prevent the warning, remove the MRs from the list to prevent the UAF.(CVE-2023-53427)
In the Linux kernel, the following vulnerability has been resolved:
PCI/ASPM: Disable ASPM on MFD function removal to avoid use-after-free
Struct pcie_link_state->downstream is a pointer to the pci_dev of function 0. Previously we retained that pointer when removing function 0, and subsequent ASPM policy changes dereferenced it, resulting in a use-after-free warning from KASAN, e.g.:
# echo 1 > /sys/bus/pci/devices/0000:03:00.0/remove # echo powersave > /sys/module/pcie_aspm/parameters/policy
BUG: KASAN: slab-use-after-free in pcie_config_aspm_link+0x42d/0x500 Call Trace: kasan_report+0xae/0xe0 pcie_config_aspm_link+0x42d/0x500 pcie_aspm_set_policy+0x8e/0x1a0 param_attr_store+0x162/0x2c0 module_attr_store+0x3e/0x80
PCIe spec r6.0, sec 7.5.3.7, recommends that software program the same ASPM Control value in all functions of multi-function devices.
Disable ASPM and free the pcie_link_state when any child function is removed so we can discard the dangling pcie_link_state->downstream pointer and maintain the same ASPM Control configuration for all functions.
bhelgaas: commit log and comment
In the Linux kernel, the following vulnerability has been resolved:
HID: multitouch: Correct devm device reference for hidinput input_dev name
Reference the HID device rather than the input device for the devm allocation of the input_dev name. Referencing the input_dev would lead to a use-after-free when the input_dev was unregistered and subsequently fires a uevent that depends on the name. At the point of firing the uevent, the name would be freed by devres management.
Use devm_kasprintf to simplify the logic for allocating memory and formatting the input_dev name string.(CVE-2023-53454)
In the Linux kernel, the following vulnerability has been resolved:
xfrm: fix slab-use-after-free in decode_session6
When the xfrm device is set to the qdisc of the sfb type, the cb field of the sent skb may be modified during enqueuing. Then, slab-use-after-free may occur when the xfrm device sends IPv6 packets.
The stack information is as follows: BUG: KASAN: slab-use-after-free in decode_session6+0x103f/0x1890 Read of size 1 at addr ffff8881111458ef by task swapper/3/0 CPU: 3 PID: 0 Comm: swapper/3 Not tainted 6.4.0-next-20230707 #409 Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.14.0-1.fc33 04/01/2014 Call Trace: <IRQ> dump_stack_lvl+0xd9/0x150 print_address_description.constprop.0+0x2c/0x3c0 kasan_report+0x11d/0x130 decode_session6+0x103f/0x1890 __xfrm_decode_session+0x54/0xb0 xfrmi_xmit+0x173/0x1ca0 dev_hard_start_xmit+0x187/0x700 sch_direct_xmit+0x1a3/0xc30 __qdisc_run+0x510/0x17a0 __dev_queue_xmit+0x2215/0x3b10 neigh_connected_output+0x3c2/0x550 ip6_finish_output2+0x55a/0x1550 ip6_finish_output+0x6b9/0x1270 ip6_output+0x1f1/0x540 ndisc_send_skb+0xa63/0x1890 ndisc_send_rs+0x132/0x6f0 addrconf_rs_timer+0x3f1/0x870 call_timer_fn+0x1a0/0x580 expire_timers+0x29b/0x4b0 run_timer_softirq+0x326/0x910 __do_softirq+0x1d4/0x905 irq_exit_rcu+0xb7/0x120 sysvec_apic_timer_interrupt+0x97/0xc0 </IRQ> <TASK> asm_sysvec_apic_timer_interrupt+0x1a/0x20 RIP: 0010:intel_idle_hlt+0x23/0x30 Code: 1f 84 00 00 00 00 00 f3 0f 1e fa 41 54 41 89 d4 0f 1f 44 00 00 66 90 0f 1f 44 00 00 0f 00 2d c4 9f ab 00 0f 1f 44 00 00 fb f4 <fa> 44 89 e0 41 5c c3 66 0f 1f 44 00 00 f3 0f 1e fa 41 54 41 89 d4 RSP: 0018:ffffc90000197d78 EFLAGS: 00000246 RAX: 00000000000a83c3 RBX: ffffe8ffffd09c50 RCX: ffffffff8a22d8e5 RDX: 0000000000000001 RSI: ffffffff8d3f8080 RDI: ffffe8ffffd09c50 RBP: ffffffff8d3f8080 R08: 0000000000000001 R09: ffffed1026ba6d9d R10: ffff888135d36ceb R11: 0000000000000001 R12: 0000000000000001 R13: ffffffff8d3f8100 R14: 0000000000000001 R15: 0000000000000000 cpuidle_enter_state+0xd3/0x6f0 cpuidle_enter+0x4e/0xa0 do_idle+0x2fe/0x3c0 cpu_startup_entry+0x18/0x20 start_secondary+0x200/0x290 secondary_startup_64_no_verify+0x167/0x16b </TASK> Allocated by task 939: kasan_save_stack+0x22/0x40 kasan_set_track+0x25/0x30 __kasan_slab_alloc+0x7f/0x90 kmem_cache_alloc_node+0x1cd/0x410 kmalloc_reserve+0x165/0x270 __alloc_skb+0x129/0x330 inet6_ifa_notify+0x118/0x230 __ipv6_ifa_notify+0x177/0xbe0 addrconf_dad_completed+0x133/0xe00 addrconf_dad_work+0x764/0x1390 process_one_work+0xa32/0x16f0 worker_thread+0x67d/0x10c0 kthread+0x344/0x440 ret_from_fork+0x1f/0x30 The buggy address belongs to the object at ffff888111145800 which belongs to the cache skbuff_small_head of size 640 The buggy address is located 239 bytes inside of freed 640-byte region [ffff888111145800, ffff888111145a80)
As commit f855691975bb ("xfrm6: Fix the nexthdr offset in _decode_session6.") showed, xfrm_decode_session was originally intended only for the receive path. IP6CB(skb)->nhoff is not set during transmission. Therefore, set the cb field in the skb to 0 before sending packets.(CVE-2023-53500)
In the Linux kernel, the following vulnerability has been resolved:
wifi: brcmfmac: ensure CLM version is null-terminated to prevent stack-out-of-bounds
Fix a stack-out-of-bounds read in brcmfmac that occurs when 'buf' that is not null-terminated is passed as an argument of strreplace() in brcmf_c_preinit_dcmds(). This buffer is filled with a CLM version string by memcpy() in brcmf_fil_iovar_data_get(). Ensure buf is null-terminated.
Found by a modified version of syzkaller.
[ 33.004414][ T1896] brcmfmac: brcmf_c_process_clm_blob: no clm_blob available (err=-2), device may have limited channels available [ 33.013486][ T1896] brcmfmac: brcmf_c_preinit_dcmds: Firmware: BCM43236/3 wl0: Nov 30 2011 17:33:42 version 5.90.188.22 [ 33.021554][ T1896] ================================================================== [ 33.022379][ T1896] BUG: KASAN: stack-out-of-bounds in strreplace+0xf2/0x110 [ 33.023122][ T1896] Read of size 1 at addr ffffc90001d6efc8 by task kworker/0:2/1896 [ 33.023852][ T1896] [ 33.024096][ T1896] CPU: 0 PID: 1896 Comm: kworker/0:2 Tainted: G O 5.14.0+ #132 [ 33.024927][ T1896] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.12.1-0-ga5cab58e9a3f-prebuilt.qemu.org 04/01/2014 [ 33.026065][ T1896] Workqueue: usb_hub_wq hub_event [ 33.026581][ T1896] Call Trace: [ 33.026896][ T1896] dump_stack_lvl+0x57/0x7d [ 33.027372][ T1896] print_address_description.constprop.0.cold+0xf/0x334 [ 33.028037][ T1896] ? strreplace+0xf2/0x110 [ 33.028403][ T1896] ? strreplace+0xf2/0x110 [ 33.028807][ T1896] kasan_report.cold+0x83/0xdf [ 33.029283][ T1896] ? strreplace+0xf2/0x110 [ 33.029666][ T1896] strreplace+0xf2/0x110 [ 33.029966][ T1896] brcmf_c_preinit_dcmds+0xab1/0xc40 [ 33.030351][ T1896] ? brcmf_c_set_joinpref_default+0x100/0x100 [ 33.030787][ T1896] ? rcu_read_lock_sched_held+0xa1/0xd0 [ 33.031223][ T1896] ? rcu_read_lock_bh_held+0xb0/0xb0 [ 33.031661][ T1896] ? lock_acquire+0x19d/0x4e0 [ 33.032091][ T1896] ? find_held_lock+0x2d/0x110 [ 33.032605][ T1896] ? brcmf_usb_deq+0x1a7/0x260 [ 33.033087][ T1896] ? brcmf_usb_rx_fill_all+0x5a/0xf0 [ 33.033582][ T1896] brcmf_attach+0x246/0xd40 [ 33.034022][ T1896] ? wiphy_new_nm+0x1476/0x1d50 [ 33.034383][ T1896] ? kmemdup+0x30/0x40 [ 33.034722][ T1896] brcmf_usb_probe+0x12de/0x1690 [ 33.035223][ T1896] ? brcmf_usbdev_qinit.constprop.0+0x470/0x470 [ 33.035833][ T1896] usb_probe_interface+0x25f/0x710 [ 33.036315][ T1896] really_probe+0x1be/0xa90 [ 33.036656][ T1896] __driver_probe_device+0x2ab/0x460 [ 33.037026][ T1896] ? usb_match_id.part.0+0x88/0xc0 [ 33.037383][ T1896] driver_probe_device+0x49/0x120 [ 33.037790][ T1896] __device_attach_driver+0x18a/0x250 [ 33.038300][ T1896] ? driver_allows_async_probing+0x120/0x120 [ 33.038986][ T1896] bus_for_each_drv+0x123/0x1a0 [ 33.039906][ T1896] ? bus_rescan_devices+0x20/0x20 [ 33.041412][ T1896] ? lockdep_hardirqs_on_prepare+0x273/0x3e0 [ 33.041861][ T1896] ? trace_hardirqs_on+0x1c/0x120 [ 33.042330][ T1896] __device_attach+0x207/0x330 [ 33.042664][ T1896] ? device_bind_driver+0xb0/0xb0 [ 33.043026][ T1896] ? kobject_uevent_env+0x230/0x12c0 [ 33.043515][ T1896] bus_probe_device+0x1a2/0x260 [ 33.043914][ T1896] device_add+0xa61/0x1ce0 [ 33.044227][ T1896] ? __mutex_unlock_slowpath+0xe7/0x660 [ 33.044891][ T1896] ? __fw_devlink_link_to_suppliers+0x550/0x550 [ 33.045531][ T1896] usb_set_configuration+0x984/0x1770 [ 33.046051][ T1896] ? kernfs_create_link+0x175/0x230 [ 33.046548][ T1896] usb_generic_driver_probe+0x69/0x90 [ 33.046931][ T1896] usb_probe_device+0x9c/0x220 [ 33.047434][ T1896] really_probe+0x1be/0xa90 [ 33.047760][ T1896] __driver_probe_device+0x2ab/0x460 [ 33.048134][ T1896] driver_probe_device+0x49/0x120 [ 33.048516][ T1896] __device_attach_driver+0x18a/0x250 [ 33.048910][ T1896] ? driver_allows_async_probing+0x120/0x120 ---truncated---(CVE-2023-53582)
In the Linux kernel, the following vulnerability has been resolved:
wifi: ath9k: hif_usb: fix memory leak of remain_skbs
hif_dev->remain_skb is allocated and used exclusively in ath9k_hif_usb_rx_stream(). It is implied that an allocated remain_skb is processed and subsequently freed (in error paths) only during the next call of ath9k_hif_usb_rx_stream().
So, if the urbs are deallocated between those two calls due to the device deinitialization or suspend, it is possible that ath9k_hif_usb_rx_stream() is not called next time and the allocated remain_skb is leaked. Our local Syzkaller instance was able to trigger that.
remain_skb makes sense when receiving two consecutive urbs which are logically linked together, i.e. a specific data field from the first skb indicates a cached skb to be allocated, memcpy'd with some data and subsequently processed in the next call to ath9k_hif_usb_rx_stream(). Urbs deallocation supposedly makes that link irrelevant so we need to free the cached skb in those cases.
Fix the leak by introducing a function to explicitly free remain_skb (if it is not NULL) when the rx urbs have been deallocated. remain_skb is NULL when it has not been allocated at all (hif_dev struct is kzalloced) or when it has been processed in next call to ath9k_hif_usb_rx_stream().
Found by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2023-53641)
In the Linux kernel, the following vulnerability has been resolved:
scsi: ses: Fix possible desc_ptr out-of-bounds accesses
Sanitize possible desc_ptr out-of-bounds accesses in ses_enclosure_data_process().(CVE-2023-53675)
In the Linux kernel, the following vulnerability has been resolved:
scsi: target: iscsi: Fix buffer overflow in lio_target_nacl_info_show()
The function lio_target_nacl_info_show() uses sprintf() in a loop to print details for every iSCSI connection in a session without checking for the buffer length. With enough iSCSI connections it's possible to overflow the buffer provided by configfs and corrupt the memory.
This patch replaces sprintf() with sysfs_emit_at() that checks for buffer boundries.(CVE-2023-53676)
In the Linux kernel, the following vulnerability has been resolved:
wifi: ath9k: Fix potential stack-out-of-bounds write in ath9k_wmi_rsp_callback()
Fix a stack-out-of-bounds write that occurs in a WMI response callback function that is called after a timeout occurs in ath9k_wmi_cmd(). The callback writes to wmi->cmd_rsp_buf, a stack-allocated buffer that could no longer be valid when a timeout occurs. Set wmi->last_seq_id to 0 when a timeout occurred.
Found by a modified version of syzkaller.
BUG: KASAN: stack-out-of-bounds in ath9k_wmi_ctrl_rx Write of size 4 Call Trace: memcpy ath9k_wmi_ctrl_rx ath9k_htc_rx_msg ath9k_hif_usb_reg_in_cb __usb_hcd_giveback_urb usb_hcd_giveback_urb dummy_timer call_timer_fn run_timer_softirq __do_softirq irq_exit_rcu sysvec_apic_timer_interrupt(CVE-2023-53717)
In the Linux kernel, a resource management vulnerability exists in the cls_u32 network scheduler component. When the u32_replace_hw_knode operation fails, the system fails to properly undo the tcf_bind_filter operation previously performed via u32_set_parms, potentially leading to resource leaks or privilege escalation.(CVE-2023-53733)
In the Linux kernel, the following vulnerability has been resolved:
mm/vmscan: fix hwpoisoned large folio handling in shrink_folio_list
In shrink_folio_list(), the hwpoisoned folio may be large folio, which can't be handled by unmap_poisoned_folio(). For THP, try_to_unmap_one() must be passed with TTU_SPLIT_HUGE_PMD to split huge PMD first and then retry. Without TTU_SPLIT_HUGE_PMD, we will trigger null-ptr deref of pvmw.pte. Even we passed TTU_SPLIT_HUGE_PMD, we will trigger a WARN_ON_ONCE due to the page isn't in swapcache.
Since UCE is rare in real world, and race with reclaimation is more rare, just skipping the hwpoisoned large folio is enough. memory_failure() will handle it if the UCE is triggered again.
This happens when memory reclaim for large folio races with memory_failure(), and will lead to kernel panic. The race is as follows:
cpu0 cpu1 shrink_folio_list memory_failure TestSetPageHWPoison unmap_poisoned_folio --> trigger BUG_ON due to unmap_poisoned_folio couldn't handle large folio
[(CVE-2025-39725)
In the Linux kernel, the following vulnerability has been resolved:
jbd2: prevent softlockup in jbd2_log_do_checkpoint()
Both jbd2_log_do_checkpoint() and jbd2_journal_shrink_checkpoint_list() periodically release j_list_lock after processing a batch of buffers to avoid long hold times on the j_list_lock. However, since both functions contend for j_list_lock, the combined time spent waiting and processing can be significant.
jbd2_journal_shrink_checkpoint_list() explicitly calls cond_resched() when need_resched() is true to avoid softlockups during prolonged operations. But jbd2_log_do_checkpoint() only exits its loop when need_resched() is true, relying on potentially sleeping functions like __flush_batch() or wait_on_buffer() to trigger rescheduling. If those functions do not sleep, the kernel may hit a softlockup.
watchdog: BUG: soft lockup - CPU#3 stuck for 156s! [kworker/u129:2:373] CPU: 3 PID: 373 Comm: kworker/u129:2 Kdump: loaded Not tainted 6.6.0+ #10 Hardware name: Huawei TaiShan 2280 /BC11SPCD, BIOS 1.27 06/13/2017 Workqueue: writeback wb_workfn (flush-7:2) pstate: 20000005 (nzCv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--) pc : native_queued_spin_lock_slowpath+0x358/0x418 lr : jbd2_log_do_checkpoint+0x31c/0x438 [jbd2] Call trace: native_queued_spin_lock_slowpath+0x358/0x418 jbd2_log_do_checkpoint+0x31c/0x438 [jbd2] __jbd2_log_wait_for_space+0xfc/0x2f8 [jbd2] add_transaction_credits+0x3bc/0x418 [jbd2] start_this_handle+0xf8/0x560 [jbd2] jbd2__journal_start+0x118/0x228 [jbd2] __ext4_journal_start_sb+0x110/0x188 [ext4] ext4_do_writepages+0x3dc/0x740 [ext4] ext4_writepages+0xa4/0x190 [ext4] do_writepages+0x94/0x228 __writeback_single_inode+0x48/0x318 writeback_sb_inodes+0x204/0x590 __writeback_inodes_wb+0x54/0xf8 wb_writeback+0x2cc/0x3d8 wb_do_writeback+0x2e0/0x2f8 wb_workfn+0x80/0x2a8 process_one_work+0x178/0x3e8 worker_thread+0x234/0x3b8 kthread+0xf0/0x108 ret_from_fork+0x10/0x20
So explicitly call cond_resched() in jbd2_log_do_checkpoint() to avoid softlockup.(CVE-2025-39782)
In the Linux kernel, the following vulnerability has been resolved:
i40e: add validation for ring_len param
The ring_len parameter provided by the virtual function (VF)
is assigned directly to the hardware memory context (HMC) without
any validation.
To address this, introduce an upper boundary check for both Tx and Rx queue lengths. The maximum number of descriptors supported by the hardware is 8k-32. Additionally, enforce alignment constraints: Tx rings must be a multiple of 8, and Rx rings must be a multiple of 32.(CVE-2025-39973)
In the Linux kernel, the following vulnerability has been resolved:
fs: udf: fix OOB read in lengthAllocDescs handling
When parsing Allocation Extent Descriptor, lengthAllocDescs comes from on-disk data and must be validated against the block size. Crafted or corrupted images may set lengthAllocDescs so that the total descriptor length (sizeof(allocExtDesc) + lengthAllocDescs) exceeds the buffer, leading udf_update_tag() to call crc_itu_t() on out-of-bounds memory and trigger a KASAN use-after-free read.
BUG: KASAN: use-after-free in crc_itu_t+0x1d5/0x2b0 lib/crc-itu-t.c:60 Read of size 1 at addr ffff888041e7d000 by task syz-executor317/5309
CPU: 0 UID: 0 PID: 5309 Comm: syz-executor317 Not tainted 6.12.0-rc4-syzkaller-00261-g850925a8133c #0 Hardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014 Call Trace: <TASK> __dump_stack lib/dump_stack.c:94 [inline] dump_stack_lvl+0x241/0x360 lib/dump_stack.c:120 print_address_description mm/kasan/report.c:377 [inline] print_report+0x169/0x550 mm/kasan/report.c:488 kasan_report+0x143/0x180 mm/kasan/report.c:601 crc_itu_t+0x1d5/0x2b0 lib/crc-itu-t.c:60 udf_update_tag+0x70/0x6a0 fs/udf/misc.c:261 udf_write_aext+0x4d8/0x7b0 fs/udf/inode.c:2179 extent_trunc+0x2f7/0x4a0 fs/udf/truncate.c:46 udf_truncate_tail_extent+0x527/0x7e0 fs/udf/truncate.c:106 udf_release_file+0xc1/0x120 fs/udf/file.c:185 __fput+0x23f/0x880 fs/file_table.c:431 task_work_run+0x24f/0x310 kernel/task_work.c:239 exit_task_work include/linux/task_work.h:43 [inline] do_exit+0xa2f/0x28e0 kernel/exit.c:939 do_group_exit+0x207/0x2c0 kernel/exit.c:1088 __do_sys_exit_group kernel/exit.c:1099 [inline] __se_sys_exit_group kernel/exit.c:1097 [inline] __x64_sys_exit_group+0x3f/0x40 kernel/exit.c:1097 x64_sys_call+0x2634/0x2640 arch/x86/include/generated/asm/syscalls_64.h:232 do_syscall_x64 arch/x86/entry/common.c:52 [inline] do_syscall_64+0xf3/0x230 arch/x86/entry/common.c:83 entry_SYSCALL_64_after_hwframe+0x77/0x7f </TASK>
Validate the computed total length against epos->bh->b_size.
Found by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2025-40044)
| URL | Type | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"bpftool-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"kernel-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"kernel-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"kernel-debugsource-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"kernel-devel-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"kernel-source-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"kernel-tools-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"kernel-tools-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"kernel-tools-devel-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"perf-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"perf-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"python2-perf-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"python2-perf-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"python3-perf-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm",
"python3-perf-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.aarch64.rpm"
],
"src": [
"kernel-4.19.90-2511.2.0.0351.oe2003sp4.src.rpm"
],
"x86_64": [
"bpftool-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"bpftool-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"kernel-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"kernel-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"kernel-debugsource-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"kernel-devel-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"kernel-source-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"kernel-tools-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"kernel-tools-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"kernel-tools-devel-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"perf-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"perf-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"python2-perf-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"python2-perf-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"python3-perf-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm",
"python3-perf-debuginfo-4.19.90-2511.2.0.0351.oe2003sp4.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:20.03-LTS-SP4",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-20.03-LTS-SP4"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "4.19.90-2511.2.0.0351.oe2003sp4"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmisc: tifm: fix possible memory leak in tifm_7xx1_switch_media()\n\nIf device_register() returns error in tifm_7xx1_switch_media(),\nname of kobject which is allocated in dev_set_name() called in device_add()\nis leaked.\n\nNever directly free @dev after calling device_register(), even\nif it returned an error! Always use put_device() to give up the\nreference initialized.(CVE-2022-50349)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nnet: hns: fix possible memory leak in hnae_ae_register()\n\nInject fault while probing module, if device_register() fails,\nbut the refcount of kobject is not decreased to 0, the name\nallocated in dev_set_name() is leaked. Fix this by calling\nput_device(), so that name can be freed in callback function\nkobject_cleanup().\n\nunreferenced object 0xffff00c01aba2100 (size 128):\n comm \u0026quot;systemd-udevd\u0026quot;, pid 1259, jiffies 4294903284 (age 294.152s)\n hex dump (first 32 bytes):\n 68 6e 61 65 30 00 00 00 18 21 ba 1a c0 00 ff ff hnae0....!......\n 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 00 ................\n backtrace:\n [\u0026lt;0000000034783f26\u0026gt;] slab_post_alloc_hook+0xa0/0x3e0\n [\u0026lt;00000000748188f2\u0026gt;] __kmem_cache_alloc_node+0x164/0x2b0\n [\u0026lt;00000000ab0743e8\u0026gt;] __kmalloc_node_track_caller+0x6c/0x390\n [\u0026lt;000000006c0ffb13\u0026gt;] kvasprintf+0x8c/0x118\n [\u0026lt;00000000fa27bfe1\u0026gt;] kvasprintf_const+0x60/0xc8\n [\u0026lt;0000000083e10ed7\u0026gt;] kobject_set_name_vargs+0x3c/0xc0\n [\u0026lt;000000000b87affc\u0026gt;] dev_set_name+0x7c/0xa0\n [\u0026lt;000000003fd8fe26\u0026gt;] hnae_ae_register+0xcc/0x190 [hnae]\n [\u0026lt;00000000fe97edc9\u0026gt;] hns_dsaf_ae_init+0x9c/0x108 [hns_dsaf]\n [\u0026lt;00000000c36ff1eb\u0026gt;] hns_dsaf_probe+0x548/0x748 [hns_dsaf](CVE-2022-50352)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\next4: avoid crash when inline data creation follows DIO write\n\nWhen inode is created and written to using direct IO, there is nothing\nto clear the EXT4_STATE_MAY_INLINE_DATA flag. Thus when inode gets\ntruncated later to say 1 byte and written using normal write, we will\ntry to store the data as inline data. This confuses the code later\nbecause the inode now has both normal block and inline data allocated\nand the confusion manifests for example as:\n\nkernel BUG at fs/ext4/inode.c:2721!\ninvalid opcode: 0000 [#1] PREEMPT SMP KASAN\nCPU: 0 PID: 359 Comm: repro Not tainted 5.19.0-rc8-00001-g31ba1e3b8305-dirty #15\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.16.0-1.fc36 04/01/2014\nRIP: 0010:ext4_writepages+0x363d/0x3660\nRSP: 0018:ffffc90000ccf260 EFLAGS: 00010293\nRAX: ffffffff81e1abcd RBX: 0000008000000000 RCX: ffff88810842a180\nRDX: 0000000000000000 RSI: 0000008000000000 RDI: 0000000000000000\nRBP: ffffc90000ccf650 R08: ffffffff81e17d58 R09: ffffed10222c680b\nR10: dfffe910222c680c R11: 1ffff110222c680a R12: ffff888111634128\nR13: ffffc90000ccf880 R14: 0000008410000000 R15: 0000000000000001\nFS: 00007f72635d2640(0000) GS:ffff88811b000000(0000) knlGS:0000000000000000\nCS: 0010 DS: 0000 ES: 0000 CR0: 0000000080050033\nCR2: 0000565243379180 CR3: 000000010aa74000 CR4: 0000000000150eb0\nCall Trace:\n \u0026lt;TASK\u0026gt;\n do_writepages+0x397/0x640\n filemap_fdatawrite_wbc+0x151/0x1b0\n file_write_and_wait_range+0x1c9/0x2b0\n ext4_sync_file+0x19e/0xa00\n vfs_fsync_range+0x17b/0x190\n ext4_buffered_write_iter+0x488/0x530\n ext4_file_write_iter+0x449/0x1b90\n vfs_write+0xbcd/0xf40\n ksys_write+0x198/0x2c0\n __x64_sys_write+0x7b/0x90\n do_syscall_64+0x3d/0x90\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n \u0026lt;/TASK\u0026gt;\n\nFix the problem by clearing EXT4_STATE_MAY_INLINE_DATA when we are doing\ndirect IO write to a file.(CVE-2022-50435)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\niommu/vt-d: Clean up si_domain in the init_dmars() error path\n\nA splat from kmem_cache_destroy() was seen with a kernel prior to\ncommit ee2653bbe89d (\u0026quot;iommu/vt-d: Remove domain and devinfo mempool\u0026quot;)\nwhen there was a failure in init_dmars(), because the iommu_domain\ncache still had objects. While the mempool code is now gone, there\nstill is a leak of the si_domain memory if init_dmars() fails. So\nclean up si_domain in the init_dmars() error path.(CVE-2022-50482)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nALSA: usb-audio: Fix potential memory leaks\n\nWhen the driver hits -ENOMEM at allocating a URB or a buffer, it\naborts and goes to the error path that releases the all previously\nallocated resources. However, when -ENOMEM hits at the middle of the\nsync EP URB allocation loop, the partially allocated URBs might be\nleft without released, because ep-\u0026gt;nurbs is still zero at that point.\n\nFix it by setting ep-\u0026gt;nurbs at first, so that the error handler loops\nover the full URB list.(CVE-2022-50484)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/mipi-dsi: Detach devices when removing the host\n\nWhenever the MIPI-DSI host is unregistered, the code of\nmipi_dsi_host_unregister() loops over every device currently found on that\nbus and will unregister it.\n\nHowever, it doesn\u0026apos;t detach it from the bus first, which leads to all kind\nof resource leaks if the host wants to perform some clean up whenever a\ndevice is detached.(CVE-2022-50489)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ndrm/radeon: Fix PCI device refcount leak in radeon_atrm_get_bios()\n\nAs comment of pci_get_class() says, it returns a pci_device with its\nrefcount increased and decreased the refcount for the input parameter\n@from if it is not NULL.\n\nIf we break the loop in radeon_atrm_get_bios() with \u0026apos;pdev\u0026apos; not NULL, we\nneed to call pci_dev_put() to decrease the refcount. Add the missing\npci_dev_put() to avoid refcount leak.(CVE-2022-50520)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ntipc: fix an information leak in tipc_topsrv_kern_subscr\n\nUse a 8-byte write to initialize sub.usr_handle in\ntipc_topsrv_kern_subscr(), otherwise four bytes remain uninitialized\nwhen issuing setsockopt(..., SOL_TIPC, ...).\nThis resulted in an infoleak reported by KMSAN when the packet was\nreceived:\n\n =====================================================\n BUG: KMSAN: kernel-infoleak in copyout+0xbc/0x100 lib/iov_iter.c:169\n instrument_copy_to_user ./include/linux/instrumented.h:121\n copyout+0xbc/0x100 lib/iov_iter.c:169\n _copy_to_iter+0x5c0/0x20a0 lib/iov_iter.c:527\n copy_to_iter ./include/linux/uio.h:176\n simple_copy_to_iter+0x64/0xa0 net/core/datagram.c:513\n __skb_datagram_iter+0x123/0xdc0 net/core/datagram.c:419\n skb_copy_datagram_iter+0x58/0x200 net/core/datagram.c:527\n skb_copy_datagram_msg ./include/linux/skbuff.h:3903\n packet_recvmsg+0x521/0x1e70 net/packet/af_packet.c:3469\n ____sys_recvmsg+0x2c4/0x810 net/socket.c:?\n ___sys_recvmsg+0x217/0x840 net/socket.c:2743\n __sys_recvmsg net/socket.c:2773\n __do_sys_recvmsg net/socket.c:2783\n __se_sys_recvmsg net/socket.c:2780\n __x64_sys_recvmsg+0x364/0x540 net/socket.c:2780\n do_syscall_x64 arch/x86/entry/common.c:50\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd arch/x86/entry/entry_64.S:120\n\n ...\n\n Uninit was stored to memory at:\n tipc_sub_subscribe+0x42d/0xb50 net/tipc/subscr.c:156\n tipc_conn_rcv_sub+0x246/0x620 net/tipc/topsrv.c:375\n tipc_topsrv_kern_subscr+0x2e8/0x400 net/tipc/topsrv.c:579\n tipc_group_create+0x4e7/0x7d0 net/tipc/group.c:190\n tipc_sk_join+0x2a8/0x770 net/tipc/socket.c:3084\n tipc_setsockopt+0xae5/0xe40 net/tipc/socket.c:3201\n __sys_setsockopt+0x87f/0xdc0 net/socket.c:2252\n __do_sys_setsockopt net/socket.c:2263\n __se_sys_setsockopt net/socket.c:2260\n __x64_sys_setsockopt+0xe0/0x160 net/socket.c:2260\n do_syscall_x64 arch/x86/entry/common.c:50\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd arch/x86/entry/entry_64.S:120\n\n Local variable sub created at:\n tipc_topsrv_kern_subscr+0x57/0x400 net/tipc/topsrv.c:562\n tipc_group_create+0x4e7/0x7d0 net/tipc/group.c:190\n\n Bytes 84-87 of 88 are uninitialized\n Memory access of size 88 starts at ffff88801ed57cd0\n Data copied to user address 0000000020000400\n ...\n =====================================================(CVE-2022-50531)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: brcmfmac: Fix potential shift-out-of-bounds in brcmf_fw_alloc_request()\n\nThis patch fixes a shift-out-of-bounds in brcmfmac that occurs in\nBIT(chiprev) when a \u0026apos;chiprev\u0026apos; provided by the device is too large.\nIt should also not be equal to or greater than BITS_PER_TYPE(u32)\nas we do bitwise AND with a u32 variable and BIT(chiprev). The patch\nadds a check that makes the function return NULL if that is the case.\nNote that the NULL case is later handled by the bus-specific caller,\nbrcmf_usb_probe_cb() or brcmf_usb_reset_resume(), for example.\n\nFound by a modified version of syzkaller.\n\nUBSAN: shift-out-of-bounds in drivers/net/wireless/broadcom/brcm80211/brcmfmac/firmware.c\nshift exponent 151055786 is too large for 64-bit type \u0026apos;long unsigned int\u0026apos;\nCPU: 0 PID: 1885 Comm: kworker/0:2 Tainted: G O 5.14.0+ #132\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.12.1-0-ga5cab58e9a3f-prebuilt.qemu.org 04/01/2014\nWorkqueue: usb_hub_wq hub_event\nCall Trace:\n dump_stack_lvl+0x57/0x7d\n ubsan_epilogue+0x5/0x40\n __ubsan_handle_shift_out_of_bounds.cold+0x53/0xdb\n ? lock_chain_count+0x20/0x20\n brcmf_fw_alloc_request.cold+0x19/0x3ea\n ? brcmf_fw_get_firmwares+0x250/0x250\n ? brcmf_usb_ioctl_resp_wait+0x1a7/0x1f0\n brcmf_usb_get_fwname+0x114/0x1a0\n ? brcmf_usb_reset_resume+0x120/0x120\n ? number+0x6c4/0x9a0\n brcmf_c_process_clm_blob+0x168/0x590\n ? put_dec+0x90/0x90\n ? enable_ptr_key_workfn+0x20/0x20\n ? brcmf_common_pd_remove+0x50/0x50\n ? rcu_read_lock_sched_held+0xa1/0xd0\n brcmf_c_preinit_dcmds+0x673/0xc40\n ? brcmf_c_set_joinpref_default+0x100/0x100\n ? rcu_read_lock_sched_held+0xa1/0xd0\n ? rcu_read_lock_bh_held+0xb0/0xb0\n ? lock_acquire+0x19d/0x4e0\n ? find_held_lock+0x2d/0x110\n ? brcmf_usb_deq+0x1cc/0x260\n ? mark_held_locks+0x9f/0xe0\n ? lockdep_hardirqs_on_prepare+0x273/0x3e0\n ? _raw_spin_unlock_irqrestore+0x47/0x50\n ? trace_hardirqs_on+0x1c/0x120\n ? brcmf_usb_deq+0x1a7/0x260\n ? brcmf_usb_rx_fill_all+0x5a/0xf0\n brcmf_attach+0x246/0xd40\n ? wiphy_new_nm+0x1476/0x1d50\n ? kmemdup+0x30/0x40\n brcmf_usb_probe+0x12de/0x1690\n ? brcmf_usbdev_qinit.constprop.0+0x470/0x470\n usb_probe_interface+0x25f/0x710\n really_probe+0x1be/0xa90\n __driver_probe_device+0x2ab/0x460\n ? usb_match_id.part.0+0x88/0xc0\n driver_probe_device+0x49/0x120\n __device_attach_driver+0x18a/0x250\n ? driver_allows_async_probing+0x120/0x120\n bus_for_each_drv+0x123/0x1a0\n ? bus_rescan_devices+0x20/0x20\n ? lockdep_hardirqs_on_prepare+0x273/0x3e0\n ? trace_hardirqs_on+0x1c/0x120\n __device_attach+0x207/0x330\n ? device_bind_driver+0xb0/0xb0\n ? kobject_uevent_env+0x230/0x12c0\n bus_probe_device+0x1a2/0x260\n device_add+0xa61/0x1ce0\n ? __mutex_unlock_slowpath+0xe7/0x660\n ? __fw_devlink_link_to_suppliers+0x550/0x550\n usb_set_configuration+0x984/0x1770\n ? kernfs_create_link+0x175/0x230\n usb_generic_driver_probe+0x69/0x90\n usb_probe_device+0x9c/0x220\n really_probe+0x1be/0xa90\n __driver_probe_device+0x2ab/0x460\n driver_probe_device+0x49/0x120\n __device_attach_driver+0x18a/0x250\n ? driver_allows_async_probing+0x120/0x120\n bus_for_each_drv+0x123/0x1a0\n ? bus_rescan_devices+0x20/0x20\n ? lockdep_hardirqs_on_prepare+0x273/0x3e0\n ? trace_hardirqs_on+0x1c/0x120\n __device_attach+0x207/0x330\n ? device_bind_driver+0xb0/0xb0\n ? kobject_uevent_env+0x230/0x12c0\n bus_probe_device+0x1a2/0x260\n device_add+0xa61/0x1ce0\n ? __fw_devlink_link_to_suppliers+0x550/0x550\n usb_new_device.cold+0x463/0xf66\n ? hub_disconnect+0x400/0x400\n ? _raw_spin_unlock_irq+0x24/0x30\n hub_event+0x10d5/0x3330\n ? hub_port_debounce+0x280/0x280\n ? __lock_acquire+0x1671/0x5790\n ? wq_calc_node_cpumask+0x170/0x2a0\n ? lock_release+0x640/0x640\n ? rcu_read_lock_sched_held+0xa1/0xd0\n ? rcu_read_lock_bh_held+0xb0/0xb0\n ? lockdep_hardirqs_on_prepare+0x273/0x3e0\n process_one_work+0x873/0x13e0\n ? lock_release+0x640/0x640\n ? pwq_dec_nr_in_flight+0x320/0x320\n ? rwlock_bug.part.0+0x90/0x90\n worker_thread+0x8b/0xd10\n ? __kthread_parkme+0xd9/0x1d0\n ? pr\n---truncated---(CVE-2022-50551)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nblk-mq: use quiesced elevator switch when reinitializing queues\n\nThe hctx\u0026apos;s run_work may be racing with the elevator switch when\nreinitializing hardware queues. The queue is merely frozen in this\ncontext, but that only prevents requests from allocating and doesn\u0026apos;t\nstop the hctx work from running. The work may get an elevator pointer\nthat\u0026apos;s being torn down, and can result in use-after-free errors and\nkernel panics (example below). Use the quiesced elevator switch instead,\nand make the previous one static since it is now only used locally.\n\n nvme nvme0: resetting controller\n nvme nvme0: 32/0/0 default/read/poll queues\n BUG: kernel NULL pointer dereference, address: 0000000000000008\n #PF: supervisor read access in kernel mode\n #PF: error_code(0x0000) - not-present page\n PGD 80000020c8861067 P4D 80000020c8861067 PUD 250f8c8067 PMD 0\n Oops: 0000 [#1] SMP PTI\n Workqueue: kblockd blk_mq_run_work_fn\n RIP: 0010:kyber_has_work+0x29/0x70\n\n...\n\n Call Trace:\n __blk_mq_do_dispatch_sched+0x83/0x2b0\n __blk_mq_sched_dispatch_requests+0x12e/0x170\n blk_mq_sched_dispatch_requests+0x30/0x60\n __blk_mq_run_hw_queue+0x2b/0x50\n process_one_work+0x1ef/0x380\n worker_thread+0x2d/0x3e0(CVE-2022-50552)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: ath9k: don\u0026apos;t allow to overwrite ENDPOINT0 attributes\n\nA bad USB device is able to construct a service connection response\nmessage with target endpoint being ENDPOINT0 which is reserved for\nHTC_CTRL_RSVD_SVC and should not be modified to be used for any other\nservices.\n\nReject such service connection responses.\n\nFound by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2023-53185)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: ath9k: hif_usb: clean up skbs if ath9k_hif_usb_rx_stream() fails\n\nSyzkaller detected a memory leak of skbs in ath9k_hif_usb_rx_stream().\nWhile processing skbs in ath9k_hif_usb_rx_stream(), the already allocated\nskbs in skb_pool are not freed if ath9k_hif_usb_rx_stream() fails. If we\nhave an incorrect pkt_len or pkt_tag, the input skb is considered invalid\nand dropped. All the associated packets already in skb_pool should be\ndropped and freed. Added a comment describing this issue.\n\nThe patch also makes remain_skb NULL after being processed so that it\ncannot be referenced after potential free. The initialization of hif_dev\nfields which are associated with remain_skb (rx_remain_len,\nrx_transfer_len and rx_pad_len) is moved after a new remain_skb is\nallocated.\n\nFound by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2023-53199)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncan: bcm: bcm_tx_setup(): fix KMSAN uninit-value in vfs_write\n\nSyzkaller reported the following issue:\n\n=====================================================\nBUG: KMSAN: uninit-value in aio_rw_done fs/aio.c:1520 [inline]\nBUG: KMSAN: uninit-value in aio_write+0x899/0x950 fs/aio.c:1600\n aio_rw_done fs/aio.c:1520 [inline]\n aio_write+0x899/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nUninit was created at:\n slab_post_alloc_hook mm/slab.h:766 [inline]\n slab_alloc_node mm/slub.c:3452 [inline]\n __kmem_cache_alloc_node+0x71f/0xce0 mm/slub.c:3491\n __do_kmalloc_node mm/slab_common.c:967 [inline]\n __kmalloc+0x11d/0x3b0 mm/slab_common.c:981\n kmalloc_array include/linux/slab.h:636 [inline]\n bcm_tx_setup+0x80e/0x29d0 net/can/bcm.c:930\n bcm_sendmsg+0x3a2/0xce0 net/can/bcm.c:1351\n sock_sendmsg_nosec net/socket.c:714 [inline]\n sock_sendmsg net/socket.c:734 [inline]\n sock_write_iter+0x495/0x5e0 net/socket.c:1108\n call_write_iter include/linux/fs.h:2189 [inline]\n aio_write+0x63a/0x950 fs/aio.c:1600\n io_submit_one+0x1d1c/0x3bf0 fs/aio.c:2019\n __do_sys_io_submit fs/aio.c:2078 [inline]\n __se_sys_io_submit+0x293/0x770 fs/aio.c:2048\n __x64_sys_io_submit+0x92/0xd0 fs/aio.c:2048\n do_syscall_x64 arch/x86/entry/common.c:50 [inline]\n do_syscall_64+0x3d/0xb0 arch/x86/entry/common.c:80\n entry_SYSCALL_64_after_hwframe+0x63/0xcd\n\nCPU: 1 PID: 5034 Comm: syz-executor350 Not tainted 6.2.0-rc6-syzkaller-80422-geda666ff2276 #0\nHardware name: Google Google Compute Engine/Google Compute Engine, BIOS Google 01/12/2023\n=====================================================\n\nWe can follow the call chain and find that \u0026apos;bcm_tx_setup\u0026apos; function\ncalls \u0026apos;memcpy_from_msg\u0026apos; to copy some content to the newly allocated\nframe of \u0026apos;op-\u0026gt;frames\u0026apos;. After that the \u0026apos;len\u0026apos; field of copied structure\nbeing compared with some constant value (64 or 8). However, if\n\u0026apos;memcpy_from_msg\u0026apos; returns an error, we will compare some uninitialized\nmemory. This triggers \u0026apos;uninit-value\u0026apos; issue.\n\nThis patch will add \u0026apos;memcpy_from_msg\u0026apos; possible errors processing to\navoid uninit-value issue.\n\nTested via syzkaller(CVE-2023-53344)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ncifs: Fix warning and UAF when destroy the MR list\n\nIf the MR allocate failed, the MR recovery work not initialized\nand list not cleared. Then will be warning and UAF when release\nthe MR:\n\n WARNING: CPU: 4 PID: 824 at kernel/workqueue.c:3066 __flush_work.isra.0+0xf7/0x110\n CPU: 4 PID: 824 Comm: mount.cifs Not tainted 6.1.0-rc5+ #82\n RIP: 0010:__flush_work.isra.0+0xf7/0x110\n Call Trace:\n \u0026lt;TASK\u0026gt;\n __cancel_work_timer+0x2ba/0x2e0\n smbd_destroy+0x4e1/0x990\n _smbd_get_connection+0x1cbd/0x2110\n smbd_get_connection+0x21/0x40\n cifs_get_tcp_session+0x8ef/0xda0\n mount_get_conns+0x60/0x750\n cifs_mount+0x103/0xd00\n cifs_smb3_do_mount+0x1dd/0xcb0\n smb3_get_tree+0x1d5/0x300\n vfs_get_tree+0x41/0xf0\n path_mount+0x9b3/0xdd0\n __x64_sys_mount+0x190/0x1d0\n do_syscall_64+0x35/0x80\n entry_SYSCALL_64_after_hwframe+0x46/0xb0\n\n BUG: KASAN: use-after-free in smbd_destroy+0x4fc/0x990\n Read of size 8 at addr ffff88810b156a08 by task mount.cifs/824\n CPU: 4 PID: 824 Comm: mount.cifs Tainted: G W 6.1.0-rc5+ #82\n Call Trace:\n dump_stack_lvl+0x34/0x44\n print_report+0x171/0x472\n kasan_report+0xad/0x130\n smbd_destroy+0x4fc/0x990\n _smbd_get_connection+0x1cbd/0x2110\n smbd_get_connection+0x21/0x40\n cifs_get_tcp_session+0x8ef/0xda0\n mount_get_conns+0x60/0x750\n cifs_mount+0x103/0xd00\n cifs_smb3_do_mount+0x1dd/0xcb0\n smb3_get_tree+0x1d5/0x300\n vfs_get_tree+0x41/0xf0\n path_mount+0x9b3/0xdd0\n __x64_sys_mount+0x190/0x1d0\n do_syscall_64+0x35/0x80\n entry_SYSCALL_64_after_hwframe+0x46/0xb0\n\n Allocated by task 824:\n kasan_save_stack+0x1e/0x40\n kasan_set_track+0x21/0x30\n __kasan_kmalloc+0x7a/0x90\n _smbd_get_connection+0x1b6f/0x2110\n smbd_get_connection+0x21/0x40\n cifs_get_tcp_session+0x8ef/0xda0\n mount_get_conns+0x60/0x750\n cifs_mount+0x103/0xd00\n cifs_smb3_do_mount+0x1dd/0xcb0\n smb3_get_tree+0x1d5/0x300\n vfs_get_tree+0x41/0xf0\n path_mount+0x9b3/0xdd0\n __x64_sys_mount+0x190/0x1d0\n do_syscall_64+0x35/0x80\n entry_SYSCALL_64_after_hwframe+0x46/0xb0\n\n Freed by task 824:\n kasan_save_stack+0x1e/0x40\n kasan_set_track+0x21/0x30\n kasan_save_free_info+0x2a/0x40\n ____kasan_slab_free+0x143/0x1b0\n __kmem_cache_free+0xc8/0x330\n _smbd_get_connection+0x1c6a/0x2110\n smbd_get_connection+0x21/0x40\n cifs_get_tcp_session+0x8ef/0xda0\n mount_get_conns+0x60/0x750\n cifs_mount+0x103/0xd00\n cifs_smb3_do_mount+0x1dd/0xcb0\n smb3_get_tree+0x1d5/0x300\n vfs_get_tree+0x41/0xf0\n path_mount+0x9b3/0xdd0\n __x64_sys_mount+0x190/0x1d0\n do_syscall_64+0x35/0x80\n entry_SYSCALL_64_after_hwframe+0x46/0xb0\n\nLet\u0026apos;s initialize the MR recovery work before MR allocate to prevent\nthe warning, remove the MRs from the list to prevent the UAF.(CVE-2023-53427)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nPCI/ASPM: Disable ASPM on MFD function removal to avoid use-after-free\n\nStruct pcie_link_state-\u0026gt;downstream is a pointer to the pci_dev of function\n0. Previously we retained that pointer when removing function 0, and\nsubsequent ASPM policy changes dereferenced it, resulting in a\nuse-after-free warning from KASAN, e.g.:\n\n # echo 1 \u0026gt; /sys/bus/pci/devices/0000:03:00.0/remove\n # echo powersave \u0026gt; /sys/module/pcie_aspm/parameters/policy\n\n BUG: KASAN: slab-use-after-free in pcie_config_aspm_link+0x42d/0x500\n Call Trace:\n kasan_report+0xae/0xe0\n pcie_config_aspm_link+0x42d/0x500\n pcie_aspm_set_policy+0x8e/0x1a0\n param_attr_store+0x162/0x2c0\n module_attr_store+0x3e/0x80\n\nPCIe spec r6.0, sec 7.5.3.7, recommends that software program the same ASPM\nControl value in all functions of multi-function devices.\n\nDisable ASPM and free the pcie_link_state when any child function is\nremoved so we can discard the dangling pcie_link_state-\u0026gt;downstream pointer\nand maintain the same ASPM Control configuration for all functions.\n\n[bhelgaas: commit log and comment](CVE-2023-53446)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nHID: multitouch: Correct devm device reference for hidinput input_dev name\n\nReference the HID device rather than the input device for the devm\nallocation of the input_dev name. Referencing the input_dev would lead to a\nuse-after-free when the input_dev was unregistered and subsequently fires a\nuevent that depends on the name. At the point of firing the uevent, the\nname would be freed by devres management.\n\nUse devm_kasprintf to simplify the logic for allocating memory and\nformatting the input_dev name string.(CVE-2023-53454)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nxfrm: fix slab-use-after-free in decode_session6\n\nWhen the xfrm device is set to the qdisc of the sfb type, the cb field\nof the sent skb may be modified during enqueuing. Then,\nslab-use-after-free may occur when the xfrm device sends IPv6 packets.\n\nThe stack information is as follows:\nBUG: KASAN: slab-use-after-free in decode_session6+0x103f/0x1890\nRead of size 1 at addr ffff8881111458ef by task swapper/3/0\nCPU: 3 PID: 0 Comm: swapper/3 Not tainted 6.4.0-next-20230707 #409\nHardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS 1.14.0-1.fc33 04/01/2014\nCall Trace:\n\u0026lt;IRQ\u0026gt;\ndump_stack_lvl+0xd9/0x150\nprint_address_description.constprop.0+0x2c/0x3c0\nkasan_report+0x11d/0x130\ndecode_session6+0x103f/0x1890\n__xfrm_decode_session+0x54/0xb0\nxfrmi_xmit+0x173/0x1ca0\ndev_hard_start_xmit+0x187/0x700\nsch_direct_xmit+0x1a3/0xc30\n__qdisc_run+0x510/0x17a0\n__dev_queue_xmit+0x2215/0x3b10\nneigh_connected_output+0x3c2/0x550\nip6_finish_output2+0x55a/0x1550\nip6_finish_output+0x6b9/0x1270\nip6_output+0x1f1/0x540\nndisc_send_skb+0xa63/0x1890\nndisc_send_rs+0x132/0x6f0\naddrconf_rs_timer+0x3f1/0x870\ncall_timer_fn+0x1a0/0x580\nexpire_timers+0x29b/0x4b0\nrun_timer_softirq+0x326/0x910\n__do_softirq+0x1d4/0x905\nirq_exit_rcu+0xb7/0x120\nsysvec_apic_timer_interrupt+0x97/0xc0\n\u0026lt;/IRQ\u0026gt;\n\u0026lt;TASK\u0026gt;\nasm_sysvec_apic_timer_interrupt+0x1a/0x20\nRIP: 0010:intel_idle_hlt+0x23/0x30\nCode: 1f 84 00 00 00 00 00 f3 0f 1e fa 41 54 41 89 d4 0f 1f 44 00 00 66 90 0f 1f 44 00 00 0f 00 2d c4 9f ab 00 0f 1f 44 00 00 fb f4 \u0026lt;fa\u0026gt; 44 89 e0 41 5c c3 66 0f 1f 44 00 00 f3 0f 1e fa 41 54 41 89 d4\nRSP: 0018:ffffc90000197d78 EFLAGS: 00000246\nRAX: 00000000000a83c3 RBX: ffffe8ffffd09c50 RCX: ffffffff8a22d8e5\nRDX: 0000000000000001 RSI: ffffffff8d3f8080 RDI: ffffe8ffffd09c50\nRBP: ffffffff8d3f8080 R08: 0000000000000001 R09: ffffed1026ba6d9d\nR10: ffff888135d36ceb R11: 0000000000000001 R12: 0000000000000001\nR13: ffffffff8d3f8100 R14: 0000000000000001 R15: 0000000000000000\ncpuidle_enter_state+0xd3/0x6f0\ncpuidle_enter+0x4e/0xa0\ndo_idle+0x2fe/0x3c0\ncpu_startup_entry+0x18/0x20\nstart_secondary+0x200/0x290\nsecondary_startup_64_no_verify+0x167/0x16b\n\u0026lt;/TASK\u0026gt;\nAllocated by task 939:\nkasan_save_stack+0x22/0x40\nkasan_set_track+0x25/0x30\n__kasan_slab_alloc+0x7f/0x90\nkmem_cache_alloc_node+0x1cd/0x410\nkmalloc_reserve+0x165/0x270\n__alloc_skb+0x129/0x330\ninet6_ifa_notify+0x118/0x230\n__ipv6_ifa_notify+0x177/0xbe0\naddrconf_dad_completed+0x133/0xe00\naddrconf_dad_work+0x764/0x1390\nprocess_one_work+0xa32/0x16f0\nworker_thread+0x67d/0x10c0\nkthread+0x344/0x440\nret_from_fork+0x1f/0x30\nThe buggy address belongs to the object at ffff888111145800\nwhich belongs to the cache skbuff_small_head of size 640\nThe buggy address is located 239 bytes inside of\nfreed 640-byte region [ffff888111145800, ffff888111145a80)\n\nAs commit f855691975bb (\u0026quot;xfrm6: Fix the nexthdr offset in\n_decode_session6.\u0026quot;) showed, xfrm_decode_session was originally intended\nonly for the receive path. IP6CB(skb)-\u0026gt;nhoff is not set during\ntransmission. Therefore, set the cb field in the skb to 0 before\nsending packets.(CVE-2023-53500)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: brcmfmac: ensure CLM version is null-terminated to prevent stack-out-of-bounds\n\nFix a stack-out-of-bounds read in brcmfmac that occurs\nwhen \u0026apos;buf\u0026apos; that is not null-terminated is passed as an argument of\nstrreplace() in brcmf_c_preinit_dcmds(). This buffer is filled with\na CLM version string by memcpy() in brcmf_fil_iovar_data_get().\nEnsure buf is null-terminated.\n\nFound by a modified version of syzkaller.\n\n[ 33.004414][ T1896] brcmfmac: brcmf_c_process_clm_blob: no clm_blob available (err=-2), device may have limited channels available\n[ 33.013486][ T1896] brcmfmac: brcmf_c_preinit_dcmds: Firmware: BCM43236/3 wl0: Nov 30 2011 17:33:42 version 5.90.188.22\n[ 33.021554][ T1896] ==================================================================\n[ 33.022379][ T1896] BUG: KASAN: stack-out-of-bounds in strreplace+0xf2/0x110\n[ 33.023122][ T1896] Read of size 1 at addr ffffc90001d6efc8 by task kworker/0:2/1896\n[ 33.023852][ T1896]\n[ 33.024096][ T1896] CPU: 0 PID: 1896 Comm: kworker/0:2 Tainted: G O 5.14.0+ #132\n[ 33.024927][ T1896] Hardware name: QEMU Standard PC (i440FX + PIIX, 1996), BIOS rel-1.12.1-0-ga5cab58e9a3f-prebuilt.qemu.org 04/01/2014\n[ 33.026065][ T1896] Workqueue: usb_hub_wq hub_event\n[ 33.026581][ T1896] Call Trace:\n[ 33.026896][ T1896] dump_stack_lvl+0x57/0x7d\n[ 33.027372][ T1896] print_address_description.constprop.0.cold+0xf/0x334\n[ 33.028037][ T1896] ? strreplace+0xf2/0x110\n[ 33.028403][ T1896] ? strreplace+0xf2/0x110\n[ 33.028807][ T1896] kasan_report.cold+0x83/0xdf\n[ 33.029283][ T1896] ? strreplace+0xf2/0x110\n[ 33.029666][ T1896] strreplace+0xf2/0x110\n[ 33.029966][ T1896] brcmf_c_preinit_dcmds+0xab1/0xc40\n[ 33.030351][ T1896] ? brcmf_c_set_joinpref_default+0x100/0x100\n[ 33.030787][ T1896] ? rcu_read_lock_sched_held+0xa1/0xd0\n[ 33.031223][ T1896] ? rcu_read_lock_bh_held+0xb0/0xb0\n[ 33.031661][ T1896] ? lock_acquire+0x19d/0x4e0\n[ 33.032091][ T1896] ? find_held_lock+0x2d/0x110\n[ 33.032605][ T1896] ? brcmf_usb_deq+0x1a7/0x260\n[ 33.033087][ T1896] ? brcmf_usb_rx_fill_all+0x5a/0xf0\n[ 33.033582][ T1896] brcmf_attach+0x246/0xd40\n[ 33.034022][ T1896] ? wiphy_new_nm+0x1476/0x1d50\n[ 33.034383][ T1896] ? kmemdup+0x30/0x40\n[ 33.034722][ T1896] brcmf_usb_probe+0x12de/0x1690\n[ 33.035223][ T1896] ? brcmf_usbdev_qinit.constprop.0+0x470/0x470\n[ 33.035833][ T1896] usb_probe_interface+0x25f/0x710\n[ 33.036315][ T1896] really_probe+0x1be/0xa90\n[ 33.036656][ T1896] __driver_probe_device+0x2ab/0x460\n[ 33.037026][ T1896] ? usb_match_id.part.0+0x88/0xc0\n[ 33.037383][ T1896] driver_probe_device+0x49/0x120\n[ 33.037790][ T1896] __device_attach_driver+0x18a/0x250\n[ 33.038300][ T1896] ? driver_allows_async_probing+0x120/0x120\n[ 33.038986][ T1896] bus_for_each_drv+0x123/0x1a0\n[ 33.039906][ T1896] ? bus_rescan_devices+0x20/0x20\n[ 33.041412][ T1896] ? lockdep_hardirqs_on_prepare+0x273/0x3e0\n[ 33.041861][ T1896] ? trace_hardirqs_on+0x1c/0x120\n[ 33.042330][ T1896] __device_attach+0x207/0x330\n[ 33.042664][ T1896] ? device_bind_driver+0xb0/0xb0\n[ 33.043026][ T1896] ? kobject_uevent_env+0x230/0x12c0\n[ 33.043515][ T1896] bus_probe_device+0x1a2/0x260\n[ 33.043914][ T1896] device_add+0xa61/0x1ce0\n[ 33.044227][ T1896] ? __mutex_unlock_slowpath+0xe7/0x660\n[ 33.044891][ T1896] ? __fw_devlink_link_to_suppliers+0x550/0x550\n[ 33.045531][ T1896] usb_set_configuration+0x984/0x1770\n[ 33.046051][ T1896] ? kernfs_create_link+0x175/0x230\n[ 33.046548][ T1896] usb_generic_driver_probe+0x69/0x90\n[ 33.046931][ T1896] usb_probe_device+0x9c/0x220\n[ 33.047434][ T1896] really_probe+0x1be/0xa90\n[ 33.047760][ T1896] __driver_probe_device+0x2ab/0x460\n[ 33.048134][ T1896] driver_probe_device+0x49/0x120\n[ 33.048516][ T1896] __device_attach_driver+0x18a/0x250\n[ 33.048910][ T1896] ? driver_allows_async_probing+0x120/0x120\n---truncated---(CVE-2023-53582)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: ath9k: hif_usb: fix memory leak of remain_skbs\n\nhif_dev-\u0026gt;remain_skb is allocated and used exclusively in\nath9k_hif_usb_rx_stream(). It is implied that an allocated remain_skb is\nprocessed and subsequently freed (in error paths) only during the next\ncall of ath9k_hif_usb_rx_stream().\n\nSo, if the urbs are deallocated between those two calls due to the device\ndeinitialization or suspend, it is possible that ath9k_hif_usb_rx_stream()\nis not called next time and the allocated remain_skb is leaked. Our local\nSyzkaller instance was able to trigger that.\n\nremain_skb makes sense when receiving two consecutive urbs which are\nlogically linked together, i.e. a specific data field from the first skb\nindicates a cached skb to be allocated, memcpy\u0026apos;d with some data and\nsubsequently processed in the next call to ath9k_hif_usb_rx_stream(). Urbs\ndeallocation supposedly makes that link irrelevant so we need to free the\ncached skb in those cases.\n\nFix the leak by introducing a function to explicitly free remain_skb (if\nit is not NULL) when the rx urbs have been deallocated. remain_skb is NULL\nwhen it has not been allocated at all (hif_dev struct is kzalloced) or\nwhen it has been processed in next call to ath9k_hif_usb_rx_stream().\n\nFound by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2023-53641)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: ses: Fix possible desc_ptr out-of-bounds accesses\n\nSanitize possible desc_ptr out-of-bounds accesses in\nses_enclosure_data_process().(CVE-2023-53675)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nscsi: target: iscsi: Fix buffer overflow in lio_target_nacl_info_show()\n\nThe function lio_target_nacl_info_show() uses sprintf() in a loop to print\ndetails for every iSCSI connection in a session without checking for the\nbuffer length. With enough iSCSI connections it\u0026apos;s possible to overflow the\nbuffer provided by configfs and corrupt the memory.\n\nThis patch replaces sprintf() with sysfs_emit_at() that checks for buffer\nboundries.(CVE-2023-53676)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nwifi: ath9k: Fix potential stack-out-of-bounds write in ath9k_wmi_rsp_callback()\n\nFix a stack-out-of-bounds write that occurs in a WMI response callback\nfunction that is called after a timeout occurs in ath9k_wmi_cmd().\nThe callback writes to wmi-\u0026gt;cmd_rsp_buf, a stack-allocated buffer that\ncould no longer be valid when a timeout occurs. Set wmi-\u0026gt;last_seq_id to\n0 when a timeout occurred.\n\nFound by a modified version of syzkaller.\n\nBUG: KASAN: stack-out-of-bounds in ath9k_wmi_ctrl_rx\nWrite of size 4\nCall Trace:\n memcpy\n ath9k_wmi_ctrl_rx\n ath9k_htc_rx_msg\n ath9k_hif_usb_reg_in_cb\n __usb_hcd_giveback_urb\n usb_hcd_giveback_urb\n dummy_timer\n call_timer_fn\n run_timer_softirq\n __do_softirq\n irq_exit_rcu\n sysvec_apic_timer_interrupt(CVE-2023-53717)\n\nIn the Linux kernel, a resource management vulnerability exists in the cls_u32 network scheduler component. When the u32_replace_hw_knode operation fails, the system fails to properly undo the tcf_bind_filter operation previously performed via u32_set_parms, potentially leading to resource leaks or privilege escalation.(CVE-2023-53733)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nmm/vmscan: fix hwpoisoned large folio handling in shrink_folio_list\n\nIn shrink_folio_list(), the hwpoisoned folio may be large folio, which\ncan\u0026apos;t be handled by unmap_poisoned_folio(). For THP, try_to_unmap_one()\nmust be passed with TTU_SPLIT_HUGE_PMD to split huge PMD first and then\nretry. Without TTU_SPLIT_HUGE_PMD, we will trigger null-ptr deref of\npvmw.pte. Even we passed TTU_SPLIT_HUGE_PMD, we will trigger a\nWARN_ON_ONCE due to the page isn\u0026apos;t in swapcache.\n\nSince UCE is rare in real world, and race with reclaimation is more rare,\njust skipping the hwpoisoned large folio is enough. memory_failure() will\nhandle it if the UCE is triggered again.\n\nThis happens when memory reclaim for large folio races with\nmemory_failure(), and will lead to kernel panic. The race is as\nfollows:\n\ncpu0 cpu1\n shrink_folio_list memory_failure\n TestSetPageHWPoison\n unmap_poisoned_folio\n --\u0026gt; trigger BUG_ON due to\n unmap_poisoned_folio couldn\u0026apos;t\n handle large folio\n\n[(CVE-2025-39725)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\njbd2: prevent softlockup in jbd2_log_do_checkpoint()\n\nBoth jbd2_log_do_checkpoint() and jbd2_journal_shrink_checkpoint_list()\nperiodically release j_list_lock after processing a batch of buffers to\navoid long hold times on the j_list_lock. However, since both functions\ncontend for j_list_lock, the combined time spent waiting and processing\ncan be significant.\n\njbd2_journal_shrink_checkpoint_list() explicitly calls cond_resched() when\nneed_resched() is true to avoid softlockups during prolonged operations.\nBut jbd2_log_do_checkpoint() only exits its loop when need_resched() is\ntrue, relying on potentially sleeping functions like __flush_batch() or\nwait_on_buffer() to trigger rescheduling. If those functions do not sleep,\nthe kernel may hit a softlockup.\n\nwatchdog: BUG: soft lockup - CPU#3 stuck for 156s! [kworker/u129:2:373]\nCPU: 3 PID: 373 Comm: kworker/u129:2 Kdump: loaded Not tainted 6.6.0+ #10\nHardware name: Huawei TaiShan 2280 /BC11SPCD, BIOS 1.27 06/13/2017\nWorkqueue: writeback wb_workfn (flush-7:2)\npstate: 20000005 (nzCv daif -PAN -UAO -TCO -DIT -SSBS BTYPE=--)\npc : native_queued_spin_lock_slowpath+0x358/0x418\nlr : jbd2_log_do_checkpoint+0x31c/0x438 [jbd2]\nCall trace:\n native_queued_spin_lock_slowpath+0x358/0x418\n jbd2_log_do_checkpoint+0x31c/0x438 [jbd2]\n __jbd2_log_wait_for_space+0xfc/0x2f8 [jbd2]\n add_transaction_credits+0x3bc/0x418 [jbd2]\n start_this_handle+0xf8/0x560 [jbd2]\n jbd2__journal_start+0x118/0x228 [jbd2]\n __ext4_journal_start_sb+0x110/0x188 [ext4]\n ext4_do_writepages+0x3dc/0x740 [ext4]\n ext4_writepages+0xa4/0x190 [ext4]\n do_writepages+0x94/0x228\n __writeback_single_inode+0x48/0x318\n writeback_sb_inodes+0x204/0x590\n __writeback_inodes_wb+0x54/0xf8\n wb_writeback+0x2cc/0x3d8\n wb_do_writeback+0x2e0/0x2f8\n wb_workfn+0x80/0x2a8\n process_one_work+0x178/0x3e8\n worker_thread+0x234/0x3b8\n kthread+0xf0/0x108\n ret_from_fork+0x10/0x20\n\nSo explicitly call cond_resched() in jbd2_log_do_checkpoint() to avoid\nsoftlockup.(CVE-2025-39782)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\ni40e: add validation for ring_len param\n\nThe `ring_len` parameter provided by the virtual function (VF)\nis assigned directly to the hardware memory context (HMC) without\nany validation.\n\nTo address this, introduce an upper boundary check for both Tx and Rx\nqueue lengths. The maximum number of descriptors supported by the\nhardware is 8k-32.\nAdditionally, enforce alignment constraints: Tx rings must be a multiple\nof 8, and Rx rings must be a multiple of 32.(CVE-2025-39973)\n\nIn the Linux kernel, the following vulnerability has been resolved:\n\nfs: udf: fix OOB read in lengthAllocDescs handling\n\nWhen parsing Allocation Extent Descriptor, lengthAllocDescs comes from\non-disk data and must be validated against the block size. Crafted or\ncorrupted images may set lengthAllocDescs so that the total descriptor\nlength (sizeof(allocExtDesc) + lengthAllocDescs) exceeds the buffer,\nleading udf_update_tag() to call crc_itu_t() on out-of-bounds memory and\ntrigger a KASAN use-after-free read.\n\nBUG: KASAN: use-after-free in crc_itu_t+0x1d5/0x2b0 lib/crc-itu-t.c:60\nRead of size 1 at addr ffff888041e7d000 by task syz-executor317/5309\n\nCPU: 0 UID: 0 PID: 5309 Comm: syz-executor317 Not tainted 6.12.0-rc4-syzkaller-00261-g850925a8133c #0\nHardware name: QEMU Standard PC (Q35 + ICH9, 2009), BIOS 1.16.3-debian-1.16.3-2~bpo12+1 04/01/2014\nCall Trace:\n \u0026lt;TASK\u0026gt;\n __dump_stack lib/dump_stack.c:94 [inline]\n dump_stack_lvl+0x241/0x360 lib/dump_stack.c:120\n print_address_description mm/kasan/report.c:377 [inline]\n print_report+0x169/0x550 mm/kasan/report.c:488\n kasan_report+0x143/0x180 mm/kasan/report.c:601\n crc_itu_t+0x1d5/0x2b0 lib/crc-itu-t.c:60\n udf_update_tag+0x70/0x6a0 fs/udf/misc.c:261\n udf_write_aext+0x4d8/0x7b0 fs/udf/inode.c:2179\n extent_trunc+0x2f7/0x4a0 fs/udf/truncate.c:46\n udf_truncate_tail_extent+0x527/0x7e0 fs/udf/truncate.c:106\n udf_release_file+0xc1/0x120 fs/udf/file.c:185\n __fput+0x23f/0x880 fs/file_table.c:431\n task_work_run+0x24f/0x310 kernel/task_work.c:239\n exit_task_work include/linux/task_work.h:43 [inline]\n do_exit+0xa2f/0x28e0 kernel/exit.c:939\n do_group_exit+0x207/0x2c0 kernel/exit.c:1088\n __do_sys_exit_group kernel/exit.c:1099 [inline]\n __se_sys_exit_group kernel/exit.c:1097 [inline]\n __x64_sys_exit_group+0x3f/0x40 kernel/exit.c:1097\n x64_sys_call+0x2634/0x2640 arch/x86/include/generated/asm/syscalls_64.h:232\n do_syscall_x64 arch/x86/entry/common.c:52 [inline]\n do_syscall_64+0xf3/0x230 arch/x86/entry/common.c:83\n entry_SYSCALL_64_after_hwframe+0x77/0x7f\n \u0026lt;/TASK\u0026gt;\n\nValidate the computed total length against epos-\u0026gt;bh-\u0026gt;b_size.\n\nFound by Linux Verification Center (linuxtesting.org) with Syzkaller.(CVE-2025-40044)",
"id": "OESA-2025-2659",
"modified": "2026-08-06T11:09:47Z",
"published": "2025-11-14T11:09:47Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/zh/security/security-bulletins/detail/?id=openEuler-SA-2025-2659"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50349"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50352"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50435"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50482"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50484"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50489"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50520"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50531"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50551"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-50552"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53185"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53199"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53344"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53427"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53446"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53454"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53500"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53582"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53641"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53675"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53676"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53717"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-53733"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39725"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39782"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-39973"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2025-40044"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:H/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-50349",
"CVE-2022-50352",
"CVE-2022-50435",
"CVE-2022-50482",
"CVE-2022-50484",
"CVE-2022-50489",
"CVE-2022-50520",
"CVE-2022-50531",
"CVE-2022-50551",
"CVE-2022-50552",
"CVE-2023-53185",
"CVE-2023-53199",
"CVE-2023-53344",
"CVE-2023-53427",
"CVE-2023-53446",
"CVE-2023-53454",
"CVE-2023-53500",
"CVE-2023-53582",
"CVE-2023-53641",
"CVE-2023-53675",
"CVE-2023-53676",
"CVE-2023-53717",
"CVE-2023-53733",
"CVE-2025-39725",
"CVE-2025-39782",
"CVE-2025-39973",
"CVE-2025-40044"
]
}
SUSE-SU-2025:03614-1
Vulnerability from csaf_suse - Published: 2025-10-16 05:48 - Updated: 2025-10-16 05:48SUSE-SU-2025:03615-1
Vulnerability from csaf_suse - Published: 2025-10-16 05:49 - Updated: 2025-10-16 05:49SUSE-SU-2025:03628-1
Vulnerability from csaf_suse - Published: 2025-10-17 11:34 - Updated: 2025-10-17 11:34SUSE-SU-2025:3716-1
Vulnerability from csaf_suse - Published: 2025-10-22 07:11 - Updated: 2025-10-22 07:11Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.