Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2023-28327 (GCVE-0-2023-28327)
Vulnerability from cvelistv5 – Published: 2023-04-19 00:00 – Updated: 2025-03-19 15:35{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T12:38:24.978Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2023-28327",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-03-06T15:56:18.401087Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-03-19T15:35:50.422Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"product": "Linux",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "Linux"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service."
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-476",
"description": "CWE-476",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-19T00:00:00.000Z",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2023-28327",
"datePublished": "2023-04-19T00:00:00.000Z",
"dateReserved": "2023-03-14T00:00:00.000Z",
"dateUpdated": "2025-03-19T15:35:50.422Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1",
"vulnerability-lookup:meta": {
"epss": {
"cve": "CVE-2023-28327",
"date": "2026-09-26",
"epss": "0.00189",
"percentile": "0.07663"
},
"microsoft_vex": {
"current_release_date": "2023-05-25T00:00:00.000Z",
"cve": "CVE-2023-28327",
"id": "msrc_CVE-2023-28327",
"initial_release_date": "2023-04-01T00:00:00.000Z",
"product_status:fixed": "1",
"product_status:known_affected": "1",
"source": "Microsoft CSAF VEX",
"status": "final",
"title": "A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service.",
"url": "https://msrc.microsoft.com/csaf/vex/2023/msrc_cve-2023-28327.json",
"version": "2"
},
"nvd": {
"cve": {
"affected": [
{
"affectedData": [
{
"product": "Linux",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "Linux"
}
]
}
],
"source": "secalert@redhat.com"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "87B81C9D-7173-4FFB-97BC-9C41AB20A53C",
"versionEndExcluding": "6.0",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
},
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:redhat:enterprise_linux:8.0:*:*:*:*:*:*:*",
"matchCriteriaId": "F4CFF558-3C47-480D-A2F0-BABF26042943",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:redhat:enterprise_linux:9.0:*:*:*:*:*:*:*",
"matchCriteriaId": "7F6FB57C-2BC7-487C-96DD-132683AEB35D",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service."
}
],
"id": "CVE-2023-28327",
"lastModified": "2026-06-17T05:47:26.733",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-28327",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-03-06T15:56:18.401087Z",
"version": "2.0.3"
}
}
]
},
"published": "2023-04-19T23:15:07.027",
"references": [
{
"source": "secalert@redhat.com",
"tags": [
"Issue Tracking",
"Patch"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Issue Tracking",
"Patch"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
}
],
"sourceIdentifier": "secalert@redhat.com",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "secalert@redhat.com",
"type": "Secondary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
},
"redhat_vex": {
"aggregate_severity": "Moderate",
"current_release_date": "2025-11-21T13:40:42+00:00",
"cve": "CVE-2023-28327",
"id": "CVE-2023-28327",
"initial_release_date": "2023-01-01T00:00:00+00:00",
"product_status:fixed": "356",
"product_status:known_affected": "108",
"product_status:known_not_affected": "114",
"source": "Red Hat CSAF VEX",
"status": "final",
"title": "kernel: denial of service problem in net/unix/diag.c",
"url": "https://security.access.redhat.com/data/csaf/v2/vex/2023/cve-2023-28327.json",
"version": "3"
},
"vulnrichment": {
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-02T12:38:24.978Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"tags": [
"x_transferred"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
}
],
"title": "CVE Program Container"
},
{
"metrics": [
{
"cvssV3_1": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
}
},
{
"other": {
"content": {
"id": "CVE-2023-28327",
"options": [
{
"Exploitation": "none"
},
{
"Automatable": "no"
},
{
"Technical Impact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-03-06T15:56:18.401087Z",
"version": "2.0.3"
},
"type": "ssvc"
}
}
],
"providerMetadata": {
"dateUpdated": "2025-03-06T15:56:19.618Z",
"orgId": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"shortName": "CISA-ADP"
},
"title": "CISA ADP Vulnrichment"
}
],
"cna": {
"affected": [
{
"product": "Linux",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "Linux"
}
]
}
],
"descriptions": [
{
"lang": "en",
"value": "A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service."
}
],
"problemTypes": [
{
"descriptions": [
{
"cweId": "CWE-476",
"description": "CWE-476",
"lang": "en",
"type": "CWE"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2023-04-19T00:00:00.000Z",
"orgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"shortName": "redhat"
},
"references": [
{
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
}
]
}
},
"cveMetadata": {
"assignerOrgId": "53f830b8-0a3f-465b-8143-3b8a9948e749",
"assignerShortName": "redhat",
"cveId": "CVE-2023-28327",
"datePublished": "2023-04-19T00:00:00.000Z",
"dateReserved": "2023-03-14T00:00:00.000Z",
"dateUpdated": "2025-03-19T15:35:50.422Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1"
}
}
}
CERTFR-2024-AVI-1102
Vulnerability from certfr_avis - Published: 2024-12-20 - Updated: 2024-12-20
De multiples vulnérabilités ont été découvertes dans le noyau Linux de SUSE. Certaines d'entre elles permettent à un attaquant de provoquer une exécution de code arbitraire, une atteinte à la confidentialité des données et une atteinte à l'intégrité des données.
Solutions
Se référer au bulletin de sécurité de l'éditeur pour l'obtention des correctifs (cf. section Documentation).
| Vendor | Product | Description | ||
|---|---|---|---|---|
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.3 | ||
| SUSE | N/A | Legacy Module 15-SP5 | ||
| SUSE | N/A | openSUSE Leap Micro 5.5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP5 | ||
| SUSE | N/A | SUSE Manager Proxy 4.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 Business Critical Linux | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.3 | ||
| SUSE | N/A | SUSE Manager Proxy 4.3 | ||
| SUSE | N/A | Basesystem Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.2 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 12 SP5 | ||
| SUSE | N/A | Public Cloud Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP4 | ||
| SUSE | N/A | Public Cloud Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro for Rancher 5.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP4 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP3 | ||
| SUSE | N/A | openSUSE Leap 15.4 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP4 | ||
| SUSE | N/A | openSUSE Leap 15.5 | ||
| SUSE | N/A | SUSE Manager Server 4.3 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 12 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 Business Critical Linux | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP5 | ||
| SUSE | N/A | Legacy Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 12-SP5 | ||
| SUSE | N/A | SUSE Manager Retail Branch Server 4.2 | ||
| SUSE | N/A | Confidential Computing Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Live Patching 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 | ||
| SUSE | N/A | SUSE Manager Server 4.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.2 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP6 | ||
| SUSE | N/A | openSUSE Leap 15.6 | ||
| SUSE | N/A | SUSE Enterprise Storage 7.1 | ||
| SUSE | N/A | SUSE Real Time Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Desktop 15 SP4 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing LTSS 15 SP4 | ||
| SUSE | N/A | SUSE Linux Enterprise Real Time 15 SP4 | ||
| SUSE | N/A | SUSE Manager Proxy 4.1 | ||
| SUSE | N/A | SUSE Manager Server 4.2 | ||
| SUSE | N/A | Basesystem Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Workstation Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise High Performance Computing 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP3 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 12 SP5 | ||
| SUSE | N/A | Development Tools Module 15-SP5 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP3 LTSS | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.1 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.4 | ||
| SUSE | N/A | openSUSE Leap 15.3 | ||
| SUSE | N/A | SUSE Linux Enterprise High Availability Extension 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP2 | ||
| SUSE | N/A | SUSE Linux Enterprise Server for SAP Applications 15 SP6 | ||
| SUSE | N/A | Development Tools Module 15-SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security | ||
| SUSE | N/A | SUSE Linux Enterprise Server 15 SP6 | ||
| SUSE | N/A | SUSE Linux Enterprise Micro 5.5 |
| Title | Publication Time | Tags | |||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||||||||||||||||||||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 Business Critical Linux",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Public Cloud Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro for Rancher 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 Business Critical Linux",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP2 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Legacy Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 12-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Retail Branch Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Confidential Computing Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Live Patching 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Enterprise Storage 7.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Real Time Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Desktop 15 SP4 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing ESPOS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing LTSS 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Real Time 15 SP4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Proxy 4.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Manager Server 4.2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Basesystem Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Workstation Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Performance Computing 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 12 SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP3 LTSS",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.1",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.4",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "openSUSE Leap 15.3",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise High Availability Extension 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP2",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server for SAP Applications 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "Development Tools Module 15-SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 12 SP5 LTSS Extended Security",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Server 15 SP6",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
},
{
"description": "SUSE Linux Enterprise Micro 5.5",
"product": {
"name": "N/A",
"vendor": {
"name": "SUSE",
"scada": false
}
}
}
],
"affected_systems_content": "",
"content": "## Solutions\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 de l\u0027\u00e9diteur pour l\u0027obtention des correctifs (cf. section Documentation).",
"cves": [
{
"name": "CVE-2022-3435",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-3435"
},
{
"name": "CVE-2022-45934",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-45934"
},
{
"name": "CVE-2023-28327",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-28327"
},
{
"name": "CVE-2023-2166",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-2166"
},
{
"name": "CVE-2023-6270",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-6270"
},
{
"name": "CVE-2023-52524",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52524"
},
{
"name": "CVE-2024-26801",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26801"
},
{
"name": "CVE-2024-26741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26741"
},
{
"name": "CVE-2024-26761",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26761"
},
{
"name": "CVE-2024-26782",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26782"
},
{
"name": "CVE-2024-26906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26906"
},
{
"name": "CVE-2024-27043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27043"
},
{
"name": "CVE-2024-27051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27051"
},
{
"name": "CVE-2024-26852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26852"
},
{
"name": "CVE-2021-47162",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47162"
},
{
"name": "CVE-2024-36031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36031"
},
{
"name": "CVE-2024-36883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36883"
},
{
"name": "CVE-2024-36886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36886"
},
{
"name": "CVE-2024-36905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36905"
},
{
"name": "CVE-2024-36953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36953"
},
{
"name": "CVE-2024-36954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36954"
},
{
"name": "CVE-2024-36957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36957"
},
{
"name": "CVE-2021-47416",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47416"
},
{
"name": "CVE-2021-47534",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47534"
},
{
"name": "CVE-2023-52766",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52766"
},
{
"name": "CVE-2023-52800",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52800"
},
{
"name": "CVE-2024-26758",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26758"
},
{
"name": "CVE-2024-26943",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26943"
},
{
"name": "CVE-2024-35937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35937"
},
{
"name": "CVE-2024-35888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35888"
},
{
"name": "CVE-2024-38589",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38589"
},
{
"name": "CVE-2024-38599",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38599"
},
{
"name": "CVE-2024-26864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26864"
},
{
"name": "CVE-2024-26886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26886"
},
{
"name": "CVE-2024-26953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26953"
},
{
"name": "CVE-2024-27026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27026"
},
{
"name": "CVE-2023-52881",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52881"
},
{
"name": "CVE-2024-26703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26703"
},
{
"name": "CVE-2024-27017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27017"
},
{
"name": "CVE-2024-35980",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-35980"
},
{
"name": "CVE-2024-38615",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38615"
},
{
"name": "CVE-2024-39476",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-39476"
},
{
"name": "CVE-2024-40914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40914"
},
{
"name": "CVE-2024-26767",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26767"
},
{
"name": "CVE-2022-48674",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48674"
},
{
"name": "CVE-2024-36000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36000"
},
{
"name": "CVE-2024-36920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36920"
},
{
"name": "CVE-2024-36927",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36927"
},
{
"name": "CVE-2024-36968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36968"
},
{
"name": "CVE-2024-38576",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38576"
},
{
"name": "CVE-2024-38577",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-38577"
},
{
"name": "CVE-2022-48853",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48853"
},
{
"name": "CVE-2024-41016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41016"
},
{
"name": "CVE-2024-42145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42145"
},
{
"name": "CVE-2024-36484",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36484"
},
{
"name": "CVE-2024-41049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41049"
},
{
"name": "CVE-2024-42102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42102"
},
{
"name": "CVE-2024-42131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42131"
},
{
"name": "CVE-2024-42229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42229"
},
{
"name": "CVE-2024-36244",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-36244"
},
{
"name": "CVE-2024-40965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40965"
},
{
"name": "CVE-2024-40997",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-40997"
},
{
"name": "CVE-2024-41047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41047"
},
{
"name": "CVE-2024-42098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42098"
},
{
"name": "CVE-2024-42226",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42226"
},
{
"name": "CVE-2024-42253",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-42253"
},
{
"name": "CVE-2024-43817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43817"
},
{
"name": "CVE-2024-43854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43854"
},
{
"name": "CVE-2024-43897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-43897"
},
{
"name": "CVE-2024-44931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44931"
},
{
"name": "CVE-2024-44947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44947"
},
{
"name": "CVE-2024-41023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41023"
},
{
"name": "CVE-2024-41031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41031"
},
{
"name": "CVE-2024-44995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44995"
},
{
"name": "CVE-2024-45016",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45016"
},
{
"name": "CVE-2024-45025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-45025"
},
{
"name": "CVE-2024-46716",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46716"
},
{
"name": "CVE-2024-46719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46719"
},
{
"name": "CVE-2024-46721",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46721"
},
{
"name": "CVE-2024-46770",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46770"
},
{
"name": "CVE-2024-46771",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46771"
},
{
"name": "CVE-2024-46777",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46777"
},
{
"name": "CVE-2024-46800",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46800"
},
{
"name": "CVE-2024-46802",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46802"
},
{
"name": "CVE-2024-46804",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46804"
},
{
"name": "CVE-2024-46805",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46805"
},
{
"name": "CVE-2024-46807",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46807"
},
{
"name": "CVE-2024-46810",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46810"
},
{
"name": "CVE-2024-46812",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46812"
},
{
"name": "CVE-2024-46814",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46814"
},
{
"name": "CVE-2024-46815",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46815"
},
{
"name": "CVE-2024-46817",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46817"
},
{
"name": "CVE-2024-46818",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46818"
},
{
"name": "CVE-2024-46819",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46819"
},
{
"name": "CVE-2024-46821",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46821"
},
{
"name": "CVE-2024-46826",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46826"
},
{
"name": "CVE-2024-46828",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46828"
},
{
"name": "CVE-2024-46830",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46830"
},
{
"name": "CVE-2024-46835",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46835"
},
{
"name": "CVE-2024-46836",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46836"
},
{
"name": "CVE-2024-46840",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46840"
},
{
"name": "CVE-2024-46846",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46846"
},
{
"name": "CVE-2024-46848",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46848"
},
{
"name": "CVE-2024-46849",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46849"
},
{
"name": "CVE-2024-46852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46852"
},
{
"name": "CVE-2024-46853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46853"
},
{
"name": "CVE-2024-46854",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46854"
},
{
"name": "CVE-2024-46855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46855"
},
{
"name": "CVE-2024-46857",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46857"
},
{
"name": "CVE-2024-46859",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46859"
},
{
"name": "CVE-2023-52915",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52915"
},
{
"name": "CVE-2024-41082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-41082"
},
{
"name": "CVE-2024-46678",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46678"
},
{
"name": "CVE-2024-46775",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46775"
},
{
"name": "CVE-2024-46797",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46797"
},
{
"name": "CVE-2024-47668",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47668"
},
{
"name": "CVE-2023-52918",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52918"
},
{
"name": "CVE-2024-47663",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47663"
},
{
"name": "CVE-2024-47667",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47667"
},
{
"name": "CVE-2024-47669",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47669"
},
{
"name": "CVE-2022-48664",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48664"
},
{
"name": "CVE-2022-48879",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48879"
},
{
"name": "CVE-2022-48946",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48946"
},
{
"name": "CVE-2022-48947",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48947"
},
{
"name": "CVE-2022-48948",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48948"
},
{
"name": "CVE-2022-48949",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48949"
},
{
"name": "CVE-2022-48951",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48951"
},
{
"name": "CVE-2022-48953",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48953"
},
{
"name": "CVE-2022-48954",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48954"
},
{
"name": "CVE-2022-48955",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48955"
},
{
"name": "CVE-2022-48956",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48956"
},
{
"name": "CVE-2022-48957",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48957"
},
{
"name": "CVE-2022-48958",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48958"
},
{
"name": "CVE-2022-48959",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48959"
},
{
"name": "CVE-2022-48960",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48960"
},
{
"name": "CVE-2022-48961",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48961"
},
{
"name": "CVE-2022-48962",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48962"
},
{
"name": "CVE-2022-48966",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48966"
},
{
"name": "CVE-2022-48967",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48967"
},
{
"name": "CVE-2022-48968",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48968"
},
{
"name": "CVE-2022-48969",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48969"
},
{
"name": "CVE-2022-48970",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48970"
},
{
"name": "CVE-2022-48971",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48971"
},
{
"name": "CVE-2022-48972",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48972"
},
{
"name": "CVE-2022-48973",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48973"
},
{
"name": "CVE-2022-48975",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48975"
},
{
"name": "CVE-2022-48977",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48977"
},
{
"name": "CVE-2022-48978",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48978"
},
{
"name": "CVE-2022-48980",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48980"
},
{
"name": "CVE-2022-48981",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48981"
},
{
"name": "CVE-2022-48985",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48985"
},
{
"name": "CVE-2022-48987",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48987"
},
{
"name": "CVE-2022-48988",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48988"
},
{
"name": "CVE-2022-48991",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48991"
},
{
"name": "CVE-2022-48992",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48992"
},
{
"name": "CVE-2022-48994",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48994"
},
{
"name": "CVE-2022-48995",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48995"
},
{
"name": "CVE-2022-48997",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48997"
},
{
"name": "CVE-2022-48999",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48999"
},
{
"name": "CVE-2022-49000",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49000"
},
{
"name": "CVE-2022-49002",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49002"
},
{
"name": "CVE-2022-49003",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49003"
},
{
"name": "CVE-2022-49005",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49005"
},
{
"name": "CVE-2022-49006",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49006"
},
{
"name": "CVE-2022-49007",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49007"
},
{
"name": "CVE-2022-49010",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49010"
},
{
"name": "CVE-2022-49011",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49011"
},
{
"name": "CVE-2022-49012",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49012"
},
{
"name": "CVE-2022-49014",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49014"
},
{
"name": "CVE-2022-49015",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49015"
},
{
"name": "CVE-2022-49016",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49016"
},
{
"name": "CVE-2022-49017",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49017"
},
{
"name": "CVE-2022-49019",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49019"
},
{
"name": "CVE-2022-49020",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49020"
},
{
"name": "CVE-2022-49021",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49021"
},
{
"name": "CVE-2022-49022",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49022"
},
{
"name": "CVE-2022-49023",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49023"
},
{
"name": "CVE-2022-49024",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49024"
},
{
"name": "CVE-2022-49025",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49025"
},
{
"name": "CVE-2022-49026",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49026"
},
{
"name": "CVE-2022-49027",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49027"
},
{
"name": "CVE-2022-49028",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49028"
},
{
"name": "CVE-2022-49029",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49029"
},
{
"name": "CVE-2022-49031",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49031"
},
{
"name": "CVE-2022-49032",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-49032"
},
{
"name": "CVE-2023-52917",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52917"
},
{
"name": "CVE-2023-52919",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52919"
},
{
"name": "CVE-2024-44932",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44932"
},
{
"name": "CVE-2024-44964",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44964"
},
{
"name": "CVE-2024-46754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46754"
},
{
"name": "CVE-2024-46766",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46766"
},
{
"name": "CVE-2024-46803",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46803"
},
{
"name": "CVE-2024-46806",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46806"
},
{
"name": "CVE-2024-46809",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46809"
},
{
"name": "CVE-2024-46811",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46811"
},
{
"name": "CVE-2024-46813",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46813"
},
{
"name": "CVE-2024-46816",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46816"
},
{
"name": "CVE-2024-46825",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46825"
},
{
"name": "CVE-2024-46827",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46827"
},
{
"name": "CVE-2024-46831",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46831"
},
{
"name": "CVE-2024-46834",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46834"
},
{
"name": "CVE-2024-46841",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46841"
},
{
"name": "CVE-2024-46842",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46842"
},
{
"name": "CVE-2024-46843",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46843"
},
{
"name": "CVE-2024-46851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46851"
},
{
"name": "CVE-2024-46860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46860"
},
{
"name": "CVE-2024-46861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46861"
},
{
"name": "CVE-2024-46864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46864"
},
{
"name": "CVE-2024-46870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46870"
},
{
"name": "CVE-2024-46871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46871"
},
{
"name": "CVE-2024-47658",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47658"
},
{
"name": "CVE-2024-47661",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47661"
},
{
"name": "CVE-2024-44958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-44958"
},
{
"name": "CVE-2024-47660",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47660"
},
{
"name": "CVE-2024-47665",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47665"
},
{
"name": "CVE-2024-47662",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47662"
},
{
"name": "CVE-2024-47664",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47664"
},
{
"name": "CVE-2024-47670",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47670"
},
{
"name": "CVE-2024-47671",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47671"
},
{
"name": "CVE-2024-47672",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47672"
},
{
"name": "CVE-2024-47673",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47673"
},
{
"name": "CVE-2024-47674",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47674"
},
{
"name": "CVE-2024-47675",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47675"
},
{
"name": "CVE-2024-47681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47681"
},
{
"name": "CVE-2024-47682",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47682"
},
{
"name": "CVE-2024-47684",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47684"
},
{
"name": "CVE-2024-47685",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47685"
},
{
"name": "CVE-2024-47686",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47686"
},
{
"name": "CVE-2024-47687",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47687"
},
{
"name": "CVE-2024-47688",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47688"
},
{
"name": "CVE-2024-47692",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47692"
},
{
"name": "CVE-2024-47693",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47693"
},
{
"name": "CVE-2024-47695",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47695"
},
{
"name": "CVE-2024-47696",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47696"
},
{
"name": "CVE-2024-47697",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47697"
},
{
"name": "CVE-2024-47698",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47698"
},
{
"name": "CVE-2024-47699",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47699"
},
{
"name": "CVE-2024-47702",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47702"
},
{
"name": "CVE-2024-47704",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47704"
},
{
"name": "CVE-2024-47705",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47705"
},
{
"name": "CVE-2024-47706",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47706"
},
{
"name": "CVE-2024-47707",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47707"
},
{
"name": "CVE-2024-47709",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47709"
},
{
"name": "CVE-2024-47710",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47710"
},
{
"name": "CVE-2024-47712",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47712"
},
{
"name": "CVE-2024-47713",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47713"
},
{
"name": "CVE-2024-47714",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47714"
},
{
"name": "CVE-2024-47715",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47715"
},
{
"name": "CVE-2024-47718",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47718"
},
{
"name": "CVE-2024-47719",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47719"
},
{
"name": "CVE-2024-47720",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47720"
},
{
"name": "CVE-2024-47723",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47723"
},
{
"name": "CVE-2024-47727",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47727"
},
{
"name": "CVE-2024-47728",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47728"
},
{
"name": "CVE-2024-47730",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47730"
},
{
"name": "CVE-2024-47731",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47731"
},
{
"name": "CVE-2024-47732",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47732"
},
{
"name": "CVE-2024-47735",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47735"
},
{
"name": "CVE-2024-47737",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47737"
},
{
"name": "CVE-2024-47738",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47738"
},
{
"name": "CVE-2024-47739",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47739"
},
{
"name": "CVE-2024-47741",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47741"
},
{
"name": "CVE-2024-47742",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47742"
},
{
"name": "CVE-2024-47743",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47743"
},
{
"name": "CVE-2024-47744",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47744"
},
{
"name": "CVE-2024-47745",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47745"
},
{
"name": "CVE-2024-47747",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47747"
},
{
"name": "CVE-2024-47748",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47748"
},
{
"name": "CVE-2024-47749",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47749"
},
{
"name": "CVE-2024-47750",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47750"
},
{
"name": "CVE-2024-47751",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47751"
},
{
"name": "CVE-2024-47752",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47752"
},
{
"name": "CVE-2024-47753",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47753"
},
{
"name": "CVE-2024-47754",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47754"
},
{
"name": "CVE-2024-47756",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47756"
},
{
"name": "CVE-2024-47757",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47757"
},
{
"name": "CVE-2024-49850",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49850"
},
{
"name": "CVE-2024-49851",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49851"
},
{
"name": "CVE-2024-49852",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49852"
},
{
"name": "CVE-2024-49853",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49853"
},
{
"name": "CVE-2024-49855",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49855"
},
{
"name": "CVE-2024-49858",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49858"
},
{
"name": "CVE-2024-49860",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49860"
},
{
"name": "CVE-2024-49861",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49861"
},
{
"name": "CVE-2024-49862",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49862"
},
{
"name": "CVE-2024-49863",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49863"
},
{
"name": "CVE-2024-49864",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49864"
},
{
"name": "CVE-2024-49866",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49866"
},
{
"name": "CVE-2024-49867",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49867"
},
{
"name": "CVE-2024-49870",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49870"
},
{
"name": "CVE-2024-49871",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49871"
},
{
"name": "CVE-2024-49874",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49874"
},
{
"name": "CVE-2024-49875",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49875"
},
{
"name": "CVE-2024-49877",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49877"
},
{
"name": "CVE-2024-49878",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49878"
},
{
"name": "CVE-2024-49879",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49879"
},
{
"name": "CVE-2024-49881",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49881"
},
{
"name": "CVE-2024-49882",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49882"
},
{
"name": "CVE-2024-49883",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49883"
},
{
"name": "CVE-2024-49886",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49886"
},
{
"name": "CVE-2024-49888",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49888"
},
{
"name": "CVE-2024-49890",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49890"
},
{
"name": "CVE-2024-49891",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49891"
},
{
"name": "CVE-2024-49892",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49892"
},
{
"name": "CVE-2024-49894",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49894"
},
{
"name": "CVE-2024-49895",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49895"
},
{
"name": "CVE-2024-49896",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49896"
},
{
"name": "CVE-2024-49897",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49897"
},
{
"name": "CVE-2024-49898",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49898"
},
{
"name": "CVE-2024-49899",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49899"
},
{
"name": "CVE-2024-49900",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49900"
},
{
"name": "CVE-2024-49901",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49901"
},
{
"name": "CVE-2024-49902",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49902"
},
{
"name": "CVE-2024-49903",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49903"
},
{
"name": "CVE-2024-49906",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49906"
},
{
"name": "CVE-2024-49907",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49907"
},
{
"name": "CVE-2024-49908",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49908"
},
{
"name": "CVE-2024-49909",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49909"
},
{
"name": "CVE-2024-49911",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49911"
},
{
"name": "CVE-2024-49912",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49912"
},
{
"name": "CVE-2024-49913",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49913"
},
{
"name": "CVE-2024-49914",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49914"
},
{
"name": "CVE-2024-49917",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49917"
},
{
"name": "CVE-2024-49918",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49918"
},
{
"name": "CVE-2024-49919",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49919"
},
{
"name": "CVE-2024-49920",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49920"
},
{
"name": "CVE-2024-49922",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49922"
},
{
"name": "CVE-2024-49923",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49923"
},
{
"name": "CVE-2024-49928",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49928"
},
{
"name": "CVE-2024-49929",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49929"
},
{
"name": "CVE-2024-49930",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49930"
},
{
"name": "CVE-2024-49931",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49931"
},
{
"name": "CVE-2024-49933",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49933"
},
{
"name": "CVE-2024-49935",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49935"
},
{
"name": "CVE-2024-49936",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49936"
},
{
"name": "CVE-2024-49937",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49937"
},
{
"name": "CVE-2024-49938",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49938"
},
{
"name": "CVE-2024-49939",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49939"
},
{
"name": "CVE-2024-49946",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49946"
},
{
"name": "CVE-2024-49947",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49947"
},
{
"name": "CVE-2024-49949",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49949"
},
{
"name": "CVE-2024-49950",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49950"
},
{
"name": "CVE-2024-49953",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49953"
},
{
"name": "CVE-2024-49954",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49954"
},
{
"name": "CVE-2024-49955",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49955"
},
{
"name": "CVE-2024-49957",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49957"
},
{
"name": "CVE-2024-49958",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49958"
},
{
"name": "CVE-2024-49959",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49959"
},
{
"name": "CVE-2024-49960",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49960"
},
{
"name": "CVE-2024-49961",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49961"
},
{
"name": "CVE-2024-49962",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49962"
},
{
"name": "CVE-2024-49963",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49963"
},
{
"name": "CVE-2024-49965",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49965"
},
{
"name": "CVE-2024-49966",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49966"
},
{
"name": "CVE-2024-49967",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49967"
},
{
"name": "CVE-2024-49969",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49969"
},
{
"name": "CVE-2024-49972",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49972"
},
{
"name": "CVE-2024-49973",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49973"
},
{
"name": "CVE-2024-49974",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49974"
},
{
"name": "CVE-2024-49975",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49975"
},
{
"name": "CVE-2024-49981",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49981"
},
{
"name": "CVE-2024-49982",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49982"
},
{
"name": "CVE-2024-49985",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49985"
},
{
"name": "CVE-2024-49986",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49986"
},
{
"name": "CVE-2024-49991",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49991"
},
{
"name": "CVE-2024-49993",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49993"
},
{
"name": "CVE-2024-49995",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49995"
},
{
"name": "CVE-2024-49996",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49996"
},
{
"name": "CVE-2024-50000",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50000"
},
{
"name": "CVE-2024-50001",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50001"
},
{
"name": "CVE-2024-50002",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50002"
},
{
"name": "CVE-2024-50006",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50006"
},
{
"name": "CVE-2024-50007",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50007"
},
{
"name": "CVE-2024-50008",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50008"
},
{
"name": "CVE-2024-50013",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50013"
},
{
"name": "CVE-2024-50014",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50014"
},
{
"name": "CVE-2024-50015",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50015"
},
{
"name": "CVE-2024-50017",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50017"
},
{
"name": "CVE-2024-50019",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50019"
},
{
"name": "CVE-2024-50020",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50020"
},
{
"name": "CVE-2024-50021",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50021"
},
{
"name": "CVE-2024-50022",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50022"
},
{
"name": "CVE-2024-50023",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50023"
},
{
"name": "CVE-2024-50024",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50024"
},
{
"name": "CVE-2024-50025",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50025"
},
{
"name": "CVE-2024-50027",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50027"
},
{
"name": "CVE-2024-50028",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50028"
},
{
"name": "CVE-2024-50031",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50031"
},
{
"name": "CVE-2024-50033",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50033"
},
{
"name": "CVE-2024-50035",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50035"
},
{
"name": "CVE-2024-50040",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50040"
},
{
"name": "CVE-2024-50041",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50041"
},
{
"name": "CVE-2024-50042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50042"
},
{
"name": "CVE-2024-50044",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50044"
},
{
"name": "CVE-2024-50045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50045"
},
{
"name": "CVE-2024-50046",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50046"
},
{
"name": "CVE-2024-50047",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50047"
},
{
"name": "CVE-2024-50048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50048"
},
{
"name": "CVE-2024-50049",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50049"
},
{
"name": "CVE-2024-50055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50055"
},
{
"name": "CVE-2024-50058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50058"
},
{
"name": "CVE-2024-50059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50059"
},
{
"name": "CVE-2024-50060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50060"
},
{
"name": "CVE-2024-50061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50061"
},
{
"name": "CVE-2024-50062",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50062"
},
{
"name": "CVE-2024-50063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50063"
},
{
"name": "CVE-2024-50064",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50064"
},
{
"name": "CVE-2024-50069",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50069"
},
{
"name": "CVE-2024-50073",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50073"
},
{
"name": "CVE-2024-50074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50074"
},
{
"name": "CVE-2024-50075",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50075"
},
{
"name": "CVE-2024-50076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50076"
},
{
"name": "CVE-2024-50077",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50077"
},
{
"name": "CVE-2024-50078",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50078"
},
{
"name": "CVE-2024-50080",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50080"
},
{
"name": "CVE-2024-50081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50081"
},
{
"name": "CVE-2024-50012",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50012"
},
{
"name": "CVE-2024-50067",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50067"
},
{
"name": "CVE-2024-50215",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50215"
},
{
"name": "CVE-2024-50218",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50218"
},
{
"name": "CVE-2024-50228",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50228"
},
{
"name": "CVE-2024-50229",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50229"
},
{
"name": "CVE-2024-50230",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50230"
},
{
"name": "CVE-2024-50232",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50232"
},
{
"name": "CVE-2024-50233",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50233"
},
{
"name": "CVE-2024-50234",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50234"
},
{
"name": "CVE-2024-50235",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50235"
},
{
"name": "CVE-2024-50236",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50236"
},
{
"name": "CVE-2024-50237",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50237"
},
{
"name": "CVE-2024-50245",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50245"
},
{
"name": "CVE-2024-50249",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50249"
},
{
"name": "CVE-2024-50250",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50250"
},
{
"name": "CVE-2024-50252",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50252"
},
{
"name": "CVE-2024-50255",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50255"
},
{
"name": "CVE-2024-50257",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50257"
},
{
"name": "CVE-2024-50259",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50259"
},
{
"name": "CVE-2024-50261",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50261"
},
{
"name": "CVE-2024-50264",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50264"
},
{
"name": "CVE-2024-50265",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50265"
},
{
"name": "CVE-2024-50267",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50267"
},
{
"name": "CVE-2024-50268",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50268"
},
{
"name": "CVE-2024-50269",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50269"
},
{
"name": "CVE-2024-50271",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50271"
},
{
"name": "CVE-2024-50273",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50273"
},
{
"name": "CVE-2024-50276",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50276"
},
{
"name": "CVE-2024-50278",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50278"
},
{
"name": "CVE-2024-50279",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50279"
},
{
"name": "CVE-2024-50282",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50282"
},
{
"name": "CVE-2024-50287",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50287"
},
{
"name": "CVE-2024-50290",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50290"
},
{
"name": "CVE-2024-50292",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50292"
},
{
"name": "CVE-2024-50295",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50295"
},
{
"name": "CVE-2024-50296",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50296"
},
{
"name": "CVE-2024-50301",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50301"
},
{
"name": "CVE-2024-50302",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50302"
},
{
"name": "CVE-2024-53042",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53042"
},
{
"name": "CVE-2024-53043",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53043"
},
{
"name": "CVE-2024-53052",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53052"
},
{
"name": "CVE-2024-53055",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53055"
},
{
"name": "CVE-2024-53058",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53058"
},
{
"name": "CVE-2024-53059",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53059"
},
{
"name": "CVE-2024-53060",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53060"
},
{
"name": "CVE-2024-53061",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53061"
},
{
"name": "CVE-2024-53063",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53063"
},
{
"name": "CVE-2024-53066",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53066"
},
{
"name": "CVE-2024-53072",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53072"
},
{
"name": "CVE-2024-53081",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53081"
},
{
"name": "CVE-2024-53082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53082"
},
{
"name": "CVE-2024-53088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53088"
},
{
"name": "CVE-2024-53093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53093"
},
{
"name": "CVE-2024-49925",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49925"
},
{
"name": "CVE-2024-49945",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49945"
},
{
"name": "CVE-2024-50208",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50208"
},
{
"name": "CVE-2024-50082",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50082"
},
{
"name": "CVE-2024-50099",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50099"
},
{
"name": "CVE-2024-50110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50110"
},
{
"name": "CVE-2024-50192",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50192"
},
{
"name": "CVE-2024-46680",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46680"
},
{
"name": "CVE-2024-46681",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46681"
},
{
"name": "CVE-2024-46765",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46765"
},
{
"name": "CVE-2024-46788",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46788"
},
{
"name": "CVE-2024-46845",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-46845"
},
{
"name": "CVE-2024-47666",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47666"
},
{
"name": "CVE-2024-47679",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47679"
},
{
"name": "CVE-2024-47701",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47701"
},
{
"name": "CVE-2024-49868",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49868"
},
{
"name": "CVE-2024-49884",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49884"
},
{
"name": "CVE-2024-49905",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49905"
},
{
"name": "CVE-2024-49921",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49921"
},
{
"name": "CVE-2024-49924",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49924"
},
{
"name": "CVE-2024-49944",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49944"
},
{
"name": "CVE-2024-49952",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49952"
},
{
"name": "CVE-2024-49983",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49983"
},
{
"name": "CVE-2024-50003",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50003"
},
{
"name": "CVE-2024-50093",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50093"
},
{
"name": "CVE-2024-50095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50095"
},
{
"name": "CVE-2024-50096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50096"
},
{
"name": "CVE-2024-50179",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50179"
},
{
"name": "CVE-2024-50180",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50180"
},
{
"name": "CVE-2024-50181",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50181"
},
{
"name": "CVE-2024-50184",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50184"
},
{
"name": "CVE-2024-50186",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50186"
},
{
"name": "CVE-2024-50188",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50188"
},
{
"name": "CVE-2024-50189",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50189"
},
{
"name": "CVE-2021-47594",
"url": "https://www.cve.org/CVERecord?id=CVE-2021-47594"
},
{
"name": "CVE-2022-48979",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48979"
},
{
"name": "CVE-2022-48982",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48982"
},
{
"name": "CVE-2022-48983",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48983"
},
{
"name": "CVE-2022-48989",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48989"
},
{
"name": "CVE-2022-48990",
"url": "https://www.cve.org/CVERecord?id=CVE-2022-48990"
},
{
"name": "CVE-2023-52778",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52778"
},
{
"name": "CVE-2023-52920",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52920"
},
{
"name": "CVE-2023-52921",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52921"
},
{
"name": "CVE-2023-52922",
"url": "https://www.cve.org/CVERecord?id=CVE-2023-52922"
},
{
"name": "CVE-2024-26596",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-26596"
},
{
"name": "CVE-2024-27407",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-27407"
},
{
"name": "CVE-2024-47703",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-47703"
},
{
"name": "CVE-2024-49934",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49934"
},
{
"name": "CVE-2024-49968",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49968"
},
{
"name": "CVE-2024-49976",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49976"
},
{
"name": "CVE-2024-49987",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49987"
},
{
"name": "CVE-2024-49989",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-49989"
},
{
"name": "CVE-2024-50004",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50004"
},
{
"name": "CVE-2024-50009",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50009"
},
{
"name": "CVE-2024-50026",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50026"
},
{
"name": "CVE-2024-50084",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50084"
},
{
"name": "CVE-2024-50087",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50087"
},
{
"name": "CVE-2024-50088",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50088"
},
{
"name": "CVE-2024-50089",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50089"
},
{
"name": "CVE-2024-50098",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50098"
},
{
"name": "CVE-2024-50100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50100"
},
{
"name": "CVE-2024-50101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50101"
},
{
"name": "CVE-2024-50102",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50102"
},
{
"name": "CVE-2024-50103",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50103"
},
{
"name": "CVE-2024-50108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50108"
},
{
"name": "CVE-2024-50115",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50115"
},
{
"name": "CVE-2024-50116",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50116"
},
{
"name": "CVE-2024-50117",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50117"
},
{
"name": "CVE-2024-50121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50121"
},
{
"name": "CVE-2024-50124",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50124"
},
{
"name": "CVE-2024-50125",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50125"
},
{
"name": "CVE-2024-50127",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50127"
},
{
"name": "CVE-2024-50128",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50128"
},
{
"name": "CVE-2024-50130",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50130"
},
{
"name": "CVE-2024-50131",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50131"
},
{
"name": "CVE-2024-50134",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50134"
},
{
"name": "CVE-2024-50135",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50135"
},
{
"name": "CVE-2024-50136",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50136"
},
{
"name": "CVE-2024-50138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50138"
},
{
"name": "CVE-2024-50139",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50139"
},
{
"name": "CVE-2024-50141",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50141"
},
{
"name": "CVE-2024-50145",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50145"
},
{
"name": "CVE-2024-50146",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50146"
},
{
"name": "CVE-2024-50147",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50147"
},
{
"name": "CVE-2024-50148",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50148"
},
{
"name": "CVE-2024-50150",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50150"
},
{
"name": "CVE-2024-50153",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50153"
},
{
"name": "CVE-2024-50154",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50154"
},
{
"name": "CVE-2024-50155",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50155"
},
{
"name": "CVE-2024-50156",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50156"
},
{
"name": "CVE-2024-50157",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50157"
},
{
"name": "CVE-2024-50158",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50158"
},
{
"name": "CVE-2024-50159",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50159"
},
{
"name": "CVE-2024-50160",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50160"
},
{
"name": "CVE-2024-50166",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50166"
},
{
"name": "CVE-2024-50167",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50167"
},
{
"name": "CVE-2024-50169",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50169"
},
{
"name": "CVE-2024-50171",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50171"
},
{
"name": "CVE-2024-50172",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50172"
},
{
"name": "CVE-2024-50175",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50175"
},
{
"name": "CVE-2024-50176",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50176"
},
{
"name": "CVE-2024-50177",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50177"
},
{
"name": "CVE-2024-50182",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50182"
},
{
"name": "CVE-2024-50183",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50183"
},
{
"name": "CVE-2024-50187",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50187"
},
{
"name": "CVE-2024-50194",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50194"
},
{
"name": "CVE-2024-50195",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50195"
},
{
"name": "CVE-2024-50196",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50196"
},
{
"name": "CVE-2024-50198",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50198"
},
{
"name": "CVE-2024-50200",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50200"
},
{
"name": "CVE-2024-50201",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50201"
},
{
"name": "CVE-2024-50205",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50205"
},
{
"name": "CVE-2024-50209",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50209"
},
{
"name": "CVE-2024-50210",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50210"
},
{
"name": "CVE-2024-50216",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50216"
},
{
"name": "CVE-2024-50221",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50221"
},
{
"name": "CVE-2024-50224",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50224"
},
{
"name": "CVE-2024-50225",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50225"
},
{
"name": "CVE-2024-50231",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50231"
},
{
"name": "CVE-2024-50240",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50240"
},
{
"name": "CVE-2024-50246",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50246"
},
{
"name": "CVE-2024-50248",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50248"
},
{
"name": "CVE-2024-50274",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50274"
},
{
"name": "CVE-2024-50275",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50275"
},
{
"name": "CVE-2024-50289",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50289"
},
{
"name": "CVE-2024-50298",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-50298"
},
{
"name": "CVE-2024-53045",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53045"
},
{
"name": "CVE-2024-53048",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53048"
},
{
"name": "CVE-2024-53051",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53051"
},
{
"name": "CVE-2024-53056",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53056"
},
{
"name": "CVE-2024-53068",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53068"
},
{
"name": "CVE-2024-53074",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53074"
},
{
"name": "CVE-2024-53076",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53076"
},
{
"name": "CVE-2024-53079",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53079"
},
{
"name": "CVE-2024-53085",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53085"
},
{
"name": "CVE-2024-53094",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53094"
},
{
"name": "CVE-2024-53095",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53095"
},
{
"name": "CVE-2024-53096",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53096"
},
{
"name": "CVE-2024-53100",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53100"
},
{
"name": "CVE-2024-53101",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53101"
},
{
"name": "CVE-2024-53104",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53104"
},
{
"name": "CVE-2024-53106",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53106"
},
{
"name": "CVE-2024-53108",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53108"
},
{
"name": "CVE-2024-53110",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53110"
},
{
"name": "CVE-2024-53112",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53112"
},
{
"name": "CVE-2024-53114",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53114"
},
{
"name": "CVE-2024-53121",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53121"
},
{
"name": "CVE-2024-53138",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53138"
},
{
"name": "CVE-2024-53142",
"url": "https://www.cve.org/CVERecord?id=CVE-2024-53142"
}
],
"initial_release_date": "2024-12-20T00:00:00",
"last_revision_date": "2024-12-20T00:00:00",
"links": [],
"reference": "CERTFR-2024-AVI-1102",
"revisions": [
{
"description": "Version initiale",
"revision_date": "2024-12-20T00:00:00.000000"
}
],
"risks": [
{
"description": "Atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es"
},
{
"description": "Ex\u00e9cution de code arbitraire"
},
{
"description": "Non sp\u00e9cifi\u00e9 par l\u0027\u00e9diteur"
},
{
"description": "D\u00e9ni de service"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "De multiples vuln\u00e9rabilit\u00e9s ont \u00e9t\u00e9 d\u00e9couvertes dans le noyau Linux de SUSE. Certaines d\u0027entre elles permettent \u00e0 un attaquant de provoquer une ex\u00e9cution de code arbitraire, une atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es et une atteinte \u00e0 l\u0027int\u00e9grit\u00e9 des donn\u00e9es.",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans le noyau Linux de SUSE",
"vendor_advisories": [
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4314-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244314-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4367-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244367-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4317-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244317-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4313-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244313-1"
},
{
"published_at": "2024-12-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4388-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244388-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4346-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244346-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4316-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244316-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4315-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244315-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4364-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244364-1"
},
{
"published_at": "2024-12-19",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4387-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244387-1"
},
{
"published_at": "2024-12-17",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4345-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244345-1"
},
{
"published_at": "2024-12-18",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4376-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244376-1"
},
{
"published_at": "2024-12-13",
"title": "Bulletin de s\u00e9curit\u00e9 SUSE SUSE-SU-2024:4318-1",
"url": "https://www.suse.com/support/update/announcement/2024/suse-su-20244318-1"
}
]
}
FKIE_CVE-2023-28327
Vulnerability from fkie_nvd - Published: 2023-04-19 23:15 - Updated: 2026-06-17 05:475.5 (Medium) - CVSS:3.1/
| URL | Tags | ||
|---|---|---|---|
| secalert@redhat.com | https://bugzilla.redhat.com/show_bug.cgi?id=2177382 | Issue Tracking, Patch | |
| af854a3a-2127-422b-91ae-364da2661108 | https://bugzilla.redhat.com/show_bug.cgi?id=2177382 | Issue Tracking, Patch |
| Vendor | Product | Version | |
|---|---|---|---|
| linux | linux_kernel | * | |
| redhat | enterprise_linux | 8.0 | |
| redhat | enterprise_linux | 9.0 |
{
"affected": [
{
"affectedData": [
{
"product": "Linux",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "Linux"
}
]
}
],
"source": "secalert@redhat.com"
}
],
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"matchCriteriaId": "87B81C9D-7173-4FFB-97BC-9C41AB20A53C",
"versionEndExcluding": "6.0",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
},
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:redhat:enterprise_linux:8.0:*:*:*:*:*:*:*",
"matchCriteriaId": "F4CFF558-3C47-480D-A2F0-BABF26042943",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:redhat:enterprise_linux:9.0:*:*:*:*:*:*:*",
"matchCriteriaId": "7F6FB57C-2BC7-487C-96DD-132683AEB35D",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service."
}
],
"id": "CVE-2023-28327",
"lastModified": "2026-06-17T05:47:26.733",
"metrics": {
"cvssMetricV31": [
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "nvd@nist.gov",
"type": "Primary"
},
{
"cvssData": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6,
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"type": "Secondary"
}
],
"ssvcV203": [
{
"source": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"ssvcData": {
"id": "CVE-2023-28327",
"options": [
{
"exploitation": "none"
},
{
"automatable": "no"
},
{
"technicalImpact": "partial"
}
],
"role": "CISA Coordinator",
"timestamp": "2025-03-06T15:56:18.401087Z",
"version": "2.0.3"
}
}
]
},
"published": "2023-04-19T23:15:07.027",
"references": [
{
"source": "secalert@redhat.com",
"tags": [
"Issue Tracking",
"Patch"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Issue Tracking",
"Patch"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
}
],
"sourceIdentifier": "secalert@redhat.com",
"vulnStatus": "Modified",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "secalert@redhat.com",
"type": "Secondary"
},
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
GHSA-GPC7-6G78-VFXW
Vulnerability from github – Published: 2023-04-20 00:30 – Updated: 2024-04-04 03:36A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service.
{
"affected": [],
"aliases": [
"CVE-2023-28327"
],
"database_specific": {
"cwe_ids": [
"CWE-476"
],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2023-04-19T23:15:07Z",
"severity": "MODERATE"
},
"details": "A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service.",
"id": "GHSA-gpc7-6g78-vfxw",
"modified": "2024-04-04T03:36:32Z",
"published": "2023-04-20T00:30:43Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-28327"
},
{
"type": "WEB",
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
}
],
"schema_version": "1.4.0",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"type": "CVSS_V3"
}
]
}
GSD-2023-28327
Vulnerability from gsd - Updated: 2023-12-13 01:20{
"GSD": {
"alias": "CVE-2023-28327",
"id": "GSD-2023-28327"
},
"gsd": {
"metadata": {
"exploitCode": "unknown",
"remediation": "unknown",
"reportConfidence": "confirmed",
"type": "vulnerability"
},
"osvSchema": {
"aliases": [
"CVE-2023-28327"
],
"details": "A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service.",
"id": "GSD-2023-28327",
"modified": "2023-12-13T01:20:47.792544Z",
"schema_version": "1.4.0"
}
},
"namespaces": {
"cve.org": {
"CVE_data_meta": {
"ASSIGNER": "secalert@redhat.com",
"ID": "CVE-2023-28327",
"STATE": "PUBLIC"
},
"affects": {
"vendor": {
"vendor_data": [
{
"product": {
"product_data": [
{
"product_name": "Linux",
"version": {
"version_data": [
{
"version_value": "Linux"
}
]
}
}
]
},
"vendor_name": "n/a"
}
]
}
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "eng",
"value": "A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service."
}
]
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "eng",
"value": "CWE-476"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382",
"refsource": "MISC",
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
}
]
}
},
"nvd.nist.gov": {
"configurations": {
"CVE_data_version": "4.0",
"nodes": [
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:linux:linux_kernel:*:*:*:*:*:*:*:*",
"cpe_name": [],
"versionEndExcluding": "6.0",
"vulnerable": true
}
],
"operator": "OR"
},
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux:8.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:redhat:enterprise_linux:9.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
}
]
},
"cve": {
"CVE_data_meta": {
"ASSIGNER": "secalert@redhat.com",
"ID": "CVE-2023-28327"
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "en",
"value": "A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service."
}
]
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "en",
"value": "CWE-476"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382",
"refsource": "MISC",
"tags": [
"Issue Tracking",
"Patch"
],
"url": "https://bugzilla.redhat.com/show_bug.cgi?id=2177382"
}
]
}
},
"impact": {
"baseMetricV3": {
"cvssV3": {
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"availabilityImpact": "HIGH",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
"exploitabilityScore": 1.8,
"impactScore": 3.6
}
},
"lastModifiedDate": "2023-04-29T03:12Z",
"publishedDate": "2023-04-19T23:15Z"
}
}
}
MSRC_CVE-2023-28327
Vulnerability from csaf_microsoft - Published: 2023-04-01 00:00 - Updated: 2023-05-25 00:00OESA-2023-1209 (CVE-2023-23004)
Vulnerability from osv_openeuler – Published: 2023-04-11 11:05 – Updated: 2026-08-06 11:05 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
In the Linux kernel before 5.19, drivers/gpu/drm/arm/malidp_planes.c misinterprets the get_sg_table return value (expects it to be NULL in the error case, whereas it is actually an error pointer).(CVE-2023-23004)
A use-after-free flaw was found in the Linux kernel’s core dump subsystem. This flaw allows a local user to crash the system. Only if patch 390031c94211 ("coredump: Use the vma snapshot in fill_files_note") not applied yet, then kernel could be affected.(CVE-2023-1249)
A null pointer dereference issue was found in the unix protocol in net/unix/diag.c in Linux before 6.0. In unix_diag_get_exact, the newly allocated skb does not have sk, leading to null pointer. A local user could use this flaw to crash the system or potentially cause a denial of service.
Reference: https://lore.kernel.org/netdev/CAO4mrfdvyjFpokhNsiwZiP-wpdSD0AStcJwfKcKQdAALQ9_2Qw@mail.gmail.com/ https://lore.kernel.org/netdev/e04315e7c90d9a75613f3993c2baf2d344eef7eb.camel@redhat.com/ https://lore.kernel.org/netdev/20221127012412.37969-3-kuniyu@amazon.com/T/(CVE-2023-28327)
Kernel: A denial of service issue in az6027 driver in drivers/media/usb/dev-usb/az6027.c(CVE-2023-28328)
A slab-out-of-bound read problem was found in brcmf_get_assoc_ies in drivers/net/wireless/broadcom/brcm80211/brcmfmac/cfg80211.c in the Linux Kernel. This issue could occur when assoc_info->req_len data is bigger than the size of the buffer, defined as WL_EXTRA_BUF_MAX, leading to a denial of service.(CVE-2023-1380)
do_tls_getsockopt in net/tls/tls_main.c in the Linux kernel through 6.2.6 lacks a lock_sock call, leading to a race condition (with a resultant use-after-free or NULL pointer dereference).(CVE-2023-28466)
In the Linux kernel before 6.1.3, fs/ntfs3/inode.c does not validate the attribute name offset. An unhandled page fault may occur.(CVE-2022-48424)
In the Linux kernel before 6.1.3, fs/ntfs3/record.c does not validate resident attribute names. An out-of-bounds write may occur.(CVE-2022-48423)
In the Linux kernel through 6.2.7, fs/ntfs3/inode.c has an invalid kfree because it does not validate MFT flags before replaying logs.(CVE-2022-48425)
A flaw was found in KVM. When calling the KVM_GET_DEBUGREGS ioctl, on 32-bit systems, there might be some uninitialized portions of the kvm_debugregs structure that could be copied to userspace, causing an information leak.(CVE-2023-1513)
Use After Free vulnerability in Linux kernel traffic control index filter (tcindex) allows Privilege Escalation. The imperfect hash area can be updated while packets are traversing, which will cause a use-after-free when 'tcf_exts_exec()' is called with the destroyed tcf_ext. A local attacker user can use this vulnerability to elevate its privileges to root. This issue affects Linux Kernel: from 4.14 before git commit ee059170b1f7e94e55fa6cadee544e176a6e59c2.(CVE-2023-1281)
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"kernel-tools-devel-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"bpftool-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"perf-debuginfo-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"kernel-devel-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"bpftool-debuginfo-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"kernel-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"kernel-debugsource-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"kernel-debuginfo-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"python3-perf-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"kernel-headers-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"kernel-source-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"kernel-tools-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm",
"perf-5.10.0-136.27.0.103.oe2203sp1.aarch64.rpm"
],
"src": [
"kernel-5.10.0-136.27.0.103.oe2203sp1.src.rpm"
],
"x86_64": [
"kernel-debugsource-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"bpftool-debuginfo-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"kernel-tools-devel-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"bpftool-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"kernel-devel-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"kernel-headers-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"kernel-source-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"kernel-tools-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"python3-perf-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"perf-debuginfo-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"perf-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"kernel-debuginfo-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm",
"kernel-5.10.0-136.27.0.103.oe2203sp1.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS-SP1",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS-SP1"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-136.27.0.103.oe2203sp1"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIn the Linux kernel before 5.19, drivers/gpu/drm/arm/malidp_planes.c misinterprets the get_sg_table return value (expects it to be NULL in the error case, whereas it is actually an error pointer).(CVE-2023-23004)\r\n\r\nA use-after-free flaw was found in the Linux kernel\u2019s core dump subsystem. This flaw allows a local user to crash the system. Only if patch 390031c94211 (\u0026quot;coredump: Use the vma snapshot in fill_files_note\u0026quot;) not applied yet, then kernel could be affected.(CVE-2023-1249)\r\n\r\nA null pointer dereference issue was found in the unix protocol in net/unix/diag.c in Linux before 6.0. In unix_diag_get_exact, the newly allocated skb does not have sk, leading to null pointer. A local user could use this flaw to crash the system or potentially cause a denial of service.\r\n\r\nReference:\nhttps://lore.kernel.org/netdev/CAO4mrfdvyjFpokhNsiwZiP-wpdSD0AStcJwfKcKQdAALQ9_2Qw@mail.gmail.com/\nhttps://lore.kernel.org/netdev/e04315e7c90d9a75613f3993c2baf2d344eef7eb.camel@redhat.com/\nhttps://lore.kernel.org/netdev/20221127012412.37969-3-kuniyu@amazon.com/T/(CVE-2023-28327)\r\n\r\n\nKernel: A denial of service issue in az6027 driver in\ndrivers/media/usb/dev-usb/az6027.c(CVE-2023-28328)\r\n\r\nA slab-out-of-bound read problem was found in brcmf_get_assoc_ies in drivers/net/wireless/broadcom/brcm80211/brcmfmac/cfg80211.c in the Linux Kernel. This issue could occur when assoc_info-\u0026gt;req_len data is bigger than the size of the buffer, defined as WL_EXTRA_BUF_MAX, leading to a denial of service.(CVE-2023-1380)\r\n\r\ndo_tls_getsockopt in net/tls/tls_main.c in the Linux kernel through 6.2.6 lacks a lock_sock call, leading to a race condition (with a resultant use-after-free or NULL pointer dereference).(CVE-2023-28466)\r\n\r\nIn the Linux kernel before 6.1.3, fs/ntfs3/inode.c does not validate the attribute name offset. An unhandled page fault may occur.(CVE-2022-48424)\r\n\r\nIn the Linux kernel before 6.1.3, fs/ntfs3/record.c does not validate resident attribute names. An out-of-bounds write may occur.(CVE-2022-48423)\r\n\r\nIn the Linux kernel through 6.2.7, fs/ntfs3/inode.c has an invalid kfree because it does not validate MFT flags before replaying logs.(CVE-2022-48425)\r\n\r\nA flaw was found in KVM. When calling the KVM_GET_DEBUGREGS ioctl, on 32-bit systems, there might be some uninitialized portions of the kvm_debugregs structure that could be copied to userspace, causing an information leak.(CVE-2023-1513)\r\n\r\nUse After Free vulnerability in Linux kernel traffic control index filter (tcindex) allows Privilege Escalation. The imperfect hash area can be updated while packets are traversing, which will cause a use-after-free when \u0026apos;tcf_exts_exec()\u0026apos; is called with the destroyed tcf_ext. A local attacker user can use this vulnerability to elevate its privileges to root. This issue affects Linux Kernel: from 4.14 before git commit ee059170b1f7e94e55fa6cadee544e176a6e59c2.(CVE-2023-1281)",
"id": "OESA-2023-1209",
"modified": "2026-08-06T11:05:41Z",
"published": "2023-04-11T11:05:41Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2023-1209"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-23004"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-1249"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-28327"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-28328"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-1380"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-28466"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48424"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48423"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-48425"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-1513"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-1281"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:L/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2023-23004",
"CVE-2023-1249",
"CVE-2023-28327",
"CVE-2023-28328",
"CVE-2023-1380",
"CVE-2023-28466",
"CVE-2022-48424",
"CVE-2022-48423",
"CVE-2022-48425",
"CVE-2023-1513",
"CVE-2023-1281"
]
}
OESA-2023-1210 (CVE-2022-29901)
Vulnerability from osv_openeuler – Published: 2023-04-11 11:05 – Updated: 2026-08-06 11:05 – Source websiteThe Linux Kernel, the operating system core itself.
Security Fix(es):
Intel microprocessor generations 6 to 8 are affected by a new Spectre variant that is able to bypass their retpoline mitigation in the kernel to leak arbitrary data. An attacker with unprivileged user access can hijack return instructions to achieve arbitrary speculative code execution under certain microarchitecture-dependent conditions.(CVE-2022-29901)
A flaw was found in the Linux kernel Traffic Control (TC) subsystem. Using a specific networking configuration (redirecting egress packets to ingress using TC action "mirred") a local unprivileged user could trigger a CPU soft lockup (ABBA deadlock) when the transport protocol in use (TCP or SCTP) does a retransmission, resulting in a denial of service condition.(CVE-2022-4269)
A null pointer dereference issue was found in the unix protocol in net/unix/diag.c in Linux before 6.0. In unix_diag_get_exact, the newly allocated skb does not have sk, leading to null pointer. A local user could use this flaw to crash the system or potentially cause a denial of service.
Reference: https://lore.kernel.org/netdev/CAO4mrfdvyjFpokhNsiwZiP-wpdSD0AStcJwfKcKQdAALQ9_2Qw@mail.gmail.com/ https://lore.kernel.org/netdev/e04315e7c90d9a75613f3993c2baf2d344eef7eb.camel@redhat.com/ https://lore.kernel.org/netdev/20221127012412.37969-3-kuniyu@amazon.com/T/(CVE-2023-28327)
Kernel: A denial of service issue in az6027 driver in drivers/media/usb/dev-usb/az6027.c(CVE-2023-28328)
A slab-out-of-bound read problem was found in brcmf_get_assoc_ies in drivers/net/wireless/broadcom/brcm80211/brcmfmac/cfg80211.c in the Linux Kernel. This issue could occur when assoc_info->req_len data is bigger than the size of the buffer, defined as WL_EXTRA_BUF_MAX, leading to a denial of service.(CVE-2023-1380)
A flaw was found in KVM. When calling the KVM_GET_DEBUGREGS ioctl, on 32-bit systems, there might be some uninitialized portions of the kvm_debugregs structure that could be copied to userspace, causing an information leak.(CVE-2023-1513)
| URL | Type | ||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|||||||||||||||||||||||
{
"affected": [
{
"ecosystem_specific": {
"aarch64": [
"bpftool-debuginfo-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"perf-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"python3-perf-debuginfo-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"kernel-tools-debuginfo-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"kernel-headers-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"python3-perf-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"kernel-tools-devel-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"kernel-devel-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"perf-debuginfo-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"kernel-debuginfo-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"kernel-debugsource-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"bpftool-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"kernel-source-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"kernel-5.10.0-60.89.0.113.oe2203.aarch64.rpm",
"kernel-tools-5.10.0-60.89.0.113.oe2203.aarch64.rpm"
],
"src": [
"kernel-5.10.0-60.89.0.113.oe2203.src.rpm"
],
"x86_64": [
"bpftool-debuginfo-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"kernel-tools-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"python3-perf-debuginfo-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"kernel-tools-devel-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"kernel-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"python3-perf-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"bpftool-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"perf-debuginfo-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"kernel-tools-debuginfo-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"kernel-debuginfo-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"kernel-headers-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"kernel-debugsource-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"kernel-source-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"kernel-devel-5.10.0-60.89.0.113.oe2203.x86_64.rpm",
"perf-5.10.0-60.89.0.113.oe2203.x86_64.rpm"
]
},
"package": {
"ecosystem": "openEuler:22.03-LTS",
"name": "kernel",
"purl": "pkg:rpm/openEuler/kernel\u0026distro=openEuler-22.03-LTS"
},
"ranges": [
{
"events": [
{
"introduced": "0"
},
{
"fixed": "5.10.0-60.89.0.113.oe2203"
}
],
"type": "ECOSYSTEM"
}
]
}
],
"database_specific": {
"severity": "High"
},
"details": "The Linux Kernel, the operating system core itself.\r\n\r\nSecurity Fix(es):\r\n\r\nIntel microprocessor generations 6 to 8 are affected by a new Spectre variant that is able to bypass their retpoline mitigation in the kernel to leak arbitrary data. An attacker with unprivileged user access can hijack return instructions to achieve arbitrary speculative code execution under certain microarchitecture-dependent conditions.(CVE-2022-29901)\r\n\r\nA flaw was found in the Linux kernel Traffic Control (TC) subsystem. Using a specific networking configuration (redirecting egress packets to ingress using TC action \u0026quot;mirred\u0026quot;) a local unprivileged user could trigger a CPU soft lockup (ABBA deadlock) when the transport protocol in use (TCP or SCTP) does a retransmission, resulting in a denial of service condition.(CVE-2022-4269)\r\n\r\nA null pointer dereference issue was found in the unix protocol in net/unix/diag.c in Linux before 6.0. In unix_diag_get_exact, the newly allocated skb does not have sk, leading to null pointer. A local user could use this flaw to crash the system or potentially cause a denial of service.\r\n\r\nReference:\nhttps://lore.kernel.org/netdev/CAO4mrfdvyjFpokhNsiwZiP-wpdSD0AStcJwfKcKQdAALQ9_2Qw@mail.gmail.com/\nhttps://lore.kernel.org/netdev/e04315e7c90d9a75613f3993c2baf2d344eef7eb.camel@redhat.com/\nhttps://lore.kernel.org/netdev/20221127012412.37969-3-kuniyu@amazon.com/T/(CVE-2023-28327)\r\n\r\n\nKernel: A denial of service issue in az6027 driver in\ndrivers/media/usb/dev-usb/az6027.c(CVE-2023-28328)\r\n\r\nA slab-out-of-bound read problem was found in brcmf_get_assoc_ies in drivers/net/wireless/broadcom/brcm80211/brcmfmac/cfg80211.c in the Linux Kernel. This issue could occur when assoc_info-\u0026gt;req_len data is bigger than the size of the buffer, defined as WL_EXTRA_BUF_MAX, leading to a denial of service.(CVE-2023-1380)\r\n\r\nA flaw was found in KVM. When calling the KVM_GET_DEBUGREGS ioctl, on 32-bit systems, there might be some uninitialized portions of the kvm_debugregs structure that could be copied to userspace, causing an information leak.(CVE-2023-1513)",
"id": "OESA-2023-1210",
"modified": "2026-08-06T11:05:41Z",
"published": "2023-04-11T11:05:41Z",
"references": [
{
"type": "ADVISORY",
"url": "https://www.openeuler.org/en/security/safety-bulletin/detail.html?id=openEuler-SA-2023-1210"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-29901"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2022-4269"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-28327"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-28328"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-1380"
},
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2023-1513"
}
],
"schema_version": "1.7.2",
"severity": [
{
"score": "CVSS:3.1/AV:N/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N",
"type": "CVSS_V3"
}
],
"summary": "kernel security update",
"upstream": [
"CVE-2022-29901",
"CVE-2022-4269",
"CVE-2023-28327",
"CVE-2023-28328",
"CVE-2023-1380",
"CVE-2023-1513"
]
}
RHSA-2023:5603
Vulnerability from csaf_redhat - Published: 2023-10-10 15:27 - Updated: 2026-08-07 02:40A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service.
RHSA-2023:5604
Vulnerability from csaf_redhat - Published: 2023-10-10 15:37 - Updated: 2026-08-07 02:40A NULL pointer dereference flaw was found in the UNIX protocol in net/unix/diag.c In unix_diag_get_exact in the Linux Kernel. The newly allocated skb does not have sk, leading to a NULL pointer. This flaw allows a local user to crash or potentially cause a denial of service.
SUSE-SU-2023:1800-1
Vulnerability from csaf_suse - Published: 2023-07-06 09:46 - Updated: 2026-09-20 15:01Sightings
| Author | Source | Type | Date | Other |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.
The approach is described in our paper Mapping CVEs to MITRE ATT&CK Techniques: A Curated Gold-Set Classifier and the Limits of LLM-Assisted Label Expansion.
Browse all ATT&CK techniques and the vulnerabilities related to each.
Related by attack behaviour
Vulnerabilities whose description is nearest to this one in the vector space of the CIRCL/vulnerability-attack-technique-biencoder model. This is a similarity search over the bi-encoder space (plain cosine), not a classification, and it has no measured accuracy.