Action not permitted
Modal body text goes here.
Modal Title
Modal Body
CVE-2008-1152 (GCVE-0-2008-1152)
Vulnerability from cvelistv5 – Published: 2008-03-27 17:00 – Updated: 2024-08-07 08:08- n/a
| URL | Tags | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
||||||||||||||||||||||||||
{
"containers": {
"adp": [
{
"providerMetadata": {
"dateUpdated": "2024-08-07T08:08:57.828Z",
"orgId": "af854a3a-2127-422b-91ae-364da2661108",
"shortName": "CVE"
},
"references": [
{
"name": "ADV-2008-1006",
"tags": [
"vdb-entry",
"x_refsource_VUPEN",
"x_transferred"
],
"url": "http://www.vupen.com/english/advisories/2008/1006/references"
},
{
"name": "TA08-087B",
"tags": [
"third-party-advisory",
"x_refsource_CERT",
"x_transferred"
],
"url": "http://www.us-cert.gov/cas/techalerts/TA08-087B.html"
},
{
"name": "1019712",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK",
"x_transferred"
],
"url": "http://www.securitytracker.com/id?1019712"
},
{
"name": "28465",
"tags": [
"vdb-entry",
"x_refsource_BID",
"x_transferred"
],
"url": "http://www.securityfocus.com/bid/28465"
},
{
"name": "20080326 Multiple DLSw Denial of Service Vulnerabilities in Cisco IOS",
"tags": [
"vendor-advisory",
"x_refsource_CISCO",
"x_transferred"
],
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml"
},
{
"name": "29507",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA",
"x_transferred"
],
"url": "http://secunia.com/advisories/29507"
},
{
"name": "oval:org.mitre.oval:def:5821",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL",
"x_transferred"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821"
},
{
"name": "cisco-ios-dlsw-dos(41482)",
"tags": [
"vdb-entry",
"x_refsource_XF",
"x_transferred"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/41482"
}
],
"title": "CVE Program Container"
}
],
"cna": {
"affected": [
{
"product": "n/a",
"vendor": "n/a",
"versions": [
{
"status": "affected",
"version": "n/a"
}
]
}
],
"datePublic": "2008-03-26T00:00:00",
"descriptions": [
{
"lang": "en",
"value": "The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets."
}
],
"problemTypes": [
{
"descriptions": [
{
"description": "n/a",
"lang": "en",
"type": "text"
}
]
}
],
"providerMetadata": {
"dateUpdated": "2017-09-28T12:57:01",
"orgId": "d1c1063e-7a18-46af-9102-31f8928bc633",
"shortName": "cisco"
},
"references": [
{
"name": "ADV-2008-1006",
"tags": [
"vdb-entry",
"x_refsource_VUPEN"
],
"url": "http://www.vupen.com/english/advisories/2008/1006/references"
},
{
"name": "TA08-087B",
"tags": [
"third-party-advisory",
"x_refsource_CERT"
],
"url": "http://www.us-cert.gov/cas/techalerts/TA08-087B.html"
},
{
"name": "1019712",
"tags": [
"vdb-entry",
"x_refsource_SECTRACK"
],
"url": "http://www.securitytracker.com/id?1019712"
},
{
"name": "28465",
"tags": [
"vdb-entry",
"x_refsource_BID"
],
"url": "http://www.securityfocus.com/bid/28465"
},
{
"name": "20080326 Multiple DLSw Denial of Service Vulnerabilities in Cisco IOS",
"tags": [
"vendor-advisory",
"x_refsource_CISCO"
],
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml"
},
{
"name": "29507",
"tags": [
"third-party-advisory",
"x_refsource_SECUNIA"
],
"url": "http://secunia.com/advisories/29507"
},
{
"name": "oval:org.mitre.oval:def:5821",
"tags": [
"vdb-entry",
"signature",
"x_refsource_OVAL"
],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821"
},
{
"name": "cisco-ios-dlsw-dos(41482)",
"tags": [
"vdb-entry",
"x_refsource_XF"
],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/41482"
}
],
"x_legacyV4Record": {
"CVE_data_meta": {
"ASSIGNER": "psirt@cisco.com",
"ID": "CVE-2008-1152",
"STATE": "PUBLIC"
},
"affects": {
"vendor": {
"vendor_data": [
{
"product": {
"product_data": [
{
"product_name": "n/a",
"version": {
"version_data": [
{
"version_value": "n/a"
}
]
}
}
]
},
"vendor_name": "n/a"
}
]
}
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "eng",
"value": "The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets."
}
]
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "eng",
"value": "n/a"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "ADV-2008-1006",
"refsource": "VUPEN",
"url": "http://www.vupen.com/english/advisories/2008/1006/references"
},
{
"name": "TA08-087B",
"refsource": "CERT",
"url": "http://www.us-cert.gov/cas/techalerts/TA08-087B.html"
},
{
"name": "1019712",
"refsource": "SECTRACK",
"url": "http://www.securitytracker.com/id?1019712"
},
{
"name": "28465",
"refsource": "BID",
"url": "http://www.securityfocus.com/bid/28465"
},
{
"name": "20080326 Multiple DLSw Denial of Service Vulnerabilities in Cisco IOS",
"refsource": "CISCO",
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml"
},
{
"name": "29507",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/29507"
},
{
"name": "oval:org.mitre.oval:def:5821",
"refsource": "OVAL",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821"
},
{
"name": "cisco-ios-dlsw-dos(41482)",
"refsource": "XF",
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/41482"
}
]
}
}
}
},
"cveMetadata": {
"assignerOrgId": "d1c1063e-7a18-46af-9102-31f8928bc633",
"assignerShortName": "cisco",
"cveId": "CVE-2008-1152",
"datePublished": "2008-03-27T17:00:00",
"dateReserved": "2008-03-05T00:00:00",
"dateUpdated": "2024-08-07T08:08:57.828Z",
"state": "PUBLISHED"
},
"dataType": "CVE_RECORD",
"dataVersion": "5.1",
"vulnerability-lookup:meta": {
"nvd": "{\"cve\":{\"id\":\"CVE-2008-1152\",\"sourceIdentifier\":\"psirt@cisco.com\",\"published\":\"2008-03-27T17:44:00.000\",\"lastModified\":\"2025-04-09T00:30:58.490\",\"vulnStatus\":\"Deferred\",\"cveTags\":[],\"descriptions\":[{\"lang\":\"en\",\"value\":\"The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets.\"},{\"lang\":\"es\",\"value\":\"El componente data-link switching (DLSw) en Cisco IOS 12.0 hasta 12.4 permite a atacantes remotos provocar una denegaci\u00f3n de servicio (reinicio de dispositivo o consumo de memoria) a trav\u00e9s de 91 paquetes manipulados del (1) puerto UDP 2067 o (2) protocolo IP.\"}],\"metrics\":{\"cvssMetricV2\":[{\"source\":\"nvd@nist.gov\",\"type\":\"Primary\",\"cvssData\":{\"version\":\"2.0\",\"vectorString\":\"AV:N/AC:L/Au:N/C:N/I:N/A:C\",\"baseScore\":7.8,\"accessVector\":\"NETWORK\",\"accessComplexity\":\"LOW\",\"authentication\":\"NONE\",\"confidentialityImpact\":\"NONE\",\"integrityImpact\":\"NONE\",\"availabilityImpact\":\"COMPLETE\"},\"baseSeverity\":\"HIGH\",\"exploitabilityScore\":10.0,\"impactScore\":6.9,\"acInsufInfo\":false,\"obtainAllPrivilege\":false,\"obtainUserPrivilege\":false,\"obtainOtherPrivilege\":false,\"userInteractionRequired\":false}]},\"weaknesses\":[{\"source\":\"nvd@nist.gov\",\"type\":\"Primary\",\"description\":[{\"lang\":\"en\",\"value\":\"CWE-399\"}]}],\"configurations\":[{\"nodes\":[{\"operator\":\"OR\",\"negate\":false,\"cpeMatch\":[{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:da:*:*:*:*:*:*\",\"matchCriteriaId\":\"225C93BF-8749-46AB-BAE7-9A67C7B99552\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:db:*:*:*:*:*:*\",\"matchCriteriaId\":\"AD6138B2-1F13-4D98-B389-496E1F50FCFB\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:dc:*:*:*:*:*:*\",\"matchCriteriaId\":\"33D056B2-CB1C-4287-A3E0-E0F985304969\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:s:*:*:*:*:*:*\",\"matchCriteriaId\":\"A5823F33-7FB3-465B-8017-1866D9EF3AA6\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:sc:*:*:*:*:*:*\",\"matchCriteriaId\":\"EB1A7A2E-265F-4322-A6ED-4DD761497D4E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:sl:*:*:*:*:*:*\",\"matchCriteriaId\":\"D2E8E311-8E6C-42FC-A662-799CC78E22FE\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:sp:*:*:*:*:*:*\",\"matchCriteriaId\":\"2B02125C-1132-4748-9495-60BACFA2164D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:st:*:*:*:*:*:*\",\"matchCriteriaId\":\"0FE78CB4-3CF1-4F0A-B4CA-6B6E33D1991D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:sx:*:*:*:*:*:*\",\"matchCriteriaId\":\"B6680190-2688-48E2-BE31-A186A82AF79F\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:sy:*:*:*:*:*:*\",\"matchCriteriaId\":\"94870E9E-C883-4051-8854-CDE0AE7A64B6\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:sz:*:*:*:*:*:*\",\"matchCriteriaId\":\"BB4F46A5-7561-4C17-BB15-F9A704DB1E66\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:t:*:*:*:*:*:*\",\"matchCriteriaId\":\"ACC2FCAE-6A56-4D45-A35F-CA2C2C7A4372\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:wc:*:*:*:*:*:*\",\"matchCriteriaId\":\"8D10302E-76CE-4D65-9068-2657C1834215\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:wt:*:*:*:*:*:*\",\"matchCriteriaId\":\"48BABA92-17D7-419D-B25D-2DE914F12D91\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xa:*:*:*:*:*:*\",\"matchCriteriaId\":\"607E42A0-D5BA-4B59-812F-44DC970202D4\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xb:*:*:*:*:*:*\",\"matchCriteriaId\":\"AA54B6EB-CA03-4209-ACA6-7AE6455B764A\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xc:*:*:*:*:*:*\",\"matchCriteriaId\":\"DC811D5E-A2D1-4098-990F-06DEC9080276\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xd:*:*:*:*:*:*\",\"matchCriteriaId\":\"9C1A32C0-0809-4242-9D23-7F8887D8AFE1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xe:*:*:*:*:*:*\",\"matchCriteriaId\":\"9048DB68-228A-4496-9FEC-514A65130DA0\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xf:*:*:*:*:*:*\",\"matchCriteriaId\":\"6D2435B9-EFE4-4CA6-9E55-C9C050D579DA\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xg:*:*:*:*:*:*\",\"matchCriteriaId\":\"2929498A-BB56-48B2-9089-E6B602B81929\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xh:*:*:*:*:*:*\",\"matchCriteriaId\":\"73BA6E1B-B6DC-404A-BF1D-5059EB2F7C16\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xi:*:*:*:*:*:*\",\"matchCriteriaId\":\"B385E45E-FCBD-4574-88FD-E000F320BE6D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xj:*:*:*:*:*:*\",\"matchCriteriaId\":\"2FC95E36-024E-487B-8190-E96745B590EF\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xk:*:*:*:*:*:*\",\"matchCriteriaId\":\"6A006524-45C0-4B11-82A3-0AF69374BD29\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xl:*:*:*:*:*:*\",\"matchCriteriaId\":\"518AAECA-0455-4688-8937-2D4248962C38\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xm:*:*:*:*:*:*\",\"matchCriteriaId\":\"6EE54B6B-99F0-40B2-990C-950E08E05FBB\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xn:*:*:*:*:*:*\",\"matchCriteriaId\":\"F740871A-7E8C-4077-8DB0-9D54B18D4037\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xo:*:*:*:*:*:*\",\"matchCriteriaId\":\"7D0B5D1A-016B-4017-B476-F66F6A82ABCE\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xq:*:*:*:*:*:*\",\"matchCriteriaId\":\"A7897C03-2EE4-42D5-9A70-9FD9DD025708\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xr:*:*:*:*:*:*\",\"matchCriteriaId\":\"BA0D5F4E-21CC-464C-930A-4DB1C25DDA70\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xs:*:*:*:*:*:*\",\"matchCriteriaId\":\"54348563-5740-4EF0-AADA-B864F3A47277\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xv:*:*:*:*:*:*\",\"matchCriteriaId\":\"A091E988-DA6B-4FC9-9899-86F97AA29C18\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.0:xw:*:*:*:*:*:*\",\"matchCriteriaId\":\"39C863BC-B042-41C7-A15D-4D29CA8933CB\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:aa:*:*:*:*:*:*\",\"matchCriteriaId\":\"0AE43587-46FE-4930-84FB-689AFCC122E7\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ax:*:*:*:*:*:*\",\"matchCriteriaId\":\"A0D676A9-7110-4446-9503-73BA2A4F49BC\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:az:*:*:*:*:*:*\",\"matchCriteriaId\":\"437F70FE-58DD-4F92-8219-4B09AAFA6F85\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:b:*:*:*:*:*:*\",\"matchCriteriaId\":\"EC1D82C4-AA1B-492C-81A7-7D579687C684\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:c:*:*:*:*:*:*\",\"matchCriteriaId\":\"02045A97-7AF6-4308-95A1-F4AC47A75AAB\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:cx:*:*:*:*:*:*\",\"matchCriteriaId\":\"0B560BA9-D8EF-4618-A909-1B779829E4DF\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:d:*:*:*:*:*:*\",\"matchCriteriaId\":\"5CB10E53-3177-4502-88DA-CA935403DADA\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:da:*:*:*:*:*:*\",\"matchCriteriaId\":\"A61E033B-EFDD-4ECC-A370-F85A8D8161D8\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:db:*:*:*:*:*:*\",\"matchCriteriaId\":\"90F4AB09-46FE-47F7-831D-863F5C296A40\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:dc:*:*:*:*:*:*\",\"matchCriteriaId\":\"22723E8E-18E9-45A4-A216-D7D2B4EC8A93\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:e:*:*:*:*:*:*\",\"matchCriteriaId\":\"85C2FF9C-7730-4DBF-8C86-1EF0F1E71D8C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ea:*:*:*:*:*:*\",\"matchCriteriaId\":\"4B2F42F9-1760-4A97-ADAE-66E5FC0B81FA\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:eb:*:*:*:*:*:*\",\"matchCriteriaId\":\"E92ACC7B-EB0E-4142-8397-3AF58C3E7406\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ec:*:*:*:*:*:*\",\"matchCriteriaId\":\"EAC665EA-CFAF-4F69-B8F6-BBC7D869CA42\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:eo:*:*:*:*:*:*\",\"matchCriteriaId\":\"365D4890-2676-4C0D-9D64-95A07B10DA8C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:eu:*:*:*:*:*:*\",\"matchCriteriaId\":\"1B1705DD-7DA2-4203-96FD-2344BBF99A17\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ew:*:*:*:*:*:*\",\"matchCriteriaId\":\"660ED401-2B7F-477F-99BA-DC553D47A9D1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ex:*:*:*:*:*:*\",\"matchCriteriaId\":\"D5F66FC9-7BBB-460A-9D50-E971F8F489AE\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ey:*:*:*:*:*:*\",\"matchCriteriaId\":\"83A2B33B-BD96-42D6-B455-C6877F8C5BF5\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ez:*:*:*:*:*:*\",\"matchCriteriaId\":\"946C08B8-DB52-41F0-8963-FD865FDE4462\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ga:*:*:*:*:*:*\",\"matchCriteriaId\":\"F4F4AC3A-F2B8-40FB-A11D-9B2F8F81F699\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:gb:*:*:*:*:*:*\",\"matchCriteriaId\":\"5A7CEA79-0B95-4EA4-B07C-AE93A75BF7A0\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xa:*:*:*:*:*:*\",\"matchCriteriaId\":\"F6A42922-F82A-4F7E-AF58-CAC0FD3402BA\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xb:*:*:*:*:*:*\",\"matchCriteriaId\":\"11BD3E2A-45B6-4A50-81C0-5089138434C1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xc:*:*:*:*:*:*\",\"matchCriteriaId\":\"C62A96DA-2A55-4B7B-9D66-19583B4FD63A\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xd:*:*:*:*:*:*\",\"matchCriteriaId\":\"DCE34BEA-83F6-4908-A71B-7850D2B964ED\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xe:*:*:*:*:*:*\",\"matchCriteriaId\":\"07B63B0A-1D38-4E5A-8D6E-5DE8F961E0F8\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xf:*:*:*:*:*:*\",\"matchCriteriaId\":\"3E856620-FF4D-48B6-BAD6-F85744185593\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xg:*:*:*:*:*:*\",\"matchCriteriaId\":\"6D78F36C-02EF-4839-B361-999F0445F20B\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xh:*:*:*:*:*:*\",\"matchCriteriaId\":\"9EEB9ED5-A623-46F0-8386-35DA38BD5FA6\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xi:*:*:*:*:*:*\",\"matchCriteriaId\":\"E2F6E880-FDB3-4888-95FC-8709444530E0\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xj:*:*:*:*:*:*\",\"matchCriteriaId\":\"27E31864-DE6C-48AF-A7B3-A66F63575ABF\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xk:*:*:*:*:*:*\",\"matchCriteriaId\":\"48572A1B-3696-4C47-9E59-30BC221FDEFC\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xl:*:*:*:*:*:*\",\"matchCriteriaId\":\"C1AE04CB-E03D-4C29-A257-BFB9468F86CE\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xm:*:*:*:*:*:*\",\"matchCriteriaId\":\"78F6FFF6-F5B9-4539-A189-6EA4C2D122CA\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xp:*:*:*:*:*:*\",\"matchCriteriaId\":\"D8D5EFEF-F27A-429D-B005-BFC8D1D39FA6\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xq:*:*:*:*:*:*\",\"matchCriteriaId\":\"D8A3B7BF-D52A-487E-ADCA-C2537CB5F36C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xr:*:*:*:*:*:*\",\"matchCriteriaId\":\"35F77E17-F109-4CB7-8333-E0651FF2B5DE\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xs:*:*:*:*:*:*\",\"matchCriteriaId\":\"9AAD994B-C227-4D5A-B21A-51C44EEB4798\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xt:*:*:*:*:*:*\",\"matchCriteriaId\":\"FD3ABECA-25E5-4D10-B319-354F1C202C14\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xv:*:*:*:*:*:*\",\"matchCriteriaId\":\"D50BD3AD-BCDC-4271-BFE1-D81DCE4106BE\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xw:*:*:*:*:*:*\",\"matchCriteriaId\":\"91A12162-E442-4FA4-9CCA-67F910582D9A\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xx:*:*:*:*:*:*\",\"matchCriteriaId\":\"92EF445D-F19B-44F6-A878-6409D4E28FC2\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xy:*:*:*:*:*:*\",\"matchCriteriaId\":\"A0FD7E21-2C42-49B8-98A1-CB2E6DC6B3CB\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:xz:*:*:*:*:*:*\",\"matchCriteriaId\":\"05E1A96A-D29D-4D57-B40A-EB12A40116A8\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ya:*:*:*:*:*:*\",\"matchCriteriaId\":\"59EE8734-9650-4B38-B62B-6A0ADF6E7BD1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:yb:*:*:*:*:*:*\",\"matchCriteriaId\":\"65351CCD-C47C-4035-88FB-616E05398C1D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:yc:*:*:*:*:*:*\",\"matchCriteriaId\":\"A28DF3F1-6788-4F7D-87CC-DEEA8D8F3205\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:yd:*:*:*:*:*:*\",\"matchCriteriaId\":\"FA52C637-B9B1-4B3F-924F-A7D5286F816C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:ye:*:*:*:*:*:*\",\"matchCriteriaId\":\"81CF042A-391D-496B-8317-65CA10FEED03\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:yf:*:*:*:*:*:*\",\"matchCriteriaId\":\"5C010477-1440-4B0F-937B-399D3A4535A4\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:yh:*:*:*:*:*:*\",\"matchCriteriaId\":\"675A9670-F046-4840-9B0B-E384046C4324\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:yi:*:*:*:*:*:*\",\"matchCriteriaId\":\"C67EBC40-4D6E-4126-B044-BC1F215E868C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.1:yj:*:*:*:*:*:*\",\"matchCriteriaId\":\"FD317149-C33D-4139-AAA1-878005806645\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:b:*:*:*:*:*:*\",\"matchCriteriaId\":\"91844D86-1C49-4FBE-8D8E-84A75586B1A3\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:bc:*:*:*:*:*:*\",\"matchCriteriaId\":\"A31E1599-C1D0-40C6-B18A-D0604BD109F2\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:bw:*:*:*:*:*:*\",\"matchCriteriaId\":\"64B4036B-5BDF-4D1C-A0B2-7252F24742E4\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:by:*:*:*:*:*:*\",\"matchCriteriaId\":\"C6CB71F1-6092-48C7-B715-7349F044360C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:bz:*:*:*:*:*:*\",\"matchCriteriaId\":\"D86ED994-3F96-4380-A2BE-71FDD3CAE4A8\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:cx:*:*:*:*:*:*\",\"matchCriteriaId\":\"74BFFADB-27F2-4C35-B5FC-9BAE1227EB51\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:cy:*:*:*:*:*:*\",\"matchCriteriaId\":\"EA13518D-B17B-4531-B0E5-866120506116\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:da:*:*:*:*:*:*\",\"matchCriteriaId\":\"4BE495A4-E66B-4710-A554-D0FE9023E69D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:dd:*:*:*:*:*:*\",\"matchCriteriaId\":\"B13A02F5-65F2-4DB5-8EB3-8A0B9F7884D9\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:dx:*:*:*:*:*:*\",\"matchCriteriaId\":\"95224EB1-BD20-4AA4-AD35-7ADDD3049359\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:eu:*:*:*:*:*:*\",\"matchCriteriaId\":\"1AFEA3F7-D9AD-4817-9F75-864221C88DC0\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ew:*:*:*:*:*:*\",\"matchCriteriaId\":\"3013C05E-3A15-4FD8-943A-AAB36EB4FB41\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ewa:*:*:*:*:*:*\",\"matchCriteriaId\":\"4A4AFC06-85C5-4AD0-A409-27F9AF398D7D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ex:*:*:*:*:*:*\",\"matchCriteriaId\":\"0CE16131-2E4C-49F5-91A0-820AACC6683C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ey:*:*:*:*:*:*\",\"matchCriteriaId\":\"D7BAF29F-1EB4-44F9-92C1-D3322D7C0B81\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ez:*:*:*:*:*:*\",\"matchCriteriaId\":\"DAB50CF9-9392-425C-B56E-3576CF0F6989\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:fz:*:*:*:*:*:*\",\"matchCriteriaId\":\"EA697982-AF54-432F-8CCA-481678DE56D4\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ixa:*:*:*:*:*:*\",\"matchCriteriaId\":\"4DA9B310-0E8E-4BCD-8254-5B8835413D78\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ixb:*:*:*:*:*:*\",\"matchCriteriaId\":\"1D3B1EB1-E066-42D3-A623-8FBBF42220F1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ixc:*:*:*:*:*:*\",\"matchCriteriaId\":\"D9631E85-B8BC-4F0A-AD9B-0DB668C1ED98\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ixd:*:*:*:*:*:*\",\"matchCriteriaId\":\"25EA7E2F-8C5C-486A-B03D-D0A2A6BB5B69\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ja:*:*:*:*:*:*\",\"matchCriteriaId\":\"9215D716-E6F6-4AEE-8808-9398A4826F04\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:mb:*:*:*:*:*:*\",\"matchCriteriaId\":\"7B70078D-2F0E-4B00-8AF9-E2641A37A59E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:mc:*:*:*:*:*:*\",\"matchCriteriaId\":\"06F481C2-4714-4995-9ED6-766BF5EA5738\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:s:*:*:*:*:*:*\",\"matchCriteriaId\":\"BFE5AEBE-EB53-43F0-857E-7B4EDC1A0ED9\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sb:*:*:*:*:*:*\",\"matchCriteriaId\":\"74382B2D-E9A6-453D-9C07-F959EAB4C075\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sbc:*:*:*:*:*:*\",\"matchCriteriaId\":\"1D64DA55-828B-40B4-9320-423121B5F8CD\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:se:*:*:*:*:*:*\",\"matchCriteriaId\":\"04D4ED20-A74A-4553-8FAC-3DA57A6E7423\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sea:*:*:*:*:*:*\",\"matchCriteriaId\":\"AFD7C0D7-FE22-4EAA-A21E-D393DD73C5C7\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:seb:*:*:*:*:*:*\",\"matchCriteriaId\":\"2270E882-0B30-4948-B4E7-BA3E87DD7E7F\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sec:*:*:*:*:*:*\",\"matchCriteriaId\":\"D1A0DD83-80AB-4B1C-A267-2CCC2D37D57E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sed:*:*:*:*:*:*\",\"matchCriteriaId\":\"ED52280F-D956-4617-9AFC-2928CF8F93F8\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:see:*:*:*:*:*:*\",\"matchCriteriaId\":\"A2C0605F-4FC6-43AC-A349-F1BB0572304F\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sef:*:*:*:*:*:*\",\"matchCriteriaId\":\"224BD2C9-6213-416F-88D2-5FAECC005802\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:seg:*:*:*:*:*:*\",\"matchCriteriaId\":\"5CB5F125-9124-4C37-8FC9-CC63CFE20AE1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sg:*:*:*:*:*:*\",\"matchCriteriaId\":\"B3D93383-BD5A-4052-B724-055F6FCFC314\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sga:*:*:*:*:*:*\",\"matchCriteriaId\":\"6B1E3C39-163D-4A99-AC96-2EE388305000\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sm:*:*:*:*:*:*\",\"matchCriteriaId\":\"5C0F2D29-F6E6-440E-B08C-8EED785878CD\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:so:*:*:*:*:*:*\",\"matchCriteriaId\":\"C04488E3-F13F-4CA5-B8AF-6951FB510086\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sra:*:*:*:*:*:*\",\"matchCriteriaId\":\"90710000-F963-4F36-9EE1-C3CE1CECDCA2\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:srb:*:*:*:*:*:*\",\"matchCriteriaId\":\"5F4F8B9E-B2AB-4545-8ACF-8F03E636E842\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:st:*:*:*:*:*:*\",\"matchCriteriaId\":\"80FB05B8-8BE5-4AE9-B018-DAB58034DC7F\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:su:*:*:*:*:*:*\",\"matchCriteriaId\":\"69DC7D98-2B14-425F-8F93-A8BEBD9D1AE5\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sv:*:*:*:*:*:*\",\"matchCriteriaId\":\"90D0875E-837B-4F8A-92F8-1D2DD219570B\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sw:*:*:*:*:*:*\",\"matchCriteriaId\":\"CF6A17FF-49C2-489A-AD7B-FD1B014A3EB4\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sxa:*:*:*:*:*:*\",\"matchCriteriaId\":\"C3E2ACD9-8623-4B0E-807A-CFC2900497E0\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sxb:*:*:*:*:*:*\",\"matchCriteriaId\":\"79BB5494-735D-424B-8B41-2FAECE1A7AD4\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sxd:*:*:*:*:*:*\",\"matchCriteriaId\":\"FD6178BC-9741-4FC1-87DA-A5407B3A4F40\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sy:*:*:*:*:*:*\",\"matchCriteriaId\":\"764FEE81-E2BD-4E46-92D8-48FEC6A1B249\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:sz:*:*:*:*:*:*\",\"matchCriteriaId\":\"59E8E365-8A31-48EE-BE20-7FBE7E9B54B7\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:t:*:*:*:*:*:*\",\"matchCriteriaId\":\"9C3E10F8-62D6-4159-B883-C886FD0B63DF\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:tpc:*:*:*:*:*:*\",\"matchCriteriaId\":\"FABE7C54-B03B-4D1E-BF40-C0F357567543\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:uz:*:*:*:*:*:*\",\"matchCriteriaId\":\"9E4E6DF2-61BB-46AE-9B69-CCC899C9A38D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xa:*:*:*:*:*:*\",\"matchCriteriaId\":\"B260F027-B463-490A-A067-D8324FE4871A\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xb:*:*:*:*:*:*\",\"matchCriteriaId\":\"C4644F2D-A4F4-42D3-931B-EB3B0AC15D72\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xc:*:*:*:*:*:*\",\"matchCriteriaId\":\"FB43EBD8-3517-4399-B532-5B84BE96B2A0\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xd:*:*:*:*:*:*\",\"matchCriteriaId\":\"F4C59703-BB87-459F-BA79-D22541CB73A8\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xe:*:*:*:*:*:*\",\"matchCriteriaId\":\"71F5830A-D8FA-4A21-B7CB-E8A1E6746E67\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xf:*:*:*:*:*:*\",\"matchCriteriaId\":\"114E0B28-5AD8-4FEC-A089-79017AAB33C5\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xg:*:*:*:*:*:*\",\"matchCriteriaId\":\"6C4B4250-6044-43CF-84B1-53C4AE4ECC8D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xh:*:*:*:*:*:*\",\"matchCriteriaId\":\"E1C04A14-709B-44B3-B189-F50A41AA4C86\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xi:*:*:*:*:*:*\",\"matchCriteriaId\":\"2C0EA3E0-6BFC-4A4A-ACFF-C38C3948B7E2\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xj:*:*:*:*:*:*\",\"matchCriteriaId\":\"1C911936-17C0-43BE-A956-3F60D9606DAC\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xk:*:*:*:*:*:*\",\"matchCriteriaId\":\"E1C06F44-E4A4-400B-AF91-7A4209733569\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xl:*:*:*:*:*:*\",\"matchCriteriaId\":\"E5B2FACC-2958-4E2D-BADD-51550F1FA63A\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xm:*:*:*:*:*:*\",\"matchCriteriaId\":\"582B03D7-57A4-4E00-9B67-4DC2B4320DFD\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xn:*:*:*:*:*:*\",\"matchCriteriaId\":\"8038D0FA-30FB-4BC1-A33D-6BE76C248D21\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xq:*:*:*:*:*:*\",\"matchCriteriaId\":\"F5B5177C-98A7-42FF-83A8-8DFE33B28595\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xr:*:*:*:*:*:*\",\"matchCriteriaId\":\"19C09D13-4124-461C-9976-F7B141563532\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xs:*:*:*:*:*:*\",\"matchCriteriaId\":\"EE8EBF0C-7C7B-4C12-8135-0AB9957B7E19\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xt:*:*:*:*:*:*\",\"matchCriteriaId\":\"09C89AB4-7060-401D-B8B1-A5969D843558\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xu:*:*:*:*:*:*\",\"matchCriteriaId\":\"A365C1C0-B014-42C9-A8B3-9D0C967DC9E2\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xv:*:*:*:*:*:*\",\"matchCriteriaId\":\"0A56B6C5-C50D-44CF-BF43-4EDEBDA19581\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:xw:*:*:*:*:*:*\",\"matchCriteriaId\":\"D5AE6379-25CE-44A1-BA61-2461DB0C0E89\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ya:*:*:*:*:*:*\",\"matchCriteriaId\":\"907A6B20-721D-4756-840F-8A2EE776BDD0\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yb:*:*:*:*:*:*\",\"matchCriteriaId\":\"DBD1A8F1-73AD-41A0-8426-158402875952\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yc:*:*:*:*:*:*\",\"matchCriteriaId\":\"0D431519-F500-408D-A79D-DAE2DF2F3A5C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ye:*:*:*:*:*:*\",\"matchCriteriaId\":\"880952B0-E796-4C8A-9D28-900338B3C629\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yj:*:*:*:*:*:*\",\"matchCriteriaId\":\"B5D19A29-3500-4D69-B55F-16F6AF04CF4F\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yk:*:*:*:*:*:*\",\"matchCriteriaId\":\"ECD7F135-CFC7-42D4-A223-02D69B905E4C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yl:*:*:*:*:*:*\",\"matchCriteriaId\":\"AE54DF91-7757-4676-A497-2FDE4B039367\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ym:*:*:*:*:*:*\",\"matchCriteriaId\":\"65F91BB4-5721-46B8-97D7-98467F7E1172\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yn:*:*:*:*:*:*\",\"matchCriteriaId\":\"582D94B0-5980-492A-A8BB-4C107521573C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yo:*:*:*:*:*:*\",\"matchCriteriaId\":\"A6DCA5A2-7CE2-4273-B548-AA63E8EBCA2E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yp:*:*:*:*:*:*\",\"matchCriteriaId\":\"5A3625CC-B081-41DF-9C18-921C67FB4D95\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yq:*:*:*:*:*:*\",\"matchCriteriaId\":\"59DBDE9C-1898-4D8C-B63F-0F962FDEA23C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yr:*:*:*:*:*:*\",\"matchCriteriaId\":\"C072D406-81E6-4FA8-82AC-47033F3229D4\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ys:*:*:*:*:*:*\",\"matchCriteriaId\":\"06193800-DE6B-4014-99A2-AE9AAFC11F64\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yt:*:*:*:*:*:*\",\"matchCriteriaId\":\"A7ED5BF0-BC3A-467A-BF14-8FE3529FD6F2\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yu:*:*:*:*:*:*\",\"matchCriteriaId\":\"AC94BEC7-F050-4679-9331-9B7F679B2196\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yv:*:*:*:*:*:*\",\"matchCriteriaId\":\"9D21DF3F-4793-4F4A-94E7-C174EEC7CF61\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yx:*:*:*:*:*:*\",\"matchCriteriaId\":\"FD47D76A-7F35-4B38-B479-FDA1EB09C35D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:yy:*:*:*:*:*:*\",\"matchCriteriaId\":\"A82F0863-9143-4390-A9C0-19DDB06C176E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:za:*:*:*:*:*:*\",\"matchCriteriaId\":\"D86A8DA9-D114-4BBE-90DE-F643C12EFB1D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zb:*:*:*:*:*:*\",\"matchCriteriaId\":\"DF7E107F-4805-4832-A013-A35D374FF07C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zc:*:*:*:*:*:*\",\"matchCriteriaId\":\"2223DB0D-E7DA-488A-96C2-8845946CEDA3\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zd:*:*:*:*:*:*\",\"matchCriteriaId\":\"5779F924-F313-427F-82F4-571E657B57F8\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:ze:*:*:*:*:*:*\",\"matchCriteriaId\":\"9783B2B3-F735-4E96-8FAA-679D753CDC90\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zf:*:*:*:*:*:*\",\"matchCriteriaId\":\"748B610B-7659-431E-BCB9-B7B5E72C0E89\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zg:*:*:*:*:*:*\",\"matchCriteriaId\":\"98798701-533E-4255-9450-C6354B779EF1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zh:*:*:*:*:*:*\",\"matchCriteriaId\":\"F69E5442-C31F-46C8-8911-F5B77437754A\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zj:*:*:*:*:*:*\",\"matchCriteriaId\":\"E1D75842-3328-49A3-AC0E-C508CACE5C71\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zl:*:*:*:*:*:*\",\"matchCriteriaId\":\"B472DEEE-148A-46B4-BCBC-0A9F62F38B31\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zp:*:*:*:*:*:*\",\"matchCriteriaId\":\"FA06B835-2324-47D4-A04D-D01FFA069A59\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.2:zy:*:*:*:*:*:*\",\"matchCriteriaId\":\"23305EBA-11D5-417E-823E-39D0D052839D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:*:*:*:*:*:*:*\",\"matchCriteriaId\":\"8A8D0F64-5DE1-4A6F-91F0-8A8509BF077F\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:b:*:*:*:*:*:*\",\"matchCriteriaId\":\"95418AD2-FB85-4E20-B874-D82DDF88BC91\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:bc:*:*:*:*:*:*\",\"matchCriteriaId\":\"D8FC7948-B922-486E-9E5F-069B930EB1E8\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:bw:*:*:*:*:*:*\",\"matchCriteriaId\":\"475EABCF-7404-4B65-9B29-E35C7D673B47\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:eu:*:*:*:*:*:*\",\"matchCriteriaId\":\"7D99C07D-4EE3-4057-8E76-3468C45B4A4C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:ja:*:*:*:*:*:*\",\"matchCriteriaId\":\"14D1B81D-95E4-4945-94F2-C36FD7C0DC55\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:jea:*:*:*:*:*:*\",\"matchCriteriaId\":\"372582DB-DAB8-4B57-A778-5E2BC35B8233\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:jeb:*:*:*:*:*:*\",\"matchCriteriaId\":\"452FF154-F6C0-4BC4-969E-1D49AA3CCE49\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:jec:*:*:*:*:*:*\",\"matchCriteriaId\":\"36CF94C8-D6FE-4229-86F4-AF503F950151\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:jl:*:*:*:*:*:*\",\"matchCriteriaId\":\"554C9611-55F1-40AF-9862-7E902D5CE1D1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:jx:*:*:*:*:*:*\",\"matchCriteriaId\":\"F89C185A-D3B3-4F5F-9249-F8EE89E8DD04\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:t:*:*:*:*:*:*\",\"matchCriteriaId\":\"EEB0B55E-3579-4929-862F-C5FF9F796AE1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:tpc:*:*:*:*:*:*\",\"matchCriteriaId\":\"A19FD313-0AF6-43E1-9FCB-5D27A18C8C57\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:va:*:*:*:*:*:*\",\"matchCriteriaId\":\"CBC11203-84FD-4F6C-8597-573FD784C68E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xa:*:*:*:*:*:*\",\"matchCriteriaId\":\"8E8E34D3-0BCB-4D19-A41C-0375941E1B21\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xb:*:*:*:*:*:*\",\"matchCriteriaId\":\"0F894B6F-9061-4D5B-A7F9-C9DDF2DD35D9\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xc:*:*:*:*:*:*\",\"matchCriteriaId\":\"39BB1F5B-9D53-4DEC-8FC7-C9FC7B51C862\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xd:*:*:*:*:*:*\",\"matchCriteriaId\":\"5A124BB0-EFC3-430E-89F9-FF49B4BF9A28\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xe:*:*:*:*:*:*\",\"matchCriteriaId\":\"A0515E7C-E3A5-44F4-866F-283E43AE8654\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xf:*:*:*:*:*:*\",\"matchCriteriaId\":\"1A74B4D0-939B-4FF1-9163-86FF64DB368E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xg:*:*:*:*:*:*\",\"matchCriteriaId\":\"09CBD68E-2A5C-43DF-9AD6-DE07815821B3\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xh:*:*:*:*:*:*\",\"matchCriteriaId\":\"463C3A96-F8B7-4117-8CB3-D15B44119AB5\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xi:*:*:*:*:*:*\",\"matchCriteriaId\":\"01393D91-ED1D-460D-8621-10260F0CBDD0\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xj:*:*:*:*:*:*\",\"matchCriteriaId\":\"48ABA40D-DE49-4B20-AFA1-302EB93719FB\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xk:*:*:*:*:*:*\",\"matchCriteriaId\":\"8AB2FF53-5991-4264-B5CC-D1E45460BFCE\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xq:*:*:*:*:*:*\",\"matchCriteriaId\":\"0B0B18B6-FF50-48BE-8250-14E57FB73AE0\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xr:*:*:*:*:*:*\",\"matchCriteriaId\":\"1A1FAF42-B7B1-40B0-A0F7-5DF821E6193F\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xs:*:*:*:*:*:*\",\"matchCriteriaId\":\"0ED386B6-3C75-41C3-8206-9CBA14E20B00\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xu:*:*:*:*:*:*\",\"matchCriteriaId\":\"989581B0-FC28-457B-BDD2-72ED65BBE51E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xw:*:*:*:*:*:*\",\"matchCriteriaId\":\"EF8A8C95-2DC3-47AB-BED3-7D33902440C2\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:xy:*:*:*:*:*:*\",\"matchCriteriaId\":\"B8920235-87C6-41D6-9497-CC12D18A6536\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:ya:*:*:*:*:*:*\",\"matchCriteriaId\":\"9752CFFC-F1DA-4122-ACD8-79CB963F485F\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yd:*:*:*:*:*:*\",\"matchCriteriaId\":\"7012F8E0-2256-448A-9C4D-E2DB5AB9852B\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yf:*:*:*:*:*:*\",\"matchCriteriaId\":\"1BE94EA2-E0CC-4760-94A8-DE56C8181F74\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yg:*:*:*:*:*:*\",\"matchCriteriaId\":\"5B44691F-A47B-4953-BAC9-B2D43F4BCC06\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yh:*:*:*:*:*:*\",\"matchCriteriaId\":\"8910F02B-DF61-443B-A4B5-2C0C04484519\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yi:*:*:*:*:*:*\",\"matchCriteriaId\":\"929836AD-8128-4174-872D-B9638B54611C\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yj:*:*:*:*:*:*\",\"matchCriteriaId\":\"045B4782-6CE2-40DD-A9F0-16E0C25768FE\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yk:*:*:*:*:*:*\",\"matchCriteriaId\":\"9009E0C3-8BBC-4928-8528-62DA1ADC8BF5\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:ym:*:*:*:*:*:*\",\"matchCriteriaId\":\"5FE4985F-2C87-4532-9D11-9BA37B7D6A9B\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yq:*:*:*:*:*:*\",\"matchCriteriaId\":\"9A80C51F-C69A-4780-8AE9-BEBC8EBFA115\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:ys:*:*:*:*:*:*\",\"matchCriteriaId\":\"416B8D2F-0B11-4074-B6BD-2E97F79B5520\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yt:*:*:*:*:*:*\",\"matchCriteriaId\":\"5ED5B53D-930D-477E-A0F6-76167AE67641\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yu:*:*:*:*:*:*\",\"matchCriteriaId\":\"29B39978-3BD0-40A8-93AE-EF40042EB7CB\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yx:*:*:*:*:*:*\",\"matchCriteriaId\":\"84983F6A-64F6-4720-9291-FC84CA10EE25\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.3:yz:*:*:*:*:*:*\",\"matchCriteriaId\":\"4A2784C6-588A-4CAC-9362-515FB070D21E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:*:*:*:*:*:*:*\",\"matchCriteriaId\":\"E6A60117-E4D1-4741-98A2-E643A26616A7\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:ja:*:*:*:*:*:*\",\"matchCriteriaId\":\"93580300-6B1F-4D21-A51E-B781E234217D\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:jk:*:*:*:*:*:*\",\"matchCriteriaId\":\"28E2C53A-51B0-4BD6-869E-1554B0BD3A4A\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:jma:*:*:*:*:*:*\",\"matchCriteriaId\":\"DB3BA487-727D-416C-80C6-C2F90D52E149\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:jmb:*:*:*:*:*:*\",\"matchCriteriaId\":\"A73738DE-E81B-4226-ABA3-B54A5AD96389\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:jmc:*:*:*:*:*:*\",\"matchCriteriaId\":\"F2DA9F41-FBD0-404A-8C6B-E827C3FACE81\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:jx:*:*:*:*:*:*\",\"matchCriteriaId\":\"EFB1DA86-E0C2-4EDF-B82C-6677516CF1CC\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:md:*:*:*:*:*:*\",\"matchCriteriaId\":\"8E2376E9-D7F4-4483-AB13-8840EA9A63E3\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:mr:*:*:*:*:*:*\",\"matchCriteriaId\":\"473A31DD-A0DC-4716-B98E-D2926A26DAF6\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:sw:*:*:*:*:*:*\",\"matchCriteriaId\":\"C9569DC5-9803-4B17-9FF1-5BDA8194FE2A\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:t:*:*:*:*:*:*\",\"matchCriteriaId\":\"156B91B9-1F5B-4E83-A2B7-A5B7F272D5B1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xa:*:*:*:*:*:*\",\"matchCriteriaId\":\"C9E90E83-1732-4BEF-BC5B-401769DC8880\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xb:*:*:*:*:*:*\",\"matchCriteriaId\":\"68C9DDEB-EDE8-4B0D-A347-32621CCEDE42\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xc:*:*:*:*:*:*\",\"matchCriteriaId\":\"51679B26-DF28-4E41-9801-E1599F250FFD\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xd:*:*:*:*:*:*\",\"matchCriteriaId\":\"E989900F-BE66-47E4-9A1B-11B9785F89BB\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xe:*:*:*:*:*:*\",\"matchCriteriaId\":\"95A01B7E-8231-4001-A340-31CE66474FDA\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xf:*:*:*:*:*:*\",\"matchCriteriaId\":\"3EB012E7-E2E0-4F9D-ADF9-827816E3E6D2\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xg:*:*:*:*:*:*\",\"matchCriteriaId\":\"B7368529-518E-4DB2-B291-1F0009445D01\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xj:*:*:*:*:*:*\",\"matchCriteriaId\":\"3CC62D3B-A287-4DED-A44D-3351452D4A55\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xk:*:*:*:*:*:*\",\"matchCriteriaId\":\"EA2F5D70-6790-4756-9A6A-F1865DCD4D10\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xl:*:*:*:*:*:*\",\"matchCriteriaId\":\"57C8EB63-52B5-4B16-8EA1-621790F70B7E\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xm:*:*:*:*:*:*\",\"matchCriteriaId\":\"61C80F8B-ADE8-4289-8D87-02C6284D5A8F\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xn:*:*:*:*:*:*\",\"matchCriteriaId\":\"3CBBBBD1-496B-4C31-80B8-C217E915F077\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xt:*:*:*:*:*:*\",\"matchCriteriaId\":\"07ED91C2-B8ED-4AE7-8A37-82DB94EE28A1\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xv:*:*:*:*:*:*\",\"matchCriteriaId\":\"CBDA82BB-93D1-436C-9598-0AF3FAC8CD26\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xw:*:*:*:*:*:*\",\"matchCriteriaId\":\"687E91FF-957E-449F-BDD6-85AA59E1E0D5\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:cisco_ios:12.4:xy:*:*:*:*:*:*\",\"matchCriteriaId\":\"8049D059-2A09-4820-A4F0-6B8D794606BC\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:ios:12.0:*:*:*:*:*:*:*\",\"matchCriteriaId\":\"8F86F790-6247-42F2-9487-3D60A2842F52\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:ios:12.2yd:*:*:*:*:*:*:*\",\"matchCriteriaId\":\"86309E93-F2C9-4334-9A1C-989EFDC99215\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:ios:12.2yf:*:*:*:*:*:*:*\",\"matchCriteriaId\":\"9BFAF394-6E9A-4CD6-B8A6-5BDDE4EC8EC4\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:ios:12.2yg:*:*:*:*:*:*:*\",\"matchCriteriaId\":\"65318A70-40FF-4BE8-962B-DFCD5C476166\"},{\"vulnerable\":true,\"criteria\":\"cpe:2.3:o:cisco:ios:12.2yh:*:*:*:*:*:*:*\",\"matchCriteriaId\":\"8B6DB954-EDC8-4A81-8C26-9D3DBC68FC67\"}]}]}],\"references\":[{\"url\":\"http://secunia.com/advisories/29507\",\"source\":\"psirt@cisco.com\"},{\"url\":\"http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml\",\"source\":\"psirt@cisco.com\",\"tags\":[\"Patch\"]},{\"url\":\"http://www.securityfocus.com/bid/28465\",\"source\":\"psirt@cisco.com\"},{\"url\":\"http://www.securitytracker.com/id?1019712\",\"source\":\"psirt@cisco.com\"},{\"url\":\"http://www.us-cert.gov/cas/techalerts/TA08-087B.html\",\"source\":\"psirt@cisco.com\",\"tags\":[\"US Government Resource\"]},{\"url\":\"http://www.vupen.com/english/advisories/2008/1006/references\",\"source\":\"psirt@cisco.com\"},{\"url\":\"https://exchange.xforce.ibmcloud.com/vulnerabilities/41482\",\"source\":\"psirt@cisco.com\"},{\"url\":\"https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821\",\"source\":\"psirt@cisco.com\"},{\"url\":\"http://secunia.com/advisories/29507\",\"source\":\"af854a3a-2127-422b-91ae-364da2661108\"},{\"url\":\"http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml\",\"source\":\"af854a3a-2127-422b-91ae-364da2661108\",\"tags\":[\"Patch\"]},{\"url\":\"http://www.securityfocus.com/bid/28465\",\"source\":\"af854a3a-2127-422b-91ae-364da2661108\"},{\"url\":\"http://www.securitytracker.com/id?1019712\",\"source\":\"af854a3a-2127-422b-91ae-364da2661108\"},{\"url\":\"http://www.us-cert.gov/cas/techalerts/TA08-087B.html\",\"source\":\"af854a3a-2127-422b-91ae-364da2661108\",\"tags\":[\"US Government Resource\"]},{\"url\":\"http://www.vupen.com/english/advisories/2008/1006/references\",\"source\":\"af854a3a-2127-422b-91ae-364da2661108\"},{\"url\":\"https://exchange.xforce.ibmcloud.com/vulnerabilities/41482\",\"source\":\"af854a3a-2127-422b-91ae-364da2661108\"},{\"url\":\"https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821\",\"source\":\"af854a3a-2127-422b-91ae-364da2661108\"}]}}"
}
}
VAR-200803-0328
Vulnerability from variot - Updated: 2025-04-10 21:34The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets. A vulnerability in the way Cisco IOS handles IPv6 packets could result in a remotely exploitable denial of service. Cisco IOS is prone to multiple remote denial-of-service vulnerabilities because the software fails to properly handle malformed network datagrams. Successfully exploiting these issues allows remote attackers to trigger memory leaks or crashes in targeted devices. This will lead to denial-of-service conditions. These issues are tracked by Cisco Bug ID CSCsk73104. ----------------------------------------------------------------------
A new version (0.9.0.0 - Release Candidate 1) of the free Secunia PSI has been released. The new version includes many new and advanced features, which makes it even easier to stay patched.
1) A memory leak exists in the handling of completed PPTP sessions, which can be exploited to exhaust memory on an affected system.
2) An error exists in the handling of PPTP sessions when virtual access interfaces are not removed from the interface descriptor block (IDB) and are not reused. This can result in an exhaustion of the interface descriptor block (IDB) limit. This can be exploited to cause a reload of the system or a memory leak.
Successful exploitation of this vulnerability requires that IPv6 and certain IPv4 UDP services are enabled.
5) An error exists in the implementation of Multicast Virtual Private Networks (MVPN), which can be exploited to create extra multicast states on the core routers via specially crafted Multicast Distribution Tree (MDT) Data Join messages. This can also be exploited to receive multicast traffic from VPNs that are not connected to the same Provider Edge (PE).
Successful exploitation of the multicast traffic leak requires that the attacker knows or guesses the Border Gateway Protocol (BGP) peering IP address of a remote PE router and the address of the multicast group that is used in other MPLS VPNs.
SOLUTION: Update to the fixed version (please see the vendor's advisories for details).
PROVIDED AND/OR DISCOVERED BY: 1, 2) The vendor credits Martin Kluge of Elxsi Security. 5) The vendor credits Thomas Morin.
ORIGINAL ADVISORY: Cisco: http://www.cisco.com/warp/public/707/cisco-sa-20080326-pptp.shtml http://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml http://www.cisco.com/warp/public/707/cisco-sa-20080326-IPv4IPv6.shtml http://www.cisco.com/warp/public/707/cisco-sa-20080326-mvpn.shtml
OTHER REFERENCES: US-CERT VU#936177: http://www.kb.cert.org/vuls/id/936177
About: This Advisory was delivered by Secunia as a free service to help everybody keeping their systems up to date against the latest vulnerabilities.
Subscribe: http://secunia.com/secunia_security_advisories/
Definitions: (Criticality, Where etc.) http://secunia.com/about_secunia_advisories/
Please Note: Secunia recommends that you verify all advisories you receive by clicking the link. Secunia NEVER sends attached files with advisories. Secunia does not advise people to install third party patches, only use those supplied by the vendor. Attackers could exploit these vulnerabilities to access sensitive information or cause a denial of service.
I. Further details are available in the US-CERT Vulnerability Notes Database.
II. Potential consequences include disclosure of sensitive information and denial of service.
III.
IV. Please send email to cert@cert.org with "TA08-087B Feedback VU#936177" in the subject.
For instructions on subscribing to or unsubscribing from this mailing list, visit http://www.us-cert.gov/cas/signup.html.
Produced 2008 by US-CERT, a government organization.
Cisco has released free software updates that address these vulnerabilities. Workarounds are available to mitigate the effects of these vulnerabilities.
This advisory is posted at http://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml
Note: The March 26, 2008 publication includes five Security Advisories. The Advisories all affect Cisco's Internetwork Operating System (IOS). Each Advisory lists the releases that correct the vulnerability described in the Advisory, and the Advisories also detail the releases that correct the vulnerabilities in all five Advisories. Please reference the following software table to find a release which fixes all published Security Advisories as of March 26th, 2008.
- March 26th bundled IOS Advisory Table http://www.cisco.com/warp/public/707/cisco-sa-20080326-bundle.shtml
Individual publication links are listed below:
-
Cisco IOS Virtual Private Dial-up Network Denial of Service Vulnerability http://www.cisco.com/warp/public/707/cisco-sa-20080326-pptp.shtml
-
Multiple DLSw Denial of Service Vulnerabilities in Cisco IOS http://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml
-
Cisco IOS User Datagram Protocol Delivery Issue For IPv4/IPv6 Dual-stack Routers http://www.cisco.com/warp/public/707/cisco-sa-20080326-IPv4IPv6.shtml
-
Vulnerability in Cisco IOS with OSPF, MPLS VPN, and Supervisor 32, Supervisor 720, or Route Switch Processor 720 http://www.cisco.com/warp/public/707/cisco-sa-20080326-queue.shtml
-
Cisco IOS Multicast Virtual Private Network (MVPN) Data Leak http://www.cisco.com/warp/public/707/cisco-sa-20080326-mvpn.shtml
Affected Products
Vulnerable Products +------------------
This security advisory applies to all Cisco products that run any version of affected Cisco IOS software configured for DLSw. Systems that contain the DLSw feature, but do not have it enabled, are not affected.
Routers enabled for DLSw contain a line in the configuration defining a local DLSw peer. This configuration can be observed by issuing the command "show running-config". Systems configured for DLSw contain lines similar to the following:
"dlsw local-peer"
or
"dlsw local-peer peer-id <IP address>"
Any version of Cisco IOS prior to the versions which are listed in the Software Versions and Fixes section below is vulnerable.
To determine the version of Cisco IOS software running on a Cisco product, log in to the device and issue the show version command to display the system banner. Cisco IOS Software will identify itself as "Internetwork Operating System Software" or simply "IOS". On the next line of output, the image name will be displayed between parentheses, followed by "Version" and the IOS release name. Other Cisco devices will not have the "show version" command or will give different output.
The following example identifies a Cisco product running Cisco IOS Software Release 12.3(6) with an installed image name of C3640-IS-M:
Cisco Internetwork Operating System Software
IOS (tm) 3600 Software (C3640-IS-M), Version 12.3(6), RELEASE SOFTWARE (fc3)
The next example shows a product running Cisco IOS Software Release 12.3(11)T3 with an image name of C3845-ADVIPSERVICESK9-M:
Cisco IOS Software, 3800 Software (C3845-ADVIPSERVICESK9-M), Version 12.3(11)T3, RELEASE SOFTWARE (fc4)
Technical Support: http://www.cisco.com/techsupport
Copyright (c) 1986-2005 by Cisco Systems, Inc.
Additional information about Cisco IOS release naming can be found at http://www.cisco.com/warp/public/620/1.html.
Products Confirmed Not Vulnerable +--------------------------------
Cisco IOS devices that are not configured for DLSw are not vulnerable.
No other Cisco products are currently known to be affected by these vulnerabilities.
Details
Data-link switching (DLSw) provides a means of transporting IBM Systems Network Architecture (SNA) and network basic input/output system (NetBIOS) traffic over an IP network. Cisco implementation of DLSw also uses UDP port 2067 and IP Protocol 91 for Fast Sequenced Transport (FST). These vulnerabilities do not affect TCP packet processing. A successful exploitation may result in a reload of the system or a memory leak on the device, leading to a denial of service (DoS) condition.
Cisco IOS devices configured for DLSw with "dlsw local-peer" automatically listen for IP protocol 91 packets.
Cisco IOS devices listen to IP protocol 91 packets when DLSw is configured. However, it is only used if DLSw is configured for Fast Sequenced Transport (FST). A DLSw FST peer configuration will contain the following line:
"dlsw remote-peer 0 fst <ip-address>"
It is possible to disable UDP processing in DLSw with the "dlsw udp-disable" command. However, disabling UDP only prevents the sending of UDP packets, it does not prevent the device from receiving and processing incoming UDP packets.
Vulnerability Scoring Details
Cisco has provided scores for the vulnerabilities in this advisory based on the Common Vulnerability Scoring System (CVSS). The CVSS scoring in this Security Advisory is done in accordance with CVSS version 2.0.
CVSS is a standards-based scoring method that conveys vulnerability severity and helps determine urgency and priority of response.
Cisco has provided a base and temporal score. Customers can then compute environmental scores to assist in determining the impact of the vulnerability in individual networks.
Cisco has provided an FAQ to answer additional questions regarding CVSS at http://www.cisco.com/web/about/security/intelligence/cvss-qandas.html
Cisco has also provided a CVSS calculator to help compute the environmental impact for individual networks at http://intellishield.cisco.com/security/alertmanager/cvss
CSCsk73104 - Handling of malformed packets by DLSW
CVSS Base Score - 7.8
Access Vector: Network Access Complexity: Low Authentication: None
Confidentiality Impact: None Integrity Impact: None Availability Impact: Complete
CVSS Temporal Score - 6.4
Exploitability: Functional Remediation Level: Official-Fix Report Confidence: Confirmed
Impact
Successful exploitation of these vulnerabilities may result in the reload of the device or memory leaks, leading to a DoS condition.
Software Versions and Fixes
When considering software upgrades, also consult http://www.cisco.com/go/psirt and any subsequent advisories to determine exposure and a complete upgrade solution.
In all cases, customers should exercise caution to be certain the devices to be upgraded contain sufficient memory and that current hardware and software configurations will continue to be supported properly by the new release. If the information is not clear, contact the Cisco Technical Assistance Center (TAC) or your contracted maintenance provider for assistance.
Each row of the Cisco IOS software table (below) names a Cisco IOS release train. If a given release train is vulnerable, then the earliest possible releases that contain the fix (along with the anticipated date of availability for each, if applicable) are listed in the "First Fixed Release" column of the table. The "Recommended Release" column indicates the releases which have fixes for all the published vulnerabilities at the time of this Advisory. A device running a release in the given train that is earlier than the release in a specific column (less than the First Fixed Release) is known to be vulnerable. Cisco recommends upgrading to a release equal to or later than the release in the "Recommended Releases" column of the table.
+----------------------------------------+ | Major | Availability of Repaired | | Release | Releases | |------------+---------------------------| | Affected | First Fixed | Recommended | | 12.0-Based | Release | Release | | Releases | | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0 | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.0(8)DA3 | | | | are | | | | vulnerable, | | | | release | | | 12.0DA | 12.0(8)DA3 | | | | and later | | | | are not | | | | vulnerable; | | | | migrate to | | | | any release | | | | in 12.2DA | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.0(7)DB | | | | are | | | | vulnerable, | | | 12.0DB | release | 12.4(18a) | | | 12.0(7)DB | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.4 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.0(7)DC | | | | are | | | | vulnerable, | | | 12.0DC | release | 12.4(18a) | | | 12.0(7)DC | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.4 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.0(17)S5 | | | | are | | | 12.0S | vulnerable, | 12.0(32)S10 | | | release | | | | 12.0(17)S5 | | | | and later | | | | are not | | | | vulnerable; | | |------------+-------------+-------------| | 12.0SC | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.0SL | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.0SP | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.0ST | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.0SX | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.0SY | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.0SZ | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0T | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.0W | Vulnerable; | 12.0(3c)W5 | | | contact TAC | (8) | |------------+-------------+-------------| | 12.0WC | Vulnerable; | | | | contact TAC | | |------------+-------------+-------------| | 12.0WT | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0XA | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.0XB | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.0(2)XC2 | | | | are | | | | vulnerable, | | | 12.0XC | release | 12.3(26) | | | 12.0(2)XC2 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0XD | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0XE | first fixed | | | | in 12.1E | | |------------+-------------+-------------| | 12.0XF | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0XG | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0XH | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.0(4)XI2 | | | | are | | | | vulnerable, | | | 12.0XI | release | 12.3(26) | | | 12.0(4)XI2 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.3 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.0(4)XJ5 | | | | are | | | | vulnerable, | | | 12.0XJ | release | 12.3(26) | | | 12.0(4)XJ5 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0XK | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.0XL | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.0XM | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0XN | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0XQ | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.0XR | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.0XS | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.0XV | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.0XW | Not | | | | Vulnerable | | |------------+-------------+-------------| | Affected | First Fixed | Recommended | | 12.1-Based | Release | Release | | Releases | | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1 | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1AA | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.1AX | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.1(22)AY1 | | | | are | | | 12.1AY | vulnerable, | 12.1(22) | | | release | EA11 | | | 12.1(22)AY1 | | | | and later | | | | are not | | | | vulnerable; | | |------------+-------------+-------------| | 12.1AZ | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1CX | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1DA | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.1(4)DB1 | | | | are | | | | vulnerable, | | | 12.1DB | release | 12.4(18a) | | | 12.1(4)DB1 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.4 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.1(4)DC2 | | | | are | | | | vulnerable, | | | 12.1DC | release | 12.4(18a) | | | 12.1(4)DC2 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.4 | | |------------+-------------+-------------| | 12.1E | 12.1(27b)E4 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.1(11)EA1 | | | | are | | | 12.1EA | vulnerable, | 12.1(22) | | | release | EA11 | | | 12.1(11)EA1 | | | | and later | | | | are not | | | | vulnerable; | | |------------+-------------+-------------| | 12.1EB | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1EC | migrate to | 12.3(23)BC1 | | | any release | | | | in 12.2BC | | |------------+-------------+-------------| | 12.1EO | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1EU | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1EV | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1EW | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1EX | first fixed | | | | in 12.1E | | |------------+-------------+-------------| | 12.1EY | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1EZ | first fixed | | | | in 12.1E | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1GA | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1GB | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1T | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XA | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.1XB | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XC | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XD | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.1XE | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1XF | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XG | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XH | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XI | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XJ | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.1XK | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1XL | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XM | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.1XN | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1XO | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XP | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XQ | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.1XR | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XS | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.1(3)XT2 | | | | are | | | | vulnerable, | | | 12.1XT | release | 12.3(26) | | | 12.1(3)XT2 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.3 | | |------------+-------------+-------------| | 12.1XU | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.1(5)XV1 | | | | are | | | | vulnerable, | | | 12.1XV | release | 12.3(26) | | | 12.1(5)XV1 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XW | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XX | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XY | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1XZ | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1YA | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1YB | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.1YC | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1YD | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.1(5)YE1 | | | | are | | | | vulnerable, | | | 12.1YE | release | 12.3(26) | | | 12.1(5)YE1 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.3 | | |------------+-------------+-------------| | 12.1YF | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1YG | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.1YH | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.1YI | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.1YJ | Not | | | | Vulnerable | | |------------+-------------+-------------| | Affected | First Fixed | Recommended | | 12.2-Based | Release | Release | | Releases | | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2 | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2B | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | 12.2BC | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2BW | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2BY | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | 12.2BZ | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2CX | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2CY | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2CZ | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2DA | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2DD | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2DX | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | 12.2EU | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2EW | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2EWA | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2EX | migrate to | 12.2(40)EX1 | | | any release | | | | in 12.2SEA | | |------------+-------------+-------------| | 12.2EY | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2EZ | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2FX | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2FY | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2FZ | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2IXA | Vulnerable; | | | | contact TAC | | |------------+-------------+-------------| | 12.2IXB | Vulnerable; | | | | contact TAC | | |------------+-------------+-------------| | 12.2IXC | Vulnerable; | | | | contact TAC | | |------------+-------------+-------------| | 12.2IXD | Vulnerable; | | | | contact TAC | | |------------+-------------+-------------| | | Vulnerable; | 12.2(18) | | | migrate to | IXF; | | 12.2IXE | any release | Available | | | in 12.2IXF | on | | | | 31-MAR-08 | |------------+-------------+-------------| | 12.2JA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2JK | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2MB | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2MC | 12.2(15) | 12.4(18a) | | | MC2h | | |------------+-------------+-------------| | 12.2S | 12.2(25)S15 | 12.2(25)S15 | |------------+-------------+-------------| | | 12.2(28) | | | | SB10 | | | | | | | | 12.2(31)SB9 | 12.2(28) | | 12.2SB | | SB12 | | | 12.2(33)SB; | | | | Available | | | | on | | | | 31-MAR-08 | | |------------+-------------+-------------| | | Vulnerable; | | | | first fixed | | | | in 12.2SB | | | | | | | 12.2SBC | Vulnerable; | 12.2(28) | | | first fixed | SB12 | | | in 12.2SB; | | | | Available | | | | on | | | | 31-MAR-08 | | |------------+-------------+-------------| | 12.2SCA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SE | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SEA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SEB | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SEC | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SED | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SEE | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SEF | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SEG | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SG | 12.2(44)SG | 12.2(44)SG | |------------+-------------+-------------| | 12.2SGA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SL | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SM | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SO | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SRA | 12.2(33) | 12.2(33) | | | SRA6 | SRA7 | |------------+-------------+-------------| | | 12.2(33) | 12.2(33) | | | SRB3; | SRB3; | | 12.2SRB | Available | Available | | | on | on | | | 31-MAR-08 | 31-MAR-08 | |------------+-------------+-------------| | 12.2SRC | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2SU | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.2(29a) | | | | SV1 are | | | | vulnerable, | | | | release | | | 12.2SV | 12.2(29a) | 12.2(29b)SV | | | SV1 and | | | | later are | | | | not | | | | vulnerable; | | | | migrate to | | | | any release | | | | in 12.2SVA | | |------------+-------------+-------------| | 12.2SVA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SVC | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2SVD | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.2(25) | | | | SW10 are | | | | vulnerable, | | | 12.2SW | release | | | | 12.2(25) | | | | SW10 and | | | | later are | | | | not | | | | vulnerable; | | |------------+-------------+-------------| | | Vulnerable; | 12.2(18) | | 12.2SX | first fixed | SXF13 | | | in 12.2SXF | | |------------+-------------+-------------| | | Vulnerable; | 12.2(18) | | 12.2SXA | first fixed | SXF13 | | | in 12.2SXF | | |------------+-------------+-------------| | | Vulnerable; | 12.2(18) | | 12.2SXB | first fixed | SXF13 | | | in 12.2SXF | | |------------+-------------+-------------| | | Vulnerable; | 12.2(18) | | 12.2SXD | first fixed | SXF13 | | | in 12.2SXF | | |------------+-------------+-------------| | | Vulnerable; | 12.2(18) | | 12.2SXE | first fixed | SXF13 | | | in 12.2SXF | | |------------+-------------+-------------| | | 12.2(18) | | | | SXF12 | | | | | | | 12.2SXF | 12.2(18) | 12.2(18) | | | SXF12a | SXF13 | | | | | | | 12.2(18) | | | | SXF13a | | |------------+-------------+-------------| | 12.2SXH | 12.2(33) | | | | SXH1 | | |------------+-------------+-------------| | | Vulnerable; | 12.2(18) | | 12.2SY | first fixed | SXF13 | | | in 12.2SXF | | |------------+-------------+-------------| | | | 12.2(25)S15 | | | Vulnerable; | | | 12.2SZ | first fixed | 12.2(28) | | | in 12.2S | SB12 | | | | | | | | 12.2(33)SRC | |------------+-------------+-------------| | | Vulnerable; | | | 12.2T | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.2TPC | 12.2(8) | | | | TPC10d | | |------------+-------------+-------------| | 12.2UZ | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XA | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XB | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XC | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XD | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.2XE | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2XF | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XG | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XH | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.2XI | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XJ | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XK | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XL | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XM | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.2XN | 12.2(33)XN1 | 12.3(26) | |------------+-------------+-------------| | 12.2XO | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XQ | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.2XR | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2XS | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XT | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XU | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XV | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2XW | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.2(4)YA8 | | | | are | | | | vulnerable, | | | 12.2YA | release | 12.3(26) | | | 12.2(4)YA8 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YB | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YC | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YD | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | | 12.2(25)S15 | | | Vulnerable; | | | 12.2YE | first fixed | 12.2(28) | | | in 12.2S | SB12 | | | | | | | | 12.2(33)SRC | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YF | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | 12.2YG | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YH | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.2(8)YJ1 | | | | are | | | | vulnerable, | | | 12.2YJ | release | 12.3(26) | | | 12.2(8)YJ1 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.3 | | |------------+-------------+-------------| | 12.2YK | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YL | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YM | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YN | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | 12.2(18) | | 12.2YO | first fixed | SXF13 | | | in 12.2SXF | | |------------+-------------+-------------| | 12.2YP | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2YQ | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2YR | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2YS | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YT | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YU | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.2(11)YV1 | | | | are | | | | vulnerable, | | | 12.2YV | release | 12.4(18a) | | | 12.2(11)YV1 | | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YW | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YX | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2YY | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | | 12.2(25)S15 | | | Vulnerable; | | | 12.2YZ | first fixed | 12.2(28) | | | in 12.2S | SB12 | | | | | | | | 12.2(33)SRC | |------------+-------------+-------------| | | Vulnerable; | 12.2(18) | | 12.2ZA | first fixed | SXF13 | | | in 12.2SXF | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2ZB | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | 12.2ZC | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.2ZD | Vulnerable; | | | | contact TAC | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2ZE | first fixed | 12.3(26) | | | in 12.3 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2ZF | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | 12.2ZG | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.2(13)ZH6 | | | | are | | | | vulnerable, | | | 12.2ZH | release | 12.2(13) | | | 12.2(13)ZH6 | ZH11 | | | and later | | | | are not | | | | vulnerable; | | | | first fixed | | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.2ZJ | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | 12.4(15)T4 | | 12.2ZL | first fixed | | | | in 12.4 | 12.4(18a) | |------------+-------------+-------------| | 12.2ZP | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | 12.2(33) | | 12.2ZU | first fixed | SXH2 | | | in 12.2SXH | | |------------+-------------+-------------| | 12.2ZY | 12.2(18)ZY2 | 12.2(18)ZY2 | |------------+-------------+-------------| | Affected | First Fixed | Recommended | | 12.3-Based | Release | Release | | Releases | | | |------------+-------------+-------------| | 12.3 | 12.3(24) | 12.3(26) | |------------+-------------+-------------| | | Vulnerable; | | | 12.3B | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | 12.3BC | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3BW | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | 12.3EU | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.3JA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.3JEA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.3JEB | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.3JEC | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Releases | | | | prior to | | | | 12.3(8)JK1 | | | | are | | | 12.3JK | vulnerable, | 12.3(8)JK1 | | | release | | | | 12.3(8)JK1 | | | | and later | | | | are not | | | | vulnerable; | | |------------+-------------+-------------| | 12.3JL | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.3JX | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3T | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | 12.3TPC | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.3VA | Vulnerable; | | | | contact TAC | | |------------+-------------+-------------| | | 12.3(2)XA7; | 12.3(2)XA7; | | 12.3XA | Available | Available | | | on | on | | | 31-MAR-08 | 31-MAR-08 | |------------+-------------+-------------| | | Vulnerable; | | | 12.3XB | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | | 12.4(15)T4 | | 12.3XC | 12.3(2)XC5 | | | | | 12.4(18a) | |------------+-------------+-------------| | | Vulnerable; | | | 12.3XD | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | 12.3(2)XE6; | 12.4(15)T4 | | 12.3XE | Available | | | | on | 12.4(18a) | | | 31-MAR-08 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3XF | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | | first fixed | 12.4(15)T4 | | 12.3XG | in 12.3YG; | | | | Available | 12.4(18a) | | | on | | | | 16-JUN-08 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3XH | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | 12.3(7) | | | | XI11; | | | 12.3XI | Available | | | | on | | | | 18-SEP-08 | | |------------+-------------+-------------| | | Vulnerable; | 12.3(14) | | 12.3XJ | first fixed | YX11 | | | in 12.3YX | | | | | 12.4(15)T4 | |------------+-------------+-------------| | | Vulnerable; | | | 12.3XK | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3XQ | first fixed | 12.4(18a) | | | in 12.4 | | |------------+-------------+-------------| | | 12.3(7)XR8; | 12.3(7)XR8; | | 12.3XR | Available | Available | | | on | on | | | 31-MAR-08 | 31-MAR-08 | |------------+-------------+-------------| | 12.3XS | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3XU | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | | Vulnerable; | 12.3(14) | | 12.3XW | first fixed | YX11 | | | in 12.3YX | | | | | 12.4(15)T4 | |------------+-------------+-------------| | 12.3XY | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.3YA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.3YD | Not | | | | Vulnerable | | |------------+-------------+-------------| | | Vulnerable; | 12.3(14) | | 12.3YF | first fixed | YX11 | | | in 12.3YX | | | | | 12.4(15)T4 | |------------+-------------+-------------| | | 12.3(8)YG7; | | | 12.3YG | Available | 12.4(15)T4 | | | on | | | | 16-JUN-08 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3YH | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3YI | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3YJ | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3YK | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | 12.3YM | 12.3(14) | 12.3(14) | | | YM12 | YM12 | |------------+-------------+-------------| | | Vulnerable; | | | 12.3YQ | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | | 12.3(11) | | | | YS3; | | | 12.3YS | Available | 12.4(15)T4 | | | on | | | | 31-MAR-08 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3YT | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | | Vulnerable; | | | 12.3YU | first fixed | | | | in 12.4XB | | |------------+-------------+-------------| | 12.3YX | 12.3(14) | 12.3(14) | | | YX11 | YX11 | |------------+-------------+-------------| | 12.3YZ | 12.3(11)YZ3 | | |------------+-------------+-------------| | Affected | First Fixed | Recommended | | 12.4-Based | Release | Release | | Releases | | | |------------+-------------+-------------| | | 12.4(10c) | | | | | | | | 12.4(13e) | | | | | | | | 12.4(16b) | | | 12.4 | | 12.4(18a) | | | 12.4(17) | | | | | | | | 12.4(3h) | | | | | | | | 12.4(8d) | | |------------+-------------+-------------| | 12.4JA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.4JK | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.4JMA | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.4JMB | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.4JMC | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.4JX | Not | | | | Vulnerable | | |------------+-------------+-------------| | | 12.4(15)MD; | | | 12.4MD | Available | | | | on | | | | 09-MAY-08 | | |------------+-------------+-------------| | 12.4MR | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.4SW | Vulnerable; | | | | contact TAC | | |------------+-------------+-------------| | | 12.4(15)T2 | | | | | | | 12.4T | 12.4(6)T10 | 12.4(15)T4 | | | | | | | 12.4(9)T7 | | |------------+-------------+-------------| | | Vulnerable; | | | 12.4XA | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | 12.4XB | 12.4(2)XB6 | | |------------+-------------+-------------| | 12.4XC | Vulnerable; | | | | contact TAC | | |------------+-------------+-------------| | 12.4XD | 12.4(4)XD10 | 12.4(4)XD10 | |------------+-------------+-------------| | 12.4XE | 12.4(6)XE2 | 12.4(15)T4 | |------------+-------------+-------------| | 12.4XF | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.4XG | 12.4(9)XG2 | 12.4(9)XG2 | |------------+-------------+-------------| | | Vulnerable; | | | 12.4XJ | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | | Vulnerable; | | | 12.4XK | first fixed | 12.4(15)T4 | | | in 12.4T | | |------------+-------------+-------------| | 12.4XL | 12.4(15)XL2 | | |------------+-------------+-------------| | 12.4XM | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.4XN | Not | | | | Vulnerable | | |------------+-------------+-------------| | 12.4XT | 12.4(6)XT2 | 12.4(6)XT2 | |------------+-------------+-------------| | 12.4XV | 12.4(11)XV | | |------------+-------------+-------------| | 12.4XW | Vulnerable; | 12.4(11)XW6 | | | contact TAC | | |------------+-------------+-------------| | 12.4XY | Not | | | | Vulnerable | | +----------------------------------------+
A special patch for Cisco IOS Software Modularity is also available and can be downloaded from the Cisco IOS Software Modularity Patch Navigator at http://tools.cisco.com/swdf/ionpn/jsp/main.jsp.
Workarounds
The workaround consists of filtering UDP packets to port 2067 and IP protocol 91 packets. Filters can be applied at network boundaries to filter all IP protocol 91 packets and UDP packets to port 2067 or can be applied on individual affected devices to permit such traffic only from trusted peer IP addresses. However, since both of the protocols are connectionless, it is possible for an attacker to spoof malformed packets from legitimate peer IP addresses.
As soon as DLSw is configured, the Cisco IOS device begins listening on IP protocol 91. However, this protocol is only used if DLSw is configured for Fast Sequenced Transport (FST). A DLSw FST peer configuration will contain the following line:
"dlsw remote-peer 0 fst <ip-address>"
If FST is used, filtering IP protocol 91 will break the operation, so filters need to permit protocol 91 traffic from legitimate peer IP addresses.
It is possible to disable UDP processing in DLSw with the "dlsw udp-disable" command. However, disabling UDP only prevents the sending of UDP packets, it does not prevent the receiving and processing of incoming UDP packets. To protect a vulnerable device from malicious packets via UDP port 2067, both of the following actions must be taken:
- Disable UDP outgoing packets with the "dlsw udp-disable" command, AND
- Filter UDP 2067 in the vulnerable device using infrastructure ACL.
Additional mitigation techniques that can be deployed on Cisco devices within the network are available in the Cisco Applied Mitigation Bulletin companion document for this advisory:
http://www.cisco.com/warp/public/707/cisco-amb-20080326-dlsw.shtml
Using Control Plane Policing on Affected Devices +-----------------------------------------------
Control Plane Policing (CoPP) can be used to block untrusted DLSw traffic to the device. Cisco IOS software releases 12.0S, 12.2SX, 12.2S, 12.3T, 12.4, and 12.4T support the CoPP feature. CoPP may be configured on a device to protect the management and control planes to minimize the risk and effectiveness of direct infrastructure attacks by explicitly permitting only authorized traffic sent to infrastructure devices in accordance with existing security policies and configurations. The following example, which uses 192.168.100.1 to represent a trusted host, can be adapted to your network. If FST is not used, protocol 91 may be completely filtered. Additionally, if UDP is disabled with the "dlsw udp-disable" command, UDP port 2067 may also be completely filtered.
!--- Deny DLSw traffic from trusted hosts to all IP addresses
!--- configured on all interfaces of the affected device so that
!--- it will be allowed by the CoPP feature
access-list 111 deny udp host 192.168.100.1 any eq 2067
access-list 111 deny 91 host 192.168.100.1 any
!--- Permit all other DLSw traffic sent to all IP addresses
!--- configured on all interfaces of the affected device so that it
!--- will be policed and dropped by the CoPP feature
access-list 111 permit udp any any eq 2067
access-list 111 permit 91 any any
!--- Permit (Police or Drop)/Deny (Allow) all other Layer 3 and Layer 4
!--- traffic in accordance with existing security policies and
!--- configurations for traffic that is authorized to be sent
!--- to infrastructure devices
!--- Create a Class-Map for traffic to be policed by
!--- the CoPP feature
class-map match-all drop-DLSw-class
match access-group 111
!--- Create a Policy-Map that will be applied to the
!--- Control-Plane of the device.
policy-map drop-DLSw-traffic
class drop-DLSw-class
drop
!--- Apply the Policy-Map to the Control-Plane of the
!--- device
control-plane
service-policy input drop-DLSw-traffic
In the above CoPP example, the access control entries (ACEs) which match the potential exploit packets with the "permit" action result in these packets being discarded by the policy-map "drop" function, while packets that match the "deny" action (not shown) are not affected by the policy-map drop function. Please note that in the Cisco IOS 12.2S and 12.0S trains the policy-map syntax is different:
policy-map drop-DLSw-traffic
class drop-DLSw-class
police 32000 1500 1500 conform-action drop exceed-action drop
Additional information on the configuration and use of the CoPP feature is available at http://www.cisco.com/en/US/products/ps6642/products_white_paper0900aecd804fa16a.shtml and http://www.cisco.com/en/US/products/sw/iosswrel/ps1838/products_feature_guide09186a008052446b.html.
Using Infrastructure ACLs at Network Boundary +--------------------------------------------
Although it is often difficult to block traffic transiting your network, it is possible to identify traffic that should never be allowed to target your infrastructure devices and block that traffic at the border of your network. iACLs are a network security best practice and should be considered as a long-term addition to good network security as well as a workaround for this specific vulnerability. The iACL example shown below should be included as part of the deployed infrastructure access-list that will protect all devices with IP addresses in the infrastructure IP address range. If FST is not used, protocol 91 may be completely filtered. Additionally, if UDP is disabled with the "dlsw udp-disable" command, UDP port 2067 may also be completely filtered.
!--- Permit DLSw (UDP port 2067 and IP protocol 91) packets
!--- from trusted hosts destined to infrastructure addresses.
access-list 150 permit udp TRUSTED_HOSTS MASK INFRASTRUCTURE_ADDRESSES MASK eq 2067
access-list 150 permit 91 TRUSTED_HOSTS MASK INFRASTRUCTURE_ADDRESSES MASK
!--- Deny DLSw (UDP port 2067 and IP protocol 91) packets from
!--- all other sources destined to infrastructure addresses.
access-list 150 deny udp any INFRASTRUCTURE_ADDRESSES MASK eq 2067
access-list 150 deny 91 any INFRASTRUCTURE_ADDRESSES MASK
!--- Permit/deny all other Layer 3 and Layer 4 traffic in accordance
!--- with existing security policies and configurations
!--- Permit all other traffic to transit the device.
access-list 150 permit ip any any
interface serial 2/0
ip access-group 150 in
The white paper entitled "Protecting Your Core: Infrastructure Protection Access Control Lists" presents guidelines and recommended deployment techniques for infrastructure protection access lists. This white paper can be obtained at the following link:
http://www.cisco.com/en/US/tech/tk648/tk361/technologies_white_paper09186a00801a1a55.shtml
Obtaining Fixed Software
Cisco has released free software updates that address these vulnerabilities. Prior to deploying software, customers should consult their maintenance provider or check the software for feature set compatibility and known issues specific to their environment.
Customers may only install and expect support for the feature sets they have purchased. By installing, downloading, accessing or otherwise using such software upgrades, customers agree to be bound by the terms of Cisco's software license terms found at http://www.cisco.com/en/US/products/prod_warranties_item09186a008088e31f.html or as otherwise set forth at Cisco.com Downloads at http://www.cisco.com/public/sw-center/sw-usingswc.shtml.
Do not contact psirt@cisco.com or security-alert@cisco.com for software upgrades.
Customers with Service Contracts +-------------------------------
Customers with contracts should obtain upgraded software through their regular update channels. For most customers, this means that upgrades should be obtained through the Software Center on Cisco's worldwide website at http://www.cisco.com.
Customers using Third Party Support Organizations +------------------------------------------------
Customers whose Cisco products are provided or maintained through prior or existing agreements with third-party support organizations, such as Cisco Partners, authorized resellers, or service providers should contact that support organization for guidance and assistance with the appropriate course of action in regards to this advisory.
The effectiveness of any workaround or fix is dependent on specific customer situations, such as product mix, network topology, traffic behavior, and organizational mission. Due to the variety of affected products and releases, customers should consult with their service provider or support organization to ensure any applied workaround or fix is the most appropriate for use in the intended network before it is deployed.
Customers without Service Contracts +----------------------------------
Customers who purchase direct from Cisco but do not hold a Cisco service contract, and customers who purchase through third-party vendors but are unsuccessful in obtaining fixed software through their point of sale should acquire upgrades by contacting the Cisco Technical Assistance Center (TAC). TAC contacts are as follows.
- +1 800 553 2447 (toll free from within North America)
- +1 408 526 7209 (toll call from anywhere in the world)
- e-mail: tac@cisco.com
Customers should have their product serial number available and be prepared to give the URL of this notice as evidence of entitlement to a free upgrade. Free upgrades for non-contract customers must be requested through the TAC.
Refer to http://www.cisco.com/warp/public/687/Directory/DirTAC.shtml for additional TAC contact information, including localized telephone numbers, and instructions and e-mail addresses for use in various languages.
Exploitation and Public Announcements
The Cisco PSIRT is not aware of any public announcements or malicious use of the vulnerability described in this advisory.
These vulnerabilities were found internally.
Status of this Notice: FINAL
THIS DOCUMENT IS PROVIDED ON AN "AS IS" BASIS AND DOES NOT IMPLY ANY KIND OF GUARANTEE OR WARRANTY, INCLUDING THE WARRANTIES OF MERCHANTABILITY OR FITNESS FOR A PARTICULAR USE. YOUR USE OF THE INFORMATION ON THE DOCUMENT OR MATERIALS LINKED FROM THE DOCUMENT IS AT YOUR OWN RISK. CISCO RESERVES THE RIGHT TO CHANGE OR UPDATE THIS DOCUMENT AT ANY TIME.
A stand-alone copy or Paraphrase of the text of this document that omits the distribution URL in the following section is an uncontrolled copy, and may lack important information or contain factual errors.
Distribution
This advisory is posted on Cisco's worldwide website at :
http://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml
In addition to worldwide web posting, a text version of this notice is clear-signed with the Cisco PSIRT PGP key and is posted to the following e-mail and Usenet news recipients.
- cust-security-announce@cisco.com
- first-teams@first.org
- bugtraq@securityfocus.com
- vulnwatch@vulnwatch.org
- cisco@spot.colorado.edu
- cisco-nsp@puck.nether.net
- full-disclosure@lists.grok.org.uk
- comp.dcom.sys.cisco@newsgate.cisco.com
Future updates of this advisory, if any, will be placed on Cisco's worldwide website, but may or may not be actively announced on mailing lists or newsgroups. Users concerned about this problem are encouraged to check the above URL for any updates.
Revision History
+---------------------------------------+ | Revision | | Initial | | 1.0 | 2008-Mar-26 | public | | | | release | +---------------------------------------+
Cisco Security Procedures
Complete information on reporting security vulnerabilities in Cisco products, obtaining assistance with security incidents, and registering to receive security information from Cisco, is available on Cisco's worldwide website at http://www.cisco.com/en/US/products/products_security_vulnerability_policy.html. This includes instructions for press inquiries regarding Cisco security notices. All Cisco security advisories are available at http://www.cisco.com/go/psirt. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1.4.8 (Darwin)
iEYEARECAAYFAkfqS64ACgkQ86n/Gc8U/uD2DwCgloXg5P1/99amiSHmfy+hWxw4 j3YAnjEDUj724NtdpJQcDw2Ui4pKwu01 =ufq4 -----END PGP SIGNATURE-----
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-200803-0328",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "ios",
"scope": "eq",
"trust": 2.3,
"vendor": "cisco",
"version": "12.0"
},
{
"model": "ios",
"scope": "eq",
"trust": 1.9,
"vendor": "cisco",
"version": "12.4"
},
{
"model": "ios 12.4",
"scope": "ne",
"trust": 1.8,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "eq",
"trust": 1.3,
"vendor": "cisco",
"version": "12.2"
},
{
"model": "ios",
"scope": "eq",
"trust": 1.3,
"vendor": "cisco",
"version": "12.3"
},
{
"model": "ios",
"scope": "eq",
"trust": 1.3,
"vendor": "cisco",
"version": "12.1"
},
{
"model": "ios",
"scope": "eq",
"trust": 1.0,
"vendor": "cisco",
"version": "12.2yh"
},
{
"model": "ios",
"scope": "eq",
"trust": 1.0,
"vendor": "cisco",
"version": "12.2yd"
},
{
"model": "ios",
"scope": "eq",
"trust": 1.0,
"vendor": "cisco",
"version": "12.2yf"
},
{
"model": "ios",
"scope": "eq",
"trust": 1.0,
"vendor": "cisco",
"version": "12.2yg"
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "lte",
"trust": 0.8,
"vendor": "cisco",
"version": "12.3"
},
{
"model": "ios 12.3b",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4jk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4jx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sb12",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3jec",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yj",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1 ea1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 t7",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1 ye1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 ixf",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 xl2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "eq",
"trust": 0.3,
"vendor": "cisco",
"version": "12.2xv"
},
{
"model": "ios 12.2 sb",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sz",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sl",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1aa",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yh",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zh",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yr",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0s",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xi",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xm",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": "12.4(17)"
},
{
"model": "ios 12.1gb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1da",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xm",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": "12.4(11)xv"
},
{
"model": "ios 12.2uz",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zl",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sra7",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3jl",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3jea",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 md",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 src",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xr",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4jma",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0 xj5",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3ja",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 jk1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0wc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ixa",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 zh6",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 ya8",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 yz3",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xh",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 xg2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sra",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2cx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ay",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xe",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 s15",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sb9",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2by",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xl",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2b",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xu",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 tpc10d",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0 s10",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0 da3",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3jx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xq",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sb10",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ec",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xh",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2svd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xj",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xi",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ze",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2cy",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0da",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xa",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sxa",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sv",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ey",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2src",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xj",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 t10",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ez",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2dd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0st",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3ys",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 xi11",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xl",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 xa7",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sxb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xt",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xm",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sea",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ixb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xp",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2seg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2svc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xu",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 xe6",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2seb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sw10",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 mc2h",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yy",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "eq",
"trust": 0.3,
"vendor": "cisco",
"version": "12.1xx"
},
{
"model": "ios 12.2t",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 t4",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1cx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xh",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2fy",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1yf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yp",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4jmb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2s",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2so",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 xe2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sxf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ixc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1yj",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ixd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "eq",
"trust": 0.3,
"vendor": "cisco",
"version": "12.1xv"
},
{
"model": "ios 12.1ev",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 yj1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2jk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xn",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4jmc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xj",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3jk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3ym",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2bc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xr",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4mr",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sy",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xi",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sec",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xq",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0 xc2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2fz",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1yg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2fx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1yc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xn",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xe",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ez",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ea",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xo",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1 ea11",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "eq",
"trust": 0.3,
"vendor": "cisco",
"version": "12.4xv"
},
{
"model": "ios 12.2ixe",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yt",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2see",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xa",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1db",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sxf13a",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yq",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2dx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0sp",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ex",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xe",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yi",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xq",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xe",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xe",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sxf12a",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xr",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zp",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4t",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yn",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2bw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xn",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xl",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ye",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sxf12",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3va",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1 dc2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xs",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sbc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 ex1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yv",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 yx11",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ga",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sed",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1 ay1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sm",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4md",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2eu",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 bc1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sxh1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1 db1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1eb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 xd10",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0 db",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3bw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1yd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xa",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yz",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ewa",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yt",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2za",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 xn1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3t",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xs",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1 xt2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ja",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xa",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": "12.3(24)"
},
{
"model": "ios 12.2zc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4ja",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xj",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1e",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1yi",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "eq",
"trust": 0.3,
"vendor": "cisco",
"version": "0"
},
{
"model": "ios 12.4xc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xl",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1az",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2da",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xi",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 xr8",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 xb6",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yu",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xs",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sga",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1dc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0sl",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sxh",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1eu",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3jeb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xt",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2mc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0sy",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1yh",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0 s5",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0sz",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3yu",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ya",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xa",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0sc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ey",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3eu",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2su",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sca",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sef",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ew",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sxf13",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xz",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xm",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4sw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2se",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1eo",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": "12.1(5)xv1"
},
{
"model": "ios 12.3yk",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 t2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yh",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xu",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0w",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0 dc",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 zy2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yz",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sxe",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 xc5",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0 w5",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xt",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sv1",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zy",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yo",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 ym12",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ys",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zj",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2mb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ex",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yl",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ew",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0wt",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ax",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xj",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sv",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xh",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1ye",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sva",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xr",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2bz",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sxh2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3xy",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3 ys3",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ym",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xo",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0t",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0 xi2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": "12.3(26)"
},
{
"model": "ios 12.4xf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xq",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2cz",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1yb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1t",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yw",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xn",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sxd",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2xf",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3tpc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yq",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2ya",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 xt2",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3bc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zu",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 sg",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.1xy",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.3ya",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4xy",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2sg",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2srb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.4 xw6",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios",
"scope": "eq",
"trust": 0.3,
"vendor": "cisco",
"version": "12.0xv"
},
{
"model": "ios 12.2xb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0db",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2zb",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0xs",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 zh11",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2 srb3",
"scope": "ne",
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0dc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2tpc",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.2yj",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
},
{
"model": "ios 12.0sx",
"scope": null,
"trust": 0.3,
"vendor": "cisco",
"version": null
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#936177"
},
{
"db": "BID",
"id": "28465"
},
{
"db": "JVNDB",
"id": "JVNDB-2008-001247"
},
{
"db": "CNNVD",
"id": "CNNVD-200803-448"
},
{
"db": "NVD",
"id": "CVE-2008-1152"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:cisco:ios",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2008-001247"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Cisco Security bulletin",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-200803-448"
}
],
"trust": 0.6
},
"cve": "CVE-2008-1152",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "COMPLETE",
"baseScore": 7.8,
"confidentialityImpact": "NONE",
"exploitabilityScore": 10.0,
"id": "CVE-2008-1152",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "HIGH",
"trust": 1.8,
"vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "VULHUB",
"availabilityImpact": "COMPLETE",
"baseScore": 7.8,
"confidentialityImpact": "NONE",
"exploitabilityScore": 10.0,
"id": "VHN-31277",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "HIGH",
"trust": 0.1,
"vectorString": "AV:N/AC:L/AU:N/C:N/I:N/A:C",
"version": "2.0"
}
],
"cvssV3": [],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2008-1152",
"trust": 1.0,
"value": "HIGH"
},
{
"author": "CARNEGIE MELLON",
"id": "VU#936177",
"trust": 0.8,
"value": "10.55"
},
{
"author": "NVD",
"id": "CVE-2008-1152",
"trust": 0.8,
"value": "High"
},
{
"author": "CNNVD",
"id": "CNNVD-200803-448",
"trust": 0.6,
"value": "HIGH"
},
{
"author": "VULHUB",
"id": "VHN-31277",
"trust": 0.1,
"value": "HIGH"
}
]
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#936177"
},
{
"db": "VULHUB",
"id": "VHN-31277"
},
{
"db": "JVNDB",
"id": "JVNDB-2008-001247"
},
{
"db": "CNNVD",
"id": "CNNVD-200803-448"
},
{
"db": "NVD",
"id": "CVE-2008-1152"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets. A vulnerability in the way Cisco IOS handles IPv6 packets could result in a remotely exploitable denial of service. Cisco IOS is prone to multiple remote denial-of-service vulnerabilities because the software fails to properly handle malformed network datagrams. \nSuccessfully exploiting these issues allows remote attackers to trigger memory leaks or crashes in targeted devices. This will lead to denial-of-service conditions. \nThese issues are tracked by Cisco Bug ID CSCsk73104. ----------------------------------------------------------------------\n\nA new version (0.9.0.0 - Release Candidate 1) of the free Secunia PSI\nhas been released. The new version includes many new and advanced\nfeatures, which makes it even easier to stay patched. \n\n1) A memory leak exists in the handling of completed PPTP sessions,\nwhich can be exploited to exhaust memory on an affected system. \n\n2) An error exists in the handling of PPTP sessions when virtual\naccess interfaces are not removed from the interface descriptor block\n(IDB) and are not reused. This can result in an exhaustion of the\ninterface descriptor block (IDB) limit. This can be exploited to\ncause a reload of the system or a memory leak. \n\nSuccessful exploitation of this vulnerability requires that IPv6 and\ncertain IPv4 UDP services are enabled. \n\n5) An error exists in the implementation of Multicast Virtual Private\nNetworks (MVPN), which can be exploited to create extra multicast\nstates on the core routers via specially crafted Multicast\nDistribution Tree (MDT) Data Join messages. This can also be\nexploited to receive multicast traffic from VPNs that are not\nconnected to the same Provider Edge (PE). \n\nSuccessful exploitation of the multicast traffic leak requires that\nthe attacker knows or guesses the Border Gateway Protocol (BGP)\npeering IP address of a remote PE router and the address of the\nmulticast group that is used in other MPLS VPNs. \n\nSOLUTION:\nUpdate to the fixed version (please see the vendor\u0027s advisories for\ndetails). \n\nPROVIDED AND/OR DISCOVERED BY:\n1, 2) The vendor credits Martin Kluge of Elxsi Security. \n5) The vendor credits Thomas Morin. \n\nORIGINAL ADVISORY:\nCisco:\nhttp://www.cisco.com/warp/public/707/cisco-sa-20080326-pptp.shtml\nhttp://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml\nhttp://www.cisco.com/warp/public/707/cisco-sa-20080326-IPv4IPv6.shtml\nhttp://www.cisco.com/warp/public/707/cisco-sa-20080326-mvpn.shtml\n\nOTHER REFERENCES:\nUS-CERT VU#936177:\nhttp://www.kb.cert.org/vuls/id/936177\n\n----------------------------------------------------------------------\n\nAbout:\nThis Advisory was delivered by Secunia as a free service to help\neverybody keeping their systems up to date against the latest\nvulnerabilities. \n\nSubscribe:\nhttp://secunia.com/secunia_security_advisories/\n\nDefinitions: (Criticality, Where etc.)\nhttp://secunia.com/about_secunia_advisories/\n\n\nPlease Note:\nSecunia recommends that you verify all advisories you receive by\nclicking the link. \nSecunia NEVER sends attached files with advisories. \nSecunia does not advise people to install third party patches, only\nuse those supplied by the vendor. Attackers could\n exploit these vulnerabilities to access sensitive information\n or cause a denial of service. \n\n\nI. Further details are available in the US-CERT\n Vulnerability Notes Database. \n\n\nII. Potential consequences\n include disclosure of sensitive information and denial of service. \n\n\nIII. \n\n\nIV. Please send\n email to \u003ccert@cert.org\u003e with \"TA08-087B Feedback VU#936177\" in the\n subject. \n ____________________________________________________________________\n\n For instructions on subscribing to or unsubscribing from this\n mailing list, visit \u003chttp://www.us-cert.gov/cas/signup.html\u003e. \n ____________________________________________________________________\n\n Produced 2008 by US-CERT, a government organization. \n\nCisco has released free software updates that address these\nvulnerabilities. Workarounds are available to mitigate the effects of\nthese vulnerabilities. \n\nThis advisory is posted at \nhttp://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml\n\nNote: The March 26, 2008 publication includes five Security\nAdvisories. The Advisories all affect Cisco\u0027s Internetwork Operating\nSystem (IOS). Each Advisory lists the releases that correct the\nvulnerability described in the Advisory, and the Advisories also\ndetail the releases that correct the vulnerabilities in all five\nAdvisories. Please reference the following software table to find a\nrelease which fixes all published Security Advisories as of March\n26th, 2008. \n\n * March 26th bundled IOS Advisory Table\n http://www.cisco.com/warp/public/707/cisco-sa-20080326-bundle.shtml\n\nIndividual publication links are listed below:\n\n * Cisco IOS Virtual Private Dial-up Network Denial of Service\n Vulnerability\n http://www.cisco.com/warp/public/707/cisco-sa-20080326-pptp.shtml\n \n * Multiple DLSw Denial of Service Vulnerabilities in Cisco IOS\n http://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml\n \n * Cisco IOS User Datagram Protocol Delivery Issue For IPv4/IPv6\n Dual-stack Routers\n http://www.cisco.com/warp/public/707/cisco-sa-20080326-IPv4IPv6.shtml\n \n * Vulnerability in Cisco IOS with OSPF, MPLS VPN, and Supervisor\n 32, Supervisor 720, or Route Switch Processor 720\n http://www.cisco.com/warp/public/707/cisco-sa-20080326-queue.shtml\n \n * Cisco IOS Multicast Virtual Private Network (MVPN) Data Leak\n http://www.cisco.com/warp/public/707/cisco-sa-20080326-mvpn.shtml\n\nAffected Products\n=================\n\nVulnerable Products\n+------------------\n\nThis security advisory applies to all Cisco products that run any\nversion of affected Cisco IOS software configured for DLSw. Systems\nthat contain the DLSw feature, but do not have it enabled, are not\naffected. \n\nRouters enabled for DLSw contain a line in the configuration defining\na local DLSw peer. This configuration can be observed by issuing the\ncommand \"show running-config\". Systems configured for DLSw contain\nlines similar to the following:\n\n \"dlsw local-peer\"\n\nor\n\n \"dlsw local-peer peer-id \u003cIP address\u003e\"\n\nAny version of Cisco IOS prior to the versions which are listed in\nthe Software Versions and Fixes section below is vulnerable. \n\nTo determine the version of Cisco IOS software running on a Cisco\nproduct, log in to the device and issue the show version command to\ndisplay the system banner. Cisco IOS Software will identify itself as\n\"Internetwork Operating System Software\" or simply \"IOS\". On the next\nline of output, the image name will be displayed between parentheses,\nfollowed by \"Version\" and the IOS release name. Other Cisco devices\nwill not have the \"show version\" command or will give different \noutput. \n\nThe following example identifies a Cisco product running Cisco IOS\nSoftware Release 12.3(6) with an installed image name of C3640-IS-M:\n\n Cisco Internetwork Operating System Software\n IOS (tm) 3600 Software (C3640-IS-M), Version 12.3(6), RELEASE SOFTWARE (fc3)\n\nThe next example shows a product running Cisco IOS Software Release\n12.3(11)T3 with an image name of C3845-ADVIPSERVICESK9-M:\n\n Cisco IOS Software, 3800 Software (C3845-ADVIPSERVICESK9-M), Version 12.3(11)T3, RELEASE SOFTWARE (fc4)\n Technical Support: http://www.cisco.com/techsupport\n Copyright (c) 1986-2005 by Cisco Systems, Inc. \n\nAdditional information about Cisco IOS release naming can be found at\nhttp://www.cisco.com/warp/public/620/1.html. \n\nProducts Confirmed Not Vulnerable\n+--------------------------------\n\nCisco IOS devices that are not configured for DLSw are not\nvulnerable. \n\nNo other Cisco products are currently known to be affected by these\nvulnerabilities. \n\nDetails\n=======\n\nData-link switching (DLSw) provides a means of transporting IBM\nSystems Network Architecture (SNA) and network basic input/output\nsystem (NetBIOS) traffic over an IP network. Cisco implementation of\nDLSw also uses UDP port 2067 and IP Protocol 91 for Fast Sequenced\nTransport (FST). These vulnerabilities do not affect TCP\npacket processing. A successful exploitation may result in a reload\nof the system or a memory leak on the device, leading to a denial of\nservice (DoS) condition. \n\nCisco IOS devices configured for DLSw with \"dlsw local-peer\"\nautomatically listen for IP protocol 91 packets. \n\nCisco IOS devices listen to IP protocol 91 packets when DLSw is\nconfigured. However, it is only used if DLSw is configured for Fast\nSequenced Transport (FST). A DLSw FST peer configuration will contain\nthe following line:\n\n \"dlsw remote-peer 0 fst \u003cip-address\u003e\"\n\nIt is possible to disable UDP processing in DLSw with the \"dlsw\nudp-disable\" command. However, disabling UDP only prevents the \nsending of UDP packets, it does not prevent the device from receiving\nand processing incoming UDP packets. \n\nVulnerability Scoring Details\n=============================\n\nCisco has provided scores for the vulnerabilities in this advisory\nbased on the Common Vulnerability Scoring System (CVSS). The CVSS\nscoring in this Security Advisory is done in accordance with CVSS\nversion 2.0. \n\nCVSS is a standards-based scoring method that conveys vulnerability\nseverity and helps determine urgency and priority of response. \n\nCisco has provided a base and temporal score. Customers can then\ncompute environmental scores to assist in determining the impact of\nthe vulnerability in individual networks. \n\nCisco has provided an FAQ to answer additional questions regarding\nCVSS at\nhttp://www.cisco.com/web/about/security/intelligence/cvss-qandas.html\n\nCisco has also provided a CVSS calculator to help compute the\nenvironmental impact for individual networks at\nhttp://intellishield.cisco.com/security/alertmanager/cvss \n\nCSCsk73104 - Handling of malformed packets by DLSW\n\n CVSS Base Score - 7.8\n\n Access Vector: Network\n Access Complexity: Low\n Authentication: None\n\n Confidentiality Impact: None\n Integrity Impact: None\n Availability Impact: Complete\n\n CVSS Temporal Score - 6.4\n\n Exploitability: Functional\n Remediation Level: Official-Fix\n Report Confidence: Confirmed\n\nImpact\n======\n\nSuccessful exploitation of these vulnerabilities may result in the\nreload of the device or memory leaks, leading to a DoS condition. \n\nSoftware Versions and Fixes\n===========================\n\nWhen considering software upgrades, also consult \nhttp://www.cisco.com/go/psirt and any subsequent advisories to \ndetermine exposure and a complete upgrade solution. \n\nIn all cases, customers should exercise caution to be certain the\ndevices to be upgraded contain sufficient memory and that current\nhardware and software configurations will continue to be supported\nproperly by the new release. If the information is not clear, contact\nthe Cisco Technical Assistance Center (TAC) or your contracted\nmaintenance provider for assistance. \n\nEach row of the Cisco IOS software table (below) names a Cisco IOS\nrelease train. If a given release train is vulnerable, then the\nearliest possible releases that contain the fix (along with the\nanticipated date of availability for each, if applicable) are listed\nin the \"First Fixed Release\" column of the table. The \"Recommended\nRelease\" column indicates the releases which have fixes for all the\npublished vulnerabilities at the time of this Advisory. A device\nrunning a release in the given train that is earlier than the release\nin a specific column (less than the First Fixed Release) is known to\nbe vulnerable. Cisco recommends upgrading to a release equal to or\nlater than the release in the \"Recommended Releases\" column of the\ntable. \n\n+----------------------------------------+\n| Major | Availability of Repaired |\n| Release | Releases |\n|------------+---------------------------|\n| Affected | First Fixed | Recommended |\n| 12.0-Based | Release | Release |\n| Releases | | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0 | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.0(8)DA3 | |\n| | are | |\n| | vulnerable, | |\n| | release | |\n| 12.0DA | 12.0(8)DA3 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | migrate to | |\n| | any release | |\n| | in 12.2DA | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.0(7)DB | |\n| | are | |\n| | vulnerable, | |\n| 12.0DB | release | 12.4(18a) |\n| | 12.0(7)DB | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.0(7)DC | |\n| | are | |\n| | vulnerable, | |\n| 12.0DC | release | 12.4(18a) |\n| | 12.0(7)DC | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.0(17)S5 | |\n| | are | |\n| 12.0S | vulnerable, | 12.0(32)S10 |\n| | release | |\n| | 12.0(17)S5 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n|------------+-------------+-------------|\n| 12.0SC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.0SL | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.0SP | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.0ST | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.0SX | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.0SY | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.0SZ | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0T | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.0W | Vulnerable; | 12.0(3c)W5 |\n| | contact TAC | (8) |\n|------------+-------------+-------------|\n| 12.0WC | Vulnerable; | |\n| | contact TAC | |\n|------------+-------------+-------------|\n| 12.0WT | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0XA | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.0XB | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.0(2)XC2 | |\n| | are | |\n| | vulnerable, | |\n| 12.0XC | release | 12.3(26) |\n| | 12.0(2)XC2 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0XD | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0XE | first fixed | |\n| | in 12.1E | |\n|------------+-------------+-------------|\n| 12.0XF | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0XG | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0XH | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.0(4)XI2 | |\n| | are | |\n| | vulnerable, | |\n| 12.0XI | release | 12.3(26) |\n| | 12.0(4)XI2 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.0(4)XJ5 | |\n| | are | |\n| | vulnerable, | |\n| 12.0XJ | release | 12.3(26) |\n| | 12.0(4)XJ5 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0XK | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.0XL | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.0XM | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0XN | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0XQ | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.0XR | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.0XS | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.0XV | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.0XW | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| Affected | First Fixed | Recommended |\n| 12.1-Based | Release | Release |\n| Releases | | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1 | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1AA | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1AX | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.1(22)AY1 | |\n| | are | |\n| 12.1AY | vulnerable, | 12.1(22) |\n| | release | EA11 |\n| | 12.1(22)AY1 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n|------------+-------------+-------------|\n| 12.1AZ | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1CX | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1DA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.1(4)DB1 | |\n| | are | |\n| | vulnerable, | |\n| 12.1DB | release | 12.4(18a) |\n| | 12.1(4)DB1 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.1(4)DC2 | |\n| | are | |\n| | vulnerable, | |\n| 12.1DC | release | 12.4(18a) |\n| | 12.1(4)DC2 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| 12.1E | 12.1(27b)E4 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.1(11)EA1 | |\n| | are | |\n| 12.1EA | vulnerable, | 12.1(22) |\n| | release | EA11 |\n| | 12.1(11)EA1 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n|------------+-------------+-------------|\n| 12.1EB | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1EC | migrate to | 12.3(23)BC1 |\n| | any release | |\n| | in 12.2BC | |\n|------------+-------------+-------------|\n| 12.1EO | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1EU | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1EV | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1EW | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1EX | first fixed | |\n| | in 12.1E | |\n|------------+-------------+-------------|\n| 12.1EY | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1EZ | first fixed | |\n| | in 12.1E | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1GA | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1GB | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1T | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XA | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1XB | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XC | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XD | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1XE | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1XF | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XG | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XH | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XI | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XJ | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1XK | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1XL | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XM | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1XN | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1XO | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XP | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XQ | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1XR | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XS | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.1(3)XT2 | |\n| | are | |\n| | vulnerable, | |\n| 12.1XT | release | 12.3(26) |\n| | 12.1(3)XT2 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1XU | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.1(5)XV1 | |\n| | are | |\n| | vulnerable, | |\n| 12.1XV | release | 12.3(26) |\n| | 12.1(5)XV1 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XW | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XX | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XY | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1XZ | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1YA | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1YB | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1YC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1YD | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.1(5)YE1 | |\n| | are | |\n| | vulnerable, | |\n| 12.1YE | release | 12.3(26) |\n| | 12.1(5)YE1 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1YF | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1YG | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.1YH | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.1YI | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.1YJ | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| Affected | First Fixed | Recommended |\n| 12.2-Based | Release | Release |\n| Releases | | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2 | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2B | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| 12.2BC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2BW | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2BY | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| 12.2BZ | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2CX | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2CY | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2CZ | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2DA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2DD | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2DX | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| 12.2EU | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2EW | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2EWA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2EX | migrate to | 12.2(40)EX1 |\n| | any release | |\n| | in 12.2SEA | |\n|------------+-------------+-------------|\n| 12.2EY | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2EZ | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2FX | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2FY | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2FZ | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2IXA | Vulnerable; | |\n| | contact TAC | |\n|------------+-------------+-------------|\n| 12.2IXB | Vulnerable; | |\n| | contact TAC | |\n|------------+-------------+-------------|\n| 12.2IXC | Vulnerable; | |\n| | contact TAC | |\n|------------+-------------+-------------|\n| 12.2IXD | Vulnerable; | |\n| | contact TAC | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(18) |\n| | migrate to | IXF; |\n| 12.2IXE | any release | Available |\n| | in 12.2IXF | on |\n| | | 31-MAR-08 |\n|------------+-------------+-------------|\n| 12.2JA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2JK | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2MB | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2MC | 12.2(15) | 12.4(18a) |\n| | MC2h | |\n|------------+-------------+-------------|\n| 12.2S | 12.2(25)S15 | 12.2(25)S15 |\n|------------+-------------+-------------|\n| | 12.2(28) | |\n| | SB10 | |\n| | | |\n| | 12.2(31)SB9 | 12.2(28) |\n| 12.2SB | | SB12 |\n| | 12.2(33)SB; | |\n| | Available | |\n| | on | |\n| | 31-MAR-08 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| | first fixed | |\n| | in 12.2SB | |\n| | | |\n| 12.2SBC | Vulnerable; | 12.2(28) |\n| | first fixed | SB12 |\n| | in 12.2SB; | |\n| | Available | |\n| | on | |\n| | 31-MAR-08 | |\n|------------+-------------+-------------|\n| 12.2SCA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SE | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SEA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SEB | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SEC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SED | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SEE | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SEF | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SEG | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SG | 12.2(44)SG | 12.2(44)SG |\n|------------+-------------+-------------|\n| 12.2SGA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SL | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SM | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SO | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SRA | 12.2(33) | 12.2(33) |\n| | SRA6 | SRA7 |\n|------------+-------------+-------------|\n| | 12.2(33) | 12.2(33) |\n| | SRB3; | SRB3; |\n| 12.2SRB | Available | Available |\n| | on | on |\n| | 31-MAR-08 | 31-MAR-08 |\n|------------+-------------+-------------|\n| 12.2SRC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2SU | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.2(29a) | |\n| | SV1 are | |\n| | vulnerable, | |\n| | release | |\n| 12.2SV | 12.2(29a) | 12.2(29b)SV |\n| | SV1 and | |\n| | later are | |\n| | not | |\n| | vulnerable; | |\n| | migrate to | |\n| | any release | |\n| | in 12.2SVA | |\n|------------+-------------+-------------|\n| 12.2SVA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SVC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2SVD | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.2(25) | |\n| | SW10 are | |\n| | vulnerable, | |\n| 12.2SW | release | |\n| | 12.2(25) | |\n| | SW10 and | |\n| | later are | |\n| | not | |\n| | vulnerable; | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(18) |\n| 12.2SX | first fixed | SXF13 |\n| | in 12.2SXF | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(18) |\n| 12.2SXA | first fixed | SXF13 |\n| | in 12.2SXF | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(18) |\n| 12.2SXB | first fixed | SXF13 |\n| | in 12.2SXF | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(18) |\n| 12.2SXD | first fixed | SXF13 |\n| | in 12.2SXF | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(18) |\n| 12.2SXE | first fixed | SXF13 |\n| | in 12.2SXF | |\n|------------+-------------+-------------|\n| | 12.2(18) | |\n| | SXF12 | |\n| | | |\n| 12.2SXF | 12.2(18) | 12.2(18) |\n| | SXF12a | SXF13 |\n| | | |\n| | 12.2(18) | |\n| | SXF13a | |\n|------------+-------------+-------------|\n| 12.2SXH | 12.2(33) | |\n| | SXH1 | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(18) |\n| 12.2SY | first fixed | SXF13 |\n| | in 12.2SXF | |\n|------------+-------------+-------------|\n| | | 12.2(25)S15 |\n| | Vulnerable; | |\n| 12.2SZ | first fixed | 12.2(28) |\n| | in 12.2S | SB12 |\n| | | |\n| | | 12.2(33)SRC |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2T | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.2TPC | 12.2(8) | |\n| | TPC10d | |\n|------------+-------------+-------------|\n| 12.2UZ | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XA | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XB | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XC | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XD | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.2XE | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2XF | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XG | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XH | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.2XI | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XJ | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XK | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XL | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XM | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.2XN | 12.2(33)XN1 | 12.3(26) |\n|------------+-------------+-------------|\n| 12.2XO | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XQ | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.2XR | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2XS | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XT | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XU | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XV | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2XW | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.2(4)YA8 | |\n| | are | |\n| | vulnerable, | |\n| 12.2YA | release | 12.3(26) |\n| | 12.2(4)YA8 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YB | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YC | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YD | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | | 12.2(25)S15 |\n| | Vulnerable; | |\n| 12.2YE | first fixed | 12.2(28) |\n| | in 12.2S | SB12 |\n| | | |\n| | | 12.2(33)SRC |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YF | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.2YG | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YH | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.2(8)YJ1 | |\n| | are | |\n| | vulnerable, | |\n| 12.2YJ | release | 12.3(26) |\n| | 12.2(8)YJ1 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| 12.2YK | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YL | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YM | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YN | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(18) |\n| 12.2YO | first fixed | SXF13 |\n| | in 12.2SXF | |\n|------------+-------------+-------------|\n| 12.2YP | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2YQ | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2YR | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2YS | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YT | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YU | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.2(11)YV1 | |\n| | are | |\n| | vulnerable, | |\n| 12.2YV | release | 12.4(18a) |\n| | 12.2(11)YV1 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YW | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YX | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2YY | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | | 12.2(25)S15 |\n| | Vulnerable; | |\n| 12.2YZ | first fixed | 12.2(28) |\n| | in 12.2S | SB12 |\n| | | |\n| | | 12.2(33)SRC |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(18) |\n| 12.2ZA | first fixed | SXF13 |\n| | in 12.2SXF | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2ZB | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| 12.2ZC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.2ZD | Vulnerable; | |\n| | contact TAC | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2ZE | first fixed | 12.3(26) |\n| | in 12.3 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2ZF | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| 12.2ZG | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.2(13)ZH6 | |\n| | are | |\n| | vulnerable, | |\n| 12.2ZH | release | 12.2(13) |\n| | 12.2(13)ZH6 | ZH11 |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n| | first fixed | |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.2ZJ | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.4(15)T4 |\n| 12.2ZL | first fixed | |\n| | in 12.4 | 12.4(18a) |\n|------------+-------------+-------------|\n| 12.2ZP | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.2(33) |\n| 12.2ZU | first fixed | SXH2 |\n| | in 12.2SXH | |\n|------------+-------------+-------------|\n| 12.2ZY | 12.2(18)ZY2 | 12.2(18)ZY2 |\n|------------+-------------+-------------|\n| Affected | First Fixed | Recommended |\n| 12.3-Based | Release | Release |\n| Releases | | |\n|------------+-------------+-------------|\n| 12.3 | 12.3(24) | 12.3(26) |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3B | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| 12.3BC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3BW | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| 12.3EU | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.3JA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.3JEA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.3JEB | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.3JEC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Releases | |\n| | prior to | |\n| | 12.3(8)JK1 | |\n| | are | |\n| 12.3JK | vulnerable, | 12.3(8)JK1 |\n| | release | |\n| | 12.3(8)JK1 | |\n| | and later | |\n| | are not | |\n| | vulnerable; | |\n|------------+-------------+-------------|\n| 12.3JL | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.3JX | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3T | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| 12.3TPC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.3VA | Vulnerable; | |\n| | contact TAC | |\n|------------+-------------+-------------|\n| | 12.3(2)XA7; | 12.3(2)XA7; |\n| 12.3XA | Available | Available |\n| | on | on |\n| | 31-MAR-08 | 31-MAR-08 |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3XB | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | | 12.4(15)T4 |\n| 12.3XC | 12.3(2)XC5 | |\n| | | 12.4(18a) |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3XD | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | 12.3(2)XE6; | 12.4(15)T4 |\n| 12.3XE | Available | |\n| | on | 12.4(18a) |\n| | 31-MAR-08 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3XF | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| | first fixed | 12.4(15)T4 |\n| 12.3XG | in 12.3YG; | |\n| | Available | 12.4(18a) |\n| | on | |\n| | 16-JUN-08 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3XH | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | 12.3(7) | |\n| | XI11; | |\n| 12.3XI | Available | |\n| | on | |\n| | 18-SEP-08 | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.3(14) |\n| 12.3XJ | first fixed | YX11 |\n| | in 12.3YX | |\n| | | 12.4(15)T4 |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3XK | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3XQ | first fixed | 12.4(18a) |\n| | in 12.4 | |\n|------------+-------------+-------------|\n| | 12.3(7)XR8; | 12.3(7)XR8; |\n| 12.3XR | Available | Available |\n| | on | on |\n| | 31-MAR-08 | 31-MAR-08 |\n|------------+-------------+-------------|\n| 12.3XS | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3XU | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.3(14) |\n| 12.3XW | first fixed | YX11 |\n| | in 12.3YX | |\n| | | 12.4(15)T4 |\n|------------+-------------+-------------|\n| 12.3XY | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.3YA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.3YD | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | Vulnerable; | 12.3(14) |\n| 12.3YF | first fixed | YX11 |\n| | in 12.3YX | |\n| | | 12.4(15)T4 |\n|------------+-------------+-------------|\n| | 12.3(8)YG7; | |\n| 12.3YG | Available | 12.4(15)T4 |\n| | on | |\n| | 16-JUN-08 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3YH | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3YI | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3YJ | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3YK | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| 12.3YM | 12.3(14) | 12.3(14) |\n| | YM12 | YM12 |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3YQ | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| | 12.3(11) | |\n| | YS3; | |\n| 12.3YS | Available | 12.4(15)T4 |\n| | on | |\n| | 31-MAR-08 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3YT | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.3YU | first fixed | |\n| | in 12.4XB | |\n|------------+-------------+-------------|\n| 12.3YX | 12.3(14) | 12.3(14) |\n| | YX11 | YX11 |\n|------------+-------------+-------------|\n| 12.3YZ | 12.3(11)YZ3 | |\n|------------+-------------+-------------|\n| Affected | First Fixed | Recommended |\n| 12.4-Based | Release | Release |\n| Releases | | |\n|------------+-------------+-------------|\n| | 12.4(10c) | |\n| | | |\n| | 12.4(13e) | |\n| | | |\n| | 12.4(16b) | |\n| 12.4 | | 12.4(18a) |\n| | 12.4(17) | |\n| | | |\n| | 12.4(3h) | |\n| | | |\n| | 12.4(8d) | |\n|------------+-------------+-------------|\n| 12.4JA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.4JK | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.4JMA | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.4JMB | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.4JMC | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.4JX | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| | 12.4(15)MD; | |\n| 12.4MD | Available | |\n| | on | |\n| | 09-MAY-08 | |\n|------------+-------------+-------------|\n| 12.4MR | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.4SW | Vulnerable; | |\n| | contact TAC | |\n|------------+-------------+-------------|\n| | 12.4(15)T2 | |\n| | | |\n| 12.4T | 12.4(6)T10 | 12.4(15)T4 |\n| | | |\n| | 12.4(9)T7 | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.4XA | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| 12.4XB | 12.4(2)XB6 | |\n|------------+-------------+-------------|\n| 12.4XC | Vulnerable; | |\n| | contact TAC | |\n|------------+-------------+-------------|\n| 12.4XD | 12.4(4)XD10 | 12.4(4)XD10 |\n|------------+-------------+-------------|\n| 12.4XE | 12.4(6)XE2 | 12.4(15)T4 |\n|------------+-------------+-------------|\n| 12.4XF | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.4XG | 12.4(9)XG2 | 12.4(9)XG2 |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.4XJ | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| | Vulnerable; | |\n| 12.4XK | first fixed | 12.4(15)T4 |\n| | in 12.4T | |\n|------------+-------------+-------------|\n| 12.4XL | 12.4(15)XL2 | |\n|------------+-------------+-------------|\n| 12.4XM | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.4XN | Not | |\n| | Vulnerable | |\n|------------+-------------+-------------|\n| 12.4XT | 12.4(6)XT2 | 12.4(6)XT2 |\n|------------+-------------+-------------|\n| 12.4XV | 12.4(11)XV | |\n|------------+-------------+-------------|\n| 12.4XW | Vulnerable; | 12.4(11)XW6 |\n| | contact TAC | |\n|------------+-------------+-------------|\n| 12.4XY | Not | |\n| | Vulnerable | |\n+----------------------------------------+\n\nA special patch for Cisco IOS Software Modularity is also available\nand can be downloaded from the Cisco IOS Software Modularity Patch\nNavigator at http://tools.cisco.com/swdf/ionpn/jsp/main.jsp. \n\nWorkarounds\n===========\n\nThe workaround consists of filtering UDP packets to port 2067 and IP\nprotocol 91 packets. Filters can be applied at network boundaries to\nfilter all IP protocol 91 packets and UDP packets to port 2067 or can\nbe applied on individual affected devices to permit such traffic only\nfrom trusted peer IP addresses. However, since both of the protocols\nare connectionless, it is possible for an attacker to spoof malformed\npackets from legitimate peer IP addresses. \n\nAs soon as DLSw is configured, the Cisco IOS device begins listening\non IP protocol 91. However, this protocol is only used if DLSw is\nconfigured for Fast Sequenced Transport (FST). A DLSw FST peer\nconfiguration will contain the following line:\n\n \"dlsw remote-peer 0 fst \u003cip-address\u003e\"\n\nIf FST is used, filtering IP protocol 91 will break the operation, so\nfilters need to permit protocol 91 traffic from legitimate peer IP\naddresses. \n\nIt is possible to disable UDP processing in DLSw with the \"dlsw\nudp-disable\" command. However, disabling UDP only prevents the sending\nof UDP packets, it does not prevent the receiving and processing of\nincoming UDP packets. To protect a vulnerable device from malicious\npackets via UDP port 2067, both of the following actions must be\ntaken:\n\n 1. Disable UDP outgoing packets with the \"dlsw udp-disable\" command,\n AND\n 2. Filter UDP 2067 in the vulnerable device using infrastructure\n ACL. \n\nAdditional mitigation techniques that can be deployed on Cisco\ndevices within the network are available in the Cisco Applied\nMitigation Bulletin companion document for this advisory:\n\nhttp://www.cisco.com/warp/public/707/cisco-amb-20080326-dlsw.shtml\n\nUsing Control Plane Policing on Affected Devices\n+-----------------------------------------------\n\nControl Plane Policing (CoPP) can be used to block untrusted DLSw\ntraffic to the device. Cisco IOS software releases 12.0S, 12.2SX,\n12.2S, 12.3T, 12.4, and 12.4T support the CoPP feature. CoPP may be\nconfigured on a device to protect the management and control planes\nto minimize the risk and effectiveness of direct infrastructure\nattacks by explicitly permitting only authorized traffic sent to\ninfrastructure devices in accordance with existing security policies\nand configurations. The following example, which uses 192.168.100.1\nto represent a trusted host, can be adapted to your network. If FST\nis not used, protocol 91 may be completely filtered. Additionally, if\nUDP is disabled with the \"dlsw udp-disable\" command, UDP port 2067 \nmay also be completely filtered. \n\n \n !--- Deny DLSw traffic from trusted hosts to all IP addresses\n !--- configured on all interfaces of the affected device so that\n !--- it will be allowed by the CoPP feature\n \n access-list 111 deny udp host 192.168.100.1 any eq 2067\n access-list 111 deny 91 host 192.168.100.1 any\n \n !--- Permit all other DLSw traffic sent to all IP addresses\n !--- configured on all interfaces of the affected device so that it\n !--- will be policed and dropped by the CoPP feature\n \n access-list 111 permit udp any any eq 2067\n access-list 111 permit 91 any any \n \n !--- Permit (Police or Drop)/Deny (Allow) all other Layer 3 and Layer 4\n !--- traffic in accordance with existing security policies and\n !--- configurations for traffic that is authorized to be sent\n !--- to infrastructure devices\n !--- Create a Class-Map for traffic to be policed by\n !--- the CoPP feature\n \n class-map match-all drop-DLSw-class\n match access-group 111\n \n !--- Create a Policy-Map that will be applied to the\n !--- Control-Plane of the device. \n \n policy-map drop-DLSw-traffic\n class drop-DLSw-class\n drop\n \n !--- Apply the Policy-Map to the Control-Plane of the\n !--- device\n \n control-plane\n service-policy input drop-DLSw-traffic\n\nIn the above CoPP example, the access control entries (ACEs) which\nmatch the potential exploit packets with the \"permit\" action result\nin these packets being discarded by the policy-map \"drop\" function,\nwhile packets that match the \"deny\" action (not shown) are not\naffected by the policy-map drop function. Please note that in the\nCisco IOS 12.2S and 12.0S trains the policy-map syntax is different:\n\n policy-map drop-DLSw-traffic\n class drop-DLSw-class\n police 32000 1500 1500 conform-action drop exceed-action drop\n\nAdditional information on the configuration and use of the CoPP\nfeature is available at \nhttp://www.cisco.com/en/US/products/ps6642/products_white_paper0900aecd804fa16a.shtml \nand http://www.cisco.com/en/US/products/sw/iosswrel/ps1838/products_feature_guide09186a008052446b.html. \n\nUsing Infrastructure ACLs at Network Boundary\n+--------------------------------------------\n\nAlthough it is often difficult to block traffic transiting your\nnetwork, it is possible to identify traffic that should never be\nallowed to target your infrastructure devices and block that traffic\nat the border of your network. iACLs are a network security best\npractice and should be considered as a long-term addition to good\nnetwork security as well as a workaround for this specific\nvulnerability. The iACL example shown below should be included as\npart of the deployed infrastructure access-list that will protect all\ndevices with IP addresses in the infrastructure IP address range. If\nFST is not used, protocol 91 may be completely filtered. \nAdditionally, if UDP is disabled with the \"dlsw udp-disable\" command,\nUDP port 2067 may also be completely filtered. \n\n \n !--- Permit DLSw (UDP port 2067 and IP protocol 91) packets\n !--- from trusted hosts destined to infrastructure addresses. \n \n access-list 150 permit udp TRUSTED_HOSTS MASK INFRASTRUCTURE_ADDRESSES MASK eq 2067\n access-list 150 permit 91 TRUSTED_HOSTS MASK INFRASTRUCTURE_ADDRESSES MASK \n \n !--- Deny DLSw (UDP port 2067 and IP protocol 91) packets from \n !--- all other sources destined to infrastructure addresses. \n \n access-list 150 deny udp any INFRASTRUCTURE_ADDRESSES MASK eq 2067\n access-list 150 deny 91 any INFRASTRUCTURE_ADDRESSES MASK\n \n !--- Permit/deny all other Layer 3 and Layer 4 traffic in accordance\n !--- with existing security policies and configurations\n !--- Permit all other traffic to transit the device. \n \n access-list 150 permit ip any any\n interface serial 2/0\n ip access-group 150 in\n\nThe white paper entitled \"Protecting Your Core: Infrastructure\nProtection Access Control Lists\" presents guidelines and recommended\ndeployment techniques for infrastructure protection access lists. \nThis white paper can be obtained at the following link:\n\nhttp://www.cisco.com/en/US/tech/tk648/tk361/technologies_white_paper09186a00801a1a55.shtml\n\nObtaining Fixed Software\n========================\n\nCisco has released free software updates that address these\nvulnerabilities. Prior to deploying software, customers should\nconsult their maintenance provider or check the software for feature\nset compatibility and known issues specific to their environment. \n\nCustomers may only install and expect support for the feature sets\nthey have purchased. By installing, downloading, accessing or\notherwise using such software upgrades, customers agree to be bound\nby the terms of Cisco\u0027s software license terms found at \nhttp://www.cisco.com/en/US/products/prod_warranties_item09186a008088e31f.html\nor as otherwise set forth at Cisco.com Downloads at \nhttp://www.cisco.com/public/sw-center/sw-usingswc.shtml. \n\nDo not contact psirt@cisco.com or security-alert@cisco.com for\nsoftware upgrades. \n\nCustomers with Service Contracts\n+-------------------------------\n\nCustomers with contracts should obtain upgraded software through\ntheir regular update channels. For most customers, this means that\nupgrades should be obtained through the Software Center on Cisco\u0027s\nworldwide website at http://www.cisco.com. \n\nCustomers using Third Party Support Organizations\n+------------------------------------------------\n\nCustomers whose Cisco products are provided or maintained through\nprior or existing agreements with third-party support organizations,\nsuch as Cisco Partners, authorized resellers, or service providers\nshould contact that support organization for guidance and assistance\nwith the appropriate course of action in regards to this advisory. \n\nThe effectiveness of any workaround or fix is dependent on specific\ncustomer situations, such as product mix, network topology, traffic\nbehavior, and organizational mission. Due to the variety of affected\nproducts and releases, customers should consult with their service\nprovider or support organization to ensure any applied workaround or\nfix is the most appropriate for use in the intended network before it\nis deployed. \n\nCustomers without Service Contracts\n+----------------------------------\n\nCustomers who purchase direct from Cisco but do not hold a Cisco\nservice contract, and customers who purchase through third-party\nvendors but are unsuccessful in obtaining fixed software through\ntheir point of sale should acquire upgrades by contacting the Cisco\nTechnical Assistance Center (TAC). TAC contacts are as follows. \n\n * +1 800 553 2447 (toll free from within North America)\n * +1 408 526 7209 (toll call from anywhere in the world)\n * e-mail: tac@cisco.com\n\nCustomers should have their product serial number available and be\nprepared to give the URL of this notice as evidence of entitlement to\na free upgrade. Free upgrades for non-contract customers must be\nrequested through the TAC. \n\nRefer to http://www.cisco.com/warp/public/687/Directory/DirTAC.shtml\nfor additional TAC contact information, including localized telephone\nnumbers, and instructions and e-mail addresses for use in various\nlanguages. \n\nExploitation and Public Announcements\n=====================================\n\nThe Cisco PSIRT is not aware of any public announcements or malicious\nuse of the vulnerability described in this advisory. \n\nThese vulnerabilities were found internally. \n\nStatus of this Notice: FINAL\n============================\n\nTHIS DOCUMENT IS PROVIDED ON AN \"AS IS\" BASIS AND DOES NOT IMPLY ANY\nKIND OF GUARANTEE OR WARRANTY, INCLUDING THE WARRANTIES OF\nMERCHANTABILITY OR FITNESS FOR A PARTICULAR USE. YOUR USE OF THE\nINFORMATION ON THE DOCUMENT OR MATERIALS LINKED FROM THE DOCUMENT IS\nAT YOUR OWN RISK. CISCO RESERVES THE RIGHT TO CHANGE OR UPDATE THIS\nDOCUMENT AT ANY TIME. \n\nA stand-alone copy or Paraphrase of the text of this document that\nomits the distribution URL in the following section is an\nuncontrolled copy, and may lack important information or contain\nfactual errors. \n\nDistribution\n============\n\nThis advisory is posted on Cisco\u0027s worldwide website at :\n\nhttp://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml\n\nIn addition to worldwide web posting, a text version of this notice\nis clear-signed with the Cisco PSIRT PGP key and is posted to the\nfollowing e-mail and Usenet news recipients. \n\n * cust-security-announce@cisco.com\n * first-teams@first.org\n * bugtraq@securityfocus.com\n * vulnwatch@vulnwatch.org\n * cisco@spot.colorado.edu\n * cisco-nsp@puck.nether.net\n * full-disclosure@lists.grok.org.uk\n * comp.dcom.sys.cisco@newsgate.cisco.com\n\nFuture updates of this advisory, if any, will be placed on Cisco\u0027s\nworldwide website, but may or may not be actively announced on\nmailing lists or newsgroups. Users concerned about this problem are\nencouraged to check the above URL for any updates. \n\nRevision History\n================\n\n+---------------------------------------+\n| Revision | | Initial |\n| 1.0 | 2008-Mar-26 | public |\n| | | release |\n+---------------------------------------+\n\nCisco Security Procedures\n=========================\n\nComplete information on reporting security vulnerabilities in Cisco\nproducts, obtaining assistance with security incidents, and\nregistering to receive security information from Cisco, is available\non Cisco\u0027s worldwide website at \nhttp://www.cisco.com/en/US/products/products_security_vulnerability_policy.html. \nThis includes instructions for press inquiries regarding Cisco \nsecurity notices. All Cisco security advisories are available at \nhttp://www.cisco.com/go/psirt. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1.4.8 (Darwin)\n\niEYEARECAAYFAkfqS64ACgkQ86n/Gc8U/uD2DwCgloXg5P1/99amiSHmfy+hWxw4\nj3YAnjEDUj724NtdpJQcDw2Ui4pKwu01\n=ufq4\n-----END PGP SIGNATURE-----\n",
"sources": [
{
"db": "NVD",
"id": "CVE-2008-1152"
},
{
"db": "CERT/CC",
"id": "VU#936177"
},
{
"db": "JVNDB",
"id": "JVNDB-2008-001247"
},
{
"db": "BID",
"id": "28465"
},
{
"db": "VULHUB",
"id": "VHN-31277"
},
{
"db": "PACKETSTORM",
"id": "64964"
},
{
"db": "PACKETSTORM",
"id": "64957"
},
{
"db": "PACKETSTORM",
"id": "64920"
}
],
"trust": 2.97
},
"exploit_availability": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/exploit_availability#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"reference": "https://www.scap.org.cn/vuln/vhn-31277",
"trust": 0.1,
"type": "unknown"
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-31277"
}
]
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2008-1152",
"trust": 2.9
},
{
"db": "BID",
"id": "28465",
"trust": 2.8
},
{
"db": "SECUNIA",
"id": "29507",
"trust": 2.7
},
{
"db": "USCERT",
"id": "TA08-087B",
"trust": 2.6
},
{
"db": "SECTRACK",
"id": "1019712",
"trust": 2.5
},
{
"db": "VUPEN",
"id": "ADV-2008-1006",
"trust": 1.7
},
{
"db": "XF",
"id": "41482",
"trust": 1.4
},
{
"db": "CERT/CC",
"id": "VU#936177",
"trust": 0.9
},
{
"db": "JVNDB",
"id": "JVNDB-2008-001247",
"trust": 0.8
},
{
"db": "CNNVD",
"id": "CNNVD-200803-448",
"trust": 0.7
},
{
"db": "CERT/CC",
"id": "TA08-087B",
"trust": 0.6
},
{
"db": "CISCO",
"id": "20080326 MULTIPLE DLSW DENIAL OF SERVICE VULNERABILITIES IN CISCO IOS",
"trust": 0.6
},
{
"db": "OVAL",
"id": "OVAL:ORG.MITRE.OVAL:DEF:5821",
"trust": 0.6
},
{
"db": "PACKETSTORM",
"id": "64920",
"trust": 0.2
},
{
"db": "VULHUB",
"id": "VHN-31277",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "64964",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "64957",
"trust": 0.1
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#936177"
},
{
"db": "VULHUB",
"id": "VHN-31277"
},
{
"db": "BID",
"id": "28465"
},
{
"db": "JVNDB",
"id": "JVNDB-2008-001247"
},
{
"db": "PACKETSTORM",
"id": "64964"
},
{
"db": "PACKETSTORM",
"id": "64957"
},
{
"db": "PACKETSTORM",
"id": "64920"
},
{
"db": "CNNVD",
"id": "CNNVD-200803-448"
},
{
"db": "NVD",
"id": "CVE-2008-1152"
}
]
},
"id": "VAR-200803-0328",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VULHUB",
"id": "VHN-31277"
}
],
"trust": 0.01
},
"last_update_date": "2025-04-10T21:34:14.960000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "cisco-sa-20080326-dlsw",
"trust": 0.8,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml"
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2008-001247"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-399",
"trust": 1.9
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-31277"
},
{
"db": "JVNDB",
"id": "JVNDB-2008-001247"
},
{
"db": "NVD",
"id": "CVE-2008-1152"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.5,
"url": "http://www.securityfocus.com/bid/28465"
},
{
"trust": 2.5,
"url": "http://www.us-cert.gov/cas/techalerts/ta08-087b.html"
},
{
"trust": 2.5,
"url": "http://www.securitytracker.com/id?1019712"
},
{
"trust": 1.7,
"url": "http://www.cisco.com/en/us/products/products_security_advisory09186a0080969866.shtml"
},
{
"trust": 1.7,
"url": "http://secunia.com/advisories/29507"
},
{
"trust": 1.4,
"url": "http://xforce.iss.net/xforce/xfdb/41482"
},
{
"trust": 1.1,
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3aorg.mitre.oval%3adef%3a5821"
},
{
"trust": 1.1,
"url": "http://www.vupen.com/english/advisories/2008/1006/references"
},
{
"trust": 1.1,
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/41482"
},
{
"trust": 1.0,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-ipv4ipv6.shtml"
},
{
"trust": 0.9,
"url": "http://secunia.com/advisories/29507/"
},
{
"trust": 0.8,
"url": "http://tools.ietf.org/html/rfc2460"
},
{
"trust": 0.8,
"url": "http://en.wikipedia.org/wiki/ipv6"
},
{
"trust": 0.8,
"url": "http://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2008-1152"
},
{
"trust": 0.8,
"url": "http://www.frsirt.com/english/advisories/2008/1006"
},
{
"trust": 0.8,
"url": "http://jvn.jp/cert/jvnta08-087b/index.html"
},
{
"trust": 0.8,
"url": "http://jvn.jp/tr/trta08-087b"
},
{
"trust": 0.8,
"url": "http://nvd.nist.gov/nvd.cfm?cvename=cve-2008-1152"
},
{
"trust": 0.6,
"url": "http://oval.mitre.org/repository/data/getdef?id=oval:org.mitre.oval:def:5821"
},
{
"trust": 0.6,
"url": "http://www.frsirt.com/english/advisories/2008/1006/references"
},
{
"trust": 0.4,
"url": "http://www.cisco.com/warp/public/707/cisco-amb-20080326-dlsw.shtml"
},
{
"trust": 0.3,
"url": "http://www.cisco.com/public/sw-center/sw-ios.shtml"
},
{
"trust": 0.3,
"url": "/archive/1/490107"
},
{
"trust": 0.2,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-mvpn.shtml"
},
{
"trust": 0.2,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-pptp.shtml"
},
{
"trust": 0.2,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml"
},
{
"trust": 0.1,
"url": "http://secunia.com/secunia_security_advisories/"
},
{
"trust": 0.1,
"url": "http://secunia.com/product/50/"
},
{
"trust": 0.1,
"url": "http://secunia.com/about_secunia_advisories/"
},
{
"trust": 0.1,
"url": "https://psi.secunia.com/?page=changelog"
},
{
"trust": 0.1,
"url": "https://psi.secunia.com/"
},
{
"trust": 0.1,
"url": "http://secunia.com/sec_adv_unsubscribe/?email=packet%40packetstormsecurity.org"
},
{
"trust": 0.1,
"url": "http://www.kb.cert.org/vuls/id/936177"
},
{
"trust": 0.1,
"url": "http://secunia.com/product/182/"
},
{
"trust": 0.1,
"url": "http://www.us-cert.gov/cas/signup.html\u003e."
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-queue.shtml\u003e"
},
{
"trust": 0.1,
"url": "http://www.kb.cert.org/vuls/byid?searchview\u0026query=cisco-sa-20080326-bundle\u003e"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml\u003e"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-bundle.shtml\u003e"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-ipv4ipv6.shtml\u003e"
},
{
"trust": 0.1,
"url": "http://www.us-cert.gov/cas/techalerts/ta08-087b.html\u003e"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-pptp.shtml\u003e"
},
{
"trust": 0.1,
"url": "http://www.us-cert.gov/legal.html\u003e"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-mvpn.shtml\u003e"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/en/us/products/sw/iosswrel/ps1838/products_feature_guide09186a008052446b.html."
},
{
"trust": 0.1,
"url": "http://www.cisco.com/go/psirt"
},
{
"trust": 0.1,
"url": "http://tools.cisco.com/swdf/ionpn/jsp/main.jsp."
},
{
"trust": 0.1,
"url": "http://www.cisco.com/en/us/tech/tk648/tk361/technologies_white_paper09186a00801a1a55.shtml"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/en/us/products/prod_warranties_item09186a008088e31f.html"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/en/us/products/products_security_vulnerability_policy.html."
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-queue.shtml"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/web/about/security/intelligence/cvss-qandas.html"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/en/us/products/ps6642/products_white_paper0900aecd804fa16a.shtml"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/go/psirt."
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/620/1.html."
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-bundle.shtml"
},
{
"trust": 0.1,
"url": "http://www.cisco.com."
},
{
"trust": 0.1,
"url": "http://www.cisco.com/public/sw-center/sw-usingswc.shtml."
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2008-1152"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/techsupport"
},
{
"trust": 0.1,
"url": "http://www.cisco.com/warp/public/687/directory/dirtac.shtml"
},
{
"trust": 0.1,
"url": "http://intellishield.cisco.com/security/alertmanager/cvss"
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#936177"
},
{
"db": "VULHUB",
"id": "VHN-31277"
},
{
"db": "BID",
"id": "28465"
},
{
"db": "JVNDB",
"id": "JVNDB-2008-001247"
},
{
"db": "PACKETSTORM",
"id": "64964"
},
{
"db": "PACKETSTORM",
"id": "64957"
},
{
"db": "PACKETSTORM",
"id": "64920"
},
{
"db": "CNNVD",
"id": "CNNVD-200803-448"
},
{
"db": "NVD",
"id": "CVE-2008-1152"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CERT/CC",
"id": "VU#936177"
},
{
"db": "VULHUB",
"id": "VHN-31277"
},
{
"db": "BID",
"id": "28465"
},
{
"db": "JVNDB",
"id": "JVNDB-2008-001247"
},
{
"db": "PACKETSTORM",
"id": "64964"
},
{
"db": "PACKETSTORM",
"id": "64957"
},
{
"db": "PACKETSTORM",
"id": "64920"
},
{
"db": "CNNVD",
"id": "CNNVD-200803-448"
},
{
"db": "NVD",
"id": "CVE-2008-1152"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2008-03-26T00:00:00",
"db": "CERT/CC",
"id": "VU#936177"
},
{
"date": "2008-03-27T00:00:00",
"db": "VULHUB",
"id": "VHN-31277"
},
{
"date": "2008-03-26T00:00:00",
"db": "BID",
"id": "28465"
},
{
"date": "2008-04-18T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2008-001247"
},
{
"date": "2008-03-28T20:26:02",
"db": "PACKETSTORM",
"id": "64964"
},
{
"date": "2008-03-27T21:29:26",
"db": "PACKETSTORM",
"id": "64957"
},
{
"date": "2008-03-26T22:23:13",
"db": "PACKETSTORM",
"id": "64920"
},
{
"date": "2008-03-27T00:00:00",
"db": "CNNVD",
"id": "CNNVD-200803-448"
},
{
"date": "2008-03-27T17:44:00",
"db": "NVD",
"id": "CVE-2008-1152"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2008-03-27T00:00:00",
"db": "CERT/CC",
"id": "VU#936177"
},
{
"date": "2017-09-29T00:00:00",
"db": "VULHUB",
"id": "VHN-31277"
},
{
"date": "2008-04-01T15:59:00",
"db": "BID",
"id": "28465"
},
{
"date": "2008-04-18T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2008-001247"
},
{
"date": "2009-03-04T00:00:00",
"db": "CNNVD",
"id": "CNNVD-200803-448"
},
{
"date": "2025-04-09T00:30:58.490000",
"db": "NVD",
"id": "CVE-2008-1152"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-200803-448"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Cisco IOS denial-of-service vulnerability",
"sources": [
{
"db": "CERT/CC",
"id": "VU#936177"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "resource management error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-200803-448"
}
],
"trust": 0.6
}
}
GHSA-MX4J-M8XG-9RJJ
Vulnerability from github – Published: 2022-05-01 23:37 – Updated: 2022-05-01 23:37The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets.
{
"affected": [],
"aliases": [
"CVE-2008-1152"
],
"database_specific": {
"cwe_ids": [],
"github_reviewed": false,
"github_reviewed_at": null,
"nvd_published_at": "2008-03-27T17:44:00Z",
"severity": "HIGH"
},
"details": "The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets.",
"id": "GHSA-mx4j-m8xg-9rjj",
"modified": "2022-05-01T23:37:14Z",
"published": "2022-05-01T23:37:14Z",
"references": [
{
"type": "ADVISORY",
"url": "https://nvd.nist.gov/vuln/detail/CVE-2008-1152"
},
{
"type": "WEB",
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/41482"
},
{
"type": "WEB",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821"
},
{
"type": "WEB",
"url": "http://secunia.com/advisories/29507"
},
{
"type": "WEB",
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml"
},
{
"type": "WEB",
"url": "http://www.securityfocus.com/bid/28465"
},
{
"type": "WEB",
"url": "http://www.securitytracker.com/id?1019712"
},
{
"type": "WEB",
"url": "http://www.us-cert.gov/cas/techalerts/TA08-087B.html"
},
{
"type": "WEB",
"url": "http://www.vupen.com/english/advisories/2008/1006/references"
}
],
"schema_version": "1.4.0",
"severity": []
}
GSD-2008-1152
Vulnerability from gsd - Updated: 2023-12-13 01:23{
"GSD": {
"alias": "CVE-2008-1152",
"description": "The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets.",
"id": "GSD-2008-1152"
},
"gsd": {
"metadata": {
"exploitCode": "unknown",
"remediation": "unknown",
"reportConfidence": "confirmed",
"type": "vulnerability"
},
"osvSchema": {
"aliases": [
"CVE-2008-1152"
],
"details": "The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets.",
"id": "GSD-2008-1152",
"modified": "2023-12-13T01:23:03.239044Z",
"schema_version": "1.4.0"
}
},
"namespaces": {
"cve.org": {
"CVE_data_meta": {
"ASSIGNER": "psirt@cisco.com",
"ID": "CVE-2008-1152",
"STATE": "PUBLIC"
},
"affects": {
"vendor": {
"vendor_data": [
{
"product": {
"product_data": [
{
"product_name": "n/a",
"version": {
"version_data": [
{
"version_value": "n/a"
}
]
}
}
]
},
"vendor_name": "n/a"
}
]
}
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "eng",
"value": "The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets."
}
]
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "eng",
"value": "n/a"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "ADV-2008-1006",
"refsource": "VUPEN",
"url": "http://www.vupen.com/english/advisories/2008/1006/references"
},
{
"name": "TA08-087B",
"refsource": "CERT",
"url": "http://www.us-cert.gov/cas/techalerts/TA08-087B.html"
},
{
"name": "1019712",
"refsource": "SECTRACK",
"url": "http://www.securitytracker.com/id?1019712"
},
{
"name": "28465",
"refsource": "BID",
"url": "http://www.securityfocus.com/bid/28465"
},
{
"name": "20080326 Multiple DLSw Denial of Service Vulnerabilities in Cisco IOS",
"refsource": "CISCO",
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml"
},
{
"name": "29507",
"refsource": "SECUNIA",
"url": "http://secunia.com/advisories/29507"
},
{
"name": "oval:org.mitre.oval:def:5821",
"refsource": "OVAL",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821"
},
{
"name": "cisco-ios-dlsw-dos(41482)",
"refsource": "XF",
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/41482"
}
]
}
},
"nvd.nist.gov": {
"configurations": {
"CVE_data_version": "4.0",
"nodes": [
{
"children": [],
"cpe_match": [
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:da:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:st:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:sx:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xk:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xl:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xv:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xw:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:d:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:da:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:eu:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ew:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xj:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xk:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xv:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xw:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:yd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ye:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:bw:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:by:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:bz:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ew:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ewa:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ixc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ixd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:se:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sea:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:seb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sga:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sm:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sw:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sxa:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xa:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xi:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xj:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xs:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xt:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yj:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yk:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yr:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ys:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:sl:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:sp:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:wt:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xa:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xh:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xi:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xj:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xr:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xs:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:c:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:cx:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ec:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:eo:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:gb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xa:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xh:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xi:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xs:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xt:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:yb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:yc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:b:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:bc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:dx:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:eu:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ixa:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ixb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sbc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:seg:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sg:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:su:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sv:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:t:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:tpc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:uz:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xg:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xh:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xq:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xr:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ye:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yp:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yq:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yy:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:za:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zj:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zl:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:eu:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:ja:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:s:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:sc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:t:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:wc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xf:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xg:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xo:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xq:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:az:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:b:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:e:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ea:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:eb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ez:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ga:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xf:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xg:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xq:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xr:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xz:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ya:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:yi:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:yj:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:da:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:dd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ez:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:fz:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:mc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:s:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:see:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sef:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:srb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:st:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sy:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sz:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xe:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xf:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xm:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xn:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xw:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ya:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yn:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yo:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yv:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yx:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zg:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zh:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:bc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:bw:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:jx:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:t:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xf:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xg:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xs:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xu:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yh:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yi:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yx:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yz:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:jx:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:md:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xe:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xt:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:db:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:dc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:sy:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:sz:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xe:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xm:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.0:xn:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:aa:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ax:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:db:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:dc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ex:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:ey:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xe:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xl:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xm:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xp:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xx:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:xy:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:yf:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.1:yh:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:cx:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:cy:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ex:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ey:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ja:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:mb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sec:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sed:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:so:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sra:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sxb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:sxd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xk:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xl:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xu:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:xv:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yl:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ym:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yt:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:yu:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:ze:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zf:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:b:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:jec:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:jl:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xe:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xq:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xr:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yf:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yg:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yt:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yu:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:jmb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:jmc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zp:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.2:zy:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:jea:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:jeb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xa:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xb:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xj:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xk:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:ya:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yd:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:ym:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yq:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:ys:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:jk:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:jma:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:t:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xa:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xk:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xl:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:ios:12.0:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:ios:12.2yd:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xv:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:ios:12.2yh:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xm:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xn:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:ios:12.2yf:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:ios:12.2yg:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:tpc:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:va:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xh:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xi:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xw:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:xy:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yj:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.3:yk:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:*:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:ja:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:mr:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:sw:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xf:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xg:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xj:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xw:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
},
{
"cpe23Uri": "cpe:2.3:o:cisco:cisco_ios:12.4:xy:*:*:*:*:*:*",
"cpe_name": [],
"vulnerable": true
}
],
"operator": "OR"
}
]
},
"cve": {
"CVE_data_meta": {
"ASSIGNER": "psirt@cisco.com",
"ID": "CVE-2008-1152"
},
"data_format": "MITRE",
"data_type": "CVE",
"data_version": "4.0",
"description": {
"description_data": [
{
"lang": "en",
"value": "The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets."
}
]
},
"problemtype": {
"problemtype_data": [
{
"description": [
{
"lang": "en",
"value": "CWE-399"
}
]
}
]
},
"references": {
"reference_data": [
{
"name": "20080326 Multiple DLSw Denial of Service Vulnerabilities in Cisco IOS",
"refsource": "CISCO",
"tags": [
"Patch"
],
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml"
},
{
"name": "28465",
"refsource": "BID",
"tags": [],
"url": "http://www.securityfocus.com/bid/28465"
},
{
"name": "TA08-087B",
"refsource": "CERT",
"tags": [
"US Government Resource"
],
"url": "http://www.us-cert.gov/cas/techalerts/TA08-087B.html"
},
{
"name": "1019712",
"refsource": "SECTRACK",
"tags": [],
"url": "http://www.securitytracker.com/id?1019712"
},
{
"name": "29507",
"refsource": "SECUNIA",
"tags": [],
"url": "http://secunia.com/advisories/29507"
},
{
"name": "ADV-2008-1006",
"refsource": "VUPEN",
"tags": [],
"url": "http://www.vupen.com/english/advisories/2008/1006/references"
},
{
"name": "cisco-ios-dlsw-dos(41482)",
"refsource": "XF",
"tags": [],
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/41482"
},
{
"name": "oval:org.mitre.oval:def:5821",
"refsource": "OVAL",
"tags": [],
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821"
}
]
}
},
"impact": {
"baseMetricV2": {
"cvssV2": {
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "NONE",
"availabilityImpact": "COMPLETE",
"baseScore": 7.8,
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
"version": "2.0"
},
"exploitabilityScore": 10.0,
"impactScore": 6.9,
"obtainAllPrivilege": false,
"obtainOtherPrivilege": false,
"obtainUserPrivilege": false,
"severity": "HIGH",
"userInteractionRequired": false
}
},
"lastModifiedDate": "2017-09-29T01:30Z",
"publishedDate": "2008-03-27T17:44Z"
}
}
}
FKIE_CVE-2008-1152
Vulnerability from fkie_nvd - Published: 2008-03-27 17:44 - Updated: 2025-04-09 00:30{
"configurations": [
{
"nodes": [
{
"cpeMatch": [
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:da:*:*:*:*:*:*",
"matchCriteriaId": "225C93BF-8749-46AB-BAE7-9A67C7B99552",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:db:*:*:*:*:*:*",
"matchCriteriaId": "AD6138B2-1F13-4D98-B389-496E1F50FCFB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:dc:*:*:*:*:*:*",
"matchCriteriaId": "33D056B2-CB1C-4287-A3E0-E0F985304969",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:s:*:*:*:*:*:*",
"matchCriteriaId": "A5823F33-7FB3-465B-8017-1866D9EF3AA6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:sc:*:*:*:*:*:*",
"matchCriteriaId": "EB1A7A2E-265F-4322-A6ED-4DD761497D4E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:sl:*:*:*:*:*:*",
"matchCriteriaId": "D2E8E311-8E6C-42FC-A662-799CC78E22FE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:sp:*:*:*:*:*:*",
"matchCriteriaId": "2B02125C-1132-4748-9495-60BACFA2164D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:st:*:*:*:*:*:*",
"matchCriteriaId": "0FE78CB4-3CF1-4F0A-B4CA-6B6E33D1991D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:sx:*:*:*:*:*:*",
"matchCriteriaId": "B6680190-2688-48E2-BE31-A186A82AF79F",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:sy:*:*:*:*:*:*",
"matchCriteriaId": "94870E9E-C883-4051-8854-CDE0AE7A64B6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:sz:*:*:*:*:*:*",
"matchCriteriaId": "BB4F46A5-7561-4C17-BB15-F9A704DB1E66",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:t:*:*:*:*:*:*",
"matchCriteriaId": "ACC2FCAE-6A56-4D45-A35F-CA2C2C7A4372",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:wc:*:*:*:*:*:*",
"matchCriteriaId": "8D10302E-76CE-4D65-9068-2657C1834215",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:wt:*:*:*:*:*:*",
"matchCriteriaId": "48BABA92-17D7-419D-B25D-2DE914F12D91",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xa:*:*:*:*:*:*",
"matchCriteriaId": "607E42A0-D5BA-4B59-812F-44DC970202D4",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xb:*:*:*:*:*:*",
"matchCriteriaId": "AA54B6EB-CA03-4209-ACA6-7AE6455B764A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xc:*:*:*:*:*:*",
"matchCriteriaId": "DC811D5E-A2D1-4098-990F-06DEC9080276",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xd:*:*:*:*:*:*",
"matchCriteriaId": "9C1A32C0-0809-4242-9D23-7F8887D8AFE1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xe:*:*:*:*:*:*",
"matchCriteriaId": "9048DB68-228A-4496-9FEC-514A65130DA0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xf:*:*:*:*:*:*",
"matchCriteriaId": "6D2435B9-EFE4-4CA6-9E55-C9C050D579DA",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xg:*:*:*:*:*:*",
"matchCriteriaId": "2929498A-BB56-48B2-9089-E6B602B81929",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xh:*:*:*:*:*:*",
"matchCriteriaId": "73BA6E1B-B6DC-404A-BF1D-5059EB2F7C16",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xi:*:*:*:*:*:*",
"matchCriteriaId": "B385E45E-FCBD-4574-88FD-E000F320BE6D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xj:*:*:*:*:*:*",
"matchCriteriaId": "2FC95E36-024E-487B-8190-E96745B590EF",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xk:*:*:*:*:*:*",
"matchCriteriaId": "6A006524-45C0-4B11-82A3-0AF69374BD29",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xl:*:*:*:*:*:*",
"matchCriteriaId": "518AAECA-0455-4688-8937-2D4248962C38",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xm:*:*:*:*:*:*",
"matchCriteriaId": "6EE54B6B-99F0-40B2-990C-950E08E05FBB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xn:*:*:*:*:*:*",
"matchCriteriaId": "F740871A-7E8C-4077-8DB0-9D54B18D4037",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xo:*:*:*:*:*:*",
"matchCriteriaId": "7D0B5D1A-016B-4017-B476-F66F6A82ABCE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xq:*:*:*:*:*:*",
"matchCriteriaId": "A7897C03-2EE4-42D5-9A70-9FD9DD025708",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xr:*:*:*:*:*:*",
"matchCriteriaId": "BA0D5F4E-21CC-464C-930A-4DB1C25DDA70",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xs:*:*:*:*:*:*",
"matchCriteriaId": "54348563-5740-4EF0-AADA-B864F3A47277",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xv:*:*:*:*:*:*",
"matchCriteriaId": "A091E988-DA6B-4FC9-9899-86F97AA29C18",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.0:xw:*:*:*:*:*:*",
"matchCriteriaId": "39C863BC-B042-41C7-A15D-4D29CA8933CB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:aa:*:*:*:*:*:*",
"matchCriteriaId": "0AE43587-46FE-4930-84FB-689AFCC122E7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ax:*:*:*:*:*:*",
"matchCriteriaId": "A0D676A9-7110-4446-9503-73BA2A4F49BC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:az:*:*:*:*:*:*",
"matchCriteriaId": "437F70FE-58DD-4F92-8219-4B09AAFA6F85",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:b:*:*:*:*:*:*",
"matchCriteriaId": "EC1D82C4-AA1B-492C-81A7-7D579687C684",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:c:*:*:*:*:*:*",
"matchCriteriaId": "02045A97-7AF6-4308-95A1-F4AC47A75AAB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:cx:*:*:*:*:*:*",
"matchCriteriaId": "0B560BA9-D8EF-4618-A909-1B779829E4DF",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:d:*:*:*:*:*:*",
"matchCriteriaId": "5CB10E53-3177-4502-88DA-CA935403DADA",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:da:*:*:*:*:*:*",
"matchCriteriaId": "A61E033B-EFDD-4ECC-A370-F85A8D8161D8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:db:*:*:*:*:*:*",
"matchCriteriaId": "90F4AB09-46FE-47F7-831D-863F5C296A40",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:dc:*:*:*:*:*:*",
"matchCriteriaId": "22723E8E-18E9-45A4-A216-D7D2B4EC8A93",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:e:*:*:*:*:*:*",
"matchCriteriaId": "85C2FF9C-7730-4DBF-8C86-1EF0F1E71D8C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ea:*:*:*:*:*:*",
"matchCriteriaId": "4B2F42F9-1760-4A97-ADAE-66E5FC0B81FA",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:eb:*:*:*:*:*:*",
"matchCriteriaId": "E92ACC7B-EB0E-4142-8397-3AF58C3E7406",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ec:*:*:*:*:*:*",
"matchCriteriaId": "EAC665EA-CFAF-4F69-B8F6-BBC7D869CA42",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:eo:*:*:*:*:*:*",
"matchCriteriaId": "365D4890-2676-4C0D-9D64-95A07B10DA8C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:eu:*:*:*:*:*:*",
"matchCriteriaId": "1B1705DD-7DA2-4203-96FD-2344BBF99A17",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ew:*:*:*:*:*:*",
"matchCriteriaId": "660ED401-2B7F-477F-99BA-DC553D47A9D1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ex:*:*:*:*:*:*",
"matchCriteriaId": "D5F66FC9-7BBB-460A-9D50-E971F8F489AE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ey:*:*:*:*:*:*",
"matchCriteriaId": "83A2B33B-BD96-42D6-B455-C6877F8C5BF5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ez:*:*:*:*:*:*",
"matchCriteriaId": "946C08B8-DB52-41F0-8963-FD865FDE4462",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ga:*:*:*:*:*:*",
"matchCriteriaId": "F4F4AC3A-F2B8-40FB-A11D-9B2F8F81F699",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:gb:*:*:*:*:*:*",
"matchCriteriaId": "5A7CEA79-0B95-4EA4-B07C-AE93A75BF7A0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xa:*:*:*:*:*:*",
"matchCriteriaId": "F6A42922-F82A-4F7E-AF58-CAC0FD3402BA",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xb:*:*:*:*:*:*",
"matchCriteriaId": "11BD3E2A-45B6-4A50-81C0-5089138434C1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xc:*:*:*:*:*:*",
"matchCriteriaId": "C62A96DA-2A55-4B7B-9D66-19583B4FD63A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xd:*:*:*:*:*:*",
"matchCriteriaId": "DCE34BEA-83F6-4908-A71B-7850D2B964ED",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xe:*:*:*:*:*:*",
"matchCriteriaId": "07B63B0A-1D38-4E5A-8D6E-5DE8F961E0F8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xf:*:*:*:*:*:*",
"matchCriteriaId": "3E856620-FF4D-48B6-BAD6-F85744185593",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xg:*:*:*:*:*:*",
"matchCriteriaId": "6D78F36C-02EF-4839-B361-999F0445F20B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xh:*:*:*:*:*:*",
"matchCriteriaId": "9EEB9ED5-A623-46F0-8386-35DA38BD5FA6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xi:*:*:*:*:*:*",
"matchCriteriaId": "E2F6E880-FDB3-4888-95FC-8709444530E0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xj:*:*:*:*:*:*",
"matchCriteriaId": "27E31864-DE6C-48AF-A7B3-A66F63575ABF",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xk:*:*:*:*:*:*",
"matchCriteriaId": "48572A1B-3696-4C47-9E59-30BC221FDEFC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xl:*:*:*:*:*:*",
"matchCriteriaId": "C1AE04CB-E03D-4C29-A257-BFB9468F86CE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xm:*:*:*:*:*:*",
"matchCriteriaId": "78F6FFF6-F5B9-4539-A189-6EA4C2D122CA",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xp:*:*:*:*:*:*",
"matchCriteriaId": "D8D5EFEF-F27A-429D-B005-BFC8D1D39FA6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xq:*:*:*:*:*:*",
"matchCriteriaId": "D8A3B7BF-D52A-487E-ADCA-C2537CB5F36C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xr:*:*:*:*:*:*",
"matchCriteriaId": "35F77E17-F109-4CB7-8333-E0651FF2B5DE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xs:*:*:*:*:*:*",
"matchCriteriaId": "9AAD994B-C227-4D5A-B21A-51C44EEB4798",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xt:*:*:*:*:*:*",
"matchCriteriaId": "FD3ABECA-25E5-4D10-B319-354F1C202C14",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xv:*:*:*:*:*:*",
"matchCriteriaId": "D50BD3AD-BCDC-4271-BFE1-D81DCE4106BE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xw:*:*:*:*:*:*",
"matchCriteriaId": "91A12162-E442-4FA4-9CCA-67F910582D9A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xx:*:*:*:*:*:*",
"matchCriteriaId": "92EF445D-F19B-44F6-A878-6409D4E28FC2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xy:*:*:*:*:*:*",
"matchCriteriaId": "A0FD7E21-2C42-49B8-98A1-CB2E6DC6B3CB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:xz:*:*:*:*:*:*",
"matchCriteriaId": "05E1A96A-D29D-4D57-B40A-EB12A40116A8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ya:*:*:*:*:*:*",
"matchCriteriaId": "59EE8734-9650-4B38-B62B-6A0ADF6E7BD1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:yb:*:*:*:*:*:*",
"matchCriteriaId": "65351CCD-C47C-4035-88FB-616E05398C1D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:yc:*:*:*:*:*:*",
"matchCriteriaId": "A28DF3F1-6788-4F7D-87CC-DEEA8D8F3205",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:yd:*:*:*:*:*:*",
"matchCriteriaId": "FA52C637-B9B1-4B3F-924F-A7D5286F816C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:ye:*:*:*:*:*:*",
"matchCriteriaId": "81CF042A-391D-496B-8317-65CA10FEED03",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:yf:*:*:*:*:*:*",
"matchCriteriaId": "5C010477-1440-4B0F-937B-399D3A4535A4",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:yh:*:*:*:*:*:*",
"matchCriteriaId": "675A9670-F046-4840-9B0B-E384046C4324",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:yi:*:*:*:*:*:*",
"matchCriteriaId": "C67EBC40-4D6E-4126-B044-BC1F215E868C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.1:yj:*:*:*:*:*:*",
"matchCriteriaId": "FD317149-C33D-4139-AAA1-878005806645",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:b:*:*:*:*:*:*",
"matchCriteriaId": "91844D86-1C49-4FBE-8D8E-84A75586B1A3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:bc:*:*:*:*:*:*",
"matchCriteriaId": "A31E1599-C1D0-40C6-B18A-D0604BD109F2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:bw:*:*:*:*:*:*",
"matchCriteriaId": "64B4036B-5BDF-4D1C-A0B2-7252F24742E4",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:by:*:*:*:*:*:*",
"matchCriteriaId": "C6CB71F1-6092-48C7-B715-7349F044360C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:bz:*:*:*:*:*:*",
"matchCriteriaId": "D86ED994-3F96-4380-A2BE-71FDD3CAE4A8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:cx:*:*:*:*:*:*",
"matchCriteriaId": "74BFFADB-27F2-4C35-B5FC-9BAE1227EB51",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:cy:*:*:*:*:*:*",
"matchCriteriaId": "EA13518D-B17B-4531-B0E5-866120506116",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:da:*:*:*:*:*:*",
"matchCriteriaId": "4BE495A4-E66B-4710-A554-D0FE9023E69D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:dd:*:*:*:*:*:*",
"matchCriteriaId": "B13A02F5-65F2-4DB5-8EB3-8A0B9F7884D9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:dx:*:*:*:*:*:*",
"matchCriteriaId": "95224EB1-BD20-4AA4-AD35-7ADDD3049359",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:eu:*:*:*:*:*:*",
"matchCriteriaId": "1AFEA3F7-D9AD-4817-9F75-864221C88DC0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ew:*:*:*:*:*:*",
"matchCriteriaId": "3013C05E-3A15-4FD8-943A-AAB36EB4FB41",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ewa:*:*:*:*:*:*",
"matchCriteriaId": "4A4AFC06-85C5-4AD0-A409-27F9AF398D7D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ex:*:*:*:*:*:*",
"matchCriteriaId": "0CE16131-2E4C-49F5-91A0-820AACC6683C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ey:*:*:*:*:*:*",
"matchCriteriaId": "D7BAF29F-1EB4-44F9-92C1-D3322D7C0B81",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ez:*:*:*:*:*:*",
"matchCriteriaId": "DAB50CF9-9392-425C-B56E-3576CF0F6989",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:fz:*:*:*:*:*:*",
"matchCriteriaId": "EA697982-AF54-432F-8CCA-481678DE56D4",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ixa:*:*:*:*:*:*",
"matchCriteriaId": "4DA9B310-0E8E-4BCD-8254-5B8835413D78",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ixb:*:*:*:*:*:*",
"matchCriteriaId": "1D3B1EB1-E066-42D3-A623-8FBBF42220F1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ixc:*:*:*:*:*:*",
"matchCriteriaId": "D9631E85-B8BC-4F0A-AD9B-0DB668C1ED98",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ixd:*:*:*:*:*:*",
"matchCriteriaId": "25EA7E2F-8C5C-486A-B03D-D0A2A6BB5B69",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ja:*:*:*:*:*:*",
"matchCriteriaId": "9215D716-E6F6-4AEE-8808-9398A4826F04",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:mb:*:*:*:*:*:*",
"matchCriteriaId": "7B70078D-2F0E-4B00-8AF9-E2641A37A59E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:mc:*:*:*:*:*:*",
"matchCriteriaId": "06F481C2-4714-4995-9ED6-766BF5EA5738",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:s:*:*:*:*:*:*",
"matchCriteriaId": "BFE5AEBE-EB53-43F0-857E-7B4EDC1A0ED9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sb:*:*:*:*:*:*",
"matchCriteriaId": "74382B2D-E9A6-453D-9C07-F959EAB4C075",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sbc:*:*:*:*:*:*",
"matchCriteriaId": "1D64DA55-828B-40B4-9320-423121B5F8CD",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:se:*:*:*:*:*:*",
"matchCriteriaId": "04D4ED20-A74A-4553-8FAC-3DA57A6E7423",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sea:*:*:*:*:*:*",
"matchCriteriaId": "AFD7C0D7-FE22-4EAA-A21E-D393DD73C5C7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:seb:*:*:*:*:*:*",
"matchCriteriaId": "2270E882-0B30-4948-B4E7-BA3E87DD7E7F",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sec:*:*:*:*:*:*",
"matchCriteriaId": "D1A0DD83-80AB-4B1C-A267-2CCC2D37D57E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sed:*:*:*:*:*:*",
"matchCriteriaId": "ED52280F-D956-4617-9AFC-2928CF8F93F8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:see:*:*:*:*:*:*",
"matchCriteriaId": "A2C0605F-4FC6-43AC-A349-F1BB0572304F",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sef:*:*:*:*:*:*",
"matchCriteriaId": "224BD2C9-6213-416F-88D2-5FAECC005802",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:seg:*:*:*:*:*:*",
"matchCriteriaId": "5CB5F125-9124-4C37-8FC9-CC63CFE20AE1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sg:*:*:*:*:*:*",
"matchCriteriaId": "B3D93383-BD5A-4052-B724-055F6FCFC314",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sga:*:*:*:*:*:*",
"matchCriteriaId": "6B1E3C39-163D-4A99-AC96-2EE388305000",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sm:*:*:*:*:*:*",
"matchCriteriaId": "5C0F2D29-F6E6-440E-B08C-8EED785878CD",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:so:*:*:*:*:*:*",
"matchCriteriaId": "C04488E3-F13F-4CA5-B8AF-6951FB510086",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sra:*:*:*:*:*:*",
"matchCriteriaId": "90710000-F963-4F36-9EE1-C3CE1CECDCA2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:srb:*:*:*:*:*:*",
"matchCriteriaId": "5F4F8B9E-B2AB-4545-8ACF-8F03E636E842",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:st:*:*:*:*:*:*",
"matchCriteriaId": "80FB05B8-8BE5-4AE9-B018-DAB58034DC7F",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:su:*:*:*:*:*:*",
"matchCriteriaId": "69DC7D98-2B14-425F-8F93-A8BEBD9D1AE5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sv:*:*:*:*:*:*",
"matchCriteriaId": "90D0875E-837B-4F8A-92F8-1D2DD219570B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sw:*:*:*:*:*:*",
"matchCriteriaId": "CF6A17FF-49C2-489A-AD7B-FD1B014A3EB4",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sxa:*:*:*:*:*:*",
"matchCriteriaId": "C3E2ACD9-8623-4B0E-807A-CFC2900497E0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sxb:*:*:*:*:*:*",
"matchCriteriaId": "79BB5494-735D-424B-8B41-2FAECE1A7AD4",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sxd:*:*:*:*:*:*",
"matchCriteriaId": "FD6178BC-9741-4FC1-87DA-A5407B3A4F40",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sy:*:*:*:*:*:*",
"matchCriteriaId": "764FEE81-E2BD-4E46-92D8-48FEC6A1B249",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:sz:*:*:*:*:*:*",
"matchCriteriaId": "59E8E365-8A31-48EE-BE20-7FBE7E9B54B7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:t:*:*:*:*:*:*",
"matchCriteriaId": "9C3E10F8-62D6-4159-B883-C886FD0B63DF",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:tpc:*:*:*:*:*:*",
"matchCriteriaId": "FABE7C54-B03B-4D1E-BF40-C0F357567543",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:uz:*:*:*:*:*:*",
"matchCriteriaId": "9E4E6DF2-61BB-46AE-9B69-CCC899C9A38D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xa:*:*:*:*:*:*",
"matchCriteriaId": "B260F027-B463-490A-A067-D8324FE4871A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xb:*:*:*:*:*:*",
"matchCriteriaId": "C4644F2D-A4F4-42D3-931B-EB3B0AC15D72",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xc:*:*:*:*:*:*",
"matchCriteriaId": "FB43EBD8-3517-4399-B532-5B84BE96B2A0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xd:*:*:*:*:*:*",
"matchCriteriaId": "F4C59703-BB87-459F-BA79-D22541CB73A8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xe:*:*:*:*:*:*",
"matchCriteriaId": "71F5830A-D8FA-4A21-B7CB-E8A1E6746E67",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xf:*:*:*:*:*:*",
"matchCriteriaId": "114E0B28-5AD8-4FEC-A089-79017AAB33C5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xg:*:*:*:*:*:*",
"matchCriteriaId": "6C4B4250-6044-43CF-84B1-53C4AE4ECC8D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xh:*:*:*:*:*:*",
"matchCriteriaId": "E1C04A14-709B-44B3-B189-F50A41AA4C86",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xi:*:*:*:*:*:*",
"matchCriteriaId": "2C0EA3E0-6BFC-4A4A-ACFF-C38C3948B7E2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xj:*:*:*:*:*:*",
"matchCriteriaId": "1C911936-17C0-43BE-A956-3F60D9606DAC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xk:*:*:*:*:*:*",
"matchCriteriaId": "E1C06F44-E4A4-400B-AF91-7A4209733569",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xl:*:*:*:*:*:*",
"matchCriteriaId": "E5B2FACC-2958-4E2D-BADD-51550F1FA63A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xm:*:*:*:*:*:*",
"matchCriteriaId": "582B03D7-57A4-4E00-9B67-4DC2B4320DFD",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xn:*:*:*:*:*:*",
"matchCriteriaId": "8038D0FA-30FB-4BC1-A33D-6BE76C248D21",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xq:*:*:*:*:*:*",
"matchCriteriaId": "F5B5177C-98A7-42FF-83A8-8DFE33B28595",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xr:*:*:*:*:*:*",
"matchCriteriaId": "19C09D13-4124-461C-9976-F7B141563532",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xs:*:*:*:*:*:*",
"matchCriteriaId": "EE8EBF0C-7C7B-4C12-8135-0AB9957B7E19",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xt:*:*:*:*:*:*",
"matchCriteriaId": "09C89AB4-7060-401D-B8B1-A5969D843558",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xu:*:*:*:*:*:*",
"matchCriteriaId": "A365C1C0-B014-42C9-A8B3-9D0C967DC9E2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xv:*:*:*:*:*:*",
"matchCriteriaId": "0A56B6C5-C50D-44CF-BF43-4EDEBDA19581",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:xw:*:*:*:*:*:*",
"matchCriteriaId": "D5AE6379-25CE-44A1-BA61-2461DB0C0E89",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ya:*:*:*:*:*:*",
"matchCriteriaId": "907A6B20-721D-4756-840F-8A2EE776BDD0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yb:*:*:*:*:*:*",
"matchCriteriaId": "DBD1A8F1-73AD-41A0-8426-158402875952",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yc:*:*:*:*:*:*",
"matchCriteriaId": "0D431519-F500-408D-A79D-DAE2DF2F3A5C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ye:*:*:*:*:*:*",
"matchCriteriaId": "880952B0-E796-4C8A-9D28-900338B3C629",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yj:*:*:*:*:*:*",
"matchCriteriaId": "B5D19A29-3500-4D69-B55F-16F6AF04CF4F",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yk:*:*:*:*:*:*",
"matchCriteriaId": "ECD7F135-CFC7-42D4-A223-02D69B905E4C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yl:*:*:*:*:*:*",
"matchCriteriaId": "AE54DF91-7757-4676-A497-2FDE4B039367",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ym:*:*:*:*:*:*",
"matchCriteriaId": "65F91BB4-5721-46B8-97D7-98467F7E1172",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yn:*:*:*:*:*:*",
"matchCriteriaId": "582D94B0-5980-492A-A8BB-4C107521573C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yo:*:*:*:*:*:*",
"matchCriteriaId": "A6DCA5A2-7CE2-4273-B548-AA63E8EBCA2E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yp:*:*:*:*:*:*",
"matchCriteriaId": "5A3625CC-B081-41DF-9C18-921C67FB4D95",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yq:*:*:*:*:*:*",
"matchCriteriaId": "59DBDE9C-1898-4D8C-B63F-0F962FDEA23C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yr:*:*:*:*:*:*",
"matchCriteriaId": "C072D406-81E6-4FA8-82AC-47033F3229D4",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ys:*:*:*:*:*:*",
"matchCriteriaId": "06193800-DE6B-4014-99A2-AE9AAFC11F64",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yt:*:*:*:*:*:*",
"matchCriteriaId": "A7ED5BF0-BC3A-467A-BF14-8FE3529FD6F2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yu:*:*:*:*:*:*",
"matchCriteriaId": "AC94BEC7-F050-4679-9331-9B7F679B2196",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yv:*:*:*:*:*:*",
"matchCriteriaId": "9D21DF3F-4793-4F4A-94E7-C174EEC7CF61",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yx:*:*:*:*:*:*",
"matchCriteriaId": "FD47D76A-7F35-4B38-B479-FDA1EB09C35D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:yy:*:*:*:*:*:*",
"matchCriteriaId": "A82F0863-9143-4390-A9C0-19DDB06C176E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:za:*:*:*:*:*:*",
"matchCriteriaId": "D86A8DA9-D114-4BBE-90DE-F643C12EFB1D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zb:*:*:*:*:*:*",
"matchCriteriaId": "DF7E107F-4805-4832-A013-A35D374FF07C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zc:*:*:*:*:*:*",
"matchCriteriaId": "2223DB0D-E7DA-488A-96C2-8845946CEDA3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zd:*:*:*:*:*:*",
"matchCriteriaId": "5779F924-F313-427F-82F4-571E657B57F8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:ze:*:*:*:*:*:*",
"matchCriteriaId": "9783B2B3-F735-4E96-8FAA-679D753CDC90",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zf:*:*:*:*:*:*",
"matchCriteriaId": "748B610B-7659-431E-BCB9-B7B5E72C0E89",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zg:*:*:*:*:*:*",
"matchCriteriaId": "98798701-533E-4255-9450-C6354B779EF1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zh:*:*:*:*:*:*",
"matchCriteriaId": "F69E5442-C31F-46C8-8911-F5B77437754A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zj:*:*:*:*:*:*",
"matchCriteriaId": "E1D75842-3328-49A3-AC0E-C508CACE5C71",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zl:*:*:*:*:*:*",
"matchCriteriaId": "B472DEEE-148A-46B4-BCBC-0A9F62F38B31",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zp:*:*:*:*:*:*",
"matchCriteriaId": "FA06B835-2324-47D4-A04D-D01FFA069A59",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.2:zy:*:*:*:*:*:*",
"matchCriteriaId": "23305EBA-11D5-417E-823E-39D0D052839D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:*:*:*:*:*:*:*",
"matchCriteriaId": "8A8D0F64-5DE1-4A6F-91F0-8A8509BF077F",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:b:*:*:*:*:*:*",
"matchCriteriaId": "95418AD2-FB85-4E20-B874-D82DDF88BC91",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:bc:*:*:*:*:*:*",
"matchCriteriaId": "D8FC7948-B922-486E-9E5F-069B930EB1E8",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:bw:*:*:*:*:*:*",
"matchCriteriaId": "475EABCF-7404-4B65-9B29-E35C7D673B47",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:eu:*:*:*:*:*:*",
"matchCriteriaId": "7D99C07D-4EE3-4057-8E76-3468C45B4A4C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:ja:*:*:*:*:*:*",
"matchCriteriaId": "14D1B81D-95E4-4945-94F2-C36FD7C0DC55",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:jea:*:*:*:*:*:*",
"matchCriteriaId": "372582DB-DAB8-4B57-A778-5E2BC35B8233",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:jeb:*:*:*:*:*:*",
"matchCriteriaId": "452FF154-F6C0-4BC4-969E-1D49AA3CCE49",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:jec:*:*:*:*:*:*",
"matchCriteriaId": "36CF94C8-D6FE-4229-86F4-AF503F950151",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:jl:*:*:*:*:*:*",
"matchCriteriaId": "554C9611-55F1-40AF-9862-7E902D5CE1D1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:jx:*:*:*:*:*:*",
"matchCriteriaId": "F89C185A-D3B3-4F5F-9249-F8EE89E8DD04",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:t:*:*:*:*:*:*",
"matchCriteriaId": "EEB0B55E-3579-4929-862F-C5FF9F796AE1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:tpc:*:*:*:*:*:*",
"matchCriteriaId": "A19FD313-0AF6-43E1-9FCB-5D27A18C8C57",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:va:*:*:*:*:*:*",
"matchCriteriaId": "CBC11203-84FD-4F6C-8597-573FD784C68E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xa:*:*:*:*:*:*",
"matchCriteriaId": "8E8E34D3-0BCB-4D19-A41C-0375941E1B21",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xb:*:*:*:*:*:*",
"matchCriteriaId": "0F894B6F-9061-4D5B-A7F9-C9DDF2DD35D9",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xc:*:*:*:*:*:*",
"matchCriteriaId": "39BB1F5B-9D53-4DEC-8FC7-C9FC7B51C862",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xd:*:*:*:*:*:*",
"matchCriteriaId": "5A124BB0-EFC3-430E-89F9-FF49B4BF9A28",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xe:*:*:*:*:*:*",
"matchCriteriaId": "A0515E7C-E3A5-44F4-866F-283E43AE8654",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xf:*:*:*:*:*:*",
"matchCriteriaId": "1A74B4D0-939B-4FF1-9163-86FF64DB368E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xg:*:*:*:*:*:*",
"matchCriteriaId": "09CBD68E-2A5C-43DF-9AD6-DE07815821B3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xh:*:*:*:*:*:*",
"matchCriteriaId": "463C3A96-F8B7-4117-8CB3-D15B44119AB5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xi:*:*:*:*:*:*",
"matchCriteriaId": "01393D91-ED1D-460D-8621-10260F0CBDD0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xj:*:*:*:*:*:*",
"matchCriteriaId": "48ABA40D-DE49-4B20-AFA1-302EB93719FB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xk:*:*:*:*:*:*",
"matchCriteriaId": "8AB2FF53-5991-4264-B5CC-D1E45460BFCE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xq:*:*:*:*:*:*",
"matchCriteriaId": "0B0B18B6-FF50-48BE-8250-14E57FB73AE0",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xr:*:*:*:*:*:*",
"matchCriteriaId": "1A1FAF42-B7B1-40B0-A0F7-5DF821E6193F",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xs:*:*:*:*:*:*",
"matchCriteriaId": "0ED386B6-3C75-41C3-8206-9CBA14E20B00",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xu:*:*:*:*:*:*",
"matchCriteriaId": "989581B0-FC28-457B-BDD2-72ED65BBE51E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xw:*:*:*:*:*:*",
"matchCriteriaId": "EF8A8C95-2DC3-47AB-BED3-7D33902440C2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:xy:*:*:*:*:*:*",
"matchCriteriaId": "B8920235-87C6-41D6-9497-CC12D18A6536",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:ya:*:*:*:*:*:*",
"matchCriteriaId": "9752CFFC-F1DA-4122-ACD8-79CB963F485F",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yd:*:*:*:*:*:*",
"matchCriteriaId": "7012F8E0-2256-448A-9C4D-E2DB5AB9852B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yf:*:*:*:*:*:*",
"matchCriteriaId": "1BE94EA2-E0CC-4760-94A8-DE56C8181F74",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yg:*:*:*:*:*:*",
"matchCriteriaId": "5B44691F-A47B-4953-BAC9-B2D43F4BCC06",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yh:*:*:*:*:*:*",
"matchCriteriaId": "8910F02B-DF61-443B-A4B5-2C0C04484519",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yi:*:*:*:*:*:*",
"matchCriteriaId": "929836AD-8128-4174-872D-B9638B54611C",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yj:*:*:*:*:*:*",
"matchCriteriaId": "045B4782-6CE2-40DD-A9F0-16E0C25768FE",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yk:*:*:*:*:*:*",
"matchCriteriaId": "9009E0C3-8BBC-4928-8528-62DA1ADC8BF5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:ym:*:*:*:*:*:*",
"matchCriteriaId": "5FE4985F-2C87-4532-9D11-9BA37B7D6A9B",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yq:*:*:*:*:*:*",
"matchCriteriaId": "9A80C51F-C69A-4780-8AE9-BEBC8EBFA115",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:ys:*:*:*:*:*:*",
"matchCriteriaId": "416B8D2F-0B11-4074-B6BD-2E97F79B5520",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yt:*:*:*:*:*:*",
"matchCriteriaId": "5ED5B53D-930D-477E-A0F6-76167AE67641",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yu:*:*:*:*:*:*",
"matchCriteriaId": "29B39978-3BD0-40A8-93AE-EF40042EB7CB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yx:*:*:*:*:*:*",
"matchCriteriaId": "84983F6A-64F6-4720-9291-FC84CA10EE25",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.3:yz:*:*:*:*:*:*",
"matchCriteriaId": "4A2784C6-588A-4CAC-9362-515FB070D21E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:*:*:*:*:*:*:*",
"matchCriteriaId": "E6A60117-E4D1-4741-98A2-E643A26616A7",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:ja:*:*:*:*:*:*",
"matchCriteriaId": "93580300-6B1F-4D21-A51E-B781E234217D",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:jk:*:*:*:*:*:*",
"matchCriteriaId": "28E2C53A-51B0-4BD6-869E-1554B0BD3A4A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:jma:*:*:*:*:*:*",
"matchCriteriaId": "DB3BA487-727D-416C-80C6-C2F90D52E149",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:jmb:*:*:*:*:*:*",
"matchCriteriaId": "A73738DE-E81B-4226-ABA3-B54A5AD96389",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:jmc:*:*:*:*:*:*",
"matchCriteriaId": "F2DA9F41-FBD0-404A-8C6B-E827C3FACE81",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:jx:*:*:*:*:*:*",
"matchCriteriaId": "EFB1DA86-E0C2-4EDF-B82C-6677516CF1CC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:md:*:*:*:*:*:*",
"matchCriteriaId": "8E2376E9-D7F4-4483-AB13-8840EA9A63E3",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:mr:*:*:*:*:*:*",
"matchCriteriaId": "473A31DD-A0DC-4716-B98E-D2926A26DAF6",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:sw:*:*:*:*:*:*",
"matchCriteriaId": "C9569DC5-9803-4B17-9FF1-5BDA8194FE2A",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:t:*:*:*:*:*:*",
"matchCriteriaId": "156B91B9-1F5B-4E83-A2B7-A5B7F272D5B1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xa:*:*:*:*:*:*",
"matchCriteriaId": "C9E90E83-1732-4BEF-BC5B-401769DC8880",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xb:*:*:*:*:*:*",
"matchCriteriaId": "68C9DDEB-EDE8-4B0D-A347-32621CCEDE42",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xc:*:*:*:*:*:*",
"matchCriteriaId": "51679B26-DF28-4E41-9801-E1599F250FFD",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xd:*:*:*:*:*:*",
"matchCriteriaId": "E989900F-BE66-47E4-9A1B-11B9785F89BB",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xe:*:*:*:*:*:*",
"matchCriteriaId": "95A01B7E-8231-4001-A340-31CE66474FDA",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xf:*:*:*:*:*:*",
"matchCriteriaId": "3EB012E7-E2E0-4F9D-ADF9-827816E3E6D2",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xg:*:*:*:*:*:*",
"matchCriteriaId": "B7368529-518E-4DB2-B291-1F0009445D01",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xj:*:*:*:*:*:*",
"matchCriteriaId": "3CC62D3B-A287-4DED-A44D-3351452D4A55",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xk:*:*:*:*:*:*",
"matchCriteriaId": "EA2F5D70-6790-4756-9A6A-F1865DCD4D10",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xl:*:*:*:*:*:*",
"matchCriteriaId": "57C8EB63-52B5-4B16-8EA1-621790F70B7E",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xm:*:*:*:*:*:*",
"matchCriteriaId": "61C80F8B-ADE8-4289-8D87-02C6284D5A8F",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xn:*:*:*:*:*:*",
"matchCriteriaId": "3CBBBBD1-496B-4C31-80B8-C217E915F077",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xt:*:*:*:*:*:*",
"matchCriteriaId": "07ED91C2-B8ED-4AE7-8A37-82DB94EE28A1",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xv:*:*:*:*:*:*",
"matchCriteriaId": "CBDA82BB-93D1-436C-9598-0AF3FAC8CD26",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xw:*:*:*:*:*:*",
"matchCriteriaId": "687E91FF-957E-449F-BDD6-85AA59E1E0D5",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:cisco_ios:12.4:xy:*:*:*:*:*:*",
"matchCriteriaId": "8049D059-2A09-4820-A4F0-6B8D794606BC",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:ios:12.0:*:*:*:*:*:*:*",
"matchCriteriaId": "8F86F790-6247-42F2-9487-3D60A2842F52",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:ios:12.2yd:*:*:*:*:*:*:*",
"matchCriteriaId": "86309E93-F2C9-4334-9A1C-989EFDC99215",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:ios:12.2yf:*:*:*:*:*:*:*",
"matchCriteriaId": "9BFAF394-6E9A-4CD6-B8A6-5BDDE4EC8EC4",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:ios:12.2yg:*:*:*:*:*:*:*",
"matchCriteriaId": "65318A70-40FF-4BE8-962B-DFCD5C476166",
"vulnerable": true
},
{
"criteria": "cpe:2.3:o:cisco:ios:12.2yh:*:*:*:*:*:*:*",
"matchCriteriaId": "8B6DB954-EDC8-4A81-8C26-9D3DBC68FC67",
"vulnerable": true
}
],
"negate": false,
"operator": "OR"
}
]
}
],
"cveTags": [],
"descriptions": [
{
"lang": "en",
"value": "The data-link switching (DLSw) component in Cisco IOS 12.0 through 12.4 allows remote attackers to cause a denial of service (device restart or memory consumption) via crafted (1) UDP port 2067 or (2) IP protocol 91 packets."
},
{
"lang": "es",
"value": "El componente data-link switching (DLSw) en Cisco IOS 12.0 hasta 12.4 permite a atacantes remotos provocar una denegaci\u00f3n de servicio (reinicio de dispositivo o consumo de memoria) a trav\u00e9s de 91 paquetes manipulados del (1) puerto UDP 2067 o (2) protocolo IP."
}
],
"id": "CVE-2008-1152",
"lastModified": "2025-04-09T00:30:58.490",
"metrics": {
"cvssMetricV2": [
{
"acInsufInfo": false,
"baseSeverity": "HIGH",
"cvssData": {
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "NONE",
"availabilityImpact": "COMPLETE",
"baseScore": 7.8,
"confidentialityImpact": "NONE",
"integrityImpact": "NONE",
"vectorString": "AV:N/AC:L/Au:N/C:N/I:N/A:C",
"version": "2.0"
},
"exploitabilityScore": 10.0,
"impactScore": 6.9,
"obtainAllPrivilege": false,
"obtainOtherPrivilege": false,
"obtainUserPrivilege": false,
"source": "nvd@nist.gov",
"type": "Primary",
"userInteractionRequired": false
}
]
},
"published": "2008-03-27T17:44:00.000",
"references": [
{
"source": "psirt@cisco.com",
"url": "http://secunia.com/advisories/29507"
},
{
"source": "psirt@cisco.com",
"tags": [
"Patch"
],
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml"
},
{
"source": "psirt@cisco.com",
"url": "http://www.securityfocus.com/bid/28465"
},
{
"source": "psirt@cisco.com",
"url": "http://www.securitytracker.com/id?1019712"
},
{
"source": "psirt@cisco.com",
"tags": [
"US Government Resource"
],
"url": "http://www.us-cert.gov/cas/techalerts/TA08-087B.html"
},
{
"source": "psirt@cisco.com",
"url": "http://www.vupen.com/english/advisories/2008/1006/references"
},
{
"source": "psirt@cisco.com",
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/41482"
},
{
"source": "psirt@cisco.com",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "http://secunia.com/advisories/29507"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"Patch"
],
"url": "http://www.cisco.com/en/US/products/products_security_advisory09186a0080969866.shtml"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "http://www.securityfocus.com/bid/28465"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "http://www.securitytracker.com/id?1019712"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"tags": [
"US Government Resource"
],
"url": "http://www.us-cert.gov/cas/techalerts/TA08-087B.html"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "http://www.vupen.com/english/advisories/2008/1006/references"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/41482"
},
{
"source": "af854a3a-2127-422b-91ae-364da2661108",
"url": "https://oval.cisecurity.org/repository/search/definition/oval%3Aorg.mitre.oval%3Adef%3A5821"
}
],
"sourceIdentifier": "psirt@cisco.com",
"vulnStatus": "Deferred",
"weaknesses": [
{
"description": [
{
"lang": "en",
"value": "CWE-399"
}
],
"source": "nvd@nist.gov",
"type": "Primary"
}
]
}
CERTA-2008-AVI-163
Vulnerability from certfr_avis - Published: 2008-03-27 - Updated: 2008-03-27
Cisco a publié un bulletin de sécurité regroupant cinq bulletins sur des vulnérabilités séparées. Elles concernent toutes Cisco IOS et plus précisément PPTP, DLSw, IPv6, MVPN et MPLS VPN.
Description
Cisco IOS (Internetwork Operating System) est le système d'exploitation de la majorité des routeurs et commutateurs Cisco.
- PPTP : des vulnérabilités concernant une fuite de mémoire et une mauvaise gestion des blocs décrivant les interfaces permettent un épuisement des ressources entrainant un déni de service.
- DLSw : une vulnérabilité affectant le traitement des trames UDP et IP (protocole 91) permet un redémarrage ou un déni de service à distance par épuisement des ressources mémoire.
- IPv6 : une vulnérabilité permet à l'aide d'une trame IPv6, spécifiquement créée et ciblant un équipement, de provoquer un déni de service de l'interface ou de l'équipement en fonction des cas.
- MVPN : une trame MDT (Multicast Distribution Tree) spécifiquement créée permet de détourner une partie du trafic du réseau virtuel privé.
- MPLS VPN : une vulnérabilité permet le blocage des files, des fuites mémoire et le redémarrage de l'équipement.
Solution
Se référer au bulletin de sécurité Cisco 100893 du 26 mars 2008 pour l'obtention des correctifs (cf. section Documentation).
Les Cisco IOS déployés sont vulnérables dans les cas suivants :
- les versions antérieures à la 12.3 avec le VPDN (Virtual Private Dial-up Network) activé ;
- les versions antérieures à la 12.3 avec le DLSw (Data Link Switching) activé ;
- certaines versions antérieures à la 12.3 avec le support IPv6 activé ainsi que l'UDP en IPv4 ;
- certaines versions antérieures à la 12.3 avec le MVPN (Multicast Virtual Private Network) activé ;
- certaines sous-versions de la 12.2 équipant les Cisco Catalyst 6500 et Cisco 7600 router, configurées avec OSPF (Open Shortest Path First) et MPLS VPN (Multi Protocol Label Switching Virtual Private Networking).
| Vendor | Product | Description |
|---|
| Title | Publication Time | Tags | |
|---|---|---|---|
|
|
|||
{
"$ref": "https://www.cert.ssi.gouv.fr/openapi.json",
"affected_systems": [],
"affected_systems_content": "\u003cp\u003eLes \u003cTT\u003eCisco IOS\u003c/TT\u003e d\u00e9ploy\u00e9s sont vuln\u00e9rables dans les cas suivants : \u003cUL\u003e \u003cLI\u003eles versions ant\u00e9rieures \u00e0 la 12.3 avec le \u003cTT\u003eVPDN\u003c/TT\u003e (\u003cSPAN class=\"textit\"\u003eVirtual Private Dial-up Network\u003c/SPAN\u003e) activ\u00e9 ;\u003c/LI\u003e \u003cLI\u003eles versions ant\u00e9rieures \u00e0 la 12.3 avec le \u003cTT\u003eDLSw\u003c/TT\u003e (\u003cSPAN class=\"textit\"\u003eData Link Switching\u003c/SPAN\u003e) activ\u00e9 ;\u003c/LI\u003e \u003cLI\u003ecertaines versions ant\u00e9rieures \u00e0 la 12.3 avec le support IPv6 activ\u00e9 ainsi que l\u0027UDP en IPv4 ;\u003c/LI\u003e \u003cLI\u003ecertaines versions ant\u00e9rieures \u00e0 la 12.3 avec le \u003cTT\u003eMVPN\u003c/TT\u003e (\u003cSPAN class=\"textit\"\u003eMulticast Virtual Private Network\u003c/SPAN\u003e) activ\u00e9 ;\u003c/LI\u003e \u003cLI\u003ecertaines sous-versions de la 12.2 \u00e9quipant les \u003cSPAN class=\"textit\"\u003eCisco Catalyst 6500\u003c/SPAN\u003e et \u003cSPAN class=\n \"textit\"\u003eCisco 7600 router\u003c/SPAN\u003e, configur\u00e9es avec \u003cTT\u003eOSPF\u003c/TT\u003e (\u003cSPAN class=\"textit\"\u003eOpen Shortest Path First\u003c/SPAN\u003e) et \u003cTT\u003eMPLS VPN\u003c/TT\u003e (\u003cSPAN class=\"textit\"\u003eMulti Protocol Label Switching Virtual Private Networking\u003c/SPAN\u003e).\u003c/LI\u003e \u003c/UL\u003e\u003c/p\u003e",
"content": "## Description\n\nCisco IOS (Internetwork Operating System) est le syst\u00e8me d\u0027exploitation\nde la majorit\u00e9 des routeurs et commutateurs Cisco.\n\n- PPTP : des vuln\u00e9rabilit\u00e9s concernant une fuite de m\u00e9moire et une\n mauvaise gestion des blocs d\u00e9crivant les interfaces permettent un\n \u00e9puisement des ressources entrainant un d\u00e9ni de service.\n- DLSw : une vuln\u00e9rabilit\u00e9 affectant le traitement des trames UDP et\n IP (protocole 91) permet un red\u00e9marrage ou un d\u00e9ni de service \u00e0\n distance par \u00e9puisement des ressources m\u00e9moire.\n- IPv6 : une vuln\u00e9rabilit\u00e9 permet \u00e0 l\u0027aide d\u0027une trame IPv6,\n sp\u00e9cifiquement cr\u00e9\u00e9e et ciblant un \u00e9quipement, de provoquer un d\u00e9ni\n de service de l\u0027interface ou de l\u0027\u00e9quipement en fonction des cas.\n- MVPN : une trame MDT (Multicast Distribution Tree) sp\u00e9cifiquement\n cr\u00e9\u00e9e permet de d\u00e9tourner une partie du trafic du r\u00e9seau virtuel\n priv\u00e9.\n- MPLS VPN : une vuln\u00e9rabilit\u00e9 permet le blocage des files, des fuites\n m\u00e9moire et le red\u00e9marrage de l\u0027\u00e9quipement.\n\n## Solution\n\nSe r\u00e9f\u00e9rer au bulletin de s\u00e9curit\u00e9 Cisco 100893 du 26 mars 2008 pour\nl\u0027obtention des correctifs (cf. section Documentation).\n",
"cves": [
{
"name": "CVE-2008-1151",
"url": "https://www.cve.org/CVERecord?id=CVE-2008-1151"
},
{
"name": "CVE-2008-0537",
"url": "https://www.cve.org/CVERecord?id=CVE-2008-0537"
},
{
"name": "CVE-2008-1156",
"url": "https://www.cve.org/CVERecord?id=CVE-2008-1156"
},
{
"name": "CVE-2008-1153",
"url": "https://www.cve.org/CVERecord?id=CVE-2008-1153"
},
{
"name": "CVE-2008-1150",
"url": "https://www.cve.org/CVERecord?id=CVE-2008-1150"
},
{
"name": "CVE-2008-1152",
"url": "https://www.cve.org/CVERecord?id=CVE-2008-1152"
}
],
"initial_release_date": "2008-03-27T00:00:00",
"last_revision_date": "2008-03-27T00:00:00",
"links": [
{
"title": "Bulletin de s\u00e9curit\u00e9 Cisco 20080326-queue du 26 mars 2008 :",
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-queue.shtml"
},
{
"title": "Bulletin de s\u00e9curit\u00e9 Cisco 20080326-dlsw du 26 mars 2008 :",
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-dlsw.shtml"
},
{
"title": "Bulletin de s\u00e9curit\u00e9 Cisco 20080326-bundle du 26 mars 2008 :",
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-bundle.shtml"
},
{
"title": "Bulletin de s\u00e9curit\u00e9 Cisco 20080326-pptp du 26 mars 2008 :",
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-pptp.shtml"
},
{
"title": "Bulletin de s\u00e9curit\u00e9 Cisco 20080326-IPv4IPv6 du 26 mars 2008 :",
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-IPv4IPv6.shtml"
},
{
"title": "Bulletin de s\u00e9curit\u00e9 Cisco 20080326-mvpn du 26 mars 2008 :",
"url": "http://www.cisco.com/warp/public/707/cisco-sa-20080326-mvpn.shtml"
}
],
"reference": "CERTA-2008-AVI-163",
"revisions": [
{
"description": "version initiale.",
"revision_date": "2008-03-27T00:00:00.000000"
}
],
"risks": [
{
"description": "D\u00e9ni de service \u00e0 distance"
},
{
"description": "Contournement de la politique de s\u00e9curit\u00e9"
},
{
"description": "Atteinte \u00e0 la confidentialit\u00e9 des donn\u00e9es"
}
],
"summary": "Cisco a publi\u00e9 un bulletin de s\u00e9curit\u00e9 regroupant cinq bulletins sur des\nvuln\u00e9rabilit\u00e9s s\u00e9par\u00e9es. Elles concernent toutes Cisco IOS et plus\npr\u00e9cis\u00e9ment PPTP, DLSw, IPv6, MVPN et MPLS VPN.\n",
"title": "Multiples vuln\u00e9rabilit\u00e9s dans Cisco IOS",
"vendor_advisories": [
{
"published_at": null,
"title": "Bulletin de s\u00e9curit\u00e9 Cisco 100893 du 26 mars 2008",
"url": null
}
]
}
Sightings
| Author | Source | Type | Date |
|---|
Nomenclature
- Seen: The vulnerability was mentioned, discussed, or observed by the user.
- Confirmed: The vulnerability has been validated from an analyst's perspective.
- Published Proof of Concept: A public proof of concept is available for this vulnerability.
- Exploited: The vulnerability was observed as exploited by the user who reported the sighting.
- Patched: The vulnerability was observed as successfully patched by the user who reported the sighting.
- Not exploited: The vulnerability was not observed as exploited by the user who reported the sighting.
- Not confirmed: The user expressed doubt about the validity of the vulnerability.
- Not patched: The vulnerability was not observed as successfully patched by the user who reported the sighting.