Search criteria
34 vulnerabilities found for Mate 20 by Huawei
VAR-201908-1958
Vulnerability from variot - Updated: 2025-12-22 22:47The Bluetooth BR/EDR specification up to and including version 5.1 permits sufficiently low encryption key length and does not prevent an attacker from influencing the key length negotiation. This allows practical brute-force attacks (aka "KNOB") that can decrypt traffic and inject arbitrary ciphertext without the victim noticing. Bluetooth BR/EDR The entropy negotiation of the encryption key used for encryption on the connection has a problem that is vulnerable to man-in-the-middle attacks by design. A third party Bluetooth BR/EDR The entropy of the encryption key used for communication 1 Force byte (Key Negotiation Of Bluetooth (KNOB) attack) Brute force attacks on subsequent communications (Brute force attack) May be able to decrypt and intercept the contents. Bluetooth Is Bluetooth Basic Rate / Enhanced Data Rate (Bluetooth BR/EDR) Includes core configuration 6 A short-range wireless technology based on different core specifications and used for low-power short-range communications. Bluetooth To establish encrypted communication for 2 Horn Bluetooth You need to establish a link key that the device will pair and use to generate the encryption key used for encryption at the link layer. The entropy of the encryption key is 1 From bytes 16 In bytes length Bluetooth Set between controllers. When an attacker interrupts the encryption key entropy setting request between controllers and each controller accepts a low entropy setting, encrypted communication with low entropy is forced, resulting in a brute force attack (Brute force attack) Because of this, communication between devices may be easily decrypted.Man-in-the-middle attacks (man-in-the-middle attack) There is a possibility of eavesdropping on encrypted communication by. An encryption issue vulnerability exists in Bluetooth BR/EDR 5.1 and earlier versions. The vulnerability stems from incorrect use of relevant cryptographic algorithms by network systems or products, resulting in improperly encrypted content, weak encryption, and storing sensitive information in plain text. The attack must be performed during negotiation or renegotiation of a paired device connection; existing sessions cannot be attacked. This advisory will be updated as additional information becomes available. There are no workarounds that address this vulnerability.
This advisory is available at the following link: tools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20190813-bluetooth. 8.0) - aarch64, noarch, ppc64le, s390x, x86_64
Bug Fix(es):
-
Backport TCP follow-up for small buffers (BZ#1739184)
-
TCP performance regression after CVE-2019-11478 bug fix (BZ#1743170)
-
RHEL8.0 - bnx2x link down, caused by transmit timeouts during load test (Marvell/Cavium/QLogic) (L3:) (BZ#1743548)
-
block: blk-mq improvement (BZ#1780567)
-
RHEL8.0 - Regression to RHEL7.6 by changing force_latency found during RHEL8.0 validation for SAP HANA on POWER (BZ#1781111)
-
blk-mq: overwirte performance drops on real MQ device (BZ#1782183)
-
RHEL8: creating vport takes lot of memory i.e 2GB per vport which leads to drain out system memory quickly. (BZ#1782705)
-
8) - x86_64
-
Description:
The kernel-rt packages provide the Real Time Linux Kernel, which enables fine-tuning for systems with extremely high determinism requirements.
Security Fix(es):
-
kernel: nfs: use-after-free in svc_process_common() (CVE-2018-16884)
-
Kernel: vhost_net: infinite loop while receiving packets leads to DoS (CVE-2019-3900)
-
Kernel: page cache side channel attacks (CVE-2019-5489)
-
hardware: bluetooth: BR/EDR encryption key negotiation attacks (KNOB) (CVE-2019-9506)
-
kernel: Heap overflow in mwifiex_uap_parse_tail_ies function in drivers/net/wireless/marvell/mwifiex/ie.c (CVE-2019-10126)
-
Kernel: KVM: OOB memory access via mmio ring buffer (CVE-2019-14821)
-
kernel: Information Disclosure in crypto_report_one in crypto/crypto_user.c (CVE-2018-19854)
-
kernel: usb: missing size check in the __usb_get_extra_descriptor() leading to DoS (CVE-2018-20169)
-
kernel: Heap address information leak while using L2CAP_GET_CONF_OPT (CVE-2019-3459)
-
kernel: Heap address information leak while using L2CAP_PARSE_CONF_RSP (CVE-2019-3460)
-
kernel: SCTP socket buffer memory leak leading to denial of service (CVE-2019-3874)
-
kernel: denial of service vector through vfio DMA mappings (CVE-2019-3882)
-
kernel: null-pointer dereference in hci_uart_set_flow_control (CVE-2019-10207)
-
kernel: fix race condition between mmget_not_zero()/get_task_mm() and core dumping (CVE-2019-11599)
-
kernel: fs/ext4/extents.c leads to information disclosure (CVE-2019-11833)
-
kernel: sensitive information disclosure from kernel stack memory via HIDPCONNADD command (CVE-2019-11884)
-
kernel: use-after-free in arch/x86/lib/insn-eval.c (CVE-2019-13233)
-
kernel: memory leak in register_queue_kobjects() in net/core/net-sysfs.c leads to denial of service (CVE-2019-15916)
-
kernel: oob memory read in hso_probe in drivers/net/usb/hso.c (CVE-2018-19985)
-
Kernel: KVM: leak of uninitialized stack contents to guest (CVE-2019-7222)
-
Kernel: net: weak IP ID generation leads to remote device tracking (CVE-2019-10638)
For more details about the security issue(s), including the impact, a CVSS score, acknowledgments, and other related information, refer to the CVE page(s) listed in the References section. Bugs fixed (https://bugzilla.redhat.com/):
1656986 - CVE-2018-19854 kernel: Information Disclosure in crypto_report_one in crypto/crypto_user.c 1660375 - CVE-2018-16884 kernel: nfs: use-after-free in svc_process_common() 1660385 - CVE-2018-20169 kernel: usb: missing size check in the __usb_get_extra_descriptor() leading to DoS 1663176 - CVE-2019-3459 kernel: Heap address information leak while using L2CAP_GET_CONF_OPT 1663179 - CVE-2019-3460 kernel: Heap address information leak while using L2CAP_PARSE_CONF_RSP 1664110 - CVE-2019-5489 Kernel: page cache side channel attacks 1666106 - CVE-2018-19985 kernel: oob memory read in hso_probe in drivers/net/usb/hso.c 1671930 - CVE-2019-7222 Kernel: KVM: leak of uninitialized stack contents to guest 1678887 - RT: update RT source tree to the RHEL-8.1 tree 1686373 - CVE-2019-3874 kernel: SCTP socket buffer memory leak leading to denial of service 1689426 - CVE-2019-3882 kernel: denial of service vector through vfio DMA mappings 1698757 - CVE-2019-3900 Kernel: vhost_net: infinite loop while receiving packets leads to DoS 1700666 - Make kernel-rt require rt-setup 1705937 - CVE-2019-11599 kernel: fix race condition between mmget_not_zero()/get_task_mm() and core dumping 1709837 - CVE-2019-11884 kernel: sensitive information disclosure from kernel stack memory via HIDPCONNADD command 1712072 - CVE-2019-11833 kernel: fs/ext4/extents.c leads to information disclosure 1716992 - CVE-2019-10126 kernel: Heap overflow in mwifiex_uap_parse_tail_ies function in drivers/net/wireless/marvell/mwifiex/ie.c 1724657 - BUG: scheduling while atomic in zswap 1727756 - CVE-2019-13233 kernel: use-after-free in arch/x86/lib/insn-eval.c 1727857 - CVE-2019-9506 hardware: bluetooth: BR/EDR encryption key negotiation attacks (KNOB) 1728765 - BUG: scheduling while atomic: rcuc/13/134/0x00000002 1729931 - CVE-2019-10638 Kernel: net: weak IP ID generation leads to remote device tracking 1733472 - BUG: scheduling while atomic: rcuc/1/24/0x00000002 1733874 - CVE-2019-10207 kernel: null-pointer dereference in hci_uart_set_flow_control 1743931 - BUG: unable to handle kernel NULL pointer dereference at 0000000000000020 1745646 - [RT] sched/fair: Robustify CFS-bandwidth timer locking 1746708 - CVE-2019-14821 Kernel: KVM: OOB memory access via mmio ring buffer 1750813 - CVE-2019-15916 kernel: memory leak in register_queue_kobjects() in net/core/net-sysfs.c leads to denial of service
Bug Fix(es):
-
port show-kabi to python3 (BZ#1806924)
-
7.6) - ppc64le, x86_64
-
Description:
This is a kernel live patch module which is automatically loaded by the RPM post-install script to modify the code of a running kernel. Solution:
Before applying this update, make sure all previously released errata relevant to your system have been applied.
Bug Fix(es):
-
kernel build: parallelize redhat/mod-sign.sh (BZ#1755326)
-
-----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
APPLE-SA-2019-8-13-1 Additional information for APPLE-SA-2019-7-22-2 macOS Mojave 10.14.6, Security Update 2019-004 High Sierra, Security Update 2019-004 Sierra
macOS Mojave 10.14.6, Security Update 2019-004 High Sierra, Security Update 2019-004 Sierra address the following:
AppleGraphicsControl Available for: macOS Mojave 10.14.5 Impact: An application may be able to read restricted memory Description: A validation issue was addressed with improved input sanitization. CVE-2019-8693: Arash Tohidi of Solita
autofs Available for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS Mojave 10.14.5 Impact: Extracting a zip file containing a symbolic link to an endpoint in an NFS mount that is attacker controlled may bypass Gatekeeper Description: This was addressed with additional checks by Gatekeeper on files mounted through a network share. CVE-2019-8656: Filippo Cavallarin
Bluetooth Available for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS Mojave 10.14.5 Impact: A remote attacker may be able to cause arbitrary code execution Description: A memory corruption issue was addressed with improved input validation. CVE-2018-19860
Bluetooth Available for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS Mojave 10.14.5 Impact: An attacker in a privileged network position may be able to intercept Bluetooth traffic (Key Negotiation of Bluetooth - KNOB) Description: An input validation issue existed in Bluetooth. This issue was addressed with improved input validation. CVE-2019-9506: Daniele Antonioli of SUTD, Singapore, Dr. Nils Ole Tippenhauer of CISPA, Germany, and Prof. Kasper Rasmussen of University of Oxford, England Entry added August 13, 2019
Carbon Core Available for: macOS Mojave 10.14.5 Impact: A remote attacker may be able to cause arbitrary code execution Description: A use after free issue was addressed with improved memory management. CVE-2019-8661: Natalie Silvanovich of Google Project Zero
Core Data Available for: macOS Mojave 10.14.5 Impact: A remote attacker may be able to leak memory Description: An out-of-bounds read was addressed with improved input validation. CVE-2019-8646: Natalie Silvanovich of Google Project Zero
Core Data Available for: macOS Mojave 10.14.5 Impact: A remote attacker may be able to cause unexpected application termination or arbitrary code execution Description: A memory corruption issue was addressed with improved input validation. CVE-2019-8660: Samuel Groß and Natalie Silvanovich of Google Project Zero
Disk Management Available for: macOS Mojave 10.14.5 Impact: An application may be able to execute arbitrary code with system privileges Description: A memory corruption issue was addressed with improved memory handling. CVE-2019-8697: ccpwd working with Trend Micro's Zero Day Initiative
FaceTime Available for: macOS Mojave 10.14.5 Impact: A remote attacker may be able to cause arbitrary code execution Description: A memory corruption issue was addressed with improved input validation. CVE-2019-8648: Tao Huang and Tielei Wang of Team Pangu
Found in Apps Available for: macOS Mojave 10.14.5 Impact: A remote attacker may be able to leak memory Description: This issue was addressed with improved checks. CVE-2019-8663: Natalie Silvanovich of Google Project Zero
Foundation Available for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS Mojave 10.14.5 Impact: A remote attacker may be able to cause unexpected application termination or arbitrary code execution Description: An out-of-bounds read was addressed with improved input validation. CVE-2019-8641: Samuel Groß and Natalie Silvanovich of Google Project Zero
Grapher Available for: macOS Mojave 10.14.5 Impact: An application may be able to execute arbitrary code with system privileges Description: A memory corruption issue was addressed with improved memory handling. CVE-2019-8695: riusksk of VulWar Corp working with Trend Micro's Zero Day Initiative
Graphics Drivers Available for: macOS High Sierra 10.13.6, macOS Mojave 10.14.5 Impact: An application may be able to read restricted memory Description: A validation issue was addressed with improved input sanitization. CVE-2019-8691: Aleksandr Tarasikov (@astarasikov), Arash Tohidi of Solita, Lilang Wu and Moony Li of Trend Micro's Mobile Security Research Team working with Trend Micro's Zero Day Initiative CVE-2019-8692: Lilang Wu and Moony Li of Trend Micro Mobile Security Research Team working with Trend Micro's Zero Day Initiative
Heimdal Available for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS Mojave 10.14.5 Impact: An issue existed in Samba that may allow attackers to perform unauthorized actions by intercepting communications between services Description: This issue was addressed with improved checks to prevent unauthorized actions. CVE-2018-16860: Isaac Boukris and Andrew Bartlett of the Samba Team and Catalyst
IOAcceleratorFamily Available for: macOS Mojave 10.14.5 Impact: An application may be able to execute arbitrary code with kernel privileges Description: A memory corruption issue was addressed with improved memory handling. CVE-2019-8694: Arash Tohidi of Solita
libxslt Available for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS Mojave 10.14.5 Impact: A remote attacker may be able to view sensitive information Description: A stack overflow was addressed with improved input validation. CVE-2019-13118: found by OSS-Fuzz
Quick Look Available for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS Mojave 10.14.5 Impact: An attacker may be able to trigger a use-after-free in an application deserializing an untrusted NSDictionary Description: This issue was addressed with improved checks. CVE-2019-8662: Natalie Silvanovich and Samuel Groß of Google Project Zero
Security Available for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6 Impact: An application may be able to execute arbitrary code with system privileges Description: A memory corruption issue was addressed with improved memory handling. CVE-2019-8697: ccpwd working with Trend Micro's Zero Day Initiative
Siri Available for: macOS Mojave 10.14.5 Impact: A remote attacker may be able to leak memory Description: An out-of-bounds read was addressed with improved input validation. CVE-2019-8646: Natalie Silvanovich of Google Project Zero
Time Machine Available for: macOS Mojave 10.14.5 Impact: The encryption status of a Time Machine backup may be incorrect Description: An inconsistent user interface issue was addressed with improved state management. CVE-2019-8667: Roland Kletzing of cyber:con GmbH
UIFoundation Available for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS Mojave 10.14.5 Impact: Parsing a maliciously crafted office document may lead to an unexpected application termination or arbitrary code execution Description: An out-of-bounds read was addressed with improved input validation. CVE-2019-8657: riusksk of VulWar Corp working with Trend Micro's Zero Day Initiative
Additional recognition
Classroom We would like to acknowledge Jeff Johnson of underpassapp.com for their assistance.
Game Center We would like to acknowledge Min (Spark) Zheng and Xiaolong Bai of Alibaba Inc. for their assistance.
Installation note:
macOS Mojave 10.14.6, Security Update 2019-004 High Sierra, Security Update 2019-004 Sierra may be obtained from the Mac App Store or Apple's Software Downloads web site: https://support.apple.com/downloads/
Information will also be posted to the Apple Security Updates web site: https://support.apple.com/kb/HT201222
This message is signed with Apple's Product Security PGP key, and details are available at: https://www.apple.com/support/security/pgp/ -----BEGIN PGP SIGNATURE-----
iQJdBAEBCABHFiEEDNXJVNCJJEAVmJdZeC9tht7TK3EFAl1S688pHHByb2R1Y3Qt c2VjdXJpdHktbm9yZXBseUBsaXN0cy5hcHBsZS5jb20ACgkQeC9tht7TK3Hiog/+ PcWPEhxDpnU1ctoVPhyoqkV1tUs8z3hdNyX/tPtQZIQVFB7No1Md0GX8Zrv2libb LwrbU25ewe82XE9Es6ngxTdkRaREn8+hm9gxYPCMDXyKRlv904Q1b4zthYUt7/NO 7RG6ZRHEINOQORzrDsmgT/X6TukIy73HNob+4xZJTdJe9ZU3/zDCaqUgyUJSodou vsVFR3oqkwbVby4eT9+YbxJWMvVoFfB1+Qqo1w9kN7WXcYK3gb7sGtnNQlrE70kR pLRogcmwTQsi+sTm8bxQsuXXjdtTHeeCf0FRJg8NY5wZmdV9lNOghtmNxfTwIuir VeWusIgZWaK7IbgHW3PRYv3Sbrk40zcOraDsPv2rdgjOj4ReVyKHw5/f5Fyhcn+v WnIC4iNIBurz0HZU91QqD58Sqp+HtWl8xkM3ZW+Kd9LjnLty3fNw6Au5Aw8DTHzN 5F+lz7JRVV3+j7AYELog3WV6mdzMKW85gJRJtwXJ8hHSYZnvat06faFlPcDiKjBW rW7BehRykZpmZtaSZjL25IeOuXJHHdRfvabuTZ3nk47SSn7EJJ3xFBnvw6TgVFX+ TvmcUg5FinTSR81NkIY0ux6x1kuV/4vIUGZ4O0Houf/FoUhMQvig9ZkSw2B+Ynbd Xl3qBT4SVPWQyFAvjHwjCZA+GpNsnEKgZm8SlYVgqog= =tCwo -----END PGP SIGNATURE----- .
Bug Fix(es):
-
kernel-rt: update to the RHEL7.7.z batch#2 source tree (BZ#1748570)
-
-----BEGIN PGP SIGNED MESSAGE----- Hash: SHA256
===================================================================== Red Hat Security Advisory
Synopsis: Important: kernel security and bug fix update Advisory ID: RHSA-2019:3187-01 Product: Red Hat Enterprise Linux Advisory URL: https://access.redhat.com/errata/RHSA-2019:3187 Issue date: 2019-10-23 CVE Names: CVE-2019-9506 =====================================================================
- Summary:
An update for kernel is now available for Red Hat Enterprise Linux 7.4 Advanced Update Support, Red Hat Enterprise Linux 7.4 Telco Extended Update Support, and Red Hat Enterprise Linux 7.4 Update Services for SAP Solutions.
Red Hat Product Security has rated this update as having a security impact of Important. A Common Vulnerability Scoring System (CVSS) base score, which gives a detailed severity rating, is available for each vulnerability from the CVE link(s) in the References section.
- Relevant releases/architectures:
Red Hat Enterprise Linux Server AUS (v. 7.4) - noarch, x86_64 Red Hat Enterprise Linux Server E4S (v. 7.4) - noarch, ppc64le, x86_64 Red Hat Enterprise Linux Server Optional AUS (v. 7.4) - x86_64 Red Hat Enterprise Linux Server Optional E4S (v. 7.4) - ppc64le, x86_64 Red Hat Enterprise Linux Server Optional TUS (v. 7.4) - x86_64 Red Hat Enterprise Linux Server TUS (v. 7.4) - noarch, x86_64
- Description:
The kernel packages contain the Linux kernel, the core of any Linux operating system.
Security Fix(es):
- hardware: bluetooth: BR/EDR encryption key negotiation attacks (KNOB) (CVE-2019-9506)
For more details about the security issue(s), including the impact, a CVSS score, acknowledgments, and other related information, refer to the CVE page(s) listed in the References section.
Bug Fix(es):
-
Fix possible Spectre-v1 bugs in wireless code (BZ#1706696)
-
powerpc/pseries: Disable CPU hotplug across migrations / powerpc/rtas: Fix a potential race between CPU-Offline & Migration (LPM) (BZ#1745436)
-
powerpc/pseries: Fix unitialized timer reset on migration / powerpc/pseries/mobility: Extend start/stop topology update scope (LPM) (BZ#1745438)
-
ISST-LTE:PVM:Zeppelin :LPM: Failure logs and stack trace seen during LPM (POWER9/P9) (BZ#1745446)
-
Solution:
For details on how to apply this update, which includes the changes described in this advisory, refer to:
https://access.redhat.com/articles/11258
The system must be rebooted for this update to take effect.
- Package List:
Red Hat Enterprise Linux Server AUS (v. 7.4):
Source: kernel-3.10.0-693.60.1.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-693.60.1.el7.noarch.rpm kernel-doc-3.10.0-693.60.1.el7.noarch.rpm
x86_64: kernel-3.10.0-693.60.1.el7.x86_64.rpm kernel-debug-3.10.0-693.60.1.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debug-devel-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm kernel-devel-3.10.0-693.60.1.el7.x86_64.rpm kernel-headers-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-libs-3.10.0-693.60.1.el7.x86_64.rpm perf-3.10.0-693.60.1.el7.x86_64.rpm perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm python-perf-3.10.0-693.60.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm
Red Hat Enterprise Linux Server E4S (v. 7.4):
Source: kernel-3.10.0-693.60.1.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-693.60.1.el7.noarch.rpm kernel-doc-3.10.0-693.60.1.el7.noarch.rpm
ppc64le: kernel-3.10.0-693.60.1.el7.ppc64le.rpm kernel-bootwrapper-3.10.0-693.60.1.el7.ppc64le.rpm kernel-debug-3.10.0-693.60.1.el7.ppc64le.rpm kernel-debug-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm kernel-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-693.60.1.el7.ppc64le.rpm kernel-devel-3.10.0-693.60.1.el7.ppc64le.rpm kernel-headers-3.10.0-693.60.1.el7.ppc64le.rpm kernel-tools-3.10.0-693.60.1.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm kernel-tools-libs-3.10.0-693.60.1.el7.ppc64le.rpm perf-3.10.0-693.60.1.el7.ppc64le.rpm perf-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm python-perf-3.10.0-693.60.1.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm
x86_64: kernel-3.10.0-693.60.1.el7.x86_64.rpm kernel-debug-3.10.0-693.60.1.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debug-devel-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm kernel-devel-3.10.0-693.60.1.el7.x86_64.rpm kernel-headers-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-libs-3.10.0-693.60.1.el7.x86_64.rpm perf-3.10.0-693.60.1.el7.x86_64.rpm perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm python-perf-3.10.0-693.60.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm
Red Hat Enterprise Linux Server TUS (v. 7.4):
Source: kernel-3.10.0-693.60.1.el7.src.rpm
noarch: kernel-abi-whitelists-3.10.0-693.60.1.el7.noarch.rpm kernel-doc-3.10.0-693.60.1.el7.noarch.rpm
x86_64: kernel-3.10.0-693.60.1.el7.x86_64.rpm kernel-debug-3.10.0-693.60.1.el7.x86_64.rpm kernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debug-devel-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm kernel-devel-3.10.0-693.60.1.el7.x86_64.rpm kernel-headers-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-libs-3.10.0-693.60.1.el7.x86_64.rpm perf-3.10.0-693.60.1.el7.x86_64.rpm perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm python-perf-3.10.0-693.60.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm
Red Hat Enterprise Linux Server Optional AUS (v. 7.4):
x86_64: kernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-693.60.1.el7.x86_64.rpm perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm
Red Hat Enterprise Linux Server Optional E4S (v. 7.4):
ppc64le: kernel-debug-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm kernel-debug-devel-3.10.0-693.60.1.el7.ppc64le.rpm kernel-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm kernel-debuginfo-common-ppc64le-3.10.0-693.60.1.el7.ppc64le.rpm kernel-tools-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm kernel-tools-libs-devel-3.10.0-693.60.1.el7.ppc64le.rpm perf-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm python-perf-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm
x86_64: kernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-693.60.1.el7.x86_64.rpm perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm
Red Hat Enterprise Linux Server Optional TUS (v. 7.4):
x86_64: kernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm kernel-tools-libs-devel-3.10.0-693.60.1.el7.x86_64.rpm perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm python-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm
These packages are GPG signed by Red Hat for security. Our key and details on how to verify the signature are available from https://access.redhat.com/security/team/key/
- References:
https://access.redhat.com/security/cve/CVE-2019-9506 https://access.redhat.com/security/updates/classification/#important
- Contact:
The Red Hat security contact is secalert@redhat.com. More contact details at https://access.redhat.com/security/team/contact/
Copyright 2019 Red Hat, Inc. -----BEGIN PGP SIGNATURE----- Version: GnuPG v1
iQIVAwUBXbAXitzjgjWX9erEAQh25A/9FrjeF3eVkgGwc/RvTRPF/Qqb44x+l61E KceVqzr3avw9TDoiCA8e35ZYwNBvpN6YW/VDiI0vSyj2nQp57xFK48ybhUvXGUKL A2dXn793a3ZBKIp4wVVQKyjBsAI31MT/AZDKrzlugszWlV25u/mc2tC4Yndbe+8e Lbwf2VvKdvtlH26Cadv1UN9YsnmtQuNdGp9NrRbttTCW9rMmHtkoQ/yT4rcS/7Fl 1tu2j2Yoi0GEG9wXWda7cbpd2jLCcpjwIYnrjRNOuMNVSugRKRcAY1rMwpL5dVpA rx2bi3X3HhCpGTgZSJbl9fz2f1J71o9WoUSybaT36Uc50iOs7anoHc82XPGFvkak xg+mkIVNkwGxW9pkum8tZANjhDwyGJl0bpS98zkzpNiBqdrGdN4V9qMmhqmEa/lT lQ7haJR1rqboIzS5uSpTL/a79blwDjnMNsZ3D+c6xFfjsq8yu1zGfDWBbMdoc1Zo 3CNT4+pdBr5ASdlE7R3G+8Zx77WSK2MLxRnzzHBF6KphF4LOOUJmefpZ0KQRGkN8 zOKjvsynVKSzqt++WJrij+U74KL65PZokF8kKSc0yDhgYRaeqK6QIwe+Dbn/YUsn RNBi1ZoILHB9nMxbT5OlEVf/0EJl7oD1zINT0n7S8b86gRnfHdMLlvZ1Kcfjs0Sy Vdo262+aA6k= =FkCN -----END PGP SIGNATURE-----
-- RHSA-announce mailing list RHSA-announce@redhat.com https://www.redhat.com/mailman/listinfo/rhsa-announce
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201908-1958",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "cornell-tl10b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c01e333r1p1t8\\)"
},
{
"model": "p30",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "lelandp-l22d",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "leland-tl10b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "columbia-tl00d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "8.1.0.186\\(c01gt\\)"
},
{
"model": "y6 2019",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "19.04"
},
{
"model": "tvos",
"scope": "eq",
"trust": 1.0,
"vendor": "apple",
"version": "12.4"
},
{
"model": "cairogo-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "cairogo-l22c461b153"
},
{
"model": "enterprise linux server",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.0"
},
{
"model": "princeton-tl10c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "ever-l29b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.338\\(c185e3r3p1\\)"
},
{
"model": "princeton-al10d",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.341\\(c185e1r1p9t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.325\\(c185e2r1p12t8\\)"
},
{
"model": "leland-l32c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "yale-tl00b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "berkeley-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c10e3r1p14t8\\)"
},
{
"model": "mac os x",
"scope": "eq",
"trust": 1.0,
"vendor": "apple",
"version": "10.12.6"
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.307\\(c635e4r1p13t8\\)"
},
{
"model": "virtualization host eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "4.2"
},
{
"model": "nova 3",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.7"
},
{
"model": "laya-al00ep",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.306\\(c432e4r1p11t8\\)"
},
{
"model": "figo-l31",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.158\\(c432e8r1p5t8\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.328\\(c782e10r1p9t8\\)"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "berkeley-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.332\\(c432e5r1p13t8\\)"
},
{
"model": "lelandp-l22c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "ares-al10d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.160\\(c00e160r2p5t8\\)"
},
{
"model": "y6 prime 2018",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "sydney-l21",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "18.04"
},
{
"model": "cornell-al00ind",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "8.2.0.141\\(c675custc675d1gt\\)"
},
{
"model": "leap",
"scope": "eq",
"trust": 1.0,
"vendor": "opensuse",
"version": "15.0"
},
{
"model": "paris-al00ic",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "atomu-l42",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "8.0.0.155\\(c636custc636d1\\)"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.3"
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.155\\(c10e2r3p1\\)"
},
{
"model": "madrid-tl00a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "enterprise linux",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.0"
},
{
"model": "enterprise linux aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.5"
},
{
"model": "enterprise linux for real time for nfv",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8"
},
{
"model": "florida-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.150\\(c185e6r1p5t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c636e3r1p13t8\\)"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.4"
},
{
"model": "figo-l31",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.137\\(c33e8r1p5t8\\)"
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.171\\(c10e2r3p1\\)"
},
{
"model": "leland-tl10c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "madrid-al00a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "cornell-al10ind",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.363\\(c675e2r1p9t8\\)"
},
{
"model": "nova 5i pro",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "jakarta-al00a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "yale-l21a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "cornell-al00a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.351\\(c432e5r1p13t8\\)"
},
{
"model": "nova lite 3",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.172\\(c432e2r5p1\\)"
},
{
"model": "enterprise linux tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.336\\(c636e2r1p12t8\\)"
},
{
"model": "enterprise linux for real time",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7"
},
{
"model": "sydney-l22",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "dura-tl00a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "1.0.0.176\\(c01\\)"
},
{
"model": "p20",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "y9 2019",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "potter-al00c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "florida-tl10b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.128\\(c01e112r1p6t8\\)"
},
{
"model": "sydneym-l22",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.7"
},
{
"model": "lelandp-al10b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "berkeley-tl10",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c01e333r1p1t8\\)"
},
{
"model": "ubuntu linux",
"scope": "eq",
"trust": 1.0,
"vendor": "canonical",
"version": "16.04"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.2"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "p30 pro",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.342\\(c461e1r1p9t8\\)"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.4"
},
{
"model": "figo-l23",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.160\\(c605e6r1p5t8\\)"
},
{
"model": "imanager neteco 6000",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "berkeley-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c636e4r1p13t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.328\\(c432e7r1p11t8\\)"
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c432e2r5p1\\)"
},
{
"model": "tony-tl00b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "harry-al00c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "florida-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.150\\(c636e6r1p5t8\\)"
},
{
"model": "honor 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.149\\(c675e8r2p1\\)"
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.2"
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.170\\(c185e2r5p1\\)"
},
{
"model": "nova 5",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "leland-l42c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "honor 8a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "lelandp-al10d",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "figo-tl10b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.130\\(c01e115r2p8t8\\)"
},
{
"model": "tony-al00b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.306\\(c185e2r1p13t8\\)"
},
{
"model": "london-al40ind",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "harry-al10b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "johnson-tl00d",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "alp-al00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r2p1t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.326\\(c635e2r1p11t8\\)"
},
{
"model": "p smart",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.1"
},
{
"model": "asoka-al00ax",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.1.181\\(c00e48r6p1\\)"
},
{
"model": "columbia-al10i",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.335\\(c675e8r1p9t8\\)"
},
{
"model": "sydneym-l23",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "ares-tl00c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.165\\(c01e165r2p5t8\\)"
},
{
"model": "enterprise linux for real time for nfv eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.2"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.347\\(c432e1r1p9t8\\)"
},
{
"model": "enterprise linux for real time eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.2"
},
{
"model": "katyusha-al00a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "paris-l29b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "sydneym-l01",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "florida-al20b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.128\\(c00e112r1p6t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c185e3r1p12t8\\)"
},
{
"model": "potter-al10a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "linux",
"scope": "eq",
"trust": 1.0,
"vendor": "debian",
"version": "8.0"
},
{
"model": "yale-l61c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "iphone os",
"scope": "eq",
"trust": 1.0,
"vendor": "apple",
"version": "12.4"
},
{
"model": "sydney-l22br",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "sydneym-al00",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.328\\(c432e5r1p9t8\\)"
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.170\\(c636e2r3p1\\)"
},
{
"model": "enterprise linux eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.4"
},
{
"model": "dubai-al00a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "8.2.0.190\\(c00r2p2\\)"
},
{
"model": "android",
"scope": "eq",
"trust": 1.0,
"vendor": "google",
"version": null
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c605e2r1p11t8\\)"
},
{
"model": "honor 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.143\\(c675e8r2p1\\)"
},
{
"model": "hima-l29c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "atomu-l33",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "8.0.0.147\\(c605custc605d1\\)"
},
{
"model": "enterprise linux for real time for nfv",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7"
},
{
"model": "bla-tl00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.329\\(c01e320r1p1t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.325\\(c636e7r1p13t8\\)"
},
{
"model": "dura-al00a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "1.0.0.182\\(c00\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.325\\(c636e2r1p12t8\\)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": "8.1.0.156\\(c605\\)"
},
{
"model": "p smart 2019",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "mac os x",
"scope": "eq",
"trust": 1.0,
"vendor": "apple",
"version": "10.14.5"
},
{
"model": "harry-tl00c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "enterprise linux for real time",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8"
},
{
"model": "y6 pro 2019",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "honor view 10",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "berkeley-al20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r2p1t8\\)"
},
{
"model": "johnson-tl00f",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "figo-l31",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.122\\(c09e7r1p5t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c10e5r1p14t8\\)"
},
{
"model": "yalep-al10b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "florida-l23",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c605e7r1p2t8\\)"
},
{
"model": "yale-al50a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c461e2r1p11t8\\)"
},
{
"model": "enterprise linux for real time for nfv eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.4"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.7"
},
{
"model": "enterprise linux for real time eus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.4"
},
{
"model": "honor 8x",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "figo-l31",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": "8.0.0.122d\\(c652\\)"
},
{
"model": "mate 20 x",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "cornell-al00i",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.363\\(c675e3r1p9t8\\)"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.6"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.4"
},
{
"model": "nova 4",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "leland-l42a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "sydney-al00",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "figo-l31",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.165\\(c10e8r1p5t8\\)"
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c636e2r3p1\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c461e3r1p11t8\\)"
},
{
"model": "enterprise linux server tus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.2"
},
{
"model": "leland-l32a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "neo-al00d",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "sydneym-l03",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c185e2r5p1\\)"
},
{
"model": "mac os x",
"scope": "eq",
"trust": 1.0,
"vendor": "apple",
"version": "10.13.6"
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.300\\(c605e2r1p12t8\\)"
},
{
"model": "lelandp-l22a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.325\\(c185e4r1p11t8\\)"
},
{
"model": "leland-l31a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "atomu-l41",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "8.0.0.153\\(c461custc461d1\\)"
},
{
"model": "imanager neteco",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "paris-l21b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "7.3"
},
{
"model": "mate 20 pro",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "mrg realtime",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "2.0"
},
{
"model": "y5 2018",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "yale-al00a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "sydney-tl00",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.306\\(c636e2r1p13t8\\)"
},
{
"model": "lelandp-al00c",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "sydney-l21br",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "columbia-al10b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "p20 pro",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "honor view 20",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "enterprise linux server aus",
"scope": "eq",
"trust": 1.0,
"vendor": "redhat",
"version": "8.4"
},
{
"model": "barca-al00",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "8.0.0.366\\(c00\\)"
},
{
"model": "leland-l21a",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "paris-l21meb",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "princeton-al10b",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "florida-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.150\\(c432e6r1p5t8\\)"
},
{
"model": "ares-al00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.160\\(c00e160r2p5t8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "watchos",
"scope": "eq",
"trust": 1.0,
"vendor": "apple",
"version": "5.3"
},
{
"model": "honor 10 lite",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "y5 lite",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "bla-al00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.329\\(c786e320r2p1t8\\)"
},
{
"model": "figo-l31",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.137\\(c530e8r1p5t8\\)"
},
{
"model": "leap",
"scope": "eq",
"trust": 1.0,
"vendor": "opensuse",
"version": "15.1"
},
{
"model": "y7 2019",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "sydneym-l21",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "blackberry",
"version": null
},
{
"model": null,
"scope": null,
"trust": 0.8,
"vendor": "bluetooth sig",
"version": null
},
{
"model": "br/edr core",
"scope": "lte",
"trust": 0.8,
"vendor": "bluetooth sig",
"version": "v5.1"
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#918987"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-007618"
},
{
"db": "NVD",
"id": "CVE-2019-9506"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/a:misc:bluetooth_br_edr_core",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-007618"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Red Hat",
"sources": [
{
"db": "PACKETSTORM",
"id": "156058"
},
{
"db": "PACKETSTORM",
"id": "155121"
},
{
"db": "PACKETSTORM",
"id": "157216"
},
{
"db": "PACKETSTORM",
"id": "155017"
},
{
"db": "PACKETSTORM",
"id": "155004"
},
{
"db": "PACKETSTORM",
"id": "154879"
},
{
"db": "PACKETSTORM",
"id": "154936"
},
{
"db": "PACKETSTORM",
"id": "154949"
}
],
"trust": 0.8
},
"cve": "CVE-2019-9506",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "ADJACENT_NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.8,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 6.5,
"id": "CVE-2019-9506",
"impactScore": 4.9,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 1.1,
"vectorString": "AV:A/AC:L/Au:N/C:P/I:P/A:N",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "LOW",
"accessVector": "ADJACENT NETWORK",
"authentication": "NONE",
"author": "NVD",
"availabilityImpact": "NONE",
"availabilityRequirement": "NOT DEFINED",
"baseScore": 7.8,
"collateralDamagePotential": "NOT DEFINED",
"confidentialityImpact": "COMPLETE",
"confidentialityRequirement": "NOT DEFINED",
"enviromentalScore": 7.8,
"exploitability": "NOT DEFINED",
"exploitabilityScore": 6.5,
"id": "CVE-2019-9506",
"impactScore": 9.2,
"integrityImpact": "COMPLETE",
"integrityRequirement": "NOT DEFINED",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"remediationLevel": "NOT DEFINED",
"reportConfidence": "NOT DEFINED",
"severity": "HIGH",
"targetDistribution": "NOT DEFINED",
"trust": 0.8,
"userInteractionRequired": null,
"vector_string": "AV:A/AC:L/Au:N/C:C/I:C/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "ADJACENT_NETWORK",
"authentication": "NONE",
"author": "VULHUB",
"availabilityImpact": "NONE",
"baseScore": 4.8,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 6.5,
"id": "VHN-160941",
"impactScore": 4.9,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 0.1,
"vectorString": "AV:A/AC:L/AU:N/C:P/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "ADJACENT",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 8.1,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 2.8,
"id": "CVE-2019-9506",
"impactScore": 5.2,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:A/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:N",
"version": "3.1"
},
{
"attackComplexity": "LOW",
"attackVector": "ADJACENT",
"author": "cret@cert.org",
"availabilityImpact": "LOW",
"baseScore": 7.6,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 2.8,
"id": "CVE-2019-9506",
"impactScore": 4.7,
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:U/C:H/I:L/A:L",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-9506",
"trust": 1.0,
"value": "HIGH"
},
{
"author": "cret@cert.org",
"id": "CVE-2019-9506",
"trust": 1.0,
"value": "HIGH"
},
{
"author": "NVD",
"id": "CVE-2019-9506",
"trust": 0.8,
"value": "HIGH"
},
{
"author": "CNNVD",
"id": "CNNVD-201908-864",
"trust": 0.6,
"value": "HIGH"
},
{
"author": "VULHUB",
"id": "VHN-160941",
"trust": 0.1,
"value": "MEDIUM"
},
{
"author": "VULMON",
"id": "CVE-2019-9506",
"trust": 0.1,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#918987"
},
{
"db": "VULHUB",
"id": "VHN-160941"
},
{
"db": "VULMON",
"id": "CVE-2019-9506"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-864"
},
{
"db": "NVD",
"id": "CVE-2019-9506"
},
{
"db": "NVD",
"id": "CVE-2019-9506"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "The Bluetooth BR/EDR specification up to and including version 5.1 permits sufficiently low encryption key length and does not prevent an attacker from influencing the key length negotiation. This allows practical brute-force attacks (aka \"KNOB\") that can decrypt traffic and inject arbitrary ciphertext without the victim noticing. Bluetooth BR/EDR The entropy negotiation of the encryption key used for encryption on the connection has a problem that is vulnerable to man-in-the-middle attacks by design. A third party Bluetooth BR/EDR The entropy of the encryption key used for communication 1 Force byte (Key Negotiation Of Bluetooth (KNOB) attack) Brute force attacks on subsequent communications (Brute force attack) May be able to decrypt and intercept the contents. Bluetooth Is Bluetooth Basic Rate / Enhanced Data Rate (Bluetooth BR/EDR) Includes core configuration 6 A short-range wireless technology based on different core specifications and used for low-power short-range communications. Bluetooth To establish encrypted communication for 2 Horn Bluetooth You need to establish a link key that the device will pair and use to generate the encryption key used for encryption at the link layer. The entropy of the encryption key is 1 From bytes 16 In bytes length Bluetooth Set between controllers. When an attacker interrupts the encryption key entropy setting request between controllers and each controller accepts a low entropy setting, encrypted communication with low entropy is forced, resulting in a brute force attack (Brute force attack) Because of this, communication between devices may be easily decrypted.Man-in-the-middle attacks (man-in-the-middle attack) There is a possibility of eavesdropping on encrypted communication by. An encryption issue vulnerability exists in Bluetooth BR/EDR 5.1 and earlier versions. The vulnerability stems from incorrect use of relevant cryptographic algorithms by network systems or products, resulting in improperly encrypted content, weak encryption, and storing sensitive information in plain text. The attack must be performed during negotiation or renegotiation of a paired device connection; existing sessions cannot be attacked. \nThis advisory will be updated as additional information becomes available. There are no workarounds that address this vulnerability. \n\nThis advisory is available at the following link:\ntools.cisco.com/security/center/content/CiscoSecurityAdvisory/cisco-sa-20190813-bluetooth. 8.0) - aarch64, noarch, ppc64le, s390x, x86_64\n\n3. \n\nBug Fix(es):\n\n* Backport TCP follow-up for small buffers (BZ#1739184)\n\n* TCP performance regression after CVE-2019-11478 bug fix (BZ#1743170)\n\n* RHEL8.0 - bnx2x link down, caused by transmit timeouts during load test\n(Marvell/Cavium/QLogic) (L3:) (BZ#1743548)\n\n* block: blk-mq improvement (BZ#1780567)\n\n* RHEL8.0 - Regression to RHEL7.6 by changing force_latency found during\nRHEL8.0 validation for SAP HANA on POWER (BZ#1781111)\n\n* blk-mq: overwirte performance drops on real MQ device (BZ#1782183)\n\n* RHEL8: creating vport takes lot of memory i.e 2GB per vport which leads\nto drain out system memory quickly. (BZ#1782705)\n\n4. 8) - x86_64\n\n3. Description:\n\nThe kernel-rt packages provide the Real Time Linux Kernel, which enables\nfine-tuning for systems with extremely high determinism requirements. \n\nSecurity Fix(es):\n\n* kernel: nfs: use-after-free in svc_process_common() (CVE-2018-16884)\n\n* Kernel: vhost_net: infinite loop while receiving packets leads to DoS\n(CVE-2019-3900)\n\n* Kernel: page cache side channel attacks (CVE-2019-5489)\n\n* hardware: bluetooth: BR/EDR encryption key negotiation attacks (KNOB)\n(CVE-2019-9506)\n\n* kernel: Heap overflow in mwifiex_uap_parse_tail_ies function in\ndrivers/net/wireless/marvell/mwifiex/ie.c (CVE-2019-10126)\n\n* Kernel: KVM: OOB memory access via mmio ring buffer (CVE-2019-14821)\n\n* kernel: Information Disclosure in crypto_report_one in\ncrypto/crypto_user.c (CVE-2018-19854)\n\n* kernel: usb: missing size check in the __usb_get_extra_descriptor()\nleading to DoS (CVE-2018-20169)\n\n* kernel: Heap address information leak while using L2CAP_GET_CONF_OPT\n(CVE-2019-3459)\n\n* kernel: Heap address information leak while using L2CAP_PARSE_CONF_RSP\n(CVE-2019-3460)\n\n* kernel: SCTP socket buffer memory leak leading to denial of service\n(CVE-2019-3874)\n\n* kernel: denial of service vector through vfio DMA mappings\n(CVE-2019-3882)\n\n* kernel: null-pointer dereference in hci_uart_set_flow_control\n(CVE-2019-10207)\n\n* kernel: fix race condition between mmget_not_zero()/get_task_mm() and\ncore dumping (CVE-2019-11599)\n\n* kernel: fs/ext4/extents.c leads to information disclosure\n(CVE-2019-11833)\n\n* kernel: sensitive information disclosure from kernel stack memory via\nHIDPCONNADD command (CVE-2019-11884)\n\n* kernel: use-after-free in arch/x86/lib/insn-eval.c (CVE-2019-13233)\n\n* kernel: memory leak in register_queue_kobjects() in net/core/net-sysfs.c\nleads to denial of service (CVE-2019-15916)\n\n* kernel: oob memory read in hso_probe in drivers/net/usb/hso.c\n(CVE-2018-19985)\n\n* Kernel: KVM: leak of uninitialized stack contents to guest\n(CVE-2019-7222)\n\n* Kernel: net: weak IP ID generation leads to remote device tracking\n(CVE-2019-10638)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, acknowledgments, and other related information, refer to the CVE\npage(s) listed in the References section. Bugs fixed (https://bugzilla.redhat.com/):\n\n1656986 - CVE-2018-19854 kernel: Information Disclosure in crypto_report_one in crypto/crypto_user.c\n1660375 - CVE-2018-16884 kernel: nfs: use-after-free in svc_process_common()\n1660385 - CVE-2018-20169 kernel: usb: missing size check in the __usb_get_extra_descriptor() leading to DoS\n1663176 - CVE-2019-3459 kernel: Heap address information leak while using L2CAP_GET_CONF_OPT\n1663179 - CVE-2019-3460 kernel: Heap address information leak while using L2CAP_PARSE_CONF_RSP\n1664110 - CVE-2019-5489 Kernel: page cache side channel attacks\n1666106 - CVE-2018-19985 kernel: oob memory read in hso_probe in drivers/net/usb/hso.c\n1671930 - CVE-2019-7222 Kernel: KVM: leak of uninitialized stack contents to guest\n1678887 - RT: update RT source tree to the RHEL-8.1 tree\n1686373 - CVE-2019-3874 kernel: SCTP socket buffer memory leak leading to denial of service\n1689426 - CVE-2019-3882 kernel: denial of service vector through vfio DMA mappings\n1698757 - CVE-2019-3900 Kernel: vhost_net: infinite loop while receiving packets leads to DoS\n1700666 - Make kernel-rt require rt-setup\n1705937 - CVE-2019-11599 kernel: fix race condition between mmget_not_zero()/get_task_mm() and core dumping\n1709837 - CVE-2019-11884 kernel: sensitive information disclosure from kernel stack memory via HIDPCONNADD command\n1712072 - CVE-2019-11833 kernel: fs/ext4/extents.c leads to information disclosure\n1716992 - CVE-2019-10126 kernel: Heap overflow in mwifiex_uap_parse_tail_ies function in drivers/net/wireless/marvell/mwifiex/ie.c\n1724657 - BUG: scheduling while atomic in zswap\n1727756 - CVE-2019-13233 kernel: use-after-free in arch/x86/lib/insn-eval.c\n1727857 - CVE-2019-9506 hardware: bluetooth: BR/EDR encryption key negotiation attacks (KNOB)\n1728765 - BUG: scheduling while atomic: rcuc/13/134/0x00000002\n1729931 - CVE-2019-10638 Kernel: net: weak IP ID generation leads to remote device tracking\n1733472 - BUG: scheduling while atomic: rcuc/1/24/0x00000002\n1733874 - CVE-2019-10207 kernel: null-pointer dereference in hci_uart_set_flow_control\n1743931 - BUG: unable to handle kernel NULL pointer dereference at 0000000000000020\n1745646 - [RT] sched/fair: Robustify CFS-bandwidth timer locking\n1746708 - CVE-2019-14821 Kernel: KVM: OOB memory access via mmio ring buffer\n1750813 - CVE-2019-15916 kernel: memory leak in register_queue_kobjects() in net/core/net-sysfs.c leads to denial of service\n\n6. \n\nBug Fix(es):\n\n* port show-kabi to python3 (BZ#1806924)\n\n4. 7.6) - ppc64le, x86_64\n\n3. Description:\n\nThis is a kernel live patch module which is automatically loaded by the RPM\npost-install script to modify the code of a running kernel. Solution:\n\nBefore applying this update, make sure all previously released errata\nrelevant to your system have been applied. \n\nBug Fix(es):\n\n* kernel build: parallelize redhat/mod-sign.sh (BZ#1755326)\n\n4. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\nAPPLE-SA-2019-8-13-1 Additional information for\nAPPLE-SA-2019-7-22-2 macOS Mojave 10.14.6, Security Update\n2019-004 High Sierra, Security Update 2019-004 Sierra\n\nmacOS Mojave 10.14.6, Security Update 2019-004 High Sierra,\nSecurity Update 2019-004 Sierra address the\nfollowing:\n\nAppleGraphicsControl\nAvailable for: macOS Mojave 10.14.5\nImpact: An application may be able to read restricted memory\nDescription: A validation issue was addressed with improved input\nsanitization. \nCVE-2019-8693: Arash Tohidi of Solita\n\nautofs\nAvailable for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS\nMojave 10.14.5\nImpact: Extracting a zip file containing a symbolic link to an\nendpoint in an NFS mount that is attacker controlled may bypass\nGatekeeper\nDescription: This was addressed with additional checks by Gatekeeper\non files mounted through a network share. \nCVE-2019-8656: Filippo Cavallarin\n\nBluetooth\nAvailable for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS\nMojave 10.14.5\nImpact: A remote attacker may be able to cause arbitrary code\nexecution\nDescription: A memory corruption issue was addressed with improved\ninput validation. \nCVE-2018-19860\n\nBluetooth\nAvailable for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS\nMojave 10.14.5\nImpact: An attacker in a privileged network position may be able to\nintercept Bluetooth traffic (Key Negotiation of Bluetooth - KNOB)\nDescription: An input validation issue existed in Bluetooth. This\nissue was addressed with improved input validation. \nCVE-2019-9506: Daniele Antonioli of SUTD, Singapore, Dr. Nils Ole\nTippenhauer of CISPA, Germany, and Prof. Kasper Rasmussen of\nUniversity of Oxford, England\nEntry added August 13, 2019\n\nCarbon Core\nAvailable for: macOS Mojave 10.14.5\nImpact: A remote attacker may be able to cause arbitrary code\nexecution\nDescription: A use after free issue was addressed with improved\nmemory management. \nCVE-2019-8661: Natalie Silvanovich of Google Project Zero\n\nCore Data\nAvailable for: macOS Mojave 10.14.5\nImpact: A remote attacker may be able to leak memory\nDescription: An out-of-bounds read was addressed with improved input\nvalidation. \nCVE-2019-8646: Natalie Silvanovich of Google Project Zero\n\nCore Data\nAvailable for: macOS Mojave 10.14.5\nImpact: A remote attacker may be able to cause unexpected application\ntermination or arbitrary code execution\nDescription: A memory corruption issue was addressed with improved\ninput validation. \nCVE-2019-8660: Samuel Gro\u00df and Natalie Silvanovich of Google Project\nZero\n\nDisk Management\nAvailable for: macOS Mojave 10.14.5\nImpact: An application may be able to execute arbitrary code with\nsystem privileges\nDescription: A memory corruption issue was addressed with improved\nmemory handling. \nCVE-2019-8697: ccpwd working with Trend Micro\u0027s Zero Day Initiative\n\nFaceTime\nAvailable for: macOS Mojave 10.14.5\nImpact: A remote attacker may be able to cause arbitrary code\nexecution\nDescription: A memory corruption issue was addressed with improved\ninput validation. \nCVE-2019-8648: Tao Huang and Tielei Wang of Team Pangu\n\nFound in Apps\nAvailable for: macOS Mojave 10.14.5\nImpact: A remote attacker may be able to leak memory\nDescription: This issue was addressed with improved checks. \nCVE-2019-8663: Natalie Silvanovich of Google Project Zero\n\nFoundation\nAvailable for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS\nMojave 10.14.5\nImpact: A remote attacker may be able to cause unexpected application\ntermination or arbitrary code execution\nDescription: An out-of-bounds read was addressed with improved input\nvalidation. \nCVE-2019-8641: Samuel Gro\u00df and Natalie Silvanovich of Google Project\nZero\n\nGrapher\nAvailable for: macOS Mojave 10.14.5\nImpact: An application may be able to execute arbitrary code with\nsystem privileges\nDescription: A memory corruption issue was addressed with improved\nmemory handling. \nCVE-2019-8695: riusksk of VulWar Corp working with Trend Micro\u0027s Zero\nDay Initiative\n\nGraphics Drivers\nAvailable for: macOS High Sierra 10.13.6, macOS Mojave 10.14.5\nImpact: An application may be able to read restricted memory\nDescription: A validation issue was addressed with improved input\nsanitization. \nCVE-2019-8691: Aleksandr Tarasikov (@astarasikov), Arash Tohidi of\nSolita, Lilang Wu and Moony Li of Trend Micro\u0027s Mobile Security\nResearch Team working with Trend Micro\u0027s Zero Day Initiative\nCVE-2019-8692: Lilang Wu and Moony Li of Trend Micro Mobile Security\nResearch Team working with Trend Micro\u0027s Zero Day Initiative\n\nHeimdal\nAvailable for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS\nMojave 10.14.5\nImpact: An issue existed in Samba that may allow attackers to perform\nunauthorized actions by intercepting communications between services\nDescription: This issue was addressed with improved checks to prevent\nunauthorized actions. \nCVE-2018-16860: Isaac Boukris and Andrew Bartlett of the Samba Team\nand Catalyst\n\nIOAcceleratorFamily\nAvailable for: macOS Mojave 10.14.5\nImpact: An application may be able to execute arbitrary code with\nkernel privileges\nDescription: A memory corruption issue was addressed with improved\nmemory handling. \nCVE-2019-8694: Arash Tohidi of Solita\n\nlibxslt\nAvailable for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS\nMojave 10.14.5\nImpact: A remote attacker may be able to view sensitive information\nDescription: A stack overflow was addressed with improved input\nvalidation. \nCVE-2019-13118: found by OSS-Fuzz\n\nQuick Look\nAvailable for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS\nMojave 10.14.5\nImpact: An attacker may be able to trigger a use-after-free in an\napplication deserializing an untrusted NSDictionary\nDescription: This issue was addressed with improved checks. \nCVE-2019-8662: Natalie Silvanovich and Samuel Gro\u00df of Google Project\nZero\n\nSecurity\nAvailable for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6\nImpact: An application may be able to execute arbitrary code with\nsystem privileges\nDescription: A memory corruption issue was addressed with improved\nmemory handling. \nCVE-2019-8697: ccpwd working with Trend Micro\u0027s Zero Day Initiative\n\nSiri\nAvailable for: macOS Mojave 10.14.5\nImpact: A remote attacker may be able to leak memory\nDescription: An out-of-bounds read was addressed with improved input\nvalidation. \nCVE-2019-8646: Natalie Silvanovich of Google Project Zero\n\nTime Machine\nAvailable for: macOS Mojave 10.14.5\nImpact: The encryption status of a Time Machine backup may be\nincorrect\nDescription: An inconsistent user interface issue was addressed with\nimproved state management. \nCVE-2019-8667: Roland Kletzing of cyber:con GmbH\n\nUIFoundation\nAvailable for: macOS Sierra 10.12.6, macOS High Sierra 10.13.6, macOS\nMojave 10.14.5\nImpact: Parsing a maliciously crafted office document may lead to an\nunexpected application termination or arbitrary code execution\nDescription: An out-of-bounds read was addressed with improved input\nvalidation. \nCVE-2019-8657: riusksk of VulWar Corp working with Trend Micro\u0027s Zero\nDay Initiative\n\nAdditional recognition\n\nClassroom\nWe would like to acknowledge Jeff Johnson of underpassapp.com for\ntheir assistance. \n\nGame Center\nWe would like to acknowledge Min (Spark) Zheng and Xiaolong Bai of\nAlibaba Inc. for their assistance. \n\nInstallation note:\n\nmacOS Mojave 10.14.6, Security Update 2019-004 High Sierra,\nSecurity Update 2019-004 Sierra may be obtained from the\nMac App Store or Apple\u0027s Software Downloads web site:\nhttps://support.apple.com/downloads/\n\nInformation will also be posted to the Apple Security Updates\nweb site: https://support.apple.com/kb/HT201222\n\nThis message is signed with Apple\u0027s Product Security PGP key,\nand details are available at:\nhttps://www.apple.com/support/security/pgp/\n-----BEGIN PGP SIGNATURE-----\n\niQJdBAEBCABHFiEEDNXJVNCJJEAVmJdZeC9tht7TK3EFAl1S688pHHByb2R1Y3Qt\nc2VjdXJpdHktbm9yZXBseUBsaXN0cy5hcHBsZS5jb20ACgkQeC9tht7TK3Hiog/+\nPcWPEhxDpnU1ctoVPhyoqkV1tUs8z3hdNyX/tPtQZIQVFB7No1Md0GX8Zrv2libb\nLwrbU25ewe82XE9Es6ngxTdkRaREn8+hm9gxYPCMDXyKRlv904Q1b4zthYUt7/NO\n7RG6ZRHEINOQORzrDsmgT/X6TukIy73HNob+4xZJTdJe9ZU3/zDCaqUgyUJSodou\nvsVFR3oqkwbVby4eT9+YbxJWMvVoFfB1+Qqo1w9kN7WXcYK3gb7sGtnNQlrE70kR\npLRogcmwTQsi+sTm8bxQsuXXjdtTHeeCf0FRJg8NY5wZmdV9lNOghtmNxfTwIuir\nVeWusIgZWaK7IbgHW3PRYv3Sbrk40zcOraDsPv2rdgjOj4ReVyKHw5/f5Fyhcn+v\nWnIC4iNIBurz0HZU91QqD58Sqp+HtWl8xkM3ZW+Kd9LjnLty3fNw6Au5Aw8DTHzN\n5F+lz7JRVV3+j7AYELog3WV6mdzMKW85gJRJtwXJ8hHSYZnvat06faFlPcDiKjBW\nrW7BehRykZpmZtaSZjL25IeOuXJHHdRfvabuTZ3nk47SSn7EJJ3xFBnvw6TgVFX+\nTvmcUg5FinTSR81NkIY0ux6x1kuV/4vIUGZ4O0Houf/FoUhMQvig9ZkSw2B+Ynbd\nXl3qBT4SVPWQyFAvjHwjCZA+GpNsnEKgZm8SlYVgqog=\n=tCwo\n-----END PGP SIGNATURE-----\n. \n\nBug Fix(es):\n\n* kernel-rt: update to the RHEL7.7.z batch#2 source tree (BZ#1748570)\n\n4. -----BEGIN PGP SIGNED MESSAGE-----\nHash: SHA256\n\n=====================================================================\n Red Hat Security Advisory\n\nSynopsis: Important: kernel security and bug fix update\nAdvisory ID: RHSA-2019:3187-01\nProduct: Red Hat Enterprise Linux\nAdvisory URL: https://access.redhat.com/errata/RHSA-2019:3187\nIssue date: 2019-10-23\nCVE Names: CVE-2019-9506 \n=====================================================================\n\n1. Summary:\n\nAn update for kernel is now available for Red Hat Enterprise Linux 7.4\nAdvanced Update Support, Red Hat Enterprise Linux 7.4 Telco Extended Update\nSupport, and Red Hat Enterprise Linux 7.4 Update Services for SAP\nSolutions. \n\nRed Hat Product Security has rated this update as having a security impact\nof Important. A Common Vulnerability Scoring System (CVSS) base score,\nwhich gives a detailed severity rating, is available for each vulnerability\nfrom the CVE link(s) in the References section. \n\n2. Relevant releases/architectures:\n\nRed Hat Enterprise Linux Server AUS (v. 7.4) - noarch, x86_64\nRed Hat Enterprise Linux Server E4S (v. 7.4) - noarch, ppc64le, x86_64\nRed Hat Enterprise Linux Server Optional AUS (v. 7.4) - x86_64\nRed Hat Enterprise Linux Server Optional E4S (v. 7.4) - ppc64le, x86_64\nRed Hat Enterprise Linux Server Optional TUS (v. 7.4) - x86_64\nRed Hat Enterprise Linux Server TUS (v. 7.4) - noarch, x86_64\n\n3. Description:\n\nThe kernel packages contain the Linux kernel, the core of any Linux\noperating system. \n\nSecurity Fix(es):\n\n* hardware: bluetooth: BR/EDR encryption key negotiation attacks (KNOB)\n(CVE-2019-9506)\n\nFor more details about the security issue(s), including the impact, a CVSS\nscore, acknowledgments, and other related information, refer to the CVE\npage(s) listed in the References section. \n\nBug Fix(es):\n\n* Fix possible Spectre-v1 bugs in wireless code (BZ#1706696)\n\n* powerpc/pseries: Disable CPU hotplug across migrations / powerpc/rtas:\nFix a potential race between CPU-Offline \u0026 Migration (LPM) (BZ#1745436)\n\n* powerpc/pseries: Fix unitialized timer reset on migration /\npowerpc/pseries/mobility: Extend start/stop topology update scope (LPM)\n(BZ#1745438)\n\n* ISST-LTE:PVM:Zeppelin :LPM: Failure logs and stack trace seen during LPM\n(POWER9/P9) (BZ#1745446)\n\n4. Solution:\n\nFor details on how to apply this update, which includes the changes\ndescribed in this advisory, refer to:\n\nhttps://access.redhat.com/articles/11258\n\nThe system must be rebooted for this update to take effect. \n\n5. Package List:\n\nRed Hat Enterprise Linux Server AUS (v. 7.4):\n\nSource:\nkernel-3.10.0-693.60.1.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-693.60.1.el7.noarch.rpm\nkernel-doc-3.10.0-693.60.1.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debug-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-devel-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-headers-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-693.60.1.el7.x86_64.rpm\nperf-3.10.0-693.60.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\npython-perf-3.10.0-693.60.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server E4S (v. 7.4):\n\nSource:\nkernel-3.10.0-693.60.1.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-693.60.1.el7.noarch.rpm\nkernel-doc-3.10.0-693.60.1.el7.noarch.rpm\n\nppc64le:\nkernel-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-bootwrapper-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-debug-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-debug-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-devel-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-headers-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-tools-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-tools-libs-3.10.0-693.60.1.el7.ppc64le.rpm\nperf-3.10.0-693.60.1.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\npython-perf-3.10.0-693.60.1.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\n\nx86_64:\nkernel-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debug-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-devel-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-headers-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-693.60.1.el7.x86_64.rpm\nperf-3.10.0-693.60.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\npython-perf-3.10.0-693.60.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server TUS (v. 7.4):\n\nSource:\nkernel-3.10.0-693.60.1.el7.src.rpm\n\nnoarch:\nkernel-abi-whitelists-3.10.0-693.60.1.el7.noarch.rpm\nkernel-doc-3.10.0-693.60.1.el7.noarch.rpm\n\nx86_64:\nkernel-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debug-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debug-devel-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-devel-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-headers-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-libs-3.10.0-693.60.1.el7.x86_64.rpm\nperf-3.10.0-693.60.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\npython-perf-3.10.0-693.60.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional AUS (v. 7.4):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-693.60.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional E4S (v. 7.4):\n\nppc64le:\nkernel-debug-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-debug-devel-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-debuginfo-common-ppc64le-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-tools-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\nkernel-tools-libs-devel-3.10.0-693.60.1.el7.ppc64le.rpm\nperf-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\npython-perf-debuginfo-3.10.0-693.60.1.el7.ppc64le.rpm\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-693.60.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\n\nRed Hat Enterprise Linux Server Optional TUS (v. 7.4):\n\nx86_64:\nkernel-debug-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-debuginfo-common-x86_64-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\nkernel-tools-libs-devel-3.10.0-693.60.1.el7.x86_64.rpm\nperf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\npython-perf-debuginfo-3.10.0-693.60.1.el7.x86_64.rpm\n\nThese packages are GPG signed by Red Hat for security. Our key and\ndetails on how to verify the signature are available from\nhttps://access.redhat.com/security/team/key/\n\n7. References:\n\nhttps://access.redhat.com/security/cve/CVE-2019-9506\nhttps://access.redhat.com/security/updates/classification/#important\n\n8. Contact:\n\nThe Red Hat security contact is \u003csecalert@redhat.com\u003e. More contact\ndetails at https://access.redhat.com/security/team/contact/\n\nCopyright 2019 Red Hat, Inc. \n-----BEGIN PGP SIGNATURE-----\nVersion: GnuPG v1\n\niQIVAwUBXbAXitzjgjWX9erEAQh25A/9FrjeF3eVkgGwc/RvTRPF/Qqb44x+l61E\nKceVqzr3avw9TDoiCA8e35ZYwNBvpN6YW/VDiI0vSyj2nQp57xFK48ybhUvXGUKL\nA2dXn793a3ZBKIp4wVVQKyjBsAI31MT/AZDKrzlugszWlV25u/mc2tC4Yndbe+8e\nLbwf2VvKdvtlH26Cadv1UN9YsnmtQuNdGp9NrRbttTCW9rMmHtkoQ/yT4rcS/7Fl\n1tu2j2Yoi0GEG9wXWda7cbpd2jLCcpjwIYnrjRNOuMNVSugRKRcAY1rMwpL5dVpA\nrx2bi3X3HhCpGTgZSJbl9fz2f1J71o9WoUSybaT36Uc50iOs7anoHc82XPGFvkak\nxg+mkIVNkwGxW9pkum8tZANjhDwyGJl0bpS98zkzpNiBqdrGdN4V9qMmhqmEa/lT\nlQ7haJR1rqboIzS5uSpTL/a79blwDjnMNsZ3D+c6xFfjsq8yu1zGfDWBbMdoc1Zo\n3CNT4+pdBr5ASdlE7R3G+8Zx77WSK2MLxRnzzHBF6KphF4LOOUJmefpZ0KQRGkN8\nzOKjvsynVKSzqt++WJrij+U74KL65PZokF8kKSc0yDhgYRaeqK6QIwe+Dbn/YUsn\nRNBi1ZoILHB9nMxbT5OlEVf/0EJl7oD1zINT0n7S8b86gRnfHdMLlvZ1Kcfjs0Sy\nVdo262+aA6k=\n=FkCN\n-----END PGP SIGNATURE-----\n\n--\nRHSA-announce mailing list\nRHSA-announce@redhat.com\nhttps://www.redhat.com/mailman/listinfo/rhsa-announce\n",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-9506"
},
{
"db": "CERT/CC",
"id": "VU#918987"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-007618"
},
{
"db": "VULHUB",
"id": "VHN-160941"
},
{
"db": "VULMON",
"id": "CVE-2019-9506"
},
{
"db": "PACKETSTORM",
"id": "156058"
},
{
"db": "PACKETSTORM",
"id": "155121"
},
{
"db": "PACKETSTORM",
"id": "157216"
},
{
"db": "PACKETSTORM",
"id": "155017"
},
{
"db": "PACKETSTORM",
"id": "155004"
},
{
"db": "PACKETSTORM",
"id": "154054"
},
{
"db": "PACKETSTORM",
"id": "154879"
},
{
"db": "PACKETSTORM",
"id": "154936"
},
{
"db": "PACKETSTORM",
"id": "154949"
}
],
"trust": 3.33
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-9506",
"trust": 3.5
},
{
"db": "CERT/CC",
"id": "VU#918987",
"trust": 3.4
},
{
"db": "PACKETSTORM",
"id": "157216",
"trust": 0.8
},
{
"db": "JVN",
"id": "JVNVU90240762",
"trust": 0.8
},
{
"db": "JVNDB",
"id": "JVNDB-2019-007618",
"trust": 0.8
},
{
"db": "CNNVD",
"id": "CNNVD-201908-864",
"trust": 0.7
},
{
"db": "PACKETSTORM",
"id": "156058",
"trust": 0.7
},
{
"db": "AUSCERT",
"id": "ESB-2020.0141",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.1366",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.1189",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.1366.2",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.4346",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.4346.2",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.4676",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.0262",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.3115",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.4252",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2020.1338",
"trust": 0.6
},
{
"db": "AUSCERT",
"id": "ESB-2019.4584",
"trust": 0.6
},
{
"db": "LENOVO",
"id": "LEN-27173",
"trust": 0.6
},
{
"db": "PACKETSTORM",
"id": "155017",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "154949",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "154936",
"trust": 0.2
},
{
"db": "PACKETSTORM",
"id": "155004",
"trust": 0.2
},
{
"db": "VULHUB",
"id": "VHN-160941",
"trust": 0.1
},
{
"db": "VULMON",
"id": "CVE-2019-9506",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "155121",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "154054",
"trust": 0.1
},
{
"db": "PACKETSTORM",
"id": "154879",
"trust": 0.1
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#918987"
},
{
"db": "VULHUB",
"id": "VHN-160941"
},
{
"db": "VULMON",
"id": "CVE-2019-9506"
},
{
"db": "PACKETSTORM",
"id": "156058"
},
{
"db": "PACKETSTORM",
"id": "155121"
},
{
"db": "PACKETSTORM",
"id": "157216"
},
{
"db": "PACKETSTORM",
"id": "155017"
},
{
"db": "PACKETSTORM",
"id": "155004"
},
{
"db": "PACKETSTORM",
"id": "154054"
},
{
"db": "PACKETSTORM",
"id": "154879"
},
{
"db": "PACKETSTORM",
"id": "154936"
},
{
"db": "PACKETSTORM",
"id": "154949"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-864"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-007618"
},
{
"db": "NVD",
"id": "CVE-2019-9506"
}
]
},
"id": "VAR-201908-1958",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VULHUB",
"id": "VHN-160941"
}
],
"trust": 0.6336539924999999
},
"last_update_date": "2025-12-22T22:47:45.218000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "Key Negotiation of Bluetooth",
"trust": 0.8,
"url": "https://www.bluetooth.com/security/statement-key-negotiation-of-bluetooth/"
},
{
"title": "The building blocks of all Bluetooth devices",
"trust": 0.8,
"url": "https://www.bluetooth.com/specifications/"
},
{
"title": "Keep up to date with Errata",
"trust": 0.8,
"url": "https://www.bluetooth.com/specifications/errata/"
},
{
"title": "Bluetooth Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=96553"
},
{
"title": "The Register",
"trust": 0.2,
"url": "https://www.theregister.co.uk/2019/08/22/cisco_patch_bundle/"
},
{
"title": "Red Hat: Important: kernel security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193187 - Security Advisory"
},
{
"title": "Red Hat: Important: kpatch-patch security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193231 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20192975 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel-rt security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193165 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193218 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20201460 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193220 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel-rt security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193089 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193055 - Security Advisory"
},
{
"title": "Red Hat: Important: kernel-alt security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193217 - Security Advisory"
},
{
"title": "Red Hat: Important: kpatch-patch security update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193076 - Security Advisory"
},
{
"title": "Red Hat: CVE-2019-9506",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_cve_database\u0026qid=CVE-2019-9506"
},
{
"title": "Cisco: Key Negotiation of Bluetooth Vulnerability",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=cisco_security_advisories_and_alerts_ciscoproducts\u0026qid=cisco-sa-20190813-bluetooth"
},
{
"title": "HP: HPSBPI03634 rev. 1 - HP OfficeJet Mobile and Sprocket Printers KNOB Vulnerability",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=hp_bulletin\u0026qid=HPSBPI03634"
},
{
"title": "Red Hat: Important: kernel security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20200204 - Security Advisory"
},
{
"title": "HP: SUPPORT COMMUNICATION- SECURITY BULLETIN\nHPSBPI03634 rev. 1 - HP OfficeJet Mobile and Sprocket Printers KNOB Vulnerability",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=hp_bulletin\u0026qid=814c3d5b0bc03fc1c34e62dbc5cf6bf7"
},
{
"title": "HP: SUPPORT COMMUNICATION- SECURITY BULLETIN\nHPSBPI03634 rev. 1 - HP OfficeJet Mobile and Sprocket Printers KNOB Vulnerability",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=hp_bulletin\u0026qid=20bba81176880ee641f9d46354adc125"
},
{
"title": "Red Hat: Important: kernel security, bug fix, and enhancement update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193517 - Security Advisory"
},
{
"title": "Huawei Security Advisories: Security Advisory - Key Negotiation of Bluetooth (KNOB) Vulnerability",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=huawei_security_advisories\u0026qid=4da976eef66883f5331725800e5cf063"
},
{
"title": "Red Hat: Important: kernel-rt security and bug fix update",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=red_hat_security_advisories\u0026qid=RHSA-20193309 - Security Advisory"
},
{
"title": "Ubuntu Security Notice: linux, linux-aws, linux-azure, linux-gcp, linux-gke-5.0, linux-hwe, linux-kvm, linux-raspi2, linux-snapdragon vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-4147-1"
},
{
"title": "Fortinet Security Advisories: CVE-2019-9506 Encryption Key Negotiation of Bluetooth Vulnerability",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=fortinet_security_advisories\u0026qid=FG-IR-19-224"
},
{
"title": "Ubuntu Security Notice: linux, linux-aws, linux-aws-hwe, linux-azure, linux-gcp, linux-gke-4.15, linux-hwe, linux-kvm, linux-oracle, linux-raspi2 regression",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-4115-2"
},
{
"title": "Ubuntu Security Notice: linux, linux-azure, linux-gcp, linux-gke-4.15, linux-hwe, linux-kvm, linux-oracle, linux-raspi2 vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-4115-1"
},
{
"title": "Ubuntu Security Notice: linux-aws vulnerabilities",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=ubuntu_security_notice\u0026qid=USN-4118-1"
},
{
"title": "knob",
"trust": 0.1,
"url": "https://github.com/francozappa/knob "
},
{
"title": "bluetooth-KNOB",
"trust": 0.1,
"url": "https://github.com/u10427687/bluetooth-KNOB "
},
{
"title": "",
"trust": 0.1,
"url": "https://github.com/makaubenson/Fix-BT-Ubuntu "
},
{
"title": "broadcom-bt-firmware",
"trust": 0.1,
"url": "https://github.com/winterheart/broadcom-bt-firmware "
},
{
"title": "broadcom-bt-firmware",
"trust": 0.1,
"url": "https://github.com/AlexandrBing/broadcom-bt-firmware "
},
{
"title": "Protocol-Vul",
"trust": 0.1,
"url": "https://github.com/WinMin/Protocol-Vul "
},
{
"title": "awesome-bluetooth-security",
"trust": 0.1,
"url": "https://github.com/engn33r/awesome-bluetooth-security "
},
{
"title": "",
"trust": 0.1,
"url": "https://github.com/JeffroMF/awesome-bluetooth-security321 "
},
{
"title": "PoC-in-GitHub",
"trust": 0.1,
"url": "https://github.com/developer3000S/PoC-in-GitHub "
},
{
"title": "CVE-POC",
"trust": 0.1,
"url": "https://github.com/0xT11/CVE-POC "
},
{
"title": "",
"trust": 0.1,
"url": "https://github.com/vincent-deng/veracode-container-security-finding-parser "
},
{
"title": "PoC-in-GitHub",
"trust": 0.1,
"url": "https://github.com/hectorgie/PoC-in-GitHub "
},
{
"title": "PoC-in-GitHub",
"trust": 0.1,
"url": "https://github.com/nomi-sec/PoC-in-GitHub "
},
{
"title": "Symantec Threat Intelligence Blog",
"trust": 0.1,
"url": "https://www.symantec.com/blogs/threat-intelligence/microsoft-patch-tuesday-august-2019"
},
{
"title": "Threatpost",
"trust": 0.1,
"url": "https://threatpost.com/cisco-patches-six-critical-bugs/147585/"
},
{
"title": "Threatpost",
"trust": 0.1,
"url": "https://threatpost.com/lenovo-warns-bugs-thinkpads/147338/"
},
{
"title": "Threatpost",
"trust": 0.1,
"url": "https://threatpost.com/wormable-remote-desktop-bugs-august-patch-tuesday/147302/"
},
{
"title": "BleepingComputer",
"trust": 0.1,
"url": "https://www.bleepingcomputer.com/news/security/new-bluetooth-knob-flaw-lets-attackers-manipulate-traffic/"
},
{
"title": "BleepingComputer",
"trust": 0.1,
"url": "https://www.bleepingcomputer.com/news/security/new-bluetooth-knob-flaw-lets-attackers-manipulate-connections/"
}
],
"sources": [
{
"db": "VULMON",
"id": "CVE-2019-9506"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-864"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-007618"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-310",
"trust": 1.1
},
{
"problemtype": "CWE-327",
"trust": 1.1
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-160941"
},
{
"db": "NVD",
"id": "CVE-2019-9506"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.6,
"url": "https://www.kb.cert.org/vuls/id/918987/"
},
{
"trust": 2.6,
"url": "https://www.usenix.org/conference/usenixsecurity19/presentation/antonioli"
},
{
"trust": 2.5,
"url": "https://access.redhat.com/errata/rhsa-2020:0204"
},
{
"trust": 2.0,
"url": "https://access.redhat.com/errata/rhsa-2019:3187"
},
{
"trust": 1.9,
"url": "https://access.redhat.com/errata/rhsa-2019:3089"
},
{
"trust": 1.9,
"url": "https://access.redhat.com/errata/rhsa-2019:3165"
},
{
"trust": 1.9,
"url": "https://access.redhat.com/errata/rhsa-2019:3218"
},
{
"trust": 1.9,
"url": "https://access.redhat.com/errata/rhsa-2019:3231"
},
{
"trust": 1.9,
"url": "https://access.redhat.com/errata/rhsa-2019:3309"
},
{
"trust": 1.8,
"url": "http://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190828-01-knob-en"
},
{
"trust": 1.8,
"url": "https://www.bluetooth.com/security/statement-key-negotiation-of-bluetooth/"
},
{
"trust": 1.8,
"url": "http://seclists.org/fulldisclosure/2019/aug/11"
},
{
"trust": 1.8,
"url": "http://seclists.org/fulldisclosure/2019/aug/13"
},
{
"trust": 1.8,
"url": "http://seclists.org/fulldisclosure/2019/aug/14"
},
{
"trust": 1.8,
"url": "http://seclists.org/fulldisclosure/2019/aug/15"
},
{
"trust": 1.8,
"url": "http://www.cs.ox.ac.uk/publications/publication12404-abstract.html"
},
{
"trust": 1.8,
"url": "https://lists.debian.org/debian-lts-announce/2019/09/msg00014.html"
},
{
"trust": 1.8,
"url": "https://lists.debian.org/debian-lts-announce/2019/09/msg00015.html"
},
{
"trust": 1.8,
"url": "https://lists.debian.org/debian-lts-announce/2019/09/msg00025.html"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2019:2975"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2019:3055"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2019:3076"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2019:3217"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2019:3220"
},
{
"trust": 1.8,
"url": "https://access.redhat.com/errata/rhsa-2019:3517"
},
{
"trust": 1.8,
"url": "http://lists.opensuse.org/opensuse-security-announce/2019-10/msg00037.html"
},
{
"trust": 1.8,
"url": "http://lists.opensuse.org/opensuse-security-announce/2019-10/msg00036.html"
},
{
"trust": 1.8,
"url": "https://usn.ubuntu.com/4115-1/"
},
{
"trust": 1.8,
"url": "https://usn.ubuntu.com/4118-1/"
},
{
"trust": 1.8,
"url": "https://usn.ubuntu.com/4147-1/"
},
{
"trust": 1.6,
"url": "https://www.bluetooth.com/security/statement-key-negotiation-of-bluetooth"
},
{
"trust": 1.5,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-9506"
},
{
"trust": 0.9,
"url": "https://github.com/francozappa/knob"
},
{
"trust": 0.8,
"url": "https://www.bluetooth.com/specifications/adopted-specifications"
},
{
"trust": 0.8,
"url": "https://www.usenix.org/system/files/sec19-antonioli.pdf"
},
{
"trust": 0.8,
"url": "https://www.icasi.org/br-edr-encryption-key-bluetooth-vulnerability/"
},
{
"trust": 0.8,
"url": "http://support.blackberry.com/kb/articledetail?articlenumber=000057251"
},
{
"trust": 0.8,
"url": "https://access.redhat.com/security/updates/classification/#important"
},
{
"trust": 0.8,
"url": "https://access.redhat.com/articles/11258"
},
{
"trust": 0.8,
"url": "https://access.redhat.com/security/team/contact/"
},
{
"trust": 0.8,
"url": "https://www.redhat.com/mailman/listinfo/rhsa-announce"
},
{
"trust": 0.8,
"url": "https://bugzilla.redhat.com/):"
},
{
"trust": 0.8,
"url": "https://access.redhat.com/security/cve/cve-2019-9506"
},
{
"trust": 0.8,
"url": "https://access.redhat.com/security/team/key/"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-9506"
},
{
"trust": 0.8,
"url": "https://jvn.jp/vu/jvnvu90240762/"
},
{
"trust": 0.7,
"url": "https://tools.cisco.com/security/center/content/ciscosecurityadvisory/cisco-sa-20190813-bluetooth"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20193294-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20193295-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192984-1.html"
},
{
"trust": 0.6,
"url": "https://www.intel.com/content/www/us/en/security-center/advisory/intel-sa-00237.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20193200-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192953-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192952-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192951-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192950-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192949-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192948-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192947-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2019/suse-su-20192946-1.html"
},
{
"trust": 0.6,
"url": "https://www.suse.com/support/update/announcement/2020/suse-su-20200093-1.html"
},
{
"trust": 0.6,
"url": "https://packetstormsecurity.com/files/157216/red-hat-security-advisory-2020-1460-01.html"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.1338/"
},
{
"trust": 0.6,
"url": "https://portal.msrc.microsoft.com/zh-cn/security-guidance/advisory/cve-2019-9506"
},
{
"trust": 0.6,
"url": "https://support.lenovo.com/us/en/product_security/len-27173"
},
{
"trust": 0.6,
"url": "https://support.apple.com/en-us/ht210353"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.4676/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.4346/"
},
{
"trust": 0.6,
"url": "https://support.apple.com/en-us/ht210346"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.4252/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.4584/"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20190828-01-knob-cn"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.0141/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.0262/"
},
{
"trust": 0.6,
"url": "https://packetstormsecurity.com/files/156058/red-hat-security-advisory-2020-0204-01.html"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.3115/"
},
{
"trust": 0.6,
"url": "https://vigilance.fr/vulnerability/bluetooth-br-edr-information-disclosure-via-key-negotiation-30041"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2019.4346.2/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.1189/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.1366/"
},
{
"trust": 0.6,
"url": "https://www.auscert.org.au/bulletins/esb-2020.1366.2/"
},
{
"trust": 0.3,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-10126"
},
{
"trust": 0.3,
"url": "https://access.redhat.com/security/cve/cve-2019-10126"
},
{
"trust": 0.2,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5489"
},
{
"trust": 0.2,
"url": "https://access.redhat.com/security/cve/cve-2018-16884"
},
{
"trust": 0.2,
"url": "https://access.redhat.com/security/cve/cve-2019-14821"
},
{
"trust": 0.2,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-14821"
},
{
"trust": 0.2,
"url": "https://access.redhat.com/security/cve/cve-2019-5489"
},
{
"trust": 0.2,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-3900"
},
{
"trust": 0.2,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-16884"
},
{
"trust": 0.2,
"url": "https://access.redhat.com/security/cve/cve-2019-3900"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/327.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
},
{
"trust": 0.1,
"url": "https://www.kb.cert.org/vuls/id/918987"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-0154"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-0154"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-12207"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-11135"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-0155"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-0155"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-14901"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-14816"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-14901"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/vulnerabilities/ifu-page-mce"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-12207"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-14816"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-11135"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-11884"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-11884"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-3459"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-7222"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-3874"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-10207"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-19985"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-13233"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-19854"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-10207"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-3882"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-11599"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-3874"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-13233"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-11599"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-20169"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-20169"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-15916"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-3460"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-3460"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-10638"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-7222"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-19985"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-11833"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-19854"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-10638"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-15916"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-3882"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/documentation/en-us/red_hat_enterprise_linux/8/html/8.1_release_notes/"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-11833"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-3459"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/errata/rhsa-2020:1460"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8691"
},
{
"trust": 0.1,
"url": "https://support.apple.com/kb/ht201222"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-16860"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8695"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8692"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8646"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8694"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-13118"
},
{
"trust": 0.1,
"url": "https://support.apple.com/downloads/"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8693"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8663"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8656"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8648"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8641"
},
{
"trust": 0.1,
"url": "https://www.apple.com/support/security/pgp/"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8660"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8657"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8667"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-19860"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8697"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8662"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-8661"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2019-3846"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-20856"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-3846"
},
{
"trust": 0.1,
"url": "https://access.redhat.com/security/cve/cve-2018-20856"
}
],
"sources": [
{
"db": "CERT/CC",
"id": "VU#918987"
},
{
"db": "VULHUB",
"id": "VHN-160941"
},
{
"db": "VULMON",
"id": "CVE-2019-9506"
},
{
"db": "PACKETSTORM",
"id": "156058"
},
{
"db": "PACKETSTORM",
"id": "155121"
},
{
"db": "PACKETSTORM",
"id": "157216"
},
{
"db": "PACKETSTORM",
"id": "155017"
},
{
"db": "PACKETSTORM",
"id": "155004"
},
{
"db": "PACKETSTORM",
"id": "154054"
},
{
"db": "PACKETSTORM",
"id": "154879"
},
{
"db": "PACKETSTORM",
"id": "154936"
},
{
"db": "PACKETSTORM",
"id": "154949"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-864"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-007618"
},
{
"db": "NVD",
"id": "CVE-2019-9506"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CERT/CC",
"id": "VU#918987"
},
{
"db": "VULHUB",
"id": "VHN-160941"
},
{
"db": "VULMON",
"id": "CVE-2019-9506"
},
{
"db": "PACKETSTORM",
"id": "156058"
},
{
"db": "PACKETSTORM",
"id": "155121"
},
{
"db": "PACKETSTORM",
"id": "157216"
},
{
"db": "PACKETSTORM",
"id": "155017"
},
{
"db": "PACKETSTORM",
"id": "155004"
},
{
"db": "PACKETSTORM",
"id": "154054"
},
{
"db": "PACKETSTORM",
"id": "154879"
},
{
"db": "PACKETSTORM",
"id": "154936"
},
{
"db": "PACKETSTORM",
"id": "154949"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-864"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-007618"
},
{
"db": "NVD",
"id": "CVE-2019-9506"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-08-14T00:00:00",
"db": "CERT/CC",
"id": "VU#918987"
},
{
"date": "2019-08-14T00:00:00",
"db": "VULHUB",
"id": "VHN-160941"
},
{
"date": "2019-08-14T00:00:00",
"db": "VULMON",
"id": "CVE-2019-9506"
},
{
"date": "2020-01-23T00:26:55",
"db": "PACKETSTORM",
"id": "156058"
},
{
"date": "2019-11-06T15:33:55",
"db": "PACKETSTORM",
"id": "155121"
},
{
"date": "2020-04-14T15:40:41",
"db": "PACKETSTORM",
"id": "157216"
},
{
"date": "2019-10-29T14:59:12",
"db": "PACKETSTORM",
"id": "155017"
},
{
"date": "2019-10-29T14:48:28",
"db": "PACKETSTORM",
"id": "155004"
},
{
"date": "2019-08-14T18:32:22",
"db": "PACKETSTORM",
"id": "154054"
},
{
"date": "2019-10-16T15:06:37",
"db": "PACKETSTORM",
"id": "154879"
},
{
"date": "2019-10-22T17:27:00",
"db": "PACKETSTORM",
"id": "154936"
},
{
"date": "2019-10-23T18:29:02",
"db": "PACKETSTORM",
"id": "154949"
},
{
"date": "2019-08-13T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201908-864"
},
{
"date": "2019-08-16T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-007618"
},
{
"date": "2019-08-14T17:15:11.597000",
"db": "NVD",
"id": "CVE-2019-9506"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-05-15T00:00:00",
"db": "CERT/CC",
"id": "VU#918987"
},
{
"date": "2021-11-04T00:00:00",
"db": "VULHUB",
"id": "VHN-160941"
},
{
"date": "2021-11-04T00:00:00",
"db": "VULMON",
"id": "CVE-2019-9506"
},
{
"date": "2021-11-05T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201908-864"
},
{
"date": "2019-08-16T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-007618"
},
{
"date": "2024-11-21T04:51:45.113000",
"db": "NVD",
"id": "CVE-2019-9506"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote or local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-864"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Bluetooth BR/EDR supported devices are vulnerable to key negotiation attacks",
"sources": [
{
"db": "CERT/CC",
"id": "VU#918987"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "encryption problem",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-864"
}
],
"trust": 0.6
}
}
VAR-202008-1252
Vulnerability from variot - Updated: 2025-01-19 23:30There is an improper authorization vulnerability in some Huawei smartphones. An attacker could perform a series of operation in specific mode to exploit this vulnerability. Successful exploit could allow the attacker to bypass app lock. (Vulnerability ID: HWPSIRT-2019-12144)
This vulnerability has been assigned a Common Vulnerabilities and Exposures (CVE) ID: CVE-2020-9081. Mate 20 firmware, P30 firmware, P30 Pro firmware etc. Huawei The product contains an incorrect authentication vulnerability.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202008-1252",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "princeton-al10d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p11\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p8\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c01e160r2p8\\)"
},
{
"model": "yalep-al10b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r8p12\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p11\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r3p8\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c01e160r2p8\\)"
},
{
"model": "yale-al50a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.88\\(c00e88r8p1\\)"
},
{
"model": "yale-al00a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r8p12\\)"
},
{
"model": "p30 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "princeton-al10d",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "yale-al50a",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "yalep-al10b",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "yale-al00a",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-018356"
},
{
"db": "NVD",
"id": "CVE-2020-9081"
}
]
},
"cve": "CVE-2020-9081",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "psirt@huawei.com",
"availabilityImpact": "NONE",
"baseScore": 3.5,
"baseSeverity": "LOW",
"confidentialityImpact": "LOW",
"exploitabilityScore": 0.9,
"id": "CVE-2020-9081",
"impactScore": 2.5,
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:L/I:L/A:N",
"version": "3.1"
},
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 6.8,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 0.9,
"id": "CVE-2020-9081",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 6.8,
"baseSeverity": "Medium",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2020-9081",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "psirt@huawei.com",
"id": "CVE-2020-9081",
"trust": 1.0,
"value": "LOW"
},
{
"author": "nvd@nist.gov",
"id": "CVE-2020-9081",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2020-9081",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNNVD",
"id": "CNNVD-202008-1321",
"trust": 0.6,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-018356"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-1321"
},
{
"db": "NVD",
"id": "CVE-2020-9081"
},
{
"db": "NVD",
"id": "CVE-2020-9081"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There is an improper authorization vulnerability in some Huawei smartphones. An attacker could perform a series of operation in specific mode to exploit this vulnerability. Successful exploit could allow the attacker to bypass app lock. (Vulnerability ID: HWPSIRT-2019-12144)\n\n\n\nThis vulnerability has been assigned a Common Vulnerabilities and Exposures (CVE) ID: CVE-2020-9081. Mate 20 firmware, P30 firmware, P30 Pro firmware etc. Huawei The product contains an incorrect authentication vulnerability.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9081"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-018356"
}
],
"trust": 1.62
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-9081",
"trust": 3.2
},
{
"db": "JVNDB",
"id": "JVNDB-2020-018356",
"trust": 0.8
},
{
"db": "CNNVD",
"id": "CNNVD-202008-1321",
"trust": 0.6
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-018356"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-1321"
},
{
"db": "NVD",
"id": "CVE-2020-9081"
}
]
},
"id": "VAR-202008-1252",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VARIoT devices database",
"id": null
}
],
"trust": 0.579064925
},
"last_update_date": "2025-01-19T23:30:55.116000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "Huawei product security vulnerabilities repair measures",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=126964"
}
],
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202008-1321"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-285",
"trust": 1.0
},
{
"problemtype": "CWE-863",
"trust": 1.0
},
{
"problemtype": "Inappropriate authorization (CWE-285) [ others ]",
"trust": 0.8
},
{
"problemtype": " Illegal authentication (CWE-863) [NVD evaluation ]",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-018356"
},
{
"db": "NVD",
"id": "CVE-2020-9081"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/2020/huawei-sa-20200826-15-smartphone-en"
},
{
"trust": 0.8,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-9081"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200826-15-smartphone-cn"
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-018356"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-1321"
},
{
"db": "NVD",
"id": "CVE-2020-9081"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "JVNDB",
"id": "JVNDB-2020-018356"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-1321"
},
{
"db": "NVD",
"id": "CVE-2020-9081"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2025-01-16T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-018356"
},
{
"date": "2020-08-26T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202008-1321"
},
{
"date": "2024-12-27T10:15:10.937000",
"db": "NVD",
"id": "CVE-2020-9081"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2025-01-16T09:13:00",
"db": "JVNDB",
"id": "JVNDB-2020-018356"
},
{
"date": "2021-01-05T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202008-1321"
},
{
"date": "2025-01-10T20:37:44.267000",
"db": "NVD",
"id": "CVE-2020-9081"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural \u00a0Huawei\u00a0 Fraudulent Authentication Vulnerability in Products",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-018356"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "other",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202008-1321"
}
],
"trust": 0.6
}
}
VAR-201906-0114
Vulnerability from variot - Updated: 2024-11-23 23:11Mate20 Huawei smartphones versions earlier than HMA-AL00C00B175 have an out-of-bounds read vulnerability. An attacker with a high permission runs some specific commands on the smartphone. Due to insufficient input verification, successful exploit may cause out-of-bounds read of the memory and the system abnormal. Huawei Mate20 Smartphones contain a vulnerability related to out-of-bounds reading.Service operation interruption (DoS) There is a possibility of being put into a state. HuaweiMate20 is a smartphone from China's Huawei company. The vulnerability stems from a failure to adequately verify user input that could allow an attacker to cause a device exception
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201906-0114",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "hma-al00c00b175"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 0.8,
"vendor": "huawei",
"version": "hma-al00c00b175"
},
{
"model": "mate20 \u003chma-al00c00b175",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-04937"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"db": "NVD",
"id": "CVE-2019-5296"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Huawei internal testing",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201902-789"
}
],
"trust": 0.6
},
"cve": "CVE-2019-5296",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "SINGLE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 1.7,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.1,
"id": "CVE-2019-5296",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.8,
"vectorString": "AV:L/AC:L/Au:S/C:N/I:N/A:P",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "COMPLETE",
"baseScore": 4.9,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CNVD-2019-04937",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:N/A:C",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 3.9,
"baseSeverity": "LOW",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.3,
"id": "CVE-2019-5296",
"impactScore": 3.6,
"integrityImpact": "NONE",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"trust": 1.8,
"userInteraction": "NONE",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:H/UI:N/S:U/C:N/I:N/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-5296",
"trust": 1.0,
"value": "LOW"
},
{
"author": "NVD",
"id": "CVE-2019-5296",
"trust": 0.8,
"value": "Low"
},
{
"author": "CNVD",
"id": "CNVD-2019-04937",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-201902-789",
"trust": 0.6,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-04937"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"db": "CNNVD",
"id": "CNNVD-201902-789"
},
{
"db": "NVD",
"id": "CVE-2019-5296"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Mate20 Huawei smartphones versions earlier than HMA-AL00C00B175 have an out-of-bounds read vulnerability. An attacker with a high permission runs some specific commands on the smartphone. Due to insufficient input verification, successful exploit may cause out-of-bounds read of the memory and the system abnormal. Huawei Mate20 Smartphones contain a vulnerability related to out-of-bounds reading.Service operation interruption (DoS) There is a possibility of being put into a state. HuaweiMate20 is a smartphone from China\u0027s Huawei company. The vulnerability stems from a failure to adequately verify user input that could allow an attacker to cause a device exception",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-5296"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"db": "CNVD",
"id": "CNVD-2019-04937"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-5296",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2019-005141",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2019-04937",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201902-789",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-04937"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"db": "CNNVD",
"id": "CNNVD-201902-789"
},
{
"db": "NVD",
"id": "CVE-2019-5296"
}
]
},
"id": "VAR-201906-0114",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-04937"
}
],
"trust": 1.35
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"Network device"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-04937"
}
]
},
"last_update_date": "2024-11-23T23:11:51.674000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20190220-01-phone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190220-01-phone-en"
},
{
"title": "HuaweiMate20 Buffer Overflow Vulnerability Patch",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/154133"
},
{
"title": "Huawei Mate20 Buffer error vulnerability fix",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=89584"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-04937"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"db": "CNNVD",
"id": "CNNVD-201902-789"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-125",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"db": "NVD",
"id": "CVE-2019-5296"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190220-01-phone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5296"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-5296"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20190220-01-phone-cn"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-04937"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"db": "CNNVD",
"id": "CNNVD-201902-789"
},
{
"db": "NVD",
"id": "CVE-2019-5296"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2019-04937"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"db": "CNNVD",
"id": "CNNVD-201902-789"
},
{
"db": "NVD",
"id": "CVE-2019-5296"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-02-22T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-04937"
},
{
"date": "2019-06-17T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"date": "2019-02-20T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201902-789"
},
{
"date": "2019-06-04T18:29:00.910000",
"db": "NVD",
"id": "CVE-2019-5296"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-02-22T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-04937"
},
{
"date": "2019-06-17T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-005141"
},
{
"date": "2019-06-06T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201902-789"
},
{
"date": "2024-11-21T04:44:41.633000",
"db": "NVD",
"id": "CVE-2019-5296"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Huawei Mate20 Smartphone out-of-bounds vulnerability",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-005141"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "buffer error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201902-789"
}
],
"trust": 0.6
}
}
VAR-201911-0830
Vulnerability from variot - Updated: 2024-11-23 23:11P30, Mate 20, P30 Pro smartphones with software of versions earlier than ELLE-AL00B 9.1.0.193(C00E190R1P21), versions earlier than Hima-AL00B 9.1.0.135(C00E200R2P1), versions earlier than VOGUE-AL00A 9.1.0.193(C00E190R1P12) have a buffer overflow vulnerability on several , the system does not properly validate certain length parameter which an application transports to kernel. An attacker tricks the user to install a malicious application, successful exploit could cause malicious code execution. Huawei P30 and others are all smartphones of China's Huawei company
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201911-0830",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "vogue-al00a_9.1.0.193\\(c00e190r1p12\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "hima-al00b_9.1.0.135\\(c00e200r2p1\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "elle-al00b_9.1.0.193\\(c00e190r1p21\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 0.8,
"vendor": "huawei",
"version": "hima-al00b 9.1.0.135(c00e200r2p1)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 0.8,
"vendor": "huawei",
"version": "vogue-al00a 9.1.0.193(c00e190r1p12)"
},
{
"model": "p30",
"scope": "lt",
"trust": 0.8,
"vendor": "huawei",
"version": "elle-al00b 9.1.0.193(c00e190r1p21)"
},
{
"model": "p30 \u003celle-al00b 9.1.0.193",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro \u003cvogue-al00a 9.1.0.193",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "mate \u003chima-al00b 9.1.0.135",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-41838"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"db": "NVD",
"id": "CVE-2019-5225"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:p30_pro_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:p30_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "The vulnerability was discovered by an external researcher.",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-1747"
}
],
"trust": 0.6
},
"cve": "CVE-2019-5225",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 6.8,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 8.6,
"id": "CVE-2019-5225",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 1.8,
"vectorString": "AV:N/AC:M/Au:N/C:P/I:P/A:P",
"version": "2.0"
},
{
"accessComplexity": "HIGH",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "COMPLETE",
"baseScore": 6.2,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 1.9,
"id": "CNVD-2019-41838",
"impactScore": 10.0,
"integrityImpact": "COMPLETE",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:L/AC:H/Au:N/C:C/I:C/A:C",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 1.8,
"id": "CVE-2019-5225",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Local",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 7.8,
"baseSeverity": "High",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2019-5225",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "Required",
"vectorString": "CVSS:3.0/AV:L/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-5225",
"trust": 1.0,
"value": "HIGH"
},
{
"author": "NVD",
"id": "CVE-2019-5225",
"trust": 0.8,
"value": "High"
},
{
"author": "CNVD",
"id": "CNVD-2019-41838",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-201908-1747",
"trust": 0.6,
"value": "HIGH"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-41838"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1747"
},
{
"db": "NVD",
"id": "CVE-2019-5225"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "P30, Mate 20, P30 Pro smartphones with software of versions earlier than ELLE-AL00B 9.1.0.193(C00E190R1P21), versions earlier than Hima-AL00B 9.1.0.135(C00E200R2P1), versions earlier than VOGUE-AL00A 9.1.0.193(C00E190R1P12) have a buffer overflow vulnerability on several , the system does not properly validate certain length parameter which an application transports to kernel. An attacker tricks the user to install a malicious application, successful exploit could cause malicious code execution. Huawei P30 and others are all smartphones of China\u0027s Huawei company",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-5225"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"db": "CNVD",
"id": "CNVD-2019-41838"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-5225",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012618",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2019-41838",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1747",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-41838"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1747"
},
{
"db": "NVD",
"id": "CVE-2019-5225"
}
]
},
"id": "VAR-201911-0830",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-41838"
}
],
"trust": 1.4316259699999998
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-41838"
}
]
},
"last_update_date": "2024-11-23T23:11:37.914000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20190821-02-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190821-02-smartphone-en"
},
{
"title": "Patch for Huawei P30, Mate 20, and P30 Pro Buffer Overflow Vulnerabilities",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/191711"
},
{
"title": "Huawei P30 , Mate 20 and P30 Pro Buffer error vulnerability fix",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=97331"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-41838"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1747"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-120",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"db": "NVD",
"id": "CVE-2019-5225"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190821-02-smartphone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5225"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20190821-02-smartphone-cn"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-5225"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-41838"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1747"
},
{
"db": "NVD",
"id": "CVE-2019-5225"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2019-41838"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1747"
},
{
"db": "NVD",
"id": "CVE-2019-5225"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-11-22T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-41838"
},
{
"date": "2019-12-09T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"date": "2019-08-21T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201908-1747"
},
{
"date": "2019-11-29T20:15:11.753000",
"db": "NVD",
"id": "CVE-2019-5225"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-11-22T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-41838"
},
{
"date": "2019-12-09T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-012618"
},
{
"date": "2019-12-09T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201908-1747"
},
{
"date": "2024-11-21T04:44:33.507000",
"db": "NVD",
"id": "CVE-2019-5225"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-1747"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural Classic Buffer Overflow Vulnerability in Smartphone Products",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012618"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "buffer error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-1747"
}
],
"trust": 0.6
}
}
VAR-201912-0803
Vulnerability from variot - Updated: 2024-11-23 23:11There is a path traversal vulnerability in several Huawei smartphones. The system does not sufficiently validate certain pathnames from the application. An attacker could trick the user into installing, backing up and restoring a malicious application. Successful exploit could cause information disclosure. plural Huawei Smartphone products contain a paste traversal vulnerability.Information may be obtained. Huawei P30 and other products are products of China's Huawei. The Huawei P30 is a smartphone. Huawei P30 Pro is a smartphone. Huawei M6 is a tablet. The vulnerability stems from the system's failure to adequately verify the path name from an application. information
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201912-0803",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "enjoy 7s",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.130\\(c00e115r2p8t8\\)"
},
{
"model": "honor v10",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r2p1t8\\)"
},
{
"model": "m6",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.1.150\\(c00e150r1p150\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.139\\(c00e133r3p1\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.226\\(c00e210r2p1\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.226\\(c00e220r2p1\\)"
},
{
"model": "honor 9 lite",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.143\\(c636e5r1p5t8\\)"
},
{
"model": "honor 9i",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.120\\(c00e113r1p6t8\\)"
},
{
"model": "honor 20s",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.1.132\\(c00e131r6p1\\)"
},
{
"model": "honor 9 lite",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.130\\(c00e112r2p10t8\\)"
},
{
"model": "enjoy 7s",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "honor 20s",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "honor 9 lite",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "honor 9i",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "honor 10",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "m6",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "honor \u003c9.1.0.333",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "v10"
},
{
"model": "p30 \u003c9.1.0.226",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "enjoy 7s",
"scope": "lt",
"trust": 0.6,
"vendor": "huawei",
"version": "9.1.0.130"
},
{
"model": "mate \u003c9.1.0.139",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "honor lite \u003c9.1.0.130",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "9"
},
{
"model": "honor lite \u003c9.1.0.143",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "9"
},
{
"model": "honor 9i \u003c9.1.0.120",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "m6 \u003c9.1.1.150",
"scope": null,
"trust": 0.6,
"vendor": "ibaby",
"version": null
},
{
"model": "p30 pro \u003c9.1.0.226",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "honor 20s \u003c9.1.1.132",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02966"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"db": "NVD",
"id": "CVE-2019-5251"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:enjoy_7s_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:honor_20s_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:honor_9_lite_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:honor_9i_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:honor_10_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:m6_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:p30_pro_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:p30_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "The vulnerability was discovered by an external researcher. Huawei thanks the researcher for cooperating with us to disclose the vulnerability to protect Huawei\u0027s customers.",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201912-175"
}
],
"trust": 0.6
},
"cve": "CVE-2019-5251",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.3,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 8.6,
"id": "CVE-2019-5251",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 1.8,
"vectorString": "AV:N/AC:M/Au:N/C:P/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "MEDIUM",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 4.3,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 8.6,
"id": "CNVD-2020-02966",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:N/AC:M/Au:N/C:P/I:N/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 1.8,
"id": "CVE-2019-5251",
"impactScore": 3.6,
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:N/UI:R/S:U/C:H/I:N/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Local",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 5.5,
"baseSeverity": "Medium",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2019-5251",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "Required",
"vectorString": "CVSS:3.0/AV:L/AC:L/PR:N/UI:R/S:U/C:H/I:N/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-5251",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2019-5251",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2020-02966",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-201912-175",
"trust": 0.6,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02966"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"db": "CNNVD",
"id": "CNNVD-201912-175"
},
{
"db": "NVD",
"id": "CVE-2019-5251"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There is a path traversal vulnerability in several Huawei smartphones. The system does not sufficiently validate certain pathnames from the application. An attacker could trick the user into installing, backing up and restoring a malicious application. Successful exploit could cause information disclosure. plural Huawei Smartphone products contain a paste traversal vulnerability.Information may be obtained. Huawei P30 and other products are products of China\u0027s Huawei. The Huawei P30 is a smartphone. Huawei P30 Pro is a smartphone. Huawei M6 is a tablet. The vulnerability stems from the system\u0027s failure to adequately verify the path name from an application. information",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-5251"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"db": "CNVD",
"id": "CNVD-2020-02966"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-5251",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2019-013191",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-02966",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201912-175",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02966"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"db": "CNNVD",
"id": "CNNVD-201912-175"
},
{
"db": "NVD",
"id": "CVE-2019-5251"
}
]
},
"id": "VAR-201912-0803",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02966"
}
],
"trust": 1.281329055
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02966"
}
]
},
"last_update_date": "2024-11-23T23:11:36.711000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20191204-03-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20191204-03-smartphone-en"
},
{
"title": "Patch for Multiple Huawei Product Path Traversal Vulnerabilities",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/197281"
},
{
"title": "Multiple Huawei Product path traversal vulnerability fixes",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=103979"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02966"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"db": "CNNVD",
"id": "CNNVD-201912-175"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-22",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"db": "NVD",
"id": "CVE-2019-5251"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5251"
},
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20191204-03-smartphone-en"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-5251"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20191204-03-smartphone-cn"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02966"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"db": "CNNVD",
"id": "CNNVD-201912-175"
},
{
"db": "NVD",
"id": "CVE-2019-5251"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-02966"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"db": "CNNVD",
"id": "CNNVD-201912-175"
},
{
"db": "NVD",
"id": "CVE-2019-5251"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-01-20T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-02966"
},
{
"date": "2019-12-23T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"date": "2019-12-04T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201912-175"
},
{
"date": "2019-12-13T15:15:11.317000",
"db": "NVD",
"id": "CVE-2019-5251"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-01-21T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-02966"
},
{
"date": "2019-12-23T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-013191"
},
{
"date": "2020-09-03T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201912-175"
},
{
"date": "2024-11-21T04:44:36.387000",
"db": "NVD",
"id": "CVE-2019-5251"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201912-175"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural Huawei Vulnerability of past traversal in smartphone products",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-013191"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "path traversal",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201912-175"
}
],
"trust": 0.6
}
}
VAR-202010-1173
Vulnerability from variot - Updated: 2024-11-23 23:11There is an information disclosure vulnerability in several smartphones. The device does not sufficiently validate the identity of smart wearable device in certain specific scenario, the attacker need to gain certain information in the victim's smartphone to launch the attack, and successful exploit could cause information disclosure.Affected product versions include:HUAWEI Mate 20 versions earlier than 10.1.0.160(C00E160R3P8),versions earlier than 10.1.0.160(C01E160R2P8);HUAWEI Mate 20 X versions earlier than 10.1.0.160(C00E160R2P8),versions earlier than 10.1.0.160(C01E160R2P8);HUAWEI P30 Pro versions earlier than 10.1.0.160(C00E160R2P8);Laya-AL00EP versions earlier than 10.1.0.160(C786E160R3P8);Tony-AL00B versions earlier than 10.1.0.160(C00E160R2P11);Tony-TL00B versions earlier than 10.1.0.160(C01E160R2P11). plural Huawei Smartphone products contain vulnerabilities related to inadequate verification of data reliability.Information may be obtained. Huawei P30 Pro, etc. are all smart phones of China's Huawei (Huawei) company. The vulnerability stems from insufficient verification of the identity of the smart wearable device in a specific scenario. The attacker needs to obtain specific information in the victim's mobile phone before launching an attack
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202010-1173",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate \u003c10.1.0.160",
"scope": "eq",
"trust": 1.2,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate \u003c10.1.0.160",
"scope": "eq",
"trust": 1.2,
"vendor": "huawei",
"version": "20x"
},
{
"model": "tony-al00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p11\\)"
},
{
"model": "mate 20 x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c01e160r2p8\\)"
},
{
"model": "tony-tl00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c01e160r2p11\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r3p8\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c01e160r2p8\\)"
},
{
"model": "laya-al00ep",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c786e160r3p8\\)"
},
{
"model": "mate 20 x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p8\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p8\\)"
},
{
"model": "laya-al00ep",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20 x",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "tony-al00b",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "tony-tl00b",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro \u003c10.1.0.160",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "laya-al00ep \u003c10.1.0.160",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "tony-al00b \u003c10.1.0.160",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "tony-tl00b \u003c10.1.0.160",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-68354"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"db": "NVD",
"id": "CVE-2020-9109"
}
]
},
"cve": "CVE-2020-9109",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 1.9,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.4,
"id": "CVE-2020-9109",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.9,
"vectorString": "AV:L/AC:M/Au:N/C:P/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-68354",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.6,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 0.9,
"id": "CVE-2020-9109",
"impactScore": 3.6,
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 4.6,
"baseSeverity": "Medium",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2020-9109",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-9109",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2020-9109",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2020-68354",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202009-1687",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "VULMON",
"id": "CVE-2020-9109",
"trust": 0.1,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-68354"
},
{
"db": "VULMON",
"id": "CVE-2020-9109"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-1687"
},
{
"db": "NVD",
"id": "CVE-2020-9109"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There is an information disclosure vulnerability in several smartphones. The device does not sufficiently validate the identity of smart wearable device in certain specific scenario, the attacker need to gain certain information in the victim\u0027s smartphone to launch the attack, and successful exploit could cause information disclosure.Affected product versions include:HUAWEI Mate 20 versions earlier than 10.1.0.160(C00E160R3P8),versions earlier than 10.1.0.160(C01E160R2P8);HUAWEI Mate 20 X versions earlier than 10.1.0.160(C00E160R2P8),versions earlier than 10.1.0.160(C01E160R2P8);HUAWEI P30 Pro versions earlier than 10.1.0.160(C00E160R2P8);Laya-AL00EP versions earlier than 10.1.0.160(C786E160R3P8);Tony-AL00B versions earlier than 10.1.0.160(C00E160R2P11);Tony-TL00B versions earlier than 10.1.0.160(C01E160R2P11). plural Huawei Smartphone products contain vulnerabilities related to inadequate verification of data reliability.Information may be obtained. Huawei P30 Pro, etc. are all smart phones of China\u0027s Huawei (Huawei) company. The vulnerability stems from insufficient verification of the identity of the smart wearable device in a specific scenario. The attacker needs to obtain specific information in the victim\u0027s mobile phone before launching an attack",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9109"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"db": "CNVD",
"id": "CNVD-2020-68354"
},
{
"db": "VULMON",
"id": "CVE-2020-9109"
}
],
"trust": 2.25
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-9109",
"trust": 3.1
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012335",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-68354",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202009-1687",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2020-9109",
"trust": 0.1
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-68354"
},
{
"db": "VULMON",
"id": "CVE-2020-9109"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-1687"
},
{
"db": "NVD",
"id": "CVE-2020-9109"
}
]
},
"id": "VAR-202010-1173",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-68354"
}
],
"trust": 1.0955000125
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-68354"
}
]
},
"last_update_date": "2024-11-23T23:11:15.887000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200930-01-dos",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200930-01-dos-en"
},
{
"title": "Patch for Information Disclosure Vulnerabilities in Multiple Huawei Products (CNVD-2020-68354)",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/241534"
},
{
"title": "HUAWEI Mate 20 and HUAWEI Mate 20 X and HUAWEI P30 Pro and HUAWEI Mate 20 RS And glory Magic2 Repair measures for data forgery problem vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=131165"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-68354"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-1687"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-287",
"trust": 1.0
},
{
"problemtype": "Inadequate verification of data reliability (CWE-345) [NVD Evaluation ]",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"db": "NVD",
"id": "CVE-2020-9109"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.7,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200930-01-dos-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-9109"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200930-01-dos-cn"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/345.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
},
{
"trust": 0.1,
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/189257"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-68354"
},
{
"db": "VULMON",
"id": "CVE-2020-9109"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-1687"
},
{
"db": "NVD",
"id": "CVE-2020-9109"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-68354"
},
{
"db": "VULMON",
"id": "CVE-2020-9109"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-1687"
},
{
"db": "NVD",
"id": "CVE-2020-9109"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-12-02T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-68354"
},
{
"date": "2020-10-12T00:00:00",
"db": "VULMON",
"id": "CVE-2020-9109"
},
{
"date": "2021-04-30T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"date": "2020-09-30T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202009-1687"
},
{
"date": "2020-10-12T14:15:14.340000",
"db": "NVD",
"id": "CVE-2020-9109"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-12-02T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-68354"
},
{
"date": "2020-10-20T00:00:00",
"db": "VULMON",
"id": "CVE-2020-9109"
},
{
"date": "2021-04-30T07:13:00",
"db": "JVNDB",
"id": "JVNDB-2020-012335"
},
{
"date": "2020-10-21T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202009-1687"
},
{
"date": "2024-11-21T05:40:03.407000",
"db": "NVD",
"id": "CVE-2020-9109"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural \u00a0Huawei\u00a0 Insufficient verification vulnerability in data reliability in smartphone products",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-012335"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "data forgery",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202009-1687"
}
],
"trust": 0.6
}
}
VAR-201812-0944
Vulnerability from variot - Updated: 2024-11-23 23:08Huawei VIP App is a mobile app for Malaysia customers that purchased P20 Series, Nova 3/3i and Mate 20. There is a vulnerability in versions before 4.0.5 that attackers can conduct bruteforce to the VIP App Web Services to get user information. plural Huawei In product Contains an access control vulnerability.Information may be obtained. Huawei VIP App is a pre-installed membership service application for mobile phones of China Huawei (Huawei)
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201812-0944",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "vip app",
"scope": "lt",
"trust": 1.8,
"vendor": "huawei",
"version": "4.0.5"
},
{
"model": "nova 3i",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "nova 3",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "nova 3",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "nova 3i",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"db": "NVD",
"id": "CVE-2018-7956"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/a:huawei:vip_app",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:nova_3_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:nova_3i_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
}
]
},
"cve": "CVE-2018-7956",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 5.0,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 10.0,
"id": "CVE-2018-7956",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 1.8,
"vectorString": "AV:N/AC:L/Au:N/C:P/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "VULHUB",
"availabilityImpact": "NONE",
"baseScore": 5.0,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 10.0,
"id": "VHN-137988",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.1,
"vectorString": "AV:N/AC:L/AU:N/C:P/I:N/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "NETWORK",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 5.3,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "LOW",
"exploitabilityScore": 3.9,
"id": "CVE-2018-7956",
"impactScore": 1.4,
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.8,
"userInteraction": "NONE",
"vectorString": "CVSS:3.0/AV:N/AC:L/PR:N/UI:N/S:U/C:L/I:N/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2018-7956",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2018-7956",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNNVD",
"id": "CNNVD-201811-914",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "VULHUB",
"id": "VHN-137988",
"trust": 0.1,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-137988"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"db": "CNNVD",
"id": "CNNVD-201811-914"
},
{
"db": "NVD",
"id": "CVE-2018-7956"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Huawei VIP App is a mobile app for Malaysia customers that purchased P20 Series, Nova 3/3i and Mate 20. There is a vulnerability in versions before 4.0.5 that attackers can conduct bruteforce to the VIP App Web Services to get user information. plural Huawei In product Contains an access control vulnerability.Information may be obtained. Huawei VIP App is a pre-installed membership service application for mobile phones of China Huawei (Huawei)",
"sources": [
{
"db": "NVD",
"id": "CVE-2018-7956"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"db": "VULHUB",
"id": "VHN-137988"
}
],
"trust": 1.71
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2018-7956",
"trust": 2.5
},
{
"db": "JVNDB",
"id": "JVNDB-2018-014330",
"trust": 0.8
},
{
"db": "CNNVD",
"id": "CNNVD-201811-914",
"trust": 0.7
},
{
"db": "VULHUB",
"id": "VHN-137988",
"trust": 0.1
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-137988"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"db": "CNNVD",
"id": "CNNVD-201811-914"
},
{
"db": "NVD",
"id": "CVE-2018-7956"
}
]
},
"id": "VAR-201812-0944",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VULHUB",
"id": "VHN-137988"
}
],
"trust": 0.56363637
},
"last_update_date": "2024-11-23T23:08:32.125000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20181129-01-huaweivip-en",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20181129-01-huaweivip-en"
},
{
"title": "Huawei VIP App Repair measures for information disclosure vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=87337"
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"db": "CNNVD",
"id": "CNNVD-201811-914"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
},
{
"problemtype": "CWE-284",
"trust": 0.9
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-137988"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"db": "NVD",
"id": "CVE-2018-7956"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.7,
"url": "http://www.huawei.com/en/psirt/security-advisories/huawei-sa-20181129-01-huaweivip-en"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2018-7956"
},
{
"trust": 0.8,
"url": "https://nvd.nist.gov/vuln/detail/cve-2018-7956"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20181129-01-huaweivip-cn"
}
],
"sources": [
{
"db": "VULHUB",
"id": "VHN-137988"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"db": "CNNVD",
"id": "CNNVD-201811-914"
},
{
"db": "NVD",
"id": "CVE-2018-7956"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "VULHUB",
"id": "VHN-137988"
},
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"db": "CNNVD",
"id": "CNNVD-201811-914"
},
{
"db": "NVD",
"id": "CVE-2018-7956"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2018-12-04T00:00:00",
"db": "VULHUB",
"id": "VHN-137988"
},
{
"date": "2019-03-18T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"date": "2018-11-30T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201811-914"
},
{
"date": "2018-12-04T18:29:00.310000",
"db": "NVD",
"id": "CVE-2018-7956"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-10-03T00:00:00",
"db": "VULHUB",
"id": "VHN-137988"
},
{
"date": "2019-03-18T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2018-014330"
},
{
"date": "2022-03-18T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201811-914"
},
{
"date": "2024-11-21T04:13:00.997000",
"db": "NVD",
"id": "CVE-2018-7956"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201811-914"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural Huawei In product Access control vulnerability",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2018-014330"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "access control error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201811-914"
}
],
"trust": 0.6
}
}
VAR-201907-0268
Vulnerability from variot - Updated: 2024-11-23 23:01There is a Factory Reset Protection (FRP) bypass vulnerability on several smartphones. The system does not sufficiently verify the permission, an attacker could do a certain operation on certain step of setup wizard. Successful exploit could allow the attacker bypass the FRP protection. Affected products: Mate 20 X, versions earlier than Ever-AL00B 9.0.0.200(C00E200R2P1); Mate 20, versions earlier than Hima-AL00B/Hima-TL00B 9.0.0.200(C00E200R2P1); Honor Magic 2, versions earlier than Tony-AL00B/Tony-TL00B 9.0.0.182(C00E180R2P2). Huawei Mate 20 is a smartphone from China's Huawei company. The vulnerability stems from insufficient system validation
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201907-0268",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "honor magic 2",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "tony-al00b\\/tony-tl00b_9.0.0.182\\(c00e180r2p2\\)"
},
{
"model": "mate 20 x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "ever-al00b_9.0.0.200\\(c00e200r2p1\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "hima-al00b\\/hima-tl00b_9.0.0.200\\(c00e200r2p1\\)"
},
{
"model": "honor magic 2",
"scope": "lte",
"trust": 0.8,
"vendor": "huawei",
"version": "tony-al00b/tony-tl00b 9.0.0.182(c00e180r2p2)"
},
{
"model": "mate 20 x",
"scope": "lte",
"trust": 0.8,
"vendor": "huawei",
"version": "ever-al00b 9.0.0.200(c00e200r2p1)"
},
{
"model": "mate 20",
"scope": "lte",
"trust": 0.8,
"vendor": "huawei",
"version": "hima-al00b/hima-tl00b 9.0.0.200(c00e200r2p1)"
},
{
"model": "mate \u003cever-al00b 9.0.0.200",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20x"
},
{
"model": "mate \u003chima-al00b/hima-tl00b 9.0.0.200",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20x"
},
{
"model": "honor magic \u003ctony-al00b/tony-tl00b 9.0.0.182",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "2"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-25751"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"db": "NVD",
"id": "CVE-2019-5220"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:honor_magic_2_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_20_x_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "The vulnerability was discovered by Huawei internal testing.",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201906-1047"
}
],
"trust": 0.6
},
"cve": "CVE-2019-5220",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CVE-2019-5220",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 1.8,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CNVD-2019-25751",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.6,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.9,
"id": "CVE-2019-5220",
"impactScore": 3.6,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.8,
"userInteraction": "NONE",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:H/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-5220",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2019-5220",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2019-25751",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-201906-1047",
"trust": 0.6,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-25751"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"db": "CNNVD",
"id": "CNNVD-201906-1047"
},
{
"db": "NVD",
"id": "CVE-2019-5220"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There is a Factory Reset Protection (FRP) bypass vulnerability on several smartphones. The system does not sufficiently verify the permission, an attacker could do a certain operation on certain step of setup wizard. Successful exploit could allow the attacker bypass the FRP protection. Affected products: Mate 20 X, versions earlier than Ever-AL00B 9.0.0.200(C00E200R2P1); Mate 20, versions earlier than Hima-AL00B/Hima-TL00B 9.0.0.200(C00E200R2P1); Honor Magic 2, versions earlier than Tony-AL00B/Tony-TL00B 9.0.0.182(C00E180R2P2). Huawei Mate 20 is a smartphone from China\u0027s Huawei company. The vulnerability stems from insufficient system validation",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-5220"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"db": "CNVD",
"id": "CNVD-2019-25751"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-5220",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2019-006517",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2019-25751",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201906-1047",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-25751"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"db": "CNNVD",
"id": "CNNVD-201906-1047"
},
{
"db": "NVD",
"id": "CVE-2019-5220"
}
]
},
"id": "VAR-201907-0268",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-25751"
}
],
"trust": 1.5125
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-25751"
}
]
},
"last_update_date": "2024-11-23T23:01:48.486000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20190626-01-frp",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190626-01-frp-en"
},
{
"title": "Huawei Mate 20 X, Mate 20 and Honor Magic 2 security bypass vulnerability patches",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/173069"
},
{
"title": "Huawei Mate 20 X , Mate 20 and Honor Magic 2 Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=94174"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-25751"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"db": "CNNVD",
"id": "CNNVD-201906-1047"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-863",
"trust": 1.0
},
{
"problemtype": "CWE-275",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"db": "NVD",
"id": "CVE-2019-5220"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.8,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20190626-01-frp-cn"
},
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190626-01-frp-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5220"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-5220"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-25751"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"db": "CNNVD",
"id": "CNNVD-201906-1047"
},
{
"db": "NVD",
"id": "CVE-2019-5220"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2019-25751"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"db": "CNNVD",
"id": "CNNVD-201906-1047"
},
{
"db": "NVD",
"id": "CVE-2019-5220"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-08-04T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-25751"
},
{
"date": "2019-07-23T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"date": "2019-06-26T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201906-1047"
},
{
"date": "2019-07-10T18:15:11.067000",
"db": "NVD",
"id": "CVE-2019-5220"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-08-04T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-25751"
},
{
"date": "2019-07-23T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-006517"
},
{
"date": "2020-08-25T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201906-1047"
},
{
"date": "2024-11-21T04:44:32.850000",
"db": "NVD",
"id": "CVE-2019-5220"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural Huawei Product permission vulnerabilities",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-006517"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "authorization issue",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201906-1047"
}
],
"trust": 0.6
}
}
VAR-202009-1319
Vulnerability from variot - Updated: 2024-11-23 23:01HUAWEI Mate 20 smart phones with Versions earlier than 10.1.0.163(C00E160R3P8) have a denial of service (DoS) vulnerability. The attacker can enter a large amount of text on the phone. Due to insufficient verification of the parameter, successful exploitation can impact the service. Huawei Mate 20 is a smartphone launched by Huawei
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202009-1319",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.163\\(c00e160r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.1.0.163 (c00e160r3p8)"
},
{
"model": "mate \u003c10.1.0.163",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52403"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"db": "NVD",
"id": "CVE-2020-9083"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
}
]
},
"cve": "CVE-2020-9083",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CVE-2020-9083",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:N/A:P",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Low",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "Partial",
"baseScore": 2.1,
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-010546",
"impactScore": null,
"integrityImpact": "None",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:N/A:P",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "PARTIAL",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-52403",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:N/A:P",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "LOW",
"baseScore": 2.4,
"baseSeverity": "LOW",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.9,
"id": "CVE-2020-9083",
"impactScore": 1.4,
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:L",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "Low",
"baseScore": 2.4,
"baseSeverity": "Low",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-010546",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:L",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-9083",
"trust": 1.0,
"value": "LOW"
},
{
"author": "NVD",
"id": "JVNDB-2020-010546",
"trust": 0.8,
"value": "Low"
},
{
"author": "CNVD",
"id": "CNVD-2020-52403",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202009-250",
"trust": 0.6,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52403"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-250"
},
{
"db": "NVD",
"id": "CVE-2020-9083"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 smart phones with Versions earlier than 10.1.0.163(C00E160R3P8) have a denial of service (DoS) vulnerability. The attacker can enter a large amount of text on the phone. Due to insufficient verification of the parameter, successful exploitation can impact the service. Huawei Mate 20 is a smartphone launched by Huawei",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9083"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"db": "CNVD",
"id": "CNVD-2020-52403"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-9083",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-010546",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-52403",
"trust": 0.6
},
{
"db": "NSFOCUS",
"id": "48891",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202009-250",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52403"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-250"
},
{
"db": "NVD",
"id": "CVE-2020-9083"
}
]
},
"id": "VAR-202009-1319",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52403"
}
],
"trust": 1.26765326
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52403"
}
]
},
"last_update_date": "2024-11-23T23:01:14.153000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200902-03-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200902-03-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 denial of service vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/234322"
},
{
"title": "HUAWEI Mate 20 Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=127983"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52403"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-250"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
},
{
"problemtype": "CWE-20",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"db": "NVD",
"id": "CVE-2020-9083"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-9083"
},
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200902-03-smartphone-en"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=2020-9083"
},
{
"trust": 0.6,
"url": "http://www.nsfocus.net/vulndb/48891"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52403"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-250"
},
{
"db": "NVD",
"id": "CVE-2020-9083"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-52403"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"db": "CNNVD",
"id": "CNNVD-202009-250"
},
{
"db": "NVD",
"id": "CVE-2020-9083"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-09-17T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-52403"
},
{
"date": "2021-01-27T02:27:22",
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"date": "2020-09-03T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202009-250"
},
{
"date": "2020-09-03T19:15:12.353000",
"db": "NVD",
"id": "CVE-2020-9083"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-09-17T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-52403"
},
{
"date": "2021-01-27T02:27:22",
"db": "JVNDB",
"id": "JVNDB-2020-010546"
},
{
"date": "2022-03-08T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202009-250"
},
{
"date": "2024-11-21T05:39:59.550000",
"db": "NVD",
"id": "CVE-2020-9083"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 Input verification vulnerabilities on smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-010546"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "input validation error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202009-250"
}
],
"trust": 0.6
}
}
VAR-202008-1048
Vulnerability from variot - Updated: 2024-11-23 22:58HUAWEI Mate 20 versions Versions earlier than 10.1.0.160(C00E160R3P8);HUAWEI Mate 20 Pro versions Versions earlier than 10.1.0.270(C431E7R1P5),Versions earlier than 10.1.0.270(C635E3R1P5),Versions earlier than 10.1.0.273(C636E7R2P4);HUAWEI Mate 20 X versions Versions earlier than 10.1.0.160(C00E160R2P8);HUAWEI P30 versions Versions earlier than 10.1.0.160(C00E160R2P11);HUAWEI P30 Pro versions Versions earlier than 10.1.0.160(C00E160R2P8);HUAWEI Mate 20 RS versions Versions earlier than 10.1.0.160(C786E160R3P8);HonorMagic2 versions Versions earlier than 10.0.0.187(C00E61R2P11);Honor20 versions Versions earlier than 10.0.0.175(C00E58R4P11);Honor20 PRO versions Versions earlier than 10.0.0.194(C00E62R8P12);HonorMagic2 versions Versions earlier than 10.0.0.187(C00E61R2P11);HonorV20 versions Versions earlier than 10.0.0.188(C00E62R2P11) have an improper authentication vulnerability. The system does not properly sign certain encrypted file, the attacker should gain the key used to encrypt the file, successful exploit could cause certain file be forged. plural Huawei There is an authentication vulnerability in smartphones.Information is obtained, information is tampered with, and service is disrupted (DoS) It may be put in a state. Huawei Mate 20, Mate 20 Pro, Mate 20 X and Mate 20 RS are all smart phones of China's Huawei (Huawei) company.
There are security vulnerabilities in many Huawei products, which are caused by the program's failure to correctly sign encrypted files. Attackers can use this vulnerability to forge files
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202008-1048",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate pro \u003c10.1.0.270",
"scope": "eq",
"trust": 1.2,
"vendor": "huawei",
"version": "20"
},
{
"model": "honor v20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.188\\(c00e62r2p11\\)"
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.194\\(c00e62r8p12\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p11\\)"
},
{
"model": "honor 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.175\\(c00e58r4p11\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r3p8\\)"
},
{
"model": "mate 20 rs",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c786e160r3p8\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.270\\(c431e7r1p5\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.273\\(c636e7r2p4\\)"
},
{
"model": "mate 20 x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p8\\)"
},
{
"model": "honor magic 2",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.187\\(c00e61r2p11\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p8\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.270\\(c635e3r1p5\\)"
},
{
"model": "honor 20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "honor 20 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "honor magic 2",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "honor v20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20 rs",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20 x",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate \u003c10.1.0.160",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate pro \u003c10.1.0.273",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate \u003c10.1.0.160",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20x"
},
{
"model": "p30 \u003c10.1.0.160",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro \u003c10.1.0.160",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "mate rs \u003c10.1.0.160",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "honormagic \u003c10.0.0.187",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "2"
},
{
"model": "honor \u003c10.0.0.175",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "honor pro \u003c10.0.0.194",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "honorv20 \u003c10.0.0.188",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-46459"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"db": "NVD",
"id": "CVE-2020-9244"
}
]
},
"cve": "CVE-2020-9244",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 4.6,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CVE-2020-9244",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 1.8,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:P/A:P",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "PARTIAL",
"baseScore": 4.6,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-46459",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:P/A:P",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 6.8,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 0.9,
"id": "CVE-2020-9244",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 6.8,
"baseSeverity": "Medium",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2020-9244",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-9244",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2020-9244",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2020-46459",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-202008-580",
"trust": 0.6,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-46459"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-580"
},
{
"db": "NVD",
"id": "CVE-2020-9244"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 versions Versions earlier than 10.1.0.160(C00E160R3P8);HUAWEI Mate 20 Pro versions Versions earlier than 10.1.0.270(C431E7R1P5),Versions earlier than 10.1.0.270(C635E3R1P5),Versions earlier than 10.1.0.273(C636E7R2P4);HUAWEI Mate 20 X versions Versions earlier than 10.1.0.160(C00E160R2P8);HUAWEI P30 versions Versions earlier than 10.1.0.160(C00E160R2P11);HUAWEI P30 Pro versions Versions earlier than 10.1.0.160(C00E160R2P8);HUAWEI Mate 20 RS versions Versions earlier than 10.1.0.160(C786E160R3P8);HonorMagic2 versions Versions earlier than 10.0.0.187(C00E61R2P11);Honor20 versions Versions earlier than 10.0.0.175(C00E58R4P11);Honor20 PRO versions Versions earlier than 10.0.0.194(C00E62R8P12);HonorMagic2 versions Versions earlier than 10.0.0.187(C00E61R2P11);HonorV20 versions Versions earlier than 10.0.0.188(C00E62R2P11) have an improper authentication vulnerability. The system does not properly sign certain encrypted file, the attacker should gain the key used to encrypt the file, successful exploit could cause certain file be forged. plural Huawei There is an authentication vulnerability in smartphones.Information is obtained, information is tampered with, and service is disrupted (DoS) It may be put in a state. Huawei Mate 20, Mate 20 Pro, Mate 20 X and Mate 20 RS are all smart phones of China\u0027s Huawei (Huawei) company. \n\r\n\r\nThere are security vulnerabilities in many Huawei products, which are caused by the program\u0027s failure to correctly sign encrypted files. Attackers can use this vulnerability to forge files",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9244"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"db": "CNVD",
"id": "CNVD-2020-46459"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-9244",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009253",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-46459",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202008-580",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-46459"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-580"
},
{
"db": "NVD",
"id": "CVE-2020-9244"
}
]
},
"id": "VAR-202008-1048",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-46459"
}
],
"trust": 1.2862094863636364
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-46459"
}
]
},
"last_update_date": "2024-11-23T22:58:10.110000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200805-02-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200805-02-smartphone-en"
},
{
"title": "Patch for Incorrect authentication vulnerabilities in multiple Huawei products",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/230800"
},
{
"title": "Multiple Huawei Product Authorization Issue Vulnerability Fixing Measures",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=126447"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-46459"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-580"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
},
{
"problemtype": "Improper authentication (CWE-287) [NVD Evaluation ]",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"db": "NVD",
"id": "CVE-2020-9244"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.2,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200805-02-smartphone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-9244"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200805-02-smartphone-cn"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-46459"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-580"
},
{
"db": "NVD",
"id": "CVE-2020-9244"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-46459"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-580"
},
{
"db": "NVD",
"id": "CVE-2020-9244"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-08-17T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-46459"
},
{
"date": "2020-10-26T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"date": "2020-08-11T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202008-580"
},
{
"date": "2020-08-11T19:15:17.687000",
"db": "NVD",
"id": "CVE-2020-9244"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-08-17T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-46459"
},
{
"date": "2020-10-26T08:31:00",
"db": "JVNDB",
"id": "JVNDB-2020-009253"
},
{
"date": "2021-01-05T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202008-580"
},
{
"date": "2024-11-21T05:40:15.390000",
"db": "NVD",
"id": "CVE-2020-9244"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural \u00a0Huawei\u00a0 Authentication vulnerabilities in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-009253"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "authorization issue",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202008-580"
}
],
"trust": 0.6
}
}
VAR-202007-1264
Vulnerability from variot - Updated: 2024-11-23 22:55HUAWEI Mate 20 versions earlier than 10.1.0.160(C00E160R3P8), HUAWEI Mate 20 X versions earlier than 10.1.0.135(C00E135R2P8), HUAWEI Mate 20 RS versions earlier than 10.1.0.160(C786E160R3P8), and Honor Magic2 smartphones versions earlier than 10.1.0.160(C00E160R2P11) have a path traversal vulnerability. The system does not sufficiently validate certain pathname from certain process, successful exploit could allow the attacker write files to a crafted path. plural Huawei A past traversal vulnerability exists in smartphones.Information may be tampered with. Huawei Mate 20 and others are all smart phones of China's Huawei (Huawei) company.
There are security vulnerabilities in many Huawei products. The vulnerability is caused by the program's failure to correctly verify the path name of the process
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202007-1264",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "magic2",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p11\\)"
},
{
"model": "mate 20 x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.135\\(c00e135r2p8\\)"
},
{
"model": "mate 20 rs",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c786e160r3p8\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r3p8\\)"
},
{
"model": "magic 2",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.1.0.160(c00e160r2p11)"
},
{
"model": "mate 20 rs",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.1.0.160(c786e160r3p8)"
},
{
"model": "mate 20 x",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.1.0.135(c00e135r2p8)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.1.0.160(c00e160r3p8)"
},
{
"model": "mate \u003c10.1.0.160",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate pro \u003c10.1.0.277",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate \u003c10.1.0.135",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20x"
},
{
"model": "mate rs porsche design",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20\u003c10.1.0.160"
},
{
"model": "honor magic2 \u003c10.1.0.160",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52401"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
},
{
"db": "NVD",
"id": "CVE-2020-9252"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:magic2_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_20_rs_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_20_x_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
}
]
},
"cve": "CVE-2020-9252",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CVE-2020-9252",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Low",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.1,
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-008289",
"impactScore": null,
"integrityImpact": "Partial",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-52401",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.3,
"baseSeverity": "LOW",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.8,
"id": "CVE-2020-9252",
"impactScore": 1.4,
"integrityImpact": "LOW",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:N/I:L/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Local",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.3,
"baseSeverity": "Low",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-008289",
"impactScore": null,
"integrityImpact": "Low",
"privilegesRequired": "High",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:L/AC:L/PR:H/UI:N/S:U/C:N/I:L/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-9252",
"trust": 1.0,
"value": "LOW"
},
{
"author": "NVD",
"id": "JVNDB-2020-008289",
"trust": 0.8,
"value": "Low"
},
{
"author": "CNVD",
"id": "CNVD-2020-52401",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202007-1112",
"trust": 0.6,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52401"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1112"
},
{
"db": "NVD",
"id": "CVE-2020-9252"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 versions earlier than 10.1.0.160(C00E160R3P8), HUAWEI Mate 20 X versions earlier than 10.1.0.135(C00E135R2P8), HUAWEI Mate 20 RS versions earlier than 10.1.0.160(C786E160R3P8), and Honor Magic2 smartphones versions earlier than 10.1.0.160(C00E160R2P11) have a path traversal vulnerability. The system does not sufficiently validate certain pathname from certain process, successful exploit could allow the attacker write files to a crafted path. plural Huawei A past traversal vulnerability exists in smartphones.Information may be tampered with. Huawei Mate 20 and others are all smart phones of China\u0027s Huawei (Huawei) company. \n\r\n\r\nThere are security vulnerabilities in many Huawei products. The vulnerability is caused by the program\u0027s failure to correctly verify the path name of the process",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9252"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
},
{
"db": "CNVD",
"id": "CNVD-2020-52401"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-9252",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-008289",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-52401",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1112",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52401"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1112"
},
{
"db": "NVD",
"id": "CVE-2020-9252"
}
]
},
"id": "VAR-202007-1264",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52401"
}
],
"trust": 1.3050634149999998
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52401"
}
]
},
"last_update_date": "2024-11-23T22:55:06.327000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200715-07-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200715-07-smartphone-en"
},
{
"title": "Patch for Path traversal vulnerabilities in multiple Huawei products",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/234337"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52401"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-22",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
},
{
"db": "NVD",
"id": "CVE-2020-9252"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.2,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200715-07-smartphone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-9252"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2020-9252"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200715-07-smartphone-cn"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52401"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1112"
},
{
"db": "NVD",
"id": "CVE-2020-9252"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-52401"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1112"
},
{
"db": "NVD",
"id": "CVE-2020-9252"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-07-15T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-52401"
},
{
"date": "2020-09-08T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-008289"
},
{
"date": "2020-07-15T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202007-1112"
},
{
"date": "2020-07-17T23:15:11.537000",
"db": "NVD",
"id": "CVE-2020-9252"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-09-17T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-52401"
},
{
"date": "2020-09-08T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-008289"
},
{
"date": "2021-01-05T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202007-1112"
},
{
"date": "2024-11-21T05:40:16.590000",
"db": "NVD",
"id": "CVE-2020-9252"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202007-1112"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural Huawei Path traversal vulnerability in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-008289"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "path traversal",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202007-1112"
}
],
"trust": 0.6
}
}
VAR-202002-0214
Vulnerability from variot - Updated: 2024-11-23 22:51In reassemble_and_dispatch of packet_fragmenter.cc, there is possible out of bounds write due to an incorrect bounds calculation. This could lead to remote code execution over Bluetooth with no additional execution privileges needed. User interaction is not needed for exploitation.Product: AndroidVersions: Android-8.0 Android-8.1 Android-9 Android-10Android ID: A-143894715. Android contains a calculation error vulnerability. This vulnerability is Android ID: A-143894715 It is published as.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202002-0214",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "android",
"scope": "eq",
"trust": 1.8,
"vendor": "google",
"version": "8.0"
},
{
"model": "android",
"scope": "eq",
"trust": 1.8,
"vendor": "google",
"version": "8.1"
},
{
"model": "honor 8a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.291\\(c185e3r4p1\\)"
},
{
"model": "mate 30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.203\\(c00e202r7p2\\)"
},
{
"model": "mate 30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.203\\(c00e202r7p2\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.195\\(c00e74r3p8\\)"
},
{
"model": "p20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.162\\(c00e156r1p4\\)"
},
{
"model": "mate 30 pro 5g",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.203\\(c00e202r7p2\\)"
},
{
"model": "honor view 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.195\\(c636e3r4p3\\)"
},
{
"model": "p smart",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.193\\(c605e6r1p5t8\\)"
},
{
"model": "honor 8x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.183\\(c185e2r6p1\\)"
},
{
"model": "y6 pro 2019",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.290\\(c636e5r3p1\\)"
},
{
"model": "mate 20 x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.195\\(c00e74r2p8\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.196\\(c185e7r2p4\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.190\\(c432e22r2p5\\)"
},
{
"model": "nova 3",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.338\\(c00e333r1p1t8\\)"
},
{
"model": "y9 2019",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.264\\(c185e2r5p1t8\\)"
},
{
"model": "mate 30 5g",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.203\\(c00e202r7p2\\)"
},
{
"model": "p20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.162\\(c00e156r1p4\\)"
},
{
"model": "p smart 2019",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.180\\(c185e3r4p1\\)"
},
{
"model": "y6 2019",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.290\\(c185e5r4p1\\)"
},
{
"model": "android",
"scope": "eq",
"trust": 1.0,
"vendor": "google",
"version": "9.0"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.195\\(c00e85r2p8\\)"
},
{
"model": "nova lite 3",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.322\\(c635e8r2p2\\)"
},
{
"model": "android",
"scope": "eq",
"trust": 1.0,
"vendor": "google",
"version": "10.0"
},
{
"model": "android",
"scope": "eq",
"trust": 0.8,
"vendor": "google",
"version": null
},
{
"model": "android",
"scope": "eq",
"trust": 0.8,
"vendor": "google",
"version": "9"
},
{
"model": "android",
"scope": "eq",
"trust": 0.8,
"vendor": "google",
"version": "10"
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"db": "NVD",
"id": "CVE-2020-0022"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "nu11secur1ty",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202002-366"
}
],
"trust": 0.6
},
"cve": "CVE-2020-0022",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "ADJACENT_NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "COMPLETE",
"baseScore": 8.3,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 6.5,
"id": "CVE-2020-0022",
"impactScore": 10.0,
"integrityImpact": "COMPLETE",
"severity": "HIGH",
"trust": 1.9,
"vectorString": "AV:A/AC:L/Au:N/C:C/I:C/A:C",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "ADJACENT",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 8.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 2.8,
"id": "CVE-2020-0022",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 2.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:A/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Adjacent Network",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 8.8,
"baseSeverity": "High",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2020-0022",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:A/AC:L/PR:N/UI:N/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-0022",
"trust": 1.0,
"value": "HIGH"
},
{
"author": "134c704f-9b21-4f2e-91b3-4a467353bcc0",
"id": "CVE-2020-0022",
"trust": 1.0,
"value": "HIGH"
},
{
"author": "NVD",
"id": "CVE-2020-0022",
"trust": 0.8,
"value": "High"
},
{
"author": "CNNVD",
"id": "CNNVD-202002-366",
"trust": 0.6,
"value": "HIGH"
},
{
"author": "VULMON",
"id": "CVE-2020-0022",
"trust": 0.1,
"value": "HIGH"
}
]
}
],
"sources": [
{
"db": "VULMON",
"id": "CVE-2020-0022"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-366"
},
{
"db": "NVD",
"id": "CVE-2020-0022"
},
{
"db": "NVD",
"id": "CVE-2020-0022"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "In reassemble_and_dispatch of packet_fragmenter.cc, there is possible out of bounds write due to an incorrect bounds calculation. This could lead to remote code execution over Bluetooth with no additional execution privileges needed. User interaction is not needed for exploitation.Product: AndroidVersions: Android-8.0 Android-8.1 Android-9 Android-10Android ID: A-143894715. Android contains a calculation error vulnerability. This vulnerability is Android ID: A-143894715 It is published as.Information is obtained, information is tampered with, and service operation is interrupted. (DoS) It may be in a state",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-0022"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"db": "VULMON",
"id": "CVE-2020-0022"
}
],
"trust": 1.71
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-0022",
"trust": 3.3
},
{
"db": "PACKETSTORM",
"id": "156891",
"trust": 1.7
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001993",
"trust": 0.8
},
{
"db": "NSFOCUS",
"id": "45798",
"trust": 0.6
},
{
"db": "NSFOCUS",
"id": "49115",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202002-366",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2020-0022",
"trust": 0.1
}
],
"sources": [
{
"db": "VULMON",
"id": "CVE-2020-0022"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-366"
},
{
"db": "NVD",
"id": "CVE-2020-0022"
}
]
},
"id": "VAR-202002-0214",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VARIoT devices database",
"id": null
}
],
"trust": 0.538734306
},
"last_update_date": "2024-11-23T22:51:30.464000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "Android\u00a0 Public information about security \u00a0-\u00a02020\u00a0 Year \u00a02\u00a0 Moon",
"trust": 0.8,
"url": "https://source.android.com/security/bulletin/2020-02-01"
},
{
"title": "Android Buffer error vulnerability fix",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=110484"
},
{
"title": "Huawei Security Advisories: Security Advisory - Integer Overflow Vulnerability in Android affects Several Huawei Smartphones",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=huawei_security_advisories\u0026qid=5ecb6a3686ddfa79c27cc2c950827f9f"
},
{
"title": "CVE-2020-0022\nUpdate 1\nUpdate 2",
"trust": 0.1,
"url": "https://github.com/marcinguy/CVE-2020-0022 "
},
{
"title": "https://github.com/Polo35/CVE-2020-0022",
"trust": 0.1,
"url": "https://github.com/Polo35/CVE-2020-0022 "
},
{
"title": "Bluefrag_CVE-2020-0022",
"trust": 0.1,
"url": "https://github.com/k3vinlusec/Bluefrag_CVE-2020-0022 "
},
{
"title": "cve-2020-0022",
"trust": 0.1,
"url": "https://github.com/devdanqtuan/poc-for-cve-2020-0022 "
},
{
"title": "cve-2020-0022",
"trust": 0.1,
"url": "https://github.com/leommxj/cve-2020-0022 "
},
{
"title": "AndroidBlueFragCVE",
"trust": 0.1,
"url": "https://github.com/sharif-dev/AndroidBlueFragCVE "
},
{
"title": "cve-2020-0022",
"trust": 0.1,
"url": "https://github.com/5k1l/cve-2020-0022 "
},
{
"title": "CVE-2020-0022",
"trust": 0.1,
"url": "https://github.com/themmokhtar/CVE-2020-0022 "
},
{
"title": "CVE-2020-14292: A bluetooth transport issue in COVIDSafe App",
"trust": 0.1,
"url": "https://github.com/alwentiu/CVE-2020-14292 "
},
{
"title": "https://github.com/seemoo-lab/frankenstein",
"trust": 0.1,
"url": "https://github.com/seemoo-lab/frankenstein "
},
{
"title": "Protocol-Vulnerability\nRelated Resources\nContributors",
"trust": 0.1,
"url": "https://github.com/WinMin/Protocol-Vul "
},
{
"title": "\u7b80\u4ecb\n\u5b89\u88c5\n\u4f7f\u7528\nhttpserver\u63a5\u53e3",
"trust": 0.1,
"url": "https://github.com/he1m4n6a/cve-db "
},
{
"title": "Awesome Bluetooth Security (BR, EDR, LE, and Mesh)",
"trust": 0.1,
"url": "https://github.com/JeffroMF/awesome-bluetooth-security321 "
},
{
"title": "Awesome Bluetooth Security (BR, EDR, LE, and Mesh)",
"trust": 0.1,
"url": "https://github.com/engn33r/awesome-bluetooth-security "
},
{
"title": "\u6240\u6709\u6536\u96c6\u7c7b\u9879\u76ee\nAndroid\n\u76ee\u5f55\n\u8d44\u6e90\u6536\u96c6\n\u77e5\u540d\u5206\u6790\u5de5\u5177\n\u5404\u7c7bApp\nTopic\n\u5176\u4ed6\n\u5de5\u5177\n\u6587\u7ae0\n\u8d21\u732e",
"trust": 0.1,
"url": "https://github.com/alphaSeclab/android-security "
},
{
"title": "OPSEC-Hall-of-fame \ud83d\ude0e",
"trust": 0.1,
"url": "https://github.com/Offensive-Penetration-Security/OPSEC-Hall-of-fame "
},
{
"title": "CVE-Mitre\nDownload single CVE",
"trust": 0.1,
"url": "https://github.com/nu11secur1ty/CVE-mitre "
},
{
"title": "CVE-Mitre\nDownload single CVE",
"trust": 0.1,
"url": "https://github.com/nu11secur1ty/CVE "
},
{
"title": "PoC in GitHub",
"trust": 0.1,
"url": "https://github.com/soosmile/POC "
},
{
"title": "PoC in GitHub",
"trust": 0.1,
"url": "https://github.com/developer3000S/PoC-in-GitHub "
},
{
"title": "PoC in GitHub",
"trust": 0.1,
"url": "https://github.com/hectorgie/PoC-in-GitHub "
},
{
"title": "PoC in GitHub",
"trust": 0.1,
"url": "https://github.com/0xT11/CVE-POC "
},
{
"title": "The Register",
"trust": 0.1,
"url": "https://www.theregister.co.uk/2020/02/07/android_bluetooth_flaw/"
}
],
"sources": [
{
"db": "VULMON",
"id": "CVE-2020-0022"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-366"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-682",
"trust": 1.0
},
{
"problemtype": "calculation error (CWE-682) [NVD evaluation ]",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"db": "NVD",
"id": "CVE-2020-0022"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.3,
"url": "https://source.android.com/security/bulletin/2020-02-01"
},
{
"trust": 2.3,
"url": "http://packetstormsecurity.com/files/156891/android-bluetooth-remote-denial-of-service.html"
},
{
"trust": 1.8,
"url": "http://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200513-03-smartphone-en"
},
{
"trust": 1.7,
"url": "http://seclists.org/fulldisclosure/2020/feb/10"
},
{
"trust": 0.8,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-0022"
},
{
"trust": 0.6,
"url": "https://vigilance.fr/vulnerability/google-android-pixel-multiple-vulnerabilities-of-february-2020-31507"
},
{
"trust": 0.6,
"url": "http://www.nsfocus.net/vulndb/45798"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200513-03-smartphone-cn"
},
{
"trust": 0.6,
"url": "http://www.nsfocus.net/vulndb/49115"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/682.html"
},
{
"trust": 0.1,
"url": "https://github.com/marcinguy/cve-2020-0022"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
}
],
"sources": [
{
"db": "VULMON",
"id": "CVE-2020-0022"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-366"
},
{
"db": "NVD",
"id": "CVE-2020-0022"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "VULMON",
"id": "CVE-2020-0022"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-366"
},
{
"db": "NVD",
"id": "CVE-2020-0022"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-02-13T00:00:00",
"db": "VULMON",
"id": "CVE-2020-0022"
},
{
"date": "2020-03-02T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"date": "2020-02-04T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202002-366"
},
{
"date": "2020-02-13T15:15:11.780000",
"db": "NVD",
"id": "CVE-2020-0022"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2024-02-02T00:00:00",
"db": "VULMON",
"id": "CVE-2020-0022"
},
{
"date": "2024-02-27T07:11:00",
"db": "JVNDB",
"id": "JVNDB-2020-001993"
},
{
"date": "2020-09-25T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202002-366"
},
{
"date": "2024-11-21T04:52:45.763000",
"db": "NVD",
"id": "CVE-2020-0022"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote or local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202002-366"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Android\u00a0 calculation error vulnerability in",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-001993"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "buffer error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202002-366"
}
],
"trust": 0.6
}
}
VAR-202005-0618
Vulnerability from variot - Updated: 2024-11-23 22:44HUAWEI Mate 20 smartphones with versions earlier than 10.0.0.185(C00E74R3P8) have an improper authorization vulnerability. The system does not properly restrict certain operation in ADB mode, successful exploit could allow certain user break the limit of digital balance function. Huawei Mate 20 is a smart phone of the Chinese company Huawei. Attackers can use this vulnerability to break through the restrictions on the healthy use of mobile phone functions
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202005-0618",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.185\\(c00e74r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.185(c00e74r3p8)"
},
{
"model": "mate \u003c10.0.0.185",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31280"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"db": "NVD",
"id": "CVE-2020-1797"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
}
]
},
"cve": "CVE-2020-1797",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CVE-2020-1797",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Low",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.1,
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-005917",
"impactScore": null,
"integrityImpact": "Partial",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-31280",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.4,
"baseSeverity": "LOW",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.9,
"id": "CVE-2020-1797",
"impactScore": 1.4,
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.4,
"baseSeverity": "Low",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-005917",
"impactScore": null,
"integrityImpact": "Low",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-1797",
"trust": 1.0,
"value": "LOW"
},
{
"author": "NVD",
"id": "JVNDB-2020-005917",
"trust": 0.8,
"value": "Low"
},
{
"author": "CNVD",
"id": "CNVD-2020-31280",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202005-1350",
"trust": 0.6,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31280"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1350"
},
{
"db": "NVD",
"id": "CVE-2020-1797"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 smartphones with versions earlier than 10.0.0.185(C00E74R3P8) have an improper authorization vulnerability. The system does not properly restrict certain operation in ADB mode, successful exploit could allow certain user break the limit of digital balance function. Huawei Mate 20 is a smart phone of the Chinese company Huawei. Attackers can use this vulnerability to break through the restrictions on the healthy use of mobile phone functions",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-1797"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"db": "CNVD",
"id": "CNVD-2020-31280"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-1797",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005917",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-31280",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1350",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31280"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1350"
},
{
"db": "NVD",
"id": "CVE-2020-1797"
}
]
},
"id": "VAR-202005-0618",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31280"
}
],
"trust": 1.26765326
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31280"
}
]
},
"last_update_date": "2024-11-23T22:44:35.029000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200527-03-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200527-03-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 authorization issue vulnerability (CNVD-2020-31280)",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/220047"
},
{
"title": "Huawei Mate 20 Remediation measures for authorization problem vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=119907"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31280"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1350"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
},
{
"problemtype": "CWE-863",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"db": "NVD",
"id": "CVE-2020-1797"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-1797"
},
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200527-03-smartphone-en"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2020-1797"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200527-03-smartphone-cn"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31280"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1350"
},
{
"db": "NVD",
"id": "CVE-2020-1797"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-31280"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1350"
},
{
"db": "NVD",
"id": "CVE-2020-1797"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-06-03T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-31280"
},
{
"date": "2020-06-25T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"date": "2020-05-27T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202005-1350"
},
{
"date": "2020-05-29T20:15:11.107000",
"db": "NVD",
"id": "CVE-2020-1797"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-06-03T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-31280"
},
{
"date": "2020-06-25T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-005917"
},
{
"date": "2020-06-02T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202005-1350"
},
{
"date": "2024-11-21T05:11:23.963000",
"db": "NVD",
"id": "CVE-2020-1797"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 Unauthorized authentication vulnerabilities in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-005917"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "authorization issue",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202005-1350"
}
],
"trust": 0.6
}
}
VAR-202008-1055
Vulnerability from variot - Updated: 2024-11-23 22:44HUAWEI Mate 20 smartphones with 9.0.0.205(C00E205R2P1) have a logic error vulnerability. In a special scenario, the system does not properly process. As a result, attackers can perform a series of operations to successfully establish P2P connections that are rejected by the peer end. As a result, the availability of the device is affected. HUAWEI Mate 20 There are unspecified vulnerabilities in smartphones.Service operation interruption (DoS) It may be put into a state. Huawei Mate 20 is a smartphone of China's Huawei (Huawei) company. An attacker can use this vulnerability to achieve a successful connection when the object refuses the P2P connection
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202008-1055",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": "9.0.0.205\\(c00e205r2p1\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.0.0.205(c00e205r2p1)"
},
{
"model": "mate 9.0.0.205",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52406"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009599"
},
{
"db": "NVD",
"id": "CVE-2020-9103"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-009599"
}
]
},
"cve": "CVE-2020-9103",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CVE-2020-9103",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:N/A:P",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Low",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "Partial",
"baseScore": 2.1,
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-009599",
"impactScore": null,
"integrityImpact": "None",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:N/A:P",
"version": "2.0"
},
{
"accessComplexity": "MEDIUM",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "PARTIAL",
"baseScore": 4.3,
"confidentialityImpact": "NONE",
"exploitabilityScore": 8.6,
"id": "CNVD-2020-52406",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:N/AC:M/Au:N/C:N/I:N/A:P",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 4.6,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.9,
"id": "CVE-2020-9103",
"impactScore": 3.6,
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 4.6,
"baseSeverity": "Medium",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-009599",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:N/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-9103",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "JVNDB-2020-009599",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2020-52406",
"trust": 0.6,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52406"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009599"
},
{
"db": "NVD",
"id": "CVE-2020-9103"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 smartphones with 9.0.0.205(C00E205R2P1) have a logic error vulnerability. In a special scenario, the system does not properly process. As a result, attackers can perform a series of operations to successfully establish P2P connections that are rejected by the peer end. As a result, the availability of the device is affected. HUAWEI Mate 20 There are unspecified vulnerabilities in smartphones.Service operation interruption (DoS) It may be put into a state. Huawei Mate 20 is a smartphone of China\u0027s Huawei (Huawei) company. An attacker can use this vulnerability to achieve a successful connection when the object refuses the P2P connection",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9103"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009599"
},
{
"db": "CNVD",
"id": "CNVD-2020-52406"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-9103",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009599",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-52406",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202008-855",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52406"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009599"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-855"
},
{
"db": "NVD",
"id": "CVE-2020-9103"
}
]
},
"id": "VAR-202008-1055",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52406"
}
],
"trust": 1.26765326
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52406"
}
]
},
"last_update_date": "2024-11-23T22:44:27.337000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200812-01-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200812-01-smartphone-en"
},
{
"title": "Patch for HUAWEI Mate 20 logic error vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/231265"
},
{
"title": "Huawei Mate 20 Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=126542"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52406"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009599"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-855"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
}
],
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9103"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-9103"
},
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200812-01-smartphone-en"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2020-9103"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-52406"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009599"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-855"
},
{
"db": "NVD",
"id": "CVE-2020-9103"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-52406"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-009599"
},
{
"db": "CNNVD",
"id": "CNNVD-202008-855"
},
{
"db": "NVD",
"id": "CVE-2020-9103"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-08-20T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-52406"
},
{
"date": "2020-11-20T06:26:56",
"db": "JVNDB",
"id": "JVNDB-2020-009599"
},
{
"date": "2020-08-17T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202008-855"
},
{
"date": "2020-08-17T15:15:15.340000",
"db": "NVD",
"id": "CVE-2020-9103"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-09-17T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-52406"
},
{
"date": "2020-11-20T06:26:56",
"db": "JVNDB",
"id": "JVNDB-2020-009599"
},
{
"date": "2020-08-18T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202008-855"
},
{
"date": "2024-11-21T05:40:02.467000",
"db": "NVD",
"id": "CVE-2020-9103"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 Vulnerabilities in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-009599"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "other",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202008-855"
}
],
"trust": 0.6
}
}
VAR-202010-1177
Vulnerability from variot - Updated: 2024-11-23 22:44HUAWEI Mate 20 versions earlier than 10.0.0.188(C00E74R3P8) have a buffer overflow vulnerability in the Bluetooth module. Due to insufficient input validation, an unauthenticated attacker may craft Bluetooth messages after successful paring, causing buffer overflow. Successful exploit may cause code execution. HUAWEI Mate 20 Contains a classic buffer overflow vulnerability.Information is obtained, information is tampered with, and service is disrupted (DoS) It may be put into a state. HUAWEI Mate 20 is a smart phone launched by Huawei. The vulnerability stems from insufficient input validation. An attacker can use this vulnerability to implement code execution through a specially crafted Bluetooth message after successful pairing
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202010-1177",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.188\\(c00e74r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": "lt",
"trust": 0.8,
"vendor": "huawei",
"version": "mate 20 firmware 10.0.0.188(c00e74r3p8) less than"
},
{
"model": "mate \u003c10.0.0.188",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-57586"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"db": "NVD",
"id": "CVE-2020-9113"
}
]
},
"cve": "CVE-2020-9113",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "ADJACENT_NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 5.4,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 5.5,
"id": "CVE-2020-9113",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 1.9,
"vectorString": "AV:A/AC:M/Au:N/C:P/I:P/A:P",
"version": "2.0"
},
{
"accessComplexity": "MEDIUM",
"accessVector": "NETWORK",
"authentication": "SINGLE",
"author": "CNVD",
"availabilityImpact": "PARTIAL",
"baseScore": 6.0,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 6.8,
"id": "CNVD-2020-57586",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:N/AC:M/Au:S/C:P/I:P/A:P",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "ADJACENT",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 8.0,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 2.1,
"id": "CVE-2020-9113",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:A/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Adjacent Network",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 8.0,
"baseSeverity": "High",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2020-9113",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "Required",
"vectorString": "CVSS:3.0/AV:A/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-9113",
"trust": 1.0,
"value": "HIGH"
},
{
"author": "NVD",
"id": "CVE-2020-9113",
"trust": 0.8,
"value": "High"
},
{
"author": "CNVD",
"id": "CNVD-2020-57586",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-202010-640",
"trust": 0.6,
"value": "HIGH"
},
{
"author": "VULMON",
"id": "CVE-2020-9113",
"trust": 0.1,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-57586"
},
{
"db": "VULMON",
"id": "CVE-2020-9113"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-640"
},
{
"db": "NVD",
"id": "CVE-2020-9113"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 versions earlier than 10.0.0.188(C00E74R3P8) have a buffer overflow vulnerability in the Bluetooth module. Due to insufficient input validation, an unauthenticated attacker may craft Bluetooth messages after successful paring, causing buffer overflow. Successful exploit may cause code execution. HUAWEI Mate 20 Contains a classic buffer overflow vulnerability.Information is obtained, information is tampered with, and service is disrupted (DoS) It may be put into a state. HUAWEI Mate 20 is a smart phone launched by Huawei. The vulnerability stems from insufficient input validation. An attacker can use this vulnerability to implement code execution through a specially crafted Bluetooth message after successful pairing",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9113"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"db": "CNVD",
"id": "CNVD-2020-57586"
},
{
"db": "VULMON",
"id": "CVE-2020-9113"
}
],
"trust": 2.25
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-9113",
"trust": 3.1
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012481",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-57586",
"trust": 0.6
},
{
"db": "NSFOCUS",
"id": "50559",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202010-640",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2020-9113",
"trust": 0.1
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-57586"
},
{
"db": "VULMON",
"id": "CVE-2020-9113"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-640"
},
{
"db": "NVD",
"id": "CVE-2020-9113"
}
]
},
"id": "VAR-202010-1177",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-57586"
}
],
"trust": 1.26765326
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-57586"
}
]
},
"last_update_date": "2024-11-23T22:44:24.814000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20201014-01-bluetooth",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20201014-01-bluetooth-en"
},
{
"title": "Patch for HUAWEI Mate 20 buffer overflow vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/236905"
},
{
"title": "Huawei Mate 20 Buffer error vulnerability fix",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=131282"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-57586"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-640"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-120",
"trust": 1.0
},
{
"problemtype": "Classic buffer overflow (CWE-120) [NVD Evaluation ]",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"db": "NVD",
"id": "CVE-2020-9113"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-9113"
},
{
"trust": 1.7,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20201014-01-bluetooth-en"
},
{
"trust": 0.6,
"url": "http://www.nsfocus.net/vulndb/50559"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20201014-01-bluetooth-cn"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/120.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
},
{
"trust": 0.1,
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/189827"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-57586"
},
{
"db": "VULMON",
"id": "CVE-2020-9113"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-640"
},
{
"db": "NVD",
"id": "CVE-2020-9113"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-57586"
},
{
"db": "VULMON",
"id": "CVE-2020-9113"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-640"
},
{
"db": "NVD",
"id": "CVE-2020-9113"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-10-21T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-57586"
},
{
"date": "2020-10-19T00:00:00",
"db": "VULMON",
"id": "CVE-2020-9113"
},
{
"date": "2021-05-10T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"date": "2020-10-14T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202010-640"
},
{
"date": "2020-10-19T20:15:13.260000",
"db": "NVD",
"id": "CVE-2020-9113"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-10-21T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-57586"
},
{
"date": "2020-10-22T00:00:00",
"db": "VULMON",
"id": "CVE-2020-9113"
},
{
"date": "2021-05-10T07:32:00",
"db": "JVNDB",
"id": "JVNDB-2020-012481"
},
{
"date": "2020-11-16T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202010-640"
},
{
"date": "2024-11-21T05:40:04.010000",
"db": "NVD",
"id": "CVE-2020-9113"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote or local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202010-640"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI\u00a0Mate\u00a020\u00a0 Buffer Overflow Vulnerability in Linux",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-012481"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "buffer error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202010-640"
}
],
"trust": 0.6
}
}
VAR-201911-0258
Vulnerability from variot - Updated: 2024-11-23 22:41Mate 20 RS smartphones with versions earlier than 9.1.0.135(C786E133R3P1) have an improper authorization vulnerability. The software does not properly restrict certain operation in ADB mode, successful exploit could allow the attacker to switch to third desktop after a series of operation. The vulnerability stems from the system's improper restrictions on some operations of users in ADB mode. An attacker could use this vulnerability to switch to a third-party desktop
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201911-0258",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20 rs",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.135\\(c786e133r3p1\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.135(c786e133r3p1)"
},
{
"model": "mate rs \u003c9.1.0.135",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44560"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"db": "NVD",
"id": "CVE-2019-5308"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "The vulnerability was discovered by Huawei internal testing.",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201911-1460"
}
],
"trust": 0.6
},
"cve": "CVE-2019-5308",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CVE-2019-5308",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 1.9,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "ADJACENT_NETWORK",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 3.3,
"confidentialityImpact": "NONE",
"exploitabilityScore": 6.5,
"id": "CNVD-2019-44560",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:A/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.4,
"baseSeverity": "LOW",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.9,
"id": "CVE-2019-5308",
"impactScore": 1.4,
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.4,
"baseSeverity": "Low",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "CVE-2019-5308",
"impactScore": null,
"integrityImpact": "Low",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-5308",
"trust": 1.0,
"value": "LOW"
},
{
"author": "NVD",
"id": "CVE-2019-5308",
"trust": 0.8,
"value": "Low"
},
{
"author": "CNVD",
"id": "CNVD-2019-44560",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-201911-1460",
"trust": 0.6,
"value": "LOW"
},
{
"author": "VULMON",
"id": "CVE-2019-5308",
"trust": 0.1,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44560"
},
{
"db": "VULMON",
"id": "CVE-2019-5308"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"db": "CNNVD",
"id": "CNNVD-201911-1460"
},
{
"db": "NVD",
"id": "CVE-2019-5308"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Mate 20 RS smartphones with versions earlier than 9.1.0.135(C786E133R3P1) have an improper authorization vulnerability. The software does not properly restrict certain operation in ADB mode, successful exploit could allow the attacker to switch to third desktop after a series of operation. The vulnerability stems from the system\u0027s improper restrictions on some operations of users in ADB mode. An attacker could use this vulnerability to switch to a third-party desktop",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-5308"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"db": "CNVD",
"id": "CNVD-2019-44560"
},
{
"db": "VULMON",
"id": "CVE-2019-5308"
}
],
"trust": 2.25
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-5308",
"trust": 3.1
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012686",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2019-44560",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201911-1460",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2019-5308",
"trust": 0.1
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44560"
},
{
"db": "VULMON",
"id": "CVE-2019-5308"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"db": "CNNVD",
"id": "CNNVD-201911-1460"
},
{
"db": "NVD",
"id": "CVE-2019-5308"
}
]
},
"id": "VAR-201911-0258",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44560"
}
],
"trust": 1.3624999999999998
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44560"
}
]
},
"last_update_date": "2024-11-23T22:41:18.425000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20191127-01-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20191127-01-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 RS improper authorization vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/193523"
},
{
"title": "Huawei Mate 20 RS Remediation measures for authorization problem vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=103729"
},
{
"title": "Huawei Security Advisories: Security Advisory - Improper Authorization Vulnerability in Several Smartphones",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=huawei_security_advisories\u0026qid=705b2901adfc0c7fd70974844b866423"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44560"
},
{
"db": "VULMON",
"id": "CVE-2019-5308"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"db": "CNNVD",
"id": "CNNVD-201911-1460"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
},
{
"problemtype": "CWE-863",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"db": "NVD",
"id": "CVE-2019-5308"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20191127-01-smartphone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5308"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20191127-01-smartphone-cn"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-5308"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44560"
},
{
"db": "VULMON",
"id": "CVE-2019-5308"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"db": "CNNVD",
"id": "CNNVD-201911-1460"
},
{
"db": "NVD",
"id": "CVE-2019-5308"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2019-44560"
},
{
"db": "VULMON",
"id": "CVE-2019-5308"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"db": "CNNVD",
"id": "CNNVD-201911-1460"
},
{
"db": "NVD",
"id": "CVE-2019-5308"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-12-10T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-44560"
},
{
"date": "2019-11-29T00:00:00",
"db": "VULMON",
"id": "CVE-2019-5308"
},
{
"date": "2019-12-11T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"date": "2019-11-27T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201911-1460"
},
{
"date": "2019-11-29T21:15:11.480000",
"db": "NVD",
"id": "CVE-2019-5308"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-12-10T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-44560"
},
{
"date": "2020-08-24T00:00:00",
"db": "VULMON",
"id": "CVE-2019-5308"
},
{
"date": "2019-12-11T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-012686"
},
{
"date": "2020-08-25T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201911-1460"
},
{
"date": "2024-11-21T04:44:43.340000",
"db": "NVD",
"id": "CVE-2019-5308"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Mate 20 RS Unauthorized authentication vulnerability in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012686"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "authorization issue",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201911-1460"
}
],
"trust": 0.6
}
}
VAR-202004-0619
Vulnerability from variot - Updated: 2024-11-23 22:41There are two denial of service vulnerabilities on some Huawei smartphones. An attacker may send specially crafted TD-SCDMA messages from a rogue base station to the affected devices. Due to insufficient input validation of two values when parsing the messages, successful exploit may cause device abnormal. This is 2 out of 2 vulnerabilities. Different than CVE-2020-5302. Affected products are: ALP-AL00B: earlier than 9.1.0.333(C00E333R2P1T8) ALP-L09: earlier than 9.1.0.300(C432E4R1P9T8) ALP-L29: earlier than 9.1.0.315(C636E5R1P13T8) BLA-L29C: earlier than 9.1.0.321(C636E4R1P14T8), earlier than 9.1.0.330(C432E6R1P12T8), earlier than 9.1.0.302(C635E4R1P13T8) Berkeley-AL20: earlier than 9.1.0.333(C00E333R2P1T8) Berkeley-L09: earlier than 9.1.0.350(C10E3R1P14T8), earlier than 9.1.0.351(C432E5R1P13T8), earlier than 9.1.0.350(C636E4R1P13T8) Charlotte-L09C: earlier than 9.1.0.311(C185E4R1P11T8), earlier than 9.1.0.345(C432E8R1P11T8) Charlotte-L29C: earlier than 9.1.0.325(C185E4R1P11T8), earlier than 9.1.0.335(C636E3R1P13T8), earlier than 9.1.0.345(C432E8R1P11T8), earlier than 9.1.0.336(C605E3R1P12T8) Columbia-AL10B: earlier than 9.1.0.333(C00E333R1P1T8) Columbia-L29D: earlier than 9.1.0.350(C461E3R1P11T8), earlier than 9.1.0.350(C185E3R1P12T8), earlier than 9.1.0.350(C10E5R1P14T8), earlier than 9.1.0.351(C432E5R1P13T8) Cornell-AL00A: earlier than 9.1.0.333(C00E333R1P1T8) Cornell-L29A: earlier than 9.1.0.328(C185E1R1P9T8), earlier than 9.1.0.328(C432E1R1P9T8), earlier than 9.1.0.330(C461E1R1P9T8), earlier than 9.1.0.328(C636E2R1P12T8) Emily-L09C: earlier than 9.1.0.336(C605E4R1P12T8), earlier than 9.1.0.311(C185E2R1P12T8), earlier than 9.1.0.345(C432E10R1P12T8) Emily-L29C: earlier than 9.1.0.311(C605E2R1P12T8), earlier than 9.1.0.311(C636E7R1P13T8), earlier than 9.1.0.311(C432E7R1P11T8) Ever-L29B: earlier than 9.1.0.311(C185E3R3P1), earlier than 9.1.0.310(C636E3R2P1), earlier than 9.1.0.310(C432E3R1P12) HUAWEI Mate 20: earlier than 9.1.0.131(C00E131R3P1) HUAWEI Mate 20 Pro: earlier than 9.1.0.310(C185E10R2P1) HUAWEI Mate 20 RS: earlier than 9.1.0.135(C786E133R3P1) HUAWEI Mate 20 X: earlier than 9.1.0.135(C00E133R2P1) HUAWEI P20: earlier than 9.1.0.333(C00E333R1P1T8) HUAWEI P20 Pro: earlier than 9.1.0.333(C00E333R1P1T8) HUAWEI P30: earlier than 9.1.0.193 HUAWEI P30 Pro: earlier than 9.1.0.186(C00E180R2P1) HUAWEI Y9 2019: earlier than 9.1.0.220(C605E3R1P1T8) HUAWEI nova lite 3: earlier than 9.1.0.305(C635E8R2P2) Honor 10 Lite: earlier than 9.1.0.283(C605E8R2P2) Honor 8X: earlier than 9.1.0.221(C461E2R1P1T8) Honor View 20: earlier than 9.1.0.238(C432E1R3P1) Jackman-L22: earlier than 9.1.0.247(C636E2R4P1T8) Paris-L21B: earlier than 9.1.0.331(C432E1R1P2T8) Paris-L21MEB: earlier than 9.1.0.331(C185E4R1P3T8) Paris-L29B: earlier than 9.1.0.331(C636E1R1P3T8) Sydney-AL00: earlier than 9.1.0.212(C00E62R1P7T8) Sydney-L21: earlier than 9.1.0.215(C432E1R1P1T8), earlier than 9.1.0.213(C185E1R1P1T8) Sydney-L21BR: earlier than 9.1.0.213(C185E1R1P2T8) Sydney-L22: earlier than 9.1.0.258(C636E1R1P1T8) Sydney-L22BR: earlier than 9.1.0.258(C636E1R1P1T8) SydneyM-AL00: earlier than 9.1.0.228(C00E78R1P7T8) SydneyM-L01: earlier than 9.1.0.215(C782E2R1P1T8), earlier than 9.1.0.213(C185E1R1P1T8), earlier than 9.1.0.270(C432E3R1P1T8) SydneyM-L03: earlier than 9.1.0.217(C605E1R1P1T8) SydneyM-L21: earlier than 9.1.0.221(C461E1R1P1T8), earlier than 9.1.0.215(C432E4R1P1T8) SydneyM-L22: earlier than 9.1.0.259(C185E1R1P2T8), earlier than 9.1.0.220(C635E1R1P2T8), earlier than 9.1.0.216(C569E1R1P1T8) SydneyM-L23: earlier than 9.1.0.226(C605E2R1P1T8) Yale-L21A: earlier than 9.1.0.154(C432E2R3P2), earlier than 9.1.0.154(C461E2R2P1), earlier than 9.1.0.154(C636E2R2P1) Honor 20: earlier than 9.1.0.152(C00E150R5P1) Honor Magic2: earlier than 10.0.0.187 Honor V20: earlier than 9.1.0.234(C00E234R4P3). plural Huawei There is a vulnerability related to input confirmation on smartphones.Service operation interruption (DoS) It may be put into a state. Huawei Honor10 Lite and Huawei Y9 are both smartphones from China's Huawei.
A denial of service vulnerability exists in versions before Huawei Honor10 Lite Harry-AL00C 9.1.0.217 (C00E215R3P1) and before Huawei Y9 Jackman-L23 9.1.0.220 (C45E3R1P1T8)
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202004-0619",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "yale-l21a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c461e2r2p1\\)"
},
{
"model": "sydneym-l03",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.217\\(c605e1r1p1t8\\)"
},
{
"model": "sydneym-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.259\\(c185e1r1p2t8\\)"
},
{
"model": "nova lite 3",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.305\\(c635e8r2p2\\)"
},
{
"model": "alp-al00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r2p1t8\\)"
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.321\\(c636e4r1p14t8\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.345\\(c432e8r1p11t8\\)"
},
{
"model": "berkeley-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.351\\(c432e5r1p13t8\\)"
},
{
"model": "alp-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.300\\(c432e4r1p9t8\\)"
},
{
"model": "yale-l21a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c636e2r2p1\\)"
},
{
"model": "p20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.328\\(c185e1r1p9t8\\)"
},
{
"model": "emily-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.345\\(c432e10r1p12t8\\)"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.328\\(c636e2r1p12t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c461e3r1p11t8\\)"
},
{
"model": "jackman-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.247\\(c636e2r4p1t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c636e7r1p13t8\\)"
},
{
"model": "sydneym-l01",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.213\\(c185e1r1p1t8\\)"
},
{
"model": "sydneym-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.221\\(c461e1r1p1t8\\)"
},
{
"model": "ever-l29b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.310\\(c636e3r2p1\\)"
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.330\\(c432e6r1p12t8\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.131\\(c00e131r3p1\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.351\\(c432e5r1p13t8\\)"
},
{
"model": "cornell-al00a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "sydneym-al00",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.228\\(c00e78r1p7t8\\)"
},
{
"model": "berkeley-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c10e3r1p14t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c185e3r1p12t8\\)"
},
{
"model": "ever-l29b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.310\\(c432e3r1p12\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.325\\(c185e4r1p11t8\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.310\\(c185e10r2p1\\)"
},
{
"model": "sydneym-l01",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.215\\(c782e2r1p1t8\\)"
},
{
"model": "honor view 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.238\\(c432e1r3p1\\)"
},
{
"model": "paris-l29b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.331\\(c636e1r1p3t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c432e7r1p11t8\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.186\\(c00e180r2p1\\)"
},
{
"model": "sydneym-l23",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.226\\(c605e2r1p1t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c605e2r1p12t8\\)"
},
{
"model": "paris-l21b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.331\\(c432e1r1p2t8\\)"
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.302\\(c635e4r1p13t8\\)"
},
{
"model": "paris-l21meb",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.331\\(c185e4r1p3t8\\)"
},
{
"model": "mate 20 x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.135\\(c00e133r2p1\\)"
},
{
"model": "honor 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.152\\(c00e150r5p1\\)"
},
{
"model": "yale-l21a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c432e2r3p2\\)"
},
{
"model": "sydney-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.258\\(c636e1r1p1t8\\)"
},
{
"model": "sydney-l22br",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.258\\(c636e1r1p1t8\\)"
},
{
"model": "sydneym-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.215\\(c432e4r1p1t8\\)"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.330\\(c461e1r1p9t8\\)"
},
{
"model": "columbia-al10b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.336\\(c605e3r1p12t8\\)"
},
{
"model": "y9 2019",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.220\\(c605e3r1p1t8\\)"
},
{
"model": "sydney-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.213\\(c185e1r1p1t8\\)"
},
{
"model": "alp-l29",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.315\\(c636e5r1p13t8\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.335\\(c636e3r1p13t8\\)"
},
{
"model": "sydneym-l01",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.270\\(c432e3r1p1t8\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.193"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.328\\(c432e1r1p9t8\\)"
},
{
"model": "honor 8x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.221\\(c461e2r1p1t8\\)"
},
{
"model": "sydneym-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.220\\(c635e1r1p2t8\\)"
},
{
"model": "berkeley-al20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r2p1t8\\)"
},
{
"model": "berkeley-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c636e4r1p13t8\\)"
},
{
"model": "honor v20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.234\\(c00e234r4p3\\)"
},
{
"model": "sydney-l21br",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.213\\(c185e1r1p2t8\\)"
},
{
"model": "sydneym-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.216\\(c569e1r1p1t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c10e5r1p14t8\\)"
},
{
"model": "mate 20 rs",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.135\\(c786e133r3p1\\)"
},
{
"model": "ever-l29b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c185e3r3p1\\)"
},
{
"model": "sydney-al00",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.212\\(c00e62r1p7t8\\)"
},
{
"model": "charlotte-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c185e4r1p11t8\\)"
},
{
"model": "p20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "sydney-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.215\\(c432e1r1p1t8\\)"
},
{
"model": "emily-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c185e2r1p12t8\\)"
},
{
"model": "charlotte-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.345\\(c432e8r1p11t8\\)"
},
{
"model": "honor magic2",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.187"
},
{
"model": "emily-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.336\\(c605e4r1p12t8\\)"
},
{
"model": "honor 10 lite",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.283\\(c605e8r2p2\\)"
},
{
"model": "berkeley-l09",
"scope": "eq",
"trust": 0.9,
"vendor": "huawei",
"version": "9.1.0.350(c10e3r1p14t8)"
},
{
"model": "berkeley-l09",
"scope": "eq",
"trust": 0.9,
"vendor": "huawei",
"version": "9.1.0.350(c636e4r1p13t8)"
},
{
"model": "bla-l29c",
"scope": "eq",
"trust": 0.9,
"vendor": "huawei",
"version": "9.1.0.302(c635e4r1p13t8)"
},
{
"model": "bla-l29c",
"scope": "eq",
"trust": 0.9,
"vendor": "huawei",
"version": "9.1.0.321(c636e4r1p14t8)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.333(c00e333r2p1t8)"
},
{
"model": "alp-l09",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.300(c432e4r1p9t8)"
},
{
"model": "alp-l09",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.315(c636e5r1p13t8)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.333(c00e333r2p1t8)"
},
{
"model": "berkeley-l09",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.351(c432e5r1p13t8)"
},
{
"model": "bla-l29c",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.330(c432e6r1p12t8)"
},
{
"model": "honor10 lite \u003charry-al00c 9.1.0.217",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "y9 \u003cjackman-l23 9.1.0.220",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.1.18d(c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.106(c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.113(sp2c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.113(sp3c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.113(sp7c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.118(c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.120(sp2c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.125(sp1c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.125(sp3c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.126(sp2c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.126(sp5c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.127(sp1c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.128(sp2c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.129"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.129(sp2c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.153(c00)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.336(c00)"
},
{
"model": "alp-l09",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.105(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.111(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.112d(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.116(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.119(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.119d(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.122(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.132(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.132d(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.142(c00)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.151(c00)"
},
{
"model": "bla-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.127(c432)"
},
{
"model": "bla-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.0.0.137(c432)"
},
{
"model": "charlotte-l09c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.311(c185e4r1p11t8)"
},
{
"model": "charlotte-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.325(c185e4r1p11t8)"
},
{
"model": "charlotte-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.335(c636e3r1p13t8)"
},
{
"model": "charlotte-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.336(c605e3r1p12t8)"
},
{
"model": "columbia-al10b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.163(c00)"
},
{
"model": "columbia-l29d",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.146(c461)"
},
{
"model": "columbia-l29d",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.148(c185)"
},
{
"model": "columbia-l29d",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.151(c10)"
},
{
"model": "columbia-l29d",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.151(c432)"
},
{
"model": "columbia-l29d",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.350(c10e5r1p14t8)"
},
{
"model": "columbia-l29d",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.350(c185e3r1p12t8)"
},
{
"model": "columbia-l29d",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.350(c461e3r1p11t8)"
},
{
"model": "cornell-l29a",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.328(c185e1r1p9t8)"
},
{
"model": "cornell-l29a",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.328(c432e1r1p9t8)"
},
{
"model": "cornell-l29a",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.328(c636e2r1p12t8)"
},
{
"model": "emily-l09c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "emily-l09c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.311(c185e2r1p12t8)"
},
{
"model": "emily-l09c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.336(c605e4r1p12t8)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.132a(c432)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.135(c782)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.154(c10)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.154(c461)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.154(c635)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.156(c185)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.156(c605)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.159(c636)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.311(c10e2r1p13t8)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.311(c185e2r1p12t8)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.311(c432e7r1p11t8)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.311(c461e2r1p11t8)"
},
{
"model": "emily-l29c",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.311(c605e2r1p12t8)"
},
{
"model": "ever-l29b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.0.0.206(c185e3r3p1)"
},
{
"model": "ever-l29b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.0.0.207(c636e3r2p1)"
},
{
"model": "ever-l29b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.0.0.208(c432e3r1p12)"
},
{
"model": "ever-l29b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.310(c432e3r1p12)"
},
{
"model": "ever-l29b",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.310(c636e3r2p1)"
},
{
"model": "honor 10 lite",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "honor 10 lite",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.217(c00e215r3p1)"
},
{
"model": "honor 8x",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "honor 8x",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.217(c00e15r3p2t8)"
},
{
"model": "honor magic2",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "honor magic2",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "10.0.0.175(c00e59r2p11)"
},
{
"model": "honor v20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "honor v20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.0.1.161(c00e161r2p2)"
},
{
"model": "jackman-l22",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.2.0.156(c636r2p2)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20 pro",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20 pro",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.135(c00e133r3p1)"
},
{
"model": "mate 20 rs",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "p20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "p20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.109"
},
{
"model": "p20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.120"
},
{
"model": "p20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.121"
},
{
"model": "p20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.128"
},
{
"model": "p20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.130"
},
{
"model": "p20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.1.0.171(c00)"
},
{
"model": "p20 pro",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "p30",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "sydney-l21",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.213(c185e1r1p1t8)"
},
{
"model": "sydneym-l01",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.213(c185e1r1p1t8)"
},
{
"model": "sydneym-l01",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.215(c782e2r1p1t8)"
},
{
"model": "sydneym-l21",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.215(c432e4r1p1t8)"
},
{
"model": "sydneym-l22",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.216(c569e1r1p1t8)"
},
{
"model": "sydneym-l22",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.220(c635e1r1p2t8)"
},
{
"model": "y9 2019",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "y9 2019",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.2.0.160(c185r2p2)"
},
{
"model": "y9 2019",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.2.0.162(c605)"
},
{
"model": "y9 2019",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "8.2.0.163(c605)"
},
{
"model": "yale-l21a",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.154(c432e2r3p2)"
},
{
"model": "yale-l21a",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.154(c461e2r2p1)"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44785"
},
{
"db": "VULMON",
"id": "CVE-2019-5303"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"db": "NVD",
"id": "CVE-2019-5303"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:alp-al00b_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:alp-l09_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:berkeley-al20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:berkeley-l09_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:bla-l29c_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "These two vulnerabilities were discovered by Huawei internal testing.",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-1092"
}
],
"trust": 0.6
},
"cve": "CVE-2019-5303",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "ADJACENT_NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 2.9,
"confidentialityImpact": "NONE",
"exploitabilityScore": 5.5,
"id": "CVE-2019-5303",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.1,
"vectorString": "AV:A/AC:M/Au:N/C:N/I:N/A:P",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Medium",
"accessVector": "Adjacent Network",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "Partial",
"baseScore": 2.9,
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2019-015526",
"impactScore": null,
"integrityImpact": "None",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:A/AC:M/Au:N/C:N/I:N/A:P",
"version": "2.0"
},
{
"accessComplexity": "HIGH",
"accessVector": "ADJACENT_NETWORK",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "COMPLETE",
"baseScore": 4.6,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.2,
"id": "CNVD-2019-44785",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:A/AC:H/Au:N/C:N/I:N/A:C",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "HIGH",
"attackVector": "ADJACENT",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 5.3,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"exploitabilityScore": 1.6,
"id": "CVE-2019-5303",
"impactScore": 3.6,
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:A/AC:H/PR:N/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
{
"attackComplexity": "High",
"attackVector": "Adjacent Network",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 5.3,
"baseSeverity": "Medium",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2019-015526",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:A/AC:H/PR:N/UI:N/S:U/C:N/I:N/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-5303",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "JVNDB-2019-015526",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2019-44785",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-201908-1092",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "VULMON",
"id": "CVE-2019-5303",
"trust": 0.1,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44785"
},
{
"db": "VULMON",
"id": "CVE-2019-5303"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1092"
},
{
"db": "NVD",
"id": "CVE-2019-5303"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There are two denial of service vulnerabilities on some Huawei smartphones. An attacker may send specially crafted TD-SCDMA messages from a rogue base station to the affected devices. Due to insufficient input validation of two values when parsing the messages, successful exploit may cause device abnormal. This is 2 out of 2 vulnerabilities. Different than CVE-2020-5302. Affected products are: ALP-AL00B: earlier than 9.1.0.333(C00E333R2P1T8) ALP-L09: earlier than 9.1.0.300(C432E4R1P9T8) ALP-L29: earlier than 9.1.0.315(C636E5R1P13T8) BLA-L29C: earlier than 9.1.0.321(C636E4R1P14T8), earlier than 9.1.0.330(C432E6R1P12T8), earlier than 9.1.0.302(C635E4R1P13T8) Berkeley-AL20: earlier than 9.1.0.333(C00E333R2P1T8) Berkeley-L09: earlier than 9.1.0.350(C10E3R1P14T8), earlier than 9.1.0.351(C432E5R1P13T8), earlier than 9.1.0.350(C636E4R1P13T8) Charlotte-L09C: earlier than 9.1.0.311(C185E4R1P11T8), earlier than 9.1.0.345(C432E8R1P11T8) Charlotte-L29C: earlier than 9.1.0.325(C185E4R1P11T8), earlier than 9.1.0.335(C636E3R1P13T8), earlier than 9.1.0.345(C432E8R1P11T8), earlier than 9.1.0.336(C605E3R1P12T8) Columbia-AL10B: earlier than 9.1.0.333(C00E333R1P1T8) Columbia-L29D: earlier than 9.1.0.350(C461E3R1P11T8), earlier than 9.1.0.350(C185E3R1P12T8), earlier than 9.1.0.350(C10E5R1P14T8), earlier than 9.1.0.351(C432E5R1P13T8) Cornell-AL00A: earlier than 9.1.0.333(C00E333R1P1T8) Cornell-L29A: earlier than 9.1.0.328(C185E1R1P9T8), earlier than 9.1.0.328(C432E1R1P9T8), earlier than 9.1.0.330(C461E1R1P9T8), earlier than 9.1.0.328(C636E2R1P12T8) Emily-L09C: earlier than 9.1.0.336(C605E4R1P12T8), earlier than 9.1.0.311(C185E2R1P12T8), earlier than 9.1.0.345(C432E10R1P12T8) Emily-L29C: earlier than 9.1.0.311(C605E2R1P12T8), earlier than 9.1.0.311(C636E7R1P13T8), earlier than 9.1.0.311(C432E7R1P11T8) Ever-L29B: earlier than 9.1.0.311(C185E3R3P1), earlier than 9.1.0.310(C636E3R2P1), earlier than 9.1.0.310(C432E3R1P12) HUAWEI Mate 20: earlier than 9.1.0.131(C00E131R3P1) HUAWEI Mate 20 Pro: earlier than 9.1.0.310(C185E10R2P1) HUAWEI Mate 20 RS: earlier than 9.1.0.135(C786E133R3P1) HUAWEI Mate 20 X: earlier than 9.1.0.135(C00E133R2P1) HUAWEI P20: earlier than 9.1.0.333(C00E333R1P1T8) HUAWEI P20 Pro: earlier than 9.1.0.333(C00E333R1P1T8) HUAWEI P30: earlier than 9.1.0.193 HUAWEI P30 Pro: earlier than 9.1.0.186(C00E180R2P1) HUAWEI Y9 2019: earlier than 9.1.0.220(C605E3R1P1T8) HUAWEI nova lite 3: earlier than 9.1.0.305(C635E8R2P2) Honor 10 Lite: earlier than 9.1.0.283(C605E8R2P2) Honor 8X: earlier than 9.1.0.221(C461E2R1P1T8) Honor View 20: earlier than 9.1.0.238(C432E1R3P1) Jackman-L22: earlier than 9.1.0.247(C636E2R4P1T8) Paris-L21B: earlier than 9.1.0.331(C432E1R1P2T8) Paris-L21MEB: earlier than 9.1.0.331(C185E4R1P3T8) Paris-L29B: earlier than 9.1.0.331(C636E1R1P3T8) Sydney-AL00: earlier than 9.1.0.212(C00E62R1P7T8) Sydney-L21: earlier than 9.1.0.215(C432E1R1P1T8), earlier than 9.1.0.213(C185E1R1P1T8) Sydney-L21BR: earlier than 9.1.0.213(C185E1R1P2T8) Sydney-L22: earlier than 9.1.0.258(C636E1R1P1T8) Sydney-L22BR: earlier than 9.1.0.258(C636E1R1P1T8) SydneyM-AL00: earlier than 9.1.0.228(C00E78R1P7T8) SydneyM-L01: earlier than 9.1.0.215(C782E2R1P1T8), earlier than 9.1.0.213(C185E1R1P1T8), earlier than 9.1.0.270(C432E3R1P1T8) SydneyM-L03: earlier than 9.1.0.217(C605E1R1P1T8) SydneyM-L21: earlier than 9.1.0.221(C461E1R1P1T8), earlier than 9.1.0.215(C432E4R1P1T8) SydneyM-L22: earlier than 9.1.0.259(C185E1R1P2T8), earlier than 9.1.0.220(C635E1R1P2T8), earlier than 9.1.0.216(C569E1R1P1T8) SydneyM-L23: earlier than 9.1.0.226(C605E2R1P1T8) Yale-L21A: earlier than 9.1.0.154(C432E2R3P2), earlier than 9.1.0.154(C461E2R2P1), earlier than 9.1.0.154(C636E2R2P1) Honor 20: earlier than 9.1.0.152(C00E150R5P1) Honor Magic2: earlier than 10.0.0.187 Honor V20: earlier than 9.1.0.234(C00E234R4P3). plural Huawei There is a vulnerability related to input confirmation on smartphones.Service operation interruption (DoS) It may be put into a state. Huawei Honor10 Lite and Huawei Y9 are both smartphones from China\u0027s Huawei. \n\nA denial of service vulnerability exists in versions before Huawei Honor10 Lite Harry-AL00C 9.1.0.217 (C00E215R3P1) and before Huawei Y9 Jackman-L23 9.1.0.220 (C45E3R1P1T8)",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-5303"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"db": "CNVD",
"id": "CNVD-2019-44785"
},
{
"db": "VULMON",
"id": "CVE-2019-5303"
}
],
"trust": 2.25
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-5303",
"trust": 3.1
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015526",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2019-44785",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1092",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2019-5303",
"trust": 0.1
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44785"
},
{
"db": "VULMON",
"id": "CVE-2019-5303"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1092"
},
{
"db": "NVD",
"id": "CVE-2019-5303"
}
]
},
"id": "VAR-202004-0619",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44785"
}
],
"trust": 1.1828954514285712
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44785"
}
]
},
"last_update_date": "2024-11-23T22:41:07.750000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20190814-01-mobile",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190814-01-mobile-en"
},
{
"title": "Patch for Huawei Honor10 Lite and Huawei Y9 Denial of Service Vulnerability (CNVD-2019-44785)",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/193773"
},
{
"title": "Huawei Honor10 Lite and Huawei Y9 Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=96758"
},
{
"title": "Huawei Security Advisories: Two Denial of Service Vulnerabilities on Some Huawei Smartphones",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=huawei_security_advisories\u0026qid=88453f1b990572fac17211a1a9b849ea"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44785"
},
{
"db": "VULMON",
"id": "CVE-2019-5303"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1092"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-20",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"db": "NVD",
"id": "CVE-2019-5303"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.7,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190814-01-mobile-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5303"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20190814-01-mobile-cn"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-5303"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/20.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
},
{
"trust": 0.1,
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/165364"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-44785"
},
{
"db": "VULMON",
"id": "CVE-2019-5303"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1092"
},
{
"db": "NVD",
"id": "CVE-2019-5303"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2019-44785"
},
{
"db": "VULMON",
"id": "CVE-2019-5303"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1092"
},
{
"db": "NVD",
"id": "CVE-2019-5303"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-12-11T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-44785"
},
{
"date": "2020-04-27T00:00:00",
"db": "VULMON",
"id": "CVE-2019-5303"
},
{
"date": "2020-06-01T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"date": "2019-08-14T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201908-1092"
},
{
"date": "2020-04-27T20:15:12.397000",
"db": "NVD",
"id": "CVE-2019-5303"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-12-11T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-44785"
},
{
"date": "2020-05-05T00:00:00",
"db": "VULMON",
"id": "CVE-2019-5303"
},
{
"date": "2020-06-01T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-015526"
},
{
"date": "2020-09-03T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201908-1092"
},
{
"date": "2024-11-21T04:44:42.557000",
"db": "NVD",
"id": "CVE-2019-5303"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote or local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-1092"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural Huawei Input verification vulnerabilities on smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-015526"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "input validation error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-1092"
}
],
"trust": 0.6
}
}
VAR-202001-1007
Vulnerability from variot - Updated: 2024-11-23 22:33HUAWEI Mate 20 smart phones with versions earlier than 10.0.0.175(C00E70R3P8) have an insufficient authentication vulnerability. A local attacker with high privilege can execute a specific command to exploit this vulnerability. Successful exploitation may cause information leak and compromise the availability of the smart phones.Affected product versions include: HUAWEI Mate 20 versions Versions earlier than 10.0.0.175(C00E70R3P8). HUAWEI Mate 20 Smartphones have an authentication vulnerability.Information obtained and denial of service (DoS) May be in a state. Huawei Mate 20 is a smartphone from China's Huawei. Local attackers can use this vulnerability to leak information and affect the usability of the phone
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202001-1007",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "eq",
"trust": 2.0,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": "lte",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.175\\(c00e70r3p8\\)"
},
{
"model": "mate 20",
"scope": "lte",
"trust": 0.8,
"vendor": "huawei",
"version": "mate 20 firmware 10.0.0.175(c00e70r3p8)"
},
{
"model": "mate \u003c10.0.0.175",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "10.0.0.175c00e70r3p8"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "9.1.0.139c00e133r3p1"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02969"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-779"
},
{
"db": "NVD",
"id": "CVE-2020-1840"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "The vulnerability was discovered by Huawei internal testing.",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202001-779"
}
],
"trust": 0.6
},
"cve": "CVE-2020-1840",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 3.6,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CVE-2020-1840",
"impactScore": 4.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.8,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:P",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "PARTIAL",
"baseScore": 4.6,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-02969",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:P/A:P",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 6.0,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 0.8,
"id": "CVE-2020-1840",
"impactScore": 5.2,
"integrityImpact": "NONE",
"privilegesRequired": "HIGH",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:H/UI:N/S:U/C:H/I:N/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Local",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 6.0,
"baseSeverity": "Medium",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2020-1840",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "High",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:L/AC:L/PR:H/UI:N/S:U/C:H/I:N/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-1840",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2020-1840",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2020-02969",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-202001-779",
"trust": 0.6,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02969"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-779"
},
{
"db": "NVD",
"id": "CVE-2020-1840"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 smart phones with versions earlier than 10.0.0.175(C00E70R3P8) have an insufficient authentication vulnerability. A local attacker with high privilege can execute a specific command to exploit this vulnerability. Successful exploitation may cause information leak and compromise the availability of the smart phones.Affected product versions include: HUAWEI Mate 20 versions Versions earlier than 10.0.0.175(C00E70R3P8). HUAWEI Mate 20 Smartphones have an authentication vulnerability.Information obtained and denial of service (DoS) May be in a state. Huawei Mate 20 is a smartphone from China\u0027s Huawei. Local attackers can use this vulnerability to leak information and affect the usability of the phone",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-1840"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"db": "CNVD",
"id": "CNVD-2020-02969"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-1840",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001478",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-02969",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202001-779",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02969"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-779"
},
{
"db": "NVD",
"id": "CVE-2020-1840"
}
]
},
"id": "VAR-202001-1007",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02969"
}
],
"trust": 1.26765326
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02969"
}
]
},
"last_update_date": "2024-11-23T22:33:36.795000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200115-01-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200115-01-smartphone-en"
},
{
"title": "Patch for Unknown vulnerability in Huawei Mate 20",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/197403"
},
{
"title": "Huawei Mate 20 Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=107107"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02969"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-779"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-287",
"trust": 1.0
},
{
"problemtype": "Incorrect authentication (CWE-287) [NVD Evaluation ]",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"db": "NVD",
"id": "CVE-2020-1840"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200115-01-smartphone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-1840"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200115-01-smartphone-cn"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02969"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-779"
},
{
"db": "NVD",
"id": "CVE-2020-1840"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-02969"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-779"
},
{
"db": "NVD",
"id": "CVE-2020-1840"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-01-20T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-02969"
},
{
"date": "2020-02-12T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"date": "2020-01-15T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202001-779"
},
{
"date": "2020-01-21T19:15:14.020000",
"db": "NVD",
"id": "CVE-2020-1840"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-01-21T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-02969"
},
{
"date": "2020-02-12T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-001478"
},
{
"date": "2020-01-22T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202001-779"
},
{
"date": "2024-11-21T05:11:28.303000",
"db": "NVD",
"id": "CVE-2020-1840"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202001-779"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI\u00a0Mate\u00a020\u00a0 Authentication vulnerabilities in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-001478"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "other",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202001-779"
}
],
"trust": 0.6
}
}
VAR-202004-0961
Vulnerability from variot - Updated: 2024-11-23 22:33HUAWEI Mate 20 smartphones with versions earlier than 10.0.0.188(C00E74R3P8) have an improper authorization vulnerability. The software does not properly restrict certain user's modification of certain configuration file, successful exploit could allow the attacker to bypass app lock after a series of operation in ADB mode. Huawei Mate 20 is a smart phone of the Chinese company Huawei.
Before Huawei Mate 20 10.0.0.188 (C00E74R3P8), there was an access control error vulnerability. The vulnerability stems from the system’s failure to properly restrict the modification of configuration files by specific users. An attacker can exploit a series of operations in ADB debugging mode. The vulnerability caused the application lock to be bypassed
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202004-0961",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.188\\(c00e74r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.188(c00e74r3p8)"
},
{
"model": "mate \u003c10.0.0.188",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.131(c00e131r3p1)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "9.1.0.139(c00e133r3p1)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "10.0.0.175(c00e70r3p8)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.1,
"vendor": "huawei",
"version": "10.0.0.185(c00e74r3p8)"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-27122"
},
{
"db": "VULMON",
"id": "CVE-2020-1807"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"db": "NVD",
"id": "CVE-2020-1807"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
}
]
},
"cve": "CVE-2020-1807",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 3.6,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CVE-2020-1807",
"impactScore": 4.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 1.1,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:P/A:N",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Low",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 3.6,
"confidentialityImpact": "Partial",
"exploitabilityScore": null,
"id": "JVNDB-2020-004654",
"impactScore": null,
"integrityImpact": "Partial",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 3.6,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-27122",
"impactScore": 4.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 3.5,
"baseSeverity": "LOW",
"confidentialityImpact": "LOW",
"exploitabilityScore": 0.9,
"id": "CVE-2020-1807",
"impactScore": 2.5,
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:L/I:L/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 3.5,
"baseSeverity": "Low",
"confidentialityImpact": "Low",
"exploitabilityScore": null,
"id": "JVNDB-2020-004654",
"impactScore": null,
"integrityImpact": "Low",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:L/I:L/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-1807",
"trust": 1.0,
"value": "LOW"
},
{
"author": "NVD",
"id": "JVNDB-2020-004654",
"trust": 0.8,
"value": "Low"
},
{
"author": "CNVD",
"id": "CNVD-2020-27122",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202004-1954",
"trust": 0.6,
"value": "LOW"
},
{
"author": "VULMON",
"id": "CVE-2020-1807",
"trust": 0.1,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-27122"
},
{
"db": "VULMON",
"id": "CVE-2020-1807"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"db": "CNNVD",
"id": "CNNVD-202004-1954"
},
{
"db": "NVD",
"id": "CVE-2020-1807"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 smartphones with versions earlier than 10.0.0.188(C00E74R3P8) have an improper authorization vulnerability. The software does not properly restrict certain user\u0027s modification of certain configuration file, successful exploit could allow the attacker to bypass app lock after a series of operation in ADB mode. Huawei Mate 20 is a smart phone of the Chinese company Huawei. \n\r\n\r\nBefore Huawei Mate 20 10.0.0.188 (C00E74R3P8), there was an access control error vulnerability. The vulnerability stems from the system\u2019s failure to properly restrict the modification of configuration files by specific users. An attacker can exploit a series of operations in ADB debugging mode. The vulnerability caused the application lock to be bypassed",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-1807"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"db": "CNVD",
"id": "CNVD-2020-27122"
},
{
"db": "VULMON",
"id": "CVE-2020-1807"
}
],
"trust": 2.25
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-1807",
"trust": 3.1
},
{
"db": "JVNDB",
"id": "JVNDB-2020-004654",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-27122",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202004-1954",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2020-1807",
"trust": 0.1
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-27122"
},
{
"db": "VULMON",
"id": "CVE-2020-1807"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"db": "CNNVD",
"id": "CNNVD-202004-1954"
},
{
"db": "NVD",
"id": "CVE-2020-1807"
}
]
},
"id": "VAR-202004-0961",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-27122"
}
],
"trust": 1.26765326
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-27122"
}
]
},
"last_update_date": "2024-11-23T22:33:28.945000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200422-01-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200422-01-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 access control error vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/216753"
},
{
"title": "Huawei Mate 20 Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=116723"
},
{
"title": "Huawei Security Advisories: Security Advisory - Improper Authorization Vulnerability in Several Smartphones",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=huawei_security_advisories\u0026qid=daf6c3e6182f254486d0180254736189"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-27122"
},
{
"db": "VULMON",
"id": "CVE-2020-1807"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"db": "CNNVD",
"id": "CNNVD-202004-1954"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
},
{
"problemtype": "CWE-863",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"db": "NVD",
"id": "CVE-2020-1807"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-1807"
},
{
"trust": 1.7,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200422-01-smartphone-en"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2020-1807"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200422-01-smartphone-cn"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/863.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
},
{
"trust": 0.1,
"url": "https://exchange.xforce.ibmcloud.com/vulnerabilities/180312"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-27122"
},
{
"db": "VULMON",
"id": "CVE-2020-1807"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"db": "CNNVD",
"id": "CNNVD-202004-1954"
},
{
"db": "NVD",
"id": "CVE-2020-1807"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-27122"
},
{
"db": "VULMON",
"id": "CVE-2020-1807"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"db": "CNNVD",
"id": "CNNVD-202004-1954"
},
{
"db": "NVD",
"id": "CVE-2020-1807"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-05-08T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-27122"
},
{
"date": "2020-04-27T00:00:00",
"db": "VULMON",
"id": "CVE-2020-1807"
},
{
"date": "2020-05-25T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"date": "2020-04-22T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202004-1954"
},
{
"date": "2020-04-27T15:15:13.080000",
"db": "NVD",
"id": "CVE-2020-1807"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-05-08T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-27122"
},
{
"date": "2020-04-30T00:00:00",
"db": "VULMON",
"id": "CVE-2020-1807"
},
{
"date": "2020-05-25T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-004654"
},
{
"date": "2020-05-06T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202004-1954"
},
{
"date": "2024-11-21T05:11:25.090000",
"db": "NVD",
"id": "CVE-2020-1807"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 Unauthorized authentication vulnerabilities in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-004654"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "other",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202004-1954"
}
],
"trust": 0.6
}
}
VAR-202012-1394
Vulnerability from variot - Updated: 2024-11-23 22:29There is a buffer overflow vulnerability in several Huawei products. The system does not sufficiently validate certain configuration parameter which is passed from user that would cause buffer overflow. The attacker should trick the user into installing and running a malicious application with a high privilege, successful exploit may cause code execution. Affected product include Huawei HONOR 20 PRO, Mate 20, Mate 20 Pro, Mate 20 X, P30, P30 Pro, Hima-L29C, Laya-AL00EP, Princeton-AL10B, Tony-AL00B, Yale-L61A, Yale-TL00B and YaleP-AL10B. plural Huawei The product contains a classic buffer overflow vulnerability.Information is obtained, information is tampered with, and service is disrupted (DoS) It may be put into a state
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202012-1394",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "yale-tl00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c01e160r8p12\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.273\\(c636e7r2p4\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.126\\(c10e7r5p1\\)"
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.231\\(c10e3r3p2\\)"
},
{
"model": "yale-l61a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.226\\(c10e3r1p1\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.270\\(c635e3r1p5\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.126\\(c636e7r3p4\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.273\\(c185e7r2p4\\)"
},
{
"model": "yalep-al10b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r8p12\\)"
},
{
"model": "princeton-al10b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p11\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.270\\(c432e7r1p5\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.126\\(c636e5r3p4\\)"
},
{
"model": "hima-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.275\\(c10e4r2p4\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.126\\(c605e19r1p3\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r3p8\\)"
},
{
"model": "laya-al00ep",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c786e160r3p8\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.277\\(c10e7r2p4\\)"
},
{
"model": "p30",
"scope": "eq",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.272\\(c635e4r2p2\\)"
},
{
"model": "mate 20 x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p8\\)"
},
{
"model": "honor 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.230\\(c432e9r5p1\\)"
},
{
"model": "tony-al00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p11\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.277\\(c605e7r1p5\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.123\\(c432e22r2p5\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.126\\(c185e4r7p1\\)"
},
{
"model": "hima-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.273\\(c185e5r2p4\\)"
},
{
"model": "yale-l61a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.225\\(c432e3r1p2\\)"
},
{
"model": "hima-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.273\\(c636e5r2p4\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.160\\(c00e160r2p8\\)"
},
{
"model": "p30 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "tony-al00b",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "princeton-al10b",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "honor 20 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "laya-al00ep",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "hima-l29c",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20 x",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-014149"
},
{
"db": "NVD",
"id": "CVE-2020-9247"
}
]
},
"cve": "CVE-2020-9247",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 6.8,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 8.6,
"id": "CVE-2020-9247",
"impactScore": 6.4,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 1.8,
"vectorString": "AV:N/AC:M/Au:N/C:P/I:P/A:P",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 7.8,
"baseSeverity": "HIGH",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 1.8,
"id": "CVE-2020-9247",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Local",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 7.8,
"baseSeverity": "High",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2020-9247",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "Required",
"vectorString": "CVSS:3.0/AV:L/AC:L/PR:N/UI:R/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-9247",
"trust": 1.0,
"value": "HIGH"
},
{
"author": "NVD",
"id": "CVE-2020-9247",
"trust": 0.8,
"value": "High"
},
{
"author": "CNNVD",
"id": "CNNVD-202007-1901",
"trust": 0.6,
"value": "HIGH"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-014149"
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1901"
},
{
"db": "NVD",
"id": "CVE-2020-9247"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There is a buffer overflow vulnerability in several Huawei products. The system does not sufficiently validate certain configuration parameter which is passed from user that would cause buffer overflow. The attacker should trick the user into installing and running a malicious application with a high privilege, successful exploit may cause code execution. Affected product include Huawei HONOR 20 PRO, Mate 20, Mate 20 Pro, Mate 20 X, P30, P30 Pro, Hima-L29C, Laya-AL00EP, Princeton-AL10B, Tony-AL00B, Yale-L61A, Yale-TL00B and YaleP-AL10B. plural Huawei The product contains a classic buffer overflow vulnerability.Information is obtained, information is tampered with, and service is disrupted (DoS) It may be put into a state",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9247"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-014149"
}
],
"trust": 1.62
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-9247",
"trust": 2.4
},
{
"db": "JVNDB",
"id": "JVNDB-2020-014149",
"trust": 0.8
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1901",
"trust": 0.6
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-014149"
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1901"
},
{
"db": "NVD",
"id": "CVE-2020-9247"
}
]
},
"id": "VAR-202012-1394",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "VARIoT devices database",
"id": null
}
],
"trust": 0.49300468750000004
},
"last_update_date": "2024-11-23T22:29:21.018000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200729-03-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200729-03-smartphone-en"
},
{
"title": "Repair measures for Huawei buffer error vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=129041"
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-014149"
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1901"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-120",
"trust": 1.0
},
{
"problemtype": "Classic buffer overflow (CWE-120) [NVD Evaluation ]",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-014149"
},
{
"db": "NVD",
"id": "CVE-2020-9247"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200729-03-smartphone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-9247"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200729-03-smartphone-cn"
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-014149"
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1901"
},
{
"db": "NVD",
"id": "CVE-2020-9247"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "JVNDB",
"id": "JVNDB-2020-014149"
},
{
"db": "CNNVD",
"id": "CNNVD-202007-1901"
},
{
"db": "NVD",
"id": "CVE-2020-9247"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2021-08-03T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-014149"
},
{
"date": "2020-07-29T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202007-1901"
},
{
"date": "2020-12-07T13:15:11.123000",
"db": "NVD",
"id": "CVE-2020-9247"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2021-08-03T04:39:00",
"db": "JVNDB",
"id": "JVNDB-2020-014149"
},
{
"date": "2021-08-16T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202007-1901"
},
{
"date": "2024-11-21T05:40:15.980000",
"db": "NVD",
"id": "CVE-2020-9247"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202007-1901"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural \u00a0Huawei\u00a0 Classic buffer overflow vulnerability in the product",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-014149"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "buffer error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202007-1901"
}
],
"trust": 0.6
}
}
VAR-202004-0618
Vulnerability from variot - Updated: 2024-11-23 22:21There are two denial of service vulnerabilities on some Huawei smartphones. An attacker may send specially crafted TD-SCDMA messages from a rogue base station to the affected devices. Due to insufficient input validation of two values when parsing the messages, successful exploit may cause device abnormal. This is 1 out of 2 vulnerabilities. Different than CVE-2020-5303. Affected products are: ALP-AL00B: earlier than 9.1.0.333(C00E333R2P1T8) ALP-L09: earlier than 9.1.0.300(C432E4R1P9T8) ALP-L29: earlier than 9.1.0.315(C636E5R1P13T8) BLA-L29C: earlier than 9.1.0.321(C636E4R1P14T8), earlier than 9.1.0.330(C432E6R1P12T8), earlier than 9.1.0.302(C635E4R1P13T8) Berkeley-AL20: earlier than 9.1.0.333(C00E333R2P1T8) Berkeley-L09: earlier than 9.1.0.350(C10E3R1P14T8), earlier than 9.1.0.351(C432E5R1P13T8), earlier than 9.1.0.350(C636E4R1P13T8) Charlotte-L09C: earlier than 9.1.0.311(C185E4R1P11T8), earlier than 9.1.0.345(C432E8R1P11T8) Charlotte-L29C: earlier than 9.1.0.325(C185E4R1P11T8), earlier than 9.1.0.335(C636E3R1P13T8), earlier than 9.1.0.345(C432E8R1P11T8), earlier than 9.1.0.336(C605E3R1P12T8) Columbia-AL10B: earlier than 9.1.0.333(C00E333R1P1T8) Columbia-L29D: earlier than 9.1.0.350(C461E3R1P11T8), earlier than 9.1.0.350(C185E3R1P12T8), earlier than 9.1.0.350(C10E5R1P14T8), earlier than 9.1.0.351(C432E5R1P13T8) Cornell-AL00A: earlier than 9.1.0.333(C00E333R1P1T8) Cornell-L29A: earlier than 9.1.0.328(C185E1R1P9T8), earlier than 9.1.0.328(C432E1R1P9T8), earlier than 9.1.0.330(C461E1R1P9T8), earlier than 9.1.0.328(C636E2R1P12T8) Emily-L09C: earlier than 9.1.0.336(C605E4R1P12T8), earlier than 9.1.0.311(C185E2R1P12T8), earlier than 9.1.0.345(C432E10R1P12T8) Emily-L29C: earlier than 9.1.0.311(C605E2R1P12T8), earlier than 9.1.0.311(C636E7R1P13T8), earlier than 9.1.0.311(C432E7R1P11T8) Ever-L29B: earlier than 9.1.0.311(C185E3R3P1), earlier than 9.1.0.310(C636E3R2P1), earlier than 9.1.0.310(C432E3R1P12) HUAWEI Mate 20: earlier than 9.1.0.131(C00E131R3P1) HUAWEI Mate 20 Pro: earlier than 9.1.0.310(C185E10R2P1) HUAWEI Mate 20 RS: earlier than 9.1.0.135(C786E133R3P1) HUAWEI Mate 20 X: earlier than 9.1.0.135(C00E133R2P1) HUAWEI P20: earlier than 9.1.0.333(C00E333R1P1T8) HUAWEI P20 Pro: earlier than 9.1.0.333(C00E333R1P1T8) HUAWEI P30: earlier than 9.1.0.193 HUAWEI P30 Pro: earlier than 9.1.0.186(C00E180R2P1) HUAWEI Y9 2019: earlier than 9.1.0.220(C605E3R1P1T8) HUAWEI nova lite 3: earlier than 9.1.0.305(C635E8R2P2) Honor 10 Lite: earlier than 9.1.0.283(C605E8R2P2) Honor 8X: earlier than 9.1.0.221(C461E2R1P1T8) Honor View 20: earlier than 9.1.0.238(C432E1R3P1) Jackman-L22: earlier than 9.1.0.247(C636E2R4P1T8) Paris-L21B: earlier than 9.1.0.331(C432E1R1P2T8) Paris-L21MEB: earlier than 9.1.0.331(C185E4R1P3T8) Paris-L29B: earlier than 9.1.0.331(C636E1R1P3T8) Sydney-AL00: earlier than 9.1.0.212(C00E62R1P7T8) Sydney-L21: earlier than 9.1.0.215(C432E1R1P1T8), earlier than 9.1.0.213(C185E1R1P1T8) Sydney-L21BR: earlier than 9.1.0.213(C185E1R1P2T8) Sydney-L22: earlier than 9.1.0.258(C636E1R1P1T8) Sydney-L22BR: earlier than 9.1.0.258(C636E1R1P1T8) SydneyM-AL00: earlier than 9.1.0.228(C00E78R1P7T8) SydneyM-L01: earlier than 9.1.0.215(C782E2R1P1T8), earlier than 9.1.0.213(C185E1R1P1T8), earlier than 9.1.0.270(C432E3R1P1T8) SydneyM-L03: earlier than 9.1.0.217(C605E1R1P1T8) SydneyM-L21: earlier than 9.1.0.221(C461E1R1P1T8), earlier than 9.1.0.215(C432E4R1P1T8) SydneyM-L22: earlier than 9.1.0.259(C185E1R1P2T8), earlier than 9.1.0.220(C635E1R1P2T8), earlier than 9.1.0.216(C569E1R1P1T8) SydneyM-L23: earlier than 9.1.0.226(C605E2R1P1T8) Yale-L21A: earlier than 9.1.0.154(C432E2R3P2), earlier than 9.1.0.154(C461E2R2P1), earlier than 9.1.0.154(C636E2R2P1) Honor 20: earlier than 9.1.0.152(C00E150R5P1) Honor Magic2: earlier than 10.0.0.187 Honor V20: earlier than 9.1.0.234(C00E234R4P3). plural Huawei There is a vulnerability related to input confirmation on smartphones.Service operation interruption (DoS) It may be put into a state. Huawei Honor10 Lite and Huawei Y9 are both smartphones from China's Huawei.
A denial of service vulnerability exists in Huawei Honor10 Lite Harry-AL00C versions earlier than 9.1.0.217 (C00E215R3P1) and before Huawei Y9 Jackman-L23 9.1.0.220 (C45E3R1P1T8). The vulnerability stems from the fact that the two fields are not duplicated when parsing
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202004-0618",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "yale-l21a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c461e2r2p1\\)"
},
{
"model": "sydneym-l03",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.217\\(c605e1r1p1t8\\)"
},
{
"model": "sydneym-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.259\\(c185e1r1p2t8\\)"
},
{
"model": "nova lite 3",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.305\\(c635e8r2p2\\)"
},
{
"model": "alp-al00b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r2p1t8\\)"
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.321\\(c636e4r1p14t8\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.345\\(c432e8r1p11t8\\)"
},
{
"model": "berkeley-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.351\\(c432e5r1p13t8\\)"
},
{
"model": "alp-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.300\\(c432e4r1p9t8\\)"
},
{
"model": "yale-l21a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c636e2r2p1\\)"
},
{
"model": "p20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.328\\(c185e1r1p9t8\\)"
},
{
"model": "emily-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.345\\(c432e10r1p12t8\\)"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.328\\(c636e2r1p12t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c461e3r1p11t8\\)"
},
{
"model": "jackman-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.247\\(c636e2r4p1t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c636e7r1p13t8\\)"
},
{
"model": "sydneym-l01",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.213\\(c185e1r1p1t8\\)"
},
{
"model": "sydneym-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.221\\(c461e1r1p1t8\\)"
},
{
"model": "ever-l29b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.310\\(c636e3r2p1\\)"
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.330\\(c432e6r1p12t8\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.131\\(c00e131r3p1\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.351\\(c432e5r1p13t8\\)"
},
{
"model": "cornell-al00a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "sydneym-al00",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.228\\(c00e78r1p7t8\\)"
},
{
"model": "berkeley-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c10e3r1p14t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c185e3r1p12t8\\)"
},
{
"model": "ever-l29b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.310\\(c432e3r1p12\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.325\\(c185e4r1p11t8\\)"
},
{
"model": "mate 20 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.310\\(c185e10r2p1\\)"
},
{
"model": "sydneym-l01",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.215\\(c782e2r1p1t8\\)"
},
{
"model": "honor view 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.238\\(c432e1r3p1\\)"
},
{
"model": "paris-l29b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.331\\(c636e1r1p3t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c432e7r1p11t8\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.186\\(c00e180r2p1\\)"
},
{
"model": "sydneym-l23",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.226\\(c605e2r1p1t8\\)"
},
{
"model": "emily-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c605e2r1p12t8\\)"
},
{
"model": "paris-l21b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.331\\(c432e1r1p2t8\\)"
},
{
"model": "bla-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.302\\(c635e4r1p13t8\\)"
},
{
"model": "paris-l21meb",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.331\\(c185e4r1p3t8\\)"
},
{
"model": "mate 20 x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.135\\(c00e133r2p1\\)"
},
{
"model": "honor 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.152\\(c00e150r5p1\\)"
},
{
"model": "yale-l21a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.154\\(c432e2r3p2\\)"
},
{
"model": "sydney-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.258\\(c636e1r1p1t8\\)"
},
{
"model": "sydney-l22br",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.258\\(c636e1r1p1t8\\)"
},
{
"model": "sydneym-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.215\\(c432e4r1p1t8\\)"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.330\\(c461e1r1p9t8\\)"
},
{
"model": "columbia-al10b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.336\\(c605e3r1p12t8\\)"
},
{
"model": "y9 2019",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.220\\(c605e3r1p1t8\\)"
},
{
"model": "sydney-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.213\\(c185e1r1p1t8\\)"
},
{
"model": "alp-l29",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.315\\(c636e5r1p13t8\\)"
},
{
"model": "charlotte-l29c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.335\\(c636e3r1p13t8\\)"
},
{
"model": "sydneym-l01",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.270\\(c432e3r1p1t8\\)"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.193"
},
{
"model": "cornell-l29a",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.328\\(c432e1r1p9t8\\)"
},
{
"model": "honor 8x",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.221\\(c461e2r1p1t8\\)"
},
{
"model": "sydneym-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.220\\(c635e1r1p2t8\\)"
},
{
"model": "berkeley-al20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r2p1t8\\)"
},
{
"model": "berkeley-l09",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c636e4r1p13t8\\)"
},
{
"model": "honor v20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.234\\(c00e234r4p3\\)"
},
{
"model": "sydney-l21br",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.213\\(c185e1r1p2t8\\)"
},
{
"model": "sydneym-l22",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.216\\(c569e1r1p1t8\\)"
},
{
"model": "columbia-l29d",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.350\\(c10e5r1p14t8\\)"
},
{
"model": "mate 20 rs",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.135\\(c786e133r3p1\\)"
},
{
"model": "ever-l29b",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c185e3r3p1\\)"
},
{
"model": "sydney-al00",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.212\\(c00e62r1p7t8\\)"
},
{
"model": "charlotte-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c185e4r1p11t8\\)"
},
{
"model": "p20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.333\\(c00e333r1p1t8\\)"
},
{
"model": "sydney-l21",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.215\\(c432e1r1p1t8\\)"
},
{
"model": "emily-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.311\\(c185e2r1p12t8\\)"
},
{
"model": "charlotte-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.345\\(c432e8r1p11t8\\)"
},
{
"model": "honor magic2",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.187"
},
{
"model": "emily-l09c",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.336\\(c605e4r1p12t8\\)"
},
{
"model": "honor 10 lite",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.283\\(c605e8r2p2\\)"
},
{
"model": "alp-al00b",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.333(c00e333r2p1t8)"
},
{
"model": "alp-l09",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.300(c432e4r1p9t8)"
},
{
"model": "alp-l29",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.315(c636e5r1p13t8)"
},
{
"model": "berkeley-al20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.333(c00e333r2p1t8)"
},
{
"model": "berkeley-l09",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.350(c10e3r1p14t8)"
},
{
"model": "berkeley-l09",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.350(c636e4r1p13t8)"
},
{
"model": "berkeley-l09",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.351(c432e5r1p13t8)"
},
{
"model": "bla-l29c",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.302(c635e4r1p13t8)"
},
{
"model": "bla-l29c",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.321(c636e4r1p14t8)"
},
{
"model": "bla-l29c",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "9.1.0.330(c432e6r1p12t8)"
},
{
"model": "honor10 lite \u003charry-al00c 9.1.0.217",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "y9 \u003cjackman-l23 9.1.0.220",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-33609"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"db": "NVD",
"id": "CVE-2019-5302"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:alp-al00b_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:alp-l09_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:alp-l29_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:berkeley-al20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:berkeley-l09_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:bla-l29c_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "These two vulnerabilities were discovered by Huawei internal testing.",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-1095"
}
],
"trust": 0.6
},
"cve": "CVE-2019-5302",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "ADJACENT_NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "PARTIAL",
"baseScore": 2.9,
"confidentialityImpact": "NONE",
"exploitabilityScore": 5.5,
"id": "CVE-2019-5302",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.1,
"vectorString": "AV:A/AC:M/Au:N/C:N/I:N/A:P",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Medium",
"accessVector": "Adjacent Network",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "Partial",
"baseScore": 2.9,
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2019-015525",
"impactScore": null,
"integrityImpact": "None",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:A/AC:M/Au:N/C:N/I:N/A:P",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "ADJACENT_NETWORK",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "COMPLETE",
"baseScore": 6.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 6.5,
"id": "CNVD-2019-33609",
"impactScore": 6.9,
"integrityImpact": "NONE",
"severity": "MEDIUM",
"trust": 0.6,
"vectorString": "AV:A/AC:L/Au:N/C:N/I:N/A:C",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "HIGH",
"attackVector": "ADJACENT",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 5.3,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"exploitabilityScore": 1.6,
"id": "CVE-2019-5302",
"impactScore": 3.6,
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:A/AC:H/PR:N/UI:N/S:U/C:N/I:N/A:H",
"version": "3.1"
},
{
"attackComplexity": "High",
"attackVector": "Adjacent Network",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 5.3,
"baseSeverity": "Medium",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2019-015525",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:A/AC:H/PR:N/UI:N/S:U/C:N/I:N/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-5302",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "JVNDB-2019-015525",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2019-33609",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "CNNVD",
"id": "CNNVD-201908-1095",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "VULMON",
"id": "CVE-2019-5302",
"trust": 0.1,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-33609"
},
{
"db": "VULMON",
"id": "CVE-2019-5302"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1095"
},
{
"db": "NVD",
"id": "CVE-2019-5302"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There are two denial of service vulnerabilities on some Huawei smartphones. An attacker may send specially crafted TD-SCDMA messages from a rogue base station to the affected devices. Due to insufficient input validation of two values when parsing the messages, successful exploit may cause device abnormal. This is 1 out of 2 vulnerabilities. Different than CVE-2020-5303. Affected products are: ALP-AL00B: earlier than 9.1.0.333(C00E333R2P1T8) ALP-L09: earlier than 9.1.0.300(C432E4R1P9T8) ALP-L29: earlier than 9.1.0.315(C636E5R1P13T8) BLA-L29C: earlier than 9.1.0.321(C636E4R1P14T8), earlier than 9.1.0.330(C432E6R1P12T8), earlier than 9.1.0.302(C635E4R1P13T8) Berkeley-AL20: earlier than 9.1.0.333(C00E333R2P1T8) Berkeley-L09: earlier than 9.1.0.350(C10E3R1P14T8), earlier than 9.1.0.351(C432E5R1P13T8), earlier than 9.1.0.350(C636E4R1P13T8) Charlotte-L09C: earlier than 9.1.0.311(C185E4R1P11T8), earlier than 9.1.0.345(C432E8R1P11T8) Charlotte-L29C: earlier than 9.1.0.325(C185E4R1P11T8), earlier than 9.1.0.335(C636E3R1P13T8), earlier than 9.1.0.345(C432E8R1P11T8), earlier than 9.1.0.336(C605E3R1P12T8) Columbia-AL10B: earlier than 9.1.0.333(C00E333R1P1T8) Columbia-L29D: earlier than 9.1.0.350(C461E3R1P11T8), earlier than 9.1.0.350(C185E3R1P12T8), earlier than 9.1.0.350(C10E5R1P14T8), earlier than 9.1.0.351(C432E5R1P13T8) Cornell-AL00A: earlier than 9.1.0.333(C00E333R1P1T8) Cornell-L29A: earlier than 9.1.0.328(C185E1R1P9T8), earlier than 9.1.0.328(C432E1R1P9T8), earlier than 9.1.0.330(C461E1R1P9T8), earlier than 9.1.0.328(C636E2R1P12T8) Emily-L09C: earlier than 9.1.0.336(C605E4R1P12T8), earlier than 9.1.0.311(C185E2R1P12T8), earlier than 9.1.0.345(C432E10R1P12T8) Emily-L29C: earlier than 9.1.0.311(C605E2R1P12T8), earlier than 9.1.0.311(C636E7R1P13T8), earlier than 9.1.0.311(C432E7R1P11T8) Ever-L29B: earlier than 9.1.0.311(C185E3R3P1), earlier than 9.1.0.310(C636E3R2P1), earlier than 9.1.0.310(C432E3R1P12) HUAWEI Mate 20: earlier than 9.1.0.131(C00E131R3P1) HUAWEI Mate 20 Pro: earlier than 9.1.0.310(C185E10R2P1) HUAWEI Mate 20 RS: earlier than 9.1.0.135(C786E133R3P1) HUAWEI Mate 20 X: earlier than 9.1.0.135(C00E133R2P1) HUAWEI P20: earlier than 9.1.0.333(C00E333R1P1T8) HUAWEI P20 Pro: earlier than 9.1.0.333(C00E333R1P1T8) HUAWEI P30: earlier than 9.1.0.193 HUAWEI P30 Pro: earlier than 9.1.0.186(C00E180R2P1) HUAWEI Y9 2019: earlier than 9.1.0.220(C605E3R1P1T8) HUAWEI nova lite 3: earlier than 9.1.0.305(C635E8R2P2) Honor 10 Lite: earlier than 9.1.0.283(C605E8R2P2) Honor 8X: earlier than 9.1.0.221(C461E2R1P1T8) Honor View 20: earlier than 9.1.0.238(C432E1R3P1) Jackman-L22: earlier than 9.1.0.247(C636E2R4P1T8) Paris-L21B: earlier than 9.1.0.331(C432E1R1P2T8) Paris-L21MEB: earlier than 9.1.0.331(C185E4R1P3T8) Paris-L29B: earlier than 9.1.0.331(C636E1R1P3T8) Sydney-AL00: earlier than 9.1.0.212(C00E62R1P7T8) Sydney-L21: earlier than 9.1.0.215(C432E1R1P1T8), earlier than 9.1.0.213(C185E1R1P1T8) Sydney-L21BR: earlier than 9.1.0.213(C185E1R1P2T8) Sydney-L22: earlier than 9.1.0.258(C636E1R1P1T8) Sydney-L22BR: earlier than 9.1.0.258(C636E1R1P1T8) SydneyM-AL00: earlier than 9.1.0.228(C00E78R1P7T8) SydneyM-L01: earlier than 9.1.0.215(C782E2R1P1T8), earlier than 9.1.0.213(C185E1R1P1T8), earlier than 9.1.0.270(C432E3R1P1T8) SydneyM-L03: earlier than 9.1.0.217(C605E1R1P1T8) SydneyM-L21: earlier than 9.1.0.221(C461E1R1P1T8), earlier than 9.1.0.215(C432E4R1P1T8) SydneyM-L22: earlier than 9.1.0.259(C185E1R1P2T8), earlier than 9.1.0.220(C635E1R1P2T8), earlier than 9.1.0.216(C569E1R1P1T8) SydneyM-L23: earlier than 9.1.0.226(C605E2R1P1T8) Yale-L21A: earlier than 9.1.0.154(C432E2R3P2), earlier than 9.1.0.154(C461E2R2P1), earlier than 9.1.0.154(C636E2R2P1) Honor 20: earlier than 9.1.0.152(C00E150R5P1) Honor Magic2: earlier than 10.0.0.187 Honor V20: earlier than 9.1.0.234(C00E234R4P3). plural Huawei There is a vulnerability related to input confirmation on smartphones.Service operation interruption (DoS) It may be put into a state. Huawei Honor10 Lite and Huawei Y9 are both smartphones from China\u0027s Huawei. \n\nA denial of service vulnerability exists in Huawei Honor10 Lite Harry-AL00C versions earlier than 9.1.0.217 (C00E215R3P1) and before Huawei Y9 Jackman-L23 9.1.0.220 (C45E3R1P1T8). The vulnerability stems from the fact that the two fields are not duplicated when parsing ",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-5302"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"db": "CNVD",
"id": "CNVD-2019-33609"
},
{
"db": "VULMON",
"id": "CVE-2019-5302"
}
],
"trust": 2.25
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-5302",
"trust": 3.1
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015525",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2019-33609",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1095",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2019-5302",
"trust": 0.1
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-33609"
},
{
"db": "VULMON",
"id": "CVE-2019-5302"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1095"
},
{
"db": "NVD",
"id": "CVE-2019-5302"
}
]
},
"id": "VAR-202004-0618",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-33609"
}
],
"trust": 1.1828954514285714
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"Network device"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-33609"
}
]
},
"last_update_date": "2024-11-23T22:21:13.412000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20190814-01-mobile",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190814-01-mobile-en"
},
{
"title": "Patch for Huawei Honor10 Lite and Huawei Y9 Denial of Service Vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/182801"
},
{
"title": "Huawei Honor10 Lite and Huawei Y9 Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=96759"
},
{
"title": "Huawei Security Advisories: Two Denial of Service Vulnerabilities on Some Huawei Smartphones",
"trust": 0.1,
"url": "https://vulmon.com/vendoradvisory?qidtp=huawei_security_advisories\u0026qid=88453f1b990572fac17211a1a9b849ea"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-33609"
},
{
"db": "VULMON",
"id": "CVE-2019-5302"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1095"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-20",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"db": "NVD",
"id": "CVE-2019-5302"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190814-01-mobile-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5302"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20190814-01-mobile-cn"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-5302"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/20.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-33609"
},
{
"db": "VULMON",
"id": "CVE-2019-5302"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1095"
},
{
"db": "NVD",
"id": "CVE-2019-5302"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2019-33609"
},
{
"db": "VULMON",
"id": "CVE-2019-5302"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"db": "CNNVD",
"id": "CNNVD-201908-1095"
},
{
"db": "NVD",
"id": "CVE-2019-5302"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-09-29T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-33609"
},
{
"date": "2020-04-27T00:00:00",
"db": "VULMON",
"id": "CVE-2019-5302"
},
{
"date": "2020-06-01T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"date": "2019-08-14T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201908-1095"
},
{
"date": "2020-04-27T20:15:12.337000",
"db": "NVD",
"id": "CVE-2019-5302"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-09-29T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-33609"
},
{
"date": "2020-05-05T00:00:00",
"db": "VULMON",
"id": "CVE-2019-5302"
},
{
"date": "2020-06-01T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-015525"
},
{
"date": "2020-09-03T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201908-1095"
},
{
"date": "2024-11-21T04:44:42.343000",
"db": "NVD",
"id": "CVE-2019-5302"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "remote or local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-1095"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural Huawei Input verification vulnerabilities on smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-015525"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "input validation error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201908-1095"
}
],
"trust": 0.6
}
}
VAR-202002-0574
Vulnerability from variot - Updated: 2024-11-23 22:16HUAWEI Mate 20 smartphones with versions earlier than 10.0.0.185(C00E74R3P8) have an improper authorization vulnerability. The system has a logic judging error under certain scenario, successful exploit could allow the attacker to switch to third desktop after a series of operation in ADB mode. Huawei Mate 20 is a smartphone from China's Huawei
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202002-0574",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "eq",
"trust": 1.2,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.185\\(c00e74r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.185(c00e74r3p8)"
},
{
"model": "mate \u003c10.0.0.185",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "10.0.0.175c00e70r3p8"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "9.1.0.139c00e133r3p1"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-14858"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-415"
},
{
"db": "NVD",
"id": "CVE-2020-1791"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
}
]
},
"cve": "CVE-2020-1791",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CVE-2020-1791",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Low",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.1,
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-002089",
"impactScore": null,
"integrityImpact": "Partial",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-14858",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.4,
"baseSeverity": "LOW",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.9,
"id": "CVE-2020-1791",
"impactScore": 1.4,
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.4,
"baseSeverity": "Low",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-002089",
"impactScore": null,
"integrityImpact": "Low",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-1791",
"trust": 1.0,
"value": "LOW"
},
{
"author": "NVD",
"id": "JVNDB-2020-002089",
"trust": 0.8,
"value": "Low"
},
{
"author": "CNVD",
"id": "CNVD-2020-14858",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202002-415",
"trust": 0.6,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-14858"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-415"
},
{
"db": "NVD",
"id": "CVE-2020-1791"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 smartphones with versions earlier than 10.0.0.185(C00E74R3P8) have an improper authorization vulnerability. The system has a logic judging error under certain scenario, successful exploit could allow the attacker to switch to third desktop after a series of operation in ADB mode. Huawei Mate 20 is a smartphone from China\u0027s Huawei",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-1791"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"db": "CNVD",
"id": "CNVD-2020-14858"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-1791",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-002089",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-14858",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202002-415",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-14858"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-415"
},
{
"db": "NVD",
"id": "CVE-2020-1791"
}
]
},
"id": "VAR-202002-0574",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-14858"
}
],
"trust": 1.26765326
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-14858"
}
]
},
"last_update_date": "2024-11-23T22:16:38.951000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200205-01-smartphone",
"trust": 0.8,
"url": "http://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200205-01-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 Licensing Issue Vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/206273"
},
{
"title": "Huawei Mate 20 Remediation measures for authorization problem vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=110185"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-14858"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-415"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-noinfo",
"trust": 1.0
},
{
"problemtype": "CWE-863",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"db": "NVD",
"id": "CVE-2020-1791"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.6,
"url": "http://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200205-01-smartphone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-1791"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2020-1791"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200205-01-smartphone-cn"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-14858"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-415"
},
{
"db": "NVD",
"id": "CVE-2020-1791"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-14858"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"db": "CNNVD",
"id": "CNNVD-202002-415"
},
{
"db": "NVD",
"id": "CVE-2020-1791"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-03-04T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-14858"
},
{
"date": "2020-03-04T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"date": "2020-02-05T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202002-415"
},
{
"date": "2020-02-18T03:15:11.060000",
"db": "NVD",
"id": "CVE-2020-1791"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-03-13T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-14858"
},
{
"date": "2020-03-04T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-002089"
},
{
"date": "2020-02-21T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202002-415"
},
{
"date": "2024-11-21T05:11:23.297000",
"db": "NVD",
"id": "CVE-2020-1791"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 Unauthorized authentication vulnerabilities in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-002089"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "authorization issue",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202002-415"
}
],
"trust": 0.6
}
}
VAR-202005-0668
Vulnerability from variot - Updated: 2024-11-23 22:16HUAWEI Mate 20 smartphones with versions earlier than 10.0.0.195(SP31C00E74R3P8) have an improper authorization vulnerability. The digital balance function does not sufficiently restrict the using time of certain user, successful exploit could allow the user break the limit of digital balance function after a series of operations with a PC. Huawei Mate 20 is a smart phone of the Chinese company Huawei. The vulnerability stems from the fact that the healthy use of mobile phone functions does not adequately limit the duration of user use. Attackers can use this vulnerability to break through the restrictions on the healthy use of mobile phone functions
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202005-0668",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.195\\(sp31c00e74r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.195(sp31c00e74r3p8)"
},
{
"model": "mate \u003c10.0.0.195",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31279"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"db": "NVD",
"id": "CVE-2020-1831"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
}
]
},
"cve": "CVE-2020-1831",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 1.9,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.4,
"id": "CVE-2020-1831",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:M/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Medium",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 1.9,
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-005965",
"impactScore": null,
"integrityImpact": "Partial",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:M/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "MEDIUM",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 1.9,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.4,
"id": "CNVD-2020-31279",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:M/Au:N/C:N/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.4,
"baseSeverity": "LOW",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.9,
"id": "CVE-2020-1831",
"impactScore": 1.4,
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.4,
"baseSeverity": "Low",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-005965",
"impactScore": null,
"integrityImpact": "Low",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-1831",
"trust": 1.0,
"value": "LOW"
},
{
"author": "NVD",
"id": "JVNDB-2020-005965",
"trust": 0.8,
"value": "Low"
},
{
"author": "CNVD",
"id": "CNVD-2020-31279",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202005-1352",
"trust": 0.6,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31279"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1352"
},
{
"db": "NVD",
"id": "CVE-2020-1831"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 smartphones with versions earlier than 10.0.0.195(SP31C00E74R3P8) have an improper authorization vulnerability. The digital balance function does not sufficiently restrict the using time of certain user, successful exploit could allow the user break the limit of digital balance function after a series of operations with a PC. Huawei Mate 20 is a smart phone of the Chinese company Huawei. The vulnerability stems from the fact that the healthy use of mobile phone functions does not adequately limit the duration of user use. Attackers can use this vulnerability to break through the restrictions on the healthy use of mobile phone functions",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-1831"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"db": "CNVD",
"id": "CNVD-2020-31279"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-1831",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005965",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-31279",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1352",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31279"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1352"
},
{
"db": "NVD",
"id": "CVE-2020-1831"
}
]
},
"id": "VAR-202005-0668",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31279"
}
],
"trust": 1.26765326
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31279"
}
]
},
"last_update_date": "2024-11-23T22:16:28.521000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200527-04-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200527-04-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 authorization issue vulnerability (CNVD-2020-31279)",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/220025"
},
{
"title": "Huawei Mate 20 Remediation measures for authorization problem vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=119908"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31279"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1352"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-863",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"db": "NVD",
"id": "CVE-2020-1831"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-1831"
},
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200527-04-smartphone-en"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2020-1831"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200527-04-smartphone-cn"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-31279"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1352"
},
{
"db": "NVD",
"id": "CVE-2020-1831"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-31279"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"db": "CNNVD",
"id": "CNNVD-202005-1352"
},
{
"db": "NVD",
"id": "CVE-2020-1831"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-06-03T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-31279"
},
{
"date": "2020-06-25T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"date": "2020-05-27T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202005-1352"
},
{
"date": "2020-05-29T21:15:10.023000",
"db": "NVD",
"id": "CVE-2020-1831"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-06-03T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-31279"
},
{
"date": "2020-06-25T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-005965"
},
{
"date": "2020-06-03T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202005-1352"
},
{
"date": "2024-11-21T05:11:27.207000",
"db": "NVD",
"id": "CVE-2020-1831"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 Unauthorized authentication vulnerabilities in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-005965"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "authorization issue",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202005-1352"
}
],
"trust": 0.6
}
}
VAR-202003-1093
Vulnerability from variot - Updated: 2024-11-23 22:11There is an improper authentication vulnerability in several smartphones. The applock does not perform a sufficient authentication in certain scenarios, successful exploit could allow the attacker to gain certain data of the application which is locked. Affected product versions include:HUAWEI Mate 20 versions Versions earlier than 10.0.0.188(C00E74R3P8);HUAWEI Mate 30 Pro versions Versions earlier than 10.0.0.203(C00E202R7P2). HUAWEI Mate 20 and Mate 30 Pro There is an authentication vulnerability in.Information may be obtained. Attackers can use this vulnerability to obtain data on locked applications
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202003-1093",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.203\\(c00e202r7p2\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.188\\(c00e74r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.188(c00e74r3p8)"
},
{
"model": "mate 30 pro",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.203(c00e202r7p2)"
},
{
"model": "mate \u003c10.0.0.188",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate pro \u003c10.0.0.203",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "30"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21998"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
},
{
"db": "NVD",
"id": "CVE-2020-1794"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_30_pro_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
}
]
},
"cve": "CVE-2020-1794",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CVE-2020-1794",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Low",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.1,
"confidentialityImpact": "Partial",
"exploitabilityScore": null,
"id": "JVNDB-2020-003140",
"impactScore": null,
"integrityImpact": "None",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-21998",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.6,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 0.9,
"id": "CVE-2020-1794",
"impactScore": 3.6,
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 4.6,
"baseSeverity": "Medium",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "JVNDB-2020-003140",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-1794",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "JVNDB-2020-003140",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2020-21998",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202003-1139",
"trust": 0.6,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21998"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1139"
},
{
"db": "NVD",
"id": "CVE-2020-1794"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There is an improper authentication vulnerability in several smartphones. The applock does not perform a sufficient authentication in certain scenarios, successful exploit could allow the attacker to gain certain data of the application which is locked. Affected product versions include:HUAWEI Mate 20 versions Versions earlier than 10.0.0.188(C00E74R3P8);HUAWEI Mate 30 Pro versions Versions earlier than 10.0.0.203(C00E202R7P2). HUAWEI Mate 20 and Mate 30 Pro There is an authentication vulnerability in.Information may be obtained. Attackers can use this vulnerability to obtain data on locked applications",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-1794"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
},
{
"db": "CNVD",
"id": "CNVD-2020-21998"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-1794",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003140",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-21998",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1139",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21998"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1139"
},
{
"db": "NVD",
"id": "CVE-2020-1794"
}
]
},
"id": "VAR-202003-1093",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21998"
}
],
"trust": 1.2276592800000001
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21998"
}
]
},
"last_update_date": "2024-11-23T22:11:35.883000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200318-02-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200318-02-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 and Mate 30 Pro authorization issue vulnerability (CNVD-2020-21998)",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/213049"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21998"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-287",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
},
{
"db": "NVD",
"id": "CVE-2020-1794"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-1794"
},
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200318-02-smartphone-en"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200318-02-smartphone-cn"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2020-1794"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21998"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1139"
},
{
"db": "NVD",
"id": "CVE-2020-1794"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-21998"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1139"
},
{
"db": "NVD",
"id": "CVE-2020-1794"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-04-09T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-21998"
},
{
"date": "2020-04-06T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-003140"
},
{
"date": "2020-03-18T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202003-1139"
},
{
"date": "2020-03-20T15:15:13.950000",
"db": "NVD",
"id": "CVE-2020-1794"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-04-09T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-21998"
},
{
"date": "2020-04-06T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-003140"
},
{
"date": "2020-08-28T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202003-1139"
},
{
"date": "2024-11-21T05:11:23.630000",
"db": "NVD",
"id": "CVE-2020-1794"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 and Mate 30 Pro Authentication vulnerabilities in",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-003140"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "authorization issue",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202003-1139"
}
],
"trust": 0.6
}
}
VAR-201911-0831
Vulnerability from variot - Updated: 2024-11-23 22:05P30, P30 Pro, Mate 20 smartphones with software of versions earlier than ELLE-AL00B 9.1.0.193(C00E190R2P1), versions earlier than VOGUE-AL00A 9.1.0.193(C00E190R2P1), versions earlier than Hima-AL00B 9.1.0.135(C00E133R2P1) and HiSuite with versions earlier than HiSuite 9.1.0.305 have a version downgrade vulnerability. The device and HiSuite software do not validate the upgrade package sufficiently, so that the system of smartphone can be downgraded to an older version. Huawei P30 and others are products of China Huawei. The Huawei P30 is a smart phone. The Huawei P30 Pro is a smartphone. Huawei HiSuite is a mobile assistant application for the PC. There are security vulnerabilities in various Huawei products
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201911-0831",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "hisuite",
"scope": "lt",
"trust": 1.6,
"vendor": "huawei",
"version": "9.1.0.305"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "elle-al00b_9.1.0.193\\(c00e190r2p1\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "vogue-al00a_9.1.0.193\\(c00e190r2p1\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "hima-al00b_9.1.0.135\\(c00e133r2p1\\)"
},
{
"model": "hisuite",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30 \u003celle-al00b 9.1.0.193",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro \u003cvogue-al00a 9.1.0.193",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "mate \u003chima-al00b 9.1.0.135",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20x"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30710"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"db": "NVD",
"id": "CVE-2019-5226"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/a:huawei:hisuite",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:p30_pro_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:p30_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "vendor",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201909-205"
}
],
"trust": 0.6
},
"cve": "CVE-2019-5226",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.3,
"confidentialityImpact": "NONE",
"exploitabilityScore": 8.6,
"id": "CVE-2019-5226",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 1.8,
"vectorString": "AV:N/AC:M/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "COMPLETE",
"baseScore": 7.2,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 3.9,
"id": "CNVD-2019-30710",
"impactScore": 10.0,
"integrityImpact": "COMPLETE",
"severity": "HIGH",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:C/I:C/A:C",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"exploitabilityScore": 1.8,
"id": "CVE-2019-5226",
"impactScore": 3.6,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:N/UI:R/S:U/C:N/I:H/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Local",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 5.5,
"baseSeverity": "Medium",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "CVE-2019-5226",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "Required",
"vectorString": "CVSS:3.0/AV:L/AC:L/PR:N/UI:R/S:U/C:N/I:H/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-5226",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2019-5226",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2019-30710",
"trust": 0.6,
"value": "HIGH"
},
{
"author": "CNNVD",
"id": "CNNVD-201909-205",
"trust": 0.6,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30710"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-205"
},
{
"db": "NVD",
"id": "CVE-2019-5226"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "P30, P30 Pro, Mate 20 smartphones with software of versions earlier than ELLE-AL00B 9.1.0.193(C00E190R2P1), versions earlier than VOGUE-AL00A 9.1.0.193(C00E190R2P1), versions earlier than Hima-AL00B 9.1.0.135(C00E133R2P1) and HiSuite with versions earlier than HiSuite 9.1.0.305 have a version downgrade vulnerability. The device and HiSuite software do not validate the upgrade package sufficiently, so that the system of smartphone can be downgraded to an older version. Huawei P30 and others are products of China Huawei. The Huawei P30 is a smart phone. The Huawei P30 Pro is a smartphone. Huawei HiSuite is a mobile assistant application for the PC. There are security vulnerabilities in various Huawei products",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-5226"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"db": "CNVD",
"id": "CNVD-2019-30710"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-5226",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012738",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2019-30710",
"trust": 0.6
},
{
"db": "NSFOCUS",
"id": "44306",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201909-205",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30710"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-205"
},
{
"db": "NVD",
"id": "CVE-2019-5226"
}
]
},
"id": "VAR-201911-0831",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30710"
}
],
"trust": 1.4316259699999998
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"Network device"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30710"
}
]
},
"last_update_date": "2024-11-23T22:05:56.725000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20190904-01-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190904-01-smartphone-en"
},
{
"title": "Patches for multiple Huawei product version downgrade vulnerabilities",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/179199"
},
{
"title": "Multiple Huawei Product security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=97962"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30710"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-205"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-346",
"trust": 1.0
},
{
"problemtype": "CWE-20",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"db": "NVD",
"id": "CVE-2019-5226"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190904-01-smartphone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5226"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20190904-01-smartphone-cn"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-5226"
},
{
"trust": 0.6,
"url": "http://www.nsfocus.net/vulndb/44306"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30710"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-205"
},
{
"db": "NVD",
"id": "CVE-2019-5226"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2019-30710"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-205"
},
{
"db": "NVD",
"id": "CVE-2019-5226"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-09-06T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-30710"
},
{
"date": "2019-12-11T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"date": "2019-09-04T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201909-205"
},
{
"date": "2019-11-29T19:15:12.057000",
"db": "NVD",
"id": "CVE-2019-5226"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-09-06T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-30710"
},
{
"date": "2019-12-11T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-012738"
},
{
"date": "2019-12-12T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201909-205"
},
{
"date": "2024-11-21T04:44:33.630000",
"db": "NVD",
"id": "CVE-2019-5226"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201909-205"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural Huawei Vulnerability related to input confirmation in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012738"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "input validation error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201909-205"
}
],
"trust": 0.6
}
}
VAR-202003-1094
Vulnerability from variot - Updated: 2024-11-23 22:05There is a logic error vulnerability in several smartphones. The software does not properly restrict certain operation when the Digital Balance function is on. Successful exploit could allow the attacker to bypass the Digital Balance limit after a series of operations.Affected product versions include:HUAWEI Mate 20 versions Versions earlier than 10.0.0.188(C00E74R3P8);HUAWEI Mate 30 Pro versions Versions earlier than 10.0.0.203(C00E202R7P2). HUAWEI Mate 20 and Mate 30 Pro There is an unspecified vulnerability in.Information may be tampered with. This vulnerability stems from the fact that the system fails to reasonably restrict some operations when the mobile phone function is healthy. Attackers can use this vulnerability to bypass the restrictions on the healthy use of mobile phones
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202003-1094",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.203\\(c00e202r7p2\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.188\\(c00e74r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.188(c00e74r3p8)"
},
{
"model": "mate 30 pro",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.203(c00e202r7p2)"
},
{
"model": "mate \u003c10.0.0.188",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate pro \u003c10.0.0.203",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "30"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21999"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"db": "NVD",
"id": "CVE-2020-1795"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_30_pro_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
}
]
},
"cve": "CVE-2020-1795",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CVE-2020-1795",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Low",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.1,
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-003141",
"impactScore": null,
"integrityImpact": "Partial",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-21999",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.4,
"baseSeverity": "LOW",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.9,
"id": "CVE-2020-1795",
"impactScore": 1.4,
"integrityImpact": "LOW",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.4,
"baseSeverity": "Low",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "JVNDB-2020-003141",
"impactScore": null,
"integrityImpact": "Low",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:L/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-1795",
"trust": 1.0,
"value": "LOW"
},
{
"author": "NVD",
"id": "JVNDB-2020-003141",
"trust": 0.8,
"value": "Low"
},
{
"author": "CNVD",
"id": "CNVD-2020-21999",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202003-1144",
"trust": 0.6,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21999"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1144"
},
{
"db": "NVD",
"id": "CVE-2020-1795"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There is a logic error vulnerability in several smartphones. The software does not properly restrict certain operation when the Digital Balance function is on. Successful exploit could allow the attacker to bypass the Digital Balance limit after a series of operations.Affected product versions include:HUAWEI Mate 20 versions Versions earlier than 10.0.0.188(C00E74R3P8);HUAWEI Mate 30 Pro versions Versions earlier than 10.0.0.203(C00E202R7P2). HUAWEI Mate 20 and Mate 30 Pro There is an unspecified vulnerability in.Information may be tampered with. This vulnerability stems from the fact that the system fails to reasonably restrict some operations when the mobile phone function is healthy. Attackers can use this vulnerability to bypass the restrictions on the healthy use of mobile phones",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-1795"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"db": "CNVD",
"id": "CNVD-2020-21999"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-1795",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003141",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-21999",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1144",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21999"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1144"
},
{
"db": "NVD",
"id": "CVE-2020-1795"
}
]
},
"id": "VAR-202003-1094",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21999"
}
],
"trust": 1.2276592800000001
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21999"
}
]
},
"last_update_date": "2024-11-23T22:05:46.358000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200318-04-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200318-04-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 and Mate 30 Pro logic error vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/213047"
},
{
"title": "Huawei Mate 20 and Mate 30 Pro Security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=112622"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21999"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1144"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "NVD-CWE-Other",
"trust": 1.0
},
{
"problemtype": "CWE-Other",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"db": "NVD",
"id": "CVE-2020-1795"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-1795"
},
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200318-04-smartphone-en"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2020-1795"
},
{
"trust": 0.6,
"url": "http://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200318-04-smartphone-cn"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-21999"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1144"
},
{
"db": "NVD",
"id": "CVE-2020-1795"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-21999"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1144"
},
{
"db": "NVD",
"id": "CVE-2020-1795"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-04-09T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-21999"
},
{
"date": "2020-04-06T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"date": "2020-03-18T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202003-1144"
},
{
"date": "2020-03-20T15:15:14.027000",
"db": "NVD",
"id": "CVE-2020-1795"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-04-09T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-21999"
},
{
"date": "2020-04-06T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-003141"
},
{
"date": "2020-03-25T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202003-1144"
},
{
"date": "2024-11-21T05:11:23.733000",
"db": "NVD",
"id": "CVE-2020-1795"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 and Mate 30 Pro Vulnerability in",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-003141"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "other",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202003-1144"
}
],
"trust": 0.6
}
}
VAR-202010-1183
Vulnerability from variot - Updated: 2024-11-23 22:05HUAWEI Mate 20 versions earlier than 10.1.0.163(C00E160R3P8) have a JavaScript injection vulnerability. A module does not verify a specific input. This could allow attackers to bypass filter mechanism to launch JavaScript injection. This could compromise normal service of the affected module. HUAWEI Mate 20 Is vulnerable to injection.Information may be tampered with. Huawei Mate 20 is a smartphone of China's Huawei (Huawei) company
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202010-1183",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.1.0.163\\(c00e160r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": "lt",
"trust": 0.8,
"vendor": "huawei",
"version": "mate 20 firmware 10.1.0.163(c00e160r3p8) less than"
},
{
"model": "mate \u003c10.1.0.163",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-58217"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"db": "NVD",
"id": "CVE-2020-9092"
}
]
},
"cve": "CVE-2020-9092",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CVE-2020-9092",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 1.9,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "NONE",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-58217",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:N/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.6,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"exploitabilityScore": 0.9,
"id": "CVE-2020-9092",
"impactScore": 3.6,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:H/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 4.6,
"baseSeverity": "Medium",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "CVE-2020-9092",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:N/I:H/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-9092",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2020-9092",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2020-58217",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202010-636",
"trust": 0.6,
"value": "MEDIUM"
},
{
"author": "VULMON",
"id": "CVE-2020-9092",
"trust": 0.1,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-58217"
},
{
"db": "VULMON",
"id": "CVE-2020-9092"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-636"
},
{
"db": "NVD",
"id": "CVE-2020-9092"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 versions earlier than 10.1.0.163(C00E160R3P8) have a JavaScript injection vulnerability. A module does not verify a specific input. This could allow attackers to bypass filter mechanism to launch JavaScript injection. This could compromise normal service of the affected module. HUAWEI Mate 20 Is vulnerable to injection.Information may be tampered with. Huawei Mate 20 is a smartphone of China\u0027s Huawei (Huawei) company",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-9092"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"db": "CNVD",
"id": "CNVD-2020-58217"
},
{
"db": "VULMON",
"id": "CVE-2020-9092"
}
],
"trust": 2.25
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-9092",
"trust": 3.1
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012480",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-58217",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202010-636",
"trust": 0.6
},
{
"db": "VULMON",
"id": "CVE-2020-9092",
"trust": 0.1
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-58217"
},
{
"db": "VULMON",
"id": "CVE-2020-9092"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-636"
},
{
"db": "NVD",
"id": "CVE-2020-9092"
}
]
},
"id": "VAR-202010-1183",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-58217"
}
],
"trust": 1.26765326
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-58217"
}
]
},
"last_update_date": "2024-11-23T22:05:25.001000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20201014-01-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20201014-01-smartphone-en"
},
{
"title": "Patch for HUAWEI Mate 20 JavaScript injection vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/237439"
},
{
"title": "HUAWEI Mate20 Repair measures for injecting vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=131281"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-58217"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-636"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-79",
"trust": 1.0
},
{
"problemtype": "injection (CWE-74) [NVD Evaluation ]",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"db": "NVD",
"id": "CVE-2020-9092"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-9092"
},
{
"trust": 1.7,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20201014-01-smartphone-en"
},
{
"trust": 0.6,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20201014-01-smartphone-cn"
},
{
"trust": 0.1,
"url": "https://cwe.mitre.org/data/definitions/74.html"
},
{
"trust": 0.1,
"url": "https://nvd.nist.gov"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-58217"
},
{
"db": "VULMON",
"id": "CVE-2020-9092"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-636"
},
{
"db": "NVD",
"id": "CVE-2020-9092"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-58217"
},
{
"db": "VULMON",
"id": "CVE-2020-9092"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"db": "CNNVD",
"id": "CNNVD-202010-636"
},
{
"db": "NVD",
"id": "CVE-2020-9092"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-10-23T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-58217"
},
{
"date": "2020-10-19T00:00:00",
"db": "VULMON",
"id": "CVE-2020-9092"
},
{
"date": "2021-05-10T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"date": "2020-10-14T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202010-636"
},
{
"date": "2020-10-19T20:15:13.087000",
"db": "NVD",
"id": "CVE-2020-9092"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-10-23T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-58217"
},
{
"date": "2020-10-22T00:00:00",
"db": "VULMON",
"id": "CVE-2020-9092"
},
{
"date": "2021-05-10T07:32:00",
"db": "JVNDB",
"id": "JVNDB-2020-012480"
},
{
"date": "2020-10-23T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202010-636"
},
{
"date": "2024-11-21T05:40:00.350000",
"db": "NVD",
"id": "CVE-2020-9092"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI\u00a0Mate\u00a020\u00a0 Injection vulnerability",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-012480"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "injection",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202010-636"
}
],
"trust": 0.6
}
}
VAR-201911-0832
Vulnerability from variot - Updated: 2024-11-23 21:59P30, P30 Pro, Mate 20 smartphones with software of versions earlier than ELLE-AL00B 9.1.0.193(C00E190R2P1), versions earlier than VOGUE-AL00A 9.1.0.193(C00E190R2P1), versions earlier than Hima-AL00B 9.1.0.135(C00E133R2P1) and HiSuite with versions earlier than HiSuite 9.1.0.305 have a version downgrade vulnerability. The device and HiSuite software do not validate the upgrade package sufficiently, so that the system of smartphone can be downgraded to an older version. Huawei P30 and others are products of China Huawei. The Huawei P30 is a smart phone. The Huawei P30 Pro is a smartphone. Huawei HiSuite is a mobile assistant application for the PC.
There are security vulnerabilities in various Huawei products
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-201911-0832",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "hisuite",
"scope": "lt",
"trust": 1.6,
"vendor": "huawei",
"version": "9.1.0.305"
},
{
"model": "p30",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "elle-al00b_9.1.0.193\\(c00e190r2p1\\)"
},
{
"model": "p30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "vogue-al00a_9.1.0.193\\(c00e190r2p1\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "hima-al00b_9.1.0.135\\(c00e133r2p1\\)"
},
{
"model": "hisuite",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30",
"scope": null,
"trust": 0.8,
"vendor": "huawei",
"version": null
},
{
"model": "p30 \u003celle-al00b 9.1.0.193",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "p30 pro \u003cvogue-al00a 9.1.0.193",
"scope": null,
"trust": 0.6,
"vendor": "huawei",
"version": null
},
{
"model": "mate \u003chima-al00b 9.1.0.135",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20x"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30711"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"db": "NVD",
"id": "CVE-2019-5227"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/a:huawei:hisuite",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:p30_pro_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:p30_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "vendor",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201909-199"
}
],
"trust": 0.6
},
"cve": "CVE-2019-5227",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "MEDIUM",
"accessVector": "NETWORK",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.3,
"confidentialityImpact": "NONE",
"exploitabilityScore": 8.6,
"id": "CVE-2019-5227",
"impactScore": 2.9,
"integrityImpact": "PARTIAL",
"severity": "MEDIUM",
"trust": 1.8,
"vectorString": "AV:N/AC:M/Au:N/C:N/I:P/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "COMPLETE",
"baseScore": 7.2,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 3.9,
"id": "CNVD-2019-30711",
"impactScore": 10.0,
"integrityImpact": "COMPLETE",
"severity": "HIGH",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:C/I:C/A:C",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "LOCAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 5.5,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "NONE",
"exploitabilityScore": 1.8,
"id": "CVE-2019-5227",
"impactScore": 3.6,
"integrityImpact": "HIGH",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "REQUIRED",
"vectorString": "CVSS:3.1/AV:L/AC:L/PR:N/UI:R/S:U/C:N/I:H/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Local",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 5.5,
"baseSeverity": "Medium",
"confidentialityImpact": "None",
"exploitabilityScore": null,
"id": "CVE-2019-5227",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "Required",
"vectorString": "CVSS:3.0/AV:L/AC:L/PR:N/UI:R/S:U/C:N/I:H/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2019-5227",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2019-5227",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2019-30711",
"trust": 0.6,
"value": "HIGH"
},
{
"author": "CNNVD",
"id": "CNNVD-201909-199",
"trust": 0.6,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30711"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-199"
},
{
"db": "NVD",
"id": "CVE-2019-5227"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "P30, P30 Pro, Mate 20 smartphones with software of versions earlier than ELLE-AL00B 9.1.0.193(C00E190R2P1), versions earlier than VOGUE-AL00A 9.1.0.193(C00E190R2P1), versions earlier than Hima-AL00B 9.1.0.135(C00E133R2P1) and HiSuite with versions earlier than HiSuite 9.1.0.305 have a version downgrade vulnerability. The device and HiSuite software do not validate the upgrade package sufficiently, so that the system of smartphone can be downgraded to an older version. Huawei P30 and others are products of China Huawei. The Huawei P30 is a smart phone. The Huawei P30 Pro is a smartphone. Huawei HiSuite is a mobile assistant application for the PC. \n\nThere are security vulnerabilities in various Huawei products",
"sources": [
{
"db": "NVD",
"id": "CVE-2019-5227"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"db": "CNVD",
"id": "CNVD-2019-30711"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2019-5227",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012739",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2019-30711",
"trust": 0.6
},
{
"db": "NSFOCUS",
"id": "44307",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-201909-199",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30711"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-199"
},
{
"db": "NVD",
"id": "CVE-2019-5227"
}
]
},
"id": "VAR-201911-0832",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30711"
}
],
"trust": 1.4316259699999998
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"Network device"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30711"
}
]
},
"last_update_date": "2024-11-23T21:59:38.357000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20190904-01-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190904-01-smartphone-en"
},
{
"title": "Patch for Multiple Huawei product version downgrade vulnerabilities (CNVD-2019-30711)",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/179201"
},
{
"title": "Multiple Huawei Product security vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=97957"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30711"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-199"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-346",
"trust": 1.0
},
{
"problemtype": "CWE-20",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"db": "NVD",
"id": "CVE-2019-5227"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20190904-01-smartphone-en"
},
{
"trust": 1.4,
"url": "https://nvd.nist.gov/vuln/detail/cve-2019-5227"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20190904-01-smartphone-cn"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2019-5227"
},
{
"trust": 0.6,
"url": "http://www.nsfocus.net/vulndb/44307"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2019-30711"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-199"
},
{
"db": "NVD",
"id": "CVE-2019-5227"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2019-30711"
},
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"db": "CNNVD",
"id": "CNNVD-201909-199"
},
{
"db": "NVD",
"id": "CVE-2019-5227"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-09-06T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-30711"
},
{
"date": "2019-12-11T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"date": "2019-09-04T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201909-199"
},
{
"date": "2019-11-29T20:15:11.863000",
"db": "NVD",
"id": "CVE-2019-5227"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2019-09-09T00:00:00",
"db": "CNVD",
"id": "CNVD-2019-30711"
},
{
"date": "2019-12-11T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2019-012739"
},
{
"date": "2019-12-12T00:00:00",
"db": "CNNVD",
"id": "CNNVD-201909-199"
},
{
"date": "2024-11-21T04:44:33.753000",
"db": "NVD",
"id": "CVE-2019-5227"
}
]
},
"threat_type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/threat_type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "local",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201909-199"
}
],
"trust": 0.6
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "plural Huawei Vulnerability related to input confirmation in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2019-012739"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "input validation error",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-201909-199"
}
],
"trust": 0.6
}
}
VAR-202001-0900
Vulnerability from variot - Updated: 2024-11-23 21:51HUAWEI Mate 20 smartphones versions earlier than 9.1.0.139(C00E133R3P1) have an improper authentication vulnerability. The system has a logic error under certain scenario, successful exploit could allow the attacker who gains the privilege of guest user to access to the host user's desktop in an instant, without unlocking the screen lock of the host user. HUAWEI Mate 20 Smartphones contain an authentication vulnerability.Information is acquired, information is falsified, and denial of service (DoS) May be in a state. Huawei Mate 20 is a smartphone from China's Huawei. The vulnerability stems from logical errors in the system
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202001-0900",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 20",
"scope": "eq",
"trust": 2.0,
"vendor": "huawei",
"version": null
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "9.1.0.139\\(c00e133r3p1\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 0.8,
"vendor": "huawei",
"version": "mate 20 firmware 9.1.0.139(c00e133r3p1)"
},
{
"model": "mate pro \u003c9.1.0.139",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02173"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-270"
},
{
"db": "NVD",
"id": "CVE-2020-1787"
}
]
},
"credits": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/credits#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "Ding Yicong",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202001-270"
}
],
"trust": 0.6
},
"cve": "CVE-2020-1787",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "COMPLETE",
"baseScore": 7.2,
"confidentialityImpact": "COMPLETE",
"exploitabilityScore": 3.9,
"id": "CVE-2020-1787",
"impactScore": 10.0,
"integrityImpact": "COMPLETE",
"severity": "HIGH",
"trust": 1.8,
"vectorString": "AV:L/AC:L/Au:N/C:C/I:C/A:C",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 3.6,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-02173",
"impactScore": 4.9,
"integrityImpact": "PARTIAL",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:P/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "HIGH",
"baseScore": 6.6,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 0.7,
"id": "CVE-2020-1787",
"impactScore": 5.9,
"integrityImpact": "HIGH",
"privilegesRequired": "LOW",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "High",
"baseScore": 6.6,
"baseSeverity": "Medium",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "CVE-2020-1787",
"impactScore": null,
"integrityImpact": "High",
"privilegesRequired": "Low",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:L/UI:N/S:U/C:H/I:H/A:H",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-1787",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "CVE-2020-1787",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2020-02173",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202001-270",
"trust": 0.6,
"value": "LOW"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02173"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-270"
},
{
"db": "NVD",
"id": "CVE-2020-1787"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 smartphones versions earlier than 9.1.0.139(C00E133R3P1) have an improper authentication vulnerability. The system has a logic error under certain scenario, successful exploit could allow the attacker who gains the privilege of guest user to access to the host user\u0027s desktop in an instant, without unlocking the screen lock of the host user. HUAWEI Mate 20 Smartphones contain an authentication vulnerability.Information is acquired, information is falsified, and denial of service (DoS) May be in a state. Huawei Mate 20 is a smartphone from China\u0027s Huawei. The vulnerability stems from logical errors in the system",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-1787"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"db": "CNVD",
"id": "CNVD-2020-02173"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-1787",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001494",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-02173",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202001-270",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02173"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-270"
},
{
"db": "NVD",
"id": "CVE-2020-1787"
}
]
},
"id": "VAR-202001-0900",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02173"
}
],
"trust": 1.1876653
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02173"
}
]
},
"last_update_date": "2024-11-23T21:51:45.913000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200108-02-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200108-02-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 inappropriate authentication vulnerability",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/197023"
},
{
"title": "Huawei Mate 20 Remediation measures for authorization problem vulnerabilities",
"trust": 0.6,
"url": "http://www.cnnvd.org.cn/web/xxk/bdxqById.tag?id=106609"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02173"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-270"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-287",
"trust": 1.0
},
{
"problemtype": "Incorrect authentication (CWE-287) [NVD Evaluation ]",
"trust": 0.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"db": "NVD",
"id": "CVE-2020-1787"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200108-02-smartphone-cn"
},
{
"trust": 1.0,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200108-02-smartphone-en"
},
{
"trust": 0.8,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-1787"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-02173"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-270"
},
{
"db": "NVD",
"id": "CVE-2020-1787"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-02173"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"db": "CNNVD",
"id": "CNNVD-202001-270"
},
{
"db": "NVD",
"id": "CVE-2020-1787"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-01-14T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-02173"
},
{
"date": "2020-02-12T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"date": "2020-01-08T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202001-270"
},
{
"date": "2020-01-09T17:15:12.400000",
"db": "NVD",
"id": "CVE-2020-1787"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-01-14T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-02173"
},
{
"date": "2020-02-12T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-001494"
},
{
"date": "2020-01-09T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202001-270"
},
{
"date": "2024-11-21T05:11:22.827000",
"db": "NVD",
"id": "CVE-2020-1787"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI\u00a0Mate\u00a020\u00a0 Authentication vulnerabilities in smartphones",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-001494"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "authorization issue",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202001-270"
}
],
"trust": 0.6
}
}
VAR-202003-1092
Vulnerability from variot - Updated: 2024-11-23 21:51There is an improper authentication vulnerability in several smartphones. The applock does not perform a sufficient authentication in certain scenarios, successful exploit could allow the attacker to gain certain data of the application which is locked. Affected product versions include:HUAWEI Mate 20 versions Versions earlier than 10.0.0.188(C00E74R3P8);HUAWEI Mate 30 Pro versions Versions earlier than 10.0.0.203(C00E202R7P2). HUAWEI Mate 20 and Mate 30 Pro There is an authentication vulnerability in.Information may be obtained. You can use this vulnerability to obtain data on locked applications
Show details on source website{
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/VARIoTentry#",
"affected_products": {
"@id": "https://www.variotdbs.pl/ref/affected_products"
},
"configurations": {
"@id": "https://www.variotdbs.pl/ref/configurations"
},
"credits": {
"@id": "https://www.variotdbs.pl/ref/credits"
},
"cvss": {
"@id": "https://www.variotdbs.pl/ref/cvss/"
},
"description": {
"@id": "https://www.variotdbs.pl/ref/description/"
},
"exploit_availability": {
"@id": "https://www.variotdbs.pl/ref/exploit_availability/"
},
"external_ids": {
"@id": "https://www.variotdbs.pl/ref/external_ids/"
},
"iot": {
"@id": "https://www.variotdbs.pl/ref/iot/"
},
"iot_taxonomy": {
"@id": "https://www.variotdbs.pl/ref/iot_taxonomy/"
},
"patch": {
"@id": "https://www.variotdbs.pl/ref/patch/"
},
"problemtype_data": {
"@id": "https://www.variotdbs.pl/ref/problemtype_data/"
},
"references": {
"@id": "https://www.variotdbs.pl/ref/references/"
},
"sources": {
"@id": "https://www.variotdbs.pl/ref/sources/"
},
"sources_release_date": {
"@id": "https://www.variotdbs.pl/ref/sources_release_date/"
},
"sources_update_date": {
"@id": "https://www.variotdbs.pl/ref/sources_update_date/"
},
"threat_type": {
"@id": "https://www.variotdbs.pl/ref/threat_type/"
},
"title": {
"@id": "https://www.variotdbs.pl/ref/title/"
},
"type": {
"@id": "https://www.variotdbs.pl/ref/type/"
}
},
"@id": "https://www.variotdbs.pl/vuln/VAR-202003-1092",
"affected_products": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/affected_products#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"model": "mate 30 pro",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.203\\(c00e202r7p2\\)"
},
{
"model": "mate 20",
"scope": "lt",
"trust": 1.0,
"vendor": "huawei",
"version": "10.0.0.188\\(c00e74r3p8\\)"
},
{
"model": "mate 20",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.188(c00e74r3p8)"
},
{
"model": "mate 30 pro",
"scope": "eq",
"trust": 0.8,
"vendor": "huawei",
"version": "10.0.0.203(c00e202r7p2)"
},
{
"model": "mate \u003c10.0.0.188",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "20"
},
{
"model": "mate pro \u003c10.0.0.203",
"scope": "eq",
"trust": 0.6,
"vendor": "huawei",
"version": "30"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-22000"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
},
{
"db": "NVD",
"id": "CVE-2020-1793"
}
]
},
"configurations": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/configurations#",
"children": {
"@container": "@list"
},
"cpe_match": {
"@container": "@list"
},
"data": {
"@container": "@list"
},
"nodes": {
"@container": "@list"
}
},
"data": [
{
"CVE_data_version": "4.0",
"nodes": [
{
"cpe_match": [
{
"cpe22Uri": "cpe:/o:huawei:mate_20_firmware",
"vulnerable": true
},
{
"cpe22Uri": "cpe:/o:huawei:mate_30_pro_firmware",
"vulnerable": true
}
],
"operator": "OR"
}
]
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
}
]
},
"cve": "CVE-2020-1793",
"cvss": {
"@context": {
"cvssV2": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV2#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV2"
},
"cvssV3": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/cvss/cvssV3#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/cvssV3/"
},
"severity": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/cvss/severity#"
},
"@id": "https://www.variotdbs.pl/ref/cvss/severity"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
},
"@id": "https://www.variotdbs.pl/ref/sources"
}
},
"data": [
{
"cvssV2": [
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CVE-2020-1793",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 1.0,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N",
"version": "2.0"
},
{
"acInsufInfo": null,
"accessComplexity": "Low",
"accessVector": "Local",
"authentication": "None",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 2.1,
"confidentialityImpact": "Partial",
"exploitabilityScore": null,
"id": "JVNDB-2020-003319",
"impactScore": null,
"integrityImpact": "None",
"obtainAllPrivilege": null,
"obtainOtherPrivilege": null,
"obtainUserPrivilege": null,
"severity": "Low",
"trust": 0.8,
"userInteractionRequired": null,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N",
"version": "2.0"
},
{
"accessComplexity": "LOW",
"accessVector": "LOCAL",
"authentication": "NONE",
"author": "CNVD",
"availabilityImpact": "NONE",
"baseScore": 2.1,
"confidentialityImpact": "PARTIAL",
"exploitabilityScore": 3.9,
"id": "CNVD-2020-22000",
"impactScore": 2.9,
"integrityImpact": "NONE",
"severity": "LOW",
"trust": 0.6,
"vectorString": "AV:L/AC:L/Au:N/C:P/I:N/A:N",
"version": "2.0"
}
],
"cvssV3": [
{
"attackComplexity": "LOW",
"attackVector": "PHYSICAL",
"author": "nvd@nist.gov",
"availabilityImpact": "NONE",
"baseScore": 4.6,
"baseSeverity": "MEDIUM",
"confidentialityImpact": "HIGH",
"exploitabilityScore": 0.9,
"id": "CVE-2020-1793",
"impactScore": 3.6,
"integrityImpact": "NONE",
"privilegesRequired": "NONE",
"scope": "UNCHANGED",
"trust": 1.0,
"userInteraction": "NONE",
"vectorString": "CVSS:3.1/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N",
"version": "3.1"
},
{
"attackComplexity": "Low",
"attackVector": "Physical",
"author": "NVD",
"availabilityImpact": "None",
"baseScore": 4.6,
"baseSeverity": "Medium",
"confidentialityImpact": "High",
"exploitabilityScore": null,
"id": "JVNDB-2020-003319",
"impactScore": null,
"integrityImpact": "None",
"privilegesRequired": "None",
"scope": "Unchanged",
"trust": 0.8,
"userInteraction": "None",
"vectorString": "CVSS:3.0/AV:P/AC:L/PR:N/UI:N/S:U/C:H/I:N/A:N",
"version": "3.0"
}
],
"severity": [
{
"author": "nvd@nist.gov",
"id": "CVE-2020-1793",
"trust": 1.0,
"value": "MEDIUM"
},
{
"author": "NVD",
"id": "JVNDB-2020-003319",
"trust": 0.8,
"value": "Medium"
},
{
"author": "CNVD",
"id": "CNVD-2020-22000",
"trust": 0.6,
"value": "LOW"
},
{
"author": "CNNVD",
"id": "CNNVD-202003-1146",
"trust": 0.6,
"value": "MEDIUM"
}
]
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-22000"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1146"
},
{
"db": "NVD",
"id": "CVE-2020-1793"
}
]
},
"description": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/description#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "There is an improper authentication vulnerability in several smartphones. The applock does not perform a sufficient authentication in certain scenarios, successful exploit could allow the attacker to gain certain data of the application which is locked. Affected product versions include:HUAWEI Mate 20 versions Versions earlier than 10.0.0.188(C00E74R3P8);HUAWEI Mate 30 Pro versions Versions earlier than 10.0.0.203(C00E202R7P2). HUAWEI Mate 20 and Mate 30 Pro There is an authentication vulnerability in.Information may be obtained. You can use this vulnerability to obtain data on locked applications",
"sources": [
{
"db": "NVD",
"id": "CVE-2020-1793"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
},
{
"db": "CNVD",
"id": "CNVD-2020-22000"
}
],
"trust": 2.16
},
"external_ids": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/external_ids#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"db": "NVD",
"id": "CVE-2020-1793",
"trust": 3.0
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003319",
"trust": 0.8
},
{
"db": "CNVD",
"id": "CNVD-2020-22000",
"trust": 0.6
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1146",
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-22000"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1146"
},
{
"db": "NVD",
"id": "CVE-2020-1793"
}
]
},
"id": "VAR-202003-1092",
"iot": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": true,
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-22000"
}
],
"trust": 1.2276592800000001
},
"iot_taxonomy": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/iot_taxonomy#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"category": [
"IoT"
],
"sub_category": null,
"trust": 0.6
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-22000"
}
]
},
"last_update_date": "2024-11-23T21:51:37.488000Z",
"patch": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/patch#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"title": "huawei-sa-20200318-02-smartphone",
"trust": 0.8,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200318-02-smartphone-en"
},
{
"title": "Patch for Huawei Mate 20 and Mate 30 Pro authorization issue vulnerability (CNVD-2020-22000)",
"trust": 0.6,
"url": "https://www.cnvd.org.cn/patchInfo/show/213045"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-22000"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
}
]
},
"problemtype_data": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/problemtype_data#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"problemtype": "CWE-287",
"trust": 1.8
}
],
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
},
{
"db": "NVD",
"id": "CVE-2020-1793"
}
]
},
"references": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/references#",
"data": {
"@container": "@list"
},
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": [
{
"trust": 2.0,
"url": "https://nvd.nist.gov/vuln/detail/cve-2020-1793"
},
{
"trust": 1.6,
"url": "https://www.huawei.com/en/psirt/security-advisories/huawei-sa-20200318-02-smartphone-en"
},
{
"trust": 1.2,
"url": "https://www.huawei.com/cn/psirt/security-advisories/huawei-sa-20200318-02-smartphone-cn"
},
{
"trust": 0.8,
"url": "https://cve.mitre.org/cgi-bin/cvename.cgi?name=cve-2020-1793"
}
],
"sources": [
{
"db": "CNVD",
"id": "CNVD-2020-22000"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1146"
},
{
"db": "NVD",
"id": "CVE-2020-1793"
}
]
},
"sources": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#",
"data": {
"@container": "@list"
}
},
"data": [
{
"db": "CNVD",
"id": "CNVD-2020-22000"
},
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
},
{
"db": "CNNVD",
"id": "CNNVD-202003-1146"
},
{
"db": "NVD",
"id": "CVE-2020-1793"
}
]
},
"sources_release_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_release_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-04-09T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-22000"
},
{
"date": "2020-04-14T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-003319"
},
{
"date": "2020-03-18T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202003-1146"
},
{
"date": "2020-03-20T15:15:13.857000",
"db": "NVD",
"id": "CVE-2020-1793"
}
]
},
"sources_update_date": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources_update_date#",
"data": {
"@container": "@list"
}
},
"data": [
{
"date": "2020-04-09T00:00:00",
"db": "CNVD",
"id": "CNVD-2020-22000"
},
{
"date": "2020-04-14T00:00:00",
"db": "JVNDB",
"id": "JVNDB-2020-003319"
},
{
"date": "2020-08-28T00:00:00",
"db": "CNNVD",
"id": "CNNVD-202003-1146"
},
{
"date": "2024-11-21T05:11:23.523000",
"db": "NVD",
"id": "CVE-2020-1793"
}
]
},
"title": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/title#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "HUAWEI Mate 20 and Mate 30 Pro Authentication vulnerabilities in",
"sources": [
{
"db": "JVNDB",
"id": "JVNDB-2020-003319"
}
],
"trust": 0.8
},
"type": {
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/type#",
"sources": {
"@container": "@list",
"@context": {
"@vocab": "https://www.variotdbs.pl/ref/sources#"
}
}
},
"data": "authorization issue",
"sources": [
{
"db": "CNNVD",
"id": "CNNVD-202003-1146"
}
],
"trust": 0.6
}
}